Changed use of cpp macro LINUX to linux. The former was defined by

the old build system, but the latter is defined by the compiler.
LINUX is not used in autoconf.


git-svn-id: svn://10.0.0.236/branches/MANG_MATH_BRANCH@13369 18797224-902f-48f8-a5cc-f745e15eee43

mozilla/js/ref/ChangeLog

@@ -0,0 +1,452 @@
+Tag JSREF_RELEASE_19980414 (4/14/98):
+
+- RegExp unicode fix.
+
+- Added new iterator-style JSObjectOps enumeration API for host objects.
+  See jspubtd.h for details.
+	
+Tag JSREF_RELEASE_19980413 (4/13/98):
+
+- Date fixes:
+  - ECMAv1 fix: fixed function length for Date setters.
+  - Bug workaround: avoid MSVC optimizer bug in Date.
+  - Y2K fix: Use the verbose '%#c' date formatter for toLocaleString
+    on windows, to get a 4 digit date.
+
+- New thread safety fixes from bjorn:
+
+  - Added more asserts to catch cases where the thread
+  identifier stored in the context is out of synch with the current
+  thread. JS_ATOMIC_ADDREF now calls a function instead of a
+  macro, so that when compare-and-swap is implemented using busy-wait
+  (e.g. SPARC v8), we avoid being confused by the busy value. For the same
+  reason, we now call AtomicRead at certain places in jslock.c. Finally, the
+  environment variable JS_NO_THIN_LOCKS, when set, effectively turns off
+  the thin locks so that all locking is done using NSPR only.
+
+- ECMAv1 numeric fixes: print preceding 0 when formatting 0.4, ignore supplied
+  radix to Number.prototype.toString when printing non-finite numbers.
+	
+Tag JSREF_RELEASE_19980403 (4/3/98):
+
+- API renaming: JS_NewRuntime for JS_Init, JS_DestroyRuntime for JS_Finish
+  (the old names are maintained for backward binary compatibility; the new
+  names are macros).
+
+- Improved JS_THREADSAFE locking, with compare-and-swap based optimization of
+  the uncontested lock and unlock cases to avoid DLL-crossing and worse native
+  OS locking overhead.
+
+  The Request/GC interlock enforced by JS_BeginRequest, JS_EndRequest, JS_GC,
+  and JS_MaybeGC allows requests on the same cx to nest (JS_BeginRequest may
+  be called more than once before JS_EndRequest, so long as the number of End
+  calls matches the number of Begin calls).
+
+  Thread-safety for prarena.c and prdtoa.c, based on jslock.h/JS_THREADSAFE.
+
+- Experimental JS exception implementation, subject to change.  Any value may
+  be thrown.  The catch expression must be of the form (v) or (var v).  Catch
+  code must re-throw as there is no way yet for the compiler to decide that no
+  catch clause matched (and more than one catch clause makes no sense, yet --
+  no finally yet, either).
+
+- JS_ConvertArguments API addition, for converting an argc/argv pair according
+  to a simplified scanf-like format string.
+
+- JS_GetPropertyAttributes and JS_SetPropertyAttributes API additions, which
+  take C-string property names (Unicode string and indexed elements TBD).
+
+- JS_CloneFunctionObject, for server-like environments where code (functions)
+  should be shared in a prototype object, but data (global variables) must be
+  per request in a set of objects, one per concurrent request.  You load the
+  functions in the prototype, then "fault them in" on demand via the request
+  object's resolve hook, using JS_CloneFunctionObject to make a lightweight
+  copy that has the right scope (__parent__) link.
+
+- Whacked js.c (more whacking needed) so it uses fewer secret js_* calls and
+  more JS PUBLIC/FRIEND API entry points.
+
+- Simplified Windows MSDEV build regime to use js.mak/mdp only, which builds
+  the DLL as a sub-project, then compiles js.c and links the JS shell.
+
+- Fix a lying comment about JS_AddRoot in README (which is being turned into a
+  real "JS API tutorial" document, due soon).
+
+- Better error reporting for an operand that does not convert to function, and
+  spiffed up the decompiler (jsopcode.c) to remove hardwired opcode lengths.
+
+- Atom indexing does not abuse the atom's next link and a flags bit, which had
+  been done in haste long ago (and not fixed till now), but which required that
+  compilation be single-threaded throughout a runtime.
+
+- ECMAv2 change: undefined is a top-level property with undefined value (it may
+  be overwritten or deleted by a script).
+
+- ECMAv1 fix: arguments is implemented as a separate object from Call, but with
+  Netscape extensions (callee, caller).
+
+- ECMAv1 fix: array length and indexes are uint32.
+
+- ECMAv1 fixes enabled by major overhaul of the compiler to generate a tree of
+  parse-node structures and generate code from it.  The bugs had to do with the
+  order of evaluation and conversion in for/in loop and assignment expressions.
+  This change also moved the "quickening" for name-to-arg/var-slot bytecodes
+  from the interpreter to the compiler.
+
+- Proposed ECMAv2 toSource method, which produces compilable object and array
+  initializers and new expressions to reconstruct a given graph.
+
+- Proposed ECMAv2 instanceof operator, based on hasInstance JSObjectOp and
+  (for maximum code-sharing among native object classes, with one exception)
+  JSClass methods.  There is also js_IsDelegate, for checking whether a given
+  object is a prototype of another.
+
+- To-be-proposed ECMAv2 in operator, inspired by for/in loop syntax: ('p' in o)
+  for o = {p:1} is true; (1 in o) for o[1] defined (even with value undefined)
+  is true.  Note distinction between typeof o.p == "undefined" and ('p' in o).
+
+- XDR (eXternal Data Representation) code to support Script.prototype.freeze
+  and Script.thaw/Script.prototype.thaw.  You can store a persistent, portable
+  encoding of a script (including its top-level functions and all their kids)
+  and load it later.
+
+  Exception "try-notes" are not currently XDR'd; this will be fixed next time.
+
+- Recent GC bugs mentioned in snews://secnews.netscape.com/netscape.dev.jsref
+  have been fixed.  The patches were posted already; this tarball rolls them
+  up along with other fixes and improvements.  We've had help from Netscape's
+  Application Products Division in stress-testing this release; we are pretty
+  confident that JS_THREADSAFE GC and request execution work well.
+
+  One new fix: finalizers are run without the GC lock held, to allow them to
+  call JS_RemoveRoot and otherwise to avoid AB-BA deadlocks.
+
+- Call and construct are now optional methods in JSObjectOps and JSClass.  The
+  hack of converting a regexp to a function is no longer necessary, and script
+  callability (shorthand for script.exec) uses the JSClass call hook likewise.
+
+- Fixed standard class bootstrapping bug that left an extra Object instance
+  in the middle of the prototype chain for Date, RegExp, etc. (all but Object
+  and Function) instances.
+
+- String.prototype.split ECMAv1 conformance restoration (split-by-empty-string
+  was stupidly broken last time).
+
+Tag JSREF_RELEASE_19980219 (2/16/98):
+
+- Fixed very recent i++ (for undefined i) crash-bug (also prior, longstanding
+  bug where i++ for undefined i resulted in NaN).
+
+- ECMA conformance for [[DefaultValue]] (8.6.2.6), ToBoolean (9.2), and null
+  (default) this-parameter handling (10.2.3).
+
+- New bytecodes paving the way for ECMA-conformant for/in loops and unqualified
+  name assignment.
+
+- JS1.2 String.prototype.replace did not emulate Perl4's expansion of $` to be
+  the global left context (not from last local match).  Essentially the same
+  bug bit replace for the empty-string global match case, which "bumps along"
+  by one character, but failed to include that character in local left context
+  (so "abc".replace(/ */g, 'X') produced "XXXX" instead of "XaXbXcX").
+
+- Fix recent regression that clamped String.prototype.split's limit argument at
+  the subject string's length.
+
+- Fixed type mismatch problems in #if !JS_HAS_REGEXPS code.
+
+Tag JSREF_RELEASE_19980216 (2/16/98):
+
+- Fixed stuck GC lock by adding JS_UNLOCK_GC at the bottom of js_GC.
+
+Tag JSREF_RELEASE_19980213 (2/13/98):
+
+- Add JS_ShutDown API, which must be called after all JSRuntimes have been 
+  destroyed by JS_Finish calls, and from a single thread, when shutting down
+  or restarting the program in which JSRef is embedded.  This is needed to
+  avoid leaking the deflated_string_cache and (JS_THREADSAFE only) lock.
+
+Tag JSREF_RELEASE_19980212 (2/12/98):
+
+- Finer-grained locking.  Instead of one big, reentrant lock around the entire
+  runtime, there are distinct locks:
+  - The non-reentrant runtime lock, a binary semaphore to protect the runtime's
+    contextList and other members.
+  - An atom state lock used only in jsatom.c for a thread-safe internal atom
+    table API.  This lock is never held while calling out from jsatom.c to
+    other modules that may acquire locks, and no caller into jsatom.c's lock-
+    acquiring entry points does so while holding a lock of its own (the GC
+    calls non-locking entry points only).
+  - A lock and pair of condition variables for interlocking GC execution with
+    script execution.  The GC may run only when no script requests are running,
+    or when at most one is running and it has invoked the GC from its branch
+    callback.  The new JS_SetGCCallback API may be used to supply a function to
+    be called at the beginning and end of GC -- if called at the beginning, a
+    false return value will cancel the GC run.
+  - A reentrant lock per native object map (scope) to protect the JSScope and
+    its parts (JSProperty, JSSymbol, and PRHashTable structures) as well as the
+    slots vectors of all instances sharing the scope (the prototype object and
+    any unmutated clones of it).
+
+  The model jslock.c and jslock.h provided include four new header files that
+  are not yet supplied with JSRef:
+  - pratomic.h for PR_COMPARE_AND_SWAP_WORDS and PR_COMPARE_AND_SWAP_INT32
+    macros that take an address, an old value, and a new value, and return true
+    if the old value is at the address, in which case the new value is atomicly
+    stored there; and return false without changing memory otherwise.
+  - prcvar.h for the PRCondVar condition variable type and its operations (New,
+    Destroy, Wait, Notify, and NotifyAll).
+  - prlock.h for the PRLock binary semaphore type and its operations (New,
+    Destroy, Lock, and Unlock).
+
+  More lock overhead and lock-free synchronization optimizations are coming in
+  a future JSRef release.  In anticipation of these changes, the JS_THREADSAFE
+  version of JS_GetClass now requires an initial JSContext *cx argument along
+  with JSObject *obj.
+
+- New String.prototype.replace feature: a function expression may be passed
+  as the second argument, in which case it will be invoked with the match and
+  parenthesized submatch strings as arguments, followed by input and index
+  (these are come from the extended array returned by RegExp.prototype.exec and
+  String.prototype.match).
+  
+  This "lambda replacement" approximates Perl's s///e flag; the idea came from
+  Mike Shaver (shaver@netscape.com).  Here's a example function that replaces
+  any number with an F after it (for Fahrenheit) with its Celsius conversion:
+
+  // f2c("32F, 212F, or 0F") => "0C, 100C, or -17.77777777777778C"
+  function f2c(x) {
+    var s = String(x)
+    return s.replace(/(\d+(\.\d*)?)F\b/g,
+                     function ($0,$1,$2) { return (($1-32) * 5/9) + "C" })
+  }
+
+- First-character discrimination optimization for regular expressions, plus a
+  fix to anchor-search for \b and \B.
+
+- A first-class Script object to decompose eval into its compile and exec parts
+  (so you can compile outside a long loop, then exec in the loop body to avoid
+  recompiling invariant source).  See jsscript.c.
+
+- More ECMA fixes:
+  - bitwise logical and shift operators use the correct ECMA type conversions,
+    intermediate types, and boundary behavior.
+  - Array.prototype.push emulates Perl5 for JS versions other than 1.2; there
+    it emulated Perl4, except when no arguments were passed (it would return
+    the array object bound to this in that case; fixed to return undefined).
+  - All generic Array methods now update a length property, in case no such
+    property existed in the object that delegates to Array.prototype, or that
+    refers to the particular method.
+  - Except for JS1.2, Array.prototype.splice always returns an array, even when
+    given no arguments or a zero-length slice.  JS1.2 compatibility continues.
+  - NaN Date fixes.
+  - JSFunctionSpec's nargs member now species the "best arity" of the function,
+    which ECMA specifies as the value of the function's length property.  So to
+    allocate local GC roots, use the new extra member of JSFunctionSpec and let
+    nargs count only the minimum or optimum number of desired arguments.
+  - Relational and equality operator fixes too gnarly and subtle to describe
+    here, affecting mainly the hint argument (or lack of it) to valueOf.
+  - A new JS_IsConstructing API and underlying support, so ECMA [[Call]] and
+    [[Construct]] can be distinguished.
+  - A JS_InitClass extension to tolerate NULL for the constructor native C
+    function argument -- this causes a class like Math to be created, where
+    the class object is not callable or constructable.
+  - Fixes to handle non-finite indexes in several string and array methods.
+
+- A high-level object operation dispatch table has been added.  See JSObjectOps
+  in jsapi.h, and the new flags and function pointers in JSClass.  To provide a
+  table of object operations, your class should set the JSCLASS_HAS_OBJECTOPS
+  flag and implement the getObjectOps class method, returning the address of a
+  static or otherwise appropriate-lifetime JSObjectOps structure.  The methods
+  in this struct will be specified in a forthcoming version of the JS API doc.
+
+  The JSCLASS_NEW_ENUMERATE flag can be used without adding getObjectOps to
+  your class, to say that its enumerate method returns a JSIdArray containing
+  all lazy and eager property ids for an object, instead of having to define
+  all lazily-bound properties in the object, to minimize locking and reduce
+  the space cost of old-style enumerate.
+
+- Atoms are now garbage-collected.  To clarify the fact that symbol table ids
+  are either tagged jsval-like integers, or else JSAtom pointers, a new typedef
+  called jsid (equivalent to jsval in C) has been introduced.
+
+- Major changes to remove JSProperty's object member, in order to optimize for
+  space.  These mostly entail an extra &obj2 or &pobj result parameter being
+  passed to js_FindProperty, js_LookupProperty, etc., to capture the prototype
+  or original object in which the property was found.
+
+- Updated Windows MSDEV makefiles to support MSDEV5.0 as well as 4.2:
+  - js32.mak, an NMAKE makefile, builds js32.dll 
+  - jsshell.mak, an NMAKE makefile, now recursively invokes js32.mak to build
+    js32.dll 
+  - jsshelld.mak and jsshelld.mdp, collectively a 4.2 IDE project, build
+    jsshell.exe and have a subproject that builds js32.dll.  These two project
+    files are not derived from the other .mak files, nor are the other .mak
+    files derived from them. 
+
+- JS_PUBLIC_API etc. macros in jspubtd.h, used by jsapi.h and a few other .h
+  files, to optimize linkage within the Windows DLL.
+
+Tag JSREF_RELEASE_19971128 (11/28/97):
+
+- Major Unicode changes.  JSString has a jschar *chars member now, not
+  char *bytes; it points to a counted array of uint16 (jschar) elements.
+  The scanner handles \uXXXX escapes; so does the regular expression parser.
+
+  JS_GetStringBytes(str) now returns the ISO-Latin-1 counterpart of str's
+  Unicode sequence by decimating into separate memory whose lifetime matches
+  that of str->chars.  The API entry points taking char *name or char *base
+  arguments now have UC counterparts (except for the JS_*Property entries)
+  that take jschar *name, size_t length or similar argument-pairs.  There is
+  a new JS_ValueToUint16 API entry for converting from a jsval to a Unicode
+  code point.
+
+- The beginnings of JavaScript 1.3 version support, including === and !== for
+  equality by type and value identity, and sharp variables (see below).
+
+- Linux support from Mike Shaver (shaver@ingenia.ca, shaver@netscape.com) in
+  config/Linux_All.mk.  OS/2 ifdefs from IBM (initials DSR?), via Dan Libby
+  (danda@netscape.com).
+
+- A new gc command in the js shell for testing, useful in conjunction with
+  the GC_MARK_DEBUG ifdef'd code in jsgc.c and js.c to plug leaks and find
+  stuck references.  Use the new API entry point JS_AddNamedRoot in preference
+  to JS_AddRoot, which still exists but provides no debugging name for the GC
+  thing graph root that it establishes.  See also JS_DumpNamedRoots.
+
+- JSCLASS_NEW_RESOLVE flag and JSNewResolveOp function pointer typedef, for
+  more efficient unbound name resolution.
+
+- Sharp variables (based on Common Lisp's dispatching macros of the same form)
+  for expressing cycles and join-points in object graphs created by object and
+  array initializers.  For example,
+
+    #1={p:#2={q:42}, r:{cycle:#1#, joinPoint:#2#}}
+
+  creates an object, call it o, where o.p and o.r.joinPoint both reach the same
+  object, which has a property named q with value 42; and o.r.cycle is o.
+
+  In a future release, the final JS1.3 version will return object and array
+  initializer strings from {Object,Array}.prototype.toSource methods, rather
+  than toString, for ECMA and backward compatibility.
+
+- More ECMA conformance fixes, apart from Unicode:
+  - New ECMA-conformant jsdate.c by Mike McCabe (mccabe@netscape.com).
+  - Improved equality and relational operator implementations.
+  - Correct division operator result sign.
+  - The unary-plus operator.
+  - NaN and Infinity top-level properties.
+  - Setting a read-only property fails silently, rather than stopping the
+    script with an error report.
+  - Deleting a permanent property fails with a false return from the delete
+    operator.  If the property is not in the object addressed in the delete
+    expression, or it is successfully deleted, the expression results in true.
+
+- The beginnings of finer-grained, non-nesting/low-level locking in jslock.h,
+  used in jsstr.c for the deflated_string_cache_lock.  For this version, you
+  need to provide a PRLock typedef and PR_NewLock, PR_DestroyLock, PR_Lock,
+  and PR_Unlock functions that implement a binary semaphore.
+
+- Performance improvements based on aggressive, coherent use of the property
+  cache (part of the JSRuntime structure).  This required a fix to restore a
+  watchpoint associated with a deleted property when a new property with the
+  same identifier is created in the same object.
+
+- Regular expression bugfixes and Unicode extensions in jsregexp.c and jsstr.c.
+  - Fixed Perl bug where \xZ or similar was translated to "\0Z".
+  - Fixed another Perl bug where [x-\d] matched {'x', '-', '0', ... '9'} but
+    [\d-x] matched only the digits.  The second is now equivalent to the first.
+  - Fixed JS bug where only $1 through $9 could be used in the replacement
+    string passed to String.prototype.replace.  Also allow literal $ in the
+    replacement string if it is preceded by \ (as a JS literal: "\\$").
+  - Fixed non-JS1.2 versions to return left context from start of global match
+    instead of from end of last local match (Perl4 had a similar bug which 1.2
+    emulated too much).  This alters "$`" expansion in replacement strings.
+
+Tag JSREF_1_14_RELEASE (around 7/22/97):
+
+- JSTaskState and related API entry point names have been renamed to use the
+  trendier "Runtime" rather than "TaskState", ditto rt or runtime for task.
+
+- JS_GetScriptPrincipals is no longer in jsapi.h, it moved to jsdbgapi.h and
+  has a new interface that takes the JSScript * being queried.  It therefore
+  requires JS_FrameIterator and JS_GetFrameScript.
+
+- JS_LockGCThing/JS_UnlockGCThing and their macro wrappers JSVAL_LOCK/UNLOCK
+  are deprecated as of now.  Use JS_AddRoot to register a pointer to the thing
+  you would lock, and clear the pointer and/or JS_RemoveRoot its address later
+  to unlock the thing.  I would like to remove GC thing-locking in a future
+  release; it precludes too many alternative GC implementations.
+
+- ECMA conformant Date API, including get/setFullYear and the UTC variants
+  to all the get/set methods.
+
+- ECMA conformant Number.MIN_VALUE, which is the smallest denorm now, not
+  the smallest normal as in all past JS versions.
+
+- ECMA comformant isFinite() function.
+
+- ECMA signed 0 and NaN number to string conversions.
+
+- Watcom (__WATCOMC__) support for PC builds.
+
+Quick update (4/27/97):
+- Prototypes are no longer constructed in JS_InitClass.  If you want a class
+  prototype to be constructed by the native 'constructor' function passed to
+  JS_InitClass, you can save JS_InitClass's return value and do it yourself:
+
+    proto = JS_InitClass(...);
+    ok = JS_CallFunctionName(cx, proto, "constructor", argc, argc, &rval);
+
+- Object, array, and function literals are supported on input for JS_VERSION
+  1.2 at compile-time.  Only for JS_SetVersion(cx, JSVERSION_1_2) at runtime:
+  object.toString() returns an object literal, likewise for array.toString,
+  and function.toString returns an anonymous function literall (rather than
+  the definition of a function named "anonymous") for functions created using
+  new Function(...).
+
+- Final RegExp API: regexp.exec and string.match always return null on mismatch
+  (not -1), and always return a match array on match (whether parens matched or
+  not).  The match array's 0'th element is the matching string, and any paren
+  submatches are in elements 1..N.  The index and input properties can be used
+  to find left and right context without resort to the RegExp.leftContext and
+  RegExp.rightContext statics:
+
+    leftContext  = match.input.substring(0, match.input.index)
+    rightContext = match.input.substring(match.input.index + match[0].length)
+
+- A JS_MaybeGC entry point in the API, safe to use from branch callbacks (well
+  tested) and arbitrary preemption points (not so well tested) when garbage may
+  be piling up, but a forced GC (JS_GC) is not desirable.
+
+- Various bugfixes and improvements.
+
+Newer news (3/18/97):
+- Regular expressions a la Perl are supported.
+- Perl array methods push, pop, shift, unshift, and splice are supported.
+- Perl substr, with its righteous interpretation of negative offset, is also
+  now supported.
+- Lexical closures a la Scheme are supported.  See ycomb.js.
+- Property caching and other performance improvements have been added.
+- Mac CodeWarrior JSRef.prj and MacPrefix.h files are now bundled.
+- Windows MSDEV4.2 .mak and .mdp files bundled.
+- The 32-bit Windows version of prcpucfg.h is shipped; on Unix platforms, you
+  should remove this file or set it aside and let gmake generate the right one
+  for your host architecture.
+- Classes whose objects have private data (JS_SetPrivate/JS_GetPrivate) must
+  flag that fact with the JSCLASS_HAS_PRIVATE flag in their JSClass structs.
+- There are also two new property ops in JSClass, addProperty and delProperty.
+
+News flashes (12/31/96):
+
+- Define JS_THREADSAFE and write code in jslock.c for multi-threaded JS.
+- NOTE: JS_EvaluateScript and JS_ExecuteScript no longer return a JSVAL_LOCKed
+  result in *rval -- this was never safe in a multithreaded environment, when
+  *rval referred to an object tree of depth > 1, because a preempting GC run
+  could reclaim the unrooted, descendent objects.  Instead, callers of these
+  API entry points must use JS_AddRoot and JS_RemoveRoot to maintain the rval
+  pointer argument in the GC's root set.  See JS_AddRoot comments below.
+- Labeled statements and break and continue to label a la Java are supported.
+- The switch statement is now supported.  You can switch on any primitive type
+  value (number, string, boolean).
+- Numerous performance enhancements, notably the quick ops at the bottom of
+  jsopcode.def, have been made.

mozilla/js/ref/MacPrefix.h

@@ -0,0 +1,20 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public License
+ * Version 1.0 (the "NPL"); you may not use this file except in
+ * compliance with the NPL.  You may obtain a copy of the NPL at
+ * http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the NPL is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+ * for the specific language governing rights and limitations under the
+ * NPL.
+ *
+ * The Initial Developer of this code under the NPL is Netscape
+ * Communications Corporation.  Portions created by Netscape are
+ * Copyright (C) 1998 Netscape Communications Corporation.  All Rights
+ * Reserved.
+ */
+
+#define XP_MAC 1
+#define JSFILE 1

mozilla/js/ref/Makefile

@@ -0,0 +1,333 @@
+#
+# The contents of this file are subject to the Netscape Public License
+# Version 1.0 (the "NPL"); you may not use this file except in
+# compliance with the NPL.  You may obtain a copy of the NPL at
+# http://www.mozilla.org/NPL/
+#
+# Software distributed under the NPL is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+# for the specific language governing rights and limitations under the
+# NPL.
+#
+# The Initial Developer of this code under the NPL is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation.  All Rights
+# Reserved.
+
+#
+# JSRef GNUmake makefile.
+#
+
+# Set os+release dependent make variables
+OS_ARCH         := $(subst /,_,$(shell uname -s))
+
+# Attempt to differentiate between SunOS 5.4 and x86 5.4
+OS_CPUARCH      := $(shell uname -m)
+ifeq ($(OS_CPUARCH),i86pc)
+OS_RELEASE      := $(shell uname -r)_$(OS_CPUARCH)
+else
+ifeq ($(OS_ARCH),AIX)
+OS_RELEASE      := $(shell uname -v).$(shell uname -r)
+else
+OS_RELEASE      := $(shell uname -r)
+endif
+endif
+
+# Virtually all Linux versions are identical.
+# Any distinctions are handled in linux.h
+ifeq ($(OS_ARCH),Linux)
+OS_CONFIG      := Linux_All
+else
+ifeq ($(OS_ARCH),dgux)
+OS_CONFIG      := dgux
+else
+OS_CONFIG       := $(OS_ARCH)$(OS_OBJTYPE)$(OS_RELEASE)
+endif
+endif
+
+ASFLAGS         =
+DEFINES         =
+
+#NS_USE_NATIVE = 1
+
+include config/$(OS_CONFIG).mk
+
+ifdef BUILD_OPT
+OPTIMIZER  += -O
+DEFINES    += -UDEBUG -DNDEBUG -UDEBUG_$(shell whoami)
+OBJDIR_TAG = _OPT
+else
+ifdef USE_MSVC
+OPTIMIZER  = -Zi
+else
+OPTIMIZER  = -g
+endif
+DEFINES    += -DDEBUG -DDEBUG_$(shell whoami)
+OBJDIR_TAG = _DBG
+endif
+
+#DEFINES += -DJS_THREADSAFE
+
+ifdef JS_NO_THIN_LOCKS
+DEFINES += -DJS_USE_ONLY_NSPR_LOCKS
+endif
+
+# Name of the binary code directories
+OBJDIR          = $(OS_CONFIG)$(OBJDIR_TAG).OBJ
+VPATH           = $(OBJDIR)
+
+# Automatic make dependencies file
+DEPENDENCIES    = $(OBJDIR)/.md
+
+define MAKE_OBJDIR
+if test ! -d $(@D); then rm -rf $(@D); mkdir $(@D); fi
+endef
+
+# Look in OBJDIR to find prcpucfg.h
+INCLUDES   = -I$(OBJDIR)
+
+#
+# XCFLAGS may be set in the environment or on the gmake command line
+#
+CFLAGS          = $(OPTIMIZER) $(OS_CFLAGS) $(DEFINES) $(INCLUDES) \
+                  -DJSFILE $(XCFLAGS)
+LDFLAGS		= -lm $(XLDFLAGS) -L$(OBJDIR) -lfdm
+
+#
+# Ask perl what flags it was built with, so we can build js with similar flags
+# and link properly.  Viva gmake.
+#
+ifdef PERLCONNECT
+DEFINES += -DPERLCONNECT
+
+PERLCFLAGS := $(shell perl -MExtUtils::Embed -e ccopts)
+PERLLDFLAGS := $(shell perl -MExtUtils::Embed -e ldopts)
+
+CFLAGS += $(PERLCFLAGS)
+LDFLAGS += $(PERLLDFLAGS)
+endif
+
+# For purify
+PURE_CFLAGS     = -DXP_UNIX $(OPTIMIZER) $(PURE_OS_CFLAGS) $(DEFINES) \
+                  $(INCLUDES) $(XCFLAGS)
+
+#
+# JS file lists
+#
+PR_HFILES =		\
+	prarena.h	\
+	prassert.h	\
+	prclist.h	\
+	prdtoa.h	\
+	prhash.h	\
+	prlong.h	\
+	prmacos.h	\
+	prosdep.h	\
+	prpcos.h	\
+	prprintf.h	\
+	prtime.h	\
+	prtypes.h	\
+	prunixos.h	\
+	$(NULL)
+
+JS_HFILES =		\
+	jsarray.h	\
+	jsatom.h	\
+	jsbool.h	\
+	jsconfig.h	\
+	jscntxt.h	\
+	jsdate.h	\
+	jsemit.h	\
+	jsexn.h		\
+	jsfun.h		\
+	jsgc.h		\
+	jsinterp.h	\
+	jslock.h	\
+	jsmath.h	\
+	jsnum.h		\
+	jsobj.h		\
+	jsopcode.h      \
+	jsparse.h	\
+	jsprvtd.h	\
+	jspubtd.h	\
+	jsregexp.h	\
+	jsscan.h	\
+	jsscope.h	\
+	jsscript.h	\
+	jsstr.h		\
+	jsxdrapi.h	\
+	$(NULL)
+
+API_HFILES =		\
+	jsapi.h		\
+	jsdbgapi.h	\
+	$(NULL)
+
+HFILES = $(PR_HFILES) $(JS_HFILES) $(API_HFILES)
+
+PR_CFILES =		\
+	prarena.c	\
+	prassert.c	\
+	prdtoa.c	\
+	prhash.c	\
+	prlog2.c	\
+	prlong.c	\
+	prprintf.c	\
+	prtime.c	\
+	$(NULL)
+
+JS_CFILES =		\
+	jsapi.c		\
+	jsarray.c	\
+	jsatom.c	\
+	jsbool.c	\
+	jscntxt.c	\
+	jsdate.c	\
+	jsdbgapi.c	\
+	jsemit.c	\
+	jsexn.c		\
+	jsfun.c		\
+	jsgc.c		\
+	jsinterp.c	\
+	jslock.c	\
+	jsmath.c	\
+	jsnum.c		\
+	jsobj.c		\
+	jsopcode.c      \
+	jsparse.c	\
+	jsregexp.c	\
+	jsscan.c	\
+	jsscope.c	\
+	jsscript.c	\
+	jsstr.c		\
+	jsxdrapi.c	\
+	$(NULL)
+
+ifdef PERLCONNECT
+JS_CFILES += jsperl.c
+endif
+
+LIB_CFILES  = $(PR_CFILES) $(JS_CFILES)
+LIB_ASFILES := $(wildcard *_$(OS_ARCH).s)
+PROG_CFILES = js.c
+
+ifdef USE_MSVC
+LIB_OBJS  = $(addprefix $(OBJDIR)/, $(LIB_CFILES:.c=.obj))
+PROG_OBJS = $(addprefix $(OBJDIR)/, $(PROG_CFILES:.c=.obj))
+else
+LIB_OBJS  = $(addprefix $(OBJDIR)/, $(LIB_CFILES:.c=.o))
+LIB_OBJS  += $(addprefix $(OBJDIR)/, $(LIB_ASFILES:.s=.o))
+PROG_OBJS = $(addprefix $(OBJDIR)/, $(PROG_CFILES:.c=.o))
+endif
+
+CFILES = $(LIB_CFILES) $(PROG_CFILES)
+OBJS   = $(LIB_OBJS) $(PROG_OBJS)
+
+ifdef USE_MSVC
+LIBRARY = $(OBJDIR)/js32.dll
+PROGRAM = $(OBJDIR)/js
+else
+LIBRARY = $(OBJDIR)/libjs.a
+PROGRAM = $(OBJDIR)/js
+endif
+
+ifdef USE_MSVC
+TARGETS = $(LIBRARY)   # $(PROGRAM) not supported for MSVC yet
+else
+TARGETS = $(OBJDIR)/libfdm.a $(LIBRARY) $(PROGRAM)
+endif
+
+all: $(TARGETS)
+
+clean:
+	rm -rf $(OBJS)
+	cd fdlibm; gmake clean
+
+clobber:
+	rm -rf $(OBJS) $(TARGETS) $(DEPENDENCIES)
+	cd fdlibm; gmake clean
+
+depend:
+	gcc -MM $(CFLAGS) $(JS_CFILES)
+
+$(OBJDIR)/libfdm.a: fdlibm/$(OBJDIR)/libfdm.a
+	@$(MAKE_OBJDIR)
+	cp fdlibm/$(OBJDIR)/libfdm.a $(OBJDIR)/libfdm.a
+
+fdlibm/$(OBJDIR)/libfdm.a:
+	cd fdlibm; gmake
+
+$(OBJDIR)/%: %.c
+	@$(MAKE_OBJDIR)
+	$(CC) -o $@ $(CFLAGS) $*.c $(LDFLAGS)
+
+$(OBJDIR)/%.o: %.c
+	@$(MAKE_OBJDIR)
+	$(CC) -o $@ -c $(CFLAGS) $*.c
+
+$(OBJDIR)/%.o: %.s
+	@$(MAKE_OBJDIR)
+	$(AS) -o $@ $(ASFLAGS) $*.s
+
+# windows only
+$(OBJDIR)/%.obj: %.c
+	@$(MAKE_OBJDIR)
+	$(CC) -Fo$(OBJDIR)/ -c $(CFLAGS) $*.c
+
+ifeq ($(OS_ARCH),OS2)
+$(LIBRARY): $(LIB_OBJS)
+	$(AR) $@ $? $(AR_OS2_SUFFIX)
+	$(RANLIB) $@
+else
+ifdef USE_MSVC
+$(LIBRARY): $(LIB_OBJS)
+	link.exe $(LIB_LINK_FLAGS) /base:0x61000000 \
+	    /out:"$@" /pdb:"$(OBJDIR)/js32.pdb" /implib:"$(OBJDIR)/js32.lib" $?
+else
+$(LIBRARY): $(LIB_OBJS)
+	$(AR) rv $@ $?
+	$(RANLIB) $@
+endif
+endif
+
+#NSPR_LIBRARY = ../../dist/$(OBJDIR)/lib/libnspr21.so
+NSPR_LIBRARY =
+
+$(PROGRAM): $(PROG_OBJS) $(LIBRARY)
+	$(CC) -o $@ $(CFLAGS) $(PROG_OBJS) $(LIBRARY) $(NSPR_LIBRARY) $(LDFLAGS)
+
+$(PROGRAM).pure: $(PROG_OBJS) $(LIBRARY)
+	purify $(PUREFLAGS) \
+	    $(CC) -o $@ $(PURE_OS_CFLAGS) $(PROG_OBJS) $(LIBRARY) $(LDFLAGS)
+
+$(HFILES) $(CFILES): $(OBJDIR)/prcpucfg.h
+
+ifdef PREBUILT_CPUCFG
+$(OBJDIR)/prcpucfg.h: prcpucfg.h
+	cp prcpucfg.h $(OBJDIR)
+else
+$(OBJDIR)/prcpucfg.h: $(OBJDIR)/prcpucfg
+	rm -f $@
+	$(OBJDIR)/prcpucfg > $@
+
+$(OBJDIR)/prcpucfg: $(OBJDIR)/prcpucfg.o
+	$(CC) -o $@ $(OBJDIR)/prcpucfg.o
+endif
+
+#
+# Hardwire dependencies on jsopcode.def
+#
+jsopcode.h jsopcode.c: jsopcode.def
+
+-include $(DEPENDENCIES)
+
+TARNAME = jsref.tar
+TARFILES = files `cat files`
+
+tar:
+	tar cvf $(TARNAME) $(TARFILES)
+	gzip $(TARNAME)
+
+SUFFIXES: .i
+%.i: %.c
+	$(CC) -C -E $(CFLAGS) $< > $*.i

mozilla/js/ref/Makefile.in

@@ -0,0 +1,303 @@
+#
+# The contents of this file are subject to the Netscape Public License
+# Version 1.0 (the "NPL"); you may not use this file except in
+# compliance with the NPL.  You may obtain a copy of the NPL at
+# http://www.mozilla.org/NPL/
+#
+# Software distributed under the NPL is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+# for the specific language governing rights and limitations under the
+# NPL.
+#
+# The Initial Developer of this code under the NPL is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation.  All Rights
+# Reserved.
+
+#
+# JSRef GNUmake makefile.
+#
+
+# Set os+release dependent make variables
+OS_ARCH         := $(subst /,_,$(shell uname -s))
+
+# Attempt to differentiate between SunOS 5.4 and x86 5.4
+OS_CPUARCH      := $(shell uname -m)
+ifeq ($(OS_CPUARCH),i86pc)
+OS_RELEASE      := $(shell uname -r)_$(OS_CPUARCH)
+else
+OS_RELEASE      := $(shell uname -r)
+endif
+
+# Virtually all Linux versions are identical.
+# Any distinctions are handled in linux.h
+ifeq ($(OS_ARCH),Linux)
+OS_CONFIG      := Linux_All
+else
+OS_CONFIG       := $(OS_ARCH)$(OS_OBJTYPE)$(OS_RELEASE)
+endif
+
+ASFLAGS         =
+DEFINES         =
+
+include config/$(OS_CONFIG).mk
+
+ifndef USE_AUTOCONF
+ifdef BUILD_OPT
+OPTIMIZER  += -O
+DEFINES    += -UDEBUG -DNDEBUG -UDEBUG_$(shell whoami)
+OBJDIR_TAG = _OPT
+else
+ifdef USE_MSVC
+OPTIMIZER  = -Zi
+else
+OPTIMIZER  = -g
+endif
+DEFINES    += -DDEBUG -DDEBUG_$(shell whoami)
+OBJDIR_TAG = _DBG
+endif
+endif
+
+#DEFINES += -DJS_THREADSAFE
+
+ifdef JS_NO_THIN_LOCKS
+DEFINES += -DJS_USE_ONLY_NSPR_LOCKS
+endif
+
+ifndef USE_AUTOCONF
+# Name of the binary code directories
+OBJDIR          = $(OS_CONFIG)$(OBJDIR_TAG).OBJ
+VPATH           = $(OBJDIR)
+
+# Automatic make dependencies file
+DEPENDENCIES    = $(OBJDIR)/.md
+endif
+
+define MAKE_OBJDIR
+if test ! -d $(@D); then rm -rf $(@D); mkdir $(@D); fi
+endef
+
+# Look in OBJDIR to find prcpucfg.h
+INCLUDES   = -I$(OBJDIR)
+
+#
+# XCFLAGS may be set in the environment or on the gmake command line
+#
+ifndef USE_AUTOCONF
+CFLAGS          = $(OPTIMIZER) $(OS_CFLAGS) $(DEFINES) $(INCLUDES) \
+                  -DJSFILE $(XCFLAGS)
+LDFLAGS		= -lm $(XLDFLAGS)
+
+# For purify
+PURE_CFLAGS     = -DXP_UNIX $(OPTIMIZER) $(PURE_OS_CFLAGS) $(DEFINES) \
+                  $(INCLUDES) $(XCFLAGS)
+endif
+
+#
+# JS file lists
+#
+PR_HFILES =		\
+	prarena.h	\
+	prassert.h	\
+	prclist.h	\
+	prdtoa.h	\
+	prhash.h	\
+	prlong.h	\
+	prmacos.h	\
+	prosdep.h	\
+	prpcos.h	\
+	prprintf.h	\
+	prtime.h	\
+	prtypes.h	\
+	prunixos.h	\
+	$(NULL)
+
+JS_HFILES =		\
+	jsarray.h	\
+	jsatom.h	\
+	jsbool.h	\
+	jsconfig.h	\
+	jscntxt.h	\
+	jsdate.h	\
+	jsemit.h	\
+	jsfun.h		\
+	jsgc.h		\
+	jsinterp.h	\
+	jslock.h	\
+	jsmath.h	\
+	jsnum.h		\
+	jsobj.h		\
+	jsopcode.h      \
+	jsparse.h	\
+	jsprvtd.h	\
+	jspubtd.h	\
+	jsregexp.h	\
+	jsscan.h	\
+	jsscope.h	\
+	jsscript.h	\
+	jsstr.h		\
+	jsxdrapi.h	\
+	$(NULL)
+
+API_HFILES =		\
+	jsapi.h		\
+	jsdbgapi.h	\
+	$(NULL)
+
+HFILES = $(PR_HFILES) $(JS_HFILES) $(API_HFILES)
+HFILES := $(addprefix $(srcdir)/, $(EXPORTS))
+
+PR_CFILES =		\
+	prarena.c	\
+	prassert.c	\
+	prdtoa.c	\
+	prhash.c	\
+	prlog2.c	\
+	prlong.c	\
+	prprintf.c	\
+	prtime.c	\
+	$(NULL)
+
+JS_CFILES =		\
+	jsapi.c		\
+	jsarray.c	\
+	jsatom.c	\
+	jsbool.c	\
+	jscntxt.c	\
+	jsdate.c	\
+	jsdbgapi.c	\
+	jsemit.c	\
+	jsfun.c		\
+	jsgc.c		\
+	jsinterp.c	\
+	jslock.c	\
+	jsmath.c	\
+	jsnum.c		\
+	jsobj.c		\
+	jsopcode.c      \
+	jsparse.c	\
+	jsregexp.c	\
+	jsscan.c	\
+	jsscope.c	\
+	jsscript.c	\
+	jsstr.c		\
+	jsxdrapi.c	\
+	$(NULL)
+
+LIB_CFILES  = $(PR_CFILES) $(JS_CFILES)
+LIB_ASFILES := $(wildcard $(srcdir)/*_$(OS_ARCH).s)
+PROG_CFILES = js.c
+
+ifdef USE_MSVC
+LIB_OBJS  = $(addprefix $(OBJDIR)/, $(LIB_CFILES:.c=.obj))
+PROG_OBJS = $(addprefix $(OBJDIR)/, $(PROG_CFILES:.c=.obj))
+else
+LIB_OBJS  = $(addprefix $(OBJDIR)/, $(LIB_CFILES:.c=.o))
+LIB_OBJS  += $(addprefix $(OBJDIR)/, $(LIB_ASFILES:.s=.o))
+PROG_OBJS = $(addprefix $(OBJDIR)/, $(PROG_CFILES:.c=.o))
+endif
+
+CFILES = $(LIB_CFILES) $(PROG_CFILES)
+OBJS   = $(LIB_OBJS) $(PROG_OBJS)
+
+ifdef USE_MSVC
+LIBRARY = $(OBJDIR)/js32.dll
+PROGRAM = $(OBJDIR)/js
+else
+LIBRARY = $(OBJDIR)/libjs.a
+PROGRAM = $(OBJDIR)/js
+endif
+
+ifdef USE_MSVC
+TARGETS = $(LIBRARY)   # $(PROGRAM) not supported for MSVC yet
+else
+TARGETS = $(LIBRARY) $(PROGRAM)
+endif
+
+all: $(TARGETS)
+
+clean:
+	rm -rf $(OBJS)
+
+clobber:
+	rm -rf $(OBJS) $(TARGETS) $(DEPENDENCIES)
+
+depend:
+	gcc -MM $(CFLAGS) $(JS_CFILES)
+
+$(OBJDIR)/%: %.c
+	@$(MAKE_OBJDIR)
+	$(CC) -o $@ $(CFLAGS) $< $(LDFLAGS)
+
+$(OBJDIR)/%.o: %.c
+	@$(MAKE_OBJDIR)
+	$(CC) -o $@ -c $(CFLAGS) $<
+
+$(OBJDIR)/%.o: %.s
+	@$(MAKE_OBJDIR)
+	$(AS) -o $@ $(ASFLAGS) $<
+
+# windows only
+$(OBJDIR)/%.obj: %.c
+	@$(MAKE_OBJDIR)
+	$(CC) -Fo$(OBJDIR)/ -c $(CFLAGS) $*.c
+
+ifeq ($(OS_ARCH),OS2)
+$(LIBRARY): $(LIB_OBJS)
+	$(AR) $@ $? $(AR_OS2_SUFFIX)
+	$(RANLIB) $@
+else
+ifdef USE_MSVC
+$(LIBRARY): $(LIB_OBJS)
+	link.exe $(LIB_LINK_FLAGS) /base:0x61000000 \
+	    /out:"$@" /pdb:"$(OBJDIR)/js32.pdb" /implib:"$(OBJDIR)/js32.lib" $?
+else
+$(LIBRARY): $(LIB_OBJS)
+	$(AR) rv $@ $?
+	$(RANLIB) $@
+endif
+endif
+
+#NSPR_LIBRARY = ../../dist/$(OBJDIR)/lib/libnspr21.so
+NSPR_LIBRARY =
+
+$(PROGRAM): $(PROG_OBJS) $(LIBRARY)
+	$(CC) -o $@ $(CFLAGS) $(PROG_OBJS) $(LIBRARY) $(NSPR_LIBRARY) $(LDFLAGS)
+
+$(PROGRAM).pure: $(PROG_OBJS) $(LIBRARY)
+	purify $(PUREFLAGS) \
+	    $(CC) -o $@ $(PURE_OS_CFLAGS) $(PROG_OBJS) $(LIBRARY) $(LDFLAGS)
+
+$(HFILES) $(CFILES): $(OBJDIR)/prcpucfg.h
+
+ifdef PREBUILT_CPUCFG
+$(OBJDIR)/prcpucfg.h: prcpucfg.h
+	cp prcpucfg.h $(OBJDIR)
+else
+$(OBJDIR)/prcpucfg.h: $(OBJDIR)/prcpucfg
+	rm -f $@
+	$(OBJDIR)/prcpucfg > $@
+
+$(OBJDIR)/prcpucfg: $(OBJDIR)/prcpucfg.o
+	$(CC) -o $@ $(OBJDIR)/prcpucfg.o
+endif
+
+#
+# Hardwire dependencies on jsopcode.def
+#
+jsopcode.h jsopcode.c: jsopcode.def
+
+ifndef USE_AUTOCONF
+-include $(DEPENDENCIES)
+endif
+
+TARNAME = jsref.tar
+TARFILES = files `cat files`
+
+tar:
+	tar cvf $(TARNAME) $(TARFILES)
+	gzip $(TARNAME)
+
+SUFFIXES: .i
+%.i: %.c
+	$(CC) -C -E $(CFLAGS) $< > $*.i

mozilla/js/ref/README

@@ -0,0 +1,674 @@
+This is the README file for the JavaScript Reference (JSRef) implementation.
+It consists of build conventions and instructions, source code conventions, a
+design walk-through, and a brief file-by-file description of the source.
+
+JSRef builds a library or DLL containing the JavaScript runtime (compiler,
+interpreter, decompiler, garbage collector, atom manager, standard classes).
+It then compiles a small "shell" program and links that with the library to
+make an interpreter that can be used interactively and with test .js files to
+run scripts.
+
+The current version of JSRef lacks a conformance testsuite.  We aim to provide
+one as soon as possible.
+
+Quick start tip: skip to "Using the JS API" below, build js, and play with the
+object named "it" (start by setting 'it.noisy = true').
+
+Brendan Eich, 9/17/96
+
+------------------------------------------------------------------------------
+
+Build conventions:
+
+- On Windows, use MSDEV4.2 (js*.mdp) or 5.0 (js*.mak).
+
+- On Mac, use CodeWarrior 3.x (JSRef.mcp in the macbuild subdirectory)
+
+- On Unix, use vendor cc or gcc (ftp://prep.ai.mit.edu/pub/gnu) for compiling,
+  and use gmake for building.
+
+  To compile optimized code, pass BUILD_OPT=1 on the nmake/gmake command line
+  or preset it in the environment or makefile.  The C preprocessor macro DEBUG
+  will be undefined, and NDEBUG (archaic Unix-ism for "No Debugging") will be
+  defined.  Without BUILD_OPT, DEBUG is predefined and NDEBUG is undefined.
+
+  On Unix, your own debug flag, DEBUG_$USER, will be defined or undefined as
+  BUILD_OPT is unset or set.
+
+  (Linux autoconf support way overdue; coming some day soon, I promise.)
+
+- To add C compiler options from the make command line, set XCFLAGS=-Dfoo.
+  To predefine -D or -U options in the makefile, set DEFINES.
+  To predefine -I options in the makefile, set INCLUDES.
+
+- To turn on GC instrumentation, define JS_GCMETER.
+- To enable multi-threaded execution, define JS_THREADSAFE and flesh out the
+  stubs and required headers in jslock.c/.h.  See the JS API docs for more.
+- To turn on the arena package's instrumentation, define PR_ARENAMETER.
+- To turn on the hash table package's metering, define PR_HASHMETER.
+
+Naming and coding conventions:
+
+- Public function names begin with JS_ followed by capitalized "intercaps",
+  e.g. JS_NewObject.
+- Extern but library-private function names use a js_ prefix and mixed case,
+  e.g. js_LookupSymbol.
+- Most static function names have unprefixed, mixed-case names: GetChar.
+- But static native methods of JS objects have lowercase, underscore-separated
+  or intercaps names, e.g., str_indexOf.
+- And library-private and static data use underscores, not intercaps (but
+  library-private data do use a js_ prefix).
+- Scalar type names are lowercase and js-prefixed: jsdouble.
+- Aggregate type names are JS-prefixed and mixed-case: JSObject.
+- Macros are generally ALL_CAPS and underscored, to call out potential
+  side effects, multiple uses of a formal argument, etc.
+
+- Four spaces of indentation per statement nesting level.
+- Tabs are taken to be eight spaces, and an Emacs magic comment at the top of
+  each file tries to help.  If you're using MSVC or similar, you'll want to
+  set tab width to 8, or convert these files to be space-filled.
+- DLL entry points have their return type expanded within a PR_PUBLIC_API()
+  macro call, to get the right Windows secret type qualifiers in the right
+  places for both 16- and 32-bit builds.
+- Callback functions that might be called from a DLL are similarly macroized
+  with PR_STATIC_CALLBACK (if the function otherwise would be static to hide
+  its name) or PR_CALLBACK (this macro takes no type argument; it should be
+  used after the return type and before the function name).
+
+Using the JS API:
+
+- Starting up:
+
+    /*
+     * Tune this to avoid wasting space for shallow stacks, while saving on
+     * malloc overhead/fragmentation for deep or highly-variable stacks.
+     */
+    #define STACK_CHUNK_SIZE	8192
+
+    JSRuntime *rt;
+    JSContext *cx;
+
+    /* You need a runtime and one or more contexts to do anything with JS. */
+    rt = JS_Init(1000000L);
+    if (!rt)
+	fail("can't create JavaScript runtime");
+    cx = JS_NewContext(rt, STACK_CHUNK_SIZE);
+    if (!cx)
+	fail("can't create JavaScript context");
+
+    /*
+     * The context definitely wants a global object, in order to have standard
+     * classes and functions like Date and parseInt.  See below for details on
+     * JS_NewObject.
+     */
+    JSObject *globalObj;
+
+    globalObj = JS_NewObject(cx, &my_global_class, 0, 0);
+    JS_InitStandardClasses(cx, globalObj);
+
+- Defining objects and properties:
+
+    /* Statically initialize a class to make "one-off" objects. */
+    JSClass my_class = {
+	"MyClass",
+
+	/* All of these can be replaced with the corresponding JS_*Stub
+	   function pointers. */
+	my_addProperty, my_delProperty, my_getProperty, my_setProperty,
+	my_enumerate,   my_resolve,     my_convert,     my_finalize
+    };
+
+    JSObject *obj;
+
+    /*
+     * Define an object named in the global scope that can be enumerated by
+     * for/in loops.  The parent object is passed as the second argument, as
+     * with all other API calls that take an object/name pair.  The prototype
+     * passed in is null, so the default object prototype will be used.
+     */
+    obj = JS_DefineObject(cx, globalObj, "myObject", &my_class, 0,
+			  JSPROP_ENUMERATE);
+
+    /*
+     * Define a bunch of properties with a JSPropertySpec array statically
+     * initialized and terminated with a null-name entry.  Besides its name,
+     * each property has a "tiny" identifier (MY_COLOR, e.g.) that can be used
+     * in switch statements (in a common my_getProperty function, for example).
+     */
+    enum my_tinyid {
+	MY_COLOR, MY_HEIGHT, MY_WIDTH, MY_FUNNY, MY_ARRAY, MY_RDONLY
+    };
+
+    static JSPropertySpec my_props[] = {
+        {"color",       MY_COLOR,       JSPROP_ENUMERATE},
+        {"height",      MY_HEIGHT,      JSPROP_ENUMERATE},
+        {"width",       MY_WIDTH,       JSPROP_ENUMERATE},
+        {"funny",       MY_FUNNY,       JSPROP_ENUMERATE},
+        {"array",       MY_ARRAY,       JSPROP_ENUMERATE},
+        {"rdonly",      MY_RDONLY,      JSPROP_READONLY},
+        {0}
+    };
+
+    JS_DefineProperties(cx, obj, my_props);
+
+    /*
+     * Given the above definitions and call to JS_DefineProperties, obj will
+     * need this sort of "getter" method in its class (my_class, above).  See
+     * the example for the "It" class in js.c.
+     */
+    static JSBool
+    my_getProperty(JSContext *cx, JSObject *obj, jsval id, jsval *vp)
+    {
+	if (JSVAL_IS_INT(id)) {
+	    switch (JSVAL_TO_INT(id)) {
+	      case MY_COLOR:  *vp = . . .; break;
+	      case MY_HEIGHT: *vp = . . .; break;
+	      case MY_WIDTH:  *vp = . . .; break;
+	      case MY_FUNNY:  *vp = . . .; break;
+	      case MY_ARRAY:  *vp = . . .; break;
+	      case MY_RDONLY: *vp = . . .; break;
+	    }
+	}
+	return JS_TRUE;
+    }
+
+- Defining functions:
+
+    /* Define a bunch of native functions first: */
+    static JSBool
+    my_abs(JSContext *cx, JSObject *obj, uintN argc, jsval *argv, jsval *rval)
+    {
+	jsdouble x, z;
+
+	if (!JS_ValueToNumber(cx, argv[0], &x))
+	    return JS_FALSE;
+	z = (x < 0) ? -x : x;
+	return JS_NewDoubleValue(cx, z, rval);
+    }
+
+    . . .
+
+    /*
+     * Use a JSFunctionSpec array terminated with a null name to define a
+     * bunch of native functions.
+     */
+    static JSFunctionSpec my_functions[] = {
+    /*    name          native          nargs    */
+        {"abs",         my_abs,         1},
+        {"acos",        my_acos,        1},
+        {"asin",        my_asin,        1},
+        . . .
+        {0}
+    };
+
+    /*
+     * Pass a particular object to define methods for it alone.  If you pass
+     * a prototype object, the methods will apply to all instances past and
+     * future of the prototype's class (see below for classes).
+     */
+    JS_DefineFunctions(cx, globalObj, my_functions);
+
+- Defining classes:
+
+    /*
+     * This pulls together the above API elements by defining a constructor
+     * function, a prototype object, and properties of the prototype and of
+     * the constructor, all with one API call.
+     *
+     * Initialize a class by defining its constructor function, prototype, and
+     * per-instance and per-class properties.  The latter are called "static"
+     * below by analogy to Java.  They are defined in the constructor object's
+     * scope, so that 'MyClass.myStaticProp' works along with 'new MyClass()'.
+     *
+     * JS_InitClass takes a lot of arguments, but you can pass null for any of
+     * the last four if there are no such properties or methods.
+     *
+     * Note that you do not need to call JS_InitClass to make a new instance of
+     * that class -- otherwise there would be a chicken-and-egg problem making
+     * the global object -- but you should call JS_InitClass if you require a
+     * constructor function for script authors to call via new, and/or a class
+     * prototype object ('MyClass.prototype') for authors to extend with new
+     * properties at run-time.
+     */
+    protoObj = JS_InitClass(cx, globalObj, &my_class,
+
+			    /* native constructor function and min arg count */
+			    MyClass, 0,
+
+			    /* prototype object properties and methods -- these
+			       will be "inherited" by all instances through
+			       delegation up the instance's prototype link. */
+			    my_props, my_methods,
+
+			    /* class constructor properties and methods */
+			    my_static_props, my_static_methods);
+
+- Running scripts:
+
+    /* These should indicate source location for diagnostics. */
+    char *filename;
+    uintN lineno;
+
+    /*
+     * The return value comes back here -- if it could be a GC thing, you must
+     * add it to the GC's "root set" with JS_AddRoot(cx, &thing) where thing
+     * is a JSString *, JSObject *, or jsdouble *, and remove the root before
+     * rval goes out of scope, or when rval is no longer needed.
+     */
+    jsval rval;
+    JSBool ok;
+
+    /*
+     * Some example source in a C string.  Larger, non-null-terminated buffers
+     * can be used, if you pass the buffer length to JS_EvaluateScript.
+     */
+    char *source = "x * f(y)";
+
+    ok = JS_EvaluateScript(cx, globalObj, source, strlen(source),
+			   filename, lineno, &rval);
+
+    if (ok) {
+	/* Should get a number back from the example source. */
+	jsdouble d;
+
+	ok = JS_ValueToNumber(cx, rval, &d);
+	. . .
+    }
+
+- Calling functions:
+
+    /* Call a global function named "foo" that takes no arguments. */
+    ok = JS_CallFunctionName(cx, globalObj, "foo", 0, 0, &rval);
+
+    jsval argv[2];
+
+    /* Call a function in obj's scope named "method", passing two arguments. */
+    argv[0] = . . .;
+    argv[1] = . . .;
+    ok = JS_CallFunctionName(cx, obj, "method", 2, argv, &rval);
+
+- Shutting down:
+
+    /* For each context you've created: */
+    JS_DestroyContext(cx);
+
+    /* And finally: */
+    JS_Finish(rt);
+
+- Debugging API
+
+  See the trap, untrap, watch, unwatch, line2pc, and pc2line commands in js.c.
+  Also the (scant) comments in jsdbgapi.h.
+
+Design walk-through:
+
+  This section must be brief for now -- it could easily turn into a book.
+
+- JS "JavaScript Proper"
+
+  JS modules declare and implement the JavaScript compiler, interpreter,
+  decompiler, GC and atom manager, and standard classes.
+
+  JavaScript uses untyped bytecode and runtime type tagging of data values.
+  The jsval type is a signed machine word that contains either a signed integer
+  value (if the low bit is set), or a type-tagged pointer or boolean value (if
+  the low bit is clear).  Tagged pointers all refer to 8-byte-aligned things in
+  the GC heap.
+
+  Objects consist of a possibly shared structural description, called the map
+  or scope; and unshared property values in a vector, called the slots.  Object
+  properties are associated with nonnegative integers stored in jsvals, or with
+  atoms (unique string descriptors) if named by an identifier or a non-integral
+  index expression.
+
+  Scripts contain bytecode, source annotations, and a pool of string, number,
+  and identifier literals.  Functions are objects that extend scripts or native
+  functions with formal parameters, a literal syntax, and a distinct primitive
+  type ("function").
+
+  The compiler consists of a recursive-descent parser and a random-logic rather
+  than table-driven lexical scanner.  Semantic and lexical feedback are used to
+  disambiguate hard cases such as missing semicolons, assignable expressions
+  ("lvalues" in C parlance), etc.  The parser generates bytecode as it parses,
+  using fixup lists for downward branches and code buffering and rewriting for
+  exceptional cases such as for loops.  It attempts no error recovery.
+
+  The interpreter executes the bytecode of top-level scripts, and calls itself
+  indirectly to interpret function bodies (which are also scripts).  All state
+  associated with an interpreter instance is passed through formal parameters
+  to the interpreter entry point; most implicit state is collected in a type
+  named JSContext.  Therefore, all API and almost all other functions in JSRef
+  take a JSContext pointer as their first argument.
+
+  The decompiler translates postfix bytecode into infix source by consulting a
+  separate byte-sized code, called source notes, to disambiguate bytecodes that
+  result from more than one grammatical production.
+
+  The GC is a mark-and-sweep, non-conservative (perfect) collector.  It can
+  allocate only fixed-sized things -- the current size is two machine words.
+  It is used to hold JS object and string descriptors (but not property lists
+  or string bytes), and double-precision floating point numbers.  It runs
+  automatically only when maxbytes (as passed to JS_Init) bytes of GC things
+  have been allocated and another thing-allocation request is made.  JS API
+  users should call JS_GC or JS_MaybeGC between script executions or from the
+  branch callback, as often as necessary.
+
+  An important point about the GC's "perfection": you must add roots for new
+  objects created by your native methods if you store references to them into
+  a non-JS structure in the malloc heap or in static data.  Also, if you make
+  a new object in a native method, but do not store it through the rval result
+  parameter (see math_abs in the "Using the JS API" section above) so that it
+  is in a known root, the object is guaranteed to survive only until another
+  new object is created.  Either lock the first new object when making two in
+  a row, or store it in a root you've added, or store it via rval.
+
+  The atom manager consists of a hash table associating strings uniquely with
+  scanner/parser information such as keyword type, index in script or function
+  literal pool, etc.  Atoms play three roles in JSRef: as literals referred to
+  by unaligned 16-bit immediate bytecode operands, as unique string descriptors
+  for efficient property name hashing, and as members of the root GC set for
+  perfect GC.  This design therefore requires atoms to be manually reference
+  counted, from script literal pools (JSAtomMap) and object symbol (JSSymbol)
+  entry keys.
+
+  Native objects and methods for arrays, booleans, dates, functions, numbers,
+  and strings are implemented using the JS API and certain internal interfaces
+  used as "fast paths".
+
+  In general, errors are signaled by false or unoverloaded-null return values,
+  and are reported using JS_ReportError or one of its variants by the lowest
+  level in order to provide the most detail.  Client code can substitute its
+  own error reporting function and suppress errors, or reflect them into Java
+  or some other runtime system as exceptions, GUI dialogs, etc.
+
+- PR "Portable Runtime"
+
+  PR modules declare and implement fundamental representation types and macros,
+  arenas, hash tables, 64-bit integers, double-precision floating point to
+  string and back conversions, and date/time functions that are used by the JS
+  modules.  The PR code is independent of JavaScript and can be used without
+  linking with the JS code.
+
+  In general, errors are signaled by false or unoverloaded-null return values,
+  but are not reported.  Therefore, JS calls to PR functions check returns and
+  report errors as specifically as possible.
+
+File walk-through:
+
+- jsapi.c, jsapi.h
+
+  The public API to be used by almost all client code.
+
+  If your client code can't make do with jsapi.h, and must reach into a friend
+  or private js* file, please let us know so we can extend jsapi.h to include
+  what you need in a fashion that we can support over the long run.
+
+- jspubtd.h, jsprvtd.h
+
+  These files exist to group struct and scalar typedefs so they can be used
+  everywhere without dragging in struct definitions from N different files.
+  The jspubtd.h file contains public typedefs, and is included by jsapi.h.
+  The jsprvtd.h file contains private typedefs and is included by various .h
+  files that need type names, but not type sizes or declarations.
+
+- jsdbgapi.c, jsdbgapi.h
+
+  The Debugging API, still very much under development.  Provided so far:
+
+  - Traps, with which breakpoints, single-stepping, step over, step out, and
+    so on can be implemented.  The debugger will have to consult jsopcode.def
+    on its own to figure out where to plant trap instructions to implement
+    functions like step out, but a future jsdbgapi.h will provide convenience
+    interfaces to do these things.
+
+    At most one trap per bytecode can be set.  When a script (JSScript) is
+    destroyed, all traps set in its bytecode are cleared.
+
+  - Watchpoints, for intercepting set operations on properties and running a
+    debugger-supplied function that receives the old value and a pointer to
+    the new one, which it can use to modify the new value being set.
+
+  - Line number to PC and back mapping functions.  The line-to-PC direction
+    "rounds" toward the next bytecode generated from a line greater than or
+    equal to the input line, and may return the PC of a for-loop update part,
+    if given the line number of the loop body's closing brace.  Any line after
+    the last one in a script or function maps to a PC one byte beyond the last
+    bytecode in the script.
+
+    An example, from perfect.js:
+
+14   function perfect(n)
+15   {
+16       print("The perfect numbers up to " +  n + " are:");
+17
+18       // We build sumOfDivisors[i] to hold a string expression for
+19       // the sum of the divisors of i, excluding i itself.
+20       var sumOfDivisors = new ExprArray(n+1,1);
+21       for (var divisor = 2; divisor <= n; divisor++) {
+22           for (var j = divisor + divisor; j <= n; j += divisor) {
+23               sumOfDivisors[j] += " + " + divisor;
+24           }
+25           // At this point everything up to 'divisor' has its sumOfDivisors
+26           // expression calculated, so we can determine whether it's perfect
+27           // already by evaluating.
+28           if (eval(sumOfDivisors[divisor]) == divisor) {
+29               print("" + divisor + " = " + sumOfDivisors[divisor]);
+30           }
+31       }
+32       delete sumOfDivisors;
+33       print("That's all.");
+34   }
+
+    The line number to PC and back mappings can be tested using the js program
+    with the following script:
+
+	load("perfect.js")
+	print(perfect)
+	dis(perfect)
+
+	print()
+	for (var ln = 0; ln <= 40; ln++) {
+	    var pc = line2pc(perfect,ln)
+	    var ln2 = pc2line(perfect,pc)
+	    print("\tline " + ln + " => pc " + pc + " => line " + ln2)
+	}
+
+    The result of the for loop over lines 0 to 40 inclusive is:
+
+	line 0 => pc 0 => line 16
+	line 1 => pc 0 => line 16
+	line 2 => pc 0 => line 16
+	line 3 => pc 0 => line 16
+	line 4 => pc 0 => line 16
+	line 5 => pc 0 => line 16
+	line 6 => pc 0 => line 16
+	line 7 => pc 0 => line 16
+	line 8 => pc 0 => line 16
+	line 9 => pc 0 => line 16
+	line 10 => pc 0 => line 16
+	line 11 => pc 0 => line 16
+	line 12 => pc 0 => line 16
+	line 13 => pc 0 => line 16
+	line 14 => pc 0 => line 16
+	line 15 => pc 0 => line 16
+	line 16 => pc 0 => line 16
+	line 17 => pc 19 => line 20
+	line 18 => pc 19 => line 20
+	line 19 => pc 19 => line 20
+	line 20 => pc 19 => line 20
+	line 21 => pc 36 => line 21
+	line 22 => pc 53 => line 22
+	line 23 => pc 74 => line 23
+	line 24 => pc 92 => line 22
+	line 25 => pc 106 => line 28
+	line 26 => pc 106 => line 28
+	line 27 => pc 106 => line 28
+	line 28 => pc 106 => line 28
+	line 29 => pc 127 => line 29
+	line 30 => pc 154 => line 21
+	line 31 => pc 154 => line 21
+	line 32 => pc 161 => line 32
+	line 33 => pc 172 => line 33
+	line 34 => pc 172 => line 33
+	line 35 => pc 172 => line 33
+	line 36 => pc 172 => line 33
+	line 37 => pc 172 => line 33
+	line 38 => pc 172 => line 33
+	line 39 => pc 172 => line 33
+	line 40 => pc 172 => line 33
+
+- jsconfig.h
+
+  Various configuration macros defined as 0 or 1 depending on how JS_VERSION
+  is defined (as 10 for JavaScript 1.0, 11 for JavaScript 1.1, etc.).  Not all
+  macros are tested around related code yet.  In particular, JS 1.0 support is
+  missing from JSRef.  JS 1.2 support will appear in a future JSRef release.
+
+- js.c
+
+  The "JS shell", a simple interpreter program that uses the JS API and more
+  than a few internal interfaces (some of these internal interfaces could be
+  replaced by jsapi.h calls).  The js program built from this source provides
+  a test vehicle for evaluating scripts and calling functions, trying out new
+  debugger primitives, etc.
+
+- jsarray.c, jsarray.h
+- jsbool.c, jsbool.h
+- jsdate.c, jsdate.h
+- jsfun.c, jsfun.h
+- jsmath.c, jsmath.h
+- jsnum.c, jsnum.h
+- jsstr.c, jsstr.h
+
+  These file pairs implement the standard classes and (where they exist) their
+  underlying primitive types.  They have similar structure, generally starting
+  with class definitions and continuing with internal constructors, finalizers,
+  and helper functions.
+
+- jsobj.c, jsobj.h
+- jsscope.c, jsscope.h
+
+  These two pairs declare and implement the JS object system.  All of the
+  following happen here:
+
+  - creating objects by class and prototype, and finalizing objects;
+  - defining, looking up, getting, setting, and deleting properties;
+  - creating and destroying properties and binding names to them.
+
+  The details of an object map (scope) are mostly hidden in jsscope.[ch],
+  where scopes start out as linked lists of symbols, and grow after some
+  threshold into PR hash tables.
+
+- jsatom.c, jsatom.h
+
+  The atom manager.  Contains well-known string constants, their atoms, the
+  global atom hash table and related state, the js_Atomize() function that
+  turns a counted string of bytes into an atom, and literal pool (JSAtomMap)
+  methods.
+
+- jsgc.c, jsgc.h
+
+  [TBD]
+
+- jsinterp.c, jsinterp.h
+- jscntxt.c, jscntxt.h
+
+  The bytecode interpreter, and related functions such as Call and AllocStack,
+  live in interp.c.  The JSContext constructor and destructor are factored out
+  into jscntxt.c for minimal linking when the compiler part of JS is split from
+  the interpreter part into a separate program.
+
+- jsemit.c, jsemit.h
+- jsopcode.def, jsopcode.c, jsopcode.h
+- jsparse.c, jsparse.h
+- jsscan.c, jsscan.h
+- jsscript.c, jsscript.h
+
+  Compiler and decompiler modules.  The jsopcode.def file is a C preprocessor
+  source that defines almost everything there is to know about JS bytecodes.
+  See its major comment for how to use it.  For now, a debugger will use it
+  and its dependents such as jsopcode.h directly, but over time we intend to
+  extend jsdbgapi.h to hide uninteresting details and provide conveniences.
+
+  The code generator is split across paragraphs of code in jsparse.c, and the
+  utility methods called on JSCodeGenerator appear in jsemit.c.  Source notes
+  generated by jsparse.c and jsemit.c are used in jsscript.c to map line number
+  to program counter and back.
+
+- prtypes.h, prlog2.c
+
+  Fundamental representation types and utility macros.  This file alone among
+  all .h files in JSRef must be included first by .c files.  It is not nested
+  in .h files, as other prerequisite .h files generally are, since it is also
+  a direct dependency of most .c files and would be over-included if nested in
+  addition to being directly included.
+
+  The one "not-quite-a-macro macro" is the PR_CeilingLog2 function in prlog2.c.
+
+- prarena.c, prarena.h
+
+  Last-In-First-Out allocation macros that amortize malloc costs and allow for
+  en-masse freeing.  See the paper mentioned in prarena.h's major comment.
+
+- prassert.c, prassert.h
+
+  The PR_ASSERT macro is used throughout JSRef source as a proof device to make
+  invariants and preconditions clear to the reader, and to hold the line during
+  maintenance and evolution against regressions or violations of assumptions
+  that it would be too expensive to test unconditionally at run-time.  Certain
+  assertions are followed by run-time tests that cope with assertion failure,
+  but only where I'm too smart or paranoid to believe the assertion will never
+  fail...
+
+- prclist.h
+
+  Doubly-linked circular list struct and macros.
+
+- prcpucfg.c
+
+  This standalone program generates prcpucfg.h, a header file containing bytes
+  per word and other constants that depend on CPU architecture and C compiler
+  type model.  It tries to discover most of these constants by running its own
+  experiments on the build host, so if you are cross-compiling, beware.
+
+- prdtoa.c, prdtoa.h
+
+  David Gay's portable double-precision floating point to string conversion
+  code, with Permission To Use notice included.
+
+- prhash.c, prhash.h
+
+  Portable, extensible hash tables.  These use multiplicative hash for strength
+  reduction over division hash, yet with very good key distribution over power
+  of two table sizes.  Collisions resolve via chaining, so each entry burns a
+  malloc and can fragment the heap.
+
+- prlong.c, prlong.h
+
+  64-bit integer emulation, and compatible macros that use C's long long type
+  where it exists (my last company mapped long long to a 128-bit type, but no
+  real architecture does 128-bit ints yet).
+
+- prosdep.h, prmacos.h, prpcos.h, prunixos.h, os/*.h
+
+  A bunch of annoying OS dependencies rationalized into a few "feature-test"
+  macros such as HAVE_LONG_LONG.
+
+- prprintf.c, prprintf.h
+
+  Portable, buffer-overrun-resistant sprintf and friends.
+
+  For no good reason save lack of time, the %e, %f, and %g formats cause your
+  system's native sprintf, rather than PR_dtoa, to be used.  This bug doesn't
+  affect JSRef, because it uses its own PR_dtoa call in jsnum.c to convert
+  from double to string, but it's a bug that we'll fix later, and one you
+  should be aware of if you intend to use a PR_*printf function with your own
+  floating type arguments -- various vendor sprintf's mishandle NaN, +/-Inf,
+  and some even print normal floating values inaccurately.
+
+- prtime.c, prtime.h
+
+  Time functions.  These interfaces are named in a way that makes local vs.
+  universal time confusion likely.  Caveat emptor, and we're working on it.
+  To make matters worse, Java (and therefore JavaScript) uses "local" time
+  numbers (offsets from the epoch) in its Date class.

mozilla/js/ref/TODO

@@ -0,0 +1,9 @@
+- scriptable in jsref
+  - exposed w/o java in js
+- immutable scopes
+  - so can revive SCOPE_TABLE stuff
+- fast-as-prop-cache inline scopes for native objects
+  so elim prop-cache
+- views
+  - global vars in ssjs object model
+  - html object model

mozilla/js/ref/config/AIX4.1.mk

@@ -0,0 +1,37 @@
+#
+# The contents of this file are subject to the Netscape Public License
+# Version 1.0 (the "NPL"); you may not use this file except in
+# compliance with the NPL.  You may obtain a copy of the NPL at
+# http://www.mozilla.org/NPL/
+#
+# Software distributed under the NPL is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+# for the specific language governing rights and limitations under the
+# NPL.
+#
+# The Initial Developer of this code under the NPL is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation.  All Rights
+# Reserved.
+#
+
+#
+# Config stuff for AIX
+#
+
+CC = xlC_r
+CCC = xlC_r
+
+RANLIB = ranlib
+
+#.c.o:
+#	$(CC) -c -MD $*.d $(CFLAGS) $<
+ARCH := aix
+CPU_ARCH = rs6000
+GFX_ARCH = x
+INLINES = js_compare_and_swap:js_fast_lock1:js_fast_unlock1:js_lock_get_slot:js_lock_set_slot:js_lock_scope1
+
+OS_CFLAGS = -qarch=com -qinline+$(INLINES) -DXP_UNIX -DAIX -DAIXV3 -DSYSV
+OS_LIBS = -lbsd -lsvld -lm
+#-lpthreads -lc_r
+

mozilla/js/ref/config/AIX4.2.mk

@@ -0,0 +1,37 @@
+#
+# The contents of this file are subject to the Netscape Public License
+# Version 1.0 (the "NPL"); you may not use this file except in
+# compliance with the NPL.  You may obtain a copy of the NPL at
+# http://www.mozilla.org/NPL/
+#
+# Software distributed under the NPL is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+# for the specific language governing rights and limitations under the
+# NPL.
+#
+# The Initial Developer of this code under the NPL is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation.  All Rights
+# Reserved.
+#
+
+#
+# Config stuff for AIX
+#
+
+CC = xlC_r
+CCC = xlC_r
+
+RANLIB = ranlib
+
+#.c.o:
+#	$(CC) -c -MD $*.d $(CFLAGS) $<
+ARCH := aix
+CPU_ARCH = rs6000
+GFX_ARCH = x
+INLINES = js_compare_and_swap:js_fast_lock1:js_fast_unlock1:js_lock_get_slot:js_lock_set_slot:js_lock_scope1
+
+OS_CFLAGS = -qarch=com -qinline+$(INLINES) -DXP_UNIX -DAIX -DAIXV3 -DSYSV
+OS_LIBS = -lbsd -lsvld -lm
+#-lpthreads -lc_r
+

mozilla/js/ref/config/HP-UXB.10.10.mk

@@ -0,0 +1,48 @@
+#
+# The contents of this file are subject to the Netscape Public License
+# Version 1.0 (the "NPL"); you may not use this file except in
+# compliance with the NPL.  You may obtain a copy of the NPL at
+# http://www.mozilla.org/NPL/
+#
+# Software distributed under the NPL is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+# for the specific language governing rights and limitations under the
+# NPL.
+#
+# The Initial Developer of this code under the NPL is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation.  All Rights
+# Reserved.
+#
+
+#
+# Config stuff for HPUX
+#
+
+CC = gcc -Wall -Wno-format
+CCC = g++ -Wall -Wno-format
+
+RANLIB = echo
+
+#.c.o:
+#	$(CC) -c -MD $*.d $(CFLAGS) $<
+
+CPU_ARCH = hppa
+GFX_ARCH = x
+
+OS_CFLAGS = -DXP_UNIX -DHPUX -DSYSV -D_SVID_GETTOD
+OS_LIBS = -ldld
+
+ifeq ($(OS_RELEASE),B.10)
+PLATFORM_FLAGS		+= -DHPUX10 -Dhpux10
+PORT_FLAGS		+= -DRW_NO_OVERLOAD_SCHAR -DHAVE_MODEL_H
+ifeq ($(OS_VERSION),.10)
+PLATFORM_FLAGS		+= -DHPUX10_10
+endif
+ifeq ($(OS_VERSION),.20)
+PLATFORM_FLAGS		+= -DHPUX10_20
+endif
+ifeq ($(OS_VERSION),.30)
+PLATFORM_FLAGS		+= -DHPUX10_30
+endif
+endif

mozilla/js/ref/config/HP-UXB.11.00.mk

@@ -0,0 +1,48 @@
+#
+# The contents of this file are subject to the Netscape Public License
+# Version 1.0 (the "NPL"); you may not use this file except in
+# compliance with the NPL.  You may obtain a copy of the NPL at
+# http://www.mozilla.org/NPL/
+#
+# Software distributed under the NPL is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+# for the specific language governing rights and limitations under the
+# NPL.
+#
+# The Initial Developer of this code under the NPL is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation.  All Rights
+# Reserved.
+#
+
+#
+# Config stuff for HPUX
+#
+
+CC = gcc -Wall -Wno-format
+CCC = g++ -Wall -Wno-format
+
+RANLIB = echo
+
+#.c.o:
+#	$(CC) -c -MD $*.d $(CFLAGS) $<
+
+CPU_ARCH = hppa
+GFX_ARCH = x
+
+OS_CFLAGS = -DXP_UNIX -DHPUX -DSYSV -D_SVID_GETTOD
+OS_LIBS = -ldld
+
+ifeq ($(OS_RELEASE),B.10)
+PLATFORM_FLAGS		+= -DHPUX10 -Dhpux10
+PORT_FLAGS		+= -DRW_NO_OVERLOAD_SCHAR -DHAVE_MODEL_H
+ifeq ($(OS_VERSION),.10)
+PLATFORM_FLAGS		+= -DHPUX10_10
+endif
+ifeq ($(OS_VERSION),.20)
+PLATFORM_FLAGS		+= -DHPUX10_20
+endif
+ifeq ($(OS_VERSION),.30)
+PLATFORM_FLAGS		+= -DHPUX10_30
+endif
+endif

mozilla/js/ref/config/IRIX.mk

@@ -0,0 +1,58 @@
+#
+# The contents of this file are subject to the Netscape Public License
+# Version 1.0 (the "NPL"); you may not use this file except in
+# compliance with the NPL.  You may obtain a copy of the NPL at
+# http://www.mozilla.org/NPL/
+#
+# Software distributed under the NPL is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+# for the specific language governing rights and limitations under the
+# NPL.
+#
+# The Initial Developer of this code under the NPL is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation.  All Rights
+# Reserved.
+#
+
+#
+# Config stuff for IRIX
+#
+
+CPU_ARCH = mips
+GFX_ARCH = x
+
+RANLIB = /bin/true
+
+#NS_USE_GCC = 1
+
+ifdef NS_USE_GCC
+CC = gcc
+CCC = g++
+AS = $(CC) -x assembler-with-cpp
+ODD_CFLAGS = -Wall -Wno-format
+ifdef BUILD_OPT
+OPTIMIZER = -O6
+endif
+else
+ifeq ($(OS_RELEASE),6.2)
+CC	= cc -32 -DIRIX6_2
+endif
+ifeq ($(OS_RELEASE),6.3)
+CC	= cc -32 -DIRIX6_3
+endif
+CCC = CC
+ODD_CFLAGS = -fullwarn -xansi
+ifdef BUILD_OPT
+OPTIMIZER += -Olimit 4000
+endif
+endif
+
+# For purify
+HAVE_PURIFY = 1
+PURE_OS_CFLAGS = $(ODD_CFLAGS) -DXP_UNIX -DSVR4 -DSW_THREADS -DIRIX
+
+OS_CFLAGS = $(PURE_OS_CFLAGS) -MDupdate $(DEPENDENCIES)
+
+BSDECHO	= echo
+MKSHLIB = $(LD) -shared

mozilla/js/ref/config/IRIX5.3.mk

@@ -0,0 +1,22 @@
+#
+# The contents of this file are subject to the Netscape Public License
+# Version 1.0 (the "NPL"); you may not use this file except in
+# compliance with the NPL.  You may obtain a copy of the NPL at
+# http://www.mozilla.org/NPL/
+#
+# Software distributed under the NPL is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+# for the specific language governing rights and limitations under the
+# NPL.
+#
+# The Initial Developer of this code under the NPL is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation.  All Rights
+# Reserved.
+#
+
+#
+# Config stuff for IRIX5.3
+#
+
+include config/IRIX.mk

mozilla/js/ref/config/IRIX6.1.mk

@@ -0,0 +1,22 @@
+#
+# The contents of this file are subject to the Netscape Public License
+# Version 1.0 (the "NPL"); you may not use this file except in
+# compliance with the NPL.  You may obtain a copy of the NPL at
+# http://www.mozilla.org/NPL/
+#
+# Software distributed under the NPL is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+# for the specific language governing rights and limitations under the
+# NPL.
+#
+# The Initial Developer of this code under the NPL is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation.  All Rights
+# Reserved.
+#
+
+#
+# Config stuff for IRIX6.3
+#
+
+include config/IRIX.mk

mozilla/js/ref/config/IRIX6.2.mk

@@ -0,0 +1,22 @@
+#
+# The contents of this file are subject to the Netscape Public License
+# Version 1.0 (the "NPL"); you may not use this file except in
+# compliance with the NPL.  You may obtain a copy of the NPL at
+# http://www.mozilla.org/NPL/
+#
+# Software distributed under the NPL is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+# for the specific language governing rights and limitations under the
+# NPL.
+#
+# The Initial Developer of this code under the NPL is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation.  All Rights
+# Reserved.
+#
+
+#
+# Config stuff for IRIX6.2
+#
+
+include config/IRIX.mk

mozilla/js/ref/config/IRIX6.3.mk

@@ -0,0 +1,22 @@
+#
+# The contents of this file are subject to the Netscape Public License
+# Version 1.0 (the "NPL"); you may not use this file except in
+# compliance with the NPL.  You may obtain a copy of the NPL at
+# http://www.mozilla.org/NPL/
+#
+# Software distributed under the NPL is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+# for the specific language governing rights and limitations under the
+# NPL.
+#
+# The Initial Developer of this code under the NPL is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation.  All Rights
+# Reserved.
+#
+
+#
+# Config stuff for IRIX6.3
+#
+
+include config/IRIX.mk

mozilla/js/ref/config/Linux_All.mk

@@ -0,0 +1,47 @@
+#
+# The contents of this file are subject to the Netscape Public License
+# Version 1.0 (the "NPL"); you may not use this file except in
+# compliance with the NPL.  You may obtain a copy of the NPL at
+# http://www.mozilla.org/NPL/
+#
+# Software distributed under the NPL is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+# for the specific language governing rights and limitations under the
+# NPL.
+#
+# The Initial Developer of this code under the NPL is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation.  All Rights
+# Reserved.
+#
+
+#
+# Config for all versions of Linux
+#
+
+CC = gcc -Wall -Wno-format
+CCC = g++ -Wall -Wno-format
+
+RANLIB = echo
+
+#.c.o:
+#      $(CC) -c -MD $*.d $(CFLAGS) $<
+
+CPU_ARCH = $(shell uname -m)
+ifeq (86,$(findstring 86,$(CPU_ARCH)))
+CPU_ARCH = x86
+endif
+GFX_ARCH = x
+
+OS_CFLAGS = -DXP_UNIX -DSVR4 -DSYSV -D_BSD_SOURCE -DPOSIX_SOURCE -DLINUX
+OS_LIBS = -lm -lc
+
+ASFLAGS += -x assembler-with-cpp
+
+ifeq ($(CPU_ARCH),alpha)
+
+# Ask the C compiler on alpha linux to let us work with denormalized
+# double values, which are required by the ECMA spec.
+
+OS_CFLAGS += -mieee
+endif

mozilla/js/ref/config/SunOS4.1.4.mk

@@ -0,0 +1,79 @@
+#
+# The contents of this file are subject to the Netscape Public License
+# Version 1.0 (the "NPL"); you may not use this file except in
+# compliance with the NPL.  You may obtain a copy of the NPL at
+# http://www.mozilla.org/NPL/
+#
+# Software distributed under the NPL is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+# for the specific language governing rights and limitations under the
+# NPL.
+#
+# The Initial Developer of this code under the NPL is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation.  All Rights
+# Reserved.
+#
+
+#
+# Config stuff for SunOS4.1
+#
+
+CC = gcc
+CCC = g++
+RANLIB = ranlib
+
+#.c.o:
+#	$(CC) -c -MD $*.d $(CFLAGS) $<
+
+CPU_ARCH = sparc
+GFX_ARCH = x
+
+# A pile of -D's to build xfe on sunos
+MOZ_CFLAGS = -DSTRINGS_ALIGNED -DNO_REGEX -DNO_ISDIR -DUSE_RE_COMP \
+	     -DNO_REGCOMP -DUSE_GETWD -DNO_MEMMOVE -DNO_ALLOCA \
+	     -DBOGUS_MB_MAX -DNO_CONST
+
+# Purify doesn't like -MDupdate
+NOMD_OS_CFLAGS = -DXP_UNIX -Wall -Wno-format -DSW_THREADS -DSUNOS4 -DNEED_SYSCALL \
+		 $(MOZ_CFLAGS)
+
+OS_CFLAGS = $(NOMD_OS_CFLAGS) -MDupdate $(DEPENDENCIES)
+OS_LIBS = -ldl -lm
+
+MKSHLIB = $(LD) -L$(MOTIF)/lib
+
+HAVE_PURIFY = 1
+MOTIF = /home/motif/usr
+MOTIFLIB = -L$(MOTIF)/lib -lXm
+INCLUDES += -I/usr/X11R5/include -I$(MOTIF)/include
+
+NOSUCHFILE = /solaris-rm-f-sucks
+
+LOCALE_MAP = $(DEPTH)/cmd/xfe/intl/sunos.lm
+
+EN_LOCALE = en_US
+DE_LOCALE = de
+FR_LOCALE = fr
+JP_LOCALE = ja
+SJIS_LOCALE = ja_JP.SJIS
+KR_LOCALE = ko
+CN_LOCALE = zh
+TW_LOCALE = zh_TW
+I2_LOCALE = i2
+IT_LOCALE = it
+SV_LOCALE = sv
+ES_LOCALE = es
+NL_LOCALE = nl
+PT_LOCALE = pt
+
+LOC_LIB_DIR = /usr/openwin/lib/locale
+
+BSDECHO	= echo
+
+#
+# These defines are for building unix plugins
+#
+BUILD_UNIX_PLUGINS = 1
+DSO_LDOPTS =
+DSO_LDFLAGS =

mozilla/js/ref/config/SunOS5.3.mk

@@ -0,0 +1,66 @@
+#
+# The contents of this file are subject to the Netscape Public License
+# Version 1.0 (the "NPL"); you may not use this file except in
+# compliance with the NPL.  You may obtain a copy of the NPL at
+# http://www.mozilla.org/NPL/
+#
+# Software distributed under the NPL is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+# for the specific language governing rights and limitations under the
+# NPL.
+#
+# The Initial Developer of this code under the NPL is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation.  All Rights
+# Reserved.
+#
+
+#
+# Config stuff for SunOS5.3
+#
+
+CC = gcc -Wall -Wno-format
+CCC = g++ -Wall -Wno-format
+
+#CC = /opt/SUNWspro/SC3.0.1/bin/cc
+RANLIB = echo
+
+#.c.o:
+#	$(CC) -c -MD $*.d $(CFLAGS) $<
+
+CPU_ARCH = sparc
+GFX_ARCH = x
+
+OS_CFLAGS = -DXP_UNIX -DSVR4 -DSYSV -DSOLARIS
+OS_LIBS = -lsocket -lnsl -ldl
+
+ASFLAGS	        += -P -L -K PIC -D_ASM -D__STDC__=0
+
+HAVE_PURIFY = 1
+
+NOSUCHFILE = /solaris-rm-f-sucks
+
+ifndef JS_NO_ULTRA
+ULTRA_OPTIONS := -xarch=v8plus
+ULTRA_OPTIONSD := -DULTRA_SPARC
+else
+ULTRA_OPTIONS := -xarch=v8
+ULTRA_OPTIONSD :=
+endif
+
+ifeq ($(OS_CPUARCH),sun4u)
+DEFINES 	+= $(ULTRA_OPTIONSD)
+ifeq ($(findstring gcc,$(CC)),gcc)
+DEFINES         += -Wa,$(ULTRA_OPTIONS),$(ULTRA_OPTIONSD)
+else
+ASFLAGS         += $(ULTRA_OPTIONS) $(ULTRA_OPTIONSD)
+endif
+endif
+
+ifeq ($(OS_CPUARCH),sun4m)
+ifeq ($(findstring gcc,$(CC)),gcc)
+DEFINES         += -Wa,-xarch=v8
+else
+ASFLAGS         += -xarch=v8
+endif
+endif

mozilla/js/ref/config/SunOS5.4.mk

@@ -0,0 +1,67 @@
+#
+# The contents of this file are subject to the Netscape Public License
+# Version 1.0 (the "NPL"); you may not use this file except in
+# compliance with the NPL.  You may obtain a copy of the NPL at
+# http://www.mozilla.org/NPL/
+#
+# Software distributed under the NPL is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+# for the specific language governing rights and limitations under the
+# NPL.
+#
+# The Initial Developer of this code under the NPL is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation.  All Rights
+# Reserved.
+#
+
+#
+# Config stuff for SunOS5.4
+#
+
+ifdef NS_USE_NATIVE
+CC = cc
+CCC = CC
+else
+CC = gcc -Wall -Wno-format
+CCC = g++ -Wall -Wno-format
+endif
+
+RANLIB = echo
+
+CPU_ARCH = sparc
+GFX_ARCH = x
+
+OS_CFLAGS = -DXP_UNIX -DSVR4 -DSYSV -D__svr4 -DSOLARIS
+OS_LIBS = -lsocket -lnsl -ldl
+
+ASFLAGS	        += -P -L -K PIC -D_ASM -D__STDC__=0
+
+HAVE_PURIFY = 1
+
+NOSUCHFILE = /solaris-rm-f-sucks
+
+ifndef JS_NO_ULTRA
+ULTRA_OPTIONS := -xarch=v8plus
+ULTRA_OPTIONSD := -DULTRA_SPARC
+else
+ULTRA_OPTIONS := -xarch=v8
+ULTRA_OPTIONSD :=
+endif
+
+ifeq ($(OS_CPUARCH),sun4u)
+DEFINES 	+= $(ULTRA_OPTIONSD)
+ifeq ($(findstring gcc,$(CC)),gcc)
+DEFINES         += -Wa,$(ULTRA_OPTIONS),$(ULTRA_OPTIONSD)
+else
+ASFLAGS         += $(ULTRA_OPTIONS) $(ULTRA_OPTIONSD)
+endif
+endif
+
+ifeq ($(OS_CPUARCH),sun4m)
+ifeq ($(findstring gcc,$(CC)),gcc)
+DEFINES         += -Wa,-xarch=v8
+else
+ASFLAGS         += -xarch=v8
+endif
+endif

mozilla/js/ref/config/SunOS5.5.1.mk

@@ -0,0 +1,71 @@
+#
+# The contents of this file are subject to the Netscape Public License
+# Version 1.0 (the "NPL"); you may not use this file except in
+# compliance with the NPL.  You may obtain a copy of the NPL at
+# http://www.mozilla.org/NPL/
+#
+# Software distributed under the NPL is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+# for the specific language governing rights and limitations under the
+# NPL.
+#
+# The Initial Developer of this code under the NPL is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation.  All Rights
+# Reserved.
+#
+
+#
+# Config stuff for SunOS5.5
+#
+
+AS = as
+ifndef NS_USE_NATIVE
+CC = gcc -Wall -Wno-format
+CCC = g++ -Wall
+else
+CC = cc
+CCC = CC
+endif
+
+RANLIB = echo
+
+#.c.o:
+#	$(CC) -c -MD $*.d $(CFLAGS) $<
+
+CPU_ARCH = sparc
+GFX_ARCH = x
+
+OS_CFLAGS = -DXP_UNIX -DSVR4 -DSYSV -DSOLARIS -D_SVID_GETTOD
+OS_LIBS = -lsocket -lnsl -ldl
+
+ASFLAGS	        += -P -L -K PIC -D_ASM -D__STDC__=0
+
+HAVE_PURIFY = 1
+
+NOSUCHFILE = /solaris-rm-f-sucks
+
+ifndef JS_NO_ULTRA
+ULTRA_OPTIONS := -xarch=v8plus
+ULTRA_OPTIONSD := -DULTRA_SPARC
+else
+ULTRA_OPTIONS := -xarch=v8
+ULTRA_OPTIONSD :=
+endif
+
+ifeq ($(OS_CPUARCH),sun4u)
+DEFINES 	+= $(ULTRA_OPTIONSD)
+ifeq ($(findstring gcc,$(CC)),gcc)
+DEFINES         += -Wa,$(ULTRA_OPTIONS),$(ULTRA_OPTIONSD)
+else
+ASFLAGS         += $(ULTRA_OPTIONS) $(ULTRA_OPTIONSD)
+endif
+endif
+
+ifeq ($(OS_CPUARCH),sun4m)
+ifeq ($(findstring gcc,$(CC)),gcc)
+DEFINES         += -Wa,-xarch=v8
+else
+ASFLAGS         += -xarch=v8
+endif
+endif

mozilla/js/ref/config/SunOS5.5.mk

@@ -0,0 +1,62 @@
+#
+# The contents of this file are subject to the Netscape Public License
+# Version 1.0 (the "NPL"); you may not use this file except in
+# compliance with the NPL.  You may obtain a copy of the NPL at
+# http://www.mozilla.org/NPL/
+#
+# Software distributed under the NPL is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+# for the specific language governing rights and limitations under the
+# NPL.
+#
+# The Initial Developer of this code under the NPL is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation.  All Rights
+# Reserved.
+#
+
+#
+# Config stuff for SunOS5.5
+#
+
+AS = as
+CC = gcc -Wall -Wno-format
+CCC = g++ -Wall -Wno-format
+
+#CC = /opt/SUNWspro/SC3.0.1/bin/cc
+RANLIB = echo
+
+#.c.o:
+#	$(CC) -c -MD $*.d $(CFLAGS) $<
+
+CPU_ARCH = sparc
+GFX_ARCH = x
+
+OS_CFLAGS = -DXP_UNIX -DSVR4 -DSYSV -DSOLARIS -D_SVID_GETTOD
+OS_LIBS = -lsocket -lnsl -ldl
+
+ASFLAGS	        += -P -L -K PIC -D_ASM -D__STDC__=0
+
+HAVE_PURIFY = 1
+
+NOSUCHFILE = /solaris-rm-f-sucks
+
+ifndef JS_NO_ULTRA
+ULTRA_OPTIONS := -xarch=v8plus -DULTRA_SPARC
+else
+ULTRA_OPTIONS := -xarch=v8
+endif
+
+ifeq ($(OS_CPUARCH),sun4u)
+ASFLAGS         += $(ULTRA_OPTIONS)
+ifeq ($(findstring gcc,$(CC)),gcc)
+DEFINES         += -Wa,$(ULTRA_OPTIONS)
+endif
+else
+ifeq ($(OS_CPUARCH),sun4m)
+ASFLAGS         += -xarch=v8
+ifeq ($(findstring gcc,$(CC)),gcc)
+DEFINES         += -Wa,-xarch=v8
+endif
+endif
+endif

mozilla/js/ref/config/WINNT4.0.mk

@@ -0,0 +1,46 @@
+#
+# The contents of this file are subject to the Netscape Public License
+# Version 1.0 (the "NPL"); you may not use this file except in
+# compliance with the NPL.  You may obtain a copy of the NPL at
+# http://www.mozilla.org/NPL/
+#
+# Software distributed under the NPL is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+# for the specific language governing rights and limitations under the
+# NPL.
+#
+# The Initial Developer of this code under the NPL is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation.  All Rights
+# Reserved.
+
+#
+# Config for Windows NT using MS Visual C++ (version?)
+#
+
+CC = cl
+
+RANLIB = echo
+
+#.c.o:
+#      $(CC) -c -MD $*.d $(CFLAGS) $<
+
+CPU_ARCH = x86 # XXX fixme
+GFX_ARCH = win32
+
+OS_CFLAGS = -DXP_PC -DWIN32 -D_WINDOWS -D_WIN32
+OS_LIBS = -lm -lc
+
+PREBUILT_CPUCFG = 1
+USE_MSVC = 1
+
+LIB_LINK_FLAGS=kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib\
+ advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib oldnames.lib /nologo\
+ /subsystem:windows /dll /incremental:yes /debug\
+ /machine:I386
+
+CAFEDIR = t:/cafe
+JCLASSPATH = $(CAFEDIR)/Java/Lib/classes.zip
+JAVAC = $(CAFEDIR)/Bin/sj.exe
+JAVAH = $(CAFEDIR)/Java/Bin/javah.exe
+JCFLAGS = -I$(CAFEDIR)/Java/Include -I$(CAFEDIR)/Java/Include/win32

mozilla/js/ref/config/dgux.mk

@@ -0,0 +1,42 @@
+#
+# The contents of this file are subject to the Netscape Public License
+# Version 1.0 (the "NPL"); you may not use this file except in
+# compliance with the NPL.  You may obtain a copy of the NPL at
+# http://www.mozilla.org/NPL/
+#
+# Software distributed under the NPL is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+# for the specific language governing rights and limitations under the
+# NPL.
+#
+# The Initial Developer of this code under the NPL is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation.  All Rights
+# Reserved.
+#
+
+#
+# Config stuff for Data General DG/UX
+#
+
+#
+#  Initial DG/UX port by Marc Fraioli (fraioli@dg-rtp.dg.com)
+#
+
+AS = as
+CC = gcc 
+CCC = g++ 
+
+RANLIB = echo
+
+#
+#  _DGUX_SOURCE is needed to turn on a lot of stuff in the headers if 
+#      you're not using DG's compiler.  It shouldn't hurt if you are.
+#
+#  _POSIX4A_DRAFT10_SOURCE is needed to pick up localtime_r, used in
+#      prtime.c
+#
+OS_CFLAGS = -DXP_UNIX -DSVR4 -DSYSV -DDGUX -D_DGUX_SOURCE -D_POSIX4A_DRAFT10_SOURCE
+OS_LIBS = -lsocket -lnsl 
+
+NOSUCHFILE = /no-such-file

mozilla/js/ref/fdlibm/Makefile

@@ -0,0 +1,171 @@
+#
+# The contents of this file are subject to the Netscape Public License
+# Version 1.0 (the "NPL"); you may not use this file except in
+# compliance with the NPL.  You may obtain a copy of the NPL at
+# http://www.mozilla.org/NPL/
+#
+# Software distributed under the NPL is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+# for the specific language governing rights and limitations under the
+# NPL.
+#
+# The Initial Developer of this code under the NPL is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation.  All Rights
+# Reserved.
+
+#
+#  @(#)Makefile 1.4 95/01/18 
+# 
+#  ====================================================
+#  Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+# 
+#  Developed at SunSoft, a Sun Microsystems, Inc. business.
+#  Permission to use, copy, modify, and distribute this
+#  software is freely granted, provided that this notice 
+#  is preserved.
+#  ====================================================
+# 
+# 
+
+#
+# There are two options in making libm at fdlibm compile time:
+#       _IEEE_LIBM      --- IEEE libm; smaller, and somewhat faster
+#       _MULTI_LIBM     --- Support multi-standard at runtime by 
+#                           imposing wrapper functions defined in 
+#                           fdlibm.h:
+#                               _IEEE_MODE      -- IEEE
+#                               _XOPEN_MODE     -- X/OPEN
+#                               _POSIX_MODE     -- POSIX/ANSI
+#                               _SVID3_MODE     -- SVID
+#
+# Here is how to set up CFLAGS to create the desired libm at 
+# compile time:
+#
+#       CFLAGS = -D_IEEE_LIBM           ... IEEE libm (recommended)
+#       CFLAGS = -D_SVID3_MODE  ... Multi-standard supported
+#                                           libm with SVID as the 
+#                                           default standard
+#       CFLAGS = -D_XOPEN_MODE  ... Multi-standard supported
+#                                           libm with XOPEN as the 
+#                                           default standard
+#       CFLAGS = -D_POSIX_MODE  ... Multi-standard supported
+#                                           libm with POSIX as the 
+#                                           default standard
+#       CFLAGS =                        ... Multi-standard supported
+#                                           libm with IEEE as the 
+#                                           default standard
+# 
+# NOTE: if scalb's second arguement is an int, then one must
+# define _SCALB_INT in CFLAGS. The default prototype of scalb
+# is double scalb(double, double)
+#
+
+ifdef BUILD_OPT
+OPTIMIZER  = -O
+DEFINES    := -UDEBUG -DNDEBUG -UDEBUG_$(shell whoami)
+OBJDIR_TAG = _OPT
+else
+OPTIMIZER  = -g
+DEFINES    := -DDEBUG -UNDEBUG -DDEBUG_$(shell whoami)
+OBJDIR_TAG = _DBG
+endif
+
+# Set os+release dependent make variables
+OS_ARCH         := $(subst /,_,$(shell uname -s))
+
+# Attempt to differentiate between SunOS 5.4 and x86 5.4
+OS_CPUARCH      := $(shell uname -m)
+ifeq ($(OS_CPUARCH),i86pc)
+OS_RELEASE      := $(shell uname -r)_$(OS_CPUARCH)
+else
+ifeq ($(OS_ARCH),AIX)
+OS_RELEASE      := $(shell uname -v).$(shell uname -r)
+else
+OS_RELEASE      := $(shell uname -r)
+endif
+endif
+
+# Virtually all Linux versions are identical.
+# Any distinctions are handled in linux.h
+ifeq ($(OS_ARCH),Linux)
+OS_CONFIG      := Linux_All
+else
+OS_CONFIG       := $(OS_ARCH)$(OS_OBJTYPE)$(OS_RELEASE)
+endif
+
+# Name of the binary code directories
+OBJDIR          = $(OS_CONFIG)$(OBJDIR_TAG).OBJ
+VPATH           = $(OBJDIR)
+
+include config/$(OS_CONFIG).mk
+
+define MAKE_OBJDIR
+if test ! -d $(@D); then rm -rf $(@D); mkdir $(@D); fi
+endef
+
+# Look in OBJDIR to find prcpucfg.h
+INCLUDES   = -I$(OBJDIR)
+
+#
+# Default IEEE libm
+#
+CFLAGS          = -DXP_UNIX $(OPTIMIZER) $(OS_CFLAGS) $(DEFINES) $(INCLUDES) \
+                  -DJSFILE $(XCFLAGS) -D_IEEE_LIBM
+
+
+
+#CC = cc
+
+INCFILES = fdlibm.h
+.INIT: $(INCFILES)
+.KEEP_STATE:
+src =   k_standard.c k_rem_pio2.c \
+	k_cos.c k_sin.c k_tan.c \
+	e_acos.c e_acosh.c e_asin.c e_atan2.c \
+	e_atanh.c e_cosh.c e_exp.c e_fmod.c \
+	e_gamma.c e_gamma_r.c e_hypot.c e_j0.c \
+	e_j1.c e_jn.c e_lgamma.c e_lgamma_r.c \
+	e_log.c e_log10.c e_pow.c e_rem_pio2.c e_remainder.c \
+	e_scalb.c e_sinh.c e_sqrt.c \
+	w_acos.c w_acosh.c w_asin.c w_atan2.c \
+	w_atanh.c w_cosh.c w_exp.c w_fmod.c \
+	w_gamma.c w_gamma_r.c w_hypot.c w_j0.c \
+	w_j1.c w_jn.c w_lgamma.c w_lgamma_r.c \
+	w_log.c w_log10.c w_pow.c w_remainder.c \
+	w_scalb.c w_sinh.c w_sqrt.c \
+	s_asinh.c s_atan.c s_cbrt.c s_ceil.c s_copysign.c \
+	s_cos.c s_erf.c s_expm1.c s_fabs.c s_finite.c s_floor.c \
+	s_frexp.c s_ilogb.c s_isnan.c s_ldexp.c s_lib_version.c \
+	s_log1p.c s_logb.c s_matherr.c s_modf.c s_nextafter.c \
+	s_rint.c s_scalbn.c s_signgam.c s_significand.c s_sin.c \
+	s_tan.c s_tanh.c
+
+ifdef USE_MSVC
+obj = $(addprefix $(OBJDIR)/, $(src:.c=.obj))
+else
+obj = $(addprefix $(OBJDIR)/, $(src:.c=.o))
+endif
+
+all: libfdm.a 
+
+$(OBJDIR)/%: %.c
+	@$(MAKE_OBJDIR)
+	$(CC) -o $@ $(CFLAGS) $*.c $(LDFLAGS)
+
+$(OBJDIR)/%.o: %.c
+	@$(MAKE_OBJDIR)
+	$(CC) -o $@ -c $(CFLAGS) $*.c
+
+$(OBJDIR)/%.o: %.s
+	@$(MAKE_OBJDIR)
+	$(AS) -o $@ $(ASFLAGS) $*.s
+
+libfdm.a : $(obj) 
+	ar cru $(OBJDIR)/libfdm.a $(obj)
+	ranlib $(OBJDIR)/libfdm.a
+
+source: $(src) README
+
+clean: 
+	/bin/rm -f $(obj) $(OBJDIR)/a.out $(OBJDIR)/libfdm.a

mozilla/js/ref/fdlibm/config/AIX4.1.mk

@@ -0,0 +1,19 @@
+#
+# Config stuff for AIX
+#
+
+CC = xlC_r
+CCC = xlC_r
+
+RANLIB = ranlib
+
+#.c.o:
+#	$(CC) -c -MD $*.d $(CFLAGS) $<
+ARCH := aix
+CPU_ARCH = rs6000
+GFX_ARCH = x
+INLINES = js_compare_and_swap:js_fast_lock1:js_fast_unlock1:js_lock_get_slot:js_lock_set_slot:js_lock_scope1
+
+OS_CFLAGS = -qarch=com -qinline+$(INLINES) -DXP_UNIX -DAIX -DAIXV3 -DSYSV
+OS_LIBS = -lbsd -lsvld -lm
+#-lpthreads -lc_r

mozilla/js/ref/fdlibm/config/AIX4.2.mk

@@ -0,0 +1,19 @@
+#
+# Config stuff for AIX
+#
+
+CC = xlC_r
+CCC = xlC_r
+
+RANLIB = ranlib
+
+#.c.o:
+#	$(CC) -c -MD $*.d $(CFLAGS) $<
+ARCH := aix
+CPU_ARCH = rs6000
+GFX_ARCH = x
+INLINES = js_compare_and_swap:js_fast_lock1:js_fast_unlock1:js_lock_get_slot:js_lock_set_slot:js_lock_scope1
+
+OS_CFLAGS = -qarch=com -qinline+$(INLINES) -DXP_UNIX -DAIX -DAIXV3 -DSYSV
+OS_LIBS = -lbsd -lsvld -lm
+#-lpthreads -lc_r

mozilla/js/ref/fdlibm/config/HP-UXB.10.10.mk

@@ -0,0 +1,46 @@
+#
+# The contents of this file are subject to the Netscape Public License
+# Version 1.0 (the "NPL"); you may not use this file except in
+# compliance with the NPL.  You may obtain a copy of the NPL at
+# http://www.mozilla.org/NPL/
+#
+# Software distributed under the NPL is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+# for the specific language governing rights and limitations under the
+# NPL.
+#
+# The Initial Developer of this code under the NPL is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation.  All Rights
+# Reserved.
+
+#
+# Config stuff for HPUX
+#
+CC = gcc -Wall -Wno-format
+CCC = g++ -Wall -Wno-format
+
+RANLIB = echo
+
+#.c.o:
+#	$(CC) -c -MD $*.d $(CFLAGS) $<
+
+CPU_ARCH = hppa
+GFX_ARCH = x
+
+OS_CFLAGS = -DXP_UNIX -DHPUX -DSYSV -D_SVID_GETTOD
+OS_LIBS = -ldld
+
+ifeq ($(OS_RELEASE),B.10)
+PLATFORM_FLAGS		+= -DHPUX10 -Dhpux10
+PORT_FLAGS		+= -DRW_NO_OVERLOAD_SCHAR -DHAVE_MODEL_H
+ifeq ($(OS_VERSION),.10)
+PLATFORM_FLAGS		+= -DHPUX10_10
+endif
+ifeq ($(OS_VERSION),.20)
+PLATFORM_FLAGS		+= -DHPUX10_20
+endif
+ifeq ($(OS_VERSION),.30)
+PLATFORM_FLAGS		+= -DHPUX10_30
+endif
+endif

mozilla/js/ref/fdlibm/config/HP-UXB.10.20.mk

@@ -0,0 +1,46 @@
+#
+# The contents of this file are subject to the Netscape Public License
+# Version 1.0 (the "NPL"); you may not use this file except in
+# compliance with the NPL.  You may obtain a copy of the NPL at
+# http://www.mozilla.org/NPL/
+#
+# Software distributed under the NPL is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+# for the specific language governing rights and limitations under the
+# NPL.
+#
+# The Initial Developer of this code under the NPL is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation.  All Rights
+# Reserved.
+
+#
+# Config stuff for HPUX
+#
+CC = gcc -Wall -Wno-format
+CCC = g++ -Wall -Wno-format
+
+RANLIB = echo
+
+#.c.o:
+#	$(CC) -c -MD $*.d $(CFLAGS) $<
+
+CPU_ARCH = hppa
+GFX_ARCH = x
+
+OS_CFLAGS = -DXP_UNIX -DHPUX -DSYSV -D_SVID_GETTOD
+OS_LIBS = -ldld
+
+ifeq ($(OS_RELEASE),B.10)
+PLATFORM_FLAGS		+= -DHPUX10 -Dhpux10
+PORT_FLAGS		+= -DRW_NO_OVERLOAD_SCHAR -DHAVE_MODEL_H
+ifeq ($(OS_VERSION),.10)
+PLATFORM_FLAGS		+= -DHPUX10_10
+endif
+ifeq ($(OS_VERSION),.20)
+PLATFORM_FLAGS		+= -DHPUX10_20
+endif
+ifeq ($(OS_VERSION),.30)
+PLATFORM_FLAGS		+= -DHPUX10_30
+endif
+endif

mozilla/js/ref/fdlibm/config/HP-UXB.11.00.mk

@@ -0,0 +1,46 @@
+#
+# The contents of this file are subject to the Netscape Public License
+# Version 1.0 (the "NPL"); you may not use this file except in
+# compliance with the NPL.  You may obtain a copy of the NPL at
+# http://www.mozilla.org/NPL/
+#
+# Software distributed under the NPL is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+# for the specific language governing rights and limitations under the
+# NPL.
+#
+# The Initial Developer of this code under the NPL is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation.  All Rights
+# Reserved.
+
+#
+# Config stuff for HPUX
+#
+CC = gcc -Wall -Wno-format
+CCC = g++ -Wall -Wno-format
+
+RANLIB = echo
+
+#.c.o:
+#	$(CC) -c -MD $*.d $(CFLAGS) $<
+
+CPU_ARCH = hppa
+GFX_ARCH = x
+
+OS_CFLAGS = -DXP_UNIX -DHPUX -DSYSV -D_SVID_GETTOD
+OS_LIBS = -ldld
+
+ifeq ($(OS_RELEASE),B.10)
+PLATFORM_FLAGS		+= -DHPUX10 -Dhpux10
+PORT_FLAGS		+= -DRW_NO_OVERLOAD_SCHAR -DHAVE_MODEL_H
+ifeq ($(OS_VERSION),.10)
+PLATFORM_FLAGS		+= -DHPUX10_10
+endif
+ifeq ($(OS_VERSION),.20)
+PLATFORM_FLAGS		+= -DHPUX10_20
+endif
+ifeq ($(OS_VERSION),.30)
+PLATFORM_FLAGS		+= -DHPUX10_30
+endif
+endif

mozilla/js/ref/fdlibm/config/IRIX.mk

@@ -0,0 +1,56 @@
+#
+# The contents of this file are subject to the Netscape Public License
+# Version 1.0 (the "NPL"); you may not use this file except in
+# compliance with the NPL.  You may obtain a copy of the NPL at
+# http://www.mozilla.org/NPL/
+#
+# Software distributed under the NPL is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+# for the specific language governing rights and limitations under the
+# NPL.
+#
+# The Initial Developer of this code under the NPL is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation.  All Rights
+# Reserved.
+
+#
+# Config stuff for IRIX
+#
+CPU_ARCH = mips
+GFX_ARCH = x
+
+RANLIB = /bin/true
+
+#NS_USE_GCC = 1
+
+ifdef NS_USE_GCC
+CC = gcc
+CCC = g++
+AS = $(CC) -x assembler-with-cpp
+ODD_CFLAGS = -Wall -Wno-format
+ifdef BUILD_OPT
+OPTIMIZER = -O6
+endif
+else
+ifeq ($(OS_RELEASE),6.2)
+CC	= cc -32 -DIRIX6_2
+endif
+ifeq ($(OS_RELEASE),6.3)
+CC	= cc -32 -DIRIX6_3
+endif
+CCC = CC
+ODD_CFLAGS = -fullwarn -xansi
+ifdef BUILD_OPT
+OPTIMIZER += -Olimit 4000
+endif
+endif
+
+# For purify
+HAVE_PURIFY = 1
+PURE_OS_CFLAGS = $(ODD_CFLAGS) -DXP_UNIX -DSVR4 -DSW_THREADS -DIRIX
+
+OS_CFLAGS = $(PURE_OS_CFLAGS) -MDupdate $(DEPENDENCIES)
+
+BSDECHO	= echo
+MKSHLIB = $(LD) -shared

mozilla/js/ref/fdlibm/config/IRIX5.3.mk

@@ -0,0 +1,20 @@
+#
+# The contents of this file are subject to the Netscape Public License
+# Version 1.0 (the "NPL"); you may not use this file except in
+# compliance with the NPL.  You may obtain a copy of the NPL at
+# http://www.mozilla.org/NPL/
+#
+# Software distributed under the NPL is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+# for the specific language governing rights and limitations under the
+# NPL.
+#
+# The Initial Developer of this code under the NPL is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation.  All Rights
+# Reserved.
+
+#
+# Config stuff for IRIX5.3
+#
+include config/IRIX.mk

mozilla/js/ref/fdlibm/config/IRIX6.1.mk

@@ -0,0 +1,20 @@
+#
+# The contents of this file are subject to the Netscape Public License
+# Version 1.0 (the "NPL"); you may not use this file except in
+# compliance with the NPL.  You may obtain a copy of the NPL at
+# http://www.mozilla.org/NPL/
+#
+# Software distributed under the NPL is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+# for the specific language governing rights and limitations under the
+# NPL.
+#
+# The Initial Developer of this code under the NPL is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation.  All Rights
+# Reserved.
+
+#
+# Config stuff for IRIX6.3
+#
+include config/IRIX.mk

mozilla/js/ref/fdlibm/config/IRIX6.2.mk

@@ -0,0 +1,20 @@
+#
+# The contents of this file are subject to the Netscape Public License
+# Version 1.0 (the "NPL"); you may not use this file except in
+# compliance with the NPL.  You may obtain a copy of the NPL at
+# http://www.mozilla.org/NPL/
+#
+# Software distributed under the NPL is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+# for the specific language governing rights and limitations under the
+# NPL.
+#
+# The Initial Developer of this code under the NPL is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation.  All Rights
+# Reserved.
+
+#
+# Config stuff for IRIX6.3
+#
+include config/IRIX.mk

mozilla/js/ref/fdlibm/config/IRIX6.3.mk

@@ -0,0 +1,20 @@
+#
+# The contents of this file are subject to the Netscape Public License
+# Version 1.0 (the "NPL"); you may not use this file except in
+# compliance with the NPL.  You may obtain a copy of the NPL at
+# http://www.mozilla.org/NPL/
+#
+# Software distributed under the NPL is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+# for the specific language governing rights and limitations under the
+# NPL.
+#
+# The Initial Developer of this code under the NPL is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation.  All Rights
+# Reserved.
+
+#
+# Config stuff for IRIX6.3
+#
+include config/IRIX.mk

mozilla/js/ref/fdlibm/config/Linux_All.mk

@@ -0,0 +1,33 @@
+#
+# The contents of this file are subject to the Netscape Public License
+# Version 1.0 (the "NPL"); you may not use this file except in
+# compliance with the NPL.  You may obtain a copy of the NPL at
+# http://www.mozilla.org/NPL/
+#
+# Software distributed under the NPL is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+# for the specific language governing rights and limitations under the
+# NPL.
+#
+# The Initial Developer of this code under the NPL is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation.  All Rights
+# Reserved.
+
+# Config for all versions of Linux
+
+CC = gcc -Wall -Wno-format
+CCC = g++ -Wall -Wno-format
+
+RANLIB = echo
+
+#.c.o:
+#      $(CC) -c -MD $*.d $(CFLAGS) $<
+
+CPU_ARCH = x86 # XXX fixme
+GFX_ARCH = x
+
+OS_CFLAGS = -DXP_UNIX -DSVR4 -DSYSV -D_BSD_SOURCE -DPOSIX_SOURCE -DLINUX
+OS_LIBS = -lm -lc
+
+ASFLAGS += -x assembler-with-cpp

mozilla/js/ref/fdlibm/config/SunOS4.1.4.mk

@@ -0,0 +1,78 @@
+#
+# The contents of this file are subject to the Netscape Public License
+# Version 1.0 (the "NPL"); you may not use this file except in
+# compliance with the NPL.  You may obtain a copy of the NPL at
+# http://www.mozilla.org/NPL/
+#
+# Software distributed under the NPL is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+# for the specific language governing rights and limitations under the
+# NPL.
+#
+# The Initial Developer of this code under the NPL is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation.  All Rights
+# Reserved.
+
+#
+# Config stuff for SunOS4.1
+#
+
+CC = gcc
+CCC = g++
+RANLIB = ranlib
+
+#.c.o:
+#	$(CC) -c -MD $*.d $(CFLAGS) $<
+
+CPU_ARCH = sparc
+GFX_ARCH = x
+
+# A pile of -D's to build xfe on sunos
+MOZ_CFLAGS = -DSTRINGS_ALIGNED -DNO_REGEX -DNO_ISDIR -DUSE_RE_COMP \
+	     -DNO_REGCOMP -DUSE_GETWD -DNO_MEMMOVE -DNO_ALLOCA \
+	     -DBOGUS_MB_MAX -DNO_CONST
+
+# Purify doesn't like -MDupdate
+NOMD_OS_CFLAGS = -DXP_UNIX -Wall -Wno-format -DSW_THREADS -DSUNOS4 -DNEED_SYSCALL \
+		 $(MOZ_CFLAGS)
+
+OS_CFLAGS = $(NOMD_OS_CFLAGS) -MDupdate $(DEPENDENCIES)
+OS_LIBS = -ldl -lm
+
+MKSHLIB = $(LD) -L$(MOTIF)/lib
+
+HAVE_PURIFY = 1
+MOTIF = /home/motif/usr
+MOTIFLIB = -L$(MOTIF)/lib -lXm
+INCLUDES += -I/usr/X11R5/include -I$(MOTIF)/include
+
+NOSUCHFILE = /solaris-rm-f-sucks
+
+LOCALE_MAP = $(DEPTH)/cmd/xfe/intl/sunos.lm
+
+EN_LOCALE = en_US
+DE_LOCALE = de
+FR_LOCALE = fr
+JP_LOCALE = ja
+SJIS_LOCALE = ja_JP.SJIS
+KR_LOCALE = ko
+CN_LOCALE = zh
+TW_LOCALE = zh_TW
+I2_LOCALE = i2
+IT_LOCALE = it
+SV_LOCALE = sv
+ES_LOCALE = es
+NL_LOCALE = nl
+PT_LOCALE = pt
+
+LOC_LIB_DIR = /usr/openwin/lib/locale
+
+BSDECHO	= echo
+
+#
+# These defines are for building unix plugins
+#
+BUILD_UNIX_PLUGINS = 1
+DSO_LDOPTS =
+DSO_LDFLAGS =

mozilla/js/ref/fdlibm/config/SunOS5.3.mk

@@ -0,0 +1,65 @@
+#
+# The contents of this file are subject to the Netscape Public License
+# Version 1.0 (the "NPL"); you may not use this file except in
+# compliance with the NPL.  You may obtain a copy of the NPL at
+# http://www.mozilla.org/NPL/
+#
+# Software distributed under the NPL is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+# for the specific language governing rights and limitations under the
+# NPL.
+#
+# The Initial Developer of this code under the NPL is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation.  All Rights
+# Reserved.
+
+#
+# Config stuff for SunOS5.3
+#
+
+CC = gcc -Wall -Wno-format
+CCC = g++ -Wall -Wno-format
+
+#CC = /opt/SUNWspro/SC3.0.1/bin/cc
+RANLIB = echo
+
+#.c.o:
+#	$(CC) -c -MD $*.d $(CFLAGS) $<
+
+CPU_ARCH = sparc
+GFX_ARCH = x
+
+OS_CFLAGS = -DXP_UNIX -DSVR4 -DSYSV -DSOLARIS
+OS_LIBS = -lsocket -lnsl -ldl
+
+ASFLAGS	        += -P -L -K PIC -D_ASM -D__STDC__=0
+
+HAVE_PURIFY = 1
+
+NOSUCHFILE = /solaris-rm-f-sucks
+
+ifndef JS_NO_ULTRA
+ULTRA_OPTIONS := -xarch=v8plus
+ULTRA_OPTIONSD := -DULTRA_SPARC
+else
+ULTRA_OPTIONS := -xarch=v8
+ULTRA_OPTIONSD :=
+endif
+
+ifeq ($(OS_CPUARCH),sun4u)
+DEFINES 	+= $(ULTRA_OPTIONSD)
+ifeq ($(findstring gcc,$(CC)),gcc)
+DEFINES         += -Wa,$(ULTRA_OPTIONS),$(ULTRA_OPTIONSD)
+else
+ASFLAGS         += $(ULTRA_OPTIONS) $(ULTRA_OPTIONSD)
+endif
+endif
+
+ifeq ($(OS_CPUARCH),sun4m)
+ifeq ($(findstring gcc,$(CC)),gcc)
+DEFINES         += -Wa,-xarch=v8
+else
+ASFLAGS         += -xarch=v8
+endif
+endif

mozilla/js/ref/fdlibm/config/SunOS5.4.mk

@@ -0,0 +1,66 @@
+#
+# The contents of this file are subject to the Netscape Public License
+# Version 1.0 (the "NPL"); you may not use this file except in
+# compliance with the NPL.  You may obtain a copy of the NPL at
+# http://www.mozilla.org/NPL/
+#
+# Software distributed under the NPL is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+# for the specific language governing rights and limitations under the
+# NPL.
+#
+# The Initial Developer of this code under the NPL is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation.  All Rights
+# Reserved.
+
+#
+# Config stuff for SunOS5.4
+#
+
+ifdef NS_USE_NATIVE
+CC = cc
+CCC = CC
+else
+CC = gcc -Wall -Wno-format
+CCC = g++ -Wall -Wno-format
+endif
+
+RANLIB = echo
+
+CPU_ARCH = sparc
+GFX_ARCH = x
+
+OS_CFLAGS = -DXP_UNIX -DSVR4 -DSYSV -D__svr4 -DSOLARIS
+OS_LIBS = -lsocket -lnsl -ldl
+
+ASFLAGS	        += -P -L -K PIC -D_ASM -D__STDC__=0
+
+HAVE_PURIFY = 1
+
+NOSUCHFILE = /solaris-rm-f-sucks
+
+ifndef JS_NO_ULTRA
+ULTRA_OPTIONS := -xarch=v8plus
+ULTRA_OPTIONSD := -DULTRA_SPARC
+else
+ULTRA_OPTIONS := -xarch=v8
+ULTRA_OPTIONSD :=
+endif
+
+ifeq ($(OS_CPUARCH),sun4u)
+DEFINES 	+= $(ULTRA_OPTIONSD)
+ifeq ($(findstring gcc,$(CC)),gcc)
+DEFINES         += -Wa,$(ULTRA_OPTIONS),$(ULTRA_OPTIONSD)
+else
+ASFLAGS         += $(ULTRA_OPTIONS) $(ULTRA_OPTIONSD)
+endif
+endif
+
+ifeq ($(OS_CPUARCH),sun4m)
+ifeq ($(findstring gcc,$(CC)),gcc)
+DEFINES         += -Wa,-xarch=v8
+else
+ASFLAGS         += -xarch=v8
+endif
+endif

mozilla/js/ref/fdlibm/config/SunOS5.5.1.mk

@@ -0,0 +1,69 @@
+#
+# The contents of this file are subject to the Netscape Public License
+# Version 1.0 (the "NPL"); you may not use this file except in
+# compliance with the NPL.  You may obtain a copy of the NPL at
+# http://www.mozilla.org/NPL/
+#
+# Software distributed under the NPL is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+# for the specific language governing rights and limitations under the
+# NPL.
+#
+# The Initial Developer of this code under the NPL is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation.  All Rights
+# Reserved.
+
+#
+# Config stuff for SunOS5.5
+#
+AS = as
+ifndef NS_USE_NATIVE
+CC = gcc -Wall -Wno-format
+CCC = g++ -Wall
+else
+CC = cc
+CCC = CC
+endif
+
+RANLIB = echo
+
+#.c.o:
+#	$(CC) -c -MD $*.d $(CFLAGS) $<
+
+CPU_ARCH = sparc
+GFX_ARCH = x
+
+OS_CFLAGS = -DXP_UNIX -DSVR4 -DSYSV -DSOLARIS -D_SVID_GETTOD
+OS_LIBS = -lsocket -lnsl -ldl
+
+ASFLAGS	        += -P -L -K PIC -D_ASM -D__STDC__=0
+
+HAVE_PURIFY = 1
+
+NOSUCHFILE = /solaris-rm-f-sucks
+
+ifndef JS_NO_ULTRA
+ULTRA_OPTIONS := -xarch=v8plus
+ULTRA_OPTIONSD := -DULTRA_SPARC
+else
+ULTRA_OPTIONS := -xarch=v8
+ULTRA_OPTIONSD :=
+endif
+
+ifeq ($(OS_CPUARCH),sun4u)
+DEFINES 	+= $(ULTRA_OPTIONSD)
+ifeq ($(findstring gcc,$(CC)),gcc)
+DEFINES         += -Wa,$(ULTRA_OPTIONS),$(ULTRA_OPTIONSD)
+else
+ASFLAGS         += $(ULTRA_OPTIONS) $(ULTRA_OPTIONSD)
+endif
+endif
+
+ifeq ($(OS_CPUARCH),sun4m)
+ifeq ($(findstring gcc,$(CC)),gcc)
+DEFINES         += -Wa,-xarch=v8
+else
+ASFLAGS         += -xarch=v8
+endif
+endif

mozilla/js/ref/fdlibm/config/SunOS5.5.mk

@@ -0,0 +1,60 @@
+#
+# The contents of this file are subject to the Netscape Public License
+# Version 1.0 (the "NPL"); you may not use this file except in
+# compliance with the NPL.  You may obtain a copy of the NPL at
+# http://www.mozilla.org/NPL/
+#
+# Software distributed under the NPL is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+# for the specific language governing rights and limitations under the
+# NPL.
+#
+# The Initial Developer of this code under the NPL is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation.  All Rights
+# Reserved.
+
+#
+# Config stuff for SunOS5.5
+#
+AS = as
+CC = gcc -Wall -Wno-format
+CCC = g++ -Wall -Wno-format
+
+#CC = /opt/SUNWspro/SC3.0.1/bin/cc
+RANLIB = echo
+
+#.c.o:
+#	$(CC) -c -MD $*.d $(CFLAGS) $<
+
+CPU_ARCH = sparc
+GFX_ARCH = x
+
+OS_CFLAGS = -DXP_UNIX -DSVR4 -DSYSV -DSOLARIS -D_SVID_GETTOD
+OS_LIBS = -lsocket -lnsl -ldl
+
+ASFLAGS	        += -P -L -K PIC -D_ASM -D__STDC__=0
+
+HAVE_PURIFY = 1
+
+NOSUCHFILE = /solaris-rm-f-sucks
+
+ifndef JS_NO_ULTRA
+ULTRA_OPTIONS := -xarch=v8plus -DULTRA_SPARC
+else
+ULTRA_OPTIONS := -xarch=v8
+endif
+
+ifeq ($(OS_CPUARCH),sun4u)
+ASFLAGS         += $(ULTRA_OPTIONS)
+ifeq ($(findstring gcc,$(CC)),gcc)
+DEFINES         += -Wa,$(ULTRA_OPTIONS)
+endif
+else
+ifeq ($(OS_CPUARCH),sun4m)
+ASFLAGS         += -xarch=v8
+ifeq ($(findstring gcc,$(CC)),gcc)
+DEFINES         += -Wa,-xarch=v8
+endif
+endif
+endif

mozilla/js/ref/fdlibm/config/WINNT4.0.mk

@@ -0,0 +1,44 @@
+#
+# The contents of this file are subject to the Netscape Public License
+# Version 1.0 (the "NPL"); you may not use this file except in
+# compliance with the NPL.  You may obtain a copy of the NPL at
+# http://www.mozilla.org/NPL/
+#
+# Software distributed under the NPL is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+# for the specific language governing rights and limitations under the
+# NPL.
+#
+# The Initial Developer of this code under the NPL is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation.  All Rights
+# Reserved.
+
+# Config for Windows NT using MS Visual C++ (version?)
+
+CC = cl
+
+RANLIB = echo
+
+#.c.o:
+#      $(CC) -c -MD $*.d $(CFLAGS) $<
+
+CPU_ARCH = x86 # XXX fixme
+GFX_ARCH = win32
+
+OS_CFLAGS = -DXP_PC -DWIN32 -D_WINDOWS -D_WIN32
+OS_LIBS = -lm -lc
+
+PREBUILT_CPUCFG = 1
+USE_MSVC = 1
+
+LIB_LINK_FLAGS=kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib\
+ advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib oldnames.lib /nologo\
+ /subsystem:windows /dll /incremental:yes /debug\
+ /machine:I386
+
+CAFEDIR = t:/cafe
+JCLASSPATH = $(CAFEDIR)/Java/Lib/classes.zip
+JAVAC = $(CAFEDIR)/Bin/sj.exe
+JAVAH = $(CAFEDIR)/Java/Bin/javah.exe
+JCFLAGS = -I$(CAFEDIR)/Java/Include -I$(CAFEDIR)/Java/Include/win32

mozilla/js/ref/fdlibm/e_acos.c

@@ -0,0 +1,121 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public License
+ * Version 1.0 (the "NPL"); you may not use this file except in
+ * compliance with the NPL.  You may obtain a copy of the NPL at
+ * http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the NPL is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+ * for the specific language governing rights and limitations under the
+ * NPL.
+ *
+ * The Initial Developer of this code under the NPL is Sun Microsystems,
+ * Inc.  Portions created by Netscape are Copyright (C) 1998 Netscape
+ * Communications Corporation.  All Rights Reserved.
+ */
+
+/* @(#)e_acos.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* __ieee754_acos(x)
+ * Method :                  
+ *	acos(x)  = pi/2 - asin(x)
+ *	acos(-x) = pi/2 + asin(x)
+ * For |x|<=0.5
+ *	acos(x) = pi/2 - (x + x*x^2*R(x^2))	(see asin.c)
+ * For x>0.5
+ * 	acos(x) = pi/2 - (pi/2 - 2asin(sqrt((1-x)/2)))
+ *		= 2asin(sqrt((1-x)/2))  
+ *		= 2s + 2s*z*R(z) 	...z=(1-x)/2, s=sqrt(z)
+ *		= 2f + (2c + 2s*z*R(z))
+ *     where f=hi part of s, and c = (z-f*f)/(s+f) is the correction term
+ *     for f so that f+c ~ sqrt(z).
+ * For x<-0.5
+ *	acos(x) = pi - 2asin(sqrt((1-|x|)/2))
+ *		= pi - 0.5*(s+s*z*R(z)), where z=(1-|x|)/2,s=sqrt(z)
+ *
+ * Special cases:
+ *	if x is NaN, return x itself;
+ *	if |x|>1, return NaN with invalid signal.
+ *
+ * Function needed: sqrt
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double 
+#else
+static double 
+#endif
+one=  1.00000000000000000000e+00, /* 0x3FF00000, 0x00000000 */
+pi =  3.14159265358979311600e+00, /* 0x400921FB, 0x54442D18 */
+pio2_hi =  1.57079632679489655800e+00, /* 0x3FF921FB, 0x54442D18 */
+pio2_lo =  6.12323399573676603587e-17, /* 0x3C91A626, 0x33145C07 */
+pS0 =  1.66666666666666657415e-01, /* 0x3FC55555, 0x55555555 */
+pS1 = -3.25565818622400915405e-01, /* 0xBFD4D612, 0x03EB6F7D */
+pS2 =  2.01212532134862925881e-01, /* 0x3FC9C155, 0x0E884455 */
+pS3 = -4.00555345006794114027e-02, /* 0xBFA48228, 0xB5688F3B */
+pS4 =  7.91534994289814532176e-04, /* 0x3F49EFE0, 0x7501B288 */
+pS5 =  3.47933107596021167570e-05, /* 0x3F023DE1, 0x0DFDF709 */
+qS1 = -2.40339491173441421878e+00, /* 0xC0033A27, 0x1C8A2D4B */
+qS2 =  2.02094576023350569471e+00, /* 0x40002AE5, 0x9C598AC8 */
+qS3 = -6.88283971605453293030e-01, /* 0xBFE6066C, 0x1B8D0159 */
+qS4 =  7.70381505559019352791e-02; /* 0x3FB3B8C5, 0xB12E9282 */
+
+#ifdef __STDC__
+	double __ieee754_acos(double x)
+#else
+	double __ieee754_acos(x)
+	double x;
+#endif
+{
+	double z,p,q,r,w,s,c,df;
+	int hx,ix;
+	hx = __HI(x);
+	ix = hx&0x7fffffff;
+	if(ix>=0x3ff00000) {	/* |x| >= 1 */
+	    if(((ix-0x3ff00000)|__LO(x))==0) {	/* |x|==1 */
+		if(hx>0) return 0.0;		/* acos(1) = 0  */
+		else return pi+2.0*pio2_lo;	/* acos(-1)= pi */
+	    }
+	    return (x-x)/(x-x);		/* acos(|x|>1) is NaN */
+	}
+	if(ix<0x3fe00000) {	/* |x| < 0.5 */
+	    if(ix<=0x3c600000) return pio2_hi+pio2_lo;/*if|x|<2**-57*/
+	    z = x*x;
+	    p = z*(pS0+z*(pS1+z*(pS2+z*(pS3+z*(pS4+z*pS5)))));
+	    q = one+z*(qS1+z*(qS2+z*(qS3+z*qS4)));
+	    r = p/q;
+	    return pio2_hi - (x - (pio2_lo-x*r));
+	} else  if (hx<0) {		/* x < -0.5 */
+	    z = (one+x)*0.5;
+	    p = z*(pS0+z*(pS1+z*(pS2+z*(pS3+z*(pS4+z*pS5)))));
+	    q = one+z*(qS1+z*(qS2+z*(qS3+z*qS4)));
+	    s = fd_sqrt(z);
+	    r = p/q;
+	    w = r*s-pio2_lo;
+	    return pi - 2.0*(s+w);
+	} else {			/* x > 0.5 */
+	    z = (one-x)*0.5;
+	    s = fd_sqrt(z);
+	    df = s;
+	    __LO(df) = 0;
+	    c  = (z-df*df)/(s+df);
+	    p = z*(pS0+z*(pS1+z*(pS2+z*(pS3+z*(pS4+z*pS5)))));
+	    q = one+z*(qS1+z*(qS2+z*(qS3+z*qS4)));
+	    r = p/q;
+	    w = r*s+c;
+	    return 2.0*(df+w);
+	}
+}

mozilla/js/ref/fdlibm/e_acosh.c

@@ -0,0 +1,81 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public License
+ * Version 1.0 (the "NPL"); you may not use this file except in
+ * compliance with the NPL.  You may obtain a copy of the NPL at
+ * http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the NPL is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+ * for the specific language governing rights and limitations under the
+ * NPL.
+ *
+ * The Initial Developer of this code under the NPL is Sun Microsystems,
+ * Inc.  Portions created by Netscape are Copyright (C) 1998 Netscape
+ * Communications Corporation.  All Rights Reserved.
+ */
+
+/* @(#)e_acosh.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ *
+ */
+
+/* __ieee754_acosh(x)
+ * Method :
+ *	Based on 
+ *		acosh(x) = log [ x + sqrt(x*x-1) ]
+ *	we have
+ *		acosh(x) := log(x)+ln2,	if x is large; else
+ *		acosh(x) := log(2x-1/(sqrt(x*x-1)+x)) if x>2; else
+ *		acosh(x) := log1p(t+sqrt(2.0*t+t*t)); where t=x-1.
+ *
+ * Special cases:
+ *	acosh(x) is NaN with signal if x<1.
+ *	acosh(NaN) is NaN without signal.
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double 
+#else
+static double 
+#endif
+one	= 1.0,
+ln2	= 6.93147180559945286227e-01;  /* 0x3FE62E42, 0xFEFA39EF */
+
+#ifdef __STDC__
+	double __ieee754_acosh(double x)
+#else
+	double __ieee754_acosh(x)
+	double x;
+#endif
+{	
+	double t;
+	int hx;
+	hx = __HI(x);
+	if(hx<0x3ff00000) {		/* x < 1 */
+	    return (x-x)/(x-x);
+	} else if(hx >=0x41b00000) {	/* x > 2**28 */
+	    if(hx >=0x7ff00000) {	/* x is inf of NaN */
+	        return x+x;
+	    } else 
+		return __ieee754_log(x)+ln2;	/* acosh(huge)=log(2x) */
+	} else if(((hx-0x3ff00000)|__LO(x))==0) {
+	    return 0.0;			/* acosh(1) = 0 */
+	} else if (hx > 0x40000000) {	/* 2**28 > x > 2 */
+	    t=x*x;
+	    return __ieee754_log(2.0*x-one/(x+fd_sqrt(t-one)));
+	} else {			/* 1<x<2 */
+	    t = x-one;
+	    return fd_log1p(t+fd_sqrt(2.0*t+t*t));
+	}
+}

mozilla/js/ref/fdlibm/e_asin.c

@@ -0,0 +1,130 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public License
+ * Version 1.0 (the "NPL"); you may not use this file except in
+ * compliance with the NPL.  You may obtain a copy of the NPL at
+ * http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the NPL is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+ * for the specific language governing rights and limitations under the
+ * NPL.
+ *
+ * The Initial Developer of this code under the NPL is Sun Microsystems,
+ * Inc.  Portions created by Netscape are Copyright (C) 1998 Netscape
+ * Communications Corporation.  All Rights Reserved.
+ */
+
+/* @(#)e_asin.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* __ieee754_asin(x)
+ * Method :                  
+ *	Since  asin(x) = x + x^3/6 + x^5*3/40 + x^7*15/336 + ...
+ *	we approximate asin(x) on [0,0.5] by
+ *		asin(x) = x + x*x^2*R(x^2)
+ *	where
+ *		R(x^2) is a rational approximation of (asin(x)-x)/x^3 
+ *	and its remez error is bounded by
+ *		|(asin(x)-x)/x^3 - R(x^2)| < 2^(-58.75)
+ *
+ *	For x in [0.5,1]
+ *		asin(x) = pi/2-2*asin(sqrt((1-x)/2))
+ *	Let y = (1-x), z = y/2, s := sqrt(z), and pio2_hi+pio2_lo=pi/2;
+ *	then for x>0.98
+ *		asin(x) = pi/2 - 2*(s+s*z*R(z))
+ *			= pio2_hi - (2*(s+s*z*R(z)) - pio2_lo)
+ *	For x<=0.98, let pio4_hi = pio2_hi/2, then
+ *		f = hi part of s;
+ *		c = sqrt(z) - f = (z-f*f)/(s+f) 	...f+c=sqrt(z)
+ *	and
+ *		asin(x) = pi/2 - 2*(s+s*z*R(z))
+ *			= pio4_hi+(pio4-2s)-(2s*z*R(z)-pio2_lo)
+ *			= pio4_hi+(pio4-2f)-(2s*z*R(z)-(pio2_lo+2c))
+ *
+ * Special cases:
+ *	if x is NaN, return x itself;
+ *	if |x|>1, return NaN with invalid signal.
+ *
+ */
+
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double 
+#else
+static double 
+#endif
+one =  1.00000000000000000000e+00, /* 0x3FF00000, 0x00000000 */
+huge =  1.000e+300,
+pio2_hi =  1.57079632679489655800e+00, /* 0x3FF921FB, 0x54442D18 */
+pio2_lo =  6.12323399573676603587e-17, /* 0x3C91A626, 0x33145C07 */
+pio4_hi =  7.85398163397448278999e-01, /* 0x3FE921FB, 0x54442D18 */
+	/* coefficient for R(x^2) */
+pS0 =  1.66666666666666657415e-01, /* 0x3FC55555, 0x55555555 */
+pS1 = -3.25565818622400915405e-01, /* 0xBFD4D612, 0x03EB6F7D */
+pS2 =  2.01212532134862925881e-01, /* 0x3FC9C155, 0x0E884455 */
+pS3 = -4.00555345006794114027e-02, /* 0xBFA48228, 0xB5688F3B */
+pS4 =  7.91534994289814532176e-04, /* 0x3F49EFE0, 0x7501B288 */
+pS5 =  3.47933107596021167570e-05, /* 0x3F023DE1, 0x0DFDF709 */
+qS1 = -2.40339491173441421878e+00, /* 0xC0033A27, 0x1C8A2D4B */
+qS2 =  2.02094576023350569471e+00, /* 0x40002AE5, 0x9C598AC8 */
+qS3 = -6.88283971605453293030e-01, /* 0xBFE6066C, 0x1B8D0159 */
+qS4 =  7.70381505559019352791e-02; /* 0x3FB3B8C5, 0xB12E9282 */
+
+#ifdef __STDC__
+	double __ieee754_asin(double x)
+#else
+	double __ieee754_asin(x)
+	double x;
+#endif
+{
+	double t,w,p,q,c,r,s;
+	int hx,ix;
+	hx = __HI(x);
+	ix = hx&0x7fffffff;
+	if(ix>= 0x3ff00000) {		/* |x|>= 1 */
+	    if(((ix-0x3ff00000)|__LO(x))==0)
+		    /* asin(1)=+-pi/2 with inexact */
+		return x*pio2_hi+x*pio2_lo;	
+	    return (x-x)/(x-x);		/* asin(|x|>1) is NaN */   
+	} else if (ix<0x3fe00000) {	/* |x|<0.5 */
+	    if(ix<0x3e400000) {		/* if |x| < 2**-27 */
+		if(huge+x>one) return x;/* return x with inexact if x!=0*/
+	    } else 
+		t = x*x;
+		p = t*(pS0+t*(pS1+t*(pS2+t*(pS3+t*(pS4+t*pS5)))));
+		q = one+t*(qS1+t*(qS2+t*(qS3+t*qS4)));
+		w = p/q;
+		return x+x*w;
+	}
+	/* 1> |x|>= 0.5 */
+	w = one-fd_fabs(x);
+	t = w*0.5;
+	p = t*(pS0+t*(pS1+t*(pS2+t*(pS3+t*(pS4+t*pS5)))));
+	q = one+t*(qS1+t*(qS2+t*(qS3+t*qS4)));
+	s = fd_sqrt(t);
+	if(ix>=0x3FEF3333) { 	/* if |x| > 0.975 */
+	    w = p/q;
+	    t = pio2_hi-(2.0*(s+s*w)-pio2_lo);
+	} else {
+	    w  = s;
+	    __LO(w) = 0;
+	    c  = (t-w*w)/(s+w);
+	    r  = p/q;
+	    p  = 2.0*s*r-(pio2_lo-2.0*c);
+	    q  = pio4_hi-2.0*w;
+	    t  = pio4_hi-(p-q);
+	}    
+	if(hx>0) return t; else return -t;    
+}

mozilla/js/ref/fdlibm/e_atan2.c

@@ -0,0 +1,139 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public License
+ * Version 1.0 (the "NPL"); you may not use this file except in
+ * compliance with the NPL.  You may obtain a copy of the NPL at
+ * http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the NPL is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+ * for the specific language governing rights and limitations under the
+ * NPL.
+ *
+ * The Initial Developer of this code under the NPL is Sun Microsystems,
+ * Inc.  Portions created by Netscape are Copyright (C) 1998 Netscape
+ * Communications Corporation.  All Rights Reserved.
+ */
+
+/* @(#)e_atan2.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ *
+ */
+
+/* __ieee754_atan2(y,x)
+ * Method :
+ *	1. Reduce y to positive by atan2(y,x)=-atan2(-y,x).
+ *	2. Reduce x to positive by (if x and y are unexceptional): 
+ *		ARG (x+iy) = arctan(y/x)   	   ... if x > 0,
+ *		ARG (x+iy) = pi - arctan[y/(-x)]   ... if x < 0,
+ *
+ * Special cases:
+ *
+ *	ATAN2((anything), NaN ) is NaN;
+ *	ATAN2(NAN , (anything) ) is NaN;
+ *	ATAN2(+-0, +(anything but NaN)) is +-0  ;
+ *	ATAN2(+-0, -(anything but NaN)) is +-pi ;
+ *	ATAN2(+-(anything but 0 and NaN), 0) is +-pi/2;
+ *	ATAN2(+-(anything but INF and NaN), +INF) is +-0 ;
+ *	ATAN2(+-(anything but INF and NaN), -INF) is +-pi;
+ *	ATAN2(+-INF,+INF ) is +-pi/4 ;
+ *	ATAN2(+-INF,-INF ) is +-3pi/4;
+ *	ATAN2(+-INF, (anything but,0,NaN, and INF)) is +-pi/2;
+ *
+ * Constants:
+ * The hexadecimal values are the intended ones for the following 
+ * constants. The decimal values may be used, provided that the 
+ * compiler will convert from decimal to binary accurately enough 
+ * to produce the hexadecimal values shown.
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double 
+#else
+static double 
+#endif
+tiny  = 1.0e-300,
+zero  = 0.0,
+pi_o_4  = 7.8539816339744827900E-01, /* 0x3FE921FB, 0x54442D18 */
+pi_o_2  = 1.5707963267948965580E+00, /* 0x3FF921FB, 0x54442D18 */
+pi      = 3.1415926535897931160E+00, /* 0x400921FB, 0x54442D18 */
+pi_lo   = 1.2246467991473531772E-16; /* 0x3CA1A626, 0x33145C07 */
+
+#ifdef __STDC__
+	double __ieee754_atan2(double y, double x)
+#else
+	double __ieee754_atan2(y,x)
+	double  y,x;
+#endif
+{  
+	double z;
+	int k,m,hx,hy,ix,iy;
+	unsigned lx,ly;
+
+	hx = __HI(x); ix = hx&0x7fffffff;
+	lx = __LO(x);
+	hy = __HI(y); iy = hy&0x7fffffff;
+	ly = __LO(y);
+	if(((ix|((lx|-(int)lx)>>31))>0x7ff00000)||
+	   ((iy|((ly|-(int)ly)>>31))>0x7ff00000))	/* x or y is NaN */
+	   return x+y;
+	if((hx-0x3ff00000|lx)==0) return fd_atan(y);   /* x=1.0 */
+	m = ((hy>>31)&1)|((hx>>30)&2);	/* 2*sign(x)+sign(y) */
+
+    /* when y = 0 */
+	if((iy|ly)==0) {
+	    switch(m) {
+		case 0: 
+		case 1: return y; 	/* atan(+-0,+anything)=+-0 */
+		case 2: return  pi+tiny;/* atan(+0,-anything) = pi */
+		case 3: return -pi-tiny;/* atan(-0,-anything) =-pi */
+	    }
+	}
+    /* when x = 0 */
+	if((ix|lx)==0) return (hy<0)?  -pi_o_2-tiny: pi_o_2+tiny;
+	    
+    /* when x is INF */
+	if(ix==0x7ff00000) {
+	    if(iy==0x7ff00000) {
+		switch(m) {
+		    case 0: return  pi_o_4+tiny;/* atan(+INF,+INF) */
+		    case 1: return -pi_o_4-tiny;/* atan(-INF,+INF) */
+		    case 2: return  3.0*pi_o_4+tiny;/*atan(+INF,-INF)*/
+		    case 3: return -3.0*pi_o_4-tiny;/*atan(-INF,-INF)*/
+		}
+	    } else {
+		switch(m) {
+		    case 0: return  zero  ;	/* atan(+...,+INF) */
+		    case 1: return -zero  ;	/* atan(-...,+INF) */
+		    case 2: return  pi+tiny  ;	/* atan(+...,-INF) */
+		    case 3: return -pi-tiny  ;	/* atan(-...,-INF) */
+		}
+	    }
+	}
+    /* when y is INF */
+	if(iy==0x7ff00000) return (hy<0)? -pi_o_2-tiny: pi_o_2+tiny;
+
+    /* compute y/x */
+	k = (iy-ix)>>20;
+	if(k > 60) z=pi_o_2+0.5*pi_lo; 	/* |y/x| >  2**60 */
+	else if(hx<0&&k<-60) z=0.0; 	/* |y|/x < -2**60 */
+	else z=fd_atan(fd_fabs(y/x));		/* safe to do y/x */
+	switch (m) {
+	    case 0: return       z  ;	/* atan(+,+) */
+	    case 1: __HI(z) ^= 0x80000000;
+		    return       z  ;	/* atan(-,+) */
+	    case 2: return  pi-(z-pi_lo);/* atan(+,-) */
+	    default: /* case 3 */
+	    	    return  (z-pi_lo)-pi;/* atan(-,-) */
+	}
+}

mozilla/js/ref/fdlibm/e_atanh.c

@@ -0,0 +1,84 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public License
+ * Version 1.0 (the "NPL"); you may not use this file except in
+ * compliance with the NPL.  You may obtain a copy of the NPL at
+ * http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the NPL is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+ * for the specific language governing rights and limitations under the
+ * NPL.
+ *
+ * The Initial Developer of this code under the NPL is Sun Microsystems,
+ * Inc.  Portions created by Netscape are Copyright (C) 1998 Netscape
+ * Communications Corporation.  All Rights Reserved.
+ */
+
+/* @(#)e_atanh.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ *
+ */
+
+/* __ieee754_atanh(x)
+ * Method :
+ *    1.Reduced x to positive by atanh(-x) = -atanh(x)
+ *    2.For x>=0.5
+ *                  1              2x                          x
+ *	atanh(x) = --- * log(1 + -------) = 0.5 * log1p(2 * --------)
+ *                  2             1 - x                      1 - x
+ *	
+ * 	For x<0.5
+ *	atanh(x) = 0.5*log1p(2x+2x*x/(1-x))
+ *
+ * Special cases:
+ *	atanh(x) is NaN if |x| > 1 with signal;
+ *	atanh(NaN) is that NaN with no signal;
+ *	atanh(+-1) is +-INF with signal.
+ *
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double one = 1.0, huge = 1e300;
+#else
+static double one = 1.0, huge = 1e300;
+#endif
+
+static double zero = 0.0;
+
+#ifdef __STDC__
+	double __ieee754_atanh(double x)
+#else
+	double __ieee754_atanh(x)
+	double x;
+#endif
+{
+	double t;
+	int hx,ix;
+	unsigned lx;
+	hx = __HI(x);		/* high word */
+	lx = __LO(x);		/* low word */
+	ix = hx&0x7fffffff;
+	if ((ix|((lx|(-(int)lx))>>31))>0x3ff00000) /* |x|>1 */
+	    return (x-x)/(x-x);
+	if(ix==0x3ff00000) 
+	    return x/zero;
+	if(ix<0x3e300000&&(huge+x)>zero) return x;	/* x<2**-28 */
+	__HI(x) = ix;		/* x <- |x| */
+	if(ix<0x3fe00000) {		/* x < 0.5 */
+	    t = x+x;
+	    t = 0.5*fd_log1p(t+t*x/(one-x));
+	} else 
+	    t = 0.5*fd_log1p((x+x)/(one-x));
+	if(hx>=0) return t; else return -t;
+}

mozilla/js/ref/fdlibm/e_cosh.c

@@ -0,0 +1,109 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public License
+ * Version 1.0 (the "NPL"); you may not use this file except in
+ * compliance with the NPL.  You may obtain a copy of the NPL at
+ * http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the NPL is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+ * for the specific language governing rights and limitations under the
+ * NPL.
+ *
+ * The Initial Developer of this code under the NPL is Sun Microsystems,
+ * Inc.  Portions created by Netscape are Copyright (C) 1998 Netscape
+ * Communications Corporation.  All Rights Reserved.
+ */
+
+/* @(#)e_cosh.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* __ieee754_cosh(x)
+ * Method : 
+ * mathematically cosh(x) if defined to be (exp(x)+exp(-x))/2
+ *	1. Replace x by |x| (cosh(x) = cosh(-x)). 
+ *	2. 
+ *		                                        [ exp(x) - 1 ]^2 
+ *	    0        <= x <= ln2/2  :  cosh(x) := 1 + -------------------
+ *			       			           2*exp(x)
+ *
+ *		                                  exp(x) +  1/exp(x)
+ *	    ln2/2    <= x <= 22     :  cosh(x) := -------------------
+ *			       			          2
+ *	    22       <= x <= lnovft :  cosh(x) := exp(x)/2 
+ *	    lnovft   <= x <= ln2ovft:  cosh(x) := exp(x/2)/2 * exp(x/2)
+ *	    ln2ovft  <  x	    :  cosh(x) := huge*huge (overflow)
+ *
+ * Special cases:
+ *	cosh(x) is |x| if x is +INF, -INF, or NaN.
+ *	only cosh(0)=1 is exact for finite x.
+ */
+
+#include "fdlibm.h"
+
+#ifdef _WIN32
+#define huge myhuge
+#endif
+
+#ifdef __STDC__
+static const double one = 1.0, half=0.5, huge = 1.0e300;
+#else
+static double one = 1.0, half=0.5, huge = 1.0e300;
+#endif
+
+#ifdef __STDC__
+	double __ieee754_cosh(double x)
+#else
+	double __ieee754_cosh(x)
+	double x;
+#endif
+{	
+	double t,w;
+	int ix;
+	unsigned lx;
+
+    /* High word of |x|. */
+	ix = __HI(x);
+	ix &= 0x7fffffff;
+
+    /* x is INF or NaN */
+	if(ix>=0x7ff00000) return x*x;	
+
+    /* |x| in [0,0.5*ln2], return 1+expm1(|x|)^2/(2*exp(|x|)) */
+	if(ix<0x3fd62e43) {
+	    t = fd_expm1(fd_fabs(x));
+	    w = one+t;
+	    if (ix<0x3c800000) return w;	/* cosh(tiny) = 1 */
+	    return one+(t*t)/(w+w);
+	}
+
+    /* |x| in [0.5*ln2,22], return (exp(|x|)+1/exp(|x|)/2; */
+	if (ix < 0x40360000) {
+		t = __ieee754_exp(fd_fabs(x));
+		return half*t+half/t;
+	}
+
+    /* |x| in [22, log(maxdouble)] return half*exp(|x|) */
+	if (ix < 0x40862E42)  return half*__ieee754_exp(fd_fabs(x));
+
+    /* |x| in [log(maxdouble), overflowthresold] */
+	lx = *( (((*(unsigned*)&one)>>29)) + (unsigned*)&x);
+	if (ix<0x408633CE || 
+	      (ix==0x408633ce)&&(lx<=(unsigned)0x8fb9f87d)) {
+	    w = __ieee754_exp(half*fd_fabs(x));
+	    t = half*w;
+	    return t*w;
+	}
+
+    /* |x| > overflowthresold, cosh(x) overflow */
+	return huge*huge;
+}

mozilla/js/ref/fdlibm/e_exp.c

@@ -0,0 +1,173 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public License
+ * Version 1.0 (the "NPL"); you may not use this file except in
+ * compliance with the NPL.  You may obtain a copy of the NPL at
+ * http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the NPL is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+ * for the specific language governing rights and limitations under the
+ * NPL.
+ *
+ * The Initial Developer of this code under the NPL is Sun Microsystems,
+ * Inc.  Portions created by Netscape are Copyright (C) 1998 Netscape
+ * Communications Corporation.  All Rights Reserved.
+ */
+
+/* @(#)e_exp.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* __ieee754_exp(x)
+ * Returns the exponential of x.
+ *
+ * Method
+ *   1. Argument reduction:
+ *      Reduce x to an r so that |r| <= 0.5*ln2 ~ 0.34658.
+ *	Given x, find r and integer k such that
+ *
+ *               x = k*ln2 + r,  |r| <= 0.5*ln2.  
+ *
+ *      Here r will be represented as r = hi-lo for better 
+ *	accuracy.
+ *
+ *   2. Approximation of exp(r) by a special rational function on
+ *	the interval [0,0.34658]:
+ *	Write
+ *	    R(r**2) = r*(exp(r)+1)/(exp(r)-1) = 2 + r*r/6 - r**4/360 + ...
+ *      We use a special Reme algorithm on [0,0.34658] to generate 
+ * 	a polynomial of degree 5 to approximate R. The maximum error 
+ *	of this polynomial approximation is bounded by 2**-59. In
+ *	other words,
+ *	    R(z) ~ 2.0 + P1*z + P2*z**2 + P3*z**3 + P4*z**4 + P5*z**5
+ *  	(where z=r*r, and the values of P1 to P5 are listed below)
+ *	and
+ *	    |                  5          |     -59
+ *	    | 2.0+P1*z+...+P5*z   -  R(z) | <= 2 
+ *	    |                             |
+ *	The computation of exp(r) thus becomes
+ *                             2*r
+ *		exp(r) = 1 + -------
+ *		              R - r
+ *                                 r*R1(r)	
+ *		       = 1 + r + ----------- (for better accuracy)
+ *		                  2 - R1(r)
+ *	where
+ *			         2       4             10
+ *		R1(r) = r - (P1*r  + P2*r  + ... + P5*r   ).
+ *	
+ *   3. Scale back to obtain exp(x):
+ *	From step 1, we have
+ *	   exp(x) = 2^k * exp(r)
+ *
+ * Special cases:
+ *	exp(INF) is INF, exp(NaN) is NaN;
+ *	exp(-INF) is 0, and
+ *	for finite argument, only exp(0)=1 is exact.
+ *
+ * Accuracy:
+ *	according to an error analysis, the error is always less than
+ *	1 ulp (unit in the last place).
+ *
+ * Misc. info.
+ *	For IEEE double 
+ *	    if x >  7.09782712893383973096e+02 then exp(x) overflow
+ *	    if x < -7.45133219101941108420e+02 then exp(x) underflow
+ *
+ * Constants:
+ * The hexadecimal values are the intended ones for the following 
+ * constants. The decimal values may be used, provided that the 
+ * compiler will convert from decimal to binary accurately enough
+ * to produce the hexadecimal values shown.
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double
+#else
+static double
+#endif
+one	= 1.0,
+halF[2]	= {0.5,-0.5,},
+huge	= 1.0e+300,
+twom1000= 9.33263618503218878990e-302,     /* 2**-1000=0x01700000,0*/
+o_threshold=  7.09782712893383973096e+02,  /* 0x40862E42, 0xFEFA39EF */
+u_threshold= -7.45133219101941108420e+02,  /* 0xc0874910, 0xD52D3051 */
+ln2HI[2]   ={ 6.93147180369123816490e-01,  /* 0x3fe62e42, 0xfee00000 */
+	     -6.93147180369123816490e-01,},/* 0xbfe62e42, 0xfee00000 */
+ln2LO[2]   ={ 1.90821492927058770002e-10,  /* 0x3dea39ef, 0x35793c76 */
+	     -1.90821492927058770002e-10,},/* 0xbdea39ef, 0x35793c76 */
+invln2 =  1.44269504088896338700e+00, /* 0x3ff71547, 0x652b82fe */
+P1   =  1.66666666666666019037e-01, /* 0x3FC55555, 0x5555553E */
+P2   = -2.77777777770155933842e-03, /* 0xBF66C16C, 0x16BEBD93 */
+P3   =  6.61375632143793436117e-05, /* 0x3F11566A, 0xAF25DE2C */
+P4   = -1.65339022054652515390e-06, /* 0xBEBBBD41, 0xC5D26BF1 */
+P5   =  4.13813679705723846039e-08; /* 0x3E663769, 0x72BEA4D0 */
+
+
+#ifdef __STDC__
+	double __ieee754_exp(double x)	/* default IEEE double exp */
+#else
+	double __ieee754_exp(x)	/* default IEEE double exp */
+	double x;
+#endif
+{
+	double y,hi,lo,c,t;
+	int k,xsb;
+	unsigned hx;
+
+	hx  = __HI(x);	/* high word of x */
+	xsb = (hx>>31)&1;		/* sign bit of x */
+	hx &= 0x7fffffff;		/* high word of |x| */
+
+    /* filter out non-finite argument */
+	if(hx >= 0x40862E42) {			/* if |x|>=709.78... */
+            if(hx>=0x7ff00000) {
+		if(((hx&0xfffff)|__LO(x))!=0) 
+		     return x+x; 		/* NaN */
+		else return (xsb==0)? x:0.0;	/* exp(+-inf)={inf,0} */
+	    }
+	    if(x > o_threshold) return huge*huge; /* overflow */
+	    if(x < u_threshold) return twom1000*twom1000; /* underflow */
+	}
+
+    /* argument reduction */
+	if(hx > 0x3fd62e42) {		/* if  |x| > 0.5 ln2 */ 
+	    if(hx < 0x3FF0A2B2) {	/* and |x| < 1.5 ln2 */
+		hi = x-ln2HI[xsb]; lo=ln2LO[xsb]; k = 1-xsb-xsb;
+	    } else {
+		k  = (int)(invln2*x+halF[xsb]);
+		t  = k;
+		hi = x - t*ln2HI[0];	/* t*ln2HI is exact here */
+		lo = t*ln2LO[0];
+	    }
+	    x  = hi - lo;
+	} 
+	else if(hx < 0x3e300000)  {	/* when |x|<2**-28 */
+	    if(huge+x>one) return one+x;/* trigger inexact */
+	}
+	else k = 0;
+
+    /* x is now in primary range */
+	t  = x*x;
+	c  = x - t*(P1+t*(P2+t*(P3+t*(P4+t*P5))));
+	if(k==0) 	return one-((x*c)/(c-2.0)-x); 
+	else 		y = one-((lo-(x*c)/(2.0-c))-hi);
+	if(k >= -1021) {
+	    __HI(y) += (k<<20);	/* add k to y's exponent */
+	    return y;
+	} else {
+	    __HI(y) += ((k+1000)<<20);/* add k to y's exponent */
+	    return y*twom1000;
+	}
+}

mozilla/js/ref/fdlibm/e_fmod.c

@@ -0,0 +1,156 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public License
+ * Version 1.0 (the "NPL"); you may not use this file except in
+ * compliance with the NPL.  You may obtain a copy of the NPL at
+ * http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the NPL is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+ * for the specific language governing rights and limitations under the
+ * NPL.
+ *
+ * The Initial Developer of this code under the NPL is Sun Microsystems,
+ * Inc.  Portions created by Netscape are Copyright (C) 1998 Netscape
+ * Communications Corporation.  All Rights Reserved.
+ */
+
+/* @(#)e_fmod.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* 
+ * __ieee754_fmod(x,y)
+ * Return x mod y in exact arithmetic
+ * Method: shift and subtract
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double one = 1.0, Zero[] = {0.0, -0.0,};
+#else
+static double one = 1.0, Zero[] = {0.0, -0.0,};
+#endif
+
+#ifdef __STDC__
+	double __ieee754_fmod(double x, double y)
+#else
+	double __ieee754_fmod(x,y)
+	double x,y ;
+#endif
+{
+	int n,hx,hy,hz,ix,iy,sx,i;
+	unsigned lx,ly,lz;
+
+	hx = __HI(x);		/* high word of x */
+	lx = __LO(x);		/* low  word of x */
+	hy = __HI(y);		/* high word of y */
+	ly = __LO(y);		/* low  word of y */
+	sx = hx&0x80000000;		/* sign of x */
+	hx ^=sx;		/* |x| */
+	hy &= 0x7fffffff;	/* |y| */
+
+    /* purge off exception values */
+	if((hy|ly)==0||(hx>=0x7ff00000)||	/* y=0,or x not finite */
+	  ((hy|((ly|-(int)ly)>>31))>0x7ff00000))	/* or y is NaN */
+	    return (x*y)/(x*y);
+	if(hx<=hy) {
+	    if((hx<hy)||(lx<ly)) return x;	/* |x|<|y| return x */
+	    if(lx==ly) 
+		return Zero[(unsigned)sx>>31];	/* |x|=|y| return x*0*/
+	}
+
+    /* determine ix = ilogb(x) */
+	if(hx<0x00100000) {	/* subnormal x */
+	    if(hx==0) {
+		for (ix = -1043, i=lx; i>0; i<<=1) ix -=1;
+	    } else {
+		for (ix = -1022,i=(hx<<11); i>0; i<<=1) ix -=1;
+	    }
+	} else ix = (hx>>20)-1023;
+
+    /* determine iy = ilogb(y) */
+	if(hy<0x00100000) {	/* subnormal y */
+	    if(hy==0) {
+		for (iy = -1043, i=ly; i>0; i<<=1) iy -=1;
+	    } else {
+		for (iy = -1022,i=(hy<<11); i>0; i<<=1) iy -=1;
+	    }
+	} else iy = (hy>>20)-1023;
+
+    /* set up {hx,lx}, {hy,ly} and align y to x */
+	if(ix >= -1022) 
+	    hx = 0x00100000|(0x000fffff&hx);
+	else {		/* subnormal x, shift x to normal */
+	    n = -1022-ix;
+	    if(n<=31) {
+	        hx = (hx<<n)|(lx>>(32-n));
+	        lx <<= n;
+	    } else {
+		hx = lx<<(n-32);
+		lx = 0;
+	    }
+	}
+	if(iy >= -1022) 
+	    hy = 0x00100000|(0x000fffff&hy);
+	else {		/* subnormal y, shift y to normal */
+	    n = -1022-iy;
+	    if(n<=31) {
+	        hy = (hy<<n)|(ly>>(32-n));
+	        ly <<= n;
+	    } else {
+		hy = ly<<(n-32);
+		ly = 0;
+	    }
+	}
+
+    /* fix point fmod */
+	n = ix - iy;
+	while(n--) {
+	    hz=hx-hy;lz=lx-ly; if(lx<ly) hz -= 1;
+	    if(hz<0){hx = hx+hx+(lx>>31); lx = lx+lx;}
+	    else {
+	    	if((hz|lz)==0) 		/* return sign(x)*0 */
+		    return Zero[(unsigned)sx>>31];
+	    	hx = hz+hz+(lz>>31); lx = lz+lz;
+	    }
+	}
+	hz=hx-hy;lz=lx-ly; if(lx<ly) hz -= 1;
+	if(hz>=0) {hx=hz;lx=lz;}
+
+    /* convert back to floating value and restore the sign */
+	if((hx|lx)==0) 			/* return sign(x)*0 */
+	    return Zero[(unsigned)sx>>31];	
+	while(hx<0x00100000) {		/* normalize x */
+	    hx = hx+hx+(lx>>31); lx = lx+lx;
+	    iy -= 1;
+	}
+	if(iy>= -1022) {	/* normalize output */
+	    hx = ((hx-0x00100000)|((iy+1023)<<20));
+	    __HI(x) = hx|sx;
+	    __LO(x) = lx;
+	} else {		/* subnormal output */
+	    n = -1022 - iy;
+	    if(n<=20) {
+		lx = (lx>>n)|((unsigned)hx<<(32-n));
+		hx >>= n;
+	    } else if (n<=31) {
+		lx = (hx<<(32-n))|(lx>>n); hx = sx;
+	    } else {
+		lx = hx>>(n-32); hx = sx;
+	    }
+	    __HI(x) = hx|sx;
+	    __LO(x) = lx;
+	    x *= one;		/* create necessary signal */
+	}
+	return x;		/* exact output */
+}

mozilla/js/ref/fdlibm/e_gamma.c

@@ -0,0 +1,49 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public License
+ * Version 1.0 (the "NPL"); you may not use this file except in
+ * compliance with the NPL.  You may obtain a copy of the NPL at
+ * http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the NPL is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+ * for the specific language governing rights and limitations under the
+ * NPL.
+ *
+ * The Initial Developer of this code under the NPL is Sun Microsystems,
+ * Inc.  Portions created by Netscape are Copyright (C) 1998 Netscape
+ * Communications Corporation.  All Rights Reserved.
+ */
+
+/* @(#)e_gamma.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ *
+ */
+
+/* __ieee754_gamma(x)
+ * Return the logarithm of the Gamma function of x.
+ *
+ * Method: call __ieee754_gamma_r
+ */
+
+#include "fdlibm.h"
+
+extern int signgam;
+
+#ifdef __STDC__
+	double __ieee754_gamma(double x)
+#else
+	double __ieee754_gamma(x)
+	double x;
+#endif
+{
+	return __ieee754_gamma_r(x,&signgam);
+}

mozilla/js/ref/fdlibm/e_gamma_r.c

@@ -0,0 +1,48 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public License
+ * Version 1.0 (the "NPL"); you may not use this file except in
+ * compliance with the NPL.  You may obtain a copy of the NPL at
+ * http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the NPL is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+ * for the specific language governing rights and limitations under the
+ * NPL.
+ *
+ * The Initial Developer of this code under the NPL is Sun Microsystems,
+ * Inc.  Portions created by Netscape are Copyright (C) 1998 Netscape
+ * Communications Corporation.  All Rights Reserved.
+ */
+
+/* @(#)e_gamma_r.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ *
+ */
+
+/* __ieee754_gamma_r(x, signgamp)
+ * Reentrant version of the logarithm of the Gamma function 
+ * with user provide pointer for the sign of Gamma(x). 
+ *
+ * Method: See __ieee754_lgamma_r
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+	double __ieee754_gamma_r(double x, int *signgamp)
+#else
+	double __ieee754_gamma_r(x,signgamp)
+	double x; int *signgamp;
+#endif
+{
+	return __ieee754_lgamma_r(x,signgamp);
+}

mozilla/js/ref/fdlibm/e_hypot.c

@@ -0,0 +1,131 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public License
+ * Version 1.0 (the "NPL"); you may not use this file except in
+ * compliance with the NPL.  You may obtain a copy of the NPL at
+ * http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the NPL is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+ * for the specific language governing rights and limitations under the
+ * NPL.
+ *
+ * The Initial Developer of this code under the NPL is Sun Microsystems,
+ * Inc.  Portions created by Netscape are Copyright (C) 1998 Netscape
+ * Communications Corporation.  All Rights Reserved.
+ */
+
+/* @(#)e_hypot.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* __ieee754_hypot(x,y)
+ *
+ * Method :                  
+ *	If (assume round-to-nearest) z=x*x+y*y 
+ *	has error less than sqrt(2)/2 ulp, than 
+ *	sqrt(z) has error less than 1 ulp (exercise).
+ *
+ *	So, compute sqrt(x*x+y*y) with some care as 
+ *	follows to get the error below 1 ulp:
+ *
+ *	Assume x>y>0;
+ *	(if possible, set rounding to round-to-nearest)
+ *	1. if x > 2y  use
+ *		x1*x1+(y*y+(x2*(x+x1))) for x*x+y*y
+ *	where x1 = x with lower 32 bits cleared, x2 = x-x1; else
+ *	2. if x <= 2y use
+ *		t1*y1+((x-y)*(x-y)+(t1*y2+t2*y))
+ *	where t1 = 2x with lower 32 bits cleared, t2 = 2x-t1, 
+ *	y1= y with lower 32 bits chopped, y2 = y-y1.
+ *		
+ *	NOTE: scaling may be necessary if some argument is too 
+ *	      large or too tiny
+ *
+ * Special cases:
+ *	hypot(x,y) is INF if x or y is +INF or -INF; else
+ *	hypot(x,y) is NAN if x or y is NAN.
+ *
+ * Accuracy:
+ * 	hypot(x,y) returns sqrt(x^2+y^2) with error less 
+ * 	than 1 ulps (units in the last place) 
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+	double __ieee754_hypot(double x, double y)
+#else
+	double __ieee754_hypot(x,y)
+	double x, y;
+#endif
+{
+	double a=x,b=y,t1,t2,y1,y2,w;
+	int j,k,ha,hb;
+
+	ha = __HI(x)&0x7fffffff;	/* high word of  x */
+	hb = __HI(y)&0x7fffffff;	/* high word of  y */
+	if(hb > ha) {a=y;b=x;j=ha; ha=hb;hb=j;} else {a=x;b=y;}
+	__HI(a) = ha;	/* a <- |a| */
+	__HI(b) = hb;	/* b <- |b| */
+	if((ha-hb)>0x3c00000) {return a+b;} /* x/y > 2**60 */
+	k=0;
+	if(ha > 0x5f300000) {	/* a>2**500 */
+	   if(ha >= 0x7ff00000) {	/* Inf or NaN */
+	       w = a+b;			/* for sNaN */
+	       if(((ha&0xfffff)|__LO(a))==0) w = a;
+	       if(((hb^0x7ff00000)|__LO(b))==0) w = b;
+	       return w;
+	   }
+	   /* scale a and b by 2**-600 */
+	   ha -= 0x25800000; hb -= 0x25800000;	k += 600;
+	   __HI(a) = ha;
+	   __HI(b) = hb;
+	}
+	if(hb < 0x20b00000) {	/* b < 2**-500 */
+	    if(hb <= 0x000fffff) {	/* subnormal b or 0 */	
+		if((hb|(__LO(b)))==0) return a;
+		t1=0;
+		__HI(t1) = 0x7fd00000;	/* t1=2^1022 */
+		b *= t1;
+		a *= t1;
+		k -= 1022;
+	    } else {		/* scale a and b by 2^600 */
+	        ha += 0x25800000; 	/* a *= 2^600 */
+		hb += 0x25800000;	/* b *= 2^600 */
+		k -= 600;
+	   	__HI(a) = ha;
+	   	__HI(b) = hb;
+	    }
+	}
+    /* medium size a and b */
+	w = a-b;
+	if (w>b) {
+	    t1 = 0;
+	    __HI(t1) = ha;
+	    t2 = a-t1;
+	    w  = fd_sqrt(t1*t1-(b*(-b)-t2*(a+t1)));
+	} else {
+	    a  = a+a;
+	    y1 = 0;
+	    __HI(y1) = hb;
+	    y2 = b - y1;
+	    t1 = 0;
+	    __HI(t1) = ha+0x00100000;
+	    t2 = a - t1;
+	    w  = fd_sqrt(t1*y1-(w*(-w)-(t1*y2+t2*b)));
+	}
+	if(k!=0) {
+	    t1 = 1.0;
+	    __HI(t1) += (k<<20);
+	    return t1*w;
+	} else return w;
+}

mozilla/js/ref/fdlibm/e_j0.c

@@ -0,0 +1,494 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public License
+ * Version 1.0 (the "NPL"); you may not use this file except in
+ * compliance with the NPL.  You may obtain a copy of the NPL at
+ * http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the NPL is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+ * for the specific language governing rights and limitations under the
+ * NPL.
+ *
+ * The Initial Developer of this code under the NPL is Sun Microsystems,
+ * Inc.  Portions created by Netscape are Copyright (C) 1998 Netscape
+ * Communications Corporation.  All Rights Reserved.
+ */
+
+/* @(#)e_j0.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* __ieee754_j0(x), __ieee754_y0(x)
+ * Bessel function of the first and second kinds of order zero.
+ * Method -- j0(x):
+ *	1. For tiny x, we use j0(x) = 1 - x^2/4 + x^4/64 - ...
+ *	2. Reduce x to |x| since j0(x)=j0(-x),  and
+ *	   for x in (0,2)
+ *		j0(x) = 1-z/4+ z^2*R0/S0,  where z = x*x;
+ *	   (precision:  |j0-1+z/4-z^2R0/S0 |<2**-63.67 )
+ *	   for x in (2,inf)
+ * 		j0(x) = sqrt(2/(pi*x))*(p0(x)*cos(x0)-q0(x)*sin(x0))
+ * 	   where x0 = x-pi/4. It is better to compute sin(x0),cos(x0)
+ *	   as follow:
+ *		cos(x0) = cos(x)cos(pi/4)+sin(x)sin(pi/4)
+ *			= 1/sqrt(2) * (cos(x) + sin(x))
+ *		sin(x0) = sin(x)cos(pi/4)-cos(x)sin(pi/4)
+ *			= 1/sqrt(2) * (sin(x) - cos(x))
+ * 	   (To avoid cancellation, use
+ *		sin(x) +- cos(x) = -cos(2x)/(sin(x) -+ cos(x))
+ * 	    to compute the worse one.)
+ *	   
+ *	3 Special cases
+ *		j0(nan)= nan
+ *		j0(0) = 1
+ *		j0(inf) = 0
+ *		
+ * Method -- y0(x):
+ *	1. For x<2.
+ *	   Since 
+ *		y0(x) = 2/pi*(j0(x)*(ln(x/2)+Euler) + x^2/4 - ...)
+ *	   therefore y0(x)-2/pi*j0(x)*ln(x) is an even function.
+ *	   We use the following function to approximate y0,
+ *		y0(x) = U(z)/V(z) + (2/pi)*(j0(x)*ln(x)), z= x^2
+ *	   where 
+ *		U(z) = u00 + u01*z + ... + u06*z^6
+ *		V(z) = 1  + v01*z + ... + v04*z^4
+ *	   with absolute approximation error bounded by 2**-72.
+ *	   Note: For tiny x, U/V = u0 and j0(x)~1, hence
+ *		y0(tiny) = u0 + (2/pi)*ln(tiny), (choose tiny<2**-27)
+ *	2. For x>=2.
+ * 		y0(x) = sqrt(2/(pi*x))*(p0(x)*cos(x0)+q0(x)*sin(x0))
+ * 	   where x0 = x-pi/4. It is better to compute sin(x0),cos(x0)
+ *	   by the method mentioned above.
+ *	3. Special cases: y0(0)=-inf, y0(x<0)=NaN, y0(inf)=0.
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static double pzero(double), qzero(double);
+#else
+static double pzero(), qzero();
+#endif
+
+#ifdef __STDC__
+static const double 
+#else
+static double 
+#endif
+huge 	= 1e300,
+one	= 1.0,
+invsqrtpi=  5.64189583547756279280e-01, /* 0x3FE20DD7, 0x50429B6D */
+tpi      =  6.36619772367581382433e-01, /* 0x3FE45F30, 0x6DC9C883 */
+ 		/* R0/S0 on [0, 2.00] */
+R02  =  1.56249999999999947958e-02, /* 0x3F8FFFFF, 0xFFFFFFFD */
+R03  = -1.89979294238854721751e-04, /* 0xBF28E6A5, 0xB61AC6E9 */
+R04  =  1.82954049532700665670e-06, /* 0x3EBEB1D1, 0x0C503919 */
+R05  = -4.61832688532103189199e-09, /* 0xBE33D5E7, 0x73D63FCE */
+S01  =  1.56191029464890010492e-02, /* 0x3F8FFCE8, 0x82C8C2A4 */
+S02  =  1.16926784663337450260e-04, /* 0x3F1EA6D2, 0xDD57DBF4 */
+S03  =  5.13546550207318111446e-07, /* 0x3EA13B54, 0xCE84D5A9 */
+S04  =  1.16614003333790000205e-09; /* 0x3E1408BC, 0xF4745D8F */
+
+static double zero = 0.0;
+
+#ifdef __STDC__
+	double __ieee754_j0(double x) 
+#else
+	double __ieee754_j0(x) 
+	double x;
+#endif
+{
+	double z, s,c,ss,cc,r,u,v;
+	int hx,ix;
+
+	hx = __HI(x);
+	ix = hx&0x7fffffff;
+	if(ix>=0x7ff00000) return one/(x*x);
+	x = fd_fabs(x);
+	if(ix >= 0x40000000) {	/* |x| >= 2.0 */
+		s = fd_sin(x);
+		c = fd_cos(x);
+		ss = s-c;
+		cc = s+c;
+		if(ix<0x7fe00000) {  /* make sure x+x not overflow */
+		    z = -fd_cos(x+x);
+		    if ((s*c)<zero) cc = z/ss;
+		    else 	    ss = z/cc;
+		}
+	/*
+	 * j0(x) = 1/sqrt(pi) * (P(0,x)*cc - Q(0,x)*ss) / sqrt(x)
+	 * y0(x) = 1/sqrt(pi) * (P(0,x)*ss + Q(0,x)*cc) / sqrt(x)
+	 */
+		if(ix>0x48000000) z = (invsqrtpi*cc)/fd_sqrt(x);
+		else {
+		    u = pzero(x); v = qzero(x);
+		    z = invsqrtpi*(u*cc-v*ss)/fd_sqrt(x);
+		}
+		return z;
+	}
+	if(ix<0x3f200000) {	/* |x| < 2**-13 */
+	    if(huge+x>one) {	/* raise inexact if x != 0 */
+	        if(ix<0x3e400000) return one;	/* |x|<2**-27 */
+	        else 	      return one - 0.25*x*x;
+	    }
+	}
+	z = x*x;
+	r =  z*(R02+z*(R03+z*(R04+z*R05)));
+	s =  one+z*(S01+z*(S02+z*(S03+z*S04)));
+	if(ix < 0x3FF00000) {	/* |x| < 1.00 */
+	    return one + z*(-0.25+(r/s));
+	} else {
+	    u = 0.5*x;
+	    return((one+u)*(one-u)+z*(r/s));
+	}
+}
+
+#ifdef __STDC__
+static const double
+#else
+static double
+#endif
+u00  = -7.38042951086872317523e-02, /* 0xBFB2E4D6, 0x99CBD01F */
+u01  =  1.76666452509181115538e-01, /* 0x3FC69D01, 0x9DE9E3FC */
+u02  = -1.38185671945596898896e-02, /* 0xBF8C4CE8, 0xB16CFA97 */
+u03  =  3.47453432093683650238e-04, /* 0x3F36C54D, 0x20B29B6B */
+u04  = -3.81407053724364161125e-06, /* 0xBECFFEA7, 0x73D25CAD */
+u05  =  1.95590137035022920206e-08, /* 0x3E550057, 0x3B4EABD4 */
+u06  = -3.98205194132103398453e-11, /* 0xBDC5E43D, 0x693FB3C8 */
+v01  =  1.27304834834123699328e-02, /* 0x3F8A1270, 0x91C9C71A */
+v02  =  7.60068627350353253702e-05, /* 0x3F13ECBB, 0xF578C6C1 */
+v03  =  2.59150851840457805467e-07, /* 0x3E91642D, 0x7FF202FD */
+v04  =  4.41110311332675467403e-10; /* 0x3DFE5018, 0x3BD6D9EF */
+
+#ifdef __STDC__
+	double __ieee754_y0(double x) 
+#else
+	double __ieee754_y0(x) 
+	double x;
+#endif
+{
+	double z, s,c,ss,cc,u,v;
+	int hx,ix,lx;
+
+        hx = __HI(x);
+        ix = 0x7fffffff&hx;
+        lx = __LO(x);
+    /* Y0(NaN) is NaN, y0(-inf) is Nan, y0(inf) is 0  */
+	if(ix>=0x7ff00000) return  one/(x+x*x); 
+        if((ix|lx)==0) return -one/zero;
+        if(hx<0) return zero/zero;
+        if(ix >= 0x40000000) {  /* |x| >= 2.0 */
+        /* y0(x) = sqrt(2/(pi*x))*(p0(x)*sin(x0)+q0(x)*cos(x0))
+         * where x0 = x-pi/4
+         *      Better formula:
+         *              cos(x0) = cos(x)cos(pi/4)+sin(x)sin(pi/4)
+         *                      =  1/sqrt(2) * (sin(x) + cos(x))
+         *              sin(x0) = sin(x)cos(3pi/4)-cos(x)sin(3pi/4)
+         *                      =  1/sqrt(2) * (sin(x) - cos(x))
+         * To avoid cancellation, use
+         *              sin(x) +- cos(x) = -cos(2x)/(sin(x) -+ cos(x))
+         * to compute the worse one.
+         */
+                s = fd_sin(x);
+                c = fd_cos(x);
+                ss = s-c;
+                cc = s+c;
+	/*
+	 * j0(x) = 1/sqrt(pi) * (P(0,x)*cc - Q(0,x)*ss) / sqrt(x)
+	 * y0(x) = 1/sqrt(pi) * (P(0,x)*ss + Q(0,x)*cc) / sqrt(x)
+	 */
+                if(ix<0x7fe00000) {  /* make sure x+x not overflow */
+                    z = -fd_cos(x+x);
+                    if ((s*c)<zero) cc = z/ss;
+                    else            ss = z/cc;
+                }
+                if(ix>0x48000000) z = (invsqrtpi*ss)/fd_sqrt(x);
+                else {
+                    u = pzero(x); v = qzero(x);
+                    z = invsqrtpi*(u*ss+v*cc)/fd_sqrt(x);
+                }
+                return z;
+	}
+	if(ix<=0x3e400000) {	/* x < 2**-27 */
+	    return(u00 + tpi*__ieee754_log(x));
+	}
+	z = x*x;
+	u = u00+z*(u01+z*(u02+z*(u03+z*(u04+z*(u05+z*u06)))));
+	v = one+z*(v01+z*(v02+z*(v03+z*v04)));
+	return(u/v + tpi*(__ieee754_j0(x)*__ieee754_log(x)));
+}
+
+/* The asymptotic expansions of pzero is
+ *	1 - 9/128 s^2 + 11025/98304 s^4 - ...,	where s = 1/x.
+ * For x >= 2, We approximate pzero by
+ * 	pzero(x) = 1 + (R/S)
+ * where  R = pR0 + pR1*s^2 + pR2*s^4 + ... + pR5*s^10
+ * 	  S = 1 + pS0*s^2 + ... + pS4*s^10
+ * and
+ *	| pzero(x)-1-R/S | <= 2  ** ( -60.26)
+ */
+#ifdef __STDC__
+static const double pR8[6] = { /* for x in [inf, 8]=1/[0,0.125] */
+#else
+static double pR8[6] = { /* for x in [inf, 8]=1/[0,0.125] */
+#endif
+  0.00000000000000000000e+00, /* 0x00000000, 0x00000000 */
+ -7.03124999999900357484e-02, /* 0xBFB1FFFF, 0xFFFFFD32 */
+ -8.08167041275349795626e+00, /* 0xC02029D0, 0xB44FA779 */
+ -2.57063105679704847262e+02, /* 0xC0701102, 0x7B19E863 */
+ -2.48521641009428822144e+03, /* 0xC0A36A6E, 0xCD4DCAFC */
+ -5.25304380490729545272e+03, /* 0xC0B4850B, 0x36CC643D */
+};
+#ifdef __STDC__
+static const double pS8[5] = {
+#else
+static double pS8[5] = {
+#endif
+  1.16534364619668181717e+02, /* 0x405D2233, 0x07A96751 */
+  3.83374475364121826715e+03, /* 0x40ADF37D, 0x50596938 */
+  4.05978572648472545552e+04, /* 0x40E3D2BB, 0x6EB6B05F */
+  1.16752972564375915681e+05, /* 0x40FC810F, 0x8F9FA9BD */
+  4.76277284146730962675e+04, /* 0x40E74177, 0x4F2C49DC */
+};
+
+#ifdef __STDC__
+static const double pR5[6] = { /* for x in [8,4.5454]=1/[0.125,0.22001] */
+#else
+static double pR5[6] = { /* for x in [8,4.5454]=1/[0.125,0.22001] */
+#endif
+ -1.14125464691894502584e-11, /* 0xBDA918B1, 0x47E495CC */
+ -7.03124940873599280078e-02, /* 0xBFB1FFFF, 0xE69AFBC6 */
+ -4.15961064470587782438e+00, /* 0xC010A370, 0xF90C6BBF */
+ -6.76747652265167261021e+01, /* 0xC050EB2F, 0x5A7D1783 */
+ -3.31231299649172967747e+02, /* 0xC074B3B3, 0x6742CC63 */
+ -3.46433388365604912451e+02, /* 0xC075A6EF, 0x28A38BD7 */
+};
+#ifdef __STDC__
+static const double pS5[5] = {
+#else
+static double pS5[5] = {
+#endif
+  6.07539382692300335975e+01, /* 0x404E6081, 0x0C98C5DE */
+  1.05125230595704579173e+03, /* 0x40906D02, 0x5C7E2864 */
+  5.97897094333855784498e+03, /* 0x40B75AF8, 0x8FBE1D60 */
+  9.62544514357774460223e+03, /* 0x40C2CCB8, 0xFA76FA38 */
+  2.40605815922939109441e+03, /* 0x40A2CC1D, 0xC70BE864 */
+};
+
+#ifdef __STDC__
+static const double pR3[6] = {/* for x in [4.547,2.8571]=1/[0.2199,0.35001] */
+#else
+static double pR3[6] = {/* for x in [4.547,2.8571]=1/[0.2199,0.35001] */
+#endif
+ -2.54704601771951915620e-09, /* 0xBE25E103, 0x6FE1AA86 */
+ -7.03119616381481654654e-02, /* 0xBFB1FFF6, 0xF7C0E24B */
+ -2.40903221549529611423e+00, /* 0xC00345B2, 0xAEA48074 */
+ -2.19659774734883086467e+01, /* 0xC035F74A, 0x4CB94E14 */
+ -5.80791704701737572236e+01, /* 0xC04D0A22, 0x420A1A45 */
+ -3.14479470594888503854e+01, /* 0xC03F72AC, 0xA892D80F */
+};
+#ifdef __STDC__
+static const double pS3[5] = {
+#else
+static double pS3[5] = {
+#endif
+  3.58560338055209726349e+01, /* 0x4041ED92, 0x84077DD3 */
+  3.61513983050303863820e+02, /* 0x40769839, 0x464A7C0E */
+  1.19360783792111533330e+03, /* 0x4092A66E, 0x6D1061D6 */
+  1.12799679856907414432e+03, /* 0x40919FFC, 0xB8C39B7E */
+  1.73580930813335754692e+02, /* 0x4065B296, 0xFC379081 */
+};
+
+#ifdef __STDC__
+static const double pR2[6] = {/* for x in [2.8570,2]=1/[0.3499,0.5] */
+#else
+static double pR2[6] = {/* for x in [2.8570,2]=1/[0.3499,0.5] */
+#endif
+ -8.87534333032526411254e-08, /* 0xBE77D316, 0xE927026D */
+ -7.03030995483624743247e-02, /* 0xBFB1FF62, 0x495E1E42 */
+ -1.45073846780952986357e+00, /* 0xBFF73639, 0x8A24A843 */
+ -7.63569613823527770791e+00, /* 0xC01E8AF3, 0xEDAFA7F3 */
+ -1.11931668860356747786e+01, /* 0xC02662E6, 0xC5246303 */
+ -3.23364579351335335033e+00, /* 0xC009DE81, 0xAF8FE70F */
+};
+#ifdef __STDC__
+static const double pS2[5] = {
+#else
+static double pS2[5] = {
+#endif
+  2.22202997532088808441e+01, /* 0x40363865, 0x908B5959 */
+  1.36206794218215208048e+02, /* 0x4061069E, 0x0EE8878F */
+  2.70470278658083486789e+02, /* 0x4070E786, 0x42EA079B */
+  1.53875394208320329881e+02, /* 0x40633C03, 0x3AB6FAFF */
+  1.46576176948256193810e+01, /* 0x402D50B3, 0x44391809 */
+};
+
+#ifdef __STDC__
+	static double pzero(double x)
+#else
+	static double pzero(x)
+	double x;
+#endif
+{
+#ifdef __STDC__
+	const double *p,*q;
+#else
+	double *p,*q;
+#endif
+	double z,r,s;
+	int ix;
+	ix = 0x7fffffff&__HI(x);
+	if(ix>=0x40200000)     {p = pR8; q= pS8;}
+	else if(ix>=0x40122E8B){p = pR5; q= pS5;}
+	else if(ix>=0x4006DB6D){p = pR3; q= pS3;}
+	else if(ix>=0x40000000){p = pR2; q= pS2;}
+	z = one/(x*x);
+	r = p[0]+z*(p[1]+z*(p[2]+z*(p[3]+z*(p[4]+z*p[5]))));
+	s = one+z*(q[0]+z*(q[1]+z*(q[2]+z*(q[3]+z*q[4]))));
+	return one+ r/s;
+}
+		
+
+/* For x >= 8, the asymptotic expansions of qzero is
+ *	-1/8 s + 75/1024 s^3 - ..., where s = 1/x.
+ * We approximate pzero by
+ * 	qzero(x) = s*(-1.25 + (R/S))
+ * where  R = qR0 + qR1*s^2 + qR2*s^4 + ... + qR5*s^10
+ * 	  S = 1 + qS0*s^2 + ... + qS5*s^12
+ * and
+ *	| qzero(x)/s +1.25-R/S | <= 2  ** ( -61.22)
+ */
+#ifdef __STDC__
+static const double qR8[6] = { /* for x in [inf, 8]=1/[0,0.125] */
+#else
+static double qR8[6] = { /* for x in [inf, 8]=1/[0,0.125] */
+#endif
+  0.00000000000000000000e+00, /* 0x00000000, 0x00000000 */
+  7.32421874999935051953e-02, /* 0x3FB2BFFF, 0xFFFFFE2C */
+  1.17682064682252693899e+01, /* 0x40278952, 0x5BB334D6 */
+  5.57673380256401856059e+02, /* 0x40816D63, 0x15301825 */
+  8.85919720756468632317e+03, /* 0x40C14D99, 0x3E18F46D */
+  3.70146267776887834771e+04, /* 0x40E212D4, 0x0E901566 */
+};
+#ifdef __STDC__
+static const double qS8[6] = {
+#else
+static double qS8[6] = {
+#endif
+  1.63776026895689824414e+02, /* 0x406478D5, 0x365B39BC */
+  8.09834494656449805916e+03, /* 0x40BFA258, 0x4E6B0563 */
+  1.42538291419120476348e+05, /* 0x41016652, 0x54D38C3F */
+  8.03309257119514397345e+05, /* 0x412883DA, 0x83A52B43 */
+  8.40501579819060512818e+05, /* 0x4129A66B, 0x28DE0B3D */
+ -3.43899293537866615225e+05, /* 0xC114FD6D, 0x2C9530C5 */
+};
+
+#ifdef __STDC__
+static const double qR5[6] = { /* for x in [8,4.5454]=1/[0.125,0.22001] */
+#else
+static double qR5[6] = { /* for x in [8,4.5454]=1/[0.125,0.22001] */
+#endif
+  1.84085963594515531381e-11, /* 0x3DB43D8F, 0x29CC8CD9 */
+  7.32421766612684765896e-02, /* 0x3FB2BFFF, 0xD172B04C */
+  5.83563508962056953777e+00, /* 0x401757B0, 0xB9953DD3 */
+  1.35111577286449829671e+02, /* 0x4060E392, 0x0A8788E9 */
+  1.02724376596164097464e+03, /* 0x40900CF9, 0x9DC8C481 */
+  1.98997785864605384631e+03, /* 0x409F17E9, 0x53C6E3A6 */
+};
+#ifdef __STDC__
+static const double qS5[6] = {
+#else
+static double qS5[6] = {
+#endif
+  8.27766102236537761883e+01, /* 0x4054B1B3, 0xFB5E1543 */
+  2.07781416421392987104e+03, /* 0x40A03BA0, 0xDA21C0CE */
+  1.88472887785718085070e+04, /* 0x40D267D2, 0x7B591E6D */
+  5.67511122894947329769e+04, /* 0x40EBB5E3, 0x97E02372 */
+  3.59767538425114471465e+04, /* 0x40E19118, 0x1F7A54A0 */
+ -5.35434275601944773371e+03, /* 0xC0B4EA57, 0xBEDBC609 */
+};
+
+#ifdef __STDC__
+static const double qR3[6] = {/* for x in [4.547,2.8571]=1/[0.2199,0.35001] */
+#else
+static double qR3[6] = {/* for x in [4.547,2.8571]=1/[0.2199,0.35001] */
+#endif
+  4.37741014089738620906e-09, /* 0x3E32CD03, 0x6ADECB82 */
+  7.32411180042911447163e-02, /* 0x3FB2BFEE, 0x0E8D0842 */
+  3.34423137516170720929e+00, /* 0x400AC0FC, 0x61149CF5 */
+  4.26218440745412650017e+01, /* 0x40454F98, 0x962DAEDD */
+  1.70808091340565596283e+02, /* 0x406559DB, 0xE25EFD1F */
+  1.66733948696651168575e+02, /* 0x4064D77C, 0x81FA21E0 */
+};
+#ifdef __STDC__
+static const double qS3[6] = {
+#else
+static double qS3[6] = {
+#endif
+  4.87588729724587182091e+01, /* 0x40486122, 0xBFE343A6 */
+  7.09689221056606015736e+02, /* 0x40862D83, 0x86544EB3 */
+  3.70414822620111362994e+03, /* 0x40ACF04B, 0xE44DFC63 */
+  6.46042516752568917582e+03, /* 0x40B93C6C, 0xD7C76A28 */
+  2.51633368920368957333e+03, /* 0x40A3A8AA, 0xD94FB1C0 */
+ -1.49247451836156386662e+02, /* 0xC062A7EB, 0x201CF40F */
+};
+
+#ifdef __STDC__
+static const double qR2[6] = {/* for x in [2.8570,2]=1/[0.3499,0.5] */
+#else
+static double qR2[6] = {/* for x in [2.8570,2]=1/[0.3499,0.5] */
+#endif
+  1.50444444886983272379e-07, /* 0x3E84313B, 0x54F76BDB */
+  7.32234265963079278272e-02, /* 0x3FB2BEC5, 0x3E883E34 */
+  1.99819174093815998816e+00, /* 0x3FFFF897, 0xE727779C */
+  1.44956029347885735348e+01, /* 0x402CFDBF, 0xAAF96FE5 */
+  3.16662317504781540833e+01, /* 0x403FAA8E, 0x29FBDC4A */
+  1.62527075710929267416e+01, /* 0x403040B1, 0x71814BB4 */
+};
+#ifdef __STDC__
+static const double qS2[6] = {
+#else
+static double qS2[6] = {
+#endif
+  3.03655848355219184498e+01, /* 0x403E5D96, 0xF7C07AED */
+  2.69348118608049844624e+02, /* 0x4070D591, 0xE4D14B40 */
+  8.44783757595320139444e+02, /* 0x408A6645, 0x22B3BF22 */
+  8.82935845112488550512e+02, /* 0x408B977C, 0x9C5CC214 */
+  2.12666388511798828631e+02, /* 0x406A9553, 0x0E001365 */
+ -5.31095493882666946917e+00, /* 0xC0153E6A, 0xF8B32931 */
+};
+
+#ifdef __STDC__
+	static double qzero(double x)
+#else
+	static double qzero(x)
+	double x;
+#endif
+{
+#ifdef __STDC__
+	const double *p,*q;
+#else
+	double *p,*q;
+#endif
+	double s,r,z;
+	int ix;
+	ix = 0x7fffffff&__HI(x);
+	if(ix>=0x40200000)     {p = qR8; q= qS8;}
+	else if(ix>=0x40122E8B){p = qR5; q= qS5;}
+	else if(ix>=0x4006DB6D){p = qR3; q= qS3;}
+	else if(ix>=0x40000000){p = qR2; q= qS2;}
+	z = one/(x*x);
+	r = p[0]+z*(p[1]+z*(p[2]+z*(p[3]+z*(p[4]+z*p[5]))));
+	s = one+z*(q[0]+z*(q[1]+z*(q[2]+z*(q[3]+z*(q[4]+z*q[5])))));
+	return (-.125 + r/s)/x;
+}

mozilla/js/ref/fdlibm/e_j1.c

@@ -0,0 +1,493 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public License
+ * Version 1.0 (the "NPL"); you may not use this file except in
+ * compliance with the NPL.  You may obtain a copy of the NPL at
+ * http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the NPL is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+ * for the specific language governing rights and limitations under the
+ * NPL.
+ *
+ * The Initial Developer of this code under the NPL is Sun Microsystems,
+ * Inc.  Portions created by Netscape are Copyright (C) 1998 Netscape
+ * Communications Corporation.  All Rights Reserved.
+ */
+
+/* @(#)e_j1.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* __ieee754_j1(x), __ieee754_y1(x)
+ * Bessel function of the first and second kinds of order zero.
+ * Method -- j1(x):
+ *	1. For tiny x, we use j1(x) = x/2 - x^3/16 + x^5/384 - ...
+ *	2. Reduce x to |x| since j1(x)=-j1(-x),  and
+ *	   for x in (0,2)
+ *		j1(x) = x/2 + x*z*R0/S0,  where z = x*x;
+ *	   (precision:  |j1/x - 1/2 - R0/S0 |<2**-61.51 )
+ *	   for x in (2,inf)
+ * 		j1(x) = sqrt(2/(pi*x))*(p1(x)*cos(x1)-q1(x)*sin(x1))
+ * 		y1(x) = sqrt(2/(pi*x))*(p1(x)*sin(x1)+q1(x)*cos(x1))
+ * 	   where x1 = x-3*pi/4. It is better to compute sin(x1),cos(x1)
+ *	   as follow:
+ *		cos(x1) =  cos(x)cos(3pi/4)+sin(x)sin(3pi/4)
+ *			=  1/sqrt(2) * (sin(x) - cos(x))
+ *		sin(x1) =  sin(x)cos(3pi/4)-cos(x)sin(3pi/4)
+ *			= -1/sqrt(2) * (sin(x) + cos(x))
+ * 	   (To avoid cancellation, use
+ *		sin(x) +- cos(x) = -cos(2x)/(sin(x) -+ cos(x))
+ * 	    to compute the worse one.)
+ *	   
+ *	3 Special cases
+ *		j1(nan)= nan
+ *		j1(0) = 0
+ *		j1(inf) = 0
+ *		
+ * Method -- y1(x):
+ *	1. screen out x<=0 cases: y1(0)=-inf, y1(x<0)=NaN 
+ *	2. For x<2.
+ *	   Since 
+ *		y1(x) = 2/pi*(j1(x)*(ln(x/2)+Euler)-1/x-x/2+5/64*x^3-...)
+ *	   therefore y1(x)-2/pi*j1(x)*ln(x)-1/x is an odd function.
+ *	   We use the following function to approximate y1,
+ *		y1(x) = x*U(z)/V(z) + (2/pi)*(j1(x)*ln(x)-1/x), z= x^2
+ *	   where for x in [0,2] (abs err less than 2**-65.89)
+ *		U(z) = U0[0] + U0[1]*z + ... + U0[4]*z^4
+ *		V(z) = 1  + v0[0]*z + ... + v0[4]*z^5
+ *	   Note: For tiny x, 1/x dominate y1 and hence
+ *		y1(tiny) = -2/pi/tiny, (choose tiny<2**-54)
+ *	3. For x>=2.
+ * 		y1(x) = sqrt(2/(pi*x))*(p1(x)*sin(x1)+q1(x)*cos(x1))
+ * 	   where x1 = x-3*pi/4. It is better to compute sin(x1),cos(x1)
+ *	   by method mentioned above.
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static double pone(double), qone(double);
+#else
+static double pone(), qone();
+#endif
+
+#ifdef __STDC__
+static const double 
+#else
+static double 
+#endif
+huge    = 1e300,
+one	= 1.0,
+invsqrtpi=  5.64189583547756279280e-01, /* 0x3FE20DD7, 0x50429B6D */
+tpi      =  6.36619772367581382433e-01, /* 0x3FE45F30, 0x6DC9C883 */
+	/* R0/S0 on [0,2] */
+r00  = -6.25000000000000000000e-02, /* 0xBFB00000, 0x00000000 */
+r01  =  1.40705666955189706048e-03, /* 0x3F570D9F, 0x98472C61 */
+r02  = -1.59955631084035597520e-05, /* 0xBEF0C5C6, 0xBA169668 */
+r03  =  4.96727999609584448412e-08, /* 0x3E6AAAFA, 0x46CA0BD9 */
+s01  =  1.91537599538363460805e-02, /* 0x3F939D0B, 0x12637E53 */
+s02  =  1.85946785588630915560e-04, /* 0x3F285F56, 0xB9CDF664 */
+s03  =  1.17718464042623683263e-06, /* 0x3EB3BFF8, 0x333F8498 */
+s04  =  5.04636257076217042715e-09, /* 0x3E35AC88, 0xC97DFF2C */
+s05  =  1.23542274426137913908e-11; /* 0x3DAB2ACF, 0xCFB97ED8 */
+
+static double zero    = 0.0;
+
+#ifdef __STDC__
+	double __ieee754_j1(double x) 
+#else
+	double __ieee754_j1(x) 
+	double x;
+#endif
+{
+	double z, s,c,ss,cc,r,u,v,y;
+	int hx,ix;
+
+	hx = __HI(x);
+	ix = hx&0x7fffffff;
+	if(ix>=0x7ff00000) return one/x;
+	y = fd_fabs(x);
+	if(ix >= 0x40000000) {	/* |x| >= 2.0 */
+		s = fd_sin(y);
+		c = fd_cos(y);
+		ss = -s-c;
+		cc = s-c;
+		if(ix<0x7fe00000) {  /* make sure y+y not overflow */
+		    z = fd_cos(y+y);
+		    if ((s*c)>zero) cc = z/ss;
+		    else 	    ss = z/cc;
+		}
+	/*
+	 * j1(x) = 1/sqrt(pi) * (P(1,x)*cc - Q(1,x)*ss) / sqrt(x)
+	 * y1(x) = 1/sqrt(pi) * (P(1,x)*ss + Q(1,x)*cc) / sqrt(x)
+	 */
+		if(ix>0x48000000) z = (invsqrtpi*cc)/fd_sqrt(y);
+		else {
+		    u = pone(y); v = qone(y);
+		    z = invsqrtpi*(u*cc-v*ss)/fd_sqrt(y);
+		}
+		if(hx<0) return -z;
+		else  	 return  z;
+	}
+	if(ix<0x3e400000) {	/* |x|<2**-27 */
+	    if(huge+x>one) return 0.5*x;/* inexact if x!=0 necessary */
+	}
+	z = x*x;
+	r =  z*(r00+z*(r01+z*(r02+z*r03)));
+	s =  one+z*(s01+z*(s02+z*(s03+z*(s04+z*s05))));
+	r *= x;
+	return(x*0.5+r/s);
+}
+
+#ifdef __STDC__
+static const double U0[5] = {
+#else
+static double U0[5] = {
+#endif
+ -1.96057090646238940668e-01, /* 0xBFC91866, 0x143CBC8A */
+  5.04438716639811282616e-02, /* 0x3FA9D3C7, 0x76292CD1 */
+ -1.91256895875763547298e-03, /* 0xBF5F55E5, 0x4844F50F */
+  2.35252600561610495928e-05, /* 0x3EF8AB03, 0x8FA6B88E */
+ -9.19099158039878874504e-08, /* 0xBE78AC00, 0x569105B8 */
+};
+#ifdef __STDC__
+static const double V0[5] = {
+#else
+static double V0[5] = {
+#endif
+  1.99167318236649903973e-02, /* 0x3F94650D, 0x3F4DA9F0 */
+  2.02552581025135171496e-04, /* 0x3F2A8C89, 0x6C257764 */
+  1.35608801097516229404e-06, /* 0x3EB6C05A, 0x894E8CA6 */
+  6.22741452364621501295e-09, /* 0x3E3ABF1D, 0x5BA69A86 */
+  1.66559246207992079114e-11, /* 0x3DB25039, 0xDACA772A */
+};
+
+#ifdef __STDC__
+	double __ieee754_y1(double x) 
+#else
+	double __ieee754_y1(x) 
+	double x;
+#endif
+{
+	double z, s,c,ss,cc,u,v;
+	int hx,ix,lx;
+
+        hx = __HI(x);
+        ix = 0x7fffffff&hx;
+        lx = __LO(x);
+    /* if Y1(NaN) is NaN, Y1(-inf) is NaN, Y1(inf) is 0 */
+	if(ix>=0x7ff00000) return  one/(x+x*x); 
+        if((ix|lx)==0) return -one/zero;
+        if(hx<0) return zero/zero;
+        if(ix >= 0x40000000) {  /* |x| >= 2.0 */
+                s = fd_sin(x);
+                c = fd_cos(x);
+                ss = -s-c;
+                cc = s-c;
+                if(ix<0x7fe00000) {  /* make sure x+x not overflow */
+                    z = fd_cos(x+x);
+                    if ((s*c)>zero) cc = z/ss;
+                    else            ss = z/cc;
+                }
+        /* y1(x) = sqrt(2/(pi*x))*(p1(x)*sin(x0)+q1(x)*cos(x0))
+         * where x0 = x-3pi/4
+         *      Better formula:
+         *              cos(x0) = cos(x)cos(3pi/4)+sin(x)sin(3pi/4)
+         *                      =  1/sqrt(2) * (sin(x) - cos(x))
+         *              sin(x0) = sin(x)cos(3pi/4)-cos(x)sin(3pi/4)
+         *                      = -1/sqrt(2) * (cos(x) + sin(x))
+         * To avoid cancellation, use
+         *              sin(x) +- cos(x) = -cos(2x)/(sin(x) -+ cos(x))
+         * to compute the worse one.
+         */
+                if(ix>0x48000000) z = (invsqrtpi*ss)/fd_sqrt(x);
+                else {
+                    u = pone(x); v = qone(x);
+                    z = invsqrtpi*(u*ss+v*cc)/fd_sqrt(x);
+                }
+                return z;
+        } 
+        if(ix<=0x3c900000) {    /* x < 2**-54 */
+            return(-tpi/x);
+        } 
+        z = x*x;
+        u = U0[0]+z*(U0[1]+z*(U0[2]+z*(U0[3]+z*U0[4])));
+        v = one+z*(V0[0]+z*(V0[1]+z*(V0[2]+z*(V0[3]+z*V0[4]))));
+        return(x*(u/v) + tpi*(__ieee754_j1(x)*__ieee754_log(x)-one/x));
+}
+
+/* For x >= 8, the asymptotic expansions of pone is
+ *	1 + 15/128 s^2 - 4725/2^15 s^4 - ...,	where s = 1/x.
+ * We approximate pone by
+ * 	pone(x) = 1 + (R/S)
+ * where  R = pr0 + pr1*s^2 + pr2*s^4 + ... + pr5*s^10
+ * 	  S = 1 + ps0*s^2 + ... + ps4*s^10
+ * and
+ *	| pone(x)-1-R/S | <= 2  ** ( -60.06)
+ */
+
+#ifdef __STDC__
+static const double pr8[6] = { /* for x in [inf, 8]=1/[0,0.125] */
+#else
+static double pr8[6] = { /* for x in [inf, 8]=1/[0,0.125] */
+#endif
+  0.00000000000000000000e+00, /* 0x00000000, 0x00000000 */
+  1.17187499999988647970e-01, /* 0x3FBDFFFF, 0xFFFFFCCE */
+  1.32394806593073575129e+01, /* 0x402A7A9D, 0x357F7FCE */
+  4.12051854307378562225e+02, /* 0x4079C0D4, 0x652EA590 */
+  3.87474538913960532227e+03, /* 0x40AE457D, 0xA3A532CC */
+  7.91447954031891731574e+03, /* 0x40BEEA7A, 0xC32782DD */
+};
+#ifdef __STDC__
+static const double ps8[5] = {
+#else
+static double ps8[5] = {
+#endif
+  1.14207370375678408436e+02, /* 0x405C8D45, 0x8E656CAC */
+  3.65093083420853463394e+03, /* 0x40AC85DC, 0x964D274F */
+  3.69562060269033463555e+04, /* 0x40E20B86, 0x97C5BB7F */
+  9.76027935934950801311e+04, /* 0x40F7D42C, 0xB28F17BB */
+  3.08042720627888811578e+04, /* 0x40DE1511, 0x697A0B2D */
+};
+
+#ifdef __STDC__
+static const double pr5[6] = { /* for x in [8,4.5454]=1/[0.125,0.22001] */
+#else
+static double pr5[6] = { /* for x in [8,4.5454]=1/[0.125,0.22001] */
+#endif
+  1.31990519556243522749e-11, /* 0x3DAD0667, 0xDAE1CA7D */
+  1.17187493190614097638e-01, /* 0x3FBDFFFF, 0xE2C10043 */
+  6.80275127868432871736e+00, /* 0x401B3604, 0x6E6315E3 */
+  1.08308182990189109773e+02, /* 0x405B13B9, 0x452602ED */
+  5.17636139533199752805e+02, /* 0x40802D16, 0xD052D649 */
+  5.28715201363337541807e+02, /* 0x408085B8, 0xBB7E0CB7 */
+};
+#ifdef __STDC__
+static const double ps5[5] = {
+#else
+static double ps5[5] = {
+#endif
+  5.92805987221131331921e+01, /* 0x404DA3EA, 0xA8AF633D */
+  9.91401418733614377743e+02, /* 0x408EFB36, 0x1B066701 */
+  5.35326695291487976647e+03, /* 0x40B4E944, 0x5706B6FB */
+  7.84469031749551231769e+03, /* 0x40BEA4B0, 0xB8A5BB15 */
+  1.50404688810361062679e+03, /* 0x40978030, 0x036F5E51 */
+};
+
+#ifdef __STDC__
+static const double pr3[6] = {
+#else
+static double pr3[6] = {/* for x in [4.547,2.8571]=1/[0.2199,0.35001] */
+#endif
+  3.02503916137373618024e-09, /* 0x3E29FC21, 0xA7AD9EDD */
+  1.17186865567253592491e-01, /* 0x3FBDFFF5, 0x5B21D17B */
+  3.93297750033315640650e+00, /* 0x400F76BC, 0xE85EAD8A */
+  3.51194035591636932736e+01, /* 0x40418F48, 0x9DA6D129 */
+  9.10550110750781271918e+01, /* 0x4056C385, 0x4D2C1837 */
+  4.85590685197364919645e+01, /* 0x4048478F, 0x8EA83EE5 */
+};
+#ifdef __STDC__
+static const double ps3[5] = {
+#else
+static double ps3[5] = {
+#endif
+  3.47913095001251519989e+01, /* 0x40416549, 0xA134069C */
+  3.36762458747825746741e+02, /* 0x40750C33, 0x07F1A75F */
+  1.04687139975775130551e+03, /* 0x40905B7C, 0x5037D523 */
+  8.90811346398256432622e+02, /* 0x408BD67D, 0xA32E31E9 */
+  1.03787932439639277504e+02, /* 0x4059F26D, 0x7C2EED53 */
+};
+
+#ifdef __STDC__
+static const double pr2[6] = {/* for x in [2.8570,2]=1/[0.3499,0.5] */
+#else
+static double pr2[6] = {/* for x in [2.8570,2]=1/[0.3499,0.5] */
+#endif
+  1.07710830106873743082e-07, /* 0x3E7CE9D4, 0xF65544F4 */
+  1.17176219462683348094e-01, /* 0x3FBDFF42, 0xBE760D83 */
+  2.36851496667608785174e+00, /* 0x4002F2B7, 0xF98FAEC0 */
+  1.22426109148261232917e+01, /* 0x40287C37, 0x7F71A964 */
+  1.76939711271687727390e+01, /* 0x4031B1A8, 0x177F8EE2 */
+  5.07352312588818499250e+00, /* 0x40144B49, 0xA574C1FE */
+};
+#ifdef __STDC__
+static const double ps2[5] = {
+#else
+static double ps2[5] = {
+#endif
+  2.14364859363821409488e+01, /* 0x40356FBD, 0x8AD5ECDC */
+  1.25290227168402751090e+02, /* 0x405F5293, 0x14F92CD5 */
+  2.32276469057162813669e+02, /* 0x406D08D8, 0xD5A2DBD9 */
+  1.17679373287147100768e+02, /* 0x405D6B7A, 0xDA1884A9 */
+  8.36463893371618283368e+00, /* 0x4020BAB1, 0xF44E5192 */
+};
+
+#ifdef __STDC__
+	static double pone(double x)
+#else
+	static double pone(x)
+	double x;
+#endif
+{
+#ifdef __STDC__
+	const double *p,*q;
+#else
+	double *p,*q;
+#endif
+	double z,r,s;
+        int ix;
+        ix = 0x7fffffff&__HI(x);
+        if(ix>=0x40200000)     {p = pr8; q= ps8;}
+        else if(ix>=0x40122E8B){p = pr5; q= ps5;}
+        else if(ix>=0x4006DB6D){p = pr3; q= ps3;}
+        else if(ix>=0x40000000){p = pr2; q= ps2;}
+        z = one/(x*x);
+        r = p[0]+z*(p[1]+z*(p[2]+z*(p[3]+z*(p[4]+z*p[5]))));
+        s = one+z*(q[0]+z*(q[1]+z*(q[2]+z*(q[3]+z*q[4]))));
+        return one+ r/s;
+}
+		
+
+/* For x >= 8, the asymptotic expansions of qone is
+ *	3/8 s - 105/1024 s^3 - ..., where s = 1/x.
+ * We approximate pone by
+ * 	qone(x) = s*(0.375 + (R/S))
+ * where  R = qr1*s^2 + qr2*s^4 + ... + qr5*s^10
+ * 	  S = 1 + qs1*s^2 + ... + qs6*s^12
+ * and
+ *	| qone(x)/s -0.375-R/S | <= 2  ** ( -61.13)
+ */
+
+#ifdef __STDC__
+static const double qr8[6] = { /* for x in [inf, 8]=1/[0,0.125] */
+#else
+static double qr8[6] = { /* for x in [inf, 8]=1/[0,0.125] */
+#endif
+  0.00000000000000000000e+00, /* 0x00000000, 0x00000000 */
+ -1.02539062499992714161e-01, /* 0xBFBA3FFF, 0xFFFFFDF3 */
+ -1.62717534544589987888e+01, /* 0xC0304591, 0xA26779F7 */
+ -7.59601722513950107896e+02, /* 0xC087BCD0, 0x53E4B576 */
+ -1.18498066702429587167e+04, /* 0xC0C724E7, 0x40F87415 */
+ -4.84385124285750353010e+04, /* 0xC0E7A6D0, 0x65D09C6A */
+};
+#ifdef __STDC__
+static const double qs8[6] = {
+#else
+static double qs8[6] = {
+#endif
+  1.61395369700722909556e+02, /* 0x40642CA6, 0xDE5BCDE5 */
+  7.82538599923348465381e+03, /* 0x40BE9162, 0xD0D88419 */
+  1.33875336287249578163e+05, /* 0x4100579A, 0xB0B75E98 */
+  7.19657723683240939863e+05, /* 0x4125F653, 0x72869C19 */
+  6.66601232617776375264e+05, /* 0x412457D2, 0x7719AD5C */
+ -2.94490264303834643215e+05, /* 0xC111F969, 0x0EA5AA18 */
+};
+
+#ifdef __STDC__
+static const double qr5[6] = { /* for x in [8,4.5454]=1/[0.125,0.22001] */
+#else
+static double qr5[6] = { /* for x in [8,4.5454]=1/[0.125,0.22001] */
+#endif
+ -2.08979931141764104297e-11, /* 0xBDB6FA43, 0x1AA1A098 */
+ -1.02539050241375426231e-01, /* 0xBFBA3FFF, 0xCB597FEF */
+ -8.05644828123936029840e+00, /* 0xC0201CE6, 0xCA03AD4B */
+ -1.83669607474888380239e+02, /* 0xC066F56D, 0x6CA7B9B0 */
+ -1.37319376065508163265e+03, /* 0xC09574C6, 0x6931734F */
+ -2.61244440453215656817e+03, /* 0xC0A468E3, 0x88FDA79D */
+};
+#ifdef __STDC__
+static const double qs5[6] = {
+#else
+static double qs5[6] = {
+#endif
+  8.12765501384335777857e+01, /* 0x405451B2, 0xFF5A11B2 */
+  1.99179873460485964642e+03, /* 0x409F1F31, 0xE77BF839 */
+  1.74684851924908907677e+04, /* 0x40D10F1F, 0x0D64CE29 */
+  4.98514270910352279316e+04, /* 0x40E8576D, 0xAABAD197 */
+  2.79480751638918118260e+04, /* 0x40DB4B04, 0xCF7C364B */
+ -4.71918354795128470869e+03, /* 0xC0B26F2E, 0xFCFFA004 */
+};
+
+#ifdef __STDC__
+static const double qr3[6] = {
+#else
+static double qr3[6] = {/* for x in [4.547,2.8571]=1/[0.2199,0.35001] */
+#endif
+ -5.07831226461766561369e-09, /* 0xBE35CFA9, 0xD38FC84F */
+ -1.02537829820837089745e-01, /* 0xBFBA3FEB, 0x51AEED54 */
+ -4.61011581139473403113e+00, /* 0xC01270C2, 0x3302D9FF */
+ -5.78472216562783643212e+01, /* 0xC04CEC71, 0xC25D16DA */
+ -2.28244540737631695038e+02, /* 0xC06C87D3, 0x4718D55F */
+ -2.19210128478909325622e+02, /* 0xC06B66B9, 0x5F5C1BF6 */
+};
+#ifdef __STDC__
+static const double qs3[6] = {
+#else
+static double qs3[6] = {
+#endif
+  4.76651550323729509273e+01, /* 0x4047D523, 0xCCD367E4 */
+  6.73865112676699709482e+02, /* 0x40850EEB, 0xC031EE3E */
+  3.38015286679526343505e+03, /* 0x40AA684E, 0x448E7C9A */
+  5.54772909720722782367e+03, /* 0x40B5ABBA, 0xA61D54A6 */
+  1.90311919338810798763e+03, /* 0x409DBC7A, 0x0DD4DF4B */
+ -1.35201191444307340817e+02, /* 0xC060E670, 0x290A311F */
+};
+
+#ifdef __STDC__
+static const double qr2[6] = {/* for x in [2.8570,2]=1/[0.3499,0.5] */
+#else
+static double qr2[6] = {/* for x in [2.8570,2]=1/[0.3499,0.5] */
+#endif
+ -1.78381727510958865572e-07, /* 0xBE87F126, 0x44C626D2 */
+ -1.02517042607985553460e-01, /* 0xBFBA3E8E, 0x9148B010 */
+ -2.75220568278187460720e+00, /* 0xC0060484, 0x69BB4EDA */
+ -1.96636162643703720221e+01, /* 0xC033A9E2, 0xC168907F */
+ -4.23253133372830490089e+01, /* 0xC04529A3, 0xDE104AAA */
+ -2.13719211703704061733e+01, /* 0xC0355F36, 0x39CF6E52 */
+};
+#ifdef __STDC__
+static const double qs2[6] = {
+#else
+static double qs2[6] = {
+#endif
+  2.95333629060523854548e+01, /* 0x403D888A, 0x78AE64FF */
+  2.52981549982190529136e+02, /* 0x406F9F68, 0xDB821CBA */
+  7.57502834868645436472e+02, /* 0x4087AC05, 0xCE49A0F7 */
+  7.39393205320467245656e+02, /* 0x40871B25, 0x48D4C029 */
+  1.55949003336666123687e+02, /* 0x40637E5E, 0x3C3ED8D4 */
+ -4.95949898822628210127e+00, /* 0xC013D686, 0xE71BE86B */
+};
+
+#ifdef __STDC__
+	static double qone(double x)
+#else
+	static double qone(x)
+	double x;
+#endif
+{
+#ifdef __STDC__
+	const double *p,*q;
+#else
+	double *p,*q;
+#endif
+	double  s,r,z;
+	int ix;
+	ix = 0x7fffffff&__HI(x);
+	if(ix>=0x40200000)     {p = qr8; q= qs8;}
+	else if(ix>=0x40122E8B){p = qr5; q= qs5;}
+	else if(ix>=0x4006DB6D){p = qr3; q= qs3;}
+	else if(ix>=0x40000000){p = qr2; q= qs2;}
+	z = one/(x*x);
+	r = p[0]+z*(p[1]+z*(p[2]+z*(p[3]+z*(p[4]+z*p[5]))));
+	s = one+z*(q[0]+z*(q[1]+z*(q[2]+z*(q[3]+z*(q[4]+z*q[5])))));
+	return (.375 + r/s)/x;
+}

mozilla/js/ref/fdlibm/e_jn.c

@@ -0,0 +1,288 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public License
+ * Version 1.0 (the "NPL"); you may not use this file except in
+ * compliance with the NPL.  You may obtain a copy of the NPL at
+ * http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the NPL is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+ * for the specific language governing rights and limitations under the
+ * NPL.
+ *
+ * The Initial Developer of this code under the NPL is Sun Microsystems,
+ * Inc.  Portions created by Netscape are Copyright (C) 1998 Netscape
+ * Communications Corporation.  All Rights Reserved.
+ */
+
+/* @(#)e_jn.c 1.4 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/*
+ * __ieee754_jn(n, x), __ieee754_yn(n, x)
+ * floating point Bessel's function of the 1st and 2nd kind
+ * of order n
+ *          
+ * Special cases:
+ *	y0(0)=y1(0)=yn(n,0) = -inf with division by zero signal;
+ *	y0(-ve)=y1(-ve)=yn(n,-ve) are NaN with invalid signal.
+ * Note 2. About jn(n,x), yn(n,x)
+ *	For n=0, j0(x) is called,
+ *	for n=1, j1(x) is called,
+ *	for n<x, forward recursion us used starting
+ *	from values of j0(x) and j1(x).
+ *	for n>x, a continued fraction approximation to
+ *	j(n,x)/j(n-1,x) is evaluated and then backward
+ *	recursion is used starting from a supposed value
+ *	for j(n,x). The resulting value of j(0,x) is
+ *	compared with the actual value to correct the
+ *	supposed value of j(n,x).
+ *
+ *	yn(n,x) is similar in all respects, except
+ *	that forward recursion is used for all
+ *	values of n>1.
+ *	
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double
+#else
+static double
+#endif
+invsqrtpi=  5.64189583547756279280e-01, /* 0x3FE20DD7, 0x50429B6D */
+two   =  2.00000000000000000000e+00, /* 0x40000000, 0x00000000 */
+one   =  1.00000000000000000000e+00; /* 0x3FF00000, 0x00000000 */
+
+static double zero  =  0.00000000000000000000e+00;
+
+#ifdef __STDC__
+	double __ieee754_jn(int n, double x)
+#else
+	double __ieee754_jn(n,x)
+	int n; double x;
+#endif
+{
+	int i,hx,ix,lx, sgn;
+	double a, b, temp, di;
+	double z, w;
+
+    /* J(-n,x) = (-1)^n * J(n, x), J(n, -x) = (-1)^n * J(n, x)
+     * Thus, J(-n,x) = J(n,-x)
+     */
+	hx = __HI(x);
+	ix = 0x7fffffff&hx;
+	lx = __LO(x);
+    /* if J(n,NaN) is NaN */
+	if((ix|((unsigned)(lx|-lx))>>31)>0x7ff00000) return x+x;
+	if(n<0){		
+		n = -n;
+		x = -x;
+		hx ^= 0x80000000;
+	}
+	if(n==0) return(__ieee754_j0(x));
+	if(n==1) return(__ieee754_j1(x));
+	sgn = (n&1)&(hx>>31);	/* even n -- 0, odd n -- sign(x) */
+	x = fd_fabs(x);
+	if((ix|lx)==0||ix>=0x7ff00000) 	/* if x is 0 or inf */
+	    b = zero;
+	else if((double)n<=x) {   
+		/* Safe to use J(n+1,x)=2n/x *J(n,x)-J(n-1,x) */
+	    if(ix>=0x52D00000) { /* x > 2**302 */
+    /* (x >> n**2) 
+     *	    Jn(x) = cos(x-(2n+1)*pi/4)*sqrt(2/x*pi)
+     *	    Yn(x) = sin(x-(2n+1)*pi/4)*sqrt(2/x*pi)
+     *	    Let s=sin(x), c=cos(x), 
+     *		xn=x-(2n+1)*pi/4, sqt2 = sqrt(2),then
+     *
+     *		   n	sin(xn)*sqt2	cos(xn)*sqt2
+     *		----------------------------------
+     *		   0	 s-c		 c+s
+     *		   1	-s-c 		-c+s
+     *		   2	-s+c		-c-s
+     *		   3	 s+c		 c-s
+     */
+		switch(n&3) {
+		    case 0: temp =  fd_cos(x)+fd_sin(x); break;
+		    case 1: temp = -fd_cos(x)+fd_sin(x); break;
+		    case 2: temp = -fd_cos(x)-fd_sin(x); break;
+		    case 3: temp =  fd_cos(x)-fd_sin(x); break;
+		}
+		b = invsqrtpi*temp/fd_sqrt(x);
+	    } else {	
+	        a = __ieee754_j0(x);
+	        b = __ieee754_j1(x);
+	        for(i=1;i<n;i++){
+		    temp = b;
+		    b = b*((double)(i+i)/x) - a; /* avoid underflow */
+		    a = temp;
+	        }
+	    }
+	} else {
+	    if(ix<0x3e100000) {	/* x < 2**-29 */
+    /* x is tiny, return the first Taylor expansion of J(n,x) 
+     * J(n,x) = 1/n!*(x/2)^n  - ...
+     */
+		if(n>33)	/* underflow */
+		    b = zero;
+		else {
+		    temp = x*0.5; b = temp;
+		    for (a=one,i=2;i<=n;i++) {
+			a *= (double)i;		/* a = n! */
+			b *= temp;		/* b = (x/2)^n */
+		    }
+		    b = b/a;
+		}
+	    } else {
+		/* use backward recurrence */
+		/* 			x      x^2      x^2       
+		 *  J(n,x)/J(n-1,x) =  ----   ------   ------   .....
+		 *			2n  - 2(n+1) - 2(n+2)
+		 *
+		 * 			1      1        1       
+		 *  (for large x)   =  ----  ------   ------   .....
+		 *			2n   2(n+1)   2(n+2)
+		 *			-- - ------ - ------ - 
+		 *			 x     x         x
+		 *
+		 * Let w = 2n/x and h=2/x, then the above quotient
+		 * is equal to the continued fraction:
+		 *		    1
+		 *	= -----------------------
+		 *		       1
+		 *	   w - -----------------
+		 *			  1
+		 * 	        w+h - ---------
+		 *		       w+2h - ...
+		 *
+		 * To determine how many terms needed, let
+		 * Q(0) = w, Q(1) = w(w+h) - 1,
+		 * Q(k) = (w+k*h)*Q(k-1) - Q(k-2),
+		 * When Q(k) > 1e4	good for single 
+		 * When Q(k) > 1e9	good for double 
+		 * When Q(k) > 1e17	good for quadruple 
+		 */
+	    /* determine k */
+		double t,v;
+		double q0,q1,h,tmp; int k,m;
+		w  = (n+n)/(double)x; h = 2.0/(double)x;
+		q0 = w;  z = w+h; q1 = w*z - 1.0; k=1;
+		while(q1<1.0e9) {
+			k += 1; z += h;
+			tmp = z*q1 - q0;
+			q0 = q1;
+			q1 = tmp;
+		}
+		m = n+n;
+		for(t=zero, i = 2*(n+k); i>=m; i -= 2) t = one/(i/x-t);
+		a = t;
+		b = one;
+		/*  estimate log((2/x)^n*n!) = n*log(2/x)+n*ln(n)
+		 *  Hence, if n*(log(2n/x)) > ...
+		 *  single 8.8722839355e+01
+		 *  double 7.09782712893383973096e+02
+		 *  long double 1.1356523406294143949491931077970765006170e+04
+		 *  then recurrent value may overflow and the result is 
+		 *  likely underflow to zero
+		 */
+		tmp = n;
+		v = two/x;
+		tmp = tmp*__ieee754_log(fd_fabs(v*tmp));
+		if(tmp<7.09782712893383973096e+02) {
+	    	    for(i=n-1,di=(double)(i+i);i>0;i--){
+		        temp = b;
+			b *= di;
+			b  = b/x - a;
+		        a = temp;
+			di -= two;
+	     	    }
+		} else {
+	    	    for(i=n-1,di=(double)(i+i);i>0;i--){
+		        temp = b;
+			b *= di;
+			b  = b/x - a;
+		        a = temp;
+			di -= two;
+		    /* scale b to avoid spurious overflow */
+			if(b>1e100) {
+			    a /= b;
+			    t /= b;
+			    b  = one;
+			}
+	     	    }
+		}
+	    	b = (t*__ieee754_j0(x)/b);
+	    }
+	}
+	if(sgn==1) return -b; else return b;
+}
+
+#ifdef __STDC__
+	double __ieee754_yn(int n, double x) 
+#else
+	double __ieee754_yn(n,x) 
+	int n; double x;
+#endif
+{
+	int i,hx,ix,lx;
+	int sign;
+	double a, b, temp;
+
+	hx = __HI(x);
+	ix = 0x7fffffff&hx;
+	lx = __LO(x);
+    /* if Y(n,NaN) is NaN */
+	if((ix|((unsigned)(lx|-lx))>>31)>0x7ff00000) return x+x;
+	if((ix|lx)==0) return -one/zero;
+	if(hx<0) return zero/zero;
+	sign = 1;
+	if(n<0){
+		n = -n;
+		sign = 1 - ((n&1)<<1);
+	}
+	if(n==0) return(__ieee754_y0(x));
+	if(n==1) return(sign*__ieee754_y1(x));
+	if(ix==0x7ff00000) return zero;
+	if(ix>=0x52D00000) { /* x > 2**302 */
+    /* (x >> n**2) 
+     *	    Jn(x) = cos(x-(2n+1)*pi/4)*sqrt(2/x*pi)
+     *	    Yn(x) = sin(x-(2n+1)*pi/4)*sqrt(2/x*pi)
+     *	    Let s=sin(x), c=cos(x), 
+     *		xn=x-(2n+1)*pi/4, sqt2 = sqrt(2),then
+     *
+     *		   n	sin(xn)*sqt2	cos(xn)*sqt2
+     *		----------------------------------
+     *		   0	 s-c		 c+s
+     *		   1	-s-c 		-c+s
+     *		   2	-s+c		-c-s
+     *		   3	 s+c		 c-s
+     */
+		switch(n&3) {
+		    case 0: temp =  fd_sin(x)-fd_cos(x); break;
+		    case 1: temp = -fd_sin(x)-fd_cos(x); break;
+		    case 2: temp = -fd_sin(x)+fd_cos(x); break;
+		    case 3: temp =  fd_sin(x)+fd_cos(x); break;
+		}
+		b = invsqrtpi*temp/fd_sqrt(x);
+	} else {
+	    a = __ieee754_y0(x);
+	    b = __ieee754_y1(x);
+	/* quit if b is -inf */
+	    for(i=1;i<n&&(__HI(b) != 0xfff00000);i++){ 
+		temp = b;
+		b = ((double)(i+i)/x)*b - a;
+		a = temp;
+	    }
+	}
+	if(sign>0) return b; else return -b;
+}

mozilla/js/ref/fdlibm/e_lgamma.c

@@ -0,0 +1,49 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public License
+ * Version 1.0 (the "NPL"); you may not use this file except in
+ * compliance with the NPL.  You may obtain a copy of the NPL at
+ * http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the NPL is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+ * for the specific language governing rights and limitations under the
+ * NPL.
+ *
+ * The Initial Developer of this code under the NPL is Sun Microsystems,
+ * Inc.  Portions created by Netscape are Copyright (C) 1998 Netscape
+ * Communications Corporation.  All Rights Reserved.
+ */
+
+/* @(#)e_lgamma.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ *
+ */
+
+/* __ieee754_lgamma(x)
+ * Return the logarithm of the Gamma function of x.
+ *
+ * Method: call __ieee754_lgamma_r
+ */
+
+#include "fdlibm.h"
+
+extern int signgam;
+
+#ifdef __STDC__
+	double __ieee754_lgamma(double x)
+#else
+	double __ieee754_lgamma(x)
+	double x;
+#endif
+{
+	return __ieee754_lgamma_r(x,&signgam);
+}

mozilla/js/ref/fdlibm/e_lgamma_r.c

@@ -0,0 +1,320 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public License
+ * Version 1.0 (the "NPL"); you may not use this file except in
+ * compliance with the NPL.  You may obtain a copy of the NPL at
+ * http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the NPL is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+ * for the specific language governing rights and limitations under the
+ * NPL.
+ *
+ * The Initial Developer of this code under the NPL is Sun Microsystems,
+ * Inc.  Portions created by Netscape are Copyright (C) 1998 Netscape
+ * Communications Corporation.  All Rights Reserved.
+ */
+
+/* @(#)e_lgamma_r.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ *
+ */
+
+/* __ieee754_lgamma_r(x, signgamp)
+ * Reentrant version of the logarithm of the Gamma function 
+ * with user provide pointer for the sign of Gamma(x). 
+ *
+ * Method:
+ *   1. Argument Reduction for 0 < x <= 8
+ * 	Since gamma(1+s)=s*gamma(s), for x in [0,8], we may 
+ * 	reduce x to a number in [1.5,2.5] by
+ * 		lgamma(1+s) = log(s) + lgamma(s)
+ *	for example,
+ *		lgamma(7.3) = log(6.3) + lgamma(6.3)
+ *			    = log(6.3*5.3) + lgamma(5.3)
+ *			    = log(6.3*5.3*4.3*3.3*2.3) + lgamma(2.3)
+ *   2. Polynomial approximation of lgamma around its
+ *	minimun ymin=1.461632144968362245 to maintain monotonicity.
+ *	On [ymin-0.23, ymin+0.27] (i.e., [1.23164,1.73163]), use
+ *		Let z = x-ymin;
+ *		lgamma(x) = -1.214862905358496078218 + z^2*poly(z)
+ *	where
+ *		poly(z) is a 14 degree polynomial.
+ *   2. Rational approximation in the primary interval [2,3]
+ *	We use the following approximation:
+ *		s = x-2.0;
+ *		lgamma(x) = 0.5*s + s*P(s)/Q(s)
+ *	with accuracy
+ *		|P/Q - (lgamma(x)-0.5s)| < 2**-61.71
+ *	Our algorithms are based on the following observation
+ *
+ *                             zeta(2)-1    2    zeta(3)-1    3
+ * lgamma(2+s) = s*(1-Euler) + --------- * s  -  --------- * s  + ...
+ *                                 2                 3
+ *
+ *	where Euler = 0.5771... is the Euler constant, which is very
+ *	close to 0.5.
+ *
+ *   3. For x>=8, we have
+ *	lgamma(x)~(x-0.5)log(x)-x+0.5*log(2pi)+1/(12x)-1/(360x**3)+....
+ *	(better formula:
+ *	   lgamma(x)~(x-0.5)*(log(x)-1)-.5*(log(2pi)-1) + ...)
+ *	Let z = 1/x, then we approximation
+ *		f(z) = lgamma(x) - (x-0.5)(log(x)-1)
+ *	by
+ *	  			    3       5             11
+ *		w = w0 + w1*z + w2*z  + w3*z  + ... + w6*z
+ *	where 
+ *		|w - f(z)| < 2**-58.74
+ *		
+ *   4. For negative x, since (G is gamma function)
+ *		-x*G(-x)*G(x) = pi/sin(pi*x),
+ * 	we have
+ * 		G(x) = pi/(sin(pi*x)*(-x)*G(-x))
+ *	since G(-x) is positive, sign(G(x)) = sign(sin(pi*x)) for x<0
+ *	Hence, for x<0, signgam = sign(sin(pi*x)) and 
+ *		lgamma(x) = log(|Gamma(x)|)
+ *			  = log(pi/(|x*sin(pi*x)|)) - lgamma(-x);
+ *	Note: one should avoid compute pi*(-x) directly in the 
+ *	      computation of sin(pi*(-x)).
+ *		
+ *   5. Special Cases
+ *		lgamma(2+s) ~ s*(1-Euler) for tiny s
+ *		lgamma(1)=lgamma(2)=0
+ *		lgamma(x) ~ -log(x) for tiny x
+ *		lgamma(0) = lgamma(inf) = inf
+ *	 	lgamma(-integer) = +-inf
+ *	
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double 
+#else
+static double 
+#endif
+two52=  4.50359962737049600000e+15, /* 0x43300000, 0x00000000 */
+half=  5.00000000000000000000e-01, /* 0x3FE00000, 0x00000000 */
+one =  1.00000000000000000000e+00, /* 0x3FF00000, 0x00000000 */
+pi  =  3.14159265358979311600e+00, /* 0x400921FB, 0x54442D18 */
+a0  =  7.72156649015328655494e-02, /* 0x3FB3C467, 0xE37DB0C8 */
+a1  =  3.22467033424113591611e-01, /* 0x3FD4A34C, 0xC4A60FAD */
+a2  =  6.73523010531292681824e-02, /* 0x3FB13E00, 0x1A5562A7 */
+a3  =  2.05808084325167332806e-02, /* 0x3F951322, 0xAC92547B */
+a4  =  7.38555086081402883957e-03, /* 0x3F7E404F, 0xB68FEFE8 */
+a5  =  2.89051383673415629091e-03, /* 0x3F67ADD8, 0xCCB7926B */
+a6  =  1.19270763183362067845e-03, /* 0x3F538A94, 0x116F3F5D */
+a7  =  5.10069792153511336608e-04, /* 0x3F40B6C6, 0x89B99C00 */
+a8  =  2.20862790713908385557e-04, /* 0x3F2CF2EC, 0xED10E54D */
+a9  =  1.08011567247583939954e-04, /* 0x3F1C5088, 0x987DFB07 */
+a10 =  2.52144565451257326939e-05, /* 0x3EFA7074, 0x428CFA52 */
+a11 =  4.48640949618915160150e-05, /* 0x3F07858E, 0x90A45837 */
+tc  =  1.46163214496836224576e+00, /* 0x3FF762D8, 0x6356BE3F */
+tf  = -1.21486290535849611461e-01, /* 0xBFBF19B9, 0xBCC38A42 */
+/* tt = -(tail of tf) */
+tt  = -3.63867699703950536541e-18, /* 0xBC50C7CA, 0xA48A971F */
+t0  =  4.83836122723810047042e-01, /* 0x3FDEF72B, 0xC8EE38A2 */
+t1  = -1.47587722994593911752e-01, /* 0xBFC2E427, 0x8DC6C509 */
+t2  =  6.46249402391333854778e-02, /* 0x3FB08B42, 0x94D5419B */
+t3  = -3.27885410759859649565e-02, /* 0xBFA0C9A8, 0xDF35B713 */
+t4  =  1.79706750811820387126e-02, /* 0x3F9266E7, 0x970AF9EC */
+t5  = -1.03142241298341437450e-02, /* 0xBF851F9F, 0xBA91EC6A */
+t6  =  6.10053870246291332635e-03, /* 0x3F78FCE0, 0xE370E344 */
+t7  = -3.68452016781138256760e-03, /* 0xBF6E2EFF, 0xB3E914D7 */
+t8  =  2.25964780900612472250e-03, /* 0x3F6282D3, 0x2E15C915 */
+t9  = -1.40346469989232843813e-03, /* 0xBF56FE8E, 0xBF2D1AF1 */
+t10 =  8.81081882437654011382e-04, /* 0x3F4CDF0C, 0xEF61A8E9 */
+t11 = -5.38595305356740546715e-04, /* 0xBF41A610, 0x9C73E0EC */
+t12 =  3.15632070903625950361e-04, /* 0x3F34AF6D, 0x6C0EBBF7 */
+t13 = -3.12754168375120860518e-04, /* 0xBF347F24, 0xECC38C38 */
+t14 =  3.35529192635519073543e-04, /* 0x3F35FD3E, 0xE8C2D3F4 */
+u0  = -7.72156649015328655494e-02, /* 0xBFB3C467, 0xE37DB0C8 */
+u1  =  6.32827064025093366517e-01, /* 0x3FE4401E, 0x8B005DFF */
+u2  =  1.45492250137234768737e+00, /* 0x3FF7475C, 0xD119BD6F */
+u3  =  9.77717527963372745603e-01, /* 0x3FEF4976, 0x44EA8450 */
+u4  =  2.28963728064692451092e-01, /* 0x3FCD4EAE, 0xF6010924 */
+u5  =  1.33810918536787660377e-02, /* 0x3F8B678B, 0xBF2BAB09 */
+v1  =  2.45597793713041134822e+00, /* 0x4003A5D7, 0xC2BD619C */
+v2  =  2.12848976379893395361e+00, /* 0x40010725, 0xA42B18F5 */
+v3  =  7.69285150456672783825e-01, /* 0x3FE89DFB, 0xE45050AF */
+v4  =  1.04222645593369134254e-01, /* 0x3FBAAE55, 0xD6537C88 */
+v5  =  3.21709242282423911810e-03, /* 0x3F6A5ABB, 0x57D0CF61 */
+s0  = -7.72156649015328655494e-02, /* 0xBFB3C467, 0xE37DB0C8 */
+s1  =  2.14982415960608852501e-01, /* 0x3FCB848B, 0x36E20878 */
+s2  =  3.25778796408930981787e-01, /* 0x3FD4D98F, 0x4F139F59 */
+s3  =  1.46350472652464452805e-01, /* 0x3FC2BB9C, 0xBEE5F2F7 */
+s4  =  2.66422703033638609560e-02, /* 0x3F9B481C, 0x7E939961 */
+s5  =  1.84028451407337715652e-03, /* 0x3F5E26B6, 0x7368F239 */
+s6  =  3.19475326584100867617e-05, /* 0x3F00BFEC, 0xDD17E945 */
+r1  =  1.39200533467621045958e+00, /* 0x3FF645A7, 0x62C4AB74 */
+r2  =  7.21935547567138069525e-01, /* 0x3FE71A18, 0x93D3DCDC */
+r3  =  1.71933865632803078993e-01, /* 0x3FC601ED, 0xCCFBDF27 */
+r4  =  1.86459191715652901344e-02, /* 0x3F9317EA, 0x742ED475 */
+r5  =  7.77942496381893596434e-04, /* 0x3F497DDA, 0xCA41A95B */
+r6  =  7.32668430744625636189e-06, /* 0x3EDEBAF7, 0xA5B38140 */
+w0  =  4.18938533204672725052e-01, /* 0x3FDACFE3, 0x90C97D69 */
+w1  =  8.33333333333329678849e-02, /* 0x3FB55555, 0x5555553B */
+w2  = -2.77777777728775536470e-03, /* 0xBF66C16C, 0x16B02E5C */
+w3  =  7.93650558643019558500e-04, /* 0x3F4A019F, 0x98CF38B6 */
+w4  = -5.95187557450339963135e-04, /* 0xBF4380CB, 0x8C0FE741 */
+w5  =  8.36339918996282139126e-04, /* 0x3F4B67BA, 0x4CDAD5D1 */
+w6  = -1.63092934096575273989e-03; /* 0xBF5AB89D, 0x0B9E43E4 */
+
+static double zero=  0.00000000000000000000e+00;
+
+#ifdef __STDC__
+	static double sin_pi(double x)
+#else
+	static double sin_pi(x)
+	double x;
+#endif
+{
+	double y,z;
+	int n,ix;
+
+	ix = 0x7fffffff&__HI(x);
+
+	if(ix<0x3fd00000) return __kernel_sin(pi*x,zero,0);
+	y = -x;		/* x is assume negative */
+
+    /*
+     * argument reduction, make sure inexact flag not raised if input
+     * is an integer
+     */
+	z = fd_floor(y);
+	if(z!=y) {				/* inexact anyway */
+	    y  *= 0.5;
+	    y   = 2.0*(y - fd_floor(y));		/* y = |x| mod 2.0 */
+	    n   = (int) (y*4.0);
+	} else {
+            if(ix>=0x43400000) {
+                y = zero; n = 0;                 /* y must be even */
+            } else {
+                if(ix<0x43300000) z = y+two52;	/* exact */
+                n   = __LO(z)&1;        /* lower word of z */
+                y  = n;
+                n<<= 2;
+            }
+        }
+	switch (n) {
+	    case 0:   y =  __kernel_sin(pi*y,zero,0); break;
+	    case 1:   
+	    case 2:   y =  __kernel_cos(pi*(0.5-y),zero); break;
+	    case 3:  
+	    case 4:   y =  __kernel_sin(pi*(one-y),zero,0); break;
+	    case 5:
+	    case 6:   y = -__kernel_cos(pi*(y-1.5),zero); break;
+	    default:  y =  __kernel_sin(pi*(y-2.0),zero,0); break;
+	    }
+	return -y;
+}
+
+
+#ifdef __STDC__
+	double __ieee754_lgamma_r(double x, int *signgamp)
+#else
+	double __ieee754_lgamma_r(x,signgamp)
+	double x; int *signgamp;
+#endif
+{
+	double t,y,z,nadj,p,p1,p2,p3,q,r,w;
+	int i,hx,lx,ix;
+
+	hx = __HI(x);
+	lx = __LO(x);
+
+    /* purge off +-inf, NaN, +-0, and negative arguments */
+	*signgamp = 1;
+	ix = hx&0x7fffffff;
+	if(ix>=0x7ff00000) return x*x;
+	if((ix|lx)==0) return one/zero;
+	if(ix<0x3b900000) {	/* |x|<2**-70, return -log(|x|) */
+	    if(hx<0) {
+	        *signgamp = -1;
+	        return -__ieee754_log(-x);
+	    } else return -__ieee754_log(x);
+	}
+	if(hx<0) {
+	    if(ix>=0x43300000) 	/* |x|>=2**52, must be -integer */
+		return one/zero;
+	    t = sin_pi(x);
+	    if(t==zero) return one/zero; /* -integer */
+	    nadj = __ieee754_log(pi/fd_fabs(t*x));
+	    if(t<zero) *signgamp = -1;
+	    x = -x;
+	}
+
+    /* purge off 1 and 2 */
+	if((((ix-0x3ff00000)|lx)==0)||(((ix-0x40000000)|lx)==0)) r = 0;
+    /* for x < 2.0 */
+	else if(ix<0x40000000) {
+	    if(ix<=0x3feccccc) { 	/* lgamma(x) = lgamma(x+1)-log(x) */
+		r = -__ieee754_log(x);
+		if(ix>=0x3FE76944) {y = one-x; i= 0;}
+		else if(ix>=0x3FCDA661) {y= x-(tc-one); i=1;}
+	  	else {y = x; i=2;}
+	    } else {
+	  	r = zero;
+	        if(ix>=0x3FFBB4C3) {y=2.0-x;i=0;} /* [1.7316,2] */
+	        else if(ix>=0x3FF3B4C4) {y=x-tc;i=1;} /* [1.23,1.73] */
+		else {y=x-one;i=2;}
+	    }
+	    switch(i) {
+	      case 0:
+		z = y*y;
+		p1 = a0+z*(a2+z*(a4+z*(a6+z*(a8+z*a10))));
+		p2 = z*(a1+z*(a3+z*(a5+z*(a7+z*(a9+z*a11)))));
+		p  = y*p1+p2;
+		r  += (p-0.5*y); break;
+	      case 1:
+		z = y*y;
+		w = z*y;
+		p1 = t0+w*(t3+w*(t6+w*(t9 +w*t12)));	/* parallel comp */
+		p2 = t1+w*(t4+w*(t7+w*(t10+w*t13)));
+		p3 = t2+w*(t5+w*(t8+w*(t11+w*t14)));
+		p  = z*p1-(tt-w*(p2+y*p3));
+		r += (tf + p); break;
+	      case 2:	
+		p1 = y*(u0+y*(u1+y*(u2+y*(u3+y*(u4+y*u5)))));
+		p2 = one+y*(v1+y*(v2+y*(v3+y*(v4+y*v5))));
+		r += (-0.5*y + p1/p2);
+	    }
+	}
+	else if(ix<0x40200000) { 			/* x < 8.0 */
+	    i = (int)x;
+	    t = zero;
+	    y = x-(double)i;
+	    p = y*(s0+y*(s1+y*(s2+y*(s3+y*(s4+y*(s5+y*s6))))));
+	    q = one+y*(r1+y*(r2+y*(r3+y*(r4+y*(r5+y*r6)))));
+	    r = half*y+p/q;
+	    z = one;	/* lgamma(1+s) = log(s) + lgamma(s) */
+	    switch(i) {
+	    case 7: z *= (y+6.0);	/* FALLTHRU */
+	    case 6: z *= (y+5.0);	/* FALLTHRU */
+	    case 5: z *= (y+4.0);	/* FALLTHRU */
+	    case 4: z *= (y+3.0);	/* FALLTHRU */
+	    case 3: z *= (y+2.0);	/* FALLTHRU */
+		    r += __ieee754_log(z); break;
+	    }
+    /* 8.0 <= x < 2**58 */
+	} else if (ix < 0x43900000) {
+	    t = __ieee754_log(x);
+	    z = one/x;
+	    y = z*z;
+	    w = w0+z*(w1+y*(w2+y*(w3+y*(w4+y*(w5+y*w6)))));
+	    r = (x-half)*(t-one)+w;
+	} else 
+    /* 2**58 <= x <= inf */
+	    r =  x*(__ieee754_log(x)-one);
+	if(hx<0) r = nadj - r;
+	return r;
+}

mozilla/js/ref/fdlibm/e_log.c

@@ -0,0 +1,155 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public License
+ * Version 1.0 (the "NPL"); you may not use this file except in
+ * compliance with the NPL.  You may obtain a copy of the NPL at
+ * http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the NPL is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+ * for the specific language governing rights and limitations under the
+ * NPL.
+ *
+ * The Initial Developer of this code under the NPL is Sun Microsystems,
+ * Inc.  Portions created by Netscape are Copyright (C) 1998 Netscape
+ * Communications Corporation.  All Rights Reserved.
+ */
+
+/* @(#)e_log.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* __ieee754_log(x)
+ * Return the logrithm of x
+ *
+ * Method :                  
+ *   1. Argument Reduction: find k and f such that 
+ *			x = 2^k * (1+f), 
+ *	   where  sqrt(2)/2 < 1+f < sqrt(2) .
+ *
+ *   2. Approximation of log(1+f).
+ *	Let s = f/(2+f) ; based on log(1+f) = log(1+s) - log(1-s)
+ *		 = 2s + 2/3 s**3 + 2/5 s**5 + .....,
+ *	     	 = 2s + s*R
+ *      We use a special Reme algorithm on [0,0.1716] to generate 
+ * 	a polynomial of degree 14 to approximate R The maximum error 
+ *	of this polynomial approximation is bounded by 2**-58.45. In
+ *	other words,
+ *		        2      4      6      8      10      12      14
+ *	    R(z) ~ Lg1*s +Lg2*s +Lg3*s +Lg4*s +Lg5*s  +Lg6*s  +Lg7*s
+ *  	(the values of Lg1 to Lg7 are listed in the program)
+ *	and
+ *	    |      2          14          |     -58.45
+ *	    | Lg1*s +...+Lg7*s    -  R(z) | <= 2 
+ *	    |                             |
+ *	Note that 2s = f - s*f = f - hfsq + s*hfsq, where hfsq = f*f/2.
+ *	In order to guarantee error in log below 1ulp, we compute log
+ *	by
+ *		log(1+f) = f - s*(f - R)	(if f is not too large)
+ *		log(1+f) = f - (hfsq - s*(hfsq+R)).	(better accuracy)
+ *	
+ *	3. Finally,  log(x) = k*ln2 + log(1+f).  
+ *			    = k*ln2_hi+(f-(hfsq-(s*(hfsq+R)+k*ln2_lo)))
+ *	   Here ln2 is split into two floating point number: 
+ *			ln2_hi + ln2_lo,
+ *	   where n*ln2_hi is always exact for |n| < 2000.
+ *
+ * Special cases:
+ *	log(x) is NaN with signal if x < 0 (including -INF) ; 
+ *	log(+INF) is +INF; log(0) is -INF with signal;
+ *	log(NaN) is that NaN with no signal.
+ *
+ * Accuracy:
+ *	according to an error analysis, the error is always less than
+ *	1 ulp (unit in the last place).
+ *
+ * Constants:
+ * The hexadecimal values are the intended ones for the following 
+ * constants. The decimal values may be used, provided that the 
+ * compiler will convert from decimal to binary accurately enough 
+ * to produce the hexadecimal values shown.
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double
+#else
+static double
+#endif
+ln2_hi  =  6.93147180369123816490e-01,	/* 3fe62e42 fee00000 */
+ln2_lo  =  1.90821492927058770002e-10,	/* 3dea39ef 35793c76 */
+two54   =  1.80143985094819840000e+16,  /* 43500000 00000000 */
+Lg1 = 6.666666666666735130e-01,  /* 3FE55555 55555593 */
+Lg2 = 3.999999999940941908e-01,  /* 3FD99999 9997FA04 */
+Lg3 = 2.857142874366239149e-01,  /* 3FD24924 94229359 */
+Lg4 = 2.222219843214978396e-01,  /* 3FCC71C5 1D8E78AF */
+Lg5 = 1.818357216161805012e-01,  /* 3FC74664 96CB03DE */
+Lg6 = 1.531383769920937332e-01,  /* 3FC39A09 D078C69F */
+Lg7 = 1.479819860511658591e-01;  /* 3FC2F112 DF3E5244 */
+
+static double zero   =  0.0;
+
+#ifdef __STDC__
+	double __ieee754_log(double x)
+#else
+	double __ieee754_log(x)
+	double x;
+#endif
+{
+	double hfsq,f,s,z,R,w,t1,t2,dk;
+	int k,hx,i,j;
+	unsigned lx;
+
+	hx = __HI(x);		/* high word of x */
+	lx = __LO(x);		/* low  word of x */
+
+	k=0;
+	if (hx < 0x00100000) {			/* x < 2**-1022  */
+	    if (((hx&0x7fffffff)|lx)==0) 
+		return -two54/zero;		/* log(+-0)=-inf */
+	    if (hx<0) return (x-x)/zero;	/* log(-#) = NaN */
+	    k -= 54; x *= two54; /* subnormal number, scale up x */
+	    hx = __HI(x);		/* high word of x */
+	} 
+	if (hx >= 0x7ff00000) return x+x;
+	k += (hx>>20)-1023;
+	hx &= 0x000fffff;
+	i = (hx+0x95f64)&0x100000;
+	__HI(x) = hx|(i^0x3ff00000);	/* normalize x or x/2 */
+	k += (i>>20);
+	f = x-1.0;
+	if((0x000fffff&(2+hx))<3) {	/* |f| < 2**-20 */
+	    if(f==zero) if(k==0) return zero;  else {dk=(double)k;
+				 return dk*ln2_hi+dk*ln2_lo;}
+	    R = f*f*(0.5-0.33333333333333333*f);
+	    if(k==0) return f-R; else {dk=(double)k;
+	    	     return dk*ln2_hi-((R-dk*ln2_lo)-f);}
+	}
+ 	s = f/(2.0+f); 
+	dk = (double)k;
+	z = s*s;
+	i = hx-0x6147a;
+	w = z*z;
+	j = 0x6b851-hx;
+	t1= w*(Lg2+w*(Lg4+w*Lg6)); 
+	t2= z*(Lg1+w*(Lg3+w*(Lg5+w*Lg7))); 
+	i |= j;
+	R = t2+t1;
+	if(i>0) {
+	    hfsq=0.5*f*f;
+	    if(k==0) return f-(hfsq-s*(hfsq+R)); else
+		     return dk*ln2_hi-((hfsq-(s*(hfsq+R)+dk*ln2_lo))-f);
+	} else {
+	    if(k==0) return f-s*(f-R); else
+		     return dk*ln2_hi-((s*(f-R)-dk*ln2_lo)-f);
+	}
+}

mozilla/js/ref/fdlibm/e_log10.c

@@ -0,0 +1,107 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public License
+ * Version 1.0 (the "NPL"); you may not use this file except in
+ * compliance with the NPL.  You may obtain a copy of the NPL at
+ * http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the NPL is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+ * for the specific language governing rights and limitations under the
+ * NPL.
+ *
+ * The Initial Developer of this code under the NPL is Sun Microsystems,
+ * Inc.  Portions created by Netscape are Copyright (C) 1998 Netscape
+ * Communications Corporation.  All Rights Reserved.
+ */
+
+/* @(#)e_log10.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* __ieee754_log10(x)
+ * Return the base 10 logarithm of x
+ * 
+ * Method :
+ *	Let log10_2hi = leading 40 bits of log10(2) and
+ *	    log10_2lo = log10(2) - log10_2hi,
+ *	    ivln10   = 1/log(10) rounded.
+ *	Then
+ *		n = ilogb(x), 
+ *		if(n<0)  n = n+1;
+ *		x = scalbn(x,-n);
+ *		log10(x) := n*log10_2hi + (n*log10_2lo + ivln10*log(x))
+ *
+ * Note 1:
+ *	To guarantee log10(10**n)=n, where 10**n is normal, the rounding 
+ *	mode must set to Round-to-Nearest.
+ * Note 2:
+ *	[1/log(10)] rounded to 53 bits has error  .198   ulps;
+ *	log10 is monotonic at all binary break points.
+ *
+ * Special cases:
+ *	log10(x) is NaN with signal if x < 0; 
+ *	log10(+INF) is +INF with no signal; log10(0) is -INF with signal;
+ *	log10(NaN) is that NaN with no signal;
+ *	log10(10**N) = N  for N=0,1,...,22.
+ *
+ * Constants:
+ * The hexadecimal values are the intended ones for the following constants.
+ * The decimal values may be used, provided that the compiler will convert
+ * from decimal to binary accurately enough to produce the hexadecimal values
+ * shown.
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double
+#else
+static double
+#endif
+two54      =  1.80143985094819840000e+16, /* 0x43500000, 0x00000000 */
+ivln10     =  4.34294481903251816668e-01, /* 0x3FDBCB7B, 0x1526E50E */
+log10_2hi  =  3.01029995663611771306e-01, /* 0x3FD34413, 0x509F6000 */
+log10_2lo  =  3.69423907715893078616e-13; /* 0x3D59FEF3, 0x11F12B36 */
+
+static double zero   =  0.0;
+
+#ifdef __STDC__
+	double __ieee754_log10(double x)
+#else
+	double __ieee754_log10(x)
+	double x;
+#endif
+{
+	double y,z;
+	int i,k,hx;
+	unsigned lx;
+
+	hx = __HI(x);	/* high word of x */
+	lx = __LO(x);	/* low word of x */
+
+        k=0;
+        if (hx < 0x00100000) {                  /* x < 2**-1022  */
+            if (((hx&0x7fffffff)|lx)==0)
+                return -two54/zero;             /* log(+-0)=-inf */
+            if (hx<0) return (x-x)/zero;        /* log(-#) = NaN */
+            k -= 54; x *= two54; /* subnormal number, scale up x */
+            hx = __HI(x);                /* high word of x */
+        }
+	if (hx >= 0x7ff00000) return x+x;
+	k += (hx>>20)-1023;
+	i  = ((unsigned)k&0x80000000)>>31;
+        hx = (hx&0x000fffff)|((0x3ff-i)<<20);
+        y  = (double)(k+i);
+        __HI(x) = hx;
+	z  = y*log10_2lo + ivln10*__ieee754_log(x);
+	return  z+y*log10_2hi;
+}

mozilla/js/ref/fdlibm/e_pow.c

@@ -0,0 +1,325 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public License
+ * Version 1.0 (the "NPL"); you may not use this file except in
+ * compliance with the NPL.  You may obtain a copy of the NPL at
+ * http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the NPL is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+ * for the specific language governing rights and limitations under the
+ * NPL.
+ *
+ * The Initial Developer of this code under the NPL is Sun Microsystems,
+ * Inc.  Portions created by Netscape are Copyright (C) 1998 Netscape
+ * Communications Corporation.  All Rights Reserved.
+ */
+
+/* @(#)e_pow.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* __ieee754_pow(x,y) return x**y
+ *
+ *		      n
+ * Method:  Let x =  2   * (1+f)
+ *	1. Compute and return log2(x) in two pieces:
+ *		log2(x) = w1 + w2,
+ *	   where w1 has 53-24 = 29 bit trailing zeros.
+ *	2. Perform y*log2(x) = n+y' by simulating muti-precision 
+ *	   arithmetic, where |y'|<=0.5.
+ *	3. Return x**y = 2**n*exp(y'*log2)
+ *
+ * Special cases:
+ *	1.  (anything) ** 0  is 1
+ *	2.  (anything) ** 1  is itself
+ *	3.  (anything) ** NAN is NAN
+ *	4.  NAN ** (anything except 0) is NAN
+ *	5.  +-(|x| > 1) **  +INF is +INF
+ *	6.  +-(|x| > 1) **  -INF is +0
+ *	7.  +-(|x| < 1) **  +INF is +0
+ *	8.  +-(|x| < 1) **  -INF is +INF
+ *	9.  +-1         ** +-INF is NAN
+ *	10. +0 ** (+anything except 0, NAN)               is +0
+ *	11. -0 ** (+anything except 0, NAN, odd integer)  is +0
+ *	12. +0 ** (-anything except 0, NAN)               is +INF
+ *	13. -0 ** (-anything except 0, NAN, odd integer)  is +INF
+ *	14. -0 ** (odd integer) = -( +0 ** (odd integer) )
+ *	15. +INF ** (+anything except 0,NAN) is +INF
+ *	16. +INF ** (-anything except 0,NAN) is +0
+ *	17. -INF ** (anything)  = -0 ** (-anything)
+ *	18. (-anything) ** (integer) is (-1)**(integer)*(+anything**integer)
+ *	19. (-anything except 0 and inf) ** (non-integer) is NAN
+ *
+ * Accuracy:
+ *	pow(x,y) returns x**y nearly rounded. In particular
+ *			pow(integer,integer)
+ *	always returns the correct integer provided it is 
+ *	representable.
+ *
+ * Constants :
+ * The hexadecimal values are the intended ones for the following 
+ * constants. The decimal values may be used, provided that the 
+ * compiler will convert from decimal to binary accurately enough 
+ * to produce the hexadecimal values shown.
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double 
+#else
+static double 
+#endif
+bp[] = {1.0, 1.5,},
+dp_h[] = { 0.0, 5.84962487220764160156e-01,}, /* 0x3FE2B803, 0x40000000 */
+dp_l[] = { 0.0, 1.35003920212974897128e-08,}, /* 0x3E4CFDEB, 0x43CFD006 */
+zero    =  0.0,
+one	=  1.0,
+two	=  2.0,
+two53	=  9007199254740992.0,	/* 0x43400000, 0x00000000 */
+huge	=  1.0e300,
+tiny    =  1.0e-300,
+	/* poly coefs for (3/2)*(log(x)-2s-2/3*s**3 */
+L1  =  5.99999999999994648725e-01, /* 0x3FE33333, 0x33333303 */
+L2  =  4.28571428578550184252e-01, /* 0x3FDB6DB6, 0xDB6FABFF */
+L3  =  3.33333329818377432918e-01, /* 0x3FD55555, 0x518F264D */
+L4  =  2.72728123808534006489e-01, /* 0x3FD17460, 0xA91D4101 */
+L5  =  2.30660745775561754067e-01, /* 0x3FCD864A, 0x93C9DB65 */
+L6  =  2.06975017800338417784e-01, /* 0x3FCA7E28, 0x4A454EEF */
+P1   =  1.66666666666666019037e-01, /* 0x3FC55555, 0x5555553E */
+P2   = -2.77777777770155933842e-03, /* 0xBF66C16C, 0x16BEBD93 */
+P3   =  6.61375632143793436117e-05, /* 0x3F11566A, 0xAF25DE2C */
+P4   = -1.65339022054652515390e-06, /* 0xBEBBBD41, 0xC5D26BF1 */
+P5   =  4.13813679705723846039e-08, /* 0x3E663769, 0x72BEA4D0 */
+lg2  =  6.93147180559945286227e-01, /* 0x3FE62E42, 0xFEFA39EF */
+lg2_h  =  6.93147182464599609375e-01, /* 0x3FE62E43, 0x00000000 */
+lg2_l  = -1.90465429995776804525e-09, /* 0xBE205C61, 0x0CA86C39 */
+ovt =  8.0085662595372944372e-0017, /* -(1024-log2(ovfl+.5ulp)) */
+cp    =  9.61796693925975554329e-01, /* 0x3FEEC709, 0xDC3A03FD =2/(3ln2) */
+cp_h  =  9.61796700954437255859e-01, /* 0x3FEEC709, 0xE0000000 =(float)cp */
+cp_l  = -7.02846165095275826516e-09, /* 0xBE3E2FE0, 0x145B01F5 =tail of cp_h*/
+ivln2    =  1.44269504088896338700e+00, /* 0x3FF71547, 0x652B82FE =1/ln2 */
+ivln2_h  =  1.44269502162933349609e+00, /* 0x3FF71547, 0x60000000 =24b 1/ln2*/
+ivln2_l  =  1.92596299112661746887e-08; /* 0x3E54AE0B, 0xF85DDF44 =1/ln2 tail*/
+
+#ifdef __STDC__
+	double __ieee754_pow(double x, double y)
+#else
+	double __ieee754_pow(x,y)
+	double x, y;
+#endif
+{
+	double z,ax,z_h,z_l,p_h,p_l;
+	double y1,t1,t2,r,s,t,u,v,w;
+	int i,j,k,yisint,n;
+	int hx,hy,ix,iy;
+	unsigned lx,ly;
+
+	hx = __HI(x); lx = __LO(x);
+	hy = __HI(y); ly = __LO(y);
+	ix = hx&0x7fffffff;  iy = hy&0x7fffffff;
+
+    /* y==zero: x**0 = 1 */
+	if((iy|ly)==0) return one; 	
+
+    /* +-NaN return x+y */
+	if(ix > 0x7ff00000 || ((ix==0x7ff00000)&&(lx!=0)) ||
+	   iy > 0x7ff00000 || ((iy==0x7ff00000)&&(ly!=0))) 
+		return x+y;	
+
+    /* determine if y is an odd int when x < 0
+     * yisint = 0	... y is not an integer
+     * yisint = 1	... y is an odd int
+     * yisint = 2	... y is an even int
+     */
+	yisint  = 0;
+	if(hx<0) {	
+	    if(iy>=0x43400000) yisint = 2; /* even integer y */
+	    else if(iy>=0x3ff00000) {
+		k = (iy>>20)-0x3ff;	   /* exponent */
+		if(k>20) {
+		    j = ly>>(52-k);
+		    if((j<<(52-k))==(int)ly) yisint = 2-(j&1);
+		} else if(ly==0) {
+		    j = iy>>(20-k);
+		    if((j<<(20-k))==iy) yisint = 2-(j&1);
+		}
+	    }		
+	} 
+
+    /* special value of y */
+	if(ly==0) { 	
+	    if (iy==0x7ff00000) {	/* y is +-inf */
+	        if(((ix-0x3ff00000)|lx)==0)
+		    return  y - y;	/* inf**+-1 is NaN */
+	        else if (ix >= 0x3ff00000)/* (|x|>1)**+-inf = inf,0 */
+		    return (hy>=0)? y: zero;
+	        else			/* (|x|<1)**-,+inf = inf,0 */
+		    return (hy<0)?-y: zero;
+	    } 
+	    if(iy==0x3ff00000) {	/* y is  +-1 */
+		if(hy<0) return one/x; else return x;
+	    }
+	    if(hy==0x40000000) return x*x; /* y is  2 */
+	    if(hy==0x3fe00000) {	/* y is  0.5 */
+		if(hx>=0)	/* x >= +0 */
+		return fd_sqrt(x);	
+	    }
+	}
+
+	ax   = fd_fabs(x);
+    /* special value of x */
+	if(lx==0) {
+	    if(ix==0x7ff00000||ix==0||ix==0x3ff00000){
+		z = ax;			/*x is +-0,+-inf,+-1*/
+		if(hy<0) z = one/z;	/* z = (1/|x|) */
+		if(hx<0) {
+		    if(((ix-0x3ff00000)|yisint)==0) {
+			z = (z-z)/(z-z); /* (-1)**non-int is NaN */
+		    } else if(yisint==1) {
+#ifdef HPUX
+			__HI(z) ^= 1<<31; /* some HPUXes cannot negate 0.. */
+#else
+			z = -z;		/* (x<0)**odd = -(|x|**odd) */
+#endif
+			}
+		}
+		return z;
+	    }
+	}
+    
+    /* (x<0)**(non-int) is NaN */
+	if((((hx>>31)+1)|yisint)==0) return (x-x)/(x-x);
+
+    /* |y| is huge */
+	if(iy>0x41e00000) { /* if |y| > 2**31 */
+	    if(iy>0x43f00000){	/* if |y| > 2**64, must o/uflow */
+		if(ix<=0x3fefffff) return (hy<0)? huge*huge:tiny*tiny;
+		if(ix>=0x3ff00000) return (hy>0)? huge*huge:tiny*tiny;
+	    }
+	/* over/underflow if x is not close to one */
+	    if(ix<0x3fefffff) return (hy<0)? huge*huge:tiny*tiny;
+	    if(ix>0x3ff00000) return (hy>0)? huge*huge:tiny*tiny;
+	/* now |1-x| is tiny <= 2**-20, suffice to compute 
+	   log(x) by x-x^2/2+x^3/3-x^4/4 */
+	    t = x-1;		/* t has 20 trailing zeros */
+	    w = (t*t)*(0.5-t*(0.3333333333333333333333-t*0.25));
+	    u = ivln2_h*t;	/* ivln2_h has 21 sig. bits */
+	    v = t*ivln2_l-w*ivln2;
+	    t1 = u+v;
+	    __LO(t1) = 0;
+	    t2 = v-(t1-u);
+	} else {
+	    double s2,s_h,s_l,t_h,t_l;
+	    n = 0;
+	/* take care subnormal number */
+	    if(ix<0x00100000)
+		{ax *= two53; n -= 53; ix = __HI(ax); }
+	    n  += ((ix)>>20)-0x3ff;
+	    j  = ix&0x000fffff;
+	/* determine interval */
+	    ix = j|0x3ff00000;		/* normalize ix */
+	    if(j<=0x3988E) k=0;		/* |x|<sqrt(3/2) */
+	    else if(j<0xBB67A) k=1;	/* |x|<sqrt(3)   */
+	    else {k=0;n+=1;ix -= 0x00100000;}
+	    __HI(ax) = ix;
+
+	/* compute s = s_h+s_l = (x-1)/(x+1) or (x-1.5)/(x+1.5) */
+	    u = ax-bp[k];		/* bp[0]=1.0, bp[1]=1.5 */
+	    v = one/(ax+bp[k]);
+	    s = u*v;
+	    s_h = s;
+	    __LO(s_h) = 0;
+	/* t_h=ax+bp[k] High */
+	    t_h = zero;
+	    __HI(t_h)=((ix>>1)|0x20000000)+0x00080000+(k<<18); 
+	    t_l = ax - (t_h-bp[k]);
+	    s_l = v*((u-s_h*t_h)-s_h*t_l);
+	/* compute log(ax) */
+	    s2 = s*s;
+	    r = s2*s2*(L1+s2*(L2+s2*(L3+s2*(L4+s2*(L5+s2*L6)))));
+	    r += s_l*(s_h+s);
+	    s2  = s_h*s_h;
+	    t_h = 3.0+s2+r;
+	    __LO(t_h) = 0;
+	    t_l = r-((t_h-3.0)-s2);
+	/* u+v = s*(1+...) */
+	    u = s_h*t_h;
+	    v = s_l*t_h+t_l*s;
+	/* 2/(3log2)*(s+...) */
+	    p_h = u+v;
+	    __LO(p_h) = 0;
+	    p_l = v-(p_h-u);
+	    z_h = cp_h*p_h;		/* cp_h+cp_l = 2/(3*log2) */
+	    z_l = cp_l*p_h+p_l*cp+dp_l[k];
+	/* log2(ax) = (s+..)*2/(3*log2) = n + dp_h + z_h + z_l */
+	    t = (double)n;
+	    t1 = (((z_h+z_l)+dp_h[k])+t);
+	    __LO(t1) = 0;
+	    t2 = z_l-(((t1-t)-dp_h[k])-z_h);
+	}
+
+	s = one; /* s (sign of result -ve**odd) = -1 else = 1 */
+	if((((hx>>31)+1)|(yisint-1))==0) s = -one;/* (-ve)**(odd int) */
+
+    /* split up y into y1+y2 and compute (y1+y2)*(t1+t2) */
+	y1  = y;
+	__LO(y1) = 0;
+	p_l = (y-y1)*t1+y*t2;
+	p_h = y1*t1;
+	z = p_l+p_h;
+	j = __HI(z);
+	i = __LO(z);
+	if (j>=0x40900000) {				/* z >= 1024 */
+	    if(((j-0x40900000)|i)!=0)			/* if z > 1024 */
+		return s*huge*huge;			/* overflow */
+	    else {
+		if(p_l+ovt>z-p_h) return s*huge*huge;	/* overflow */
+	    }
+	} else if((j&0x7fffffff)>=0x4090cc00 ) {	/* z <= -1075 */
+	    if(((j-0xc090cc00)|i)!=0) 		/* z < -1075 */
+		return s*tiny*tiny;		/* underflow */
+	    else {
+		if(p_l<=z-p_h) return s*tiny*tiny;	/* underflow */
+	    }
+	}
+    /*
+     * compute 2**(p_h+p_l)
+     */
+	i = j&0x7fffffff;
+	k = (i>>20)-0x3ff;
+	n = 0;
+	if(i>0x3fe00000) {		/* if |z| > 0.5, set n = [z+0.5] */
+	    n = j+(0x00100000>>(k+1));
+	    k = ((n&0x7fffffff)>>20)-0x3ff;	/* new k for n */
+	    t = zero;
+	    __HI(t) = (n&~(0x000fffff>>k));
+	    n = ((n&0x000fffff)|0x00100000)>>(20-k);
+	    if(j<0) n = -n;
+	    p_h -= t;
+	} 
+	t = p_l+p_h;
+	__LO(t) = 0;
+	u = t*lg2_h;
+	v = (p_l-(t-p_h))*lg2+t*lg2_l;
+	z = u+v;
+	w = v-(z-u);
+	t  = z*z;
+	t1  = z - t*(P1+t*(P2+t*(P3+t*(P4+t*P5))));
+	r  = (z*t1)/(t1-two)-(w+z*w);
+	z  = one-(r-z);
+	j  = __HI(z);
+	j += (n<<20);
+	if((j>>20)<=0) z = fd_scalbn(z,n);	/* subnormal output */
+	else __HI(z) += (n<<20);
+	return s*z;
+}

mozilla/js/ref/fdlibm/e_rem_pio2.c

@@ -0,0 +1,191 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public License
+ * Version 1.0 (the "NPL"); you may not use this file except in
+ * compliance with the NPL.  You may obtain a copy of the NPL at
+ * http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the NPL is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+ * for the specific language governing rights and limitations under the
+ * NPL.
+ *
+ * The Initial Developer of this code under the NPL is Sun Microsystems,
+ * Inc.  Portions created by Netscape are Copyright (C) 1998 Netscape
+ * Communications Corporation.  All Rights Reserved.
+ */
+
+/* @(#)e_rem_pio2.c 1.4 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ *
+ */
+
+/* __ieee754_rem_pio2(x,y)
+ * 
+ * return the remainder of x rem pi/2 in y[0]+y[1] 
+ * use __kernel_rem_pio2()
+ */
+
+#include "fdlibm.h"
+
+/*
+ * Table of constants for 2/pi, 396 Hex digits (476 decimal) of 2/pi 
+ */
+#ifdef __STDC__
+static const int two_over_pi[] = {
+#else
+static int two_over_pi[] = {
+#endif
+0xA2F983, 0x6E4E44, 0x1529FC, 0x2757D1, 0xF534DD, 0xC0DB62, 
+0x95993C, 0x439041, 0xFE5163, 0xABDEBB, 0xC561B7, 0x246E3A, 
+0x424DD2, 0xE00649, 0x2EEA09, 0xD1921C, 0xFE1DEB, 0x1CB129, 
+0xA73EE8, 0x8235F5, 0x2EBB44, 0x84E99C, 0x7026B4, 0x5F7E41, 
+0x3991D6, 0x398353, 0x39F49C, 0x845F8B, 0xBDF928, 0x3B1FF8, 
+0x97FFDE, 0x05980F, 0xEF2F11, 0x8B5A0A, 0x6D1F6D, 0x367ECF, 
+0x27CB09, 0xB74F46, 0x3F669E, 0x5FEA2D, 0x7527BA, 0xC7EBE5, 
+0xF17B3D, 0x0739F7, 0x8A5292, 0xEA6BFB, 0x5FB11F, 0x8D5D08, 
+0x560330, 0x46FC7B, 0x6BABF0, 0xCFBC20, 0x9AF436, 0x1DA9E3, 
+0x91615E, 0xE61B08, 0x659985, 0x5F14A0, 0x68408D, 0xFFD880, 
+0x4D7327, 0x310606, 0x1556CA, 0x73A8C9, 0x60E27B, 0xC08C6B, 
+};
+
+#ifdef __STDC__
+static const int npio2_hw[] = {
+#else
+static int npio2_hw[] = {
+#endif
+0x3FF921FB, 0x400921FB, 0x4012D97C, 0x401921FB, 0x401F6A7A, 0x4022D97C,
+0x4025FDBB, 0x402921FB, 0x402C463A, 0x402F6A7A, 0x4031475C, 0x4032D97C,
+0x40346B9C, 0x4035FDBB, 0x40378FDB, 0x403921FB, 0x403AB41B, 0x403C463A,
+0x403DD85A, 0x403F6A7A, 0x40407E4C, 0x4041475C, 0x4042106C, 0x4042D97C,
+0x4043A28C, 0x40446B9C, 0x404534AC, 0x4045FDBB, 0x4046C6CB, 0x40478FDB,
+0x404858EB, 0x404921FB,
+};
+
+/*
+ * invpio2:  53 bits of 2/pi
+ * pio2_1:   first  33 bit of pi/2
+ * pio2_1t:  pi/2 - pio2_1
+ * pio2_2:   second 33 bit of pi/2
+ * pio2_2t:  pi/2 - (pio2_1+pio2_2)
+ * pio2_3:   third  33 bit of pi/2
+ * pio2_3t:  pi/2 - (pio2_1+pio2_2+pio2_3)
+ */
+
+#ifdef __STDC__
+static const double 
+#else
+static double 
+#endif
+zero =  0.00000000000000000000e+00, /* 0x00000000, 0x00000000 */
+half =  5.00000000000000000000e-01, /* 0x3FE00000, 0x00000000 */
+two24 =  1.67772160000000000000e+07, /* 0x41700000, 0x00000000 */
+invpio2 =  6.36619772367581382433e-01, /* 0x3FE45F30, 0x6DC9C883 */
+pio2_1  =  1.57079632673412561417e+00, /* 0x3FF921FB, 0x54400000 */
+pio2_1t =  6.07710050650619224932e-11, /* 0x3DD0B461, 0x1A626331 */
+pio2_2  =  6.07710050630396597660e-11, /* 0x3DD0B461, 0x1A600000 */
+pio2_2t =  2.02226624879595063154e-21, /* 0x3BA3198A, 0x2E037073 */
+pio2_3  =  2.02226624871116645580e-21, /* 0x3BA3198A, 0x2E000000 */
+pio2_3t =  8.47842766036889956997e-32; /* 0x397B839A, 0x252049C1 */
+
+#ifdef __STDC__
+	int __ieee754_rem_pio2(double x, double *y)
+#else
+	int __ieee754_rem_pio2(x,y)
+	double x,y[];
+#endif
+{
+	double z,w,t,r,fn;
+	double tx[3];
+	int e0,i,j,nx,n,ix,hx;
+
+	hx = __HI(x);		/* high word of x */
+	ix = hx&0x7fffffff;
+	if(ix<=0x3fe921fb)   /* |x| ~<= pi/4 , no need for reduction */
+	    {y[0] = x; y[1] = 0; return 0;}
+	if(ix<0x4002d97c) {  /* |x| < 3pi/4, special case with n=+-1 */
+	    if(hx>0) { 
+		z = x - pio2_1;
+		if(ix!=0x3ff921fb) { 	/* 33+53 bit pi is good enough */
+		    y[0] = z - pio2_1t;
+		    y[1] = (z-y[0])-pio2_1t;
+		} else {		/* near pi/2, use 33+33+53 bit pi */
+		    z -= pio2_2;
+		    y[0] = z - pio2_2t;
+		    y[1] = (z-y[0])-pio2_2t;
+		}
+		return 1;
+	    } else {	/* negative x */
+		z = x + pio2_1;
+		if(ix!=0x3ff921fb) { 	/* 33+53 bit pi is good enough */
+		    y[0] = z + pio2_1t;
+		    y[1] = (z-y[0])+pio2_1t;
+		} else {		/* near pi/2, use 33+33+53 bit pi */
+		    z += pio2_2;
+		    y[0] = z + pio2_2t;
+		    y[1] = (z-y[0])+pio2_2t;
+		}
+		return -1;
+	    }
+	}
+	if(ix<=0x413921fb) { /* |x| ~<= 2^19*(pi/2), medium size */
+	    t  = fd_fabs(x);
+	    n  = (int) (t*invpio2+half);
+	    fn = (double)n;
+	    r  = t-fn*pio2_1;
+	    w  = fn*pio2_1t;	/* 1st round good to 85 bit */
+	    if(n<32&&ix!=npio2_hw[n-1]) {	
+		y[0] = r-w;	/* quick check no cancellation */
+	    } else {
+	        j  = ix>>20;
+	        y[0] = r-w; 
+	        i = j-(((__HI(y[0]))>>20)&0x7ff);
+	        if(i>16) {  /* 2nd iteration needed, good to 118 */
+		    t  = r;
+		    w  = fn*pio2_2;	
+		    r  = t-w;
+		    w  = fn*pio2_2t-((t-r)-w);	
+		    y[0] = r-w;
+		    i = j-(((__HI(y[0]))>>20)&0x7ff);
+		    if(i>49)  {	/* 3rd iteration need, 151 bits acc */
+		    	t  = r;	/* will cover all possible cases */
+		    	w  = fn*pio2_3;	
+		    	r  = t-w;
+		    	w  = fn*pio2_3t-((t-r)-w);	
+		    	y[0] = r-w;
+		    }
+		}
+	    }
+	    y[1] = (r-y[0])-w;
+	    if(hx<0) 	{y[0] = -y[0]; y[1] = -y[1]; return -n;}
+	    else	 return n;
+	}
+    /* 
+     * all other (large) arguments
+     */
+	if(ix>=0x7ff00000) {		/* x is inf or NaN */
+	    y[0]=y[1]=x-x; return 0;
+	}
+    /* set z = scalbn(|x|,ilogb(x)-23) */
+	__LO(z) = __LO(x);
+	e0 	= (ix>>20)-1046;	/* e0 = ilogb(z)-23; */
+	__HI(z) = ix - (e0<<20);
+	for(i=0;i<2;i++) {
+		tx[i] = (double)((int)(z));
+		z     = (z-tx[i])*two24;
+	}
+	tx[2] = z;
+	nx = 3;
+	while(tx[nx-1]==zero) nx--;	/* skip zero term */
+	n  =  __kernel_rem_pio2(tx,y,e0,nx,2,two_over_pi);
+	if(hx<0) {y[0] = -y[0]; y[1] = -y[1]; return -n;}
+	return n;
+}

mozilla/js/ref/fdlibm/e_remainder.c

@@ -0,0 +1,93 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public License
+ * Version 1.0 (the "NPL"); you may not use this file except in
+ * compliance with the NPL.  You may obtain a copy of the NPL at
+ * http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the NPL is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+ * for the specific language governing rights and limitations under the
+ * NPL.
+ *
+ * The Initial Developer of this code under the NPL is Sun Microsystems,
+ * Inc.  Portions created by Netscape are Copyright (C) 1998 Netscape
+ * Communications Corporation.  All Rights Reserved.
+ */
+
+/* @(#)e_remainder.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* __ieee754_remainder(x,p)
+ * Return :                  
+ * 	returns  x REM p  =  x - [x/p]*p as if in infinite 
+ * 	precise arithmetic, where [x/p] is the (infinite bit) 
+ *	integer nearest x/p (in half way case choose the even one).
+ * Method : 
+ *	Based on fmod() return x-[x/p]chopped*p exactlp.
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double zero = 0.0;
+#else
+static double zero = 0.0;
+#endif
+
+
+#ifdef __STDC__
+	double __ieee754_remainder(double x, double p)
+#else
+	double __ieee754_remainder(x,p)
+	double x,p;
+#endif
+{
+	int hx,hp;
+	unsigned sx,lx,lp;
+	double p_half;
+
+	hx = __HI(x);		/* high word of x */
+	lx = __LO(x);		/* low  word of x */
+	hp = __HI(p);		/* high word of p */
+	lp = __LO(p);		/* low  word of p */
+	sx = hx&0x80000000;
+	hp &= 0x7fffffff;
+	hx &= 0x7fffffff;
+
+    /* purge off exception values */
+	if((hp|lp)==0) return (x*p)/(x*p); 	/* p = 0 */
+	if((hx>=0x7ff00000)||			/* x not finite */
+	  ((hp>=0x7ff00000)&&			/* p is NaN */
+	  (((hp-0x7ff00000)|lp)!=0)))
+	    return (x*p)/(x*p);
+
+
+	if (hp<=0x7fdfffff) x = __ieee754_fmod(x,p+p);	/* now x < 2p */
+	if (((hx-hp)|(lx-lp))==0) return zero*x;
+	x  = fd_fabs(x);
+	p  = fd_fabs(p);
+	if (hp<0x00200000) {
+	    if(x+x>p) {
+		x-=p;
+		if(x+x>=p) x -= p;
+	    }
+	} else {
+	    p_half = 0.5*p;
+	    if(x>p_half) {
+		x-=p;
+		if(x>=p_half) x -= p;
+	    }
+	}
+	__HI(x) ^= sx;
+	return x;
+}

mozilla/js/ref/fdlibm/e_scalb.c

@@ -0,0 +1,67 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public License
+ * Version 1.0 (the "NPL"); you may not use this file except in
+ * compliance with the NPL.  You may obtain a copy of the NPL at
+ * http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the NPL is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+ * for the specific language governing rights and limitations under the
+ * NPL.
+ *
+ * The Initial Developer of this code under the NPL is Sun Microsystems,
+ * Inc.  Portions created by Netscape are Copyright (C) 1998 Netscape
+ * Communications Corporation.  All Rights Reserved.
+ */
+
+/* @(#)e_scalb.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/*
+ * __ieee754_scalb(x, fn) is provide for
+ * passing various standard test suite. One 
+ * should use scalbn() instead.
+ */
+
+#include "fdlibm.h"
+
+#ifdef _SCALB_INT
+#ifdef __STDC__
+	double __ieee754_scalb(double x, int fn)
+#else
+	double __ieee754_scalb(x,fn)
+	double x; int fn;
+#endif
+#else
+#ifdef __STDC__
+	double __ieee754_scalb(double x, double fn)
+#else
+	double __ieee754_scalb(x,fn)
+	double x, fn;
+#endif
+#endif
+{
+#ifdef _SCALB_INT
+	return fd_scalbn(x,fn);
+#else
+	if (fd_isnan(x)||fd_isnan(fn)) return x*fn;
+	if (!fd_finite(fn)) {
+	    if(fn>0.0) return x*fn;
+	    else       return x/(-fn);
+	}
+	if (fd_rint(fn)!=fn) return (fn-fn)/(fn-fn);
+	if ( fn > 65000.0) return fd_scalbn(x, 65000);
+	if (-fn > 65000.0) return fd_scalbn(x,-65000);
+	return fd_scalbn(x,(int)fn);
+#endif
+}

mozilla/js/ref/fdlibm/e_sinh.c

@@ -0,0 +1,98 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public License
+ * Version 1.0 (the "NPL"); you may not use this file except in
+ * compliance with the NPL.  You may obtain a copy of the NPL at
+ * http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the NPL is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+ * for the specific language governing rights and limitations under the
+ * NPL.
+ *
+ * The Initial Developer of this code under the NPL is Sun Microsystems,
+ * Inc.  Portions created by Netscape are Copyright (C) 1998 Netscape
+ * Communications Corporation.  All Rights Reserved.
+ */
+
+/* @(#)e_sinh.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* __ieee754_sinh(x)
+ * Method : 
+ * mathematically sinh(x) if defined to be (exp(x)-exp(-x))/2
+ *	1. Replace x by |x| (sinh(-x) = -sinh(x)). 
+ *	2. 
+ *		                                    E + E/(E+1)
+ *	    0        <= x <= 22     :  sinh(x) := --------------, E=expm1(x)
+ *			       			        2
+ *
+ *	    22       <= x <= lnovft :  sinh(x) := exp(x)/2 
+ *	    lnovft   <= x <= ln2ovft:  sinh(x) := exp(x/2)/2 * exp(x/2)
+ *	    ln2ovft  <  x	    :  sinh(x) := x*shuge (overflow)
+ *
+ * Special cases:
+ *	sinh(x) is |x| if x is +INF, -INF, or NaN.
+ *	only sinh(0)=0 is exact for finite x.
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double one = 1.0, shuge = 1.0e307;
+#else
+static double one = 1.0, shuge = 1.0e307;
+#endif
+
+#ifdef __STDC__
+	double __ieee754_sinh(double x)
+#else
+	double __ieee754_sinh(x)
+	double x;
+#endif
+{	
+	double t,w,h;
+	int ix,jx;
+	unsigned lx;
+
+    /* High word of |x|. */
+	jx = __HI(x);
+	ix = jx&0x7fffffff;
+
+    /* x is INF or NaN */
+	if(ix>=0x7ff00000) return x+x;	
+
+	h = 0.5;
+	if (jx<0) h = -h;
+    /* |x| in [0,22], return sign(x)*0.5*(E+E/(E+1))) */
+	if (ix < 0x40360000) {		/* |x|<22 */
+	    if (ix<0x3e300000) 		/* |x|<2**-28 */
+		if(shuge+x>one) return x;/* sinh(tiny) = tiny with inexact */
+	    t = fd_expm1(fd_fabs(x));
+	    if(ix<0x3ff00000) return h*(2.0*t-t*t/(t+one));
+	    return h*(t+t/(t+one));
+	}
+
+    /* |x| in [22, log(maxdouble)] return 0.5*exp(|x|) */
+	if (ix < 0x40862E42)  return h*__ieee754_exp(fd_fabs(x));
+
+    /* |x| in [log(maxdouble), overflowthresold] */
+	lx = *( (((*(unsigned*)&one)>>29)) + (unsigned*)&x);
+	if (ix<0x408633CE || (ix==0x408633ce)&&(lx<=(unsigned)0x8fb9f87d)) {
+	    w = __ieee754_exp(0.5*fd_fabs(x));
+	    t = h*w;
+	    return t*w;
+	}
+
+    /* |x| > overflowthresold, sinh(x) overflow */
+	return x*shuge;
+}

mozilla/js/ref/fdlibm/e_sqrt.c

@@ -0,0 +1,466 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public License
+ * Version 1.0 (the "NPL"); you may not use this file except in
+ * compliance with the NPL.  You may obtain a copy of the NPL at
+ * http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the NPL is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+ * for the specific language governing rights and limitations under the
+ * NPL.
+ *
+ * The Initial Developer of this code under the NPL is Sun Microsystems,
+ * Inc.  Portions created by Netscape are Copyright (C) 1998 Netscape
+ * Communications Corporation.  All Rights Reserved.
+ */
+/* @(#)e_sqrt.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* __ieee754_sqrt(x)
+ * Return correctly rounded sqrt.
+ *           ------------------------------------------
+ *	     |  Use the hardware sqrt if you have one |
+ *           ------------------------------------------
+ * Method: 
+ *   Bit by bit method using integer arithmetic. (Slow, but portable) 
+ *   1. Normalization
+ *	Scale x to y in [1,4) with even powers of 2: 
+ *	find an integer k such that  1 <= (y=x*2^(2k)) < 4, then
+ *		sqrt(x) = 2^k * sqrt(y)
+ *   2. Bit by bit computation
+ *	Let q  = sqrt(y) truncated to i bit after binary point (q = 1),
+ *	     i							 0
+ *                                     i+1         2
+ *	    s  = 2*q , and	y  =  2   * ( y - q  ).		(1)
+ *	     i      i            i                 i
+ *                                                        
+ *	To compute q    from q , one checks whether 
+ *		    i+1       i                       
+ *
+ *			      -(i+1) 2
+ *			(q + 2      ) <= y.			(2)
+ *     			  i
+ *							      -(i+1)
+ *	If (2) is false, then q   = q ; otherwise q   = q  + 2      .
+ *		 	       i+1   i             i+1   i
+ *
+ *	With some algebric manipulation, it is not difficult to see
+ *	that (2) is equivalent to 
+ *                             -(i+1)
+ *			s  +  2       <= y			(3)
+ *			 i                i
+ *
+ *	The advantage of (3) is that s  and y  can be computed by 
+ *				      i      i
+ *	the following recurrence formula:
+ *	    if (3) is false
+ *
+ *	    s     =  s  ,	y    = y   ;			(4)
+ *	     i+1      i		 i+1    i
+ *
+ *	    otherwise,
+ *                         -i                     -(i+1)
+ *	    s	  =  s  + 2  ,  y    = y  -  s  - 2  		(5)
+ *           i+1      i          i+1    i     i
+ *				
+ *	One may easily use induction to prove (4) and (5). 
+ *	Note. Since the left hand side of (3) contain only i+2 bits,
+ *	      it does not necessary to do a full (53-bit) comparison 
+ *	      in (3).
+ *   3. Final rounding
+ *	After generating the 53 bits result, we compute one more bit.
+ *	Together with the remainder, we can decide whether the
+ *	result is exact, bigger than 1/2ulp, or less than 1/2ulp
+ *	(it will never equal to 1/2ulp).
+ *	The rounding mode can be detected by checking whether
+ *	huge + tiny is equal to huge, and whether huge - tiny is
+ *	equal to huge for some floating point number "huge" and "tiny".
+ *		
+ * Special cases:
+ *	sqrt(+-0) = +-0 	... exact
+ *	sqrt(inf) = inf
+ *	sqrt(-ve) = NaN		... with invalid signal
+ *	sqrt(NaN) = NaN		... with invalid signal for signaling NaN
+ *
+ * Other methods : see the appended file at the end of the program below.
+ *---------------
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static	const double	one	= 1.0, tiny=1.0e-300;
+#else
+static	double	one	= 1.0, tiny=1.0e-300;
+#endif
+
+#ifdef __STDC__
+	double __ieee754_sqrt(double x)
+#else
+	double __ieee754_sqrt(x)
+	double x;
+#endif
+{
+	double z;
+	int 	sign = (int)0x80000000; 
+	unsigned r,t1,s1,ix1,q1;
+	int ix0,s0,q,m,t,i;
+
+	ix0 = __HI(x);			/* high word of x */
+	ix1 = __LO(x);		/* low word of x */
+
+    /* take care of Inf and NaN */
+	if((ix0&0x7ff00000)==0x7ff00000) {			
+	    return x*x+x;		/* sqrt(NaN)=NaN, sqrt(+inf)=+inf
+					   sqrt(-inf)=sNaN */
+	} 
+    /* take care of zero */
+	if(ix0<=0) {
+	    if(((ix0&(~sign))|ix1)==0) return x;/* sqrt(+-0) = +-0 */
+	    else if(ix0<0)
+		return (x-x)/(x-x);		/* sqrt(-ve) = sNaN */
+	}
+    /* normalize x */
+	m = (ix0>>20);
+	if(m==0) {				/* subnormal x */
+	    while(ix0==0) {
+		m -= 21;
+		ix0 |= (ix1>>11); ix1 <<= 21;
+	    }
+	    for(i=0;(ix0&0x00100000)==0;i++) ix0<<=1;
+	    m -= i-1;
+	    ix0 |= (ix1>>(32-i));
+	    ix1 <<= i;
+	}
+	m -= 1023;	/* unbias exponent */
+	ix0 = (ix0&0x000fffff)|0x00100000;
+	if(m&1){	/* odd m, double x to make it even */
+	    ix0 += ix0 + ((ix1&sign)>>31);
+	    ix1 += ix1;
+	}
+	m >>= 1;	/* m = [m/2] */
+
+    /* generate sqrt(x) bit by bit */
+	ix0 += ix0 + ((ix1&sign)>>31);
+	ix1 += ix1;
+	q = q1 = s0 = s1 = 0;	/* [q,q1] = sqrt(x) */
+	r = 0x00200000;		/* r = moving bit from right to left */
+
+	while(r!=0) {
+	    t = s0+r; 
+	    if(t<=ix0) { 
+		s0   = t+r; 
+		ix0 -= t; 
+		q   += r; 
+	    } 
+	    ix0 += ix0 + ((ix1&sign)>>31);
+	    ix1 += ix1;
+	    r>>=1;
+	}
+
+	r = sign;
+	while(r!=0) {
+	    t1 = s1+r; 
+	    t  = s0;
+	    if((t<ix0)||((t==ix0)&&(t1<=ix1))) { 
+		s1  = t1+r;
+		if(((int)(t1&sign)==sign)&&(s1&sign)==0) s0 += 1;
+		ix0 -= t;
+		if (ix1 < t1) ix0 -= 1;
+		ix1 -= t1;
+		q1  += r;
+	    }
+	    ix0 += ix0 + ((ix1&sign)>>31);
+	    ix1 += ix1;
+	    r>>=1;
+	}
+
+    /* use floating add to find out rounding direction */
+	if((ix0|ix1)!=0) {
+	    z = one-tiny; /* trigger inexact flag */
+	    if (z>=one) {
+	        z = one+tiny;
+	        if (q1==(unsigned)0xffffffff) { q1=0; q += 1;}
+		else if (z>one) {
+		    if (q1==(unsigned)0xfffffffe) q+=1;
+		    q1+=2; 
+		} else
+	            q1 += (q1&1);
+	    }
+	}
+	ix0 = (q>>1)+0x3fe00000;
+	ix1 =  q1>>1;
+	if ((q&1)==1) ix1 |= sign;
+	ix0 += (m <<20);
+	__HI(z) = ix0;
+	__LO(z) = ix1;
+	return z;
+}
+
+/*
+Other methods  (use floating-point arithmetic)
+-------------
+(This is a copy of a drafted paper by Prof W. Kahan 
+and K.C. Ng, written in May, 1986)
+
+	Two algorithms are given here to implement sqrt(x) 
+	(IEEE double precision arithmetic) in software.
+	Both supply sqrt(x) correctly rounded. The first algorithm (in
+	Section A) uses newton iterations and involves four divisions.
+	The second one uses reciproot iterations to avoid division, but
+	requires more multiplications. Both algorithms need the ability
+	to chop results of arithmetic operations instead of round them, 
+	and the INEXACT flag to indicate when an arithmetic operation
+	is executed exactly with no roundoff error, all part of the 
+	standard (IEEE 754-1985). The ability to perform shift, add,
+	subtract and logical AND operations upon 32-bit words is needed
+	too, though not part of the standard.
+
+A.  sqrt(x) by Newton Iteration
+
+   (1)	Initial approximation
+
+	Let x0 and x1 be the leading and the trailing 32-bit words of
+	a floating point number x (in IEEE double format) respectively 
+
+	    1    11		     52				  ...widths
+	   ------------------------------------------------------
+	x: |s|	  e     |	      f				|
+	   ------------------------------------------------------
+	      msb    lsb  msb				      lsb ...order
+
+ 
+	     ------------------------  	     ------------------------
+	x0:  |s|   e    |    f1     |	 x1: |          f2           |
+	     ------------------------  	     ------------------------
+
+	By performing shifts and subtracts on x0 and x1 (both regarded
+	as integers), we obtain an 8-bit approximation of sqrt(x) as
+	follows.
+
+		k  := (x0>>1) + 0x1ff80000;
+		y0 := k - T1[31&(k>>15)].	... y ~ sqrt(x) to 8 bits
+	Here k is a 32-bit integer and T1[] is an integer array containing
+	correction terms. Now magically the floating value of y (y's
+	leading 32-bit word is y0, the value of its trailing word is 0)
+	approximates sqrt(x) to almost 8-bit.
+
+	Value of T1:
+	static int T1[32]= {
+	0,	1024,	3062,	5746,	9193,	13348,	18162,	23592,
+	29598,	36145,	43202,	50740,	58733,	67158,	75992,	85215,
+	83599,	71378,	60428,	50647,	41945,	34246,	27478,	21581,
+	16499,	12183,	8588,	5674,	3403,	1742,	661,	130,};
+
+    (2)	Iterative refinement
+
+	Apply Heron's rule three times to y, we have y approximates 
+	sqrt(x) to within 1 ulp (Unit in the Last Place):
+
+		y := (y+x/y)/2		... almost 17 sig. bits
+		y := (y+x/y)/2		... almost 35 sig. bits
+		y := y-(y-x/y)/2	... within 1 ulp
+
+
+	Remark 1.
+	    Another way to improve y to within 1 ulp is:
+
+		y := (y+x/y)		... almost 17 sig. bits to 2*sqrt(x)
+		y := y - 0x00100006	... almost 18 sig. bits to sqrt(x)
+
+				2
+			    (x-y )*y
+		y := y + 2* ----------	...within 1 ulp
+			       2
+			     3y  + x
+
+
+	This formula has one division fewer than the one above; however,
+	it requires more multiplications and additions. Also x must be
+	scaled in advance to avoid spurious overflow in evaluating the
+	expression 3y*y+x. Hence it is not recommended uless division
+	is slow. If division is very slow, then one should use the 
+	reciproot algorithm given in section B.
+
+    (3) Final adjustment
+
+	By twiddling y's last bit it is possible to force y to be 
+	correctly rounded according to the prevailing rounding mode
+	as follows. Let r and i be copies of the rounding mode and
+	inexact flag before entering the square root program. Also we
+	use the expression y+-ulp for the next representable floating
+	numbers (up and down) of y. Note that y+-ulp = either fixed
+	point y+-1, or multiply y by nextafter(1,+-inf) in chopped
+	mode.
+
+		I := FALSE;	... reset INEXACT flag I
+		R := RZ;	... set rounding mode to round-toward-zero
+		z := x/y;	... chopped quotient, possibly inexact
+		If(not I) then {	... if the quotient is exact
+		    if(z=y) {
+		        I := i;	 ... restore inexact flag
+		        R := r;  ... restore rounded mode
+		        return sqrt(x):=y.
+		    } else {
+			z := z - ulp;	... special rounding
+		    }
+		}
+		i := TRUE;		... sqrt(x) is inexact
+		If (r=RN) then z=z+ulp	... rounded-to-nearest
+		If (r=RP) then {	... round-toward-+inf
+		    y = y+ulp; z=z+ulp;
+		}
+		y := y+z;		... chopped sum
+		y0:=y0-0x00100000;	... y := y/2 is correctly rounded.
+	        I := i;	 		... restore inexact flag
+	        R := r;  		... restore rounded mode
+	        return sqrt(x):=y.
+		    
+    (4)	Special cases
+
+	Square root of +inf, +-0, or NaN is itself;
+	Square root of a negative number is NaN with invalid signal.
+
+
+B.  sqrt(x) by Reciproot Iteration
+
+   (1)	Initial approximation
+
+	Let x0 and x1 be the leading and the trailing 32-bit words of
+	a floating point number x (in IEEE double format) respectively
+	(see section A). By performing shifs and subtracts on x0 and y0,
+	we obtain a 7.8-bit approximation of 1/sqrt(x) as follows.
+
+	    k := 0x5fe80000 - (x0>>1);
+	    y0:= k - T2[63&(k>>14)].	... y ~ 1/sqrt(x) to 7.8 bits
+
+	Here k is a 32-bit integer and T2[] is an integer array 
+	containing correction terms. Now magically the floating
+	value of y (y's leading 32-bit word is y0, the value of
+	its trailing word y1 is set to zero) approximates 1/sqrt(x)
+	to almost 7.8-bit.
+
+	Value of T2:
+	static int T2[64]= {
+	0x1500,	0x2ef8,	0x4d67,	0x6b02,	0x87be,	0xa395,	0xbe7a,	0xd866,
+	0xf14a,	0x1091b,0x11fcd,0x13552,0x14999,0x15c98,0x16e34,0x17e5f,
+	0x18d03,0x19a01,0x1a545,0x1ae8a,0x1b5c4,0x1bb01,0x1bfde,0x1c28d,
+	0x1c2de,0x1c0db,0x1ba73,0x1b11c,0x1a4b5,0x1953d,0x18266,0x16be0,
+	0x1683e,0x179d8,0x18a4d,0x19992,0x1a789,0x1b445,0x1bf61,0x1c989,
+	0x1d16d,0x1d77b,0x1dddf,0x1e2ad,0x1e5bf,0x1e6e8,0x1e654,0x1e3cd,
+	0x1df2a,0x1d635,0x1cb16,0x1be2c,0x1ae4e,0x19bde,0x1868e,0x16e2e,
+	0x1527f,0x1334a,0x11051,0xe951,	0xbe01,	0x8e0d,	0x5924,	0x1edd,};
+
+    (2)	Iterative refinement
+
+	Apply Reciproot iteration three times to y and multiply the
+	result by x to get an approximation z that matches sqrt(x)
+	to about 1 ulp. To be exact, we will have 
+		-1ulp < sqrt(x)-z<1.0625ulp.
+	
+	... set rounding mode to Round-to-nearest
+	   y := y*(1.5-0.5*x*y*y)	... almost 15 sig. bits to 1/sqrt(x)
+	   y := y*((1.5-2^-30)+0.5*x*y*y)... about 29 sig. bits to 1/sqrt(x)
+	... special arrangement for better accuracy
+	   z := x*y			... 29 bits to sqrt(x), with z*y<1
+	   z := z + 0.5*z*(1-z*y)	... about 1 ulp to sqrt(x)
+
+	Remark 2. The constant 1.5-2^-30 is chosen to bias the error so that
+	(a) the term z*y in the final iteration is always less than 1; 
+	(b) the error in the final result is biased upward so that
+		-1 ulp < sqrt(x) - z < 1.0625 ulp
+	    instead of |sqrt(x)-z|<1.03125ulp.
+
+    (3)	Final adjustment
+
+	By twiddling y's last bit it is possible to force y to be 
+	correctly rounded according to the prevailing rounding mode
+	as follows. Let r and i be copies of the rounding mode and
+	inexact flag before entering the square root program. Also we
+	use the expression y+-ulp for the next representable floating
+	numbers (up and down) of y. Note that y+-ulp = either fixed
+	point y+-1, or multiply y by nextafter(1,+-inf) in chopped
+	mode.
+
+	R := RZ;		... set rounding mode to round-toward-zero
+	switch(r) {
+	    case RN:		... round-to-nearest
+	       if(x<= z*(z-ulp)...chopped) z = z - ulp; else
+	       if(x<= z*(z+ulp)...chopped) z = z; else z = z+ulp;
+	       break;
+	    case RZ:case RM:	... round-to-zero or round-to--inf
+	       R:=RP;		... reset rounding mod to round-to-+inf
+	       if(x<z*z ... rounded up) z = z - ulp; else
+	       if(x>=(z+ulp)*(z+ulp) ...rounded up) z = z+ulp;
+	       break;
+	    case RP:		... round-to-+inf
+	       if(x>(z+ulp)*(z+ulp)...chopped) z = z+2*ulp; else
+	       if(x>z*z ...chopped) z = z+ulp;
+	       break;
+	}
+
+	Remark 3. The above comparisons can be done in fixed point. For
+	example, to compare x and w=z*z chopped, it suffices to compare
+	x1 and w1 (the trailing parts of x and w), regarding them as
+	two's complement integers.
+
+	...Is z an exact square root?
+	To determine whether z is an exact square root of x, let z1 be the
+	trailing part of z, and also let x0 and x1 be the leading and
+	trailing parts of x.
+
+	If ((z1&0x03ffffff)!=0)	... not exact if trailing 26 bits of z!=0
+	    I := 1;		... Raise Inexact flag: z is not exact
+	else {
+	    j := 1 - [(x0>>20)&1]	... j = logb(x) mod 2
+	    k := z1 >> 26;		... get z's 25-th and 26-th 
+					    fraction bits
+	    I := i or (k&j) or ((k&(j+j+1))!=(x1&3));
+	}
+	R:= r		... restore rounded mode
+	return sqrt(x):=z.
+
+	If multiplication is cheaper then the foregoing red tape, the 
+	Inexact flag can be evaluated by
+
+	    I := i;
+	    I := (z*z!=x) or I.
+
+	Note that z*z can overwrite I; this value must be sensed if it is 
+	True.
+
+	Remark 4. If z*z = x exactly, then bit 25 to bit 0 of z1 must be
+	zero.
+
+		    --------------------
+		z1: |        f2        | 
+		    --------------------
+		bit 31		   bit 0
+
+	Further more, bit 27 and 26 of z1, bit 0 and 1 of x1, and the odd
+	or even of logb(x) have the following relations:
+
+	-------------------------------------------------
+	bit 27,26 of z1		bit 1,0 of x1	logb(x)
+	-------------------------------------------------
+	00			00		odd and even
+	01			01		even
+	10			10		odd
+	10			00		even
+	11			01		even
+	-------------------------------------------------
+
+    (4)	Special cases (see (4) of Section A).	
+ 
+ */
+ 

mozilla/js/ref/fdlibm/fdlibm.h

@@ -0,0 +1,242 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public License
+ * Version 1.0 (the "NPL"); you may not use this file except in
+ * compliance with the NPL.  You may obtain a copy of the NPL at
+ * http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the NPL is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+ * for the specific language governing rights and limitations under the
+ * NPL.
+ *
+ * The Initial Developer of this code under the NPL is Sun Microsystems,
+ * Inc.  Portions created by Netscape are Copyright (C) 1998 Netscape
+ * Communications Corporation.  All Rights Reserved.
+ */
+
+/* @(#)fdlibm.h 1.5 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+
+/* Modified defines start here.. */
+#ifdef _WIN32
+#define huge myhuge
+#define __LITTLE_ENDIAN
+#endif
+
+/* End here. The rest is the standard file. */
+
+#ifdef __NEWVALID	/* special setup for Sun test regime */
+#if defined(i386) || defined(i486) || \
+	defined(intel) || defined(x86) || defined(i86pc)
+#define __LITTLE_ENDIAN
+#endif
+#endif
+
+
+#ifdef __LITTLE_ENDIAN
+#define __HI(x) *(1+(int*)&x)
+#define __LO(x) *(int*)&x
+#define __HIp(x) *(1+(int*)x)
+#define __LOp(x) *(int*)x
+#else
+#define __HI(x) *(int*)&x
+#define __LO(x) *(1+(int*)&x)
+#define __HIp(x) *(int*)x
+#define __LOp(x) *(1+(int*)x)
+#endif
+
+#ifdef __STDC__
+#define	__P(p)	p
+#else
+#define	__P(p)	()
+#endif
+
+/*
+ * ANSI/POSIX
+ */
+
+extern int signgam;
+
+#define	MAXFLOAT	((float)3.40282346638528860e+38)
+
+enum fdversion {fdlibm_ieee = -1, fdlibm_svid, fdlibm_xopen, fdlibm_posix};
+
+#define _LIB_VERSION_TYPE enum fdversion
+#define _LIB_VERSION _fdlib_version  
+
+/* if global variable _LIB_VERSION is not desirable, one may 
+ * change the following to be a constant by: 
+ *	#define _LIB_VERSION_TYPE const enum version
+ * In that case, after one initializes the value _LIB_VERSION (see
+ * s_lib_version.c) during compile time, it cannot be modified
+ * in the middle of a program
+ */ 
+extern  _LIB_VERSION_TYPE  _LIB_VERSION;
+
+#define _IEEE_  fdlibm_ieee
+#define _SVID_  fdlibm_svid
+#define _XOPEN_ fdlibm_xopen
+#define _POSIX_ fdlibm_posix
+
+struct exception {
+	int type;
+	char *name;
+	double arg1;
+	double arg2;
+	double retval;
+};
+
+#define	HUGE		MAXFLOAT
+
+/* 
+ * set X_TLOSS = pi*2**52, which is possibly defined in <values.h>
+ * (one may replace the following line by "#include <values.h>")
+ */
+
+#define X_TLOSS		1.41484755040568800000e+16 
+
+#define	DOMAIN		1
+#define	SING		2
+#define	OVERFLOW	3
+#define	UNDERFLOW	4
+#define	TLOSS		5
+#define	PLOSS		6
+
+/*
+ * ANSI/POSIX
+ */
+
+extern double fd_acos __P((double));
+extern double fd_asin __P((double));
+extern double fd_atan __P((double));
+extern double fd_atan2 __P((double, double));
+extern double fd_cos __P((double));
+extern double fd_sin __P((double));
+extern double fd_tan __P((double));
+ 
+extern double fd_cosh __P((double));
+extern double fd_sinh __P((double));
+extern double fd_tanh __P((double));
+
+extern double fd_exp __P((double));
+extern double fd_frexp __P((double, int *));
+extern double fd_ldexp __P((double, int));
+extern double fd_log __P((double));
+extern double fd_log10 __P((double));
+extern double fd_modf __P((double, double *));
+
+extern double fd_pow __P((double, double));
+extern double fd_sqrt __P((double));
+
+extern double fd_ceil __P((double));
+extern double fd_fabs __P((double));
+extern double fd_floor __P((double));
+extern double fd_fmod __P((double, double));
+
+extern double fd_erf __P((double));
+extern double fd_erfc __P((double));
+extern double fd_gamma __P((double));
+extern double fd_hypot __P((double, double));
+extern int fd_isnan __P((double));
+extern int fd_finite __P((double));
+extern double fd_j0 __P((double));
+extern double fd_j1 __P((double));
+extern double fd_jn __P((int, double));
+extern double fd_lgamma __P((double));
+extern double fd_y0 __P((double));
+extern double fd_y1 __P((double));
+extern double fd_yn __P((int, double));
+
+extern double fd_acosh __P((double));
+extern double fd_asinh __P((double));
+extern double fd_atanh __P((double));
+extern double fd_cbrt __P((double));
+extern double fd_logb __P((double));
+extern double fd_nextafter __P((double, double));
+extern double fd_remainder __P((double, double));
+#ifdef _SCALB_INT
+extern double fd_scalb __P((double, int));
+#else
+extern double fd_scalb __P((double, double));
+#endif
+
+extern int fd_matherr __P((struct exception *));
+
+/*
+ * IEEE Test Vector
+ */
+extern double significand __P((double));
+
+/*
+ * Functions callable from C, intended to support IEEE arithmetic.
+ */
+extern double fd_copysign __P((double, double));
+extern int fd_ilogb __P((double));
+extern double fd_rint __P((double));
+extern double fd_scalbn __P((double, int));
+
+/*
+ * BSD math library entry points
+ */
+extern double fd_expm1 __P((double));
+extern double fd_log1p __P((double));
+
+/*
+ * Reentrant version of gamma & lgamma; passes signgam back by reference
+ * as the second argument; user must allocate space for signgam.
+ */
+#ifdef _REENTRANT
+extern double gamma_r __P((double, int *));
+extern double lgamma_r __P((double, int *));
+#endif	/* _REENTRANT */
+
+/* ieee style elementary functions */
+extern double __ieee754_sqrt __P((double));			
+extern double __ieee754_acos __P((double));			
+extern double __ieee754_acosh __P((double));			
+extern double __ieee754_log __P((double));			
+extern double __ieee754_atanh __P((double));			
+extern double __ieee754_asin __P((double));			
+extern double __ieee754_atan2 __P((double,double));			
+extern double __ieee754_exp __P((double));
+extern double __ieee754_cosh __P((double));
+extern double __ieee754_fmod __P((double,double));
+extern double __ieee754_pow __P((double,double));
+extern double __ieee754_lgamma_r __P((double,int *));
+extern double __ieee754_gamma_r __P((double,int *));
+extern double __ieee754_lgamma __P((double));
+extern double __ieee754_gamma __P((double));
+extern double __ieee754_log10 __P((double));
+extern double __ieee754_sinh __P((double));
+extern double __ieee754_hypot __P((double,double));
+extern double __ieee754_j0 __P((double));
+extern double __ieee754_j1 __P((double));
+extern double __ieee754_y0 __P((double));
+extern double __ieee754_y1 __P((double));
+extern double __ieee754_jn __P((int,double));
+extern double __ieee754_yn __P((int,double));
+extern double __ieee754_remainder __P((double,double));
+extern int    __ieee754_rem_pio2 __P((double,double*));
+#ifdef _SCALB_INT
+extern double __ieee754_scalb __P((double,int));
+#else
+extern double __ieee754_scalb __P((double,double));
+#endif
+
+/* fdlibm kernel function */
+extern double __kernel_standard __P((double,double,int));	
+extern double __kernel_sin __P((double,double,int));
+extern double __kernel_cos __P((double,double));
+extern double __kernel_tan __P((double,double,int));
+extern int    __kernel_rem_pio2 __P((double*,double*,int,int,int,const int*));

mozilla/js/ref/fdlibm/k_cos.c

@@ -0,0 +1,108 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public License
+ * Version 1.0 (the "NPL"); you may not use this file except in
+ * compliance with the NPL.  You may obtain a copy of the NPL at
+ * http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the NPL is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+ * for the specific language governing rights and limitations under the
+ * NPL.
+ *
+ * The Initial Developer of this code under the NPL is Sun Microsystems,
+ * Inc.  Portions created by Netscape are Copyright (C) 1998 Netscape
+ * Communications Corporation.  All Rights Reserved.
+ */
+
+/* @(#)k_cos.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/*
+ * __kernel_cos( x,  y )
+ * kernel cos function on [-pi/4, pi/4], pi/4 ~ 0.785398164
+ * Input x is assumed to be bounded by ~pi/4 in magnitude.
+ * Input y is the tail of x. 
+ *
+ * Algorithm
+ *	1. Since cos(-x) = cos(x), we need only to consider positive x.
+ *	2. if x < 2^-27 (hx<0x3e400000 0), return 1 with inexact if x!=0.
+ *	3. cos(x) is approximated by a polynomial of degree 14 on
+ *	   [0,pi/4]
+ *		  	                 4            14
+ *	   	cos(x) ~ 1 - x*x/2 + C1*x + ... + C6*x
+ *	   where the remez error is
+ *	
+ * 	|              2     4     6     8     10    12     14 |     -58
+ * 	|cos(x)-(1-.5*x +C1*x +C2*x +C3*x +C4*x +C5*x  +C6*x  )| <= 2
+ * 	|    					               | 
+ * 
+ * 	               4     6     8     10    12     14 
+ *	4. let r = C1*x +C2*x +C3*x +C4*x +C5*x  +C6*x  , then
+ *	       cos(x) = 1 - x*x/2 + r
+ *	   since cos(x+y) ~ cos(x) - sin(x)*y 
+ *			  ~ cos(x) - x*y,
+ *	   a correction term is necessary in cos(x) and hence
+ *		cos(x+y) = 1 - (x*x/2 - (r - x*y))
+ *	   For better accuracy when x > 0.3, let qx = |x|/4 with
+ *	   the last 32 bits mask off, and if x > 0.78125, let qx = 0.28125.
+ *	   Then
+ *		cos(x+y) = (1-qx) - ((x*x/2-qx) - (r-x*y)).
+ *	   Note that 1-qx and (x*x/2-qx) is EXACT here, and the
+ *	   magnitude of the latter is at least a quarter of x*x/2,
+ *	   thus, reducing the rounding error in the subtraction.
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double 
+#else
+static double 
+#endif
+one =  1.00000000000000000000e+00, /* 0x3FF00000, 0x00000000 */
+C1  =  4.16666666666666019037e-02, /* 0x3FA55555, 0x5555554C */
+C2  = -1.38888888888741095749e-03, /* 0xBF56C16C, 0x16C15177 */
+C3  =  2.48015872894767294178e-05, /* 0x3EFA01A0, 0x19CB1590 */
+C4  = -2.75573143513906633035e-07, /* 0xBE927E4F, 0x809C52AD */
+C5  =  2.08757232129817482790e-09, /* 0x3E21EE9E, 0xBDB4B1C4 */
+C6  = -1.13596475577881948265e-11; /* 0xBDA8FAE9, 0xBE8838D4 */
+
+#ifdef __STDC__
+	double __kernel_cos(double x, double y)
+#else
+	double __kernel_cos(x, y)
+	double x,y;
+#endif
+{
+	double a,hz,z,r,qx;
+	int ix;
+	ix = __HI(x)&0x7fffffff;	/* ix = |x|'s high word*/
+	if(ix<0x3e400000) {			/* if x < 2**27 */
+	    if(((int)x)==0) return one;		/* generate inexact */
+	}
+	z  = x*x;
+	r  = z*(C1+z*(C2+z*(C3+z*(C4+z*(C5+z*C6)))));
+	if(ix < 0x3FD33333) 			/* if |x| < 0.3 */ 
+	    return one - (0.5*z - (z*r - x*y));
+	else {
+	    if(ix > 0x3fe90000) {		/* x > 0.78125 */
+		qx = 0.28125;
+	    } else {
+	        __HI(qx) = ix-0x00200000;	/* x/4 */
+	        __LO(qx) = 0;
+	    }
+	    hz = 0.5*z-qx;
+	    a  = one-qx;
+	    return a - (hz - (z*r-x*y));
+	}
+}

mozilla/js/ref/fdlibm/k_rem_pio2.c

@@ -0,0 +1,332 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public License
+ * Version 1.0 (the "NPL"); you may not use this file except in
+ * compliance with the NPL.  You may obtain a copy of the NPL at
+ * http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the NPL is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+ * for the specific language governing rights and limitations under the
+ * NPL.
+ *
+ * The Initial Developer of this code under the NPL is Sun Microsystems,
+ * Inc.  Portions created by Netscape are Copyright (C) 1998 Netscape
+ * Communications Corporation.  All Rights Reserved.
+ */
+
+/* @(#)k_rem_pio2.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/*
+ * __kernel_rem_pio2(x,y,e0,nx,prec,ipio2)
+ * double x[],y[]; int e0,nx,prec; int ipio2[];
+ * 
+ * __kernel_rem_pio2 return the last three digits of N with 
+ *		y = x - N*pi/2
+ * so that |y| < pi/2.
+ *
+ * The method is to compute the integer (mod 8) and fraction parts of 
+ * (2/pi)*x without doing the full multiplication. In general we
+ * skip the part of the product that are known to be a huge integer (
+ * more accurately, = 0 mod 8 ). Thus the number of operations are
+ * independent of the exponent of the input.
+ *
+ * (2/pi) is represented by an array of 24-bit integers in ipio2[].
+ *
+ * Input parameters:
+ * 	x[]	The input value (must be positive) is broken into nx 
+ *		pieces of 24-bit integers in double precision format.
+ *		x[i] will be the i-th 24 bit of x. The scaled exponent 
+ *		of x[0] is given in input parameter e0 (i.e., x[0]*2^e0 
+ *		match x's up to 24 bits.
+ *
+ *		Example of breaking a double positive z into x[0]+x[1]+x[2]:
+ *			e0 = ilogb(z)-23
+ *			z  = scalbn(z,-e0)
+ *		for i = 0,1,2
+ *			x[i] = floor(z)
+ *			z    = (z-x[i])*2**24
+ *
+ *
+ *	y[]	ouput result in an array of double precision numbers.
+ *		The dimension of y[] is:
+ *			24-bit  precision	1
+ *			53-bit  precision	2
+ *			64-bit  precision	2
+ *			113-bit precision	3
+ *		The actual value is the sum of them. Thus for 113-bit
+ *		precison, one may have to do something like:
+ *
+ *		long double t,w,r_head, r_tail;
+ *		t = (long double)y[2] + (long double)y[1];
+ *		w = (long double)y[0];
+ *		r_head = t+w;
+ *		r_tail = w - (r_head - t);
+ *
+ *	e0	The exponent of x[0]
+ *
+ *	nx	dimension of x[]
+ *
+ *  	prec	an integer indicating the precision:
+ *			0	24  bits (single)
+ *			1	53  bits (double)
+ *			2	64  bits (extended)
+ *			3	113 bits (quad)
+ *
+ *	ipio2[]
+ *		integer array, contains the (24*i)-th to (24*i+23)-th 
+ *		bit of 2/pi after binary point. The corresponding 
+ *		floating value is
+ *
+ *			ipio2[i] * 2^(-24(i+1)).
+ *
+ * External function:
+ *	double scalbn(), floor();
+ *
+ *
+ * Here is the description of some local variables:
+ *
+ * 	jk	jk+1 is the initial number of terms of ipio2[] needed
+ *		in the computation. The recommended value is 2,3,4,
+ *		6 for single, double, extended,and quad.
+ *
+ * 	jz	local integer variable indicating the number of 
+ *		terms of ipio2[] used. 
+ *
+ *	jx	nx - 1
+ *
+ *	jv	index for pointing to the suitable ipio2[] for the
+ *		computation. In general, we want
+ *			( 2^e0*x[0] * ipio2[jv-1]*2^(-24jv) )/8
+ *		is an integer. Thus
+ *			e0-3-24*jv >= 0 or (e0-3)/24 >= jv
+ *		Hence jv = max(0,(e0-3)/24).
+ *
+ *	jp	jp+1 is the number of terms in PIo2[] needed, jp = jk.
+ *
+ * 	q[]	double array with integral value, representing the
+ *		24-bits chunk of the product of x and 2/pi.
+ *
+ *	q0	the corresponding exponent of q[0]. Note that the
+ *		exponent for q[i] would be q0-24*i.
+ *
+ *	PIo2[]	double precision array, obtained by cutting pi/2
+ *		into 24 bits chunks. 
+ *
+ *	f[]	ipio2[] in floating point 
+ *
+ *	iq[]	integer array by breaking up q[] in 24-bits chunk.
+ *
+ *	fq[]	final product of x*(2/pi) in fq[0],..,fq[jk]
+ *
+ *	ih	integer. If >0 it indicates q[] is >= 0.5, hence
+ *		it also indicates the *sign* of the result.
+ *
+ */
+
+
+/*
+ * Constants:
+ * The hexadecimal values are the intended ones for the following 
+ * constants. The decimal values may be used, provided that the 
+ * compiler will convert from decimal to binary accurately enough 
+ * to produce the hexadecimal values shown.
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const int init_jk[] = {2,3,4,6}; /* initial value for jk */
+#else
+static int init_jk[] = {2,3,4,6}; 
+#endif
+
+#ifdef __STDC__
+static const double PIo2[] = {
+#else
+static double PIo2[] = {
+#endif
+  1.57079625129699707031e+00, /* 0x3FF921FB, 0x40000000 */
+  7.54978941586159635335e-08, /* 0x3E74442D, 0x00000000 */
+  5.39030252995776476554e-15, /* 0x3CF84698, 0x80000000 */
+  3.28200341580791294123e-22, /* 0x3B78CC51, 0x60000000 */
+  1.27065575308067607349e-29, /* 0x39F01B83, 0x80000000 */
+  1.22933308981111328932e-36, /* 0x387A2520, 0x40000000 */
+  2.73370053816464559624e-44, /* 0x36E38222, 0x80000000 */
+  2.16741683877804819444e-51, /* 0x3569F31D, 0x00000000 */
+};
+
+#ifdef __STDC__
+static const double			
+#else
+static double			
+#endif
+zero   = 0.0,
+one    = 1.0,
+two24   =  1.67772160000000000000e+07, /* 0x41700000, 0x00000000 */
+twon24  =  5.96046447753906250000e-08; /* 0x3E700000, 0x00000000 */
+
+#ifdef __STDC__
+	int __kernel_rem_pio2(double *x, double *y, int e0, int nx, int prec, const int *ipio2) 
+#else
+	int __kernel_rem_pio2(x,y,e0,nx,prec,ipio2) 	
+	double x[], y[]; int e0,nx,prec; int ipio2[];
+#endif
+{
+	int jz,jx,jv,jp,jk,carry,n,iq[20],i,j,k,m,q0,ih;
+	double z,fw,f[20],fq[20],q[20];
+
+    /* initialize jk*/
+	jk = init_jk[prec];
+	jp = jk;
+
+    /* determine jx,jv,q0, note that 3>q0 */
+	jx =  nx-1;
+	jv = (e0-3)/24; if(jv<0) jv=0;
+	q0 =  e0-24*(jv+1);
+
+    /* set up f[0] to f[jx+jk] where f[jx+jk] = ipio2[jv+jk] */
+	j = jv-jx; m = jx+jk;
+	for(i=0;i<=m;i++,j++) f[i] = (j<0)? zero : (double) ipio2[j];
+
+    /* compute q[0],q[1],...q[jk] */
+	for (i=0;i<=jk;i++) {
+	    for(j=0,fw=0.0;j<=jx;j++) fw += x[j]*f[jx+i-j]; q[i] = fw;
+	}
+
+	jz = jk;
+recompute:
+    /* distill q[] into iq[] reversingly */
+	for(i=0,j=jz,z=q[jz];j>0;i++,j--) {
+	    fw    =  (double)((int)(twon24* z));
+	    iq[i] =  (int)(z-two24*fw);
+	    z     =  q[j-1]+fw;
+	}
+
+    /* compute n */
+	z  = fd_scalbn(z,q0);		/* actual value of z */
+	z -= 8.0*fd_floor(z*0.125);		/* trim off integer >= 8 */
+	n  = (int) z;
+	z -= (double)n;
+	ih = 0;
+	if(q0>0) {	/* need iq[jz-1] to determine n */
+	    i  = (iq[jz-1]>>(24-q0)); n += i;
+	    iq[jz-1] -= i<<(24-q0);
+	    ih = iq[jz-1]>>(23-q0);
+	} 
+	else if(q0==0) ih = iq[jz-1]>>23;
+	else if(z>=0.5) ih=2;
+
+	if(ih>0) {	/* q > 0.5 */
+	    n += 1; carry = 0;
+	    for(i=0;i<jz ;i++) {	/* compute 1-q */
+		j = iq[i];
+		if(carry==0) {
+		    if(j!=0) {
+			carry = 1; iq[i] = 0x1000000- j;
+		    }
+		} else  iq[i] = 0xffffff - j;
+	    }
+	    if(q0>0) {		/* rare case: chance is 1 in 12 */
+	        switch(q0) {
+	        case 1:
+	    	   iq[jz-1] &= 0x7fffff; break;
+	    	case 2:
+	    	   iq[jz-1] &= 0x3fffff; break;
+	        }
+	    }
+	    if(ih==2) {
+		z = one - z;
+		if(carry!=0) z -= fd_scalbn(one,q0);
+	    }
+	}
+
+    /* check if recomputation is needed */
+	if(z==zero) {
+	    j = 0;
+	    for (i=jz-1;i>=jk;i--) j |= iq[i];
+	    if(j==0) { /* need recomputation */
+		for(k=1;iq[jk-k]==0;k++);   /* k = no. of terms needed */
+
+		for(i=jz+1;i<=jz+k;i++) {   /* add q[jz+1] to q[jz+k] */
+		    f[jx+i] = (double) ipio2[jv+i];
+		    for(j=0,fw=0.0;j<=jx;j++) fw += x[j]*f[jx+i-j];
+		    q[i] = fw;
+		}
+		jz += k;
+		goto recompute;
+	    }
+	}
+
+    /* chop off zero terms */
+	if(z==0.0) {
+	    jz -= 1; q0 -= 24;
+	    while(iq[jz]==0) { jz--; q0-=24;}
+	} else { /* break z into 24-bit if necessary */
+	    z = fd_scalbn(z,-q0);
+	    if(z>=two24) { 
+		fw = (double)((int)(twon24*z));
+		iq[jz] = (int)(z-two24*fw);
+		jz += 1; q0 += 24;
+		iq[jz] = (int) fw;
+	    } else iq[jz] = (int) z ;
+	}
+
+    /* convert integer "bit" chunk to floating-point value */
+	fw = fd_scalbn(one,q0);
+	for(i=jz;i>=0;i--) {
+	    q[i] = fw*(double)iq[i]; fw*=twon24;
+	}
+
+    /* compute PIo2[0,...,jp]*q[jz,...,0] */
+	for(i=jz;i>=0;i--) {
+	    for(fw=0.0,k=0;k<=jp&&k<=jz-i;k++) fw += PIo2[k]*q[i+k];
+	    fq[jz-i] = fw;
+	}
+
+    /* compress fq[] into y[] */
+	switch(prec) {
+	    case 0:
+		fw = 0.0;
+		for (i=jz;i>=0;i--) fw += fq[i];
+		y[0] = (ih==0)? fw: -fw; 
+		break;
+	    case 1:
+	    case 2:
+		fw = 0.0;
+		for (i=jz;i>=0;i--) fw += fq[i]; 
+		y[0] = (ih==0)? fw: -fw; 
+		fw = fq[0]-fw;
+		for (i=1;i<=jz;i++) fw += fq[i];
+		y[1] = (ih==0)? fw: -fw; 
+		break;
+	    case 3:	/* painful */
+		for (i=jz;i>0;i--) {
+		    fw      = fq[i-1]+fq[i]; 
+		    fq[i]  += fq[i-1]-fw;
+		    fq[i-1] = fw;
+		}
+		for (i=jz;i>1;i--) {
+		    fw      = fq[i-1]+fq[i]; 
+		    fq[i]  += fq[i-1]-fw;
+		    fq[i-1] = fw;
+		}
+		for (fw=0.0,i=jz;i>=2;i--) fw += fq[i]; 
+		if(ih==0) {
+		    y[0] =  fq[0]; y[1] =  fq[1]; y[2] =  fw;
+		} else {
+		    y[0] = -fq[0]; y[1] = -fq[1]; y[2] = -fw;
+		}
+	}
+	return n&7;
+}

mozilla/js/ref/fdlibm/k_sin.c

@@ -0,0 +1,90 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public License
+ * Version 1.0 (the "NPL"); you may not use this file except in
+ * compliance with the NPL.  You may obtain a copy of the NPL at
+ * http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the NPL is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+ * for the specific language governing rights and limitations under the
+ * NPL.
+ *
+ * The Initial Developer of this code under the NPL is Sun Microsystems,
+ * Inc.  Portions created by Netscape are Copyright (C) 1998 Netscape
+ * Communications Corporation.  All Rights Reserved.
+ */
+
+/* @(#)k_sin.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* __kernel_sin( x, y, iy)
+ * kernel sin function on [-pi/4, pi/4], pi/4 ~ 0.7854
+ * Input x is assumed to be bounded by ~pi/4 in magnitude.
+ * Input y is the tail of x.
+ * Input iy indicates whether y is 0. (if iy=0, y assume to be 0). 
+ *
+ * Algorithm
+ *	1. Since sin(-x) = -sin(x), we need only to consider positive x. 
+ *	2. if x < 2^-27 (hx<0x3e400000 0), return x with inexact if x!=0.
+ *	3. sin(x) is approximated by a polynomial of degree 13 on
+ *	   [0,pi/4]
+ *		  	         3            13
+ *	   	sin(x) ~ x + S1*x + ... + S6*x
+ *	   where
+ *	
+ * 	|sin(x)         2     4     6     8     10     12  |     -58
+ * 	|----- - (1+S1*x +S2*x +S3*x +S4*x +S5*x  +S6*x   )| <= 2
+ * 	|  x 					           | 
+ * 
+ *	4. sin(x+y) = sin(x) + sin'(x')*y
+ *		    ~ sin(x) + (1-x*x/2)*y
+ *	   For better accuracy, let 
+ *		     3      2      2      2      2
+ *		r = x *(S2+x *(S3+x *(S4+x *(S5+x *S6))))
+ *	   then                   3    2
+ *		sin(x) = x + (S1*x + (x *(r-y/2)+y))
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double 
+#else
+static double 
+#endif
+half =  5.00000000000000000000e-01, /* 0x3FE00000, 0x00000000 */
+S1  = -1.66666666666666324348e-01, /* 0xBFC55555, 0x55555549 */
+S2  =  8.33333333332248946124e-03, /* 0x3F811111, 0x1110F8A6 */
+S3  = -1.98412698298579493134e-04, /* 0xBF2A01A0, 0x19C161D5 */
+S4  =  2.75573137070700676789e-06, /* 0x3EC71DE3, 0x57B1FE7D */
+S5  = -2.50507602534068634195e-08, /* 0xBE5AE5E6, 0x8A2B9CEB */
+S6  =  1.58969099521155010221e-10; /* 0x3DE5D93A, 0x5ACFD57C */
+
+#ifdef __STDC__
+	double __kernel_sin(double x, double y, int iy)
+#else
+	double __kernel_sin(x, y, iy)
+	double x,y; int iy;		/* iy=0 if y is zero */
+#endif
+{
+	double z,r,v;
+	int ix;
+	ix = __HI(x)&0x7fffffff;	/* high word of x */
+	if(ix<0x3e400000)			/* |x| < 2**-27 */
+	   {if((int)x==0) return x;}		/* generate inexact */
+	z	=  x*x;
+	v	=  z*x;
+	r	=  S2+z*(S3+z*(S4+z*(S5+z*S6)));
+	if(iy==0) return x+v*(S1+z*r);
+	else      return x-((z*(half*y-v*r)-y)-v*S1);
+}

mozilla/js/ref/fdlibm/k_standard.c

@@ -0,0 +1,758 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public License
+ * Version 1.0 (the "NPL"); you may not use this file except in
+ * compliance with the NPL.  You may obtain a copy of the NPL at
+ * http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the NPL is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+ * for the specific language governing rights and limitations under the
+ * NPL.
+ *
+ * The Initial Developer of this code under the NPL is Sun Microsystems,
+ * Inc.  Portions created by Netscape are Copyright (C) 1998 Netscape
+ * Communications Corporation.  All Rights Reserved.
+ */
+
+/* @(#)k_standard.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ *
+ */
+
+#include "fdlibm.h"
+
+/* XXX ugly hack to get msvc to link without error. */
+#if _LIB_VERSION == _IEEE_
+   int errno;
+#  define EDOM 0
+#  define ERANGE 0
+#else
+#  include <errno.h>
+#endif
+
+
+#ifndef _USE_WRITE
+#include <stdio.h>			/* fputs(), stderr */
+#define	WRITE2(u,v)	fputs(u, stderr)
+#else	/* !defined(_USE_WRITE) */
+#include <unistd.h>			/* write */
+#define	WRITE2(u,v)	write(2, u, v)
+#undef fflush
+#endif	/* !defined(_USE_WRITE) */
+
+static double zero = 0.0;	/* used as const */
+
+/* 
+ * Standard conformance (non-IEEE) on exception cases.
+ * Mapping:
+ *	1 -- acos(|x|>1)
+ *	2 -- asin(|x|>1)
+ *	3 -- atan2(+-0,+-0)
+ *	4 -- hypot overflow
+ *	5 -- cosh overflow
+ *	6 -- exp overflow
+ *	7 -- exp underflow
+ *	8 -- y0(0)
+ *	9 -- y0(-ve)
+ *	10-- y1(0)
+ *	11-- y1(-ve)
+ *	12-- yn(0)
+ *	13-- yn(-ve)
+ *	14-- lgamma(finite) overflow
+ *	15-- lgamma(-integer)
+ *	16-- log(0)
+ *	17-- log(x<0)
+ *	18-- log10(0)
+ *	19-- log10(x<0)
+ *	20-- pow(0.0,0.0)
+ *	21-- pow(x,y) overflow
+ *	22-- pow(x,y) underflow
+ *	23-- pow(0,negative) 
+ *	24-- pow(neg,non-integral)
+ *	25-- sinh(finite) overflow
+ *	26-- sqrt(negative)
+ *      27-- fmod(x,0)
+ *      28-- remainder(x,0)
+ *	29-- acosh(x<1)
+ *	30-- atanh(|x|>1)
+ *	31-- atanh(|x|=1)
+ *	32-- scalb overflow
+ *	33-- scalb underflow
+ *	34-- j0(|x|>X_TLOSS)
+ *	35-- y0(x>X_TLOSS)
+ *	36-- j1(|x|>X_TLOSS)
+ *	37-- y1(x>X_TLOSS)
+ *	38-- jn(|x|>X_TLOSS, n)
+ *	39-- yn(x>X_TLOSS, n)
+ *	40-- gamma(finite) overflow
+ *	41-- gamma(-integer)
+ *	42-- pow(NaN,0.0)
+ */
+
+
+#ifdef __STDC__
+	double __kernel_standard(double x, double y, int type) 
+#else
+	double __kernel_standard(x,y,type) 
+	double x,y; int type;
+#endif
+{
+	struct exception exc;
+#ifndef HUGE_VAL	/* this is the only routine that uses HUGE_VAL */ 
+#define HUGE_VAL inf
+	double inf = 0.0;
+
+	__HI(inf) = 0x7ff00000;	/* set inf to infinite */
+#endif
+
+#ifdef _USE_WRITE
+	(void) fflush(stdout);
+#endif
+	exc.arg1 = x;
+	exc.arg2 = y;
+	switch(type) {
+	    case 1:
+		/* acos(|x|>1) */
+		exc.type = DOMAIN;
+		exc.name = "acos";
+		exc.retval = zero;
+		if (_LIB_VERSION == _POSIX_)
+		  errno = EDOM;
+		else if (!fd_matherr(&exc)) {
+		  if(_LIB_VERSION == _SVID_) {
+		    (void) WRITE2("acos: DOMAIN error\n", 19);
+		  }
+		  errno = EDOM;
+		}
+		break;
+	    case 2:
+		/* asin(|x|>1) */
+		exc.type = DOMAIN;
+		exc.name = "asin";
+		exc.retval = zero;
+		if(_LIB_VERSION == _POSIX_)
+		  errno = EDOM;
+		else if (!fd_matherr(&exc)) {
+		  if(_LIB_VERSION == _SVID_) {
+		    	(void) WRITE2("asin: DOMAIN error\n", 19);
+		  }
+		  errno = EDOM;
+		}
+		break;
+	    case 3:
+		/* atan2(+-0,+-0) */
+		exc.arg1 = y;
+		exc.arg2 = x;
+		exc.type = DOMAIN;
+		exc.name = "atan2";
+		exc.retval = zero;
+		if(_LIB_VERSION == _POSIX_)
+		  errno = EDOM;
+		else if (!fd_matherr(&exc)) {
+		  if(_LIB_VERSION == _SVID_) {
+			(void) WRITE2("atan2: DOMAIN error\n", 20);
+		      }
+		  errno = EDOM;
+		}
+		break;
+	    case 4:
+		/* hypot(finite,finite) overflow */
+		exc.type = OVERFLOW;
+		exc.name = "hypot";
+		if (_LIB_VERSION == _SVID_)
+		  exc.retval = HUGE;
+		else
+		  exc.retval = HUGE_VAL;
+		if (_LIB_VERSION == _POSIX_)
+		  errno = ERANGE;
+		else if (!fd_matherr(&exc)) {
+			errno = ERANGE;
+		}
+		break;
+	    case 5:
+		/* cosh(finite) overflow */
+		exc.type = OVERFLOW;
+		exc.name = "cosh";
+		if (_LIB_VERSION == _SVID_)
+		  exc.retval = HUGE;
+		else
+		  exc.retval = HUGE_VAL;
+		if (_LIB_VERSION == _POSIX_)
+		  errno = ERANGE;
+		else if (!fd_matherr(&exc)) {
+			errno = ERANGE;
+		}
+		break;
+	    case 6:
+		/* exp(finite) overflow */
+		exc.type = OVERFLOW;
+		exc.name = "exp";
+		if (_LIB_VERSION == _SVID_)
+		  exc.retval = HUGE;
+		else
+		  exc.retval = HUGE_VAL;
+		if (_LIB_VERSION == _POSIX_)
+		  errno = ERANGE;
+		else if (!fd_matherr(&exc)) {
+			errno = ERANGE;
+		}
+		break;
+	    case 7:
+		/* exp(finite) underflow */
+		exc.type = UNDERFLOW;
+		exc.name = "exp";
+		exc.retval = zero;
+		if (_LIB_VERSION == _POSIX_)
+		  errno = ERANGE;
+		else if (!fd_matherr(&exc)) {
+			errno = ERANGE;
+		}
+		break;
+	    case 8:
+		/* y0(0) = -inf */
+		exc.type = DOMAIN;	/* should be SING for IEEE */
+		exc.name = "y0";
+		if (_LIB_VERSION == _SVID_)
+		  exc.retval = -HUGE;
+		else
+		  exc.retval = -HUGE_VAL;
+		if (_LIB_VERSION == _POSIX_)
+		  errno = EDOM;
+		else if (!fd_matherr(&exc)) {
+		  if (_LIB_VERSION == _SVID_) {
+			(void) WRITE2("y0: DOMAIN error\n", 17);
+		      }
+		  errno = EDOM;
+		}
+		break;
+	    case 9:
+		/* y0(x<0) = NaN */
+		exc.type = DOMAIN;
+		exc.name = "y0";
+		if (_LIB_VERSION == _SVID_)
+		  exc.retval = -HUGE;
+		else
+		  exc.retval = -HUGE_VAL;
+		if (_LIB_VERSION == _POSIX_)
+		  errno = EDOM;
+		else if (!fd_matherr(&exc)) {
+		  if (_LIB_VERSION == _SVID_) {
+			(void) WRITE2("y0: DOMAIN error\n", 17);
+		      }
+		  errno = EDOM;
+		}
+		break;
+	    case 10:
+		/* y1(0) = -inf */
+		exc.type = DOMAIN;	/* should be SING for IEEE */
+		exc.name = "y1";
+		if (_LIB_VERSION == _SVID_)
+		  exc.retval = -HUGE;
+		else
+		  exc.retval = -HUGE_VAL;
+		if (_LIB_VERSION == _POSIX_)
+		  errno = EDOM;
+		else if (!fd_matherr(&exc)) {
+		  if (_LIB_VERSION == _SVID_) {
+			(void) WRITE2("y1: DOMAIN error\n", 17);
+		      }
+		  errno = EDOM;
+		}
+		break;
+	    case 11:
+		/* y1(x<0) = NaN */
+		exc.type = DOMAIN;
+		exc.name = "y1";
+		if (_LIB_VERSION == _SVID_)
+		  exc.retval = -HUGE;
+		else
+		  exc.retval = -HUGE_VAL;
+		if (_LIB_VERSION == _POSIX_)
+		  errno = EDOM;
+		else if (!fd_matherr(&exc)) {
+		  if (_LIB_VERSION == _SVID_) {
+			(void) WRITE2("y1: DOMAIN error\n", 17);
+		      }
+		  errno = EDOM;
+		}
+		break;
+	    case 12:
+		/* yn(n,0) = -inf */
+		exc.type = DOMAIN;	/* should be SING for IEEE */
+		exc.name = "yn";
+		if (_LIB_VERSION == _SVID_)
+		  exc.retval = -HUGE;
+		else
+		  exc.retval = -HUGE_VAL;
+		if (_LIB_VERSION == _POSIX_)
+		  errno = EDOM;
+		else if (!fd_matherr(&exc)) {
+		  if (_LIB_VERSION == _SVID_) {
+			(void) WRITE2("yn: DOMAIN error\n", 17);
+		      }
+		  errno = EDOM;
+		}
+		break;
+	    case 13:
+		/* yn(x<0) = NaN */
+		exc.type = DOMAIN;
+		exc.name = "yn";
+		if (_LIB_VERSION == _SVID_)
+		  exc.retval = -HUGE;
+		else
+		  exc.retval = -HUGE_VAL;
+		if (_LIB_VERSION == _POSIX_)
+		  errno = EDOM;
+		else if (!fd_matherr(&exc)) {
+		  if (_LIB_VERSION == _SVID_) {
+			(void) WRITE2("yn: DOMAIN error\n", 17);
+		      }
+		  errno = EDOM;
+		}
+		break;
+	    case 14:
+		/* lgamma(finite) overflow */
+		exc.type = OVERFLOW;
+		exc.name = "lgamma";
+                if (_LIB_VERSION == _SVID_)
+                  exc.retval = HUGE;
+                else
+                  exc.retval = HUGE_VAL;
+                if (_LIB_VERSION == _POSIX_)
+			errno = ERANGE;
+                else if (!fd_matherr(&exc)) {
+                        errno = ERANGE;
+		}
+		break;
+	    case 15:
+		/* lgamma(-integer) or lgamma(0) */
+		exc.type = SING;
+		exc.name = "lgamma";
+                if (_LIB_VERSION == _SVID_)
+                  exc.retval = HUGE;
+                else
+                  exc.retval = HUGE_VAL;
+		if (_LIB_VERSION == _POSIX_)
+		  errno = EDOM;
+		else if (!fd_matherr(&exc)) {
+		  if (_LIB_VERSION == _SVID_) {
+			(void) WRITE2("lgamma: SING error\n", 19);
+		      }
+		  errno = EDOM;
+		}
+		break;
+	    case 16:
+		/* log(0) */
+		exc.type = SING;
+		exc.name = "log";
+		if (_LIB_VERSION == _SVID_)
+		  exc.retval = -HUGE;
+		else
+		  exc.retval = -HUGE_VAL;
+		if (_LIB_VERSION == _POSIX_)
+		  errno = ERANGE;
+		else if (!fd_matherr(&exc)) {
+		  if (_LIB_VERSION == _SVID_) {
+			(void) WRITE2("log: SING error\n", 16);
+		      }
+		  errno = EDOM;
+		}
+		break;
+	    case 17:
+		/* log(x<0) */
+		exc.type = DOMAIN;
+		exc.name = "log";
+		if (_LIB_VERSION == _SVID_)
+		  exc.retval = -HUGE;
+		else
+		  exc.retval = -HUGE_VAL;
+		if (_LIB_VERSION == _POSIX_)
+		  errno = EDOM;
+		else if (!fd_matherr(&exc)) {
+		  if (_LIB_VERSION == _SVID_) {
+			(void) WRITE2("log: DOMAIN error\n", 18);
+		      }
+		  errno = EDOM;
+		}
+		break;
+	    case 18:
+		/* log10(0) */
+		exc.type = SING;
+		exc.name = "log10";
+		if (_LIB_VERSION == _SVID_)
+		  exc.retval = -HUGE;
+		else
+		  exc.retval = -HUGE_VAL;
+		if (_LIB_VERSION == _POSIX_)
+		  errno = ERANGE;
+		else if (!fd_matherr(&exc)) {
+		  if (_LIB_VERSION == _SVID_) {
+			(void) WRITE2("log10: SING error\n", 18);
+		      }
+		  errno = EDOM;
+		}
+		break;
+	    case 19:
+		/* log10(x<0) */
+		exc.type = DOMAIN;
+		exc.name = "log10";
+		if (_LIB_VERSION == _SVID_)
+		  exc.retval = -HUGE;
+		else
+		  exc.retval = -HUGE_VAL;
+		if (_LIB_VERSION == _POSIX_)
+		  errno = EDOM;
+		else if (!fd_matherr(&exc)) {
+		  if (_LIB_VERSION == _SVID_) {
+			(void) WRITE2("log10: DOMAIN error\n", 20);
+		      }
+		  errno = EDOM;
+		}
+		break;
+	    case 20:
+		/* pow(0.0,0.0) */
+		/* error only if _LIB_VERSION == _SVID_ */
+		exc.type = DOMAIN;
+		exc.name = "pow";
+		exc.retval = zero;
+		if (_LIB_VERSION != _SVID_) exc.retval = 1.0;
+		else if (!fd_matherr(&exc)) {
+			(void) WRITE2("pow(0,0): DOMAIN error\n", 23);
+			errno = EDOM;
+		}
+		break;
+	    case 21:
+		/* pow(x,y) overflow */
+		exc.type = OVERFLOW;
+		exc.name = "pow";
+		if (_LIB_VERSION == _SVID_) {
+		  exc.retval = HUGE;
+		  y *= 0.5;
+		  if(x<zero&&fd_rint(y)!=y) exc.retval = -HUGE;
+		} else {
+		  exc.retval = HUGE_VAL;
+		  y *= 0.5;
+		  if(x<zero&&fd_rint(y)!=y) exc.retval = -HUGE_VAL;
+		}
+		if (_LIB_VERSION == _POSIX_)
+		  errno = ERANGE;
+		else if (!fd_matherr(&exc)) {
+			errno = ERANGE;
+		}
+		break;
+	    case 22:
+		/* pow(x,y) underflow */
+		exc.type = UNDERFLOW;
+		exc.name = "pow";
+		exc.retval =  zero;
+		if (_LIB_VERSION == _POSIX_)
+		  errno = ERANGE;
+		else if (!fd_matherr(&exc)) {
+			errno = ERANGE;
+		}
+		break;
+	    case 23:
+		/* 0**neg */
+		exc.type = DOMAIN;
+		exc.name = "pow";
+		if (_LIB_VERSION == _SVID_) 
+		  exc.retval = zero;
+		else
+		  exc.retval = -HUGE_VAL;
+		if (_LIB_VERSION == _POSIX_)
+		  errno = EDOM;
+		else if (!fd_matherr(&exc)) {
+		  if (_LIB_VERSION == _SVID_) {
+			(void) WRITE2("pow(0,neg): DOMAIN error\n", 25);
+		      }
+		  errno = EDOM;
+		}
+		break;
+	    case 24:
+		/* neg**non-integral */
+		exc.type = DOMAIN;
+		exc.name = "pow";
+		if (_LIB_VERSION == _SVID_) 
+		    exc.retval = zero;
+		else 
+		    exc.retval = zero/zero;	/* X/Open allow NaN */
+		if (_LIB_VERSION == _POSIX_) 
+		   errno = EDOM;
+		else if (!fd_matherr(&exc)) {
+		  if (_LIB_VERSION == _SVID_) {
+			(void) WRITE2("neg**non-integral: DOMAIN error\n", 32);
+		      }
+		  errno = EDOM;
+		}
+		break;
+	    case 25:
+		/* sinh(finite) overflow */
+		exc.type = OVERFLOW;
+		exc.name = "sinh";
+		if (_LIB_VERSION == _SVID_)
+		  exc.retval = ( (x>zero) ? HUGE : -HUGE);
+		else
+		  exc.retval = ( (x>zero) ? HUGE_VAL : -HUGE_VAL);
+		if (_LIB_VERSION == _POSIX_)
+		  errno = ERANGE;
+		else if (!fd_matherr(&exc)) {
+			errno = ERANGE;
+		}
+		break;
+	    case 26:
+		/* sqrt(x<0) */
+		exc.type = DOMAIN;
+		exc.name = "sqrt";
+		if (_LIB_VERSION == _SVID_)
+		  exc.retval = zero;
+		else
+		  exc.retval = zero/zero;
+		if (_LIB_VERSION == _POSIX_)
+		  errno = EDOM;
+		else if (!fd_matherr(&exc)) {
+		  if (_LIB_VERSION == _SVID_) {
+			(void) WRITE2("sqrt: DOMAIN error\n", 19);
+		      }
+		  errno = EDOM;
+		}
+		break;
+            case 27:
+                /* fmod(x,0) */
+                exc.type = DOMAIN;
+                exc.name = "fmod";
+                if (_LIB_VERSION == _SVID_)
+                    exc.retval = x;
+		else
+		    exc.retval = zero/zero;
+                if (_LIB_VERSION == _POSIX_)
+                  errno = EDOM;
+                else if (!fd_matherr(&exc)) {
+                  if (_LIB_VERSION == _SVID_) {
+                    (void) WRITE2("fmod:  DOMAIN error\n", 20);
+                  }
+                  errno = EDOM;
+                }
+                break;
+            case 28:
+                /* remainder(x,0) */
+                exc.type = DOMAIN;
+                exc.name = "remainder";
+                exc.retval = zero/zero;
+                if (_LIB_VERSION == _POSIX_)
+                  errno = EDOM;
+                else if (!fd_matherr(&exc)) {
+                  if (_LIB_VERSION == _SVID_) {
+                    (void) WRITE2("remainder: DOMAIN error\n", 24);
+                  }
+                  errno = EDOM;
+                }
+                break;
+            case 29:
+                /* acosh(x<1) */
+                exc.type = DOMAIN;
+                exc.name = "acosh";
+                exc.retval = zero/zero;
+                if (_LIB_VERSION == _POSIX_)
+                  errno = EDOM;
+                else if (!fd_matherr(&exc)) {
+                  if (_LIB_VERSION == _SVID_) {
+                    (void) WRITE2("acosh: DOMAIN error\n", 20);
+                  }
+                  errno = EDOM;
+                }
+                break;
+            case 30:
+                /* atanh(|x|>1) */
+                exc.type = DOMAIN;
+                exc.name = "atanh";
+                exc.retval = zero/zero;
+                if (_LIB_VERSION == _POSIX_)
+                  errno = EDOM;
+                else if (!fd_matherr(&exc)) {
+                  if (_LIB_VERSION == _SVID_) {
+                    (void) WRITE2("atanh: DOMAIN error\n", 20);
+                  }
+                  errno = EDOM;
+                }
+                break;
+            case 31:
+                /* atanh(|x|=1) */
+                exc.type = SING;
+                exc.name = "atanh";
+		exc.retval = x/zero;	/* sign(x)*inf */
+                if (_LIB_VERSION == _POSIX_)
+                  errno = EDOM;
+                else if (!fd_matherr(&exc)) {
+                  if (_LIB_VERSION == _SVID_) {
+                    (void) WRITE2("atanh: SING error\n", 18);
+                  }
+                  errno = EDOM;
+                }
+                break;
+	    case 32:
+		/* scalb overflow; SVID also returns +-HUGE_VAL */
+		exc.type = OVERFLOW;
+		exc.name = "scalb";
+		exc.retval = x > zero ? HUGE_VAL : -HUGE_VAL;
+		if (_LIB_VERSION == _POSIX_)
+		  errno = ERANGE;
+		else if (!fd_matherr(&exc)) {
+			errno = ERANGE;
+		}
+		break;
+	    case 33:
+		/* scalb underflow */
+		exc.type = UNDERFLOW;
+		exc.name = "scalb";
+		exc.retval = fd_copysign(zero,x);
+		if (_LIB_VERSION == _POSIX_)
+		  errno = ERANGE;
+		else if (!fd_matherr(&exc)) {
+			errno = ERANGE;
+		}
+		break;
+	    case 34:
+		/* j0(|x|>X_TLOSS) */
+                exc.type = TLOSS;
+                exc.name = "j0";
+                exc.retval = zero;
+                if (_LIB_VERSION == _POSIX_)
+                        errno = ERANGE;
+                else if (!fd_matherr(&exc)) {
+                        if (_LIB_VERSION == _SVID_) {
+                                (void) WRITE2(exc.name, 2);
+                                (void) WRITE2(": TLOSS error\n", 14);
+                        }
+                        errno = ERANGE;
+                }        
+		break;
+	    case 35:
+		/* y0(x>X_TLOSS) */
+                exc.type = TLOSS;
+                exc.name = "y0";
+                exc.retval = zero;
+                if (_LIB_VERSION == _POSIX_)
+                        errno = ERANGE;
+                else if (!fd_matherr(&exc)) {
+                        if (_LIB_VERSION == _SVID_) {
+                                (void) WRITE2(exc.name, 2);
+                                (void) WRITE2(": TLOSS error\n", 14);
+                        }
+                        errno = ERANGE;
+                }        
+		break;
+	    case 36:
+		/* j1(|x|>X_TLOSS) */
+                exc.type = TLOSS;
+                exc.name = "j1";
+                exc.retval = zero;
+                if (_LIB_VERSION == _POSIX_)
+                        errno = ERANGE;
+                else if (!fd_matherr(&exc)) {
+                        if (_LIB_VERSION == _SVID_) {
+                                (void) WRITE2(exc.name, 2);
+                                (void) WRITE2(": TLOSS error\n", 14);
+                        }
+                        errno = ERANGE;
+                }        
+		break;
+	    case 37:
+		/* y1(x>X_TLOSS) */
+                exc.type = TLOSS;
+                exc.name = "y1";
+                exc.retval = zero;
+                if (_LIB_VERSION == _POSIX_)
+                        errno = ERANGE;
+                else if (!fd_matherr(&exc)) {
+                        if (_LIB_VERSION == _SVID_) {
+                                (void) WRITE2(exc.name, 2);
+                                (void) WRITE2(": TLOSS error\n", 14);
+                        }
+                        errno = ERANGE;
+                }        
+		break;
+	    case 38:
+		/* jn(|x|>X_TLOSS) */
+                exc.type = TLOSS;
+                exc.name = "jn";
+                exc.retval = zero;
+                if (_LIB_VERSION == _POSIX_)
+                        errno = ERANGE;
+                else if (!fd_matherr(&exc)) {
+                        if (_LIB_VERSION == _SVID_) {
+                                (void) WRITE2(exc.name, 2);
+                                (void) WRITE2(": TLOSS error\n", 14);
+                        }
+                        errno = ERANGE;
+                }        
+		break;
+	    case 39:
+		/* yn(x>X_TLOSS) */
+                exc.type = TLOSS;
+                exc.name = "yn";
+                exc.retval = zero;
+                if (_LIB_VERSION == _POSIX_)
+                        errno = ERANGE;
+                else if (!fd_matherr(&exc)) {
+                        if (_LIB_VERSION == _SVID_) {
+                                (void) WRITE2(exc.name, 2);
+                                (void) WRITE2(": TLOSS error\n", 14);
+                        }
+                        errno = ERANGE;
+                }        
+		break;
+	    case 40:
+		/* gamma(finite) overflow */
+		exc.type = OVERFLOW;
+		exc.name = "gamma";
+                if (_LIB_VERSION == _SVID_)
+                  exc.retval = HUGE;
+                else
+                  exc.retval = HUGE_VAL;
+                if (_LIB_VERSION == _POSIX_)
+		  errno = ERANGE;
+                else if (!fd_matherr(&exc)) {
+                  errno = ERANGE;
+                }
+		break;
+	    case 41:
+		/* gamma(-integer) or gamma(0) */
+		exc.type = SING;
+		exc.name = "gamma";
+                if (_LIB_VERSION == _SVID_)
+                  exc.retval = HUGE;
+                else
+                  exc.retval = HUGE_VAL;
+		if (_LIB_VERSION == _POSIX_)
+		  errno = EDOM;
+		else if (!fd_matherr(&exc)) {
+		  if (_LIB_VERSION == _SVID_) {
+			(void) WRITE2("gamma: SING error\n", 18);
+		      }
+		  errno = EDOM;
+		}
+		break;
+	    case 42:
+		/* pow(NaN,0.0) */
+		/* error only if _LIB_VERSION == _SVID_ & _XOPEN_ */
+		exc.type = DOMAIN;
+		exc.name = "pow";
+		exc.retval = x;
+		if (_LIB_VERSION == _IEEE_ ||
+		    _LIB_VERSION == _POSIX_) exc.retval = 1.0;
+		else if (!fd_matherr(&exc)) {
+			errno = EDOM;
+		}
+		break;
+	}
+	return exc.retval; 
+}

mozilla/js/ref/fdlibm/k_tan.c

@@ -0,0 +1,141 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public License
+ * Version 1.0 (the "NPL"); you may not use this file except in
+ * compliance with the NPL.  You may obtain a copy of the NPL at
+ * http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the NPL is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+ * for the specific language governing rights and limitations under the
+ * NPL.
+ *
+ * The Initial Developer of this code under the NPL is Sun Microsystems,
+ * Inc.  Portions created by Netscape are Copyright (C) 1998 Netscape
+ * Communications Corporation.  All Rights Reserved.
+ */
+
+/* @(#)k_tan.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* __kernel_tan( x, y, k )
+ * kernel tan function on [-pi/4, pi/4], pi/4 ~ 0.7854
+ * Input x is assumed to be bounded by ~pi/4 in magnitude.
+ * Input y is the tail of x.
+ * Input k indicates whether tan (if k=1) or 
+ * -1/tan (if k= -1) is returned.
+ *
+ * Algorithm
+ *	1. Since tan(-x) = -tan(x), we need only to consider positive x. 
+ *	2. if x < 2^-28 (hx<0x3e300000 0), return x with inexact if x!=0.
+ *	3. tan(x) is approximated by a odd polynomial of degree 27 on
+ *	   [0,0.67434]
+ *		  	         3             27
+ *	   	tan(x) ~ x + T1*x + ... + T13*x
+ *	   where
+ *	
+ * 	        |tan(x)         2     4            26   |     -59.2
+ * 	        |----- - (1+T1*x +T2*x +.... +T13*x    )| <= 2
+ * 	        |  x 					| 
+ * 
+ *	   Note: tan(x+y) = tan(x) + tan'(x)*y
+ *		          ~ tan(x) + (1+x*x)*y
+ *	   Therefore, for better accuracy in computing tan(x+y), let 
+ *		     3      2      2       2       2
+ *		r = x *(T2+x *(T3+x *(...+x *(T12+x *T13))))
+ *	   then
+ *		 		    3    2
+ *		tan(x+y) = x + (T1*x + (x *(r+y)+y))
+ *
+ *      4. For x in [0.67434,pi/4],  let y = pi/4 - x, then
+ *		tan(x) = tan(pi/4-y) = (1-tan(y))/(1+tan(y))
+ *		       = 1 - 2*(tan(y) - (tan(y)^2)/(1+tan(y)))
+ */
+
+#include "fdlibm.h"
+#ifdef __STDC__
+static const double 
+#else
+static double 
+#endif
+one   =  1.00000000000000000000e+00, /* 0x3FF00000, 0x00000000 */
+pio4  =  7.85398163397448278999e-01, /* 0x3FE921FB, 0x54442D18 */
+pio4lo=  3.06161699786838301793e-17, /* 0x3C81A626, 0x33145C07 */
+T[] =  {
+  3.33333333333334091986e-01, /* 0x3FD55555, 0x55555563 */
+  1.33333333333201242699e-01, /* 0x3FC11111, 0x1110FE7A */
+  5.39682539762260521377e-02, /* 0x3FABA1BA, 0x1BB341FE */
+  2.18694882948595424599e-02, /* 0x3F9664F4, 0x8406D637 */
+  8.86323982359930005737e-03, /* 0x3F8226E3, 0xE96E8493 */
+  3.59207910759131235356e-03, /* 0x3F6D6D22, 0xC9560328 */
+  1.45620945432529025516e-03, /* 0x3F57DBC8, 0xFEE08315 */
+  5.88041240820264096874e-04, /* 0x3F4344D8, 0xF2F26501 */
+  2.46463134818469906812e-04, /* 0x3F3026F7, 0x1A8D1068 */
+  7.81794442939557092300e-05, /* 0x3F147E88, 0xA03792A6 */
+  7.14072491382608190305e-05, /* 0x3F12B80F, 0x32F0A7E9 */
+ -1.85586374855275456654e-05, /* 0xBEF375CB, 0xDB605373 */
+  2.59073051863633712884e-05, /* 0x3EFB2A70, 0x74BF7AD4 */
+};
+
+#ifdef __STDC__
+	double __kernel_tan(double x, double y, int iy)
+#else
+	double __kernel_tan(x, y, iy)
+	double x,y; int iy;
+#endif
+{
+	double z,r,v,w,s;
+	int ix,hx;
+	hx = __HI(x);	/* high word of x */
+	ix = hx&0x7fffffff;	/* high word of |x| */
+	if(ix<0x3e300000)			/* x < 2**-28 */
+	    {if((int)x==0) {			/* generate inexact */
+		if(((ix|__LO(x))|(iy+1))==0) return one/fd_fabs(x);
+		else return (iy==1)? x: -one/x;
+	    }
+	    }
+	if(ix>=0x3FE59428) { 			/* |x|>=0.6744 */
+	    if(hx<0) {x = -x; y = -y;}
+	    z = pio4-x;
+	    w = pio4lo-y;
+	    x = z+w; y = 0.0;
+	}
+	z	=  x*x;
+	w 	=  z*z;
+    /* Break x^5*(T[1]+x^2*T[2]+...) into
+     *	  x^5(T[1]+x^4*T[3]+...+x^20*T[11]) +
+     *	  x^5(x^2*(T[2]+x^4*T[4]+...+x^22*[T12]))
+     */
+	r = T[1]+w*(T[3]+w*(T[5]+w*(T[7]+w*(T[9]+w*T[11]))));
+	v = z*(T[2]+w*(T[4]+w*(T[6]+w*(T[8]+w*(T[10]+w*T[12])))));
+	s = z*x;
+	r = y + z*(s*(r+v)+y);
+	r += T[0]*s;
+	w = x+r;
+	if(ix>=0x3FE59428) {
+	    v = (double)iy;
+	    return (double)(1-((hx>>30)&2))*(v-2.0*(x-(w*w/(w+v)-r)));
+	}
+	if(iy==1) return w;
+	else {		/* if allow error up to 2 ulp, 
+			   simply return -1.0/(x+r) here */
+     /*  compute -1.0/(x+r) accurately */
+	    double a,t;
+	    z  = w;
+	    __LO(z) = 0;
+	    v  = r-(z - x); 	/* z+v = r+x */
+	    t = a  = -1.0/w;	/* a = -1.0/w */
+	    __LO(t) = 0;
+	    s  = 1.0+t*z;
+	    return t+a*(s+t*v);
+	}
+}

mozilla/js/ref/fdlibm/s_asinh.c

@@ -0,0 +1,77 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public License
+ * Version 1.0 (the "NPL"); you may not use this file except in
+ * compliance with the NPL.  You may obtain a copy of the NPL at
+ * http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the NPL is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+ * for the specific language governing rights and limitations under the
+ * NPL.
+ *
+ * The Initial Developer of this code under the NPL is Sun Microsystems,
+ * Inc.  Portions created by Netscape are Copyright (C) 1998 Netscape
+ * Communications Corporation.  All Rights Reserved.
+ */
+
+/* @(#)s_asinh.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* asinh(x)
+ * Method :
+ *	Based on 
+ *		asinh(x) = sign(x) * log [ |x| + sqrt(x*x+1) ]
+ *	we have
+ *	asinh(x) := x  if  1+x*x=1,
+ *		 := sign(x)*(log(x)+ln2)) for large |x|, else
+ *		 := sign(x)*log(2|x|+1/(|x|+sqrt(x*x+1))) if|x|>2, else
+ *		 := sign(x)*log1p(|x| + x^2/(1 + sqrt(1+x^2)))  
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double 
+#else
+static double 
+#endif
+one =  1.00000000000000000000e+00, /* 0x3FF00000, 0x00000000 */
+ln2 =  6.93147180559945286227e-01, /* 0x3FE62E42, 0xFEFA39EF */
+huge=  1.00000000000000000000e+300; 
+
+#ifdef __STDC__
+	double fd_asinh(double x)
+#else
+	double fd_asinh(x)
+	double x;
+#endif
+{	
+	double t,w;
+	int hx,ix;
+	hx = __HI(x);
+	ix = hx&0x7fffffff;
+	if(ix>=0x7ff00000) return x+x;	/* x is inf or NaN */
+	if(ix< 0x3e300000) {	/* |x|<2**-28 */
+	    if(huge+x>one) return x;	/* return x inexact except 0 */
+	} 
+	if(ix>0x41b00000) {	/* |x| > 2**28 */
+	    w = __ieee754_log(fd_fabs(x))+ln2;
+	} else if (ix>0x40000000) {	/* 2**28 > |x| > 2.0 */
+	    t = fd_fabs(x);
+	    w = __ieee754_log(2.0*t+one/(fd_sqrt(x*x+one)+t));
+	} else {		/* 2.0 > |x| > 2**-28 */
+	    t = x*x;
+	    w =fd_log1p(fd_fabs(x)+t/(one+fd_sqrt(one+t)));
+	}
+	if(hx>0) return w; else return -w;
+}

mozilla/js/ref/fdlibm/s_atan.c

@@ -0,0 +1,150 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public License
+ * Version 1.0 (the "NPL"); you may not use this file except in
+ * compliance with the NPL.  You may obtain a copy of the NPL at
+ * http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the NPL is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+ * for the specific language governing rights and limitations under the
+ * NPL.
+ *
+ * The Initial Developer of this code under the NPL is Sun Microsystems,
+ * Inc.  Portions created by Netscape are Copyright (C) 1998 Netscape
+ * Communications Corporation.  All Rights Reserved.
+ */
+
+/* @(#)s_atan.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ *
+ */
+
+/* atan(x)
+ * Method
+ *   1. Reduce x to positive by atan(x) = -atan(-x).
+ *   2. According to the integer k=4t+0.25 chopped, t=x, the argument
+ *      is further reduced to one of the following intervals and the
+ *      arctangent of t is evaluated by the corresponding formula:
+ *
+ *      [0,7/16]      atan(x) = t-t^3*(a1+t^2*(a2+...(a10+t^2*a11)...)
+ *      [7/16,11/16]  atan(x) = atan(1/2) + atan( (t-0.5)/(1+t/2) )
+ *      [11/16.19/16] atan(x) = atan( 1 ) + atan( (t-1)/(1+t) )
+ *      [19/16,39/16] atan(x) = atan(3/2) + atan( (t-1.5)/(1+1.5t) )
+ *      [39/16,INF]   atan(x) = atan(INF) + atan( -1/t )
+ *
+ * Constants:
+ * The hexadecimal values are the intended ones for the following 
+ * constants. The decimal values may be used, provided that the 
+ * compiler will convert from decimal to binary accurately enough 
+ * to produce the hexadecimal values shown.
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double atanhi[] = {
+#else
+static double atanhi[] = {
+#endif
+  4.63647609000806093515e-01, /* atan(0.5)hi 0x3FDDAC67, 0x0561BB4F */
+  7.85398163397448278999e-01, /* atan(1.0)hi 0x3FE921FB, 0x54442D18 */
+  9.82793723247329054082e-01, /* atan(1.5)hi 0x3FEF730B, 0xD281F69B */
+  1.57079632679489655800e+00, /* atan(inf)hi 0x3FF921FB, 0x54442D18 */
+};
+
+#ifdef __STDC__
+static const double atanlo[] = {
+#else
+static double atanlo[] = {
+#endif
+  2.26987774529616870924e-17, /* atan(0.5)lo 0x3C7A2B7F, 0x222F65E2 */
+  3.06161699786838301793e-17, /* atan(1.0)lo 0x3C81A626, 0x33145C07 */
+  1.39033110312309984516e-17, /* atan(1.5)lo 0x3C700788, 0x7AF0CBBD */
+  6.12323399573676603587e-17, /* atan(inf)lo 0x3C91A626, 0x33145C07 */
+};
+
+#ifdef __STDC__
+static const double aT[] = {
+#else
+static double aT[] = {
+#endif
+  3.33333333333329318027e-01, /* 0x3FD55555, 0x5555550D */
+ -1.99999999998764832476e-01, /* 0xBFC99999, 0x9998EBC4 */
+  1.42857142725034663711e-01, /* 0x3FC24924, 0x920083FF */
+ -1.11111104054623557880e-01, /* 0xBFBC71C6, 0xFE231671 */
+  9.09088713343650656196e-02, /* 0x3FB745CD, 0xC54C206E */
+ -7.69187620504482999495e-02, /* 0xBFB3B0F2, 0xAF749A6D */
+  6.66107313738753120669e-02, /* 0x3FB10D66, 0xA0D03D51 */
+ -5.83357013379057348645e-02, /* 0xBFADDE2D, 0x52DEFD9A */
+  4.97687799461593236017e-02, /* 0x3FA97B4B, 0x24760DEB */
+ -3.65315727442169155270e-02, /* 0xBFA2B444, 0x2C6A6C2F */
+  1.62858201153657823623e-02, /* 0x3F90AD3A, 0xE322DA11 */
+};
+
+#ifdef __STDC__
+	static const double 
+#else
+	static double 
+#endif
+one   = 1.0,
+huge   = 1.0e300;
+
+#ifdef __STDC__
+	double fd_atan(double x)
+#else
+	double fd_atan(x)
+	double x;
+#endif
+{
+	double w,s1,s2,z;
+	int ix,hx,id;
+
+	hx = __HI(x);
+	ix = hx&0x7fffffff;
+	if(ix>=0x44100000) {	/* if |x| >= 2^66 */
+	    if(ix>0x7ff00000||
+		(ix==0x7ff00000&&(__LO(x)!=0)))
+		return x+x;		/* NaN */
+	    if(hx>0) return  atanhi[3]+atanlo[3];
+	    else     return -atanhi[3]-atanlo[3];
+	} if (ix < 0x3fdc0000) {	/* |x| < 0.4375 */
+	    if (ix < 0x3e200000) {	/* |x| < 2^-29 */
+		if(huge+x>one) return x;	/* raise inexact */
+	    }
+	    id = -1;
+	} else {
+	x = fd_fabs(x);
+	if (ix < 0x3ff30000) {		/* |x| < 1.1875 */
+	    if (ix < 0x3fe60000) {	/* 7/16 <=|x|<11/16 */
+		id = 0; x = (2.0*x-one)/(2.0+x); 
+	    } else {			/* 11/16<=|x|< 19/16 */
+		id = 1; x  = (x-one)/(x+one); 
+	    }
+	} else {
+	    if (ix < 0x40038000) {	/* |x| < 2.4375 */
+		id = 2; x  = (x-1.5)/(one+1.5*x);
+	    } else {			/* 2.4375 <= |x| < 2^66 */
+		id = 3; x  = -1.0/x;
+	    }
+	}}
+    /* end of argument reduction */
+	z = x*x;
+	w = z*z;
+    /* break sum from i=0 to 10 aT[i]z**(i+1) into odd and even poly */
+	s1 = z*(aT[0]+w*(aT[2]+w*(aT[4]+w*(aT[6]+w*(aT[8]+w*aT[10])))));
+	s2 = w*(aT[1]+w*(aT[3]+w*(aT[5]+w*(aT[7]+w*aT[9]))));
+	if (id<0) return x - x*(s1+s2);
+	else {
+	    z = atanhi[id] - ((x*(s1+s2) - atanlo[id]) - x);
+	    return (hx<0)? -z:z;
+	}
+}

mozilla/js/ref/fdlibm/s_cbrt.c

@@ -0,0 +1,103 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public License
+ * Version 1.0 (the "NPL"); you may not use this file except in
+ * compliance with the NPL.  You may obtain a copy of the NPL at
+ * http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the NPL is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+ * for the specific language governing rights and limitations under the
+ * NPL.
+ *
+ * The Initial Developer of this code under the NPL is Sun Microsystems,
+ * Inc.  Portions created by Netscape are Copyright (C) 1998 Netscape
+ * Communications Corporation.  All Rights Reserved.
+ */
+
+/* @(#)s_cbrt.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ *
+ */
+
+#include "fdlibm.h"
+
+/* cbrt(x)
+ * Return cube root of x
+ */
+#ifdef __STDC__
+static const unsigned 
+#else
+static unsigned 
+#endif
+	B1 = 715094163, /* B1 = (682-0.03306235651)*2**20 */
+	B2 = 696219795; /* B2 = (664-0.03306235651)*2**20 */
+
+#ifdef __STDC__
+static const double
+#else
+static double
+#endif
+C =  5.42857142857142815906e-01, /* 19/35     = 0x3FE15F15, 0xF15F15F1 */
+D = -7.05306122448979611050e-01, /* -864/1225 = 0xBFE691DE, 0x2532C834 */
+E =  1.41428571428571436819e+00, /* 99/70     = 0x3FF6A0EA, 0x0EA0EA0F */
+F =  1.60714285714285720630e+00, /* 45/28     = 0x3FF9B6DB, 0x6DB6DB6E */
+G =  3.57142857142857150787e-01; /* 5/14      = 0x3FD6DB6D, 0xB6DB6DB7 */
+
+#ifdef __STDC__
+	double fd_cbrt(double x) 
+#else
+	double fd_cbrt(x) 
+	double x;
+#endif
+{
+	int	hx;
+	double r,s,t=0.0,w;
+	unsigned sign;
+
+
+	hx = __HI(x);		/* high word of x */
+	sign=hx&0x80000000; 		/* sign= sign(x) */
+	hx  ^=sign;
+	if(hx>=0x7ff00000) return(x+x); /* cbrt(NaN,INF) is itself */
+	if((hx|__LO(x))==0) 
+	    return(x);		/* cbrt(0) is itself */
+
+	__HI(x) = hx;	/* x <- |x| */
+    /* rough cbrt to 5 bits */
+	if(hx<0x00100000) 		/* subnormal number */
+	  {__HI(t)=0x43500000; 		/* set t= 2**54 */
+	   t*=x; __HI(t)=__HI(t)/3+B2;
+	  }
+	else
+	  __HI(t)=hx/3+B1;	
+
+
+    /* new cbrt to 23 bits, may be implemented in single precision */
+	r=t*t/x;
+	s=C+r*t;
+	t*=G+F/(s+E+D/s);	
+
+    /* chopped to 20 bits and make it larger than cbrt(x) */ 
+	__LO(t)=0; __HI(t)+=0x00000001;
+
+
+    /* one step newton iteration to 53 bits with error less than 0.667 ulps */
+	s=t*t;		/* t*t is exact */
+	r=x/s;
+	w=t+t;
+	r=(r-t)/(w+r);	/* r-s is exact */
+	t=t+t*r;
+
+    /* retore the sign bit */
+	__HI(t) |= sign;
+	return(t);
+}

mozilla/js/ref/fdlibm/s_ceil.c

@@ -0,0 +1,94 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public License
+ * Version 1.0 (the "NPL"); you may not use this file except in
+ * compliance with the NPL.  You may obtain a copy of the NPL at
+ * http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the NPL is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+ * for the specific language governing rights and limitations under the
+ * NPL.
+ *
+ * The Initial Developer of this code under the NPL is Sun Microsystems,
+ * Inc.  Portions created by Netscape are Copyright (C) 1998 Netscape
+ * Communications Corporation.  All Rights Reserved.
+ */
+
+/* @(#)s_ceil.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/*
+ * ceil(x)
+ * Return x rounded toward -inf to integral value
+ * Method:
+ *	Bit twiddling.
+ * Exception:
+ *	Inexact flag raised if x not equal to ceil(x).
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double huge = 1.0e300;
+#else
+static double huge = 1.0e300;
+#endif
+
+#ifdef __STDC__
+	double fd_ceil(double x)
+#else
+	double fd_ceil(x)
+	double x;
+#endif
+{
+	int i0,i1,j0;
+	unsigned i,j;
+	i0 =  __HI(x);
+	i1 =  __LO(x);
+	j0 = ((i0>>20)&0x7ff)-0x3ff;
+	if(j0<20) {
+	    if(j0<0) { 	/* raise inexact if x != 0 */
+		if(huge+x>0.0) {/* return 0*sign(x) if |x|<1 */
+		    if(i0<0) {i0=0x80000000;i1=0;} 
+		    else if((i0|i1)!=0) { i0=0x3ff00000;i1=0;}
+		}
+	    } else {
+		i = (0x000fffff)>>j0;
+		if(((i0&i)|i1)==0) return x; /* x is integral */
+		if(huge+x>0.0) {	/* raise inexact flag */
+		    if(i0>0) i0 += (0x00100000)>>j0;
+		    i0 &= (~i); i1=0;
+		}
+	    }
+	} else if (j0>51) {
+	    if(j0==0x400) return x+x;	/* inf or NaN */
+	    else return x;		/* x is integral */
+	} else {
+	    i = ((unsigned)(0xffffffff))>>(j0-20);
+	    if((i1&i)==0) return x;	/* x is integral */
+	    if(huge+x>0.0) { 		/* raise inexact flag */
+		if(i0>0) {
+		    if(j0==20) i0+=1; 
+		    else {
+			j = i1 + (1<<(52-j0));
+			if((int)j<i1) i0+=1;	/* got a carry */
+			i1 = j;
+		    }
+		}
+		i1 &= (~i);
+	    }
+	}
+	__HI(x) = i0;
+	__LO(x) = i1;
+	return x;
+}

mozilla/js/ref/fdlibm/s_copysign.c

@@ -0,0 +1,47 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public License
+ * Version 1.0 (the "NPL"); you may not use this file except in
+ * compliance with the NPL.  You may obtain a copy of the NPL at
+ * http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the NPL is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+ * for the specific language governing rights and limitations under the
+ * NPL.
+ *
+ * The Initial Developer of this code under the NPL is Sun Microsystems,
+ * Inc.  Portions created by Netscape are Copyright (C) 1998 Netscape
+ * Communications Corporation.  All Rights Reserved.
+ */
+
+/* @(#)s_copysign.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/*
+ * copysign(double x, double y)
+ * copysign(x,y) returns a value with the magnitude of x and
+ * with the sign bit of y.
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+	double fd_copysign(double x, double y)
+#else
+	double fd_copysign(x,y)
+	double x,y;
+#endif
+{
+	__HI(x) = (__HI(x)&0x7fffffff)|(__HI(y)&0x80000000);
+        return x;
+}

mozilla/js/ref/fdlibm/s_cos.c

@@ -0,0 +1,94 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public License
+ * Version 1.0 (the "NPL"); you may not use this file except in
+ * compliance with the NPL.  You may obtain a copy of the NPL at
+ * http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the NPL is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+ * for the specific language governing rights and limitations under the
+ * NPL.
+ *
+ * The Initial Developer of this code under the NPL is Sun Microsystems,
+ * Inc.  Portions created by Netscape are Copyright (C) 1998 Netscape
+ * Communications Corporation.  All Rights Reserved.
+ */
+
+/* @(#)s_cos.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* cos(x)
+ * Return cosine function of x.
+ *
+ * kernel function:
+ *	__kernel_sin		... sine function on [-pi/4,pi/4]
+ *	__kernel_cos		... cosine function on [-pi/4,pi/4]
+ *	__ieee754_rem_pio2	... argument reduction routine
+ *
+ * Method.
+ *      Let S,C and T denote the sin, cos and tan respectively on 
+ *	[-PI/4, +PI/4]. Reduce the argument x to y1+y2 = x-k*pi/2 
+ *	in [-pi/4 , +pi/4], and let n = k mod 4.
+ *	We have
+ *
+ *          n        sin(x)      cos(x)        tan(x)
+ *     ----------------------------------------------------------
+ *	    0	       S	   C		 T
+ *	    1	       C	  -S		-1/T
+ *	    2	      -S	  -C		 T
+ *	    3	      -C	   S		-1/T
+ *     ----------------------------------------------------------
+ *
+ * Special cases:
+ *      Let trig be any of sin, cos, or tan.
+ *      trig(+-INF)  is NaN, with signals;
+ *      trig(NaN)    is that NaN;
+ *
+ * Accuracy:
+ *	TRIG(x) returns trig(x) nearly rounded 
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+	double fd_cos(double x)
+#else
+	double fd_cos(x)
+	double x;
+#endif
+{
+	double y[2],z=0.0;
+	int n, ix;
+
+    /* High word of x. */
+	ix = __HI(x);
+
+    /* |x| ~< pi/4 */
+	ix &= 0x7fffffff;
+	if(ix <= 0x3fe921fb) return __kernel_cos(x,z);
+
+    /* cos(Inf or NaN) is NaN */
+	else if (ix>=0x7ff00000) return x-x;
+
+    /* argument reduction needed */
+	else {
+	    n = __ieee754_rem_pio2(x,y);
+	    switch(n&3) {
+		case 0: return  __kernel_cos(y[0],y[1]);
+		case 1: return -__kernel_sin(y[0],y[1],1);
+		case 2: return -__kernel_cos(y[0],y[1]);
+		default:
+		        return  __kernel_sin(y[0],y[1],1);
+	    }
+	}
+}

mozilla/js/ref/fdlibm/s_erf.c

@@ -0,0 +1,326 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public License
+ * Version 1.0 (the "NPL"); you may not use this file except in
+ * compliance with the NPL.  You may obtain a copy of the NPL at
+ * http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the NPL is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+ * for the specific language governing rights and limitations under the
+ * NPL.
+ *
+ * The Initial Developer of this code under the NPL is Sun Microsystems,
+ * Inc.  Portions created by Netscape are Copyright (C) 1998 Netscape
+ * Communications Corporation.  All Rights Reserved.
+ */
+
+/* @(#)s_erf.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* double erf(double x)
+ * double erfc(double x)
+ *			     x
+ *		      2      |\
+ *     erf(x)  =  ---------  | exp(-t*t)dt
+ *	 	   sqrt(pi) \| 
+ *			     0
+ *
+ *     erfc(x) =  1-erf(x)
+ *  Note that 
+ *		erf(-x) = -erf(x)
+ *		erfc(-x) = 2 - erfc(x)
+ *
+ * Method:
+ *	1. For |x| in [0, 0.84375]
+ *	    erf(x)  = x + x*R(x^2)
+ *          erfc(x) = 1 - erf(x)           if x in [-.84375,0.25]
+ *                  = 0.5 + ((0.5-x)-x*R)  if x in [0.25,0.84375]
+ *	   where R = P/Q where P is an odd poly of degree 8 and
+ *	   Q is an odd poly of degree 10.
+ *						 -57.90
+ *			| R - (erf(x)-x)/x | <= 2
+ *	
+ *
+ *	   Remark. The formula is derived by noting
+ *          erf(x) = (2/sqrt(pi))*(x - x^3/3 + x^5/10 - x^7/42 + ....)
+ *	   and that
+ *          2/sqrt(pi) = 1.128379167095512573896158903121545171688
+ *	   is close to one. The interval is chosen because the fix
+ *	   point of erf(x) is near 0.6174 (i.e., erf(x)=x when x is
+ *	   near 0.6174), and by some experiment, 0.84375 is chosen to
+ * 	   guarantee the error is less than one ulp for erf.
+ *
+ *      2. For |x| in [0.84375,1.25], let s = |x| - 1, and
+ *         c = 0.84506291151 rounded to single (24 bits)
+ *         	erf(x)  = sign(x) * (c  + P1(s)/Q1(s))
+ *         	erfc(x) = (1-c)  - P1(s)/Q1(s) if x > 0
+ *			  1+(c+P1(s)/Q1(s))    if x < 0
+ *         	|P1/Q1 - (erf(|x|)-c)| <= 2**-59.06
+ *	   Remark: here we use the taylor series expansion at x=1.
+ *		erf(1+s) = erf(1) + s*Poly(s)
+ *			 = 0.845.. + P1(s)/Q1(s)
+ *	   That is, we use rational approximation to approximate
+ *			erf(1+s) - (c = (single)0.84506291151)
+ *	   Note that |P1/Q1|< 0.078 for x in [0.84375,1.25]
+ *	   where 
+ *		P1(s) = degree 6 poly in s
+ *		Q1(s) = degree 6 poly in s
+ *
+ *      3. For x in [1.25,1/0.35(~2.857143)], 
+ *         	erfc(x) = (1/x)*exp(-x*x-0.5625+R1/S1)
+ *         	erf(x)  = 1 - erfc(x)
+ *	   where 
+ *		R1(z) = degree 7 poly in z, (z=1/x^2)
+ *		S1(z) = degree 8 poly in z
+ *
+ *      4. For x in [1/0.35,28]
+ *         	erfc(x) = (1/x)*exp(-x*x-0.5625+R2/S2) if x > 0
+ *			= 2.0 - (1/x)*exp(-x*x-0.5625+R2/S2) if -6<x<0
+ *			= 2.0 - tiny		(if x <= -6)
+ *         	erf(x)  = sign(x)*(1.0 - erfc(x)) if x < 6, else
+ *         	erf(x)  = sign(x)*(1.0 - tiny)
+ *	   where
+ *		R2(z) = degree 6 poly in z, (z=1/x^2)
+ *		S2(z) = degree 7 poly in z
+ *
+ *      Note1:
+ *	   To compute exp(-x*x-0.5625+R/S), let s be a single
+ *	   precision number and s := x; then
+ *		-x*x = -s*s + (s-x)*(s+x)
+ *	        exp(-x*x-0.5626+R/S) = 
+ *			exp(-s*s-0.5625)*exp((s-x)*(s+x)+R/S);
+ *      Note2:
+ *	   Here 4 and 5 make use of the asymptotic series
+ *			  exp(-x*x)
+ *		erfc(x) ~ ---------- * ( 1 + Poly(1/x^2) )
+ *			  x*sqrt(pi)
+ *	   We use rational approximation to approximate
+ *      	g(s)=f(1/x^2) = log(erfc(x)*x) - x*x + 0.5625
+ *	   Here is the error bound for R1/S1 and R2/S2
+ *      	|R1/S1 - f(x)|  < 2**(-62.57)
+ *      	|R2/S2 - f(x)|  < 2**(-61.52)
+ *
+ *      5. For inf > x >= 28
+ *         	erf(x)  = sign(x) *(1 - tiny)  (raise inexact)
+ *         	erfc(x) = tiny*tiny (raise underflow) if x > 0
+ *			= 2 - tiny if x<0
+ *
+ *      7. Special case:
+ *         	erf(0)  = 0, erf(inf)  = 1, erf(-inf) = -1,
+ *         	erfc(0) = 1, erfc(inf) = 0, erfc(-inf) = 2, 
+ *	   	erfc/erf(NaN) is NaN
+ */
+
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double
+#else
+static double
+#endif
+tiny	    = 1e-300,
+half=  5.00000000000000000000e-01, /* 0x3FE00000, 0x00000000 */
+one =  1.00000000000000000000e+00, /* 0x3FF00000, 0x00000000 */
+two =  2.00000000000000000000e+00, /* 0x40000000, 0x00000000 */
+	/* c = (float)0.84506291151 */
+erx =  8.45062911510467529297e-01, /* 0x3FEB0AC1, 0x60000000 */
+/*
+ * Coefficients for approximation to  erf on [0,0.84375]
+ */
+efx =  1.28379167095512586316e-01, /* 0x3FC06EBA, 0x8214DB69 */
+efx8=  1.02703333676410069053e+00, /* 0x3FF06EBA, 0x8214DB69 */
+pp0  =  1.28379167095512558561e-01, /* 0x3FC06EBA, 0x8214DB68 */
+pp1  = -3.25042107247001499370e-01, /* 0xBFD4CD7D, 0x691CB913 */
+pp2  = -2.84817495755985104766e-02, /* 0xBF9D2A51, 0xDBD7194F */
+pp3  = -5.77027029648944159157e-03, /* 0xBF77A291, 0x236668E4 */
+pp4  = -2.37630166566501626084e-05, /* 0xBEF8EAD6, 0x120016AC */
+qq1  =  3.97917223959155352819e-01, /* 0x3FD97779, 0xCDDADC09 */
+qq2  =  6.50222499887672944485e-02, /* 0x3FB0A54C, 0x5536CEBA */
+qq3  =  5.08130628187576562776e-03, /* 0x3F74D022, 0xC4D36B0F */
+qq4  =  1.32494738004321644526e-04, /* 0x3F215DC9, 0x221C1A10 */
+qq5  = -3.96022827877536812320e-06, /* 0xBED09C43, 0x42A26120 */
+/*
+ * Coefficients for approximation to  erf  in [0.84375,1.25] 
+ */
+pa0  = -2.36211856075265944077e-03, /* 0xBF6359B8, 0xBEF77538 */
+pa1  =  4.14856118683748331666e-01, /* 0x3FDA8D00, 0xAD92B34D */
+pa2  = -3.72207876035701323847e-01, /* 0xBFD7D240, 0xFBB8C3F1 */
+pa3  =  3.18346619901161753674e-01, /* 0x3FD45FCA, 0x805120E4 */
+pa4  = -1.10894694282396677476e-01, /* 0xBFBC6398, 0x3D3E28EC */
+pa5  =  3.54783043256182359371e-02, /* 0x3FA22A36, 0x599795EB */
+pa6  = -2.16637559486879084300e-03, /* 0xBF61BF38, 0x0A96073F */
+qa1  =  1.06420880400844228286e-01, /* 0x3FBB3E66, 0x18EEE323 */
+qa2  =  5.40397917702171048937e-01, /* 0x3FE14AF0, 0x92EB6F33 */
+qa3  =  7.18286544141962662868e-02, /* 0x3FB2635C, 0xD99FE9A7 */
+qa4  =  1.26171219808761642112e-01, /* 0x3FC02660, 0xE763351F */
+qa5  =  1.36370839120290507362e-02, /* 0x3F8BEDC2, 0x6B51DD1C */
+qa6  =  1.19844998467991074170e-02, /* 0x3F888B54, 0x5735151D */
+/*
+ * Coefficients for approximation to  erfc in [1.25,1/0.35]
+ */
+ra0  = -9.86494403484714822705e-03, /* 0xBF843412, 0x600D6435 */
+ra1  = -6.93858572707181764372e-01, /* 0xBFE63416, 0xE4BA7360 */
+ra2  = -1.05586262253232909814e+01, /* 0xC0251E04, 0x41B0E726 */
+ra3  = -6.23753324503260060396e+01, /* 0xC04F300A, 0xE4CBA38D */
+ra4  = -1.62396669462573470355e+02, /* 0xC0644CB1, 0x84282266 */
+ra5  = -1.84605092906711035994e+02, /* 0xC067135C, 0xEBCCABB2 */
+ra6  = -8.12874355063065934246e+01, /* 0xC0545265, 0x57E4D2F2 */
+ra7  = -9.81432934416914548592e+00, /* 0xC023A0EF, 0xC69AC25C */
+sa1  =  1.96512716674392571292e+01, /* 0x4033A6B9, 0xBD707687 */
+sa2  =  1.37657754143519042600e+02, /* 0x4061350C, 0x526AE721 */
+sa3  =  4.34565877475229228821e+02, /* 0x407B290D, 0xD58A1A71 */
+sa4  =  6.45387271733267880336e+02, /* 0x40842B19, 0x21EC2868 */
+sa5  =  4.29008140027567833386e+02, /* 0x407AD021, 0x57700314 */
+sa6  =  1.08635005541779435134e+02, /* 0x405B28A3, 0xEE48AE2C */
+sa7  =  6.57024977031928170135e+00, /* 0x401A47EF, 0x8E484A93 */
+sa8  = -6.04244152148580987438e-02, /* 0xBFAEEFF2, 0xEE749A62 */
+/*
+ * Coefficients for approximation to  erfc in [1/.35,28]
+ */
+rb0  = -9.86494292470009928597e-03, /* 0xBF843412, 0x39E86F4A */
+rb1  = -7.99283237680523006574e-01, /* 0xBFE993BA, 0x70C285DE */
+rb2  = -1.77579549177547519889e+01, /* 0xC031C209, 0x555F995A */
+rb3  = -1.60636384855821916062e+02, /* 0xC064145D, 0x43C5ED98 */
+rb4  = -6.37566443368389627722e+02, /* 0xC083EC88, 0x1375F228 */
+rb5  = -1.02509513161107724954e+03, /* 0xC0900461, 0x6A2E5992 */
+rb6  = -4.83519191608651397019e+02, /* 0xC07E384E, 0x9BDC383F */
+sb1  =  3.03380607434824582924e+01, /* 0x403E568B, 0x261D5190 */
+sb2  =  3.25792512996573918826e+02, /* 0x40745CAE, 0x221B9F0A */
+sb3  =  1.53672958608443695994e+03, /* 0x409802EB, 0x189D5118 */
+sb4  =  3.19985821950859553908e+03, /* 0x40A8FFB7, 0x688C246A */
+sb5  =  2.55305040643316442583e+03, /* 0x40A3F219, 0xCEDF3BE6 */
+sb6  =  4.74528541206955367215e+02, /* 0x407DA874, 0xE79FE763 */
+sb7  = -2.24409524465858183362e+01; /* 0xC03670E2, 0x42712D62 */
+
+#ifdef __STDC__
+	double fd_erf(double x) 
+#else
+	double fd_erf(x) 
+	double x;
+#endif
+{
+	int hx,ix,i;
+	double R,S,P,Q,s,y,z,r;
+	hx = __HI(x);
+	ix = hx&0x7fffffff;
+	if(ix>=0x7ff00000) {		/* erf(nan)=nan */
+	    i = ((unsigned)hx>>31)<<1;
+	    return (double)(1-i)+one/x;	/* erf(+-inf)=+-1 */
+	}
+
+	if(ix < 0x3feb0000) {		/* |x|<0.84375 */
+	    if(ix < 0x3e300000) { 	/* |x|<2**-28 */
+	        if (ix < 0x00800000) 
+		    return 0.125*(8.0*x+efx8*x);  /*avoid underflow */
+		return x + efx*x;
+	    }
+	    z = x*x;
+	    r = pp0+z*(pp1+z*(pp2+z*(pp3+z*pp4)));
+	    s = one+z*(qq1+z*(qq2+z*(qq3+z*(qq4+z*qq5))));
+	    y = r/s;
+	    return x + x*y;
+	}
+	if(ix < 0x3ff40000) {		/* 0.84375 <= |x| < 1.25 */
+	    s = fd_fabs(x)-one;
+	    P = pa0+s*(pa1+s*(pa2+s*(pa3+s*(pa4+s*(pa5+s*pa6)))));
+	    Q = one+s*(qa1+s*(qa2+s*(qa3+s*(qa4+s*(qa5+s*qa6)))));
+	    if(hx>=0) return erx + P/Q; else return -erx - P/Q;
+	}
+	if (ix >= 0x40180000) {		/* inf>|x|>=6 */
+	    if(hx>=0) return one-tiny; else return tiny-one;
+	}
+	x = fd_fabs(x);
+ 	s = one/(x*x);
+	if(ix< 0x4006DB6E) {	/* |x| < 1/0.35 */
+	    R=ra0+s*(ra1+s*(ra2+s*(ra3+s*(ra4+s*(
+				ra5+s*(ra6+s*ra7))))));
+	    S=one+s*(sa1+s*(sa2+s*(sa3+s*(sa4+s*(
+				sa5+s*(sa6+s*(sa7+s*sa8)))))));
+	} else {	/* |x| >= 1/0.35 */
+	    R=rb0+s*(rb1+s*(rb2+s*(rb3+s*(rb4+s*(
+				rb5+s*rb6)))));
+	    S=one+s*(sb1+s*(sb2+s*(sb3+s*(sb4+s*(
+				sb5+s*(sb6+s*sb7))))));
+	}
+	z  = x;  
+	__LO(z) = 0;
+	r  =  __ieee754_exp(-z*z-0.5625)*__ieee754_exp((z-x)*(z+x)+R/S);
+	if(hx>=0) return one-r/x; else return  r/x-one;
+}
+
+#ifdef __STDC__
+	double erfc(double x) 
+#else
+	double erfc(x) 
+	double x;
+#endif
+{
+	int hx,ix;
+	double R,S,P,Q,s,y,z,r;
+	hx = __HI(x);
+	ix = hx&0x7fffffff;
+	if(ix>=0x7ff00000) {			/* erfc(nan)=nan */
+						/* erfc(+-inf)=0,2 */
+	    return (double)(((unsigned)hx>>31)<<1)+one/x;
+	}
+
+	if(ix < 0x3feb0000) {		/* |x|<0.84375 */
+	    if(ix < 0x3c700000)  	/* |x|<2**-56 */
+		return one-x;
+	    z = x*x;
+	    r = pp0+z*(pp1+z*(pp2+z*(pp3+z*pp4)));
+	    s = one+z*(qq1+z*(qq2+z*(qq3+z*(qq4+z*qq5))));
+	    y = r/s;
+	    if(hx < 0x3fd00000) {  	/* x<1/4 */
+		return one-(x+x*y);
+	    } else {
+		r = x*y;
+		r += (x-half);
+	        return half - r ;
+	    }
+	}
+	if(ix < 0x3ff40000) {		/* 0.84375 <= |x| < 1.25 */
+	    s = fd_fabs(x)-one;
+	    P = pa0+s*(pa1+s*(pa2+s*(pa3+s*(pa4+s*(pa5+s*pa6)))));
+	    Q = one+s*(qa1+s*(qa2+s*(qa3+s*(qa4+s*(qa5+s*qa6)))));
+	    if(hx>=0) {
+	        z  = one-erx; return z - P/Q; 
+	    } else {
+		z = erx+P/Q; return one+z;
+	    }
+	}
+	if (ix < 0x403c0000) {		/* |x|<28 */
+	    x = fd_fabs(x);
+ 	    s = one/(x*x);
+	    if(ix< 0x4006DB6D) {	/* |x| < 1/.35 ~ 2.857143*/
+	        R=ra0+s*(ra1+s*(ra2+s*(ra3+s*(ra4+s*(
+				ra5+s*(ra6+s*ra7))))));
+	        S=one+s*(sa1+s*(sa2+s*(sa3+s*(sa4+s*(
+				sa5+s*(sa6+s*(sa7+s*sa8)))))));
+	    } else {			/* |x| >= 1/.35 ~ 2.857143 */
+		if(hx<0&&ix>=0x40180000) return two-tiny;/* x < -6 */
+	        R=rb0+s*(rb1+s*(rb2+s*(rb3+s*(rb4+s*(
+				rb5+s*rb6)))));
+	        S=one+s*(sb1+s*(sb2+s*(sb3+s*(sb4+s*(
+				sb5+s*(sb6+s*sb7))))));
+	    }
+	    z  = x;
+	    __LO(z)  = 0;
+	    r  =  __ieee754_exp(-z*z-0.5625)*
+			__ieee754_exp((z-x)*(z+x)+R/S);
+	    if(hx>0) return r/x; else return two-r/x;
+	} else {
+	    if(hx>0) return tiny*tiny; else return two-tiny;
+	}
+}

mozilla/js/ref/fdlibm/s_expm1.c

@@ -0,0 +1,232 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public License
+ * Version 1.0 (the "NPL"); you may not use this file except in
+ * compliance with the NPL.  You may obtain a copy of the NPL at
+ * http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the NPL is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+ * for the specific language governing rights and limitations under the
+ * NPL.
+ *
+ * The Initial Developer of this code under the NPL is Sun Microsystems,
+ * Inc.  Portions created by Netscape are Copyright (C) 1998 Netscape
+ * Communications Corporation.  All Rights Reserved.
+ */
+
+/* @(#)s_expm1.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* expm1(x)
+ * Returns exp(x)-1, the exponential of x minus 1.
+ *
+ * Method
+ *   1. Argument reduction:
+ *	Given x, find r and integer k such that
+ *
+ *               x = k*ln2 + r,  |r| <= 0.5*ln2 ~ 0.34658  
+ *
+ *      Here a correction term c will be computed to compensate 
+ *	the error in r when rounded to a floating-point number.
+ *
+ *   2. Approximating expm1(r) by a special rational function on
+ *	the interval [0,0.34658]:
+ *	Since
+ *	    r*(exp(r)+1)/(exp(r)-1) = 2+ r^2/6 - r^4/360 + ...
+ *	we define R1(r*r) by
+ *	    r*(exp(r)+1)/(exp(r)-1) = 2+ r^2/6 * R1(r*r)
+ *	That is,
+ *	    R1(r**2) = 6/r *((exp(r)+1)/(exp(r)-1) - 2/r)
+ *		     = 6/r * ( 1 + 2.0*(1/(exp(r)-1) - 1/r))
+ *		     = 1 - r^2/60 + r^4/2520 - r^6/100800 + ...
+ *      We use a special Reme algorithm on [0,0.347] to generate 
+ * 	a polynomial of degree 5 in r*r to approximate R1. The 
+ *	maximum error of this polynomial approximation is bounded 
+ *	by 2**-61. In other words,
+ *	    R1(z) ~ 1.0 + Q1*z + Q2*z**2 + Q3*z**3 + Q4*z**4 + Q5*z**5
+ *	where 	Q1  =  -1.6666666666666567384E-2,
+ * 		Q2  =   3.9682539681370365873E-4,
+ * 		Q3  =  -9.9206344733435987357E-6,
+ * 		Q4  =   2.5051361420808517002E-7,
+ * 		Q5  =  -6.2843505682382617102E-9;
+ *  	(where z=r*r, and the values of Q1 to Q5 are listed below)
+ *	with error bounded by
+ *	    |                  5           |     -61
+ *	    | 1.0+Q1*z+...+Q5*z   -  R1(z) | <= 2 
+ *	    |                              |
+ *	
+ *	expm1(r) = exp(r)-1 is then computed by the following 
+ * 	specific way which minimize the accumulation rounding error: 
+ *			       2     3
+ *			      r     r    [ 3 - (R1 + R1*r/2)  ]
+ *	      expm1(r) = r + --- + --- * [--------------------]
+ *		              2     2    [ 6 - r*(3 - R1*r/2) ]
+ *	
+ *	To compensate the error in the argument reduction, we use
+ *		expm1(r+c) = expm1(r) + c + expm1(r)*c 
+ *			   ~ expm1(r) + c + r*c 
+ *	Thus c+r*c will be added in as the correction terms for
+ *	expm1(r+c). Now rearrange the term to avoid optimization 
+ * 	screw up:
+ *		        (      2                                    2 )
+ *		        ({  ( r    [ R1 -  (3 - R1*r/2) ]  )  }    r  )
+ *	 expm1(r+c)~r - ({r*(--- * [--------------------]-c)-c} - --- )
+ *	                ({  ( 2    [ 6 - r*(3 - R1*r/2) ]  )  }    2  )
+ *                      (                                             )
+ *    	
+ *		   = r - E
+ *   3. Scale back to obtain expm1(x):
+ *	From step 1, we have
+ *	   expm1(x) = either 2^k*[expm1(r)+1] - 1
+ *		    = or     2^k*[expm1(r) + (1-2^-k)]
+ *   4. Implementation notes:
+ *	(A). To save one multiplication, we scale the coefficient Qi
+ *	     to Qi*2^i, and replace z by (x^2)/2.
+ *	(B). To achieve maximum accuracy, we compute expm1(x) by
+ *	  (i)   if x < -56*ln2, return -1.0, (raise inexact if x!=inf)
+ *	  (ii)  if k=0, return r-E
+ *	  (iii) if k=-1, return 0.5*(r-E)-0.5
+ *        (iv)	if k=1 if r < -0.25, return 2*((r+0.5)- E)
+ *	       	       else	     return  1.0+2.0*(r-E);
+ *	  (v)   if (k<-2||k>56) return 2^k(1-(E-r)) - 1 (or exp(x)-1)
+ *	  (vi)  if k <= 20, return 2^k((1-2^-k)-(E-r)), else
+ *	  (vii) return 2^k(1-((E+2^-k)-r)) 
+ *
+ * Special cases:
+ *	expm1(INF) is INF, expm1(NaN) is NaN;
+ *	expm1(-INF) is -1, and
+ *	for finite argument, only expm1(0)=0 is exact.
+ *
+ * Accuracy:
+ *	according to an error analysis, the error is always less than
+ *	1 ulp (unit in the last place).
+ *
+ * Misc. info.
+ *	For IEEE double 
+ *	    if x >  7.09782712893383973096e+02 then expm1(x) overflow
+ *
+ * Constants:
+ * The hexadecimal values are the intended ones for the following 
+ * constants. The decimal values may be used, provided that the 
+ * compiler will convert from decimal to binary accurately enough
+ * to produce the hexadecimal values shown.
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double
+#else
+static double
+#endif
+one		= 1.0,
+huge		= 1.0e+300,
+tiny		= 1.0e-300,
+o_threshold	= 7.09782712893383973096e+02,/* 0x40862E42, 0xFEFA39EF */
+ln2_hi		= 6.93147180369123816490e-01,/* 0x3fe62e42, 0xfee00000 */
+ln2_lo		= 1.90821492927058770002e-10,/* 0x3dea39ef, 0x35793c76 */
+invln2		= 1.44269504088896338700e+00,/* 0x3ff71547, 0x652b82fe */
+	/* scaled coefficients related to expm1 */
+Q1  =  -3.33333333333331316428e-02, /* BFA11111 111110F4 */
+Q2  =   1.58730158725481460165e-03, /* 3F5A01A0 19FE5585 */
+Q3  =  -7.93650757867487942473e-05, /* BF14CE19 9EAADBB7 */
+Q4  =   4.00821782732936239552e-06, /* 3ED0CFCA 86E65239 */
+Q5  =  -2.01099218183624371326e-07; /* BE8AFDB7 6E09C32D */
+
+#ifdef __STDC__
+	double fd_expm1(double x)
+#else
+	double fd_expm1(x)
+	double x;
+#endif
+{
+	double y,hi,lo,c,t,e,hxs,hfx,r1;
+	int k,xsb;
+	unsigned hx;
+
+	hx  = __HI(x);	/* high word of x */
+	xsb = hx&0x80000000;		/* sign bit of x */
+	if(xsb==0) y=x; else y= -x;	/* y = |x| */
+	hx &= 0x7fffffff;		/* high word of |x| */
+
+    /* filter out huge and non-finite argument */
+	if(hx >= 0x4043687A) {			/* if |x|>=56*ln2 */
+	    if(hx >= 0x40862E42) {		/* if |x|>=709.78... */
+                if(hx>=0x7ff00000) {
+		    if(((hx&0xfffff)|__LO(x))!=0) 
+		         return x+x; 	 /* NaN */
+		    else return (xsb==0)? x:-1.0;/* exp(+-inf)={inf,-1} */
+	        }
+	        if(x > o_threshold) return huge*huge; /* overflow */
+	    }
+	    if(xsb!=0) { /* x < -56*ln2, return -1.0 with inexact */
+		if(x+tiny<0.0)		/* raise inexact */
+		return tiny-one;	/* return -1 */
+	    }
+	}
+
+    /* argument reduction */
+	if(hx > 0x3fd62e42) {		/* if  |x| > 0.5 ln2 */ 
+	    if(hx < 0x3FF0A2B2) {	/* and |x| < 1.5 ln2 */
+		if(xsb==0)
+		    {hi = x - ln2_hi; lo =  ln2_lo;  k =  1;}
+		else
+		    {hi = x + ln2_hi; lo = -ln2_lo;  k = -1;}
+	    } else {
+		k  = (int)(invln2*x+((xsb==0)?0.5:-0.5));
+		t  = k;
+		hi = x - t*ln2_hi;	/* t*ln2_hi is exact here */
+		lo = t*ln2_lo;
+	    }
+	    x  = hi - lo;
+	    c  = (hi-x)-lo;
+	} 
+	else if(hx < 0x3c900000) {  	/* when |x|<2**-54, return x */
+	    t = huge+x;	/* return x with inexact flags when x!=0 */
+	    return x - (t-(huge+x));	
+	}
+	else k = 0;
+
+    /* x is now in primary range */
+	hfx = 0.5*x;
+	hxs = x*hfx;
+	r1 = one+hxs*(Q1+hxs*(Q2+hxs*(Q3+hxs*(Q4+hxs*Q5))));
+	t  = 3.0-r1*hfx;
+	e  = hxs*((r1-t)/(6.0 - x*t));
+	if(k==0) return x - (x*e-hxs);		/* c is 0 */
+	else {
+	    e  = (x*(e-c)-c);
+	    e -= hxs;
+	    if(k== -1) return 0.5*(x-e)-0.5;
+	    if(k==1) 
+	       	if(x < -0.25) return -2.0*(e-(x+0.5));
+	       	else 	      return  one+2.0*(x-e);
+	    if (k <= -2 || k>56) {   /* suffice to return exp(x)-1 */
+	        y = one-(e-x);
+	        __HI(y) += (k<<20);	/* add k to y's exponent */
+	        return y-one;
+	    }
+	    t = one;
+	    if(k<20) {
+	       	__HI(t) = 0x3ff00000 - (0x200000>>k);  /* t=1-2^-k */
+	       	y = t-(e-x);
+	       	__HI(y) += (k<<20);	/* add k to y's exponent */
+	   } else {
+	       	__HI(t)  = ((0x3ff-k)<<20);	/* 2^-k */
+	       	y = x-(e+t);
+	       	y += one;
+	       	__HI(y) += (k<<20);	/* add k to y's exponent */
+	    }
+	}
+	return y;
+}

mozilla/js/ref/fdlibm/s_fabs.c

@@ -0,0 +1,45 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public License
+ * Version 1.0 (the "NPL"); you may not use this file except in
+ * compliance with the NPL.  You may obtain a copy of the NPL at
+ * http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the NPL is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+ * for the specific language governing rights and limitations under the
+ * NPL.
+ *
+ * The Initial Developer of this code under the NPL is Sun Microsystems,
+ * Inc.  Portions created by Netscape are Copyright (C) 1998 Netscape
+ * Communications Corporation.  All Rights Reserved.
+ */
+
+/* @(#)s_fabs.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/*
+ * fabs(x) returns the absolute value of x.
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+	double fd_fabs(double x)
+#else
+	double fd_fabs(x)
+	double x;
+#endif
+{
+	__HI(x) &= 0x7fffffff;
+        return x;
+}

mozilla/js/ref/fdlibm/s_finite.c

@@ -0,0 +1,47 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public License
+ * Version 1.0 (the "NPL"); you may not use this file except in
+ * compliance with the NPL.  You may obtain a copy of the NPL at
+ * http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the NPL is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+ * for the specific language governing rights and limitations under the
+ * NPL.
+ *
+ * The Initial Developer of this code under the NPL is Sun Microsystems,
+ * Inc.  Portions created by Netscape are Copyright (C) 1998 Netscape
+ * Communications Corporation.  All Rights Reserved.
+ */
+
+/* @(#)s_finite.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/*
+ * finite(x) returns 1 is x is finite, else 0;
+ * no branching!
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+	int fd_finite(double x)
+#else
+	int fd_finite(x)
+	double x;
+#endif
+{
+	int hx; 
+	hx = __HI(x);
+	return  (unsigned)((hx&0x7fffffff)-0x7ff00000)>>31;
+}

mozilla/js/ref/fdlibm/s_floor.c

@@ -0,0 +1,95 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public License
+ * Version 1.0 (the "NPL"); you may not use this file except in
+ * compliance with the NPL.  You may obtain a copy of the NPL at
+ * http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the NPL is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+ * for the specific language governing rights and limitations under the
+ * NPL.
+ *
+ * The Initial Developer of this code under the NPL is Sun Microsystems,
+ * Inc.  Portions created by Netscape are Copyright (C) 1998 Netscape
+ * Communications Corporation.  All Rights Reserved.
+ */
+
+/* @(#)s_floor.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/*
+ * floor(x)
+ * Return x rounded toward -inf to integral value
+ * Method:
+ *	Bit twiddling.
+ * Exception:
+ *	Inexact flag raised if x not equal to floor(x).
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double huge = 1.0e300;
+#else
+static double huge = 1.0e300;
+#endif
+
+#ifdef __STDC__
+	double fd_floor(double x)
+#else
+	double fd_floor(x)
+	double x;
+#endif
+{
+	int i0,i1,j0;
+	unsigned i,j;
+	i0 =  __HI(x);
+	i1 =  __LO(x);
+	j0 = ((i0>>20)&0x7ff)-0x3ff;
+	if(j0<20) {
+	    if(j0<0) { 	/* raise inexact if x != 0 */
+		if(huge+x>0.0) {/* return 0*sign(x) if |x|<1 */
+		    if(i0>=0) {i0=i1=0;} 
+		    else if(((i0&0x7fffffff)|i1)!=0)
+			{ i0=0xbff00000;i1=0;}
+		}
+	    } else {
+		i = (0x000fffff)>>j0;
+		if(((i0&i)|i1)==0) return x; /* x is integral */
+		if(huge+x>0.0) {	/* raise inexact flag */
+		    if(i0<0) i0 += (0x00100000)>>j0;
+		    i0 &= (~i); i1=0;
+		}
+	    }
+	} else if (j0>51) {
+	    if(j0==0x400) return x+x;	/* inf or NaN */
+	    else return x;		/* x is integral */
+	} else {
+	    i = ((unsigned)(0xffffffff))>>(j0-20);
+	    if((i1&i)==0) return x;	/* x is integral */
+	    if(huge+x>0.0) { 		/* raise inexact flag */
+		if(i0<0) {
+		    if(j0==20) i0+=1; 
+		    else {
+			j = i1+(1<<(52-j0));
+			if((int)j<i1) i0 +=1 ; 	/* got a carry */
+			i1=j;
+		    }
+		}
+		i1 &= (~i);
+	    }
+	}
+	__HI(x) = i0;
+	__LO(x) = i1;
+	return x;
+}

mozilla/js/ref/fdlibm/s_frexp.c

@@ -0,0 +1,72 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public License
+ * Version 1.0 (the "NPL"); you may not use this file except in
+ * compliance with the NPL.  You may obtain a copy of the NPL at
+ * http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the NPL is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+ * for the specific language governing rights and limitations under the
+ * NPL.
+ *
+ * The Initial Developer of this code under the NPL is Sun Microsystems,
+ * Inc.  Portions created by Netscape are Copyright (C) 1998 Netscape
+ * Communications Corporation.  All Rights Reserved.
+ */
+
+/* @(#)s_frexp.c 1.4 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/*
+ * for non-zero x 
+ *	x = frexp(arg,&exp);
+ * return a double fp quantity x such that 0.5 <= |x| <1.0
+ * and the corresponding binary exponent "exp". That is
+ *	arg = x*2^exp.
+ * If arg is inf, 0.0, or NaN, then frexp(arg,&exp) returns arg 
+ * with *exp=0. 
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double
+#else
+static double
+#endif
+two54 =  1.80143985094819840000e+16; /* 0x43500000, 0x00000000 */
+
+#ifdef __STDC__
+	double fd_frexp(double x, int *eptr)
+#else
+	double fd_frexp(x, eptr)
+	double x; int *eptr;
+#endif
+{
+	int  hx, ix, lx;
+	hx = __HI(x);
+	ix = 0x7fffffff&hx;
+	lx = __LO(x);
+	*eptr = 0;
+	if(ix>=0x7ff00000||((ix|lx)==0)) return x;	/* 0,inf,nan */
+	if (ix<0x00100000) {		/* subnormal */
+	    x *= two54;
+	    hx = __HI(x);
+	    ix = hx&0x7fffffff;
+	    *eptr = -54;
+	}
+	*eptr += (ix>>20)-1022;
+	hx = (hx&0x800fffff)|0x3fe00000;
+	__HI(x) = hx;
+	return x;
+}

mozilla/js/ref/fdlibm/s_ilogb.c

@@ -0,0 +1,62 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public License
+ * Version 1.0 (the "NPL"); you may not use this file except in
+ * compliance with the NPL.  You may obtain a copy of the NPL at
+ * http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the NPL is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+ * for the specific language governing rights and limitations under the
+ * NPL.
+ *
+ * The Initial Developer of this code under the NPL is Sun Microsystems,
+ * Inc.  Portions created by Netscape are Copyright (C) 1998 Netscape
+ * Communications Corporation.  All Rights Reserved.
+ */
+
+/* @(#)s_ilogb.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* ilogb(double x)
+ * return the binary exponent of non-zero x
+ * ilogb(0) = 0x80000001
+ * ilogb(inf/NaN) = 0x7fffffff (no signal is raised)
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+	int fd_ilogb(double x)
+#else
+	int fd_ilogb(x)
+	double x;
+#endif
+{
+	int hx,lx,ix;
+
+	hx  = (__HI(x))&0x7fffffff;	/* high word of x */
+	if(hx<0x00100000) {
+	    lx = __LO(x);
+	    if((hx|lx)==0) 
+		return 0x80000001;	/* ilogb(0) = 0x80000001 */
+	    else			/* subnormal x */
+		if(hx==0) {
+		    for (ix = -1043; lx>0; lx<<=1) ix -=1;
+		} else {
+		    for (ix = -1022,hx<<=11; hx>0; hx<<=1) ix -=1;
+		}
+	    return ix;
+	}
+	else if (hx<0x7ff00000) return (hx>>20)-1023;
+	else return 0x7fffffff;
+}

mozilla/js/ref/fdlibm/s_isnan.c

@@ -0,0 +1,50 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public License
+ * Version 1.0 (the "NPL"); you may not use this file except in
+ * compliance with the NPL.  You may obtain a copy of the NPL at
+ * http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the NPL is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+ * for the specific language governing rights and limitations under the
+ * NPL.
+ *
+ * The Initial Developer of this code under the NPL is Sun Microsystems,
+ * Inc.  Portions created by Netscape are Copyright (C) 1998 Netscape
+ * Communications Corporation.  All Rights Reserved.
+ */
+
+/* @(#)s_isnan.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/*
+ * isnan(x) returns 1 is x is nan, else 0;
+ * no branching!
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+	int fd_isnan(double x)
+#else
+	int fd_isnan(x)
+	double x;
+#endif
+{
+	int hx,lx;
+	hx = (__HI(x)&0x7fffffff);
+	lx = __LO(x);
+	hx |= (unsigned)(lx|(-lx))>>31;	
+	hx = 0x7ff00000 - hx;
+	return ((unsigned)(hx))>>31;
+}

mozilla/js/ref/fdlibm/s_ldexp.c

@@ -0,0 +1,44 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public License
+ * Version 1.0 (the "NPL"); you may not use this file except in
+ * compliance with the NPL.  You may obtain a copy of the NPL at
+ * http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the NPL is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+ * for the specific language governing rights and limitations under the
+ * NPL.
+ *
+ * The Initial Developer of this code under the NPL is Sun Microsystems,
+ * Inc.  Portions created by Netscape are Copyright (C) 1998 Netscape
+ * Communications Corporation.  All Rights Reserved.
+ */
+
+/* @(#)s_ldexp.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+#include "fdlibm.h"
+#include <errno.h>
+
+#ifdef __STDC__
+	double fd_ldexp(double value, int exp)
+#else
+	double fd_ldexp(value, exp)
+	double value; int exp;
+#endif
+{
+	if(!fd_finite(value)||value==0.0) return value;
+	value = fd_scalbn(value,exp);
+	if(!fd_finite(value)||value==0.0) errno = ERANGE;
+	return value;
+}

mozilla/js/ref/fdlibm/s_lib_version.c

@@ -0,0 +1,51 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public License
+ * Version 1.0 (the "NPL"); you may not use this file except in
+ * compliance with the NPL.  You may obtain a copy of the NPL at
+ * http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the NPL is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+ * for the specific language governing rights and limitations under the
+ * NPL.
+ *
+ * The Initial Developer of this code under the NPL is Sun Microsystems,
+ * Inc.  Portions created by Netscape are Copyright (C) 1998 Netscape
+ * Communications Corporation.  All Rights Reserved.
+ */
+
+/* @(#)s_lib_version.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/*
+ * MACRO for standards
+ */
+
+#include "fdlibm.h"
+
+/*
+ * define and initialize _LIB_VERSION
+ */
+#ifdef _POSIX_MODE
+_LIB_VERSION_TYPE _LIB_VERSION = _POSIX_;
+#else
+#ifdef _XOPEN_MODE
+_LIB_VERSION_TYPE _LIB_VERSION = _XOPEN_;
+#else
+#ifdef _SVID3_MODE
+_LIB_VERSION_TYPE _LIB_VERSION = _SVID_;
+#else					/* default _IEEE_MODE */
+_LIB_VERSION_TYPE _LIB_VERSION = _IEEE_;
+#endif
+#endif
+#endif

mozilla/js/ref/fdlibm/s_log1p.c

@@ -0,0 +1,181 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public License
+ * Version 1.0 (the "NPL"); you may not use this file except in
+ * compliance with the NPL.  You may obtain a copy of the NPL at
+ * http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the NPL is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+ * for the specific language governing rights and limitations under the
+ * NPL.
+ *
+ * The Initial Developer of this code under the NPL is Sun Microsystems,
+ * Inc.  Portions created by Netscape are Copyright (C) 1998 Netscape
+ * Communications Corporation.  All Rights Reserved.
+ */
+
+/* @(#)s_log1p.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* double log1p(double x)
+ *
+ * Method :                  
+ *   1. Argument Reduction: find k and f such that 
+ *			1+x = 2^k * (1+f), 
+ *	   where  sqrt(2)/2 < 1+f < sqrt(2) .
+ *
+ *      Note. If k=0, then f=x is exact. However, if k!=0, then f
+ *	may not be representable exactly. In that case, a correction
+ *	term is need. Let u=1+x rounded. Let c = (1+x)-u, then
+ *	log(1+x) - log(u) ~ c/u. Thus, we proceed to compute log(u),
+ *	and add back the correction term c/u.
+ *	(Note: when x > 2**53, one can simply return log(x))
+ *
+ *   2. Approximation of log1p(f).
+ *	Let s = f/(2+f) ; based on log(1+f) = log(1+s) - log(1-s)
+ *		 = 2s + 2/3 s**3 + 2/5 s**5 + .....,
+ *	     	 = 2s + s*R
+ *      We use a special Reme algorithm on [0,0.1716] to generate 
+ * 	a polynomial of degree 14 to approximate R The maximum error 
+ *	of this polynomial approximation is bounded by 2**-58.45. In
+ *	other words,
+ *		        2      4      6      8      10      12      14
+ *	    R(z) ~ Lp1*s +Lp2*s +Lp3*s +Lp4*s +Lp5*s  +Lp6*s  +Lp7*s
+ *  	(the values of Lp1 to Lp7 are listed in the program)
+ *	and
+ *	    |      2          14          |     -58.45
+ *	    | Lp1*s +...+Lp7*s    -  R(z) | <= 2 
+ *	    |                             |
+ *	Note that 2s = f - s*f = f - hfsq + s*hfsq, where hfsq = f*f/2.
+ *	In order to guarantee error in log below 1ulp, we compute log
+ *	by
+ *		log1p(f) = f - (hfsq - s*(hfsq+R)).
+ *	
+ *	3. Finally, log1p(x) = k*ln2 + log1p(f).  
+ *		 	     = k*ln2_hi+(f-(hfsq-(s*(hfsq+R)+k*ln2_lo)))
+ *	   Here ln2 is split into two floating point number: 
+ *			ln2_hi + ln2_lo,
+ *	   where n*ln2_hi is always exact for |n| < 2000.
+ *
+ * Special cases:
+ *	log1p(x) is NaN with signal if x < -1 (including -INF) ; 
+ *	log1p(+INF) is +INF; log1p(-1) is -INF with signal;
+ *	log1p(NaN) is that NaN with no signal.
+ *
+ * Accuracy:
+ *	according to an error analysis, the error is always less than
+ *	1 ulp (unit in the last place).
+ *
+ * Constants:
+ * The hexadecimal values are the intended ones for the following 
+ * constants. The decimal values may be used, provided that the 
+ * compiler will convert from decimal to binary accurately enough 
+ * to produce the hexadecimal values shown.
+ *
+ * Note: Assuming log() return accurate answer, the following
+ * 	 algorithm can be used to compute log1p(x) to within a few ULP:
+ *	
+ *		u = 1+x;
+ *		if(u==1.0) return x ; else
+ *			   return log(u)*(x/(u-1.0));
+ *
+ *	 See HP-15C Advanced Functions Handbook, p.193.
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double
+#else
+static double
+#endif
+ln2_hi  =  6.93147180369123816490e-01,	/* 3fe62e42 fee00000 */
+ln2_lo  =  1.90821492927058770002e-10,	/* 3dea39ef 35793c76 */
+two54   =  1.80143985094819840000e+16,  /* 43500000 00000000 */
+Lp1 = 6.666666666666735130e-01,  /* 3FE55555 55555593 */
+Lp2 = 3.999999999940941908e-01,  /* 3FD99999 9997FA04 */
+Lp3 = 2.857142874366239149e-01,  /* 3FD24924 94229359 */
+Lp4 = 2.222219843214978396e-01,  /* 3FCC71C5 1D8E78AF */
+Lp5 = 1.818357216161805012e-01,  /* 3FC74664 96CB03DE */
+Lp6 = 1.531383769920937332e-01,  /* 3FC39A09 D078C69F */
+Lp7 = 1.479819860511658591e-01;  /* 3FC2F112 DF3E5244 */
+
+static double zero = 0.0;
+
+#ifdef __STDC__
+	double fd_log1p(double x)
+#else
+	double fd_log1p(x)
+	double x;
+#endif
+{
+	double hfsq,f,c,s,z,R,u;
+	int k,hx,hu,ax;
+
+	hx = __HI(x);		/* high word of x */
+	ax = hx&0x7fffffff;
+
+	k = 1;
+	if (hx < 0x3FDA827A) {			/* x < 0.41422  */
+	    if(ax>=0x3ff00000) {		/* x <= -1.0 */
+		if(x==-1.0) return -two54/zero; /* log1p(-1)=+inf */
+		else return (x-x)/(x-x);	/* log1p(x<-1)=NaN */
+	    }
+	    if(ax<0x3e200000) {			/* |x| < 2**-29 */
+		if(two54+x>zero			/* raise inexact */
+	            &&ax<0x3c900000) 		/* |x| < 2**-54 */
+		    return x;
+		else
+		    return x - x*x*0.5;
+	    }
+	    if(hx>0||hx<=((int)0xbfd2bec3)) {
+		k=0;f=x;hu=1;}	/* -0.2929<x<0.41422 */
+	} 
+	if (hx >= 0x7ff00000) return x+x;
+	if(k!=0) {
+	    if(hx<0x43400000) {
+		u  = 1.0+x; 
+	        hu = __HI(u);		/* high word of u */
+	        k  = (hu>>20)-1023;
+	        c  = (k>0)? 1.0-(u-x):x-(u-1.0);/* correction term */
+		c /= u;
+	    } else {
+		u  = x;
+	        hu = __HI(u);		/* high word of u */
+	        k  = (hu>>20)-1023;
+		c  = 0;
+	    }
+	    hu &= 0x000fffff;
+	    if(hu<0x6a09e) {
+	        __HI(u) = hu|0x3ff00000;	/* normalize u */
+	    } else {
+	        k += 1; 
+	        __HI(u) = hu|0x3fe00000;	/* normalize u/2 */
+	        hu = (0x00100000-hu)>>2;
+	    }
+	    f = u-1.0;
+	}
+	hfsq=0.5*f*f;
+	if(hu==0) {	/* |f| < 2**-20 */
+	    if(f==zero) if(k==0) return zero;  
+			else {c += k*ln2_lo; return k*ln2_hi+c;}
+	    R = hfsq*(1.0-0.66666666666666666*f);
+	    if(k==0) return f-R; else
+	    	     return k*ln2_hi-((R-(k*ln2_lo+c))-f);
+	}
+ 	s = f/(2.0+f); 
+	z = s*s;
+	R = z*(Lp1+z*(Lp2+z*(Lp3+z*(Lp4+z*(Lp5+z*(Lp6+z*Lp7))))));
+	if(k==0) return f-(hfsq-s*(hfsq+R)); else
+		 return k*ln2_hi-((hfsq-(s*(hfsq+R)+(k*ln2_lo+c)))-f);
+}

mozilla/js/ref/fdlibm/s_logb.c

@@ -0,0 +1,54 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public License
+ * Version 1.0 (the "NPL"); you may not use this file except in
+ * compliance with the NPL.  You may obtain a copy of the NPL at
+ * http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the NPL is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+ * for the specific language governing rights and limitations under the
+ * NPL.
+ *
+ * The Initial Developer of this code under the NPL is Sun Microsystems,
+ * Inc.  Portions created by Netscape are Copyright (C) 1998 Netscape
+ * Communications Corporation.  All Rights Reserved.
+ */
+
+/* @(#)s_logb.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/*
+ * double logb(x)
+ * IEEE 754 logb. Included to pass IEEE test suite. Not recommend.
+ * Use ilogb instead.
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+	double fd_logb(double x)
+#else
+	double fd_logb(x)
+	double x;
+#endif
+{
+	int lx,ix;
+	ix = (__HI(x))&0x7fffffff;	/* high |x| */
+	lx = __LO(x);			/* low x */
+	if((ix|lx)==0) return -1.0/fd_fabs(x);
+	if(ix>=0x7ff00000) return x*x;
+	if((ix>>=20)==0) 			/* IEEE 754 logb */
+		return -1022.0; 
+	else
+		return (double) (ix-1023); 
+}

mozilla/js/ref/fdlibm/s_matherr.c

@@ -0,0 +1,42 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public License
+ * Version 1.0 (the "NPL"); you may not use this file except in
+ * compliance with the NPL.  You may obtain a copy of the NPL at
+ * http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the NPL is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+ * for the specific language governing rights and limitations under the
+ * NPL.
+ *
+ * The Initial Developer of this code under the NPL is Sun Microsystems,
+ * Inc.  Portions created by Netscape are Copyright (C) 1998 Netscape
+ * Communications Corporation.  All Rights Reserved.
+ */
+
+/* @(#)s_matherr.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+	int fd_matherr(struct exception *x)
+#else
+	int fd_matherr(x)
+	struct exception *x;
+#endif
+{
+	int n=0;
+	if(x->arg1!=x->arg1) return 0;
+	return n;
+}

mozilla/js/ref/fdlibm/s_modf.c

@@ -0,0 +1,96 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public License
+ * Version 1.0 (the "NPL"); you may not use this file except in
+ * compliance with the NPL.  You may obtain a copy of the NPL at
+ * http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the NPL is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+ * for the specific language governing rights and limitations under the
+ * NPL.
+ *
+ * The Initial Developer of this code under the NPL is Sun Microsystems,
+ * Inc.  Portions created by Netscape are Copyright (C) 1998 Netscape
+ * Communications Corporation.  All Rights Reserved.
+ */
+
+/* @(#)s_modf.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/*
+ * modf(double x, double *iptr) 
+ * return fraction part of x, and return x's integral part in *iptr.
+ * Method:
+ *	Bit twiddling.
+ *
+ * Exception:
+ *	No exception.
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double one = 1.0;
+#else
+static double one = 1.0;
+#endif
+
+#ifdef __STDC__
+	double fd_modf(double x, double *iptr)
+#else
+	double fd_modf(x, iptr)
+	double x,*iptr;
+#endif
+{
+	int i0,i1,j0;
+	unsigned i;
+	i0 =  __HI(x);		/* high x */
+	i1 =  __LO(x);		/* low  x */
+	j0 = ((i0>>20)&0x7ff)-0x3ff;	/* exponent of x */
+	if(j0<20) {			/* integer part in high x */
+	    if(j0<0) {			/* |x|<1 */
+		__HIp(iptr) = i0&0x80000000;
+		__LOp(iptr) = 0;		/* *iptr = +-0 */
+		return x;
+	    } else {
+		i = (0x000fffff)>>j0;
+		if(((i0&i)|i1)==0) {		/* x is integral */
+		    *iptr = x;
+		    __HI(x) &= 0x80000000;
+		    __LO(x)  = 0;	/* return +-0 */
+		    return x;
+		} else {
+		    __HIp(iptr) = i0&(~i);
+		    __LOp(iptr) = 0;
+		    return x - *iptr;
+		}
+	    }
+	} else if (j0>51) {		/* no fraction part */
+	    *iptr = x*one;
+	    __HI(x) &= 0x80000000;
+	    __LO(x)  = 0;	/* return +-0 */
+	    return x;
+	} else {			/* fraction part in low x */
+	    i = ((unsigned)(0xffffffff))>>(j0-20);
+	    if((i1&i)==0) { 		/* x is integral */
+		*iptr = x;
+		__HI(x) &= 0x80000000;
+		__LO(x)  = 0;	/* return +-0 */
+		return x;
+	    } else {
+		__HIp(iptr) = i0;
+		__LOp(iptr) = i1&(~i);
+		return x - *iptr;
+	    }
+	}
+}

mozilla/js/ref/fdlibm/s_nextafter.c

@@ -0,0 +1,94 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public License
+ * Version 1.0 (the "NPL"); you may not use this file except in
+ * compliance with the NPL.  You may obtain a copy of the NPL at
+ * http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the NPL is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+ * for the specific language governing rights and limitations under the
+ * NPL.
+ *
+ * The Initial Developer of this code under the NPL is Sun Microsystems,
+ * Inc.  Portions created by Netscape are Copyright (C) 1998 Netscape
+ * Communications Corporation.  All Rights Reserved.
+ */
+
+/* @(#)s_nextafter.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* IEEE functions
+ *	nextafter(x,y)
+ *	return the next machine floating-point number of x in the
+ *	direction toward y.
+ *   Special cases:
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+	double fd_nextafter(double x, double y)
+#else
+	double fd_nextafter(x,y)
+	double x,y;
+#endif
+{
+	int	hx,hy,ix,iy;
+	unsigned lx,ly;
+
+	hx = __HI(x);		/* high word of x */
+	lx = __LO(x);		/* low  word of x */
+	hy = __HI(y);		/* high word of y */
+	ly = __LO(y);		/* low  word of y */
+	ix = hx&0x7fffffff;		/* |x| */
+	iy = hy&0x7fffffff;		/* |y| */
+
+	if(((ix>=0x7ff00000)&&((ix-0x7ff00000)|lx)!=0) ||   /* x is nan */ 
+	   ((iy>=0x7ff00000)&&((iy-0x7ff00000)|ly)!=0))     /* y is nan */ 
+	   return x+y;				
+	if(x==y) return x;		/* x=y, return x */
+	if((ix|lx)==0) {			/* x == 0 */
+	    __HI(x) = hy&0x80000000;	/* return +-minsubnormal */
+	    __LO(x) = 1;
+	    y = x*x;
+	    if(y==x) return y; else return x;	/* raise underflow flag */
+	} 
+	if(hx>=0) {				/* x > 0 */
+	    if(hx>hy||((hx==hy)&&(lx>ly))) {	/* x > y, x -= ulp */
+		if(lx==0) hx -= 1;
+		lx -= 1;
+	    } else {				/* x < y, x += ulp */
+		lx += 1;
+		if(lx==0) hx += 1;
+	    }
+	} else {				/* x < 0 */
+	    if(hy>=0||hx>hy||((hx==hy)&&(lx>ly))){/* x < y, x -= ulp */
+		if(lx==0) hx -= 1;
+		lx -= 1;
+	    } else {				/* x > y, x += ulp */
+		lx += 1;
+		if(lx==0) hx += 1;
+	    }
+	}
+	hy = hx&0x7ff00000;
+	if(hy>=0x7ff00000) return x+x;	/* overflow  */
+	if(hy<0x00100000) {		/* underflow */
+	    y = x*x;
+	    if(y!=x) {		/* raise underflow flag */
+		__HI(y) = hx; __LO(y) = lx;
+		return y;
+	    }
+	}
+	__HI(x) = hx; __LO(x) = lx;
+	return x;
+}

mozilla/js/ref/fdlibm/s_rint.c

@@ -0,0 +1,100 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public License
+ * Version 1.0 (the "NPL"); you may not use this file except in
+ * compliance with the NPL.  You may obtain a copy of the NPL at
+ * http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the NPL is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+ * for the specific language governing rights and limitations under the
+ * NPL.
+ *
+ * The Initial Developer of this code under the NPL is Sun Microsystems,
+ * Inc.  Portions created by Netscape are Copyright (C) 1998 Netscape
+ * Communications Corporation.  All Rights Reserved.
+ */
+
+/* @(#)s_rint.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/*
+ * rint(x)
+ * Return x rounded to integral value according to the prevailing
+ * rounding mode.
+ * Method:
+ *	Using floating addition.
+ * Exception:
+ *	Inexact flag raised if x not equal to rint(x).
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double
+#else
+static double 
+#endif
+TWO52[2]={
+  4.50359962737049600000e+15, /* 0x43300000, 0x00000000 */
+ -4.50359962737049600000e+15, /* 0xC3300000, 0x00000000 */
+};
+
+#ifdef __STDC__
+	double fd_rint(double x)
+#else
+	double fd_rint(x)
+	double x;
+#endif
+{
+	int i0,j0,sx;
+	unsigned i,i1;
+	double w,t;
+	i0 =  __HI(x);
+	sx = (i0>>31)&1;
+	i1 =  __LO(x);
+	j0 = ((i0>>20)&0x7ff)-0x3ff;
+	if(j0<20) {
+	    if(j0<0) { 	
+		if(((i0&0x7fffffff)|i1)==0) return x;
+		i1 |= (i0&0x0fffff);
+		i0 &= 0xfffe0000;
+		i0 |= ((i1|-(int)i1)>>12)&0x80000;
+		__HI(x)=i0;
+	        w = TWO52[sx]+x;
+	        t =  w-TWO52[sx];
+	        i0 = __HI(t);
+	        __HI(t) = (i0&0x7fffffff)|(sx<<31);
+	        return t;
+	    } else {
+		i = (0x000fffff)>>j0;
+		if(((i0&i)|i1)==0) return x; /* x is integral */
+		i>>=1;
+		if(((i0&i)|i1)!=0) {
+		    if(j0==19) i1 = 0x40000000; else
+		    i0 = (i0&(~i))|((0x20000)>>j0);
+		}
+	    }
+	} else if (j0>51) {
+	    if(j0==0x400) return x+x;	/* inf or NaN */
+	    else return x;		/* x is integral */
+	} else {
+	    i = ((unsigned)(0xffffffff))>>(j0-20);
+	    if((i1&i)==0) return x;	/* x is integral */
+	    i>>=1;
+	    if((i1&i)!=0) i1 = (i1&(~i))|((0x40000000)>>(j0-20));
+	}
+	__HI(x) = i0;
+	__LO(x) = i1;
+	w = TWO52[sx]+x;
+	return w-TWO52[sx];
+}

mozilla/js/ref/fdlibm/s_scalbn.c

@@ -0,0 +1,79 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public License
+ * Version 1.0 (the "NPL"); you may not use this file except in
+ * compliance with the NPL.  You may obtain a copy of the NPL at
+ * http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the NPL is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+ * for the specific language governing rights and limitations under the
+ * NPL.
+ *
+ * The Initial Developer of this code under the NPL is Sun Microsystems,
+ * Inc.  Portions created by Netscape are Copyright (C) 1998 Netscape
+ * Communications Corporation.  All Rights Reserved.
+ */
+
+/* @(#)s_scalbn.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* 
+ * scalbn (double x, int n)
+ * scalbn(x,n) returns x* 2**n  computed by  exponent  
+ * manipulation rather than by actually performing an 
+ * exponentiation or a multiplication.
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double
+#else
+static double
+#endif
+two54   =  1.80143985094819840000e+16, /* 0x43500000, 0x00000000 */
+twom54  =  5.55111512312578270212e-17, /* 0x3C900000, 0x00000000 */
+huge   = 1.0e+300,
+tiny   = 1.0e-300;
+
+#ifdef __STDC__
+	double fd_scalbn (double x, int n)
+#else
+	double fd_scalbn (x,n)
+	double x; int n;
+#endif
+{
+	int  k,hx,lx;
+	hx = __HI(x);
+	lx = __LO(x);
+        k = (hx&0x7ff00000)>>20;		/* extract exponent */
+        if (k==0) {				/* 0 or subnormal x */
+            if ((lx|(hx&0x7fffffff))==0) return x; /* +-0 */
+	    x *= two54; 
+	    hx = __HI(x);
+	    k = ((hx&0x7ff00000)>>20) - 54; 
+            if (n< -50000) return tiny*x; 	/*underflow*/
+	    }
+        if (k==0x7ff) return x+x;		/* NaN or Inf */
+        k = k+n; 
+        if (k >  0x7fe) return huge*fd_copysign(huge,x); /* overflow  */
+        if (k > 0) 				/* normal result */
+	    {__HI(x) = (hx&0x800fffff)|(k<<20); return x;}
+        if (k <= -54)
+            if (n > 50000) 	/* in case integer overflow in n+k */
+		return huge*fd_copysign(huge,x);	/*overflow*/
+	    else return tiny*fd_copysign(tiny,x); 	/*underflow*/
+        k += 54;				/* subnormal result */
+        __HI(x) = (hx&0x800fffff)|(k<<20);
+        return x*twom54;
+}

mozilla/js/ref/fdlibm/s_signgam.c

@@ -0,0 +1,18 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public License
+ * Version 1.0 (the "NPL"); you may not use this file except in
+ * compliance with the NPL.  You may obtain a copy of the NPL at
+ * http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the NPL is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+ * for the specific language governing rights and limitations under the
+ * NPL.
+ *
+ * The Initial Developer of this code under the NPL is Sun Microsystems,
+ * Inc.  Portions created by Netscape are Copyright (C) 1998 Netscape
+ * Communications Corporation.  All Rights Reserved.
+ */
+#include "fdlibm.h"
+int signgam = 0;

mozilla/js/ref/fdlibm/s_significand.c

@@ -0,0 +1,46 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public License
+ * Version 1.0 (the "NPL"); you may not use this file except in
+ * compliance with the NPL.  You may obtain a copy of the NPL at
+ * http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the NPL is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+ * for the specific language governing rights and limitations under the
+ * NPL.
+ *
+ * The Initial Developer of this code under the NPL is Sun Microsystems,
+ * Inc.  Portions created by Netscape are Copyright (C) 1998 Netscape
+ * Communications Corporation.  All Rights Reserved.
+ */
+
+/* @(#)s_significand.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/*
+ * significand(x) computes just
+ * 	scalb(x, (double) -ilogb(x)),
+ * for exercising the fraction-part(F) IEEE 754-1985 test vector.
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+	double fd_significand(double x)
+#else
+	double fd_significand(x)
+	double x;
+#endif
+{
+	return __ieee754_scalb(x,(double) -fd_ilogb(x));
+}

mozilla/js/ref/fdlibm/s_sin.c

@@ -0,0 +1,94 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public License
+ * Version 1.0 (the "NPL"); you may not use this file except in
+ * compliance with the NPL.  You may obtain a copy of the NPL at
+ * http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the NPL is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
+ * for the specific language governing rights and limitations under the
+ * NPL.
+ *
+ * The Initial Developer of this code under the NPL is Sun Microsystems,
+ * Inc.  Portions created by Netscape are Copyright (C) 1998 Netscape
+ * Communications Corporation.  All Rights Reserved.
+ */
+
+/* @(#)s_sin.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* sin(x)
+ * Return sine function of x.
+ *
+ * kernel function:
+ *	__kernel_sin		... sine function on [-pi/4,pi/4]
+ *	__kernel_cos		... cose function on [-pi/4,pi/4]
+ *	__ieee754_rem_pio2	... argument reduction routine
+ *
+ * Method.
+ *      Let S,C and T denote the sin, cos and tan respectively on 
+ *	[-PI/4, +PI/4]. Reduce the argument x to y1+y2 = x-k*pi/2 
+ *	in [-pi/4 , +pi/4], and let n = k mod 4.
+ *	We have
+ *
+ *          n        sin(x)      cos(x)        tan(x)
+ *     ----------------------------------------------------------
+ *	    0	       S	   C		 T
+ *	    1	       C	  -S		-1/T
+ *	    2	      -S	  -C		 T
+ *	    3	      -C	   S		-1/T
+ *     ----------------------------------------------------------
+ *
+ * Special cases:
+ *      Let trig be any of sin, cos, or tan.
+ *      trig(+-INF)  is NaN, with signals;
+ *      trig(NaN)    is that NaN;
+ *
+ * Accuracy:
+ *	TRIG(x) returns trig(x) nearly rounded 
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+	double fd_sin(double x)
+#else
+	double fd_sin(x)
+	double x;
+#endif
+{
+	double y[2],z=0.0;
+	int n, ix;
+
+    /* High word of x. */
+	ix = __HI(x);
+
+    /* |x| ~< pi/4 */
+	ix &= 0x7fffffff;
+	if(ix <= 0x3fe921fb) return __kernel_sin(x,z,0);
+
+    /* sin(Inf or NaN) is NaN */
+	else if (ix>=0x7ff00000) return x-x;
+
+    /* argument reduction needed */
+	else {
+	    n = __ieee754_rem_pio2(x,y);
+	    switch(n&3) {
+		case 0: return  __kernel_sin(y[0],y[1],1);
+		case 1: return  __kernel_cos(y[0],y[1]);
+		case 2: return -__kernel_sin(y[0],y[1],1);
+		default:
+			return -__kernel_cos(y[0],y[1]);
+	    }
+	}
+}