Compare commits
1 Commits
tags/Mozbo
...
CVS
| Author | SHA1 | Date | |
|---|---|---|---|
|
|
c5d6b83e4c |
617
mozilla/htmlparser/src/nsAVLTree.cpp
Normal file
617
mozilla/htmlparser/src/nsAVLTree.cpp
Normal file
@@ -0,0 +1,617 @@
|
||||
/* -*- Mode: C++; tab-width: 2; indent-tabs-mode: nil; c-basic-offset: 2 -*-
|
||||
*
|
||||
* The contents of this file are subject to the Netscape Public License
|
||||
* Version 1.0 (the "NPL"); you may not use this file except in
|
||||
* compliance with the NPL. You may obtain a copy of the NPL at
|
||||
* http://www.mozilla.org/NPL/
|
||||
*
|
||||
* Software distributed under the NPL is distributed on an "AS IS" basis,
|
||||
* WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
|
||||
* for the specific language governing rights and limitations under the
|
||||
* NPL.
|
||||
*
|
||||
* The Initial Developer of this code under the NPL is Netscape
|
||||
* Communications Corporation. Portions created by Netscape are
|
||||
* Copyright (C) 1999 Netscape Communications Corporation. All Rights
|
||||
* Reserved.
|
||||
*/
|
||||
|
||||
#include "nsAVLTree.h"
|
||||
|
||||
|
||||
enum eLean {eLeft,eNeutral,eRight};
|
||||
|
||||
struct NS_COM nsAVLNode {
|
||||
public:
|
||||
|
||||
nsAVLNode(void* aValue) {
|
||||
mLeft=0;
|
||||
mRight=0;
|
||||
mSkew=eNeutral;
|
||||
mValue=aValue;
|
||||
}
|
||||
|
||||
nsAVLNode* mLeft;
|
||||
nsAVLNode* mRight;
|
||||
eLean mSkew;
|
||||
void* mValue;
|
||||
};
|
||||
|
||||
|
||||
/************************************************************
|
||||
Now begin the tree class. Don't forget that the comparison
|
||||
between nodes must occur via the comparitor function,
|
||||
otherwise all you're testing is pointer addresses.
|
||||
************************************************************/
|
||||
|
||||
/** ------------------------------------------------
|
||||
*
|
||||
*
|
||||
* @update gess 4/22/98
|
||||
* @param
|
||||
* @return
|
||||
*/ //----------------------------------------------
|
||||
nsAVLTree::nsAVLTree(nsAVLNodeComparitor& aComparitor,
|
||||
nsAVLNodeFunctor* aDeallocator) :
|
||||
mComparitor(aComparitor), mDeallocator(aDeallocator) {
|
||||
mRoot=0;
|
||||
mCount=0;
|
||||
}
|
||||
|
||||
|
||||
static void
|
||||
avlDeleteTree(nsAVLNode* aNode){
|
||||
if (aNode) {
|
||||
avlDeleteTree(aNode->mLeft);
|
||||
avlDeleteTree(aNode->mRight);
|
||||
delete aNode;
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
*
|
||||
* @update gess12/27/98
|
||||
* @param
|
||||
* @return
|
||||
*/
|
||||
nsAVLTree::~nsAVLTree(){
|
||||
if (mDeallocator) {
|
||||
ForEachDepthFirst(*mDeallocator);
|
||||
}
|
||||
avlDeleteTree(mRoot);
|
||||
}
|
||||
|
||||
|
||||
class CDoesntExist: public nsAVLNodeFunctor {
|
||||
public:
|
||||
CDoesntExist(const nsAVLTree& anotherTree) : mOtherTree(anotherTree) {
|
||||
}
|
||||
virtual void* operator()(void* anItem) {
|
||||
void* result=mOtherTree.FindItem(anItem);
|
||||
if(result)
|
||||
return nsnull;
|
||||
return anItem;
|
||||
}
|
||||
protected:
|
||||
const nsAVLTree& mOtherTree;
|
||||
};
|
||||
|
||||
/**
|
||||
* This method compares two trees (members by identity).
|
||||
* @update gess12/27/98
|
||||
* @param tree to compare against
|
||||
* @return true if they are identical (contain same stuff).
|
||||
*/
|
||||
PRBool nsAVLTree::operator==(const nsAVLTree& aCopy) const{
|
||||
CDoesntExist functor(aCopy);
|
||||
void* theItem=FirstThat(functor);
|
||||
PRBool result=PRBool(!theItem);
|
||||
return result;
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
*
|
||||
* @update gess12/27/98
|
||||
* @param
|
||||
* @return
|
||||
*/
|
||||
static void
|
||||
avlRotateRight(nsAVLNode*& aRootNode){
|
||||
nsAVLNode* ptr2;
|
||||
nsAVLNode* ptr3;
|
||||
|
||||
ptr2=aRootNode->mRight;
|
||||
if(ptr2->mSkew==eRight) {
|
||||
aRootNode->mRight=ptr2->mLeft;
|
||||
ptr2->mLeft=aRootNode;
|
||||
aRootNode->mSkew=eNeutral;
|
||||
aRootNode=ptr2;
|
||||
}
|
||||
else {
|
||||
ptr3=ptr2->mLeft;
|
||||
ptr2->mLeft=ptr3->mRight;
|
||||
ptr3->mRight=ptr2;
|
||||
aRootNode->mRight=ptr3->mLeft;
|
||||
ptr3->mLeft=aRootNode;
|
||||
if(ptr3->mSkew==eLeft)
|
||||
ptr2->mSkew=eRight;
|
||||
else ptr2->mSkew=eNeutral;
|
||||
if(ptr3->mSkew==eRight)
|
||||
aRootNode->mSkew=eLeft;
|
||||
else aRootNode->mSkew=eNeutral;
|
||||
aRootNode=ptr3;
|
||||
}
|
||||
aRootNode->mSkew=eNeutral;
|
||||
return;
|
||||
}
|
||||
|
||||
|
||||
|
||||
/**
|
||||
*
|
||||
* @update gess12/27/98
|
||||
* @param
|
||||
* @return
|
||||
*/
|
||||
static void
|
||||
avlRotateLeft(nsAVLNode*& aRootNode){
|
||||
nsAVLNode* ptr2;
|
||||
nsAVLNode* ptr3;
|
||||
|
||||
ptr2=aRootNode->mLeft;
|
||||
if(ptr2->mSkew==eLeft) {
|
||||
aRootNode->mLeft=ptr2->mRight;
|
||||
ptr2->mRight=aRootNode;
|
||||
aRootNode->mSkew=eNeutral;
|
||||
aRootNode=ptr2;
|
||||
}
|
||||
else {
|
||||
ptr3=ptr2->mRight;
|
||||
ptr2->mRight=ptr3->mLeft;
|
||||
ptr3->mLeft=ptr2;
|
||||
aRootNode->mLeft=ptr3->mRight;
|
||||
ptr3->mRight=aRootNode;
|
||||
if(ptr3->mSkew==eRight)
|
||||
ptr2->mSkew=eLeft;
|
||||
else ptr2->mSkew=eNeutral;
|
||||
if(ptr3->mSkew==eLeft)
|
||||
aRootNode->mSkew=eRight;
|
||||
else aRootNode->mSkew=eNeutral;
|
||||
aRootNode=ptr3;
|
||||
}
|
||||
aRootNode->mSkew=eNeutral;
|
||||
return;
|
||||
}
|
||||
|
||||
|
||||
/** ------------------------------------------------
|
||||
*
|
||||
*
|
||||
* @update gess 4/22/98
|
||||
* @param
|
||||
* @return
|
||||
*/ //----------------------------------------------
|
||||
static eAVLStatus
|
||||
avlInsert(nsAVLNode*& aRootNode, nsAVLNode* aNewNode,
|
||||
nsAVLNodeComparitor& aComparitor) {
|
||||
eAVLStatus result=eAVL_unknown;
|
||||
|
||||
if(!aRootNode) {
|
||||
aRootNode = aNewNode;
|
||||
return eAVL_ok;
|
||||
}
|
||||
|
||||
if(aNewNode==aRootNode->mValue) {
|
||||
return eAVL_duplicate;
|
||||
}
|
||||
|
||||
PRInt32 theCompareResult=aComparitor(aRootNode->mValue,aNewNode->mValue);
|
||||
if(0 < theCompareResult) { //if(anItem<aRootNode->mValue)
|
||||
result=avlInsert(aRootNode->mLeft,aNewNode,aComparitor);
|
||||
if(eAVL_ok==result) {
|
||||
switch(aRootNode->mSkew){
|
||||
case eLeft:
|
||||
avlRotateLeft(aRootNode);
|
||||
result=eAVL_fail;
|
||||
break;
|
||||
case eRight:
|
||||
aRootNode->mSkew=eNeutral;
|
||||
result=eAVL_fail;
|
||||
break;
|
||||
case eNeutral:
|
||||
aRootNode->mSkew=eLeft;
|
||||
break;
|
||||
} //switch
|
||||
}//if
|
||||
} //if
|
||||
else {
|
||||
result=avlInsert(aRootNode->mRight,aNewNode,aComparitor);
|
||||
if(eAVL_ok==result) {
|
||||
switch(aRootNode->mSkew){
|
||||
case eLeft:
|
||||
aRootNode->mSkew=eNeutral;
|
||||
result=eAVL_fail;
|
||||
break;
|
||||
case eRight:
|
||||
avlRotateRight(aRootNode);
|
||||
result=eAVL_fail;
|
||||
break;
|
||||
case eNeutral:
|
||||
aRootNode->mSkew=eRight;
|
||||
break;
|
||||
} //switch
|
||||
}
|
||||
} //if
|
||||
return result;
|
||||
}
|
||||
|
||||
/** ------------------------------------------------
|
||||
*
|
||||
*
|
||||
* @update gess 4/22/98
|
||||
* @param
|
||||
* @return
|
||||
*/ //----------------------------------------------
|
||||
static void
|
||||
avlBalanceLeft(nsAVLNode*& aRootNode, PRBool& delOk){
|
||||
nsAVLNode* ptr2;
|
||||
nsAVLNode* ptr3;
|
||||
eLean balnc2;
|
||||
eLean balnc3;
|
||||
|
||||
switch(aRootNode->mSkew){
|
||||
case eLeft:
|
||||
ptr2=aRootNode->mLeft;
|
||||
balnc2=ptr2->mSkew;
|
||||
if(balnc2!=eRight) {
|
||||
aRootNode->mLeft=ptr2->mRight;
|
||||
ptr2->mRight=aRootNode;
|
||||
if(balnc2==eNeutral){
|
||||
aRootNode->mSkew=eLeft;
|
||||
ptr2->mSkew=eRight;
|
||||
delOk=PR_FALSE;
|
||||
}
|
||||
else{
|
||||
aRootNode->mSkew=eNeutral;
|
||||
ptr2->mSkew=eNeutral;
|
||||
}
|
||||
aRootNode=ptr2;
|
||||
}
|
||||
else{
|
||||
ptr3=ptr2->mRight;
|
||||
balnc3=ptr3->mSkew;
|
||||
ptr2->mRight=ptr3->mLeft;
|
||||
ptr3->mLeft=ptr2;
|
||||
aRootNode->mLeft=ptr3->mRight;
|
||||
ptr3->mRight=aRootNode;
|
||||
if(balnc3==eRight) {
|
||||
ptr2->mSkew=eLeft;
|
||||
}
|
||||
else {
|
||||
ptr2->mSkew=eNeutral;
|
||||
}
|
||||
if(balnc3==eLeft) {
|
||||
aRootNode->mSkew=eRight;
|
||||
}
|
||||
else {
|
||||
aRootNode->mSkew=eNeutral;
|
||||
}
|
||||
aRootNode=ptr3;
|
||||
ptr3->mSkew=eNeutral;
|
||||
}
|
||||
break;
|
||||
|
||||
case eRight:
|
||||
aRootNode->mSkew=eNeutral;
|
||||
break;
|
||||
|
||||
case eNeutral:
|
||||
aRootNode->mSkew=eLeft;
|
||||
delOk=PR_FALSE;
|
||||
break;
|
||||
}//switch
|
||||
return;
|
||||
}
|
||||
|
||||
/** ------------------------------------------------
|
||||
*
|
||||
*
|
||||
* @update gess 4/22/98
|
||||
* @param
|
||||
* @return
|
||||
*/ //----------------------------------------------
|
||||
static void
|
||||
avlBalanceRight(nsAVLNode*& aRootNode, PRBool& delOk){
|
||||
nsAVLNode* ptr2;
|
||||
nsAVLNode* ptr3;
|
||||
eLean balnc2;
|
||||
eLean balnc3;
|
||||
|
||||
switch(aRootNode->mSkew){
|
||||
case eLeft:
|
||||
aRootNode->mSkew=eNeutral;
|
||||
break;
|
||||
|
||||
case eRight:
|
||||
ptr2=aRootNode->mRight;
|
||||
balnc2=ptr2->mSkew;
|
||||
if(balnc2!=eLeft) {
|
||||
aRootNode->mRight=ptr2->mLeft;
|
||||
ptr2->mLeft=aRootNode;
|
||||
if(balnc2==eNeutral){
|
||||
aRootNode->mSkew=eRight;
|
||||
ptr2->mSkew=eLeft;
|
||||
delOk=PR_FALSE;
|
||||
}
|
||||
else{
|
||||
aRootNode->mSkew=eNeutral;
|
||||
ptr2->mSkew=eNeutral;
|
||||
}
|
||||
aRootNode=ptr2;
|
||||
}
|
||||
else{
|
||||
ptr3=ptr2->mLeft;
|
||||
balnc3=ptr3->mSkew;
|
||||
ptr2->mLeft=ptr3->mRight;
|
||||
ptr3->mRight=ptr2;
|
||||
aRootNode->mRight=ptr3->mLeft;
|
||||
ptr3->mLeft=aRootNode;
|
||||
if(balnc3==eLeft) {
|
||||
ptr2->mSkew=eRight;
|
||||
}
|
||||
else {
|
||||
ptr2->mSkew=eNeutral;
|
||||
}
|
||||
if(balnc3==eRight) {
|
||||
aRootNode->mSkew=eLeft;
|
||||
}
|
||||
else {
|
||||
aRootNode->mSkew=eNeutral;
|
||||
}
|
||||
aRootNode=ptr3;
|
||||
ptr3->mSkew=eNeutral;
|
||||
}
|
||||
break;
|
||||
|
||||
case eNeutral:
|
||||
aRootNode->mSkew=eRight;
|
||||
delOk=PR_FALSE;
|
||||
break;
|
||||
}//switch
|
||||
return;
|
||||
}
|
||||
|
||||
/** ------------------------------------------------
|
||||
*
|
||||
*
|
||||
* @update gess 4/22/98
|
||||
* @param
|
||||
* @return
|
||||
*/ //----------------------------------------------
|
||||
static eAVLStatus
|
||||
avlRemoveChildren(nsAVLNode*& aRootNode,nsAVLNode*& anotherNode, PRBool& delOk){
|
||||
eAVLStatus result=eAVL_ok;
|
||||
|
||||
if(!anotherNode->mRight){
|
||||
aRootNode->mValue=anotherNode->mValue; //swap
|
||||
anotherNode=anotherNode->mLeft;
|
||||
delOk=PR_TRUE;
|
||||
}
|
||||
else{
|
||||
avlRemoveChildren(aRootNode,anotherNode->mRight,delOk);
|
||||
if(delOk)
|
||||
avlBalanceLeft(anotherNode,delOk);
|
||||
}
|
||||
|
||||
return result;
|
||||
}
|
||||
|
||||
|
||||
/** ------------------------------------------------
|
||||
*
|
||||
*
|
||||
* @update gess 4/22/98
|
||||
* @param
|
||||
* @return
|
||||
*/ //----------------------------------------------
|
||||
static eAVLStatus
|
||||
avlRemove(nsAVLNode*& aRootNode, void* anItem, PRBool& delOk,
|
||||
nsAVLNodeComparitor& aComparitor){
|
||||
eAVLStatus result=eAVL_ok;
|
||||
|
||||
if(!aRootNode)
|
||||
delOk=PR_FALSE;
|
||||
else {
|
||||
PRInt32 cmp=aComparitor(anItem,aRootNode->mValue);
|
||||
if(cmp<0){
|
||||
avlRemove(aRootNode->mLeft,anItem,delOk,aComparitor);
|
||||
if(delOk)
|
||||
avlBalanceRight(aRootNode,delOk);
|
||||
}
|
||||
else if(cmp>0){
|
||||
avlRemove(aRootNode->mRight,anItem,delOk,aComparitor);
|
||||
if(delOk)
|
||||
avlBalanceLeft(aRootNode,delOk);
|
||||
}
|
||||
else{ //they match...
|
||||
nsAVLNode* temp=aRootNode;
|
||||
if(!aRootNode->mRight) {
|
||||
aRootNode=aRootNode->mLeft;
|
||||
delOk=PR_TRUE;
|
||||
delete temp;
|
||||
}
|
||||
else if(!aRootNode->mLeft) {
|
||||
aRootNode=aRootNode->mRight;
|
||||
delOk=PR_TRUE;
|
||||
delete temp;
|
||||
}
|
||||
else {
|
||||
avlRemoveChildren(aRootNode,aRootNode->mLeft,delOk);
|
||||
if(delOk)
|
||||
avlBalanceRight(aRootNode,delOk);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
return result;
|
||||
}
|
||||
|
||||
/** ------------------------------------------------
|
||||
*
|
||||
*
|
||||
* @update gess 4/22/98
|
||||
* @param
|
||||
* @return
|
||||
*/ //----------------------------------------------
|
||||
eAVLStatus
|
||||
nsAVLTree::AddItem(void* anItem){
|
||||
eAVLStatus result=eAVL_ok;
|
||||
|
||||
nsAVLNode* theNewNode=new nsAVLNode(anItem);
|
||||
result=avlInsert(mRoot,theNewNode,mComparitor);
|
||||
if(eAVL_duplicate!=result)
|
||||
mCount++;
|
||||
else {
|
||||
delete theNewNode;
|
||||
}
|
||||
return result;
|
||||
}
|
||||
|
||||
/** ------------------------------------------------
|
||||
*
|
||||
*
|
||||
* @update gess 4/22/98
|
||||
* @param
|
||||
* @return
|
||||
*/ //----------------------------------------------
|
||||
void* nsAVLTree::FindItem(void* aValue) const{
|
||||
nsAVLNode* result=mRoot;
|
||||
PRInt32 count=0;
|
||||
while(result) {
|
||||
count++;
|
||||
PRInt32 cmp=mComparitor(aValue,result->mValue);
|
||||
if(0==cmp) {
|
||||
//we matched...
|
||||
break;
|
||||
}
|
||||
else if(0>cmp){
|
||||
//theNode was greater...
|
||||
result=result->mLeft;
|
||||
}
|
||||
else {
|
||||
//aValue is greater...
|
||||
result=result->mRight;
|
||||
}
|
||||
}
|
||||
if(result) {
|
||||
return result->mValue;
|
||||
}
|
||||
return nsnull;
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
*
|
||||
* @update gess12/30/98
|
||||
* @param
|
||||
* @return
|
||||
*/
|
||||
eAVLStatus
|
||||
nsAVLTree::RemoveItem(void* aValue){
|
||||
PRBool delOk=PR_TRUE;
|
||||
eAVLStatus result=avlRemove(mRoot,aValue,delOk,mComparitor);
|
||||
if(eAVL_ok==result)
|
||||
mCount--;
|
||||
return result;
|
||||
}
|
||||
|
||||
/**
|
||||
*
|
||||
* @update gess9/11/98
|
||||
* @param
|
||||
* @return
|
||||
*/
|
||||
static void
|
||||
avlForEachDepthFirst(nsAVLNode* aNode, nsAVLNodeFunctor& aFunctor){
|
||||
if(aNode) {
|
||||
avlForEachDepthFirst(aNode->mLeft,aFunctor);
|
||||
avlForEachDepthFirst(aNode->mRight,aFunctor);
|
||||
aFunctor(aNode->mValue);
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
*
|
||||
* @update gess9/11/98
|
||||
* @param
|
||||
* @return
|
||||
*/
|
||||
void
|
||||
nsAVLTree::ForEachDepthFirst(nsAVLNodeFunctor& aFunctor) const{
|
||||
::avlForEachDepthFirst(mRoot,aFunctor);
|
||||
}
|
||||
|
||||
/**
|
||||
*
|
||||
* @update gess9/11/98
|
||||
* @param
|
||||
* @return
|
||||
*/
|
||||
static void
|
||||
avlForEach(nsAVLNode* aNode, nsAVLNodeFunctor& aFunctor) {
|
||||
if(aNode) {
|
||||
avlForEach(aNode->mLeft,aFunctor);
|
||||
aFunctor(aNode->mValue);
|
||||
avlForEach(aNode->mRight,aFunctor);
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
*
|
||||
* @update gess9/11/98
|
||||
* @param
|
||||
* @return
|
||||
*/
|
||||
void
|
||||
nsAVLTree::ForEach(nsAVLNodeFunctor& aFunctor) const{
|
||||
::avlForEach(mRoot,aFunctor);
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
*
|
||||
* @update gess9/11/98
|
||||
* @param
|
||||
* @return
|
||||
*/
|
||||
static void*
|
||||
avlFirstThat(nsAVLNode* aNode, nsAVLNodeFunctor& aFunctor) {
|
||||
void* result=nsnull;
|
||||
if(aNode) {
|
||||
result = avlFirstThat(aNode->mLeft,aFunctor);
|
||||
if (result) {
|
||||
return result;
|
||||
}
|
||||
result = aFunctor(aNode->mValue);
|
||||
if (result) {
|
||||
return result;
|
||||
}
|
||||
result = avlFirstThat(aNode->mRight,aFunctor);
|
||||
}
|
||||
return result;
|
||||
}
|
||||
|
||||
/**
|
||||
*
|
||||
* @update gess9/11/98
|
||||
* @param
|
||||
* @return
|
||||
*/
|
||||
void*
|
||||
nsAVLTree::FirstThat(nsAVLNodeFunctor& aFunctor) const{
|
||||
return ::avlFirstThat(mRoot,aFunctor);
|
||||
}
|
||||
|
||||
74
mozilla/htmlparser/src/nsAVLTree.h
Normal file
74
mozilla/htmlparser/src/nsAVLTree.h
Normal file
@@ -0,0 +1,74 @@
|
||||
/* -*- Mode: C++; tab-width: 2; indent-tabs-mode: nil; c-basic-offset: 2 -*-
|
||||
*
|
||||
* The contents of this file are subject to the Netscape Public License
|
||||
* Version 1.0 (the "NPL"); you may not use this file except in
|
||||
* compliance with the NPL. You may obtain a copy of the NPL at
|
||||
* http://www.mozilla.org/NPL/
|
||||
*
|
||||
* Software distributed under the NPL is distributed on an "AS IS" basis,
|
||||
* WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
|
||||
* for the specific language governing rights and limitations under the
|
||||
* NPL.
|
||||
*
|
||||
* The Initial Developer of this code under the NPL is Netscape
|
||||
* Communications Corporation. Portions created by Netscape are
|
||||
* Copyright (C) 1999 Netscape Communications Corporation. All Rights
|
||||
* Reserved.
|
||||
*/
|
||||
|
||||
#ifndef nsAVLTree_h___
|
||||
#define nsAVLTree_h___
|
||||
|
||||
|
||||
#include "nscore.h"
|
||||
|
||||
|
||||
enum eAVLStatus {eAVL_unknown,eAVL_ok,eAVL_fail,eAVL_duplicate};
|
||||
|
||||
|
||||
struct nsAVLNode;
|
||||
|
||||
/**
|
||||
*
|
||||
* @update gess12/26/98
|
||||
* @param anObject1 is the first object to be compared
|
||||
* @param anObject2 is the second object to be compared
|
||||
* @return -1,0,1 if object1 is less, equal, greater than object2
|
||||
*/
|
||||
class NS_COM nsAVLNodeComparitor {
|
||||
public:
|
||||
virtual PRInt32 operator()(void* anItem1,void* anItem2)=0;
|
||||
};
|
||||
|
||||
class NS_COM nsAVLNodeFunctor {
|
||||
public:
|
||||
virtual void* operator()(void* anItem)=0;
|
||||
};
|
||||
|
||||
class NS_COM nsAVLTree {
|
||||
public:
|
||||
nsAVLTree(nsAVLNodeComparitor& aComparitor, nsAVLNodeFunctor* aDeallocator);
|
||||
~nsAVLTree(void);
|
||||
|
||||
PRBool operator==(const nsAVLTree& aOther) const;
|
||||
PRInt32 GetCount(void) const {return mCount;}
|
||||
|
||||
//main functions...
|
||||
eAVLStatus AddItem(void* anItem);
|
||||
eAVLStatus RemoveItem(void* anItem);
|
||||
void* FindItem(void* anItem) const;
|
||||
void ForEach(nsAVLNodeFunctor& aFunctor) const;
|
||||
void ForEachDepthFirst(nsAVLNodeFunctor& aFunctor) const;
|
||||
void* FirstThat(nsAVLNodeFunctor& aFunctor) const;
|
||||
|
||||
protected:
|
||||
|
||||
nsAVLNode* mRoot;
|
||||
PRInt32 mCount;
|
||||
nsAVLNodeComparitor& mComparitor;
|
||||
nsAVLNodeFunctor* mDeallocator;
|
||||
};
|
||||
|
||||
|
||||
#endif /* nsAVLTree_h___ */
|
||||
|
||||
617
mozilla/parser/htmlparser/src/nsAVLTree.cpp
Normal file
617
mozilla/parser/htmlparser/src/nsAVLTree.cpp
Normal file
@@ -0,0 +1,617 @@
|
||||
/* -*- Mode: C++; tab-width: 2; indent-tabs-mode: nil; c-basic-offset: 2 -*-
|
||||
*
|
||||
* The contents of this file are subject to the Netscape Public License
|
||||
* Version 1.0 (the "NPL"); you may not use this file except in
|
||||
* compliance with the NPL. You may obtain a copy of the NPL at
|
||||
* http://www.mozilla.org/NPL/
|
||||
*
|
||||
* Software distributed under the NPL is distributed on an "AS IS" basis,
|
||||
* WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
|
||||
* for the specific language governing rights and limitations under the
|
||||
* NPL.
|
||||
*
|
||||
* The Initial Developer of this code under the NPL is Netscape
|
||||
* Communications Corporation. Portions created by Netscape are
|
||||
* Copyright (C) 1999 Netscape Communications Corporation. All Rights
|
||||
* Reserved.
|
||||
*/
|
||||
|
||||
#include "nsAVLTree.h"
|
||||
|
||||
|
||||
enum eLean {eLeft,eNeutral,eRight};
|
||||
|
||||
struct NS_COM nsAVLNode {
|
||||
public:
|
||||
|
||||
nsAVLNode(void* aValue) {
|
||||
mLeft=0;
|
||||
mRight=0;
|
||||
mSkew=eNeutral;
|
||||
mValue=aValue;
|
||||
}
|
||||
|
||||
nsAVLNode* mLeft;
|
||||
nsAVLNode* mRight;
|
||||
eLean mSkew;
|
||||
void* mValue;
|
||||
};
|
||||
|
||||
|
||||
/************************************************************
|
||||
Now begin the tree class. Don't forget that the comparison
|
||||
between nodes must occur via the comparitor function,
|
||||
otherwise all you're testing is pointer addresses.
|
||||
************************************************************/
|
||||
|
||||
/** ------------------------------------------------
|
||||
*
|
||||
*
|
||||
* @update gess 4/22/98
|
||||
* @param
|
||||
* @return
|
||||
*/ //----------------------------------------------
|
||||
nsAVLTree::nsAVLTree(nsAVLNodeComparitor& aComparitor,
|
||||
nsAVLNodeFunctor* aDeallocator) :
|
||||
mComparitor(aComparitor), mDeallocator(aDeallocator) {
|
||||
mRoot=0;
|
||||
mCount=0;
|
||||
}
|
||||
|
||||
|
||||
static void
|
||||
avlDeleteTree(nsAVLNode* aNode){
|
||||
if (aNode) {
|
||||
avlDeleteTree(aNode->mLeft);
|
||||
avlDeleteTree(aNode->mRight);
|
||||
delete aNode;
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
*
|
||||
* @update gess12/27/98
|
||||
* @param
|
||||
* @return
|
||||
*/
|
||||
nsAVLTree::~nsAVLTree(){
|
||||
if (mDeallocator) {
|
||||
ForEachDepthFirst(*mDeallocator);
|
||||
}
|
||||
avlDeleteTree(mRoot);
|
||||
}
|
||||
|
||||
|
||||
class CDoesntExist: public nsAVLNodeFunctor {
|
||||
public:
|
||||
CDoesntExist(const nsAVLTree& anotherTree) : mOtherTree(anotherTree) {
|
||||
}
|
||||
virtual void* operator()(void* anItem) {
|
||||
void* result=mOtherTree.FindItem(anItem);
|
||||
if(result)
|
||||
return nsnull;
|
||||
return anItem;
|
||||
}
|
||||
protected:
|
||||
const nsAVLTree& mOtherTree;
|
||||
};
|
||||
|
||||
/**
|
||||
* This method compares two trees (members by identity).
|
||||
* @update gess12/27/98
|
||||
* @param tree to compare against
|
||||
* @return true if they are identical (contain same stuff).
|
||||
*/
|
||||
PRBool nsAVLTree::operator==(const nsAVLTree& aCopy) const{
|
||||
CDoesntExist functor(aCopy);
|
||||
void* theItem=FirstThat(functor);
|
||||
PRBool result=PRBool(!theItem);
|
||||
return result;
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
*
|
||||
* @update gess12/27/98
|
||||
* @param
|
||||
* @return
|
||||
*/
|
||||
static void
|
||||
avlRotateRight(nsAVLNode*& aRootNode){
|
||||
nsAVLNode* ptr2;
|
||||
nsAVLNode* ptr3;
|
||||
|
||||
ptr2=aRootNode->mRight;
|
||||
if(ptr2->mSkew==eRight) {
|
||||
aRootNode->mRight=ptr2->mLeft;
|
||||
ptr2->mLeft=aRootNode;
|
||||
aRootNode->mSkew=eNeutral;
|
||||
aRootNode=ptr2;
|
||||
}
|
||||
else {
|
||||
ptr3=ptr2->mLeft;
|
||||
ptr2->mLeft=ptr3->mRight;
|
||||
ptr3->mRight=ptr2;
|
||||
aRootNode->mRight=ptr3->mLeft;
|
||||
ptr3->mLeft=aRootNode;
|
||||
if(ptr3->mSkew==eLeft)
|
||||
ptr2->mSkew=eRight;
|
||||
else ptr2->mSkew=eNeutral;
|
||||
if(ptr3->mSkew==eRight)
|
||||
aRootNode->mSkew=eLeft;
|
||||
else aRootNode->mSkew=eNeutral;
|
||||
aRootNode=ptr3;
|
||||
}
|
||||
aRootNode->mSkew=eNeutral;
|
||||
return;
|
||||
}
|
||||
|
||||
|
||||
|
||||
/**
|
||||
*
|
||||
* @update gess12/27/98
|
||||
* @param
|
||||
* @return
|
||||
*/
|
||||
static void
|
||||
avlRotateLeft(nsAVLNode*& aRootNode){
|
||||
nsAVLNode* ptr2;
|
||||
nsAVLNode* ptr3;
|
||||
|
||||
ptr2=aRootNode->mLeft;
|
||||
if(ptr2->mSkew==eLeft) {
|
||||
aRootNode->mLeft=ptr2->mRight;
|
||||
ptr2->mRight=aRootNode;
|
||||
aRootNode->mSkew=eNeutral;
|
||||
aRootNode=ptr2;
|
||||
}
|
||||
else {
|
||||
ptr3=ptr2->mRight;
|
||||
ptr2->mRight=ptr3->mLeft;
|
||||
ptr3->mLeft=ptr2;
|
||||
aRootNode->mLeft=ptr3->mRight;
|
||||
ptr3->mRight=aRootNode;
|
||||
if(ptr3->mSkew==eRight)
|
||||
ptr2->mSkew=eLeft;
|
||||
else ptr2->mSkew=eNeutral;
|
||||
if(ptr3->mSkew==eLeft)
|
||||
aRootNode->mSkew=eRight;
|
||||
else aRootNode->mSkew=eNeutral;
|
||||
aRootNode=ptr3;
|
||||
}
|
||||
aRootNode->mSkew=eNeutral;
|
||||
return;
|
||||
}
|
||||
|
||||
|
||||
/** ------------------------------------------------
|
||||
*
|
||||
*
|
||||
* @update gess 4/22/98
|
||||
* @param
|
||||
* @return
|
||||
*/ //----------------------------------------------
|
||||
static eAVLStatus
|
||||
avlInsert(nsAVLNode*& aRootNode, nsAVLNode* aNewNode,
|
||||
nsAVLNodeComparitor& aComparitor) {
|
||||
eAVLStatus result=eAVL_unknown;
|
||||
|
||||
if(!aRootNode) {
|
||||
aRootNode = aNewNode;
|
||||
return eAVL_ok;
|
||||
}
|
||||
|
||||
if(aNewNode==aRootNode->mValue) {
|
||||
return eAVL_duplicate;
|
||||
}
|
||||
|
||||
PRInt32 theCompareResult=aComparitor(aRootNode->mValue,aNewNode->mValue);
|
||||
if(0 < theCompareResult) { //if(anItem<aRootNode->mValue)
|
||||
result=avlInsert(aRootNode->mLeft,aNewNode,aComparitor);
|
||||
if(eAVL_ok==result) {
|
||||
switch(aRootNode->mSkew){
|
||||
case eLeft:
|
||||
avlRotateLeft(aRootNode);
|
||||
result=eAVL_fail;
|
||||
break;
|
||||
case eRight:
|
||||
aRootNode->mSkew=eNeutral;
|
||||
result=eAVL_fail;
|
||||
break;
|
||||
case eNeutral:
|
||||
aRootNode->mSkew=eLeft;
|
||||
break;
|
||||
} //switch
|
||||
}//if
|
||||
} //if
|
||||
else {
|
||||
result=avlInsert(aRootNode->mRight,aNewNode,aComparitor);
|
||||
if(eAVL_ok==result) {
|
||||
switch(aRootNode->mSkew){
|
||||
case eLeft:
|
||||
aRootNode->mSkew=eNeutral;
|
||||
result=eAVL_fail;
|
||||
break;
|
||||
case eRight:
|
||||
avlRotateRight(aRootNode);
|
||||
result=eAVL_fail;
|
||||
break;
|
||||
case eNeutral:
|
||||
aRootNode->mSkew=eRight;
|
||||
break;
|
||||
} //switch
|
||||
}
|
||||
} //if
|
||||
return result;
|
||||
}
|
||||
|
||||
/** ------------------------------------------------
|
||||
*
|
||||
*
|
||||
* @update gess 4/22/98
|
||||
* @param
|
||||
* @return
|
||||
*/ //----------------------------------------------
|
||||
static void
|
||||
avlBalanceLeft(nsAVLNode*& aRootNode, PRBool& delOk){
|
||||
nsAVLNode* ptr2;
|
||||
nsAVLNode* ptr3;
|
||||
eLean balnc2;
|
||||
eLean balnc3;
|
||||
|
||||
switch(aRootNode->mSkew){
|
||||
case eLeft:
|
||||
ptr2=aRootNode->mLeft;
|
||||
balnc2=ptr2->mSkew;
|
||||
if(balnc2!=eRight) {
|
||||
aRootNode->mLeft=ptr2->mRight;
|
||||
ptr2->mRight=aRootNode;
|
||||
if(balnc2==eNeutral){
|
||||
aRootNode->mSkew=eLeft;
|
||||
ptr2->mSkew=eRight;
|
||||
delOk=PR_FALSE;
|
||||
}
|
||||
else{
|
||||
aRootNode->mSkew=eNeutral;
|
||||
ptr2->mSkew=eNeutral;
|
||||
}
|
||||
aRootNode=ptr2;
|
||||
}
|
||||
else{
|
||||
ptr3=ptr2->mRight;
|
||||
balnc3=ptr3->mSkew;
|
||||
ptr2->mRight=ptr3->mLeft;
|
||||
ptr3->mLeft=ptr2;
|
||||
aRootNode->mLeft=ptr3->mRight;
|
||||
ptr3->mRight=aRootNode;
|
||||
if(balnc3==eRight) {
|
||||
ptr2->mSkew=eLeft;
|
||||
}
|
||||
else {
|
||||
ptr2->mSkew=eNeutral;
|
||||
}
|
||||
if(balnc3==eLeft) {
|
||||
aRootNode->mSkew=eRight;
|
||||
}
|
||||
else {
|
||||
aRootNode->mSkew=eNeutral;
|
||||
}
|
||||
aRootNode=ptr3;
|
||||
ptr3->mSkew=eNeutral;
|
||||
}
|
||||
break;
|
||||
|
||||
case eRight:
|
||||
aRootNode->mSkew=eNeutral;
|
||||
break;
|
||||
|
||||
case eNeutral:
|
||||
aRootNode->mSkew=eLeft;
|
||||
delOk=PR_FALSE;
|
||||
break;
|
||||
}//switch
|
||||
return;
|
||||
}
|
||||
|
||||
/** ------------------------------------------------
|
||||
*
|
||||
*
|
||||
* @update gess 4/22/98
|
||||
* @param
|
||||
* @return
|
||||
*/ //----------------------------------------------
|
||||
static void
|
||||
avlBalanceRight(nsAVLNode*& aRootNode, PRBool& delOk){
|
||||
nsAVLNode* ptr2;
|
||||
nsAVLNode* ptr3;
|
||||
eLean balnc2;
|
||||
eLean balnc3;
|
||||
|
||||
switch(aRootNode->mSkew){
|
||||
case eLeft:
|
||||
aRootNode->mSkew=eNeutral;
|
||||
break;
|
||||
|
||||
case eRight:
|
||||
ptr2=aRootNode->mRight;
|
||||
balnc2=ptr2->mSkew;
|
||||
if(balnc2!=eLeft) {
|
||||
aRootNode->mRight=ptr2->mLeft;
|
||||
ptr2->mLeft=aRootNode;
|
||||
if(balnc2==eNeutral){
|
||||
aRootNode->mSkew=eRight;
|
||||
ptr2->mSkew=eLeft;
|
||||
delOk=PR_FALSE;
|
||||
}
|
||||
else{
|
||||
aRootNode->mSkew=eNeutral;
|
||||
ptr2->mSkew=eNeutral;
|
||||
}
|
||||
aRootNode=ptr2;
|
||||
}
|
||||
else{
|
||||
ptr3=ptr2->mLeft;
|
||||
balnc3=ptr3->mSkew;
|
||||
ptr2->mLeft=ptr3->mRight;
|
||||
ptr3->mRight=ptr2;
|
||||
aRootNode->mRight=ptr3->mLeft;
|
||||
ptr3->mLeft=aRootNode;
|
||||
if(balnc3==eLeft) {
|
||||
ptr2->mSkew=eRight;
|
||||
}
|
||||
else {
|
||||
ptr2->mSkew=eNeutral;
|
||||
}
|
||||
if(balnc3==eRight) {
|
||||
aRootNode->mSkew=eLeft;
|
||||
}
|
||||
else {
|
||||
aRootNode->mSkew=eNeutral;
|
||||
}
|
||||
aRootNode=ptr3;
|
||||
ptr3->mSkew=eNeutral;
|
||||
}
|
||||
break;
|
||||
|
||||
case eNeutral:
|
||||
aRootNode->mSkew=eRight;
|
||||
delOk=PR_FALSE;
|
||||
break;
|
||||
}//switch
|
||||
return;
|
||||
}
|
||||
|
||||
/** ------------------------------------------------
|
||||
*
|
||||
*
|
||||
* @update gess 4/22/98
|
||||
* @param
|
||||
* @return
|
||||
*/ //----------------------------------------------
|
||||
static eAVLStatus
|
||||
avlRemoveChildren(nsAVLNode*& aRootNode,nsAVLNode*& anotherNode, PRBool& delOk){
|
||||
eAVLStatus result=eAVL_ok;
|
||||
|
||||
if(!anotherNode->mRight){
|
||||
aRootNode->mValue=anotherNode->mValue; //swap
|
||||
anotherNode=anotherNode->mLeft;
|
||||
delOk=PR_TRUE;
|
||||
}
|
||||
else{
|
||||
avlRemoveChildren(aRootNode,anotherNode->mRight,delOk);
|
||||
if(delOk)
|
||||
avlBalanceLeft(anotherNode,delOk);
|
||||
}
|
||||
|
||||
return result;
|
||||
}
|
||||
|
||||
|
||||
/** ------------------------------------------------
|
||||
*
|
||||
*
|
||||
* @update gess 4/22/98
|
||||
* @param
|
||||
* @return
|
||||
*/ //----------------------------------------------
|
||||
static eAVLStatus
|
||||
avlRemove(nsAVLNode*& aRootNode, void* anItem, PRBool& delOk,
|
||||
nsAVLNodeComparitor& aComparitor){
|
||||
eAVLStatus result=eAVL_ok;
|
||||
|
||||
if(!aRootNode)
|
||||
delOk=PR_FALSE;
|
||||
else {
|
||||
PRInt32 cmp=aComparitor(anItem,aRootNode->mValue);
|
||||
if(cmp<0){
|
||||
avlRemove(aRootNode->mLeft,anItem,delOk,aComparitor);
|
||||
if(delOk)
|
||||
avlBalanceRight(aRootNode,delOk);
|
||||
}
|
||||
else if(cmp>0){
|
||||
avlRemove(aRootNode->mRight,anItem,delOk,aComparitor);
|
||||
if(delOk)
|
||||
avlBalanceLeft(aRootNode,delOk);
|
||||
}
|
||||
else{ //they match...
|
||||
nsAVLNode* temp=aRootNode;
|
||||
if(!aRootNode->mRight) {
|
||||
aRootNode=aRootNode->mLeft;
|
||||
delOk=PR_TRUE;
|
||||
delete temp;
|
||||
}
|
||||
else if(!aRootNode->mLeft) {
|
||||
aRootNode=aRootNode->mRight;
|
||||
delOk=PR_TRUE;
|
||||
delete temp;
|
||||
}
|
||||
else {
|
||||
avlRemoveChildren(aRootNode,aRootNode->mLeft,delOk);
|
||||
if(delOk)
|
||||
avlBalanceRight(aRootNode,delOk);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
return result;
|
||||
}
|
||||
|
||||
/** ------------------------------------------------
|
||||
*
|
||||
*
|
||||
* @update gess 4/22/98
|
||||
* @param
|
||||
* @return
|
||||
*/ //----------------------------------------------
|
||||
eAVLStatus
|
||||
nsAVLTree::AddItem(void* anItem){
|
||||
eAVLStatus result=eAVL_ok;
|
||||
|
||||
nsAVLNode* theNewNode=new nsAVLNode(anItem);
|
||||
result=avlInsert(mRoot,theNewNode,mComparitor);
|
||||
if(eAVL_duplicate!=result)
|
||||
mCount++;
|
||||
else {
|
||||
delete theNewNode;
|
||||
}
|
||||
return result;
|
||||
}
|
||||
|
||||
/** ------------------------------------------------
|
||||
*
|
||||
*
|
||||
* @update gess 4/22/98
|
||||
* @param
|
||||
* @return
|
||||
*/ //----------------------------------------------
|
||||
void* nsAVLTree::FindItem(void* aValue) const{
|
||||
nsAVLNode* result=mRoot;
|
||||
PRInt32 count=0;
|
||||
while(result) {
|
||||
count++;
|
||||
PRInt32 cmp=mComparitor(aValue,result->mValue);
|
||||
if(0==cmp) {
|
||||
//we matched...
|
||||
break;
|
||||
}
|
||||
else if(0>cmp){
|
||||
//theNode was greater...
|
||||
result=result->mLeft;
|
||||
}
|
||||
else {
|
||||
//aValue is greater...
|
||||
result=result->mRight;
|
||||
}
|
||||
}
|
||||
if(result) {
|
||||
return result->mValue;
|
||||
}
|
||||
return nsnull;
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
*
|
||||
* @update gess12/30/98
|
||||
* @param
|
||||
* @return
|
||||
*/
|
||||
eAVLStatus
|
||||
nsAVLTree::RemoveItem(void* aValue){
|
||||
PRBool delOk=PR_TRUE;
|
||||
eAVLStatus result=avlRemove(mRoot,aValue,delOk,mComparitor);
|
||||
if(eAVL_ok==result)
|
||||
mCount--;
|
||||
return result;
|
||||
}
|
||||
|
||||
/**
|
||||
*
|
||||
* @update gess9/11/98
|
||||
* @param
|
||||
* @return
|
||||
*/
|
||||
static void
|
||||
avlForEachDepthFirst(nsAVLNode* aNode, nsAVLNodeFunctor& aFunctor){
|
||||
if(aNode) {
|
||||
avlForEachDepthFirst(aNode->mLeft,aFunctor);
|
||||
avlForEachDepthFirst(aNode->mRight,aFunctor);
|
||||
aFunctor(aNode->mValue);
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
*
|
||||
* @update gess9/11/98
|
||||
* @param
|
||||
* @return
|
||||
*/
|
||||
void
|
||||
nsAVLTree::ForEachDepthFirst(nsAVLNodeFunctor& aFunctor) const{
|
||||
::avlForEachDepthFirst(mRoot,aFunctor);
|
||||
}
|
||||
|
||||
/**
|
||||
*
|
||||
* @update gess9/11/98
|
||||
* @param
|
||||
* @return
|
||||
*/
|
||||
static void
|
||||
avlForEach(nsAVLNode* aNode, nsAVLNodeFunctor& aFunctor) {
|
||||
if(aNode) {
|
||||
avlForEach(aNode->mLeft,aFunctor);
|
||||
aFunctor(aNode->mValue);
|
||||
avlForEach(aNode->mRight,aFunctor);
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
*
|
||||
* @update gess9/11/98
|
||||
* @param
|
||||
* @return
|
||||
*/
|
||||
void
|
||||
nsAVLTree::ForEach(nsAVLNodeFunctor& aFunctor) const{
|
||||
::avlForEach(mRoot,aFunctor);
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
*
|
||||
* @update gess9/11/98
|
||||
* @param
|
||||
* @return
|
||||
*/
|
||||
static void*
|
||||
avlFirstThat(nsAVLNode* aNode, nsAVLNodeFunctor& aFunctor) {
|
||||
void* result=nsnull;
|
||||
if(aNode) {
|
||||
result = avlFirstThat(aNode->mLeft,aFunctor);
|
||||
if (result) {
|
||||
return result;
|
||||
}
|
||||
result = aFunctor(aNode->mValue);
|
||||
if (result) {
|
||||
return result;
|
||||
}
|
||||
result = avlFirstThat(aNode->mRight,aFunctor);
|
||||
}
|
||||
return result;
|
||||
}
|
||||
|
||||
/**
|
||||
*
|
||||
* @update gess9/11/98
|
||||
* @param
|
||||
* @return
|
||||
*/
|
||||
void*
|
||||
nsAVLTree::FirstThat(nsAVLNodeFunctor& aFunctor) const{
|
||||
return ::avlFirstThat(mRoot,aFunctor);
|
||||
}
|
||||
|
||||
74
mozilla/parser/htmlparser/src/nsAVLTree.h
Normal file
74
mozilla/parser/htmlparser/src/nsAVLTree.h
Normal file
@@ -0,0 +1,74 @@
|
||||
/* -*- Mode: C++; tab-width: 2; indent-tabs-mode: nil; c-basic-offset: 2 -*-
|
||||
*
|
||||
* The contents of this file are subject to the Netscape Public License
|
||||
* Version 1.0 (the "NPL"); you may not use this file except in
|
||||
* compliance with the NPL. You may obtain a copy of the NPL at
|
||||
* http://www.mozilla.org/NPL/
|
||||
*
|
||||
* Software distributed under the NPL is distributed on an "AS IS" basis,
|
||||
* WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
|
||||
* for the specific language governing rights and limitations under the
|
||||
* NPL.
|
||||
*
|
||||
* The Initial Developer of this code under the NPL is Netscape
|
||||
* Communications Corporation. Portions created by Netscape are
|
||||
* Copyright (C) 1999 Netscape Communications Corporation. All Rights
|
||||
* Reserved.
|
||||
*/
|
||||
|
||||
#ifndef nsAVLTree_h___
|
||||
#define nsAVLTree_h___
|
||||
|
||||
|
||||
#include "nscore.h"
|
||||
|
||||
|
||||
enum eAVLStatus {eAVL_unknown,eAVL_ok,eAVL_fail,eAVL_duplicate};
|
||||
|
||||
|
||||
struct nsAVLNode;
|
||||
|
||||
/**
|
||||
*
|
||||
* @update gess12/26/98
|
||||
* @param anObject1 is the first object to be compared
|
||||
* @param anObject2 is the second object to be compared
|
||||
* @return -1,0,1 if object1 is less, equal, greater than object2
|
||||
*/
|
||||
class NS_COM nsAVLNodeComparitor {
|
||||
public:
|
||||
virtual PRInt32 operator()(void* anItem1,void* anItem2)=0;
|
||||
};
|
||||
|
||||
class NS_COM nsAVLNodeFunctor {
|
||||
public:
|
||||
virtual void* operator()(void* anItem)=0;
|
||||
};
|
||||
|
||||
class NS_COM nsAVLTree {
|
||||
public:
|
||||
nsAVLTree(nsAVLNodeComparitor& aComparitor, nsAVLNodeFunctor* aDeallocator);
|
||||
~nsAVLTree(void);
|
||||
|
||||
PRBool operator==(const nsAVLTree& aOther) const;
|
||||
PRInt32 GetCount(void) const {return mCount;}
|
||||
|
||||
//main functions...
|
||||
eAVLStatus AddItem(void* anItem);
|
||||
eAVLStatus RemoveItem(void* anItem);
|
||||
void* FindItem(void* anItem) const;
|
||||
void ForEach(nsAVLNodeFunctor& aFunctor) const;
|
||||
void ForEachDepthFirst(nsAVLNodeFunctor& aFunctor) const;
|
||||
void* FirstThat(nsAVLNodeFunctor& aFunctor) const;
|
||||
|
||||
protected:
|
||||
|
||||
nsAVLNode* mRoot;
|
||||
PRInt32 mCount;
|
||||
nsAVLNodeComparitor& mComparitor;
|
||||
nsAVLNodeFunctor* mDeallocator;
|
||||
};
|
||||
|
||||
|
||||
#endif /* nsAVLTree_h___ */
|
||||
|
||||
717
mozilla/string/obsolete/nsStr.cpp
Normal file
717
mozilla/string/obsolete/nsStr.cpp
Normal file
@@ -0,0 +1,717 @@
|
||||
/* -*- Mode: C++; tab-width: 2; indent-tabs-mode: nil; c-basic-offset: 2 -*- */
|
||||
/*
|
||||
* The contents of this file are subject to the Netscape Public License
|
||||
* Version 1.0 (the "NPL"); you may not use this file except in
|
||||
* compliance with the NPL. You may obtain a copy of the NPL at
|
||||
* http://www.mozilla.org/NPL/
|
||||
*
|
||||
* Software distributed under the NPL is distributed on an "AS IS" basis,
|
||||
* WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
|
||||
* for the specific language governing rights and limitations under the
|
||||
* NPL.
|
||||
*
|
||||
* The Initial Developer of this code under the NPL is Netscape
|
||||
* Communications Corporation. Portions created by Netscape are
|
||||
* Copyright (C) 1998 Netscape Communications Corporation. All Rights
|
||||
* Reserved.
|
||||
*/
|
||||
|
||||
/******************************************************************************************
|
||||
MODULE NOTES:
|
||||
|
||||
This file contains the nsStr data structure.
|
||||
This general purpose buffer management class is used as the basis for our strings.
|
||||
It's benefits include:
|
||||
1. An efficient set of library style functions for manipulating nsStrs
|
||||
2. Support for 1 and 2 byte character strings (which can easily be increased to n)
|
||||
3. Unicode awareness and interoperability.
|
||||
|
||||
*******************************************************************************************/
|
||||
|
||||
#include "nsStr.h"
|
||||
#include "bufferRoutines.h"
|
||||
#include "stdio.h" //only used for printf
|
||||
#include "nsCRT.h"
|
||||
#include "nsDeque.h"
|
||||
|
||||
|
||||
//static const char* kCallFindChar = "For better performance, call FindChar() for targets whose length==1.";
|
||||
//static const char* kCallRFindChar = "For better performance, call RFindChar() for targets whose length==1.";
|
||||
|
||||
static const PRUnichar gCommonEmptyBuffer[1] = {0};
|
||||
|
||||
/**
|
||||
* This method initializes all the members of the nsStr structure
|
||||
*
|
||||
* @update gess10/30/98
|
||||
* @param
|
||||
* @return
|
||||
*/
|
||||
void nsStr::Initialize(nsStr& aDest,eCharSize aCharSize) {
|
||||
aDest.mStr=(char*)gCommonEmptyBuffer;
|
||||
aDest.mLength=0;
|
||||
aDest.mCapacity=0;
|
||||
aDest.mCharSize=aCharSize;
|
||||
aDest.mOwnsBuffer=0;
|
||||
}
|
||||
|
||||
/**
|
||||
* This method initializes all the members of the nsStr structure
|
||||
* @update gess10/30/98
|
||||
* @param
|
||||
* @return
|
||||
*/
|
||||
void nsStr::Initialize(nsStr& aDest,char* aCString,PRUint32 aCapacity,PRUint32 aLength,eCharSize aCharSize,PRBool aOwnsBuffer){
|
||||
aDest.mStr=(aCString) ? aCString : (char*)gCommonEmptyBuffer;
|
||||
aDest.mLength=aLength;
|
||||
aDest.mCapacity=aCapacity;
|
||||
aDest.mCharSize=aCharSize;
|
||||
aDest.mOwnsBuffer=aOwnsBuffer;
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
* This member destroys the memory buffer owned by an nsStr object (if it actually owns it)
|
||||
* @update gess10/30/98
|
||||
* @param
|
||||
* @return
|
||||
*/
|
||||
void nsStr::Destroy(nsStr& aDest) {
|
||||
if((aDest.mStr) && (aDest.mStr!=(char*)gCommonEmptyBuffer)) {
|
||||
Free(aDest);
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
* This method gets called when the internal buffer needs
|
||||
* to grow to a given size. The original contents are not preserved.
|
||||
* @update gess 3/30/98
|
||||
* @param aNewLength -- new capacity of string in charSize units
|
||||
* @return void
|
||||
*/
|
||||
PRBool nsStr::EnsureCapacity(nsStr& aString,PRUint32 aNewLength) {
|
||||
PRBool result=PR_TRUE;
|
||||
if(aNewLength>aString.mCapacity) {
|
||||
result=Realloc(aString,aNewLength);
|
||||
if(aString.mStr)
|
||||
AddNullTerminator(aString);
|
||||
}
|
||||
return result;
|
||||
}
|
||||
|
||||
/**
|
||||
* This method gets called when the internal buffer needs
|
||||
* to grow to a given size. The original contents ARE preserved.
|
||||
* @update gess 3/30/98
|
||||
* @param aNewLength -- new capacity of string in charSize units
|
||||
* @return void
|
||||
*/
|
||||
PRBool nsStr::GrowCapacity(nsStr& aDest,PRUint32 aNewLength) {
|
||||
PRBool result=PR_TRUE;
|
||||
if(aNewLength>aDest.mCapacity) {
|
||||
nsStr theTempStr;
|
||||
nsStr::Initialize(theTempStr,aDest.mCharSize);
|
||||
|
||||
result=EnsureCapacity(theTempStr,aNewLength);
|
||||
if(result) {
|
||||
if(aDest.mLength) {
|
||||
Append(theTempStr,aDest,0,aDest.mLength);
|
||||
}
|
||||
Free(aDest);
|
||||
aDest.mStr = theTempStr.mStr;
|
||||
theTempStr.mStr=0; //make sure to null this out so that you don't lose the buffer you just stole...
|
||||
aDest.mLength=theTempStr.mLength;
|
||||
aDest.mCapacity=theTempStr.mCapacity;
|
||||
aDest.mOwnsBuffer=theTempStr.mOwnsBuffer;
|
||||
}
|
||||
}
|
||||
return result;
|
||||
}
|
||||
|
||||
/**
|
||||
* Replaces the contents of aDest with aSource, up to aCount of chars.
|
||||
* @update gess10/30/98
|
||||
* @param aDest is the nsStr that gets changed.
|
||||
* @param aSource is where chars are copied from
|
||||
* @param aCount is the number of chars copied from aSource
|
||||
*/
|
||||
void nsStr::Assign(nsStr& aDest,const nsStr& aSource,PRUint32 anOffset,PRInt32 aCount){
|
||||
if(&aDest!=&aSource){
|
||||
Truncate(aDest,0);
|
||||
Append(aDest,aSource,anOffset,aCount);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* This method appends the given nsStr to this one. Note that we have to
|
||||
* pay attention to the underlying char-size of both structs.
|
||||
* @update gess10/30/98
|
||||
* @param aDest is the nsStr to be manipulated
|
||||
* @param aSource is where char are copied from
|
||||
* @aCount is the number of bytes to be copied
|
||||
*/
|
||||
void nsStr::Append(nsStr& aDest,const nsStr& aSource,PRUint32 anOffset,PRInt32 aCount){
|
||||
if(anOffset<aSource.mLength){
|
||||
PRUint32 theRealLen=(aCount<0) ? aSource.mLength : MinInt(aCount,aSource.mLength);
|
||||
PRUint32 theLength=(anOffset+theRealLen<aSource.mLength) ? theRealLen : (aSource.mLength-anOffset);
|
||||
if(0<theLength){
|
||||
|
||||
PRBool isBigEnough=PR_TRUE;
|
||||
if(aDest.mLength+theLength > aDest.mCapacity) {
|
||||
isBigEnough=GrowCapacity(aDest,aDest.mLength+theLength);
|
||||
}
|
||||
|
||||
if(isBigEnough) {
|
||||
//now append new chars, starting at offset
|
||||
(*gCopyChars[aSource.mCharSize][aDest.mCharSize])(aDest.mStr,aDest.mLength,aSource.mStr,anOffset,theLength);
|
||||
|
||||
aDest.mLength+=theLength;
|
||||
AddNullTerminator(aDest);
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
* This method inserts up to "aCount" chars from a source nsStr into a dest nsStr.
|
||||
* @update gess10/30/98
|
||||
* @param aDest is the nsStr that gets changed
|
||||
* @param aDestOffset is where in aDest the insertion is to occur
|
||||
* @param aSource is where chars are copied from
|
||||
* @param aSrcOffset is where in aSource chars are copied from
|
||||
* @param aCount is the number of chars from aSource to be inserted into aDest
|
||||
*/
|
||||
void nsStr::Insert( nsStr& aDest,PRUint32 aDestOffset,const nsStr& aSource,PRUint32 aSrcOffset,PRInt32 aCount){
|
||||
//there are a few cases for insert:
|
||||
// 1. You're inserting chars into an empty string (assign)
|
||||
// 2. You're inserting onto the end of a string (append)
|
||||
// 3. You're inserting onto the 1..n-1 pos of a string (the hard case).
|
||||
if(0<aSource.mLength){
|
||||
if(aDest.mLength){
|
||||
if(aDestOffset<aDest.mLength){
|
||||
PRInt32 theRealLen=(aCount<0) ? aSource.mLength : MinInt(aCount,aSource.mLength);
|
||||
PRInt32 theLength=(aSrcOffset+theRealLen<aSource.mLength) ? theRealLen : (aSource.mLength-aSrcOffset);
|
||||
|
||||
if(aSrcOffset<aSource.mLength) {
|
||||
//here's the only new case we have to handle.
|
||||
//chars are really being inserted into our buffer...
|
||||
|
||||
if(aDest.mLength+theLength > aDest.mCapacity) {
|
||||
nsStr theTempStr;
|
||||
nsStr::Initialize(theTempStr,aDest.mCharSize);
|
||||
|
||||
PRBool isBigEnough=EnsureCapacity(theTempStr,aDest.mLength+theLength); //grow the temp buffer to the right size
|
||||
|
||||
if(isBigEnough) {
|
||||
if(aDestOffset) {
|
||||
Append(theTempStr,aDest,0,aDestOffset); //first copy leftmost data...
|
||||
}
|
||||
|
||||
Append(theTempStr,aSource,0,aSource.mLength); //next copy inserted (new) data
|
||||
|
||||
PRUint32 theRemains=aDest.mLength-aDestOffset;
|
||||
if(theRemains) {
|
||||
Append(theTempStr,aDest,aDestOffset,theRemains); //next copy rightmost data
|
||||
}
|
||||
|
||||
Free(aDest);
|
||||
aDest.mStr = theTempStr.mStr;
|
||||
theTempStr.mStr=0; //make sure to null this out so that you don't lose the buffer you just stole...
|
||||
aDest.mCapacity=theTempStr.mCapacity;
|
||||
aDest.mOwnsBuffer=theTempStr.mOwnsBuffer;
|
||||
}
|
||||
|
||||
}
|
||||
|
||||
else {
|
||||
//shift the chars right by theDelta...
|
||||
(*gShiftChars[aDest.mCharSize][KSHIFTRIGHT])(aDest.mStr,aDest.mLength,aDestOffset,theLength);
|
||||
|
||||
//now insert new chars, starting at offset
|
||||
(*gCopyChars[aSource.mCharSize][aDest.mCharSize])(aDest.mStr,aDestOffset,aSource.mStr,aSrcOffset,theLength);
|
||||
}
|
||||
|
||||
//finally, make sure to update the string length...
|
||||
aDest.mLength+=theLength;
|
||||
AddNullTerminator(aDest);
|
||||
|
||||
}//if
|
||||
//else nothing to do!
|
||||
}
|
||||
else Append(aDest,aSource,0,aCount);
|
||||
}
|
||||
else Append(aDest,aSource,0,aCount);
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
* This method deletes up to aCount chars from aDest
|
||||
* @update gess10/30/98
|
||||
* @param aDest is the nsStr to be manipulated
|
||||
* @param aDestOffset is where in aDest deletion is to occur
|
||||
* @param aCount is the number of chars to be deleted in aDest
|
||||
*/
|
||||
void nsStr::Delete(nsStr& aDest,PRUint32 aDestOffset,PRUint32 aCount){
|
||||
if(aDestOffset<aDest.mLength){
|
||||
|
||||
PRUint32 theDelta=aDest.mLength-aDestOffset;
|
||||
PRUint32 theLength=(theDelta<aCount) ? theDelta : aCount;
|
||||
|
||||
if(aDestOffset+theLength<aDest.mLength) {
|
||||
|
||||
//if you're here, it means we're cutting chars out of the middle of the string...
|
||||
//so shift the chars left by theLength...
|
||||
(*gShiftChars[aDest.mCharSize][KSHIFTLEFT])(aDest.mStr,aDest.mLength,aDestOffset,theLength);
|
||||
aDest.mLength-=theLength;
|
||||
AddNullTerminator(aDest);
|
||||
}
|
||||
else Truncate(aDest,aDestOffset);
|
||||
}//if
|
||||
}
|
||||
|
||||
/**
|
||||
* This method truncates the given nsStr at given offset
|
||||
* @update gess10/30/98
|
||||
* @param aDest is the nsStr to be truncated
|
||||
* @param aDestOffset is where in aDest truncation is to occur
|
||||
*/
|
||||
void nsStr::Truncate(nsStr& aDest,PRUint32 aDestOffset){
|
||||
if(aDestOffset<aDest.mLength){
|
||||
aDest.mLength=aDestOffset;
|
||||
AddNullTerminator(aDest);
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
* This method forces the given string to upper or lowercase
|
||||
* @update gess1/7/99
|
||||
* @param aDest is the string you're going to change
|
||||
* @param aToUpper: if TRUE, then we go uppercase, otherwise we go lowercase
|
||||
* @return
|
||||
*/
|
||||
void nsStr::ChangeCase(nsStr& aDest,PRBool aToUpper) {
|
||||
// somehow UnicharUtil return failed, fallback to the old ascii only code
|
||||
gCaseConverters[aDest.mCharSize](aDest.mStr,aDest.mLength,aToUpper);
|
||||
}
|
||||
|
||||
/**
|
||||
*
|
||||
* @update gess1/7/99
|
||||
* @param
|
||||
* @return
|
||||
*/
|
||||
void nsStr::Trim(nsStr& aDest,const char* aSet,PRBool aEliminateLeading,PRBool aEliminateTrailing){
|
||||
|
||||
if((aDest.mLength>0) && aSet){
|
||||
PRInt32 theIndex=-1;
|
||||
PRInt32 theMax=aDest.mLength;
|
||||
PRInt32 theSetLen=nsCRT::strlen(aSet);
|
||||
|
||||
if(aEliminateLeading) {
|
||||
while(++theIndex<=theMax) {
|
||||
PRUnichar theChar=GetCharAt(aDest,theIndex);
|
||||
PRInt32 thePos=gFindChars[eOneByte](aSet,theSetLen,0,theChar,PR_FALSE);
|
||||
if(kNotFound==thePos)
|
||||
break;
|
||||
}
|
||||
if(0<theIndex) {
|
||||
if(theIndex<theMax) {
|
||||
Delete(aDest,0,theIndex);
|
||||
}
|
||||
else Truncate(aDest,0);
|
||||
}
|
||||
}
|
||||
|
||||
if(aEliminateTrailing) {
|
||||
theIndex=aDest.mLength;
|
||||
PRInt32 theNewLen=theIndex;
|
||||
while(--theIndex>0) {
|
||||
PRUnichar theChar=GetCharAt(aDest,theIndex); //read at end now...
|
||||
PRInt32 thePos=gFindChars[eOneByte](aSet,theSetLen,0,theChar,PR_FALSE);
|
||||
if(kNotFound<thePos)
|
||||
theNewLen=theIndex;
|
||||
else break;
|
||||
}
|
||||
if(theNewLen<theMax) {
|
||||
Truncate(aDest,theNewLen);
|
||||
}
|
||||
}
|
||||
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
*
|
||||
* @update gess1/7/99
|
||||
* @param
|
||||
* @return
|
||||
*/
|
||||
void nsStr::CompressSet(nsStr& aDest,const char* aSet,PRBool aEliminateLeading,PRBool aEliminateTrailing){
|
||||
Trim(aDest,aSet,aEliminateLeading,aEliminateTrailing);
|
||||
PRUint32 aNewLen=gCompressChars[aDest.mCharSize](aDest.mStr,aDest.mLength,aSet);
|
||||
aDest.mLength=aNewLen;
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
*
|
||||
* @update gess1/7/99
|
||||
* @param
|
||||
* @return
|
||||
*/
|
||||
void nsStr::StripChars(nsStr& aDest,const char* aSet){
|
||||
if((0<aDest.mLength) && (aSet)) {
|
||||
PRUint32 aNewLen=gStripChars[aDest.mCharSize](aDest.mStr,aDest.mLength,aSet);
|
||||
aDest.mLength=aNewLen;
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
/**************************************************************
|
||||
Searching methods...
|
||||
**************************************************************/
|
||||
|
||||
|
||||
/**
|
||||
* This searches aDest for a given substring
|
||||
*
|
||||
* @update gess 3/25/98
|
||||
* @param aDest string to search
|
||||
* @param aTarget is the substring you're trying to find.
|
||||
* @param aIgnorecase indicates case sensitivity of search
|
||||
* @param anOffset tells us where to start the search
|
||||
* @return index in aDest where member of aSet occurs, or -1 if not found
|
||||
*/
|
||||
PRInt32 nsStr::FindSubstr(const nsStr& aDest,const nsStr& aTarget, PRBool aIgnoreCase,PRInt32 anOffset) {
|
||||
// NS_PRECONDITION(aTarget.mLength!=1,kCallFindChar);
|
||||
|
||||
PRInt32 result=kNotFound;
|
||||
|
||||
if((0<aDest.mLength) && (anOffset<(PRInt32)aDest.mLength)) {
|
||||
PRInt32 theMax=aDest.mLength-aTarget.mLength;
|
||||
PRInt32 index=(0<=anOffset) ? anOffset : 0;
|
||||
|
||||
if((aDest.mLength>=aTarget.mLength) && (aTarget.mLength>0) && (index>=0)){
|
||||
PRInt32 theTargetMax=aTarget.mLength;
|
||||
while(index<=theMax) {
|
||||
PRInt32 theSubIndex=-1;
|
||||
PRBool matches=PR_TRUE;
|
||||
while((++theSubIndex<theTargetMax) && (matches)){
|
||||
PRUnichar theChar=(aIgnoreCase) ? nsCRT::ToLower(GetCharAt(aDest,index+theSubIndex)) : GetCharAt(aDest,index+theSubIndex);
|
||||
PRUnichar theTargetChar=(aIgnoreCase) ? nsCRT::ToLower(GetCharAt(aTarget,theSubIndex)) : GetCharAt(aTarget,theSubIndex);
|
||||
matches=PRBool(theChar==theTargetChar);
|
||||
}
|
||||
if(matches) {
|
||||
result=index;
|
||||
break;
|
||||
}
|
||||
index++;
|
||||
} //while
|
||||
}//if
|
||||
}//if
|
||||
return result;
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
* This searches aDest for a given character
|
||||
*
|
||||
* @update gess 3/25/98
|
||||
* @param aDest string to search
|
||||
* @param char is the character you're trying to find.
|
||||
* @param aIgnorecase indicates case sensitivity of search
|
||||
* @param anOffset tells us where to start the search
|
||||
* @return index in aDest where member of aSet occurs, or -1 if not found
|
||||
*/
|
||||
PRInt32 nsStr::FindChar(const nsStr& aDest,PRUnichar aChar, PRBool aIgnoreCase,PRInt32 anOffset) {
|
||||
PRInt32 result=kNotFound;
|
||||
if((0<aDest.mLength) && (anOffset<(PRInt32)aDest.mLength)) {
|
||||
PRUint32 index=(0<=anOffset) ? (PRUint32)anOffset : 0;
|
||||
result=gFindChars[aDest.mCharSize](aDest.mStr,aDest.mLength,index,aChar,aIgnoreCase);
|
||||
}
|
||||
return result;
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
* This searches aDest for a character found in aSet.
|
||||
*
|
||||
* @update gess 3/25/98
|
||||
* @param aDest string to search
|
||||
* @param aSet contains a list of chars to be searched for
|
||||
* @param aIgnorecase indicates case sensitivity of search
|
||||
* @param anOffset tells us where to start the search
|
||||
* @return index in aDest where member of aSet occurs, or -1 if not found
|
||||
*/
|
||||
PRInt32 nsStr::FindCharInSet(const nsStr& aDest,const nsStr& aSet,PRBool aIgnoreCase,PRInt32 anOffset) {
|
||||
//NS_PRECONDITION(aSet.mLength!=1,kCallFindChar);
|
||||
|
||||
PRInt32 index=(0<=anOffset) ? anOffset-1 : -1;
|
||||
PRInt32 thePos;
|
||||
|
||||
//Note that the search is inverted here. We're scanning aDest, one char at a time
|
||||
//but doing the search against the given set. That's why we use 0 as the offset below.
|
||||
if((0<aDest.mLength) && (0<aSet.mLength)){
|
||||
while(++index<(PRInt32)aDest.mLength) {
|
||||
PRUnichar theChar=GetCharAt(aDest,index);
|
||||
thePos=gFindChars[aSet.mCharSize](aSet.mStr,aSet.mLength,0,theChar,aIgnoreCase);
|
||||
if(kNotFound!=thePos)
|
||||
return index;
|
||||
} //while
|
||||
}
|
||||
return kNotFound;
|
||||
}
|
||||
|
||||
/**************************************************************
|
||||
Reverse Searching methods...
|
||||
**************************************************************/
|
||||
|
||||
|
||||
/**
|
||||
* This searches aDest (in reverse) for a given substring
|
||||
*
|
||||
* @update gess 3/25/98
|
||||
* @param aDest string to search
|
||||
* @param aTarget is the substring you're trying to find.
|
||||
* @param aIgnorecase indicates case sensitivity of search
|
||||
* @param anOffset tells us where to start the search (counting from left)
|
||||
* @return index in aDest where member of aSet occurs, or -1 if not found
|
||||
*/
|
||||
PRInt32 nsStr::RFindSubstr(const nsStr& aDest,const nsStr& aTarget, PRBool aIgnoreCase,PRInt32 anOffset) {
|
||||
//NS_PRECONDITION(aTarget.mLength!=1,kCallRFindChar);
|
||||
|
||||
PRInt32 result=kNotFound;
|
||||
|
||||
if((0<aDest.mLength) && (anOffset<(PRInt32)aDest.mLength)) {
|
||||
PRInt32 index=(0<=anOffset) ? anOffset : aDest.mLength-1;
|
||||
|
||||
if((aDest.mLength>=aTarget.mLength) && (aTarget.mLength>0) && (index>=0)){
|
||||
|
||||
nsStr theCopy;
|
||||
nsStr::Initialize(theCopy,eOneByte);
|
||||
nsStr::Assign(theCopy,aTarget,0,aTarget.mLength);
|
||||
if(aIgnoreCase){
|
||||
nsStr::ChangeCase(theCopy,PR_FALSE); //force to lowercase
|
||||
}
|
||||
|
||||
PRInt32 theTargetMax=theCopy.mLength;
|
||||
while(index>=0) {
|
||||
PRInt32 theSubIndex=-1;
|
||||
PRBool matches=PR_FALSE;
|
||||
if(index+theCopy.mLength<=aDest.mLength) {
|
||||
matches=PR_TRUE;
|
||||
while((++theSubIndex<theTargetMax) && (matches)){
|
||||
PRUnichar theDestChar=(aIgnoreCase) ? nsCRT::ToLower(GetCharAt(aDest,index+theSubIndex)) : GetCharAt(aDest,index+theSubIndex);
|
||||
PRUnichar theTargetChar=GetCharAt(theCopy,theSubIndex);
|
||||
matches=PRBool(theDestChar==theTargetChar);
|
||||
} //while
|
||||
} //if
|
||||
if(matches) {
|
||||
result=index;
|
||||
break;
|
||||
}
|
||||
index--;
|
||||
} //while
|
||||
nsStr::Destroy(theCopy);
|
||||
}//if
|
||||
}//if
|
||||
return result;
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
* This searches aDest (in reverse) for a given character
|
||||
*
|
||||
* @update gess 3/25/98
|
||||
* @param aDest string to search
|
||||
* @param char is the character you're trying to find.
|
||||
* @param aIgnorecase indicates case sensitivity of search
|
||||
* @param anOffset tells us where to start the search
|
||||
* @return index in aDest where member of aSet occurs, or -1 if not found
|
||||
*/
|
||||
PRInt32 nsStr::RFindChar(const nsStr& aDest,PRUnichar aChar, PRBool aIgnoreCase,PRInt32 anOffset) {
|
||||
PRInt32 result=kNotFound;
|
||||
if((0<aDest.mLength) && (anOffset<(PRInt32)aDest.mLength)) {
|
||||
PRUint32 index=(0<=anOffset) ? anOffset : aDest.mLength-1;
|
||||
result=gRFindChars[aDest.mCharSize](aDest.mStr,aDest.mLength,index,aChar,aIgnoreCase);
|
||||
}
|
||||
return result;
|
||||
}
|
||||
|
||||
/**
|
||||
* This searches aDest (in reverese) for a character found in aSet.
|
||||
*
|
||||
* @update gess 3/25/98
|
||||
* @param aDest string to search
|
||||
* @param aSet contains a list of chars to be searched for
|
||||
* @param aIgnorecase indicates case sensitivity of search
|
||||
* @param anOffset tells us where to start the search
|
||||
* @return index in aDest where member of aSet occurs, or -1 if not found
|
||||
*/
|
||||
PRInt32 nsStr::RFindCharInSet(const nsStr& aDest,const nsStr& aSet,PRBool aIgnoreCase,PRInt32 anOffset) {
|
||||
//NS_PRECONDITION(aSet.mLength!=1,kCallRFindChar);
|
||||
|
||||
PRInt32 index=(0<=anOffset) ? anOffset : aDest.mLength;
|
||||
PRInt32 thePos;
|
||||
|
||||
//note that the search is inverted here. We're scanning aDest, one char at a time
|
||||
//but doing the search against the given set. That's why we use 0 as the offset below.
|
||||
if(0<aDest.mLength) {
|
||||
while(--index>=0) {
|
||||
PRUnichar theChar=GetCharAt(aDest,index);
|
||||
thePos=gFindChars[aSet.mCharSize](aSet.mStr,aSet.mLength,0,theChar,aIgnoreCase);
|
||||
if(kNotFound!=thePos)
|
||||
return index;
|
||||
} //while
|
||||
}
|
||||
return kNotFound;
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
* Compare source and dest strings, up to an (optional max) number of chars
|
||||
* @param aDest is the first str to compare
|
||||
* @param aSource is the second str to compare
|
||||
* @param aCount -- if (-1), then we use length of longer string; if (0<aCount) then it gives the max # of chars to compare
|
||||
* @param aIgnorecase tells us whether to search with case sensitivity
|
||||
* @return aDest<aSource=-1;aDest==aSource==0;aDest>aSource=1
|
||||
*/
|
||||
PRInt32 nsStr::Compare(const nsStr& aDest,const nsStr& aSource,PRInt32 aCount,PRBool aIgnoreCase) {
|
||||
PRInt32 result=0;
|
||||
|
||||
if(aCount) {
|
||||
PRInt32 minlen=(aSource.mLength<aDest.mLength) ? aSource.mLength : aDest.mLength;
|
||||
|
||||
if(0==minlen) {
|
||||
if ((aDest.mLength == 0) && (aSource.mLength == 0))
|
||||
return 0;
|
||||
if (aDest.mLength == 0)
|
||||
return -1;
|
||||
return 1;
|
||||
}
|
||||
|
||||
PRInt32 maxlen=(aSource.mLength<aDest.mLength) ? aDest.mLength : aSource.mLength;
|
||||
aCount = (aCount<0) ? maxlen : MinInt(aCount,maxlen);
|
||||
result=(*gCompare[aDest.mCharSize][aSource.mCharSize])(aDest.mStr,aSource.mStr,aCount,aIgnoreCase);
|
||||
}
|
||||
return result;
|
||||
}
|
||||
|
||||
//----------------------------------------------------------------------------------------
|
||||
|
||||
PRBool nsStr::Alloc(nsStr& aDest,PRUint32 aCount) {
|
||||
|
||||
static int mAllocCount=0;
|
||||
mAllocCount++;
|
||||
|
||||
//we're given the acount value in charunits; now scale up to next multiple.
|
||||
PRUint32 theNewCapacity=kDefaultStringSize;
|
||||
while(theNewCapacity<aCount){
|
||||
theNewCapacity<<=1;
|
||||
}
|
||||
|
||||
aDest.mCapacity=theNewCapacity++;
|
||||
PRUint32 theSize=(theNewCapacity<<aDest.mCharSize);
|
||||
aDest.mStr = (char*)nsAllocator::Alloc(theSize);
|
||||
|
||||
PRBool result=PR_FALSE;
|
||||
if(aDest.mStr) {
|
||||
aDest.mOwnsBuffer=1;
|
||||
result=PR_TRUE;
|
||||
}
|
||||
return result;
|
||||
}
|
||||
|
||||
PRBool nsStr::Free(nsStr& aDest){
|
||||
if(aDest.mStr){
|
||||
if(aDest.mOwnsBuffer){
|
||||
nsAllocator::Free(aDest.mStr);
|
||||
}
|
||||
aDest.mStr=0;
|
||||
aDest.mOwnsBuffer=0;
|
||||
return PR_TRUE;
|
||||
}
|
||||
return PR_FALSE;
|
||||
}
|
||||
|
||||
PRBool nsStr::Realloc(nsStr& aDest,PRUint32 aCount){
|
||||
|
||||
nsStr temp;
|
||||
memcpy(&temp,&aDest,sizeof(aDest));
|
||||
|
||||
PRBool result=Alloc(temp,aCount);
|
||||
if(result) {
|
||||
Free(aDest);
|
||||
aDest.mStr=temp.mStr;
|
||||
aDest.mCapacity=temp.mCapacity;
|
||||
aDest.mOwnsBuffer=temp.mOwnsBuffer;
|
||||
}
|
||||
return result;
|
||||
}
|
||||
|
||||
//----------------------------------------------------------------------------------------
|
||||
|
||||
CBufDescriptor::CBufDescriptor(char* aString,PRBool aStackBased,PRUint32 aCapacity,PRInt32 aLength) {
|
||||
mBuffer=aString;
|
||||
mCharSize=eOneByte;
|
||||
mStackBased=aStackBased;
|
||||
mIsConst=PR_FALSE;
|
||||
mLength=mCapacity=0;
|
||||
if(aString && aCapacity>1) {
|
||||
mCapacity=aCapacity-1;
|
||||
mLength=(-1==aLength) ? strlen(aString) : aLength;
|
||||
if(mLength>PRInt32(mCapacity))
|
||||
mLength=mCapacity;
|
||||
}
|
||||
}
|
||||
|
||||
CBufDescriptor::CBufDescriptor(const char* aString,PRBool aStackBased,PRUint32 aCapacity,PRInt32 aLength) {
|
||||
mBuffer=(char*)aString;
|
||||
mCharSize=eOneByte;
|
||||
mStackBased=aStackBased;
|
||||
mIsConst=PR_TRUE;
|
||||
mLength=mCapacity=0;
|
||||
if(aString && aCapacity>1) {
|
||||
mCapacity=aCapacity-1;
|
||||
mLength=(-1==aLength) ? strlen(aString) : aLength;
|
||||
if(mLength>PRInt32(mCapacity))
|
||||
mLength=mCapacity;
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
CBufDescriptor::CBufDescriptor(PRUnichar* aString,PRBool aStackBased,PRUint32 aCapacity,PRInt32 aLength) {
|
||||
mBuffer=(char*)aString;
|
||||
mCharSize=eTwoByte;
|
||||
mStackBased=aStackBased;
|
||||
mLength=mCapacity=0;
|
||||
mIsConst=PR_FALSE;
|
||||
if(aString && aCapacity>1) {
|
||||
mCapacity=aCapacity-1;
|
||||
mLength=(-1==aLength) ? nsCRT::strlen(aString) : aLength;
|
||||
if(mLength>PRInt32(mCapacity))
|
||||
mLength=mCapacity;
|
||||
}
|
||||
}
|
||||
|
||||
CBufDescriptor::CBufDescriptor(const PRUnichar* aString,PRBool aStackBased,PRUint32 aCapacity,PRInt32 aLength) {
|
||||
mBuffer=(char*)aString;
|
||||
mCharSize=eTwoByte;
|
||||
mStackBased=aStackBased;
|
||||
mLength=mCapacity=0;
|
||||
mIsConst=PR_TRUE;
|
||||
if(aString && aCapacity>1) {
|
||||
mCapacity=aCapacity-1;
|
||||
mLength=(-1==aLength) ? nsCRT::strlen(aString) : aLength;
|
||||
if(mLength>PRInt32(mCapacity))
|
||||
mLength=mCapacity;
|
||||
}
|
||||
}
|
||||
|
||||
//----------------------------------------------------------------------------------------
|
||||
|
||||
|
||||
450
mozilla/string/obsolete/nsStr.h
Normal file
450
mozilla/string/obsolete/nsStr.h
Normal file
@@ -0,0 +1,450 @@
|
||||
/* -*- Mode: C++; tab-width: 2; indent-tabs-mode: nil; c-basic-offset: 2 -*- */
|
||||
/*
|
||||
* The contents of this file are subject to the Netscape Public License
|
||||
* Version 1.0 (the "NPL"); you may not use this file except in
|
||||
* compliance with the NPL. You may obtain a copy of the NPL at
|
||||
* http://www.mozilla.org/NPL/
|
||||
*
|
||||
* Software distributed under the NPL is distributed on an "AS IS" basis,
|
||||
* WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
|
||||
* for the specific language governing rights and limitations under the
|
||||
* NPL.
|
||||
*
|
||||
* The Initial Developer of this code under the NPL is Netscape
|
||||
* Communications Corporation. Portions created by Netscape are
|
||||
* Copyright (C) 1998 Netscape Communications Corporation. All Rights
|
||||
* Reserved.
|
||||
*/
|
||||
|
||||
|
||||
/***********************************************************************
|
||||
MODULE NOTES:
|
||||
|
||||
1. There are two philosophies to building string classes:
|
||||
A. Hide the underlying buffer & offer API's allow indirect iteration
|
||||
B. Reveal underlying buffer, risk corruption, but gain performance
|
||||
|
||||
We chose the option B for performance reasons.
|
||||
|
||||
2 Our internal buffer always holds capacity+1 bytes.
|
||||
|
||||
The nsStr struct is a simple structure (no methods) that contains
|
||||
the necessary info to be described as a string. This simple struct
|
||||
is manipulated by the static methods provided in this class.
|
||||
(Which effectively makes this a library that works on structs).
|
||||
|
||||
There are also object-based versions called nsString and nsAutoString
|
||||
which use nsStr but makes it look at feel like an object.
|
||||
|
||||
***********************************************************************/
|
||||
|
||||
/***********************************************************************
|
||||
ASSUMPTIONS:
|
||||
|
||||
1. nsStrings and nsAutoString are always null terminated.
|
||||
2. If you try to set a null char (via SetChar()) a new length is set
|
||||
3. nsCStrings can be upsampled into nsString without data loss
|
||||
4. Char searching is faster than string searching. Use char interfaces
|
||||
if your needs will allow it.
|
||||
5. It's easy to use the stack for nsAutostring buffer storage (fast too!).
|
||||
See the CBufDescriptor class in this file.
|
||||
6. It's ONLY ok to provide non-null-terminated buffers to Append() and Insert()
|
||||
provided you specify a 0<n value for the optional count argument.
|
||||
7. Downsampling from nsString to nsCString is lossy -- avoid it if possible!
|
||||
8. Calls to ToNewCString() and ToNewUnicode() should be matched with calls to Recycle().
|
||||
|
||||
***********************************************************************/
|
||||
|
||||
|
||||
/**********************************************************************************
|
||||
|
||||
AND NOW FOR SOME GENERAL DOCUMENTATION ON STRING USAGE...
|
||||
|
||||
The fundamental datatype in the string library is nsStr. It's a structure that
|
||||
provides the buffer storage and meta-info. It also provides a C-style library
|
||||
of functions for direct manipulation (for those of you who prefer K&R to Bjarne).
|
||||
|
||||
Here's a diagram of the class hierarchy:
|
||||
|
||||
nsStr
|
||||
|___nsString
|
||||
| |
|
||||
| ------nsAutoString
|
||||
|
|
||||
|___nsCString
|
||||
|
|
||||
------nsCAutoString
|
||||
|
||||
Why so many string classes? The 4 variants give you the control you need to
|
||||
determine the best class for your purpose. There are 2 dimensions to this
|
||||
flexibility: 1) stack vs. heap; and 2) 1-byte chars vs. 2-byte chars.
|
||||
|
||||
Note: While nsAutoString and nsCAutoString begin life using stack-based storage,
|
||||
they may not stay that way. Like all nsString classes, autostrings will
|
||||
automatically grow to contain the data you provide. When autostrings
|
||||
grow beyond their intrinsic buffer, they switch to heap based allocations.
|
||||
(We avoid alloca to avoid considerable platform difficulties; see the
|
||||
GNU documentation for more details).
|
||||
|
||||
I should also briefly mention that all the string classes use a "memory agent"
|
||||
object to perform memory operations. This class proxies the standard nsAllocator
|
||||
for actual memory calls, but knows the structure of nsStr making heap operations
|
||||
more localized.
|
||||
|
||||
|
||||
CHOOSING A STRING CLASS:
|
||||
|
||||
In order to choose a string class for you purpose, use this handy table:
|
||||
|
||||
heap-based stack-based
|
||||
-----------------------------------
|
||||
ascii data | nsCString nsCAutoString |
|
||||
|----------------------------------
|
||||
unicode data | nsString nsAutoString |
|
||||
-----------------------------------
|
||||
|
||||
|
||||
Note: The i18n folks will stenuously object if we get too carried away with the
|
||||
use of nsCString's that pass interface boundaries. Try to limit your
|
||||
use of these to external interfaces that demand them, or for your own
|
||||
private purposes in cases where they'll never be seen by humans.
|
||||
|
||||
|
||||
PERFORMANCE CONSIDERATIONS:
|
||||
|
||||
Here are a few tricks to know in order to get better string performance:
|
||||
|
||||
1) Try to limit conversions between ascii and unicode; By sticking with nsString
|
||||
wherever possible your code will be i18n-compliant.
|
||||
|
||||
|
||||
2) Preallocating your string buffer cuts down trips to the allocator. So if you
|
||||
have need for an arbitrarily large buffer, pre-size it like this:
|
||||
|
||||
{
|
||||
nsString mBuffer;
|
||||
mBuffer.SetCapacity(aReasonableSize);
|
||||
}
|
||||
|
||||
3) Allocating nsAutoString or nsCAutoString on the heap is memory inefficient
|
||||
(after all, the whole point is to avoid a heap allocation of the buffer).
|
||||
|
||||
|
||||
4) Consider using an autoString to write into your arbitrarily-sized stack buffers, rather
|
||||
than it's own buffers.
|
||||
|
||||
For example, let's say you're going to call printf() to emit pretty-printed debug output
|
||||
of your object. You know from experience that the pretty-printed version of your object
|
||||
exceeds the capacity of an autostring. Ignoring memory considerations, you could simply
|
||||
use nsCString, appending the stringized version of each of your class's data members.
|
||||
This will probably result in calls to the heap manager.
|
||||
|
||||
But there's a way to do this without necessarily having to call the heap manager.
|
||||
All you do is declare a stack based buffer and instruct nsCString to use that instead
|
||||
of it's own internal buffer by using the CBufDescriptor class:
|
||||
|
||||
{
|
||||
char theBuffer[256];
|
||||
CBufDescritor theBufDecriptor( theBuffer, PR_TRUE, sizeof(theBuffer), 0);
|
||||
nsCAutoString s3( theBufDescriptor );
|
||||
s3="HELLO, my name is inigo montoya, you killed my father, prepare to die!.";
|
||||
}
|
||||
|
||||
The assignment statment to s3 will cause the given string to be written to your
|
||||
stack-based buffer via the normal nsString/nsCString interfaces. Cool, huh?
|
||||
Note however that just like any other nsStringXXX use, if you write more data
|
||||
than will fit in the buffer, a visit to the heap manager will be in order.
|
||||
|
||||
|
||||
**********************************************************************************/
|
||||
|
||||
|
||||
#ifndef _nsStr
|
||||
#define _nsStr
|
||||
|
||||
#include "nscore.h"
|
||||
#include "nsIAllocator.h"
|
||||
#include <string.h>
|
||||
|
||||
//----------------------------------------------------------------------------------------
|
||||
|
||||
enum eCharSize {eOneByte=0,eTwoByte=1};
|
||||
#define kDefaultCharSize eTwoByte
|
||||
#define kRadix10 (10)
|
||||
#define kRadix16 (16)
|
||||
#define kAutoDetect (100)
|
||||
#define kRadixUnknown (kAutoDetect+1)
|
||||
const PRInt32 kDefaultStringSize = 64;
|
||||
const PRInt32 kNotFound = -1;
|
||||
|
||||
|
||||
//----------------------------------------------------------------------------------------
|
||||
|
||||
class NS_COM CBufDescriptor {
|
||||
public:
|
||||
CBufDescriptor(char* aString, PRBool aStackBased,PRUint32 aCapacity,PRInt32 aLength=-1);
|
||||
CBufDescriptor(const char* aString, PRBool aStackBased,PRUint32 aCapacity,PRInt32 aLength=-1);
|
||||
CBufDescriptor(PRUnichar* aString, PRBool aStackBased,PRUint32 aCapacity,PRInt32 aLength=-1);
|
||||
CBufDescriptor(const PRUnichar* aString,PRBool aStackBased,PRUint32 aCapacity,PRInt32 aLength=-1);
|
||||
|
||||
char* mBuffer;
|
||||
eCharSize mCharSize;
|
||||
PRUint32 mCapacity;
|
||||
PRInt32 mLength;
|
||||
PRBool mStackBased;
|
||||
PRBool mIsConst;
|
||||
};
|
||||
|
||||
//----------------------------------------------------------------------------------------
|
||||
|
||||
|
||||
struct NS_COM nsStr {
|
||||
|
||||
//----------------------------------------------------------------------------------------
|
||||
|
||||
nsStr() {
|
||||
MOZ_COUNT_CTOR(nsStr);
|
||||
}
|
||||
|
||||
~nsStr() {
|
||||
MOZ_COUNT_DTOR(nsStr);
|
||||
}
|
||||
|
||||
/**
|
||||
* This method initializes an nsStr for use
|
||||
*
|
||||
* @update gess 01/04/99
|
||||
* @param aString is the nsStr to be initialized
|
||||
* @param aCharSize tells us the requested char size (1 or 2 bytes)
|
||||
*/
|
||||
static void Initialize(nsStr& aDest,eCharSize aCharSize);
|
||||
|
||||
/**
|
||||
* This method initializes an nsStr for use
|
||||
*
|
||||
* @update gess 01/04/99
|
||||
* @param aString is the nsStr to be initialized
|
||||
* @param aCharSize tells us the requested char size (1 or 2 bytes)
|
||||
*/
|
||||
static void Initialize(nsStr& aDest,char* aCString,PRUint32 aCapacity,PRUint32 aLength,eCharSize aCharSize,PRBool aOwnsBuffer);
|
||||
|
||||
/**
|
||||
* This method destroys the given nsStr, and *MAY*
|
||||
* deallocate it's memory depending on the setting
|
||||
* of the internal mOwnsBUffer flag.
|
||||
*
|
||||
* @update gess 01/04/99
|
||||
* @param aString is the nsStr to be manipulated
|
||||
* @param anAgent is the allocator to be used to the nsStr
|
||||
*/
|
||||
static void Destroy(nsStr& aDest);
|
||||
|
||||
/**
|
||||
* These methods are where memory allocation/reallocation occur.
|
||||
*
|
||||
* @update gess 01/04/99
|
||||
* @param aString is the nsStr to be manipulated
|
||||
* @param anAgent is the allocator to be used on the nsStr
|
||||
* @return
|
||||
*/
|
||||
static PRBool EnsureCapacity(nsStr& aString,PRUint32 aNewLength);
|
||||
static PRBool GrowCapacity(nsStr& aString,PRUint32 aNewLength);
|
||||
|
||||
/**
|
||||
* These methods are used to append content to the given nsStr
|
||||
*
|
||||
* @update gess 01/04/99
|
||||
* @param aDest is the nsStr to be appended to
|
||||
* @param aSource is the buffer to be copied from
|
||||
* @param anOffset tells us where in source to start copying
|
||||
* @param aCount tells us the (max) # of chars to copy
|
||||
* @param anAgent is the allocator to be used for alloc/free operations
|
||||
*/
|
||||
static void Append(nsStr& aDest,const nsStr& aSource,PRUint32 anOffset,PRInt32 aCount);
|
||||
|
||||
/**
|
||||
* These methods are used to assign contents of a source string to dest string
|
||||
*
|
||||
* @update gess 01/04/99
|
||||
* @param aDest is the nsStr to be appended to
|
||||
* @param aSource is the buffer to be copied from
|
||||
* @param anOffset tells us where in source to start copying
|
||||
* @param aCount tells us the (max) # of chars to copy
|
||||
* @param anAgent is the allocator to be used for alloc/free operations
|
||||
*/
|
||||
static void Assign(nsStr& aDest,const nsStr& aSource,PRUint32 anOffset,PRInt32 aCount);
|
||||
|
||||
/**
|
||||
* These methods are used to insert content from source string to the dest nsStr
|
||||
*
|
||||
* @update gess 01/04/99
|
||||
* @param aDest is the nsStr to be appended to
|
||||
* @param aDestOffset tells us where in dest to start insertion
|
||||
* @param aSource is the buffer to be copied from
|
||||
* @param aSrcOffset tells us where in source to start copying
|
||||
* @param aCount tells us the (max) # of chars to insert
|
||||
* @param anAgent is the allocator to be used for alloc/free operations
|
||||
*/
|
||||
static void Insert( nsStr& aDest,PRUint32 aDestOffset,const nsStr& aSource,PRUint32 aSrcOffset,PRInt32 aCount);
|
||||
|
||||
/**
|
||||
* This method deletes chars from the given str.
|
||||
* The given allocator may choose to resize the str as well.
|
||||
*
|
||||
* @update gess 01/04/99
|
||||
* @param aDest is the nsStr to be deleted from
|
||||
* @param aDestOffset tells us where in dest to start deleting
|
||||
* @param aCount tells us the (max) # of chars to delete
|
||||
* @param anAgent is the allocator to be used for alloc/free operations
|
||||
*/
|
||||
static void Delete(nsStr& aDest,PRUint32 aDestOffset,PRUint32 aCount);
|
||||
|
||||
/**
|
||||
* This method is used to truncate the given string.
|
||||
* The given allocator may choose to resize the str as well (but it's not likely).
|
||||
*
|
||||
* @update gess 01/04/99
|
||||
* @param aDest is the nsStr to be appended to
|
||||
* @param aDestOffset tells us where in dest to start insertion
|
||||
* @param aSource is the buffer to be copied from
|
||||
* @param aSrcOffset tells us where in source to start copying
|
||||
* @param anAgent is the allocator to be used for alloc/free operations
|
||||
*/
|
||||
static void Truncate(nsStr& aDest,PRUint32 aDestOffset);
|
||||
|
||||
/**
|
||||
* This method is used to perform a case conversion on the given string
|
||||
*
|
||||
* @update gess 01/04/99
|
||||
* @param aDest is the nsStr to be case shifted
|
||||
* @param toUpper tells us to go upper vs. lower
|
||||
*/
|
||||
static void ChangeCase(nsStr& aDest,PRBool aToUpper);
|
||||
|
||||
|
||||
/**
|
||||
* This method trims chars (given in aSet) from the edges of given buffer
|
||||
*
|
||||
* @update gess 01/04/99
|
||||
* @param aDest is the buffer to be manipulated
|
||||
* @param aSet tells us which chars to remove from given buffer
|
||||
* @param aEliminateLeading tells us whether to strip chars from the start of the buffer
|
||||
* @param aEliminateTrailing tells us whether to strip chars from the start of the buffer
|
||||
*/
|
||||
static void Trim(nsStr& aDest,const char* aSet,PRBool aEliminateLeading,PRBool aEliminateTrailing);
|
||||
|
||||
/**
|
||||
* This method compresses duplicate runs of a given char from the given buffer
|
||||
*
|
||||
* @update gess 01/04/99
|
||||
* @param aDest is the buffer to be manipulated
|
||||
* @param aSet tells us which chars to compress from given buffer
|
||||
* @param aChar is the replacement char
|
||||
* @param aEliminateLeading tells us whether to strip chars from the start of the buffer
|
||||
* @param aEliminateTrailing tells us whether to strip chars from the start of the buffer
|
||||
*/
|
||||
static void CompressSet(nsStr& aDest,const char* aSet,PRBool aEliminateLeading,PRBool aEliminateTrailing);
|
||||
|
||||
/**
|
||||
* This method removes all occurances of chars in given set from aDest
|
||||
*
|
||||
* @update gess 01/04/99
|
||||
* @param aDest is the buffer to be manipulated
|
||||
* @param aSet tells us which chars to compress from given buffer
|
||||
* @param aChar is the replacement char
|
||||
* @param aEliminateLeading tells us whether to strip chars from the start of the buffer
|
||||
* @param aEliminateTrailing tells us whether to strip chars from the start of the buffer
|
||||
*/
|
||||
static void StripChars(nsStr& aDest,const char* aSet);
|
||||
|
||||
/**
|
||||
* This method compares the data bewteen two nsStr's
|
||||
*
|
||||
* @update gess 01/04/99
|
||||
* @param aStr1 is the first buffer to be compared
|
||||
* @param aStr2 is the 2nd buffer to be compared
|
||||
* @param aCount is the number of chars to compare
|
||||
* @param aIgnorecase tells us whether to use a case-sensitive comparison
|
||||
* @return -1,0,1 depending on <,==,>
|
||||
*/
|
||||
static PRInt32 Compare(const nsStr& aDest,const nsStr& aSource,PRInt32 aCount,PRBool aIgnoreCase);
|
||||
|
||||
/**
|
||||
* These methods scan the given string for 1 or more chars in a given direction
|
||||
*
|
||||
* @update gess 01/04/99
|
||||
* @param aDest is the nsStr to be searched to
|
||||
* @param aSource (or aChar) is the substr we're looking to find
|
||||
* @param aIgnoreCase tells us whether to search in a case-sensitive manner
|
||||
* @param anOffset tells us where in the dest string to start searching
|
||||
* @return the index of the source (substr) in dest, or -1 (kNotFound) if not found.
|
||||
*/
|
||||
static PRInt32 FindSubstr(const nsStr& aDest,const nsStr& aSource, PRBool aIgnoreCase,PRInt32 anOffset);
|
||||
static PRInt32 FindChar(const nsStr& aDest,PRUnichar aChar, PRBool aIgnoreCase,PRInt32 anOffset);
|
||||
static PRInt32 FindCharInSet(const nsStr& aDest,const nsStr& aSet,PRBool aIgnoreCase,PRInt32 anOffset);
|
||||
|
||||
static PRInt32 RFindSubstr(const nsStr& aDest,const nsStr& aSource, PRBool aIgnoreCase,PRInt32 anOffset);
|
||||
static PRInt32 RFindChar(const nsStr& aDest,PRUnichar aChar, PRBool aIgnoreCase,PRInt32 anOffset);
|
||||
static PRInt32 RFindCharInSet(const nsStr& aDest,const nsStr& aSet,PRBool aIgnoreCase,PRInt32 anOffset);
|
||||
|
||||
|
||||
PRUint32 mLength;
|
||||
PRUint32 mCapacity;
|
||||
eCharSize mCharSize;
|
||||
PRBool mOwnsBuffer;
|
||||
|
||||
union {
|
||||
char* mStr;
|
||||
PRUnichar* mUStr;
|
||||
};
|
||||
|
||||
private:
|
||||
static PRBool Alloc(nsStr& aString,PRUint32 aCount);
|
||||
static PRBool Realloc(nsStr& aString,PRUint32 aCount);
|
||||
static PRBool Free(nsStr& aString);
|
||||
|
||||
};
|
||||
|
||||
/**************************************************************
|
||||
A couple of tiny helper methods used in the string classes.
|
||||
**************************************************************/
|
||||
|
||||
inline PRInt32 MinInt(PRInt32 anInt1,PRInt32 anInt2){
|
||||
return (anInt1<anInt2) ? anInt1 : anInt2;
|
||||
}
|
||||
|
||||
inline PRInt32 MaxInt(PRInt32 anInt1,PRInt32 anInt2){
|
||||
return (anInt1<anInt2) ? anInt2 : anInt1;
|
||||
}
|
||||
|
||||
inline void AddNullTerminator(nsStr& aDest) {
|
||||
if(eTwoByte==aDest.mCharSize)
|
||||
aDest.mUStr[aDest.mLength]=0;
|
||||
else aDest.mStr[aDest.mLength]=0;
|
||||
}
|
||||
|
||||
/**
|
||||
* Return the given buffer to the heap manager. Calls allocator::Free()
|
||||
* @return string length
|
||||
*/
|
||||
inline void Recycle( char* aBuffer) { nsAllocator::Free(aBuffer); }
|
||||
inline void Recycle( PRUnichar* aBuffer) { nsAllocator::Free(aBuffer); }
|
||||
|
||||
/**
|
||||
* This method is used to access a given char in the given string
|
||||
*
|
||||
* @update gess 01/04/99
|
||||
* @param aDest is the nsStr to be appended to
|
||||
* @param anIndex tells us where in dest to get the char from
|
||||
* @return the given char, or 0 if anIndex is out of range
|
||||
*/
|
||||
inline PRUnichar GetCharAt(const nsStr& aDest,PRUint32 anIndex){
|
||||
if(anIndex<aDest.mLength) {
|
||||
return (eTwoByte==aDest.mCharSize) ? aDest.mUStr[anIndex] : aDest.mStr[anIndex];
|
||||
}//if
|
||||
return 0;
|
||||
}
|
||||
|
||||
|
||||
#endif
|
||||
|
||||
1865
mozilla/string/obsolete/nsString.cpp
Normal file
1865
mozilla/string/obsolete/nsString.cpp
Normal file
File diff suppressed because it is too large
Load Diff
747
mozilla/string/obsolete/nsString.h
Normal file
747
mozilla/string/obsolete/nsString.h
Normal file
@@ -0,0 +1,747 @@
|
||||
/* -*- Mode: C++; tab-width: 2; indent-tabs-mode: nil; c-basic-offset: 2 -*- */
|
||||
/*
|
||||
* The contents of this file are subject to the Netscape Public License
|
||||
* Version 1.0 (the "NPL"); you may not use this file except in
|
||||
* compliance with the NPL. You may obtain a copy of the NPL at
|
||||
* http://www.mozilla.org/NPL/
|
||||
*
|
||||
* Software distributed under the NPL is distributed on an "AS IS" basis,
|
||||
* WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
|
||||
* for the specific language governing rights and limitations under the
|
||||
* NPL.
|
||||
*
|
||||
* The Initial Developer of this code under the NPL is Netscape
|
||||
* Communications Corporation. Portions created by Netscape are
|
||||
* Copyright (C) 1998 Netscape Communications Corporation. All Rights
|
||||
* Reserved.
|
||||
*/
|
||||
|
||||
|
||||
/***********************************************************************
|
||||
MODULE NOTES:
|
||||
|
||||
See nsStr.h for a more general description of string classes.
|
||||
|
||||
This version of the nsString class offers many improvements over the
|
||||
original version:
|
||||
1. Wide and narrow chars
|
||||
2. Allocators
|
||||
3. Much smarter autostrings
|
||||
4. Subsumable strings
|
||||
***********************************************************************/
|
||||
|
||||
|
||||
#ifndef _nsCString_
|
||||
#define _nsCString_
|
||||
|
||||
#include "nsString2.h"
|
||||
#include "prtypes.h"
|
||||
#include "nscore.h"
|
||||
#include <stdio.h>
|
||||
#include "nsStr.h"
|
||||
#include "nsIAtom.h"
|
||||
|
||||
|
||||
class NS_COM nsSubsumeCStr;
|
||||
|
||||
class NS_COM nsCString : public nsStr {
|
||||
|
||||
public:
|
||||
|
||||
/**
|
||||
* Default constructor.
|
||||
*/
|
||||
nsCString();
|
||||
|
||||
/**
|
||||
* This constructor accepts an isolatin string
|
||||
* @param aCString is a ptr to a 1-byte cstr
|
||||
*/
|
||||
nsCString(const char* aCString,PRInt32 aLength=-1);
|
||||
|
||||
/**
|
||||
* This constructor accepts a unichar string
|
||||
* @param aCString is a ptr to a 2-byte cstr
|
||||
*/
|
||||
nsCString(const PRUnichar* aString,PRInt32 aLength=-1);
|
||||
|
||||
/**
|
||||
* This is a copy constructor that accepts an nsStr
|
||||
* @param reference to another nsCString
|
||||
*/
|
||||
nsCString(const nsStr&);
|
||||
|
||||
/**
|
||||
* This is our copy constructor
|
||||
* @param reference to another nsCString
|
||||
*/
|
||||
nsCString(const nsCString& aString);
|
||||
|
||||
/**
|
||||
* This constructor takes a subsumestr
|
||||
* @param reference to subsumestr
|
||||
*/
|
||||
nsCString(nsSubsumeCStr& aSubsumeStr);
|
||||
|
||||
/**
|
||||
* Destructor
|
||||
*
|
||||
*/
|
||||
virtual ~nsCString();
|
||||
|
||||
/**
|
||||
* Retrieve the length of this string
|
||||
* @return string length
|
||||
*/
|
||||
inline PRInt32 Length() const { return (PRInt32)mLength; }
|
||||
|
||||
/**
|
||||
* Retrieve the size of this string
|
||||
* @return string length
|
||||
*/
|
||||
virtual void SizeOf(nsISizeOfHandler* aHandler, PRUint32* aResult) const;
|
||||
|
||||
|
||||
/**
|
||||
* Call this method if you want to force a different string capacity
|
||||
* @update gess7/30/98
|
||||
* @param aLength -- contains new length for mStr
|
||||
* @return
|
||||
*/
|
||||
void SetLength(PRUint32 aLength) {
|
||||
Truncate(aLength);
|
||||
}
|
||||
|
||||
/**
|
||||
* Sets the new length of the string.
|
||||
* @param aLength is new string length.
|
||||
* @return nada
|
||||
*/
|
||||
void SetCapacity(PRUint32 aLength);
|
||||
/**
|
||||
* This method truncates this string to given length.
|
||||
*
|
||||
* @param anIndex -- new length of string
|
||||
* @return nada
|
||||
*/
|
||||
void Truncate(PRInt32 anIndex=0);
|
||||
|
||||
|
||||
/**
|
||||
* Determine whether or not the characters in this
|
||||
* string are in sorted order.
|
||||
*
|
||||
* @return TRUE if ordered.
|
||||
*/
|
||||
PRBool IsOrdered(void) const;
|
||||
|
||||
|
||||
/**
|
||||
* Determine whether or not this string has a length of 0
|
||||
*
|
||||
* @return TRUE if empty.
|
||||
*/
|
||||
PRBool IsEmpty(void) const {
|
||||
return PRBool(0==mLength);
|
||||
}
|
||||
|
||||
/**********************************************************************
|
||||
Accessor methods...
|
||||
*********************************************************************/
|
||||
|
||||
|
||||
/**
|
||||
* Retrieve const ptr to internal buffer; DO NOT TRY TO FREE IT!
|
||||
*/
|
||||
const char* GetBuffer(void) const;
|
||||
|
||||
|
||||
/**
|
||||
* Get nth character.
|
||||
*/
|
||||
PRUnichar operator[](PRUint32 anIndex) const;
|
||||
PRUnichar CharAt(PRUint32 anIndex) const;
|
||||
PRUnichar First(void) const;
|
||||
PRUnichar Last(void) const;
|
||||
|
||||
PRBool SetCharAt(PRUnichar aChar,PRUint32 anIndex);
|
||||
|
||||
|
||||
/**********************************************************************
|
||||
String creation methods...
|
||||
*********************************************************************/
|
||||
|
||||
/**
|
||||
* Create a new string by appending given string to this
|
||||
* @param aString -- 2nd string to be appended
|
||||
* @return new string
|
||||
*/
|
||||
nsSubsumeCStr operator+(const nsCString& aString);
|
||||
|
||||
/**
|
||||
* create a new string by adding this to the given char*.
|
||||
* @param aCString is a ptr to cstring to be added to this
|
||||
* @return newly created string
|
||||
*/
|
||||
nsSubsumeCStr operator+(const char* aCString);
|
||||
|
||||
|
||||
/**
|
||||
* create a new string by adding this to the given char.
|
||||
* @param aChar is a char to be added to this
|
||||
* @return newly created string
|
||||
*/
|
||||
nsSubsumeCStr operator+(PRUnichar aChar);
|
||||
nsSubsumeCStr operator+(char aChar);
|
||||
|
||||
|
||||
/**********************************************************************
|
||||
Lexomorphic transforms...
|
||||
*********************************************************************/
|
||||
|
||||
/**
|
||||
* Converts chars in this to lowercase
|
||||
* @update gess 7/27/98
|
||||
*/
|
||||
void ToLowerCase();
|
||||
|
||||
|
||||
/**
|
||||
* Converts chars in this to lowercase, and
|
||||
* stores them in aOut
|
||||
* @update gess 7/27/98
|
||||
* @param aOut is a string to contain result
|
||||
*/
|
||||
void ToLowerCase(nsCString& aString) const;
|
||||
|
||||
/**
|
||||
* Converts chars in this to uppercase
|
||||
* @update gess 7/27/98
|
||||
*/
|
||||
void ToUpperCase();
|
||||
|
||||
/**
|
||||
* Converts chars in this to lowercase, and
|
||||
* stores them in a given output string
|
||||
* @update gess 7/27/98
|
||||
* @param aOut is a string to contain result
|
||||
*/
|
||||
void ToUpperCase(nsCString& aString) const;
|
||||
|
||||
|
||||
/**
|
||||
* This method is used to remove all occurances of the
|
||||
* characters found in aSet from this string.
|
||||
*
|
||||
* @param aSet -- characters to be cut from this
|
||||
* @return *this
|
||||
*/
|
||||
nsCString& StripChars(const char* aSet);
|
||||
nsCString& StripChar(char aChar);
|
||||
|
||||
/**
|
||||
* This method strips whitespace throughout the string
|
||||
*
|
||||
* @return this
|
||||
*/
|
||||
nsCString& StripWhitespace();
|
||||
|
||||
/**
|
||||
* swaps occurence of 1 string for another
|
||||
*
|
||||
* @return this
|
||||
*/
|
||||
nsCString& ReplaceChar(PRUnichar aOldChar,PRUnichar aNewChar);
|
||||
nsCString& ReplaceChar(const char* aSet,PRUnichar aNewChar);
|
||||
|
||||
PRInt32 CountChar(PRUnichar aChar);
|
||||
|
||||
/**
|
||||
* This method trims characters found in aTrimSet from
|
||||
* either end of the underlying string.
|
||||
*
|
||||
* @param aTrimSet -- contains chars to be trimmed from
|
||||
* both ends
|
||||
* @return this
|
||||
*/
|
||||
nsCString& Trim(const char* aSet,PRBool aEliminateLeading=PR_TRUE,PRBool aEliminateTrailing=PR_TRUE);
|
||||
|
||||
/**
|
||||
* This method strips whitespace from string.
|
||||
* You can control whether whitespace is yanked from
|
||||
* start and end of string as well.
|
||||
*
|
||||
* @param aEliminateLeading controls stripping of leading ws
|
||||
* @param aEliminateTrailing controls stripping of trailing ws
|
||||
* @return this
|
||||
*/
|
||||
nsCString& CompressSet(const char* aSet, PRUnichar aChar,PRBool aEliminateLeading=PR_TRUE,PRBool aEliminateTrailing=PR_TRUE);
|
||||
|
||||
/**
|
||||
* This method strips whitespace from string.
|
||||
* You can control whether whitespace is yanked from
|
||||
* start and end of string as well.
|
||||
*
|
||||
* @param aEliminateLeading controls stripping of leading ws
|
||||
* @param aEliminateTrailing controls stripping of trailing ws
|
||||
* @return this
|
||||
*/
|
||||
nsCString& CompressWhitespace( PRBool aEliminateLeading=PR_TRUE,PRBool aEliminateTrailing=PR_TRUE);
|
||||
|
||||
/**********************************************************************
|
||||
string conversion methods...
|
||||
*********************************************************************/
|
||||
|
||||
operator char*() {return mStr;}
|
||||
operator const char*() const {return (const char*)mStr;}
|
||||
|
||||
/**
|
||||
* This method constructs a new nsCString that is a clone
|
||||
* of this string.
|
||||
*
|
||||
*/
|
||||
nsCString* ToNewString() const;
|
||||
|
||||
/**
|
||||
* Creates an ISOLatin1 clone of this string
|
||||
* Note that calls to this method should be matched with calls to Recycle().
|
||||
* @return ptr to new isolatin1 string
|
||||
*/
|
||||
char* ToNewCString() const;
|
||||
|
||||
/**
|
||||
* Creates a unicode clone of this string
|
||||
* Note that calls to this method should be matched with calls to Recycle().
|
||||
* @return ptr to new unicode string
|
||||
*/
|
||||
PRUnichar* ToNewUnicode() const;
|
||||
|
||||
/**
|
||||
* Copies data from internal buffer onto given char* buffer
|
||||
* NOTE: This only copies as many chars as will fit in given buffer (clips)
|
||||
* @param aBuf is the buffer where data is stored
|
||||
* @param aBuflength is the max # of chars to move to buffer
|
||||
* @return ptr to given buffer
|
||||
*/
|
||||
char* ToCString(char* aBuf,PRUint32 aBufLength,PRUint32 anOffset=0) const;
|
||||
|
||||
/**
|
||||
* Perform string to float conversion.
|
||||
* @param aErrorCode will contain error if one occurs
|
||||
* @return float rep of string value
|
||||
*/
|
||||
float ToFloat(PRInt32* aErrorCode) const;
|
||||
|
||||
/**
|
||||
* Try to derive the radix from the value contained in this string
|
||||
* @return kRadix10, kRadix16 or kAutoDetect (meaning unknown)
|
||||
*/
|
||||
PRUint32 DetermineRadix(void);
|
||||
|
||||
/**
|
||||
* Perform string to int conversion.
|
||||
* @param aErrorCode will contain error if one occurs
|
||||
* @return int rep of string value
|
||||
*/
|
||||
PRInt32 ToInteger(PRInt32* aErrorCode,PRUint32 aRadix=kRadix10) const;
|
||||
|
||||
|
||||
/**********************************************************************
|
||||
String manipulation methods...
|
||||
*********************************************************************/
|
||||
|
||||
/**
|
||||
* Functionally equivalent to assign or operator=
|
||||
*
|
||||
*/
|
||||
nsCString& SetString(const char* aString,PRInt32 aLength=-1) {return Assign(aString,aLength);}
|
||||
nsCString& SetString(const nsStr& aString,PRInt32 aLength=-1) {return Assign(aString,aLength);}
|
||||
|
||||
/**
|
||||
* assign given string to this string
|
||||
* @param aStr: buffer to be assigned to this
|
||||
* @param alength is the length of the given str (or -1)
|
||||
if you want me to determine its length
|
||||
* @return this
|
||||
*/
|
||||
nsCString& Assign(const nsStr& aString,PRInt32 aCount=-1);
|
||||
nsCString& Assign(const char* aString,PRInt32 aCount=-1);
|
||||
nsCString& Assign(const PRUnichar* aString,PRInt32 aCount=-1);
|
||||
nsCString& Assign(PRUnichar aChar);
|
||||
nsCString& Assign(char aChar);
|
||||
|
||||
/**
|
||||
* here come a bunch of assignment operators...
|
||||
* @param aString: string to be added to this
|
||||
* @return this
|
||||
*/
|
||||
nsCString& operator=(const nsCString& aString) {return Assign(aString);}
|
||||
nsCString& operator=(const nsStr& aString) {return Assign(aString);}
|
||||
nsCString& operator=(PRUnichar aChar) {return Assign(aChar);}
|
||||
nsCString& operator=(char aChar) {return Assign(aChar);}
|
||||
nsCString& operator=(const char* aCString) {return Assign(aCString);}
|
||||
nsCString& operator=(const PRUnichar* aString) {return Assign(aString);}
|
||||
#ifdef AIX
|
||||
nsCString& operator=(const nsSubsumeCStr& aSubsumeString); // AIX requires a const here
|
||||
#else
|
||||
nsCString& operator=(nsSubsumeCStr& aSubsumeString);
|
||||
#endif
|
||||
|
||||
/**
|
||||
* Here's a bunch of methods that append varying types...
|
||||
* @param various...
|
||||
* @return this
|
||||
*/
|
||||
nsCString& operator+=(const nsCString& aString){return Append(aString,aString.mLength);}
|
||||
nsCString& operator+=(const char* aCString) {return Append(aCString);}
|
||||
nsCString& operator+=(PRUnichar aChar){return Append(aChar);}
|
||||
nsCString& operator+=(char aChar){return Append(aChar);}
|
||||
|
||||
/*
|
||||
* Appends n characters from given string to this,
|
||||
* This version computes the length of your given string
|
||||
*
|
||||
* @param aString is the source to be appended to this
|
||||
* @return number of chars copied
|
||||
*/
|
||||
nsCString& Append(const nsCString& aString) {return Append(aString,aString.mLength);}
|
||||
|
||||
|
||||
/*
|
||||
* Appends n characters from given string to this,
|
||||
*
|
||||
* @param aString is the source to be appended to this
|
||||
* @param aCount -- number of chars to copy; -1 tells us to compute the strlen for you
|
||||
* @return number of chars copied
|
||||
*/
|
||||
nsCString& Append(const nsCString& aString,PRInt32 aCount);
|
||||
nsCString& Append(const nsStr& aString,PRInt32 aCount=-1);
|
||||
nsCString& Append(const char* aString,PRInt32 aCount=-1);
|
||||
nsCString& Append(PRUnichar aChar);
|
||||
nsCString& Append(char aChar);
|
||||
nsCString& Append(PRInt32 aInteger,PRInt32 aRadix=10); //radix=8,10 or 16
|
||||
nsCString& Append(float aFloat);
|
||||
|
||||
/*
|
||||
* Copies n characters from this string to given string,
|
||||
* starting at the leftmost offset.
|
||||
*
|
||||
*
|
||||
* @param aCopy -- Receiving string
|
||||
* @param aCount -- number of chars to copy
|
||||
* @return number of chars copied
|
||||
*/
|
||||
PRUint32 Left(nsCString& aCopy,PRInt32 aCount) const;
|
||||
|
||||
/*
|
||||
* Copies n characters from this string to given string,
|
||||
* starting at the given offset.
|
||||
*
|
||||
*
|
||||
* @param aCopy -- Receiving string
|
||||
* @param aCount -- number of chars to copy
|
||||
* @param anOffset -- position where copying begins
|
||||
* @return number of chars copied
|
||||
*/
|
||||
PRUint32 Mid(nsCString& aCopy,PRUint32 anOffset,PRInt32 aCount) const;
|
||||
|
||||
/*
|
||||
* Copies n characters from this string to given string,
|
||||
* starting at rightmost char.
|
||||
*
|
||||
*
|
||||
* @param aCopy -- Receiving string
|
||||
* @param aCount -- number of chars to copy
|
||||
* @return number of chars copied
|
||||
*/
|
||||
PRUint32 Right(nsCString& aCopy,PRInt32 aCount) const;
|
||||
|
||||
/*
|
||||
* This method inserts n chars from given string into this
|
||||
* string at str[anOffset].
|
||||
*
|
||||
* @param aCopy -- String to be inserted into this
|
||||
* @param anOffset -- insertion position within this str
|
||||
* @param aCount -- number of chars to be copied from aCopy
|
||||
* @return number of chars inserted into this.
|
||||
*/
|
||||
nsCString& Insert(const nsCString& aCopy,PRUint32 anOffset,PRInt32 aCount=-1);
|
||||
|
||||
/**
|
||||
* Insert a given string into this string at
|
||||
* a specified offset.
|
||||
*
|
||||
* @param aString* to be inserted into this string
|
||||
* @param anOffset is insert pos in str
|
||||
* @return the number of chars inserted into this string
|
||||
*/
|
||||
nsCString& Insert(const char* aChar,PRUint32 anOffset,PRInt32 aCount=-1);
|
||||
|
||||
/**
|
||||
* Insert a single char into this string at
|
||||
* a specified offset.
|
||||
*
|
||||
* @param character to be inserted into this string
|
||||
* @param anOffset is insert pos in str
|
||||
* @return the number of chars inserted into this string
|
||||
*/
|
||||
nsCString& Insert(PRUnichar aChar,PRUint32 anOffset);
|
||||
nsCString& Insert(char aChar,PRUint32 anOffset);
|
||||
|
||||
/*
|
||||
* This method is used to cut characters in this string
|
||||
* starting at anOffset, continuing for aCount chars.
|
||||
*
|
||||
* @param anOffset -- start pos for cut operation
|
||||
* @param aCount -- number of chars to be cut
|
||||
* @return *this
|
||||
*/
|
||||
nsCString& Cut(PRUint32 anOffset,PRInt32 aCount);
|
||||
|
||||
|
||||
/**********************************************************************
|
||||
Searching methods...
|
||||
*********************************************************************/
|
||||
|
||||
/**
|
||||
* Search for given character within this string.
|
||||
* This method does so by using a binary search,
|
||||
* so your string HAD BETTER BE ORDERED!
|
||||
*
|
||||
* @param aChar is the unicode char to be found
|
||||
* @return offset in string, or -1 (kNotFound)
|
||||
*/
|
||||
PRInt32 BinarySearch(PRUnichar aChar) const;
|
||||
|
||||
/**
|
||||
* Search for given substring within this string
|
||||
*
|
||||
* @param aString is substring to be sought in this
|
||||
* @param aIgnoreCase selects case sensitivity
|
||||
* @param anOffset tells us where in this strig to start searching
|
||||
* @return offset in string, or -1 (kNotFound)
|
||||
*/
|
||||
PRInt32 Find(const nsStr& aString,PRBool aIgnoreCase=PR_FALSE,PRInt32 anOffset=-1) const;
|
||||
PRInt32 Find(const char* aString,PRBool aIgnoreCase=PR_FALSE,PRInt32 anOffset=-1) const;
|
||||
PRInt32 Find(const PRUnichar* aString,PRBool aIgnoreCase=PR_FALSE,PRInt32 anOffset=-1) const;
|
||||
|
||||
/**
|
||||
* Search for given char within this string
|
||||
*
|
||||
* @param aString is substring to be sought in this
|
||||
* @param anOffset tells us where in this strig to start searching
|
||||
* @param aIgnoreCase selects case sensitivity
|
||||
* @return find pos in string, or -1 (kNotFound)
|
||||
*/
|
||||
PRInt32 FindChar(PRUnichar aChar,PRBool aIgnoreCase=PR_FALSE,PRInt32 anOffset=-1) const;
|
||||
|
||||
/**
|
||||
* This method searches this string for the first character
|
||||
* found in the given charset
|
||||
* @param aString contains set of chars to be found
|
||||
* @param anOffset tells us where to start searching in this
|
||||
* @return -1 if not found, else the offset in this
|
||||
*/
|
||||
PRInt32 FindCharInSet(const char* aString,PRInt32 anOffset=-1) const;
|
||||
PRInt32 FindCharInSet(const PRUnichar* aString,PRInt32 anOffset=-1) const;
|
||||
PRInt32 FindCharInSet(const nsStr& aString,PRInt32 anOffset=-1) const;
|
||||
|
||||
|
||||
/**
|
||||
* This methods scans the string backwards, looking for the given string
|
||||
* @param aString is substring to be sought in this
|
||||
* @param aIgnoreCase tells us whether or not to do caseless compare
|
||||
* @return offset in string, or -1 (kNotFound)
|
||||
*/
|
||||
PRInt32 RFind(const char* aCString,PRBool aIgnoreCase=PR_FALSE,PRInt32 anOffset=-1) const;
|
||||
PRInt32 RFind(const nsStr& aString,PRBool aIgnoreCase=PR_FALSE,PRInt32 anOffset=-1) const;
|
||||
PRInt32 RFind(const PRUnichar* aString,PRBool aIgnoreCase=PR_FALSE,PRInt32 anOffset=-1) const;
|
||||
|
||||
|
||||
/**
|
||||
* Search for given char within this string
|
||||
*
|
||||
* @param aString is substring to be sought in this
|
||||
* @param anOffset tells us where in this strig to start searching
|
||||
* @param aIgnoreCase selects case sensitivity
|
||||
* @return find pos in string, or -1 (kNotFound)
|
||||
*/
|
||||
PRInt32 RFindChar(PRUnichar aChar,PRBool aIgnoreCase=PR_FALSE,PRInt32 anOffset=-1) const;
|
||||
|
||||
/**
|
||||
* This method searches this string for the last character
|
||||
* found in the given string
|
||||
* @param aString contains set of chars to be found
|
||||
* @param anOffset tells us where to start searching in this
|
||||
* @return -1 if not found, else the offset in this
|
||||
*/
|
||||
PRInt32 RFindCharInSet(const char* aString,PRInt32 anOffset=-1) const;
|
||||
PRInt32 RFindCharInSet(const PRUnichar* aString,PRInt32 anOffset=-1) const;
|
||||
PRInt32 RFindCharInSet(const nsStr& aString,PRInt32 anOffset=-1) const;
|
||||
|
||||
|
||||
|
||||
/**********************************************************************
|
||||
Comparison methods...
|
||||
*********************************************************************/
|
||||
|
||||
/**
|
||||
* Compares a given string type to this string.
|
||||
* @update gess 7/27/98
|
||||
* @param S is the string to be compared
|
||||
* @param aIgnoreCase tells us how to treat case
|
||||
* @param aCount tells us how many chars to compare
|
||||
* @return -1,0,1
|
||||
*/
|
||||
virtual PRInt32 Compare(const nsStr &aString,PRBool aIgnoreCase=PR_FALSE,PRInt32 aCount=-1) const;
|
||||
virtual PRInt32 Compare(const char* aString,PRBool aIgnoreCase=PR_FALSE,PRInt32 aCount=-1) const;
|
||||
virtual PRInt32 Compare(const PRUnichar* aString,PRBool aIgnoreCase=PR_FALSE,PRInt32 aCount=-1) const;
|
||||
|
||||
/**
|
||||
* These methods compare a given string type to this one
|
||||
* @param aString is the string to be compared to this
|
||||
* @return TRUE or FALSE
|
||||
*/
|
||||
PRBool operator==(const nsStr &aString) const;
|
||||
PRBool operator==(const char* aString) const;
|
||||
PRBool operator==(const PRUnichar* aString) const;
|
||||
|
||||
/**
|
||||
* These methods perform a !compare of a given string type to this
|
||||
* @param aString is the string to be compared to this
|
||||
* @return TRUE
|
||||
*/
|
||||
PRBool operator!=(const nsStr &aString) const;
|
||||
PRBool operator!=(const char* aString) const;
|
||||
PRBool operator!=(const PRUnichar* aString) const;
|
||||
|
||||
/**
|
||||
* These methods test if a given string is < than this
|
||||
* @param aString is the string to be compared to this
|
||||
* @return TRUE or FALSE
|
||||
*/
|
||||
PRBool operator<(const nsStr &aString) const;
|
||||
PRBool operator<(const char* aString) const;
|
||||
PRBool operator<(const PRUnichar* aString) const;
|
||||
|
||||
/**
|
||||
* These methods test if a given string is > than this
|
||||
* @param aString is the string to be compared to this
|
||||
* @return TRUE or FALSE
|
||||
*/
|
||||
PRBool operator>(const nsStr &S) const;
|
||||
PRBool operator>(const char* aString) const;
|
||||
PRBool operator>(const PRUnichar* aString) const;
|
||||
|
||||
/**
|
||||
* These methods test if a given string is <= than this
|
||||
* @param aString is the string to be compared to this
|
||||
* @return TRUE or FALSE
|
||||
*/
|
||||
PRBool operator<=(const nsStr &S) const;
|
||||
PRBool operator<=(const char* aString) const;
|
||||
PRBool operator<=(const PRUnichar* aString) const;
|
||||
|
||||
/**
|
||||
* These methods test if a given string is >= than this
|
||||
* @param aString is the string to be compared to this
|
||||
* @return TRUE or FALSE
|
||||
*/
|
||||
PRBool operator>=(const nsStr &S) const;
|
||||
PRBool operator>=(const char* aString) const;
|
||||
PRBool operator>=(const PRUnichar* aString) const;
|
||||
|
||||
/**
|
||||
* Compare this to given string; note that we compare full strings here.
|
||||
* The optional length argument just lets us know how long the given string is.
|
||||
* If you provide a length, it is compared to length of this string as an
|
||||
* optimization.
|
||||
*
|
||||
* @param aString -- the string to compare to this
|
||||
* @param aCount -- number of chars in given string you want to compare
|
||||
* @return TRUE if equal
|
||||
*/
|
||||
PRBool Equals(const nsString &aString,PRBool aIgnoreCase=PR_FALSE,PRInt32 aCount=-1) const;
|
||||
PRBool Equals(const nsStr& aString,PRBool aIgnoreCase=PR_FALSE,PRInt32 aCount=-1) const;
|
||||
PRBool Equals(const char* aString,PRBool aIgnoreCase=PR_FALSE,PRInt32 aCount=-1) const;
|
||||
PRBool Equals(const PRUnichar* aString,PRBool aIgnoreCase=PR_FALSE,PRInt32 aCount=-1) const;
|
||||
|
||||
PRBool EqualsIgnoreCase(const nsStr& aString) const;
|
||||
PRBool EqualsIgnoreCase(const char* aString,PRInt32 aCount=-1) const;
|
||||
PRBool EqualsIgnoreCase(const PRUnichar* aString,PRInt32 aCount=-1) const;
|
||||
|
||||
|
||||
static void Recycle(nsCString* aString);
|
||||
static nsCString* CreateString(void);
|
||||
|
||||
};
|
||||
|
||||
extern NS_COM int fputs(const nsCString& aString, FILE* out);
|
||||
//ostream& operator<<(ostream& aStream,const nsCString& aString);
|
||||
//virtual void DebugDump(ostream& aStream) const;
|
||||
|
||||
|
||||
/**************************************************************
|
||||
Here comes the AutoString class which uses internal memory
|
||||
(typically found on the stack) for its default buffer.
|
||||
If the buffer needs to grow, it gets reallocated on the heap.
|
||||
**************************************************************/
|
||||
|
||||
class NS_COM nsCAutoString : public nsCString {
|
||||
public:
|
||||
|
||||
nsCAutoString();
|
||||
nsCAutoString(const char* aString,PRInt32 aLength=-1);
|
||||
nsCAutoString(const CBufDescriptor& aBuffer);
|
||||
nsCAutoString(const PRUnichar* aString,PRInt32 aLength=-1);
|
||||
nsCAutoString(const nsStr& aString);
|
||||
nsCAutoString(const nsCAutoString& aString);
|
||||
|
||||
#ifdef AIX
|
||||
nsCAutoString(const nsSubsumeCStr& aSubsumeStr); // AIX requires a const
|
||||
#else
|
||||
nsCAutoString(nsSubsumeCStr& aSubsumeStr);
|
||||
#endif // AIX
|
||||
nsCAutoString(PRUnichar aChar);
|
||||
virtual ~nsCAutoString();
|
||||
|
||||
nsCAutoString& operator=(const nsCString& aString) {nsCString::Assign(aString); return *this;}
|
||||
nsCAutoString& operator=(const char* aCString) {nsCString::Assign(aCString); return *this;}
|
||||
nsCAutoString& operator=(PRUnichar aChar) {nsCString::Assign(aChar); return *this;}
|
||||
nsCAutoString& operator=(char aChar) {nsCString::Assign(aChar); return *this;}
|
||||
|
||||
/**
|
||||
* Retrieve the size of this string
|
||||
* @return string length
|
||||
*/
|
||||
virtual void SizeOf(nsISizeOfHandler* aHandler, PRUint32* aResult) const;
|
||||
|
||||
char mBuffer[kDefaultStringSize];
|
||||
};
|
||||
|
||||
|
||||
/***************************************************************
|
||||
The subsumestr class is very unusual.
|
||||
It differs from a normal string in that it doesn't use normal
|
||||
copy semantics when another string is assign to this.
|
||||
Instead, it "steals" the contents of the source string.
|
||||
|
||||
This is very handy for returning nsString classes as part of
|
||||
an operator+(...) for example, in that it cuts down the number
|
||||
of copy operations that must occur.
|
||||
|
||||
You should probably not use this class unless you really know
|
||||
what you're doing.
|
||||
***************************************************************/
|
||||
class NS_COM nsSubsumeCStr : public nsCString {
|
||||
public:
|
||||
nsSubsumeCStr(nsStr& aString);
|
||||
nsSubsumeCStr(PRUnichar* aString,PRBool assumeOwnership,PRInt32 aLength=-1);
|
||||
nsSubsumeCStr(char* aString,PRBool assumeOwnership,PRInt32 aLength=-1);
|
||||
|
||||
};
|
||||
|
||||
|
||||
#endif
|
||||
|
||||
|
||||
2233
mozilla/string/obsolete/nsString2.cpp
Normal file
2233
mozilla/string/obsolete/nsString2.cpp
Normal file
File diff suppressed because it is too large
Load Diff
840
mozilla/string/obsolete/nsString2.h
Normal file
840
mozilla/string/obsolete/nsString2.h
Normal file
@@ -0,0 +1,840 @@
|
||||
/* -*- Mode: C++; tab-width: 2; indent-tabs-mode: nil; c-basic-offset: 2 -*- */
|
||||
/*
|
||||
* The contents of this file are subject to the Netscape Public License
|
||||
* Version 1.0 (the "NPL"); you may not use this file except in
|
||||
* compliance with the NPL. You may obtain a copy of the NPL at
|
||||
* http://www.mozilla.org/NPL/
|
||||
*
|
||||
* Software distributed under the NPL is distributed on an "AS IS" basis,
|
||||
* WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
|
||||
* for the specific language governing rights and limitations under the
|
||||
* NPL.
|
||||
*
|
||||
* The Initial Developer of this code under the NPL is Netscape
|
||||
* Communications Corporation. Portions created by Netscape are
|
||||
* Copyright (C) 1998 Netscape Communications Corporation. All Rights
|
||||
* Reserved.
|
||||
*/
|
||||
|
||||
|
||||
|
||||
/***********************************************************************
|
||||
MODULE NOTES:
|
||||
|
||||
See nsStr.h for a more general description of string classes.
|
||||
|
||||
This version of the nsString class offers many improvements over the
|
||||
original version:
|
||||
1. Wide and narrow chars
|
||||
2. Allocators
|
||||
3. Much smarter autostrings
|
||||
4. Subsumable strings
|
||||
***********************************************************************/
|
||||
|
||||
|
||||
#ifndef _nsString_
|
||||
#define _nsString_
|
||||
|
||||
#include "prtypes.h"
|
||||
#include "nscore.h"
|
||||
#include <stdio.h>
|
||||
#include "nsString.h"
|
||||
#include "nsIAtom.h"
|
||||
#include "nsStr.h"
|
||||
#include "nsCRT.h"
|
||||
|
||||
class nsISizeOfHandler;
|
||||
|
||||
|
||||
#define nsString2 nsString
|
||||
#define nsAutoString2 nsAutoString
|
||||
|
||||
|
||||
class NS_COM nsSubsumeStr;
|
||||
class NS_COM nsString : public nsStr {
|
||||
|
||||
public:
|
||||
|
||||
/**
|
||||
* Default constructor.
|
||||
*/
|
||||
nsString();
|
||||
|
||||
|
||||
/**
|
||||
* This constructor accepts an isolatin string
|
||||
* @param aCString is a ptr to a 1-byte cstr
|
||||
*/
|
||||
nsString(const char* aCString);
|
||||
|
||||
/**
|
||||
* This constructor accepts a unichar string
|
||||
* @param aCString is a ptr to a 2-byte cstr
|
||||
*/
|
||||
nsString(const PRUnichar* aString);
|
||||
|
||||
/**
|
||||
* This is a copy constructor that accepts an nsStr
|
||||
* @param reference to another nsString
|
||||
*/
|
||||
nsString(const nsStr&);
|
||||
|
||||
/**
|
||||
* This is our copy constructor
|
||||
* @param reference to another nsString
|
||||
*/
|
||||
nsString(const nsString& aString);
|
||||
|
||||
/**
|
||||
* This constructor takes a subsumestr
|
||||
* @param reference to subsumestr
|
||||
*/
|
||||
nsString(nsSubsumeStr& aSubsumeStr);
|
||||
|
||||
/**
|
||||
* Destructor
|
||||
*
|
||||
*/
|
||||
virtual ~nsString();
|
||||
|
||||
/**
|
||||
* Retrieve the length of this string
|
||||
* @return string length
|
||||
*/
|
||||
inline PRInt32 Length() const { return (PRInt32)mLength; }
|
||||
|
||||
/**
|
||||
* Retrieve the size of this string
|
||||
* @return string length
|
||||
*/
|
||||
virtual void SizeOf(nsISizeOfHandler* aHandler, PRUint32* aResult) const;
|
||||
|
||||
|
||||
/**
|
||||
* Call this method if you want to force a different string length
|
||||
* @update gess7/30/98
|
||||
* @param aLength -- contains new length for mStr
|
||||
* @return
|
||||
*/
|
||||
void SetLength(PRUint32 aLength) {
|
||||
Truncate(aLength);
|
||||
}
|
||||
|
||||
/**
|
||||
* Sets the new length of the string.
|
||||
* @param aLength is new string length.
|
||||
* @return nada
|
||||
*/
|
||||
void SetCapacity(PRUint32 aLength);
|
||||
|
||||
/**
|
||||
* This method truncates this string to given length.
|
||||
*
|
||||
* @param anIndex -- new length of string
|
||||
* @return nada
|
||||
*/
|
||||
void Truncate(PRInt32 anIndex=0);
|
||||
|
||||
|
||||
/**
|
||||
* Determine whether or not the characters in this
|
||||
* string are in sorted order.
|
||||
*
|
||||
* @return TRUE if ordered.
|
||||
*/
|
||||
PRBool IsOrdered(void) const;
|
||||
|
||||
/**
|
||||
* Determine whether or not the characters in this
|
||||
* string are in store as 1 or 2 byte (unicode) strings.
|
||||
*
|
||||
* @return TRUE if ordered.
|
||||
*/
|
||||
PRBool IsUnicode(void) const {
|
||||
PRBool result=PRBool(mCharSize==eTwoByte);
|
||||
return result;
|
||||
}
|
||||
|
||||
/**
|
||||
* Determine whether or not this string has a length of 0
|
||||
*
|
||||
* @return TRUE if empty.
|
||||
*/
|
||||
PRBool IsEmpty(void) const {
|
||||
return PRBool(0==mLength);
|
||||
}
|
||||
|
||||
/**********************************************************************
|
||||
Getters/Setters...
|
||||
*********************************************************************/
|
||||
|
||||
/**
|
||||
* Retrieve const ptr to internal buffer; DO NOT TRY TO FREE IT!
|
||||
*/
|
||||
const char* GetBuffer(void) const;
|
||||
const PRUnichar* GetUnicode(void) const;
|
||||
|
||||
|
||||
/**
|
||||
* Get nth character.
|
||||
*/
|
||||
PRUnichar operator[](PRUint32 anIndex) const;
|
||||
PRUnichar CharAt(PRUint32 anIndex) const;
|
||||
PRUnichar First(void) const;
|
||||
PRUnichar Last(void) const;
|
||||
|
||||
/**
|
||||
* Set nth character.
|
||||
*/
|
||||
PRBool SetCharAt(PRUnichar aChar,PRUint32 anIndex);
|
||||
|
||||
|
||||
/**********************************************************************
|
||||
String concatenation methods...
|
||||
*********************************************************************/
|
||||
|
||||
/**
|
||||
* Create a new string by appending given string to this
|
||||
* @param aString -- 2nd string to be appended
|
||||
* @return new subsumable string
|
||||
*/
|
||||
nsSubsumeStr operator+(const nsStr& aString);
|
||||
nsSubsumeStr operator+(const nsString& aString);
|
||||
|
||||
/**
|
||||
* create a new string by adding this to the given cstring
|
||||
* @param aCString is a ptr to cstring to be added to this
|
||||
* @return newly created string
|
||||
*/
|
||||
nsSubsumeStr operator+(const char* aCString);
|
||||
|
||||
/**
|
||||
* create a new string by adding this to the given prunichar*.
|
||||
* @param aString is a ptr to UC-string to be added to this
|
||||
* @return newly created string
|
||||
*/
|
||||
nsSubsumeStr operator+(const PRUnichar* aString);
|
||||
|
||||
/**
|
||||
* create a new string by adding this to the given char.
|
||||
* @param aChar is a char to be added to this
|
||||
* @return newly created string
|
||||
*/
|
||||
nsSubsumeStr operator+(char aChar);
|
||||
|
||||
/**
|
||||
* create a new string by adding this to the given char.
|
||||
* @param aChar is a unichar to be added to this
|
||||
* @return newly created string
|
||||
*/
|
||||
nsSubsumeStr operator+(PRUnichar aChar);
|
||||
|
||||
/**********************************************************************
|
||||
Lexomorphic transforms...
|
||||
*********************************************************************/
|
||||
|
||||
|
||||
/**
|
||||
* Converts chars in this to lowercase
|
||||
* @update gess 7/27/98
|
||||
*/
|
||||
void ToLowerCase();
|
||||
|
||||
|
||||
/**
|
||||
* Converts chars in this to lowercase, and
|
||||
* stores them in aOut
|
||||
* @update gess 7/27/98
|
||||
* @param aOut is a string to contain result
|
||||
*/
|
||||
void ToLowerCase(nsString& aString) const;
|
||||
|
||||
/**
|
||||
* Converts chars in this to uppercase
|
||||
* @update gess 7/27/98
|
||||
*/
|
||||
void ToUpperCase();
|
||||
|
||||
/**
|
||||
* Converts chars in this to lowercase, and
|
||||
* stores them in a given output string
|
||||
* @update gess 7/27/98
|
||||
* @param aOut is a string to contain result
|
||||
*/
|
||||
void ToUpperCase(nsString& aString) const;
|
||||
|
||||
|
||||
/**
|
||||
* This method is used to remove all occurances of the
|
||||
* characters found in aSet from this string.
|
||||
*
|
||||
* @param aSet -- characters to be cut from this
|
||||
* @return *this
|
||||
*/
|
||||
nsString& StripChars(const char* aSet);
|
||||
nsString& StripChar(char aChar);
|
||||
|
||||
/**
|
||||
* This method strips whitespace throughout the string
|
||||
*
|
||||
* @return this
|
||||
*/
|
||||
nsString& StripWhitespace();
|
||||
|
||||
/**
|
||||
* swaps occurence of 1 string for another
|
||||
*
|
||||
* @return this
|
||||
*/
|
||||
nsString& ReplaceChar(PRUnichar anOldChar,PRUnichar aNewChar);
|
||||
nsString& ReplaceChar(const char* aSet,PRUnichar aNewChar);
|
||||
|
||||
PRInt32 CountChar(PRUnichar aChar);
|
||||
|
||||
/**
|
||||
* This method trims characters found in aTrimSet from
|
||||
* either end of the underlying string.
|
||||
*
|
||||
* @param aTrimSet -- contains chars to be trimmed from
|
||||
* both ends
|
||||
* @return this
|
||||
*/
|
||||
nsString& Trim(const char* aSet,PRBool aEliminateLeading=PR_TRUE,PRBool aEliminateTrailing=PR_TRUE);
|
||||
|
||||
/**
|
||||
* This method strips whitespace from string.
|
||||
* You can control whether whitespace is yanked from
|
||||
* start and end of string as well.
|
||||
*
|
||||
* @param aEliminateLeading controls stripping of leading ws
|
||||
* @param aEliminateTrailing controls stripping of trailing ws
|
||||
* @return this
|
||||
*/
|
||||
nsString& CompressSet(const char* aSet, PRUnichar aChar,PRBool aEliminateLeading=PR_TRUE,PRBool aEliminateTrailing=PR_TRUE);
|
||||
|
||||
/**
|
||||
* This method strips whitespace from string.
|
||||
* You can control whether whitespace is yanked from
|
||||
* start and end of string as well.
|
||||
*
|
||||
* @param aEliminateLeading controls stripping of leading ws
|
||||
* @param aEliminateTrailing controls stripping of trailing ws
|
||||
* @return this
|
||||
*/
|
||||
nsString& CompressWhitespace( PRBool aEliminateLeading=PR_TRUE,PRBool aEliminateTrailing=PR_TRUE);
|
||||
|
||||
/**********************************************************************
|
||||
string conversion methods...
|
||||
*********************************************************************/
|
||||
|
||||
/**
|
||||
* This method constructs a new nsString is a clone of this string.
|
||||
*
|
||||
*/
|
||||
nsString* ToNewString() const;
|
||||
|
||||
/**
|
||||
* Creates an ISOLatin1 clone of this string
|
||||
* Note that calls to this method should be matched with calls to Recycle().
|
||||
* @return ptr to new isolatin1 string
|
||||
*/
|
||||
char* ToNewCString() const;
|
||||
|
||||
/**
|
||||
* Creates an UTF8 clone of this string
|
||||
* Note that calls to this method should be matched with calls to Recycle().
|
||||
* @return ptr to new isolatin1 string
|
||||
*/
|
||||
char* ToNewUTF8String() const;
|
||||
|
||||
/**
|
||||
* Creates a unicode clone of this string
|
||||
* Note that calls to this method should be matched with calls to Recycle().
|
||||
* @return ptr to new unicode string
|
||||
*/
|
||||
PRUnichar* ToNewUnicode() const;
|
||||
|
||||
/**
|
||||
* Copies data from internal buffer onto given char* buffer
|
||||
* NOTE: This only copies as many chars as will fit in given buffer (clips)
|
||||
* @param aBuf is the buffer where data is stored
|
||||
* @param aBuflength is the max # of chars to move to buffer
|
||||
* @return ptr to given buffer
|
||||
*/
|
||||
char* ToCString(char* aBuf,PRUint32 aBufLength,PRUint32 anOffset=0) const;
|
||||
|
||||
/**
|
||||
* Perform string to float conversion.
|
||||
* @param aErrorCode will contain error if one occurs
|
||||
* @return float rep of string value
|
||||
*/
|
||||
float ToFloat(PRInt32* aErrorCode) const;
|
||||
|
||||
/**
|
||||
* Try to derive the radix from the value contained in this string
|
||||
* @return kRadix10, kRadix16 or kAutoDetect (meaning unknown)
|
||||
*/
|
||||
PRUint32 DetermineRadix(void);
|
||||
|
||||
/**
|
||||
* Perform string to int conversion.
|
||||
* @param aErrorCode will contain error if one occurs
|
||||
* @return int rep of string value
|
||||
*/
|
||||
PRInt32 ToInteger(PRInt32* aErrorCode,PRUint32 aRadix=kRadix10) const;
|
||||
|
||||
|
||||
/**********************************************************************
|
||||
String manipulation methods...
|
||||
*********************************************************************/
|
||||
|
||||
/**
|
||||
* Functionally equivalent to assign or operator=
|
||||
*
|
||||
*/
|
||||
nsString& SetString(const char* aString,PRInt32 aLength=-1) {return Assign(aString,aLength);}
|
||||
nsString& SetString(const PRUnichar* aString,PRInt32 aLength=-1) {return Assign(aString,aLength);}
|
||||
nsString& SetString(const nsString& aString,PRInt32 aLength=-1) {return Assign(aString,aLength);}
|
||||
|
||||
/**
|
||||
* assign given string to this string
|
||||
* @param aStr: buffer to be assigned to this
|
||||
* @param alength is the length of the given str (or -1)
|
||||
if you want me to determine its length
|
||||
* @return this
|
||||
*/
|
||||
nsString& Assign(const nsStr& aString,PRInt32 aCount=-1);
|
||||
nsString& Assign(const char* aString,PRInt32 aCount=-1);
|
||||
nsString& Assign(const PRUnichar* aString,PRInt32 aCount=-1);
|
||||
nsString& Assign(char aChar);
|
||||
nsString& Assign(PRUnichar aChar);
|
||||
|
||||
/**
|
||||
* here come a bunch of assignment operators...
|
||||
* @param aString: string to be added to this
|
||||
* @return this
|
||||
*/
|
||||
nsString& operator=(const nsString& aString) {return Assign(aString);}
|
||||
nsString& operator=(const nsStr& aString) {return Assign(aString);}
|
||||
nsString& operator=(char aChar) {return Assign(aChar);}
|
||||
nsString& operator=(PRUnichar aChar) {return Assign(aChar);}
|
||||
nsString& operator=(const char* aCString) {return Assign(aCString);}
|
||||
nsString& operator=(const PRUnichar* aString) {return Assign(aString);}
|
||||
#ifdef AIX
|
||||
nsString& operator=(const nsSubsumeStr& aSubsumeString); // AIX requires a const here
|
||||
#else
|
||||
nsString& operator=(nsSubsumeStr& aSubsumeString);
|
||||
#endif
|
||||
|
||||
/**
|
||||
* Here's a bunch of methods that append varying types...
|
||||
* @param various...
|
||||
* @return this
|
||||
*/
|
||||
nsString& operator+=(const nsStr& aString){return Append(aString,aString.mLength);}
|
||||
nsString& operator+=(const nsString& aString){return Append(aString,aString.mLength);}
|
||||
nsString& operator+=(const char* aCString) {return Append(aCString);}
|
||||
//nsString& operator+=(char aChar){return Append(aChar);}
|
||||
nsString& operator+=(const PRUnichar* aUCString) {return Append(aUCString);}
|
||||
nsString& operator+=(PRUnichar aChar){return Append(aChar);}
|
||||
|
||||
/*
|
||||
* Appends n characters from given string to this,
|
||||
* This version computes the length of your given string
|
||||
*
|
||||
* @param aString is the source to be appended to this
|
||||
* @return number of chars copied
|
||||
*/
|
||||
nsString& Append(const nsStr& aString) {return Append(aString,aString.mLength);}
|
||||
nsString& Append(const nsString& aString) {return Append(aString,aString.mLength);}
|
||||
|
||||
|
||||
/*
|
||||
* Appends n characters from given string to this,
|
||||
*
|
||||
* @param aString is the source to be appended to this
|
||||
* @param aCount -- number of chars to copy; -1 tells us to compute the strlen for you
|
||||
* @return number of chars copied
|
||||
*/
|
||||
nsString& Append(const nsStr& aString,PRInt32 aCount);
|
||||
nsString& Append(const nsString& aString,PRInt32 aCount);
|
||||
nsString& Append(const char* aString,PRInt32 aCount=-1);
|
||||
nsString& Append(const PRUnichar* aString,PRInt32 aCount=-1);
|
||||
nsString& Append(char aChar);
|
||||
nsString& Append(PRUnichar aChar);
|
||||
nsString& Append(PRInt32 aInteger,PRInt32 aRadix=10); //radix=8,10 or 16
|
||||
nsString& Append(float aFloat);
|
||||
|
||||
/*
|
||||
* Copies n characters from this string to given string,
|
||||
* starting at the leftmost offset.
|
||||
*
|
||||
*
|
||||
* @param aCopy -- Receiving string
|
||||
* @param aCount -- number of chars to copy
|
||||
* @return number of chars copied
|
||||
*/
|
||||
PRUint32 Left(nsString& aCopy,PRInt32 aCount) const;
|
||||
|
||||
/*
|
||||
* Copies n characters from this string to given string,
|
||||
* starting at the given offset.
|
||||
*
|
||||
*
|
||||
* @param aCopy -- Receiving string
|
||||
* @param aCount -- number of chars to copy
|
||||
* @param anOffset -- position where copying begins
|
||||
* @return number of chars copied
|
||||
*/
|
||||
PRUint32 Mid(nsString& aCopy,PRUint32 anOffset,PRInt32 aCount) const;
|
||||
|
||||
/*
|
||||
* Copies n characters from this string to given string,
|
||||
* starting at rightmost char.
|
||||
*
|
||||
*
|
||||
* @param aCopy -- Receiving string
|
||||
* @param aCount -- number of chars to copy
|
||||
* @return number of chars copied
|
||||
*/
|
||||
PRUint32 Right(nsString& aCopy,PRInt32 aCount) const;
|
||||
|
||||
/*
|
||||
* This method inserts n chars from given string into this
|
||||
* string at str[anOffset].
|
||||
*
|
||||
* @param aCopy -- String to be inserted into this
|
||||
* @param anOffset -- insertion position within this str
|
||||
* @param aCount -- number of chars to be copied from aCopy
|
||||
* @return number of chars inserted into this.
|
||||
*/
|
||||
nsString& Insert(const nsString& aCopy,PRUint32 anOffset,PRInt32 aCount=-1);
|
||||
|
||||
/**
|
||||
* Insert a given string into this string at
|
||||
* a specified offset.
|
||||
*
|
||||
* @param aString* to be inserted into this string
|
||||
* @param anOffset is insert pos in str
|
||||
* @return the number of chars inserted into this string
|
||||
*/
|
||||
nsString& Insert(const char* aChar,PRUint32 anOffset,PRInt32 aCount=-1);
|
||||
nsString& Insert(const PRUnichar* aChar,PRUint32 anOffset,PRInt32 aCount=-1);
|
||||
|
||||
/**
|
||||
* Insert a single char into this string at
|
||||
* a specified offset.
|
||||
*
|
||||
* @param character to be inserted into this string
|
||||
* @param anOffset is insert pos in str
|
||||
* @return the number of chars inserted into this string
|
||||
*/
|
||||
//nsString& Insert(char aChar,PRUint32 anOffset);
|
||||
nsString& Insert(PRUnichar aChar,PRUint32 anOffset);
|
||||
|
||||
/*
|
||||
* This method is used to cut characters in this string
|
||||
* starting at anOffset, continuing for aCount chars.
|
||||
*
|
||||
* @param anOffset -- start pos for cut operation
|
||||
* @param aCount -- number of chars to be cut
|
||||
* @return *this
|
||||
*/
|
||||
nsString& Cut(PRUint32 anOffset,PRInt32 aCount);
|
||||
|
||||
|
||||
/**********************************************************************
|
||||
Searching methods...
|
||||
*********************************************************************/
|
||||
|
||||
/**
|
||||
* Search for given character within this string.
|
||||
* This method does so by using a binary search,
|
||||
* so your string HAD BETTER BE ORDERED!
|
||||
*
|
||||
* @param aChar is the unicode char to be found
|
||||
* @return offset in string, or -1 (kNotFound)
|
||||
*/
|
||||
PRInt32 BinarySearch(PRUnichar aChar) const;
|
||||
|
||||
/**
|
||||
* Search for given substring within this string
|
||||
*
|
||||
* @param aString is substring to be sought in this
|
||||
* @param aIgnoreCase selects case sensitivity
|
||||
* @param anOffset tells us where in this strig to start searching
|
||||
* @return offset in string, or -1 (kNotFound)
|
||||
*/
|
||||
PRInt32 Find(const nsString& aString,PRBool aIgnoreCase=PR_FALSE,PRInt32 anOffset=-1) const;
|
||||
PRInt32 Find(const nsStr& aString,PRBool aIgnoreCase=PR_FALSE,PRInt32 anOffset=-1) const;
|
||||
PRInt32 Find(const char* aString,PRBool aIgnoreCase=PR_FALSE,PRInt32 anOffset=-1) const;
|
||||
PRInt32 Find(const PRUnichar* aString,PRBool aIgnoreCase=PR_FALSE,PRInt32 anOffset=-1) const;
|
||||
|
||||
|
||||
/**
|
||||
* Search for given char within this string
|
||||
*
|
||||
* @param aString is substring to be sought in this
|
||||
* @param anOffset tells us where in this strig to start searching
|
||||
* @param aIgnoreCase selects case sensitivity
|
||||
* @return find pos in string, or -1 (kNotFound)
|
||||
*/
|
||||
//PRInt32 Find(PRUnichar aChar,PRInt32 offset=-1,PRBool aIgnoreCase=PR_FALSE) const;
|
||||
PRInt32 FindChar(PRUnichar aChar,PRBool aIgnoreCase=PR_FALSE,PRInt32 anOffset=-1) const;
|
||||
|
||||
/**
|
||||
* This method searches this string for the first character
|
||||
* found in the given charset
|
||||
* @param aString contains set of chars to be found
|
||||
* @param anOffset tells us where to start searching in this
|
||||
* @return -1 if not found, else the offset in this
|
||||
*/
|
||||
PRInt32 FindCharInSet(const char* aString,PRInt32 anOffset=-1) const;
|
||||
PRInt32 FindCharInSet(const PRUnichar* aString,PRInt32 anOffset=-1) const;
|
||||
PRInt32 FindCharInSet(const nsStr& aString,PRInt32 anOffset=-1) const;
|
||||
|
||||
|
||||
/**
|
||||
* This methods scans the string backwards, looking for the given string
|
||||
* @param aString is substring to be sought in this
|
||||
* @param aIgnoreCase tells us whether or not to do caseless compare
|
||||
* @param anOffset tells us where in this strig to start searching (counting from left)
|
||||
*/
|
||||
PRInt32 RFind(const char* aCString,PRBool aIgnoreCase=PR_FALSE,PRInt32 anOffset=-1) const;
|
||||
PRInt32 RFind(const nsString& aString,PRBool aIgnoreCase=PR_FALSE,PRInt32 anOffset=-1) const;
|
||||
PRInt32 RFind(const nsStr& aString,PRBool aIgnoreCase=PR_FALSE,PRInt32 anOffset=-1) const;
|
||||
PRInt32 RFind(const PRUnichar* aString,PRBool aIgnoreCase=PR_FALSE,PRInt32 anOffset=-1) const;
|
||||
|
||||
|
||||
/**
|
||||
* Search for given char within this string
|
||||
*
|
||||
* @param aString is substring to be sought in this
|
||||
* @param anOffset tells us where in this strig to start searching (counting from left)
|
||||
* @param aIgnoreCase selects case sensitivity
|
||||
* @return find pos in string, or -1 (kNotFound)
|
||||
*/
|
||||
//PRInt32 RFind(PRUnichar aChar,PRInt32 offset=-1,PRBool aIgnoreCase=PR_FALSE) const;
|
||||
PRInt32 RFindChar(PRUnichar aChar,PRBool aIgnoreCase=PR_FALSE,PRInt32 anOffset=-1) const;
|
||||
|
||||
/**
|
||||
* This method searches this string for the last character
|
||||
* found in the given string
|
||||
* @param aString contains set of chars to be found
|
||||
* @param anOffset tells us where in this strig to start searching (counting from left)
|
||||
* @return -1 if not found, else the offset in this
|
||||
*/
|
||||
PRInt32 RFindCharInSet(const char* aString,PRInt32 anOffset=-1) const;
|
||||
PRInt32 RFindCharInSet(const PRUnichar* aString,PRInt32 anOffset=-1) const;
|
||||
PRInt32 RFindCharInSet(const nsStr& aString,PRInt32 anOffset=-1) const;
|
||||
|
||||
|
||||
/**********************************************************************
|
||||
Comparison methods...
|
||||
*********************************************************************/
|
||||
|
||||
/**
|
||||
* Compares a given string type to this string.
|
||||
* @update gess 7/27/98
|
||||
* @param S is the string to be compared
|
||||
* @param aIgnoreCase tells us how to treat case
|
||||
* @param aCount tells us how many chars to compare
|
||||
* @return -1,0,1
|
||||
*/
|
||||
virtual PRInt32 Compare(const nsString& aString,PRBool aIgnoreCase=PR_FALSE,PRInt32 aCount=-1) const;
|
||||
virtual PRInt32 Compare(const nsStr &aString,PRBool aIgnoreCase=PR_FALSE,PRInt32 aCount=-1) const;
|
||||
virtual PRInt32 Compare(const char* aString,PRBool aIgnoreCase=PR_FALSE,PRInt32 aCount=-1) const;
|
||||
virtual PRInt32 Compare(const PRUnichar* aString,PRBool aIgnoreCase=PR_FALSE,PRInt32 aCount=-1) const;
|
||||
|
||||
/**
|
||||
* These methods compare a given string type to this one
|
||||
* @param aString is the string to be compared to this
|
||||
* @return TRUE or FALSE
|
||||
*/
|
||||
PRBool operator==(const nsString &aString) const;
|
||||
PRBool operator==(const nsStr &aString) const;
|
||||
PRBool operator==(const char *aString) const;
|
||||
PRBool operator==(const PRUnichar* aString) const;
|
||||
|
||||
/**
|
||||
* These methods perform a !compare of a given string type to this
|
||||
* @param aString is the string to be compared to this
|
||||
* @return TRUE
|
||||
*/
|
||||
PRBool operator!=(const nsString &aString) const;
|
||||
PRBool operator!=(const nsStr &aString) const;
|
||||
PRBool operator!=(const char* aString) const;
|
||||
PRBool operator!=(const PRUnichar* aString) const;
|
||||
|
||||
/**
|
||||
* These methods test if a given string is < than this
|
||||
* @param aString is the string to be compared to this
|
||||
* @return TRUE or FALSE
|
||||
*/
|
||||
PRBool operator<(const nsString &aString) const;
|
||||
PRBool operator<(const nsStr &aString) const;
|
||||
PRBool operator<(const char* aString) const;
|
||||
PRBool operator<(const PRUnichar* aString) const;
|
||||
|
||||
/**
|
||||
* These methods test if a given string is > than this
|
||||
* @param aString is the string to be compared to this
|
||||
* @return TRUE or FALSE
|
||||
*/
|
||||
PRBool operator>(const nsString &aString) const;
|
||||
PRBool operator>(const nsStr &S) const;
|
||||
PRBool operator>(const char* aString) const;
|
||||
PRBool operator>(const PRUnichar* aString) const;
|
||||
|
||||
/**
|
||||
* These methods test if a given string is <= than this
|
||||
* @param aString is the string to be compared to this
|
||||
* @return TRUE or FALSE
|
||||
*/
|
||||
PRBool operator<=(const nsString &aString) const;
|
||||
PRBool operator<=(const nsStr &S) const;
|
||||
PRBool operator<=(const char* aString) const;
|
||||
PRBool operator<=(const PRUnichar* aString) const;
|
||||
|
||||
/**
|
||||
* These methods test if a given string is >= than this
|
||||
* @param aString is the string to be compared to this
|
||||
* @return TRUE or FALSE
|
||||
*/
|
||||
PRBool operator>=(const nsString &aString) const;
|
||||
PRBool operator>=(const nsStr &S) const;
|
||||
PRBool operator>=(const char* aString) const;
|
||||
PRBool operator>=(const PRUnichar* aString) const;
|
||||
|
||||
/**
|
||||
* Compare this to given string; note that we compare full strings here.
|
||||
* The optional length argument just lets us know how long the given string is.
|
||||
* If you provide a length, it is compared to length of this string as an
|
||||
* optimization.
|
||||
*
|
||||
* @param aString -- the string to compare to this
|
||||
* @param aCount -- number of chars to be compared.
|
||||
* @return TRUE if equal
|
||||
*/
|
||||
PRBool Equals(const nsString &aString,PRBool aIgnoreCase=PR_FALSE,PRInt32 aCount=-1) const;
|
||||
PRBool Equals(const nsStr& aString,PRBool aIgnoreCase=PR_FALSE,PRInt32 aCount=-1) const;
|
||||
PRBool Equals(const char* aString,PRBool aIgnoreCase=PR_FALSE,PRInt32 aCount=-1) const;
|
||||
PRBool Equals(const PRUnichar* aString,PRBool aIgnoreCase=PR_FALSE,PRInt32 aCount=-1) const;
|
||||
PRBool Equals(/*FIX: const */nsIAtom* anAtom,PRBool aIgnoreCase) const;
|
||||
PRBool Equals(const PRUnichar* s1, const PRUnichar* s2,PRBool aIgnoreCase=PR_FALSE) const;
|
||||
|
||||
PRBool EqualsIgnoreCase(const nsString& aString) const;
|
||||
PRBool EqualsIgnoreCase(const char* aString,PRInt32 aCount=-1) const;
|
||||
PRBool EqualsIgnoreCase(/*FIX: const */nsIAtom *aAtom) const;
|
||||
PRBool EqualsIgnoreCase(const PRUnichar* s1, const PRUnichar* s2) const;
|
||||
|
||||
/**
|
||||
* Determine if given buffer is plain ascii
|
||||
*
|
||||
* @param aBuffer -- if null, then we test *this, otherwise we test given buffer
|
||||
* @return TRUE if is all ascii chars or if strlen==0
|
||||
*/
|
||||
PRBool IsASCII(const PRUnichar* aBuffer=0);
|
||||
|
||||
|
||||
/**
|
||||
* Determine if given char is a valid space character
|
||||
*
|
||||
* @param aChar is character to be tested
|
||||
* @return TRUE if is valid space char
|
||||
*/
|
||||
static PRBool IsSpace(PRUnichar ch);
|
||||
|
||||
/**
|
||||
* Determine if given char in valid alpha range
|
||||
*
|
||||
* @param aChar is character to be tested
|
||||
* @return TRUE if in alpha range
|
||||
*/
|
||||
static PRBool IsAlpha(PRUnichar ch);
|
||||
|
||||
/**
|
||||
* Determine if given char is valid digit
|
||||
*
|
||||
* @param aChar is character to be tested
|
||||
* @return TRUE if char is a valid digit
|
||||
*/
|
||||
static PRBool IsDigit(PRUnichar ch);
|
||||
|
||||
static void Recycle(nsString* aString);
|
||||
static nsString* CreateString(void);
|
||||
|
||||
};
|
||||
|
||||
extern NS_COM int fputs(const nsString& aString, FILE* out);
|
||||
//ostream& operator<<(ostream& aStream,const nsString& aString);
|
||||
//virtual void DebugDump(ostream& aStream) const;
|
||||
|
||||
|
||||
/**************************************************************
|
||||
Here comes the AutoString class which uses internal memory
|
||||
(typically found on the stack) for its default buffer.
|
||||
If the buffer needs to grow, it gets reallocated on the heap.
|
||||
**************************************************************/
|
||||
|
||||
class NS_COM nsAutoString : public nsString {
|
||||
public:
|
||||
|
||||
nsAutoString();
|
||||
nsAutoString(const char* aCString,PRInt32 aLength=-1);
|
||||
nsAutoString(const PRUnichar* aString,PRInt32 aLength=-1);
|
||||
|
||||
nsAutoString(const CBufDescriptor& aBuffer);
|
||||
nsAutoString(const nsStr& aString);
|
||||
nsAutoString(const nsAutoString& aString);
|
||||
#ifdef AIX
|
||||
nsAutoString(const nsSubsumeStr& aSubsumeStr); // AIX requires a const
|
||||
#else
|
||||
nsAutoString(nsSubsumeStr& aSubsumeStr);
|
||||
#endif // AIX
|
||||
nsAutoString(PRUnichar aChar);
|
||||
virtual ~nsAutoString();
|
||||
|
||||
nsAutoString& operator=(const nsStr& aString) {nsString::Assign(aString); return *this;}
|
||||
nsAutoString& operator=(const nsAutoString& aString) {nsString::Assign(aString); return *this;}
|
||||
nsAutoString& operator=(const char* aCString) {nsString::Assign(aCString); return *this;}
|
||||
nsAutoString& operator=(char aChar) {nsString::Assign(aChar); return *this;}
|
||||
nsAutoString& operator=(const PRUnichar* aBuffer) {nsString::Assign(aBuffer); return *this;}
|
||||
nsAutoString& operator=(PRUnichar aChar) {nsString::Assign(aChar); return *this;}
|
||||
|
||||
/**
|
||||
* Retrieve the size of this string
|
||||
* @return string length
|
||||
*/
|
||||
virtual void SizeOf(nsISizeOfHandler* aHandler, PRUint32* aResult) const;
|
||||
|
||||
char mBuffer[kDefaultStringSize<<eTwoByte];
|
||||
};
|
||||
|
||||
|
||||
|
||||
/***************************************************************
|
||||
The subsumestr class is very unusual.
|
||||
It differs from a normal string in that it doesn't use normal
|
||||
copy semantics when another string is assign to this.
|
||||
Instead, it "steals" the contents of the source string.
|
||||
|
||||
This is very handy for returning nsString classes as part of
|
||||
an operator+(...) for example, in that it cuts down the number
|
||||
of copy operations that must occur.
|
||||
|
||||
You should probably not use this class unless you really know
|
||||
what you're doing.
|
||||
***************************************************************/
|
||||
class NS_COM nsSubsumeStr : public nsString {
|
||||
public:
|
||||
nsSubsumeStr(nsStr& aString);
|
||||
nsSubsumeStr(PRUnichar* aString,PRBool assumeOwnership,PRInt32 aLength=-1);
|
||||
nsSubsumeStr(char* aString,PRBool assumeOwnership,PRInt32 aLength=-1);
|
||||
};
|
||||
|
||||
|
||||
|
||||
#endif
|
||||
|
||||
|
||||
179
mozilla/string/obsolete/nsXPIDLString.cpp
Normal file
179
mozilla/string/obsolete/nsXPIDLString.cpp
Normal file
@@ -0,0 +1,179 @@
|
||||
/* -*- Mode: C++; tab-width: 4; indent-tabs-mode: nil; c-basic-offset: 4 -*-
|
||||
*
|
||||
* The contents of this file are subject to the Netscape Public License
|
||||
* Version 1.0 (the "NPL"); you may not use this file except in
|
||||
* compliance with the NPL. You may obtain a copy of the NPL at
|
||||
* http://www.mozilla.org/NPL/
|
||||
*
|
||||
* Software distributed under the NPL is distributed on an "AS IS" basis,
|
||||
* WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
|
||||
* for the specific language governing rights and limitations under the
|
||||
* NPL.
|
||||
*
|
||||
* The Initial Developer of this code under the NPL is Netscape
|
||||
* Communications Corporation. Portions created by Netscape are
|
||||
* Copyright (C) 1998 Netscape Communications Corporation. All Rights
|
||||
* Reserved.
|
||||
*/
|
||||
|
||||
#include "nsDebug.h"
|
||||
#include "nsIAllocator.h"
|
||||
#include "nsXPIDLString.h"
|
||||
#include "plstr.h"
|
||||
|
||||
// If the allocator changes, fix it here.
|
||||
#define XPIDL_STRING_ALLOC(__len) ((PRUnichar*) nsAllocator::Alloc((__len) * sizeof(PRUnichar)))
|
||||
#define XPIDL_CSTRING_ALLOC(__len) ((char*) nsAllocator::Alloc((__len) * sizeof(char)))
|
||||
#define XPIDL_FREE(__ptr) (nsAllocator::Free(__ptr))
|
||||
|
||||
////////////////////////////////////////////////////////////////////////
|
||||
// nsXPIDLString
|
||||
|
||||
nsXPIDLString::nsXPIDLString()
|
||||
: mBuf(0),
|
||||
mBufOwner(PR_FALSE)
|
||||
{
|
||||
}
|
||||
|
||||
|
||||
nsXPIDLString::~nsXPIDLString()
|
||||
{
|
||||
if (mBufOwner && mBuf)
|
||||
XPIDL_FREE(mBuf);
|
||||
}
|
||||
|
||||
|
||||
nsXPIDLString::operator const PRUnichar*()
|
||||
{
|
||||
return mBuf;
|
||||
}
|
||||
|
||||
|
||||
PRUnichar*
|
||||
nsXPIDLString::Copy(const PRUnichar* aString)
|
||||
{
|
||||
NS_ASSERTION(aString, "null ptr");
|
||||
if (! aString)
|
||||
return 0;
|
||||
|
||||
PRInt32 len = 0;
|
||||
|
||||
{
|
||||
const PRUnichar* p = aString;
|
||||
while (*p++)
|
||||
len++;
|
||||
}
|
||||
|
||||
PRUnichar* result = XPIDL_STRING_ALLOC(len + 1);
|
||||
if (result) {
|
||||
PRUnichar* q = result;
|
||||
while (*aString) {
|
||||
*q = *aString;
|
||||
q++;
|
||||
aString++;
|
||||
}
|
||||
*q = '\0';
|
||||
}
|
||||
return result;
|
||||
}
|
||||
|
||||
|
||||
PRUnichar**
|
||||
nsXPIDLString::StartAssignmentByValue()
|
||||
{
|
||||
if (mBufOwner && mBuf)
|
||||
XPIDL_FREE(mBuf);
|
||||
|
||||
mBuf = 0;
|
||||
mBufOwner = PR_TRUE;
|
||||
return &mBuf;
|
||||
}
|
||||
|
||||
|
||||
const PRUnichar**
|
||||
nsXPIDLString::StartAssignmentByReference()
|
||||
{
|
||||
if (mBufOwner && mBuf)
|
||||
XPIDL_FREE(mBuf);
|
||||
|
||||
mBuf = 0;
|
||||
mBufOwner = PR_FALSE;
|
||||
return (const PRUnichar**) &mBuf;
|
||||
}
|
||||
|
||||
|
||||
////////////////////////////////////////////////////////////////////////
|
||||
// nsXPIDLCString
|
||||
|
||||
nsXPIDLCString::nsXPIDLCString()
|
||||
: mBuf(0),
|
||||
mBufOwner(PR_FALSE)
|
||||
{
|
||||
}
|
||||
|
||||
|
||||
nsXPIDLCString::~nsXPIDLCString()
|
||||
{
|
||||
if (mBufOwner && mBuf)
|
||||
XPIDL_FREE(mBuf);
|
||||
}
|
||||
|
||||
|
||||
nsXPIDLCString& nsXPIDLCString::operator =(const char* aCString)
|
||||
{
|
||||
if (mBufOwner && mBuf)
|
||||
XPIDL_FREE(mBuf);
|
||||
|
||||
mBuf = Copy(aCString);
|
||||
mBufOwner = PR_TRUE;
|
||||
|
||||
return *this;
|
||||
}
|
||||
|
||||
|
||||
nsXPIDLCString::operator const char*()
|
||||
{
|
||||
return mBuf;
|
||||
}
|
||||
|
||||
|
||||
char*
|
||||
nsXPIDLCString::Copy(const char* aCString)
|
||||
{
|
||||
NS_ASSERTION(aCString, "null ptr");
|
||||
if (! aCString)
|
||||
return 0;
|
||||
|
||||
PRInt32 len = PL_strlen(aCString);
|
||||
char* result = XPIDL_CSTRING_ALLOC(len + 1);
|
||||
if (result)
|
||||
PL_strcpy(result, aCString);
|
||||
|
||||
return result;
|
||||
}
|
||||
|
||||
|
||||
char**
|
||||
nsXPIDLCString::StartAssignmentByValue()
|
||||
{
|
||||
if (mBufOwner && mBuf)
|
||||
XPIDL_FREE(mBuf);
|
||||
|
||||
mBuf = 0;
|
||||
mBufOwner = PR_TRUE;
|
||||
return &mBuf;
|
||||
}
|
||||
|
||||
|
||||
const char**
|
||||
nsXPIDLCString::StartAssignmentByReference()
|
||||
{
|
||||
if (mBufOwner && mBuf)
|
||||
XPIDL_FREE(mBuf);
|
||||
|
||||
mBuf = 0;
|
||||
mBufOwner = PR_FALSE;
|
||||
return (const char**) &mBuf;
|
||||
}
|
||||
|
||||
|
||||
302
mozilla/string/obsolete/nsXPIDLString.h
Normal file
302
mozilla/string/obsolete/nsXPIDLString.h
Normal file
@@ -0,0 +1,302 @@
|
||||
/* -*- Mode: C++; tab-width: 4; indent-tabs-mode: nil; c-basic-offset: 4 -*-
|
||||
*
|
||||
* The contents of this file are subject to the Netscape Public License
|
||||
* Version 1.0 (the "NPL"); you may not use this file except in
|
||||
* compliance with the NPL. You may obtain a copy of the NPL at
|
||||
* http://www.mozilla.org/NPL/
|
||||
*
|
||||
* Software distributed under the NPL is distributed on an "AS IS" basis,
|
||||
* WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
|
||||
* for the specific language governing rights and limitations under the
|
||||
* NPL.
|
||||
*
|
||||
* The Initial Developer of this code under the NPL is Netscape
|
||||
* Communications Corporation. Portions created by Netscape are
|
||||
* Copyright (C) 1998 Netscape Communications Corporation. All Rights
|
||||
* Reserved.
|
||||
*/
|
||||
|
||||
/*
|
||||
|
||||
A set of string wrapper classes that ease transition to use of XPIDL
|
||||
interfaces. nsXPIDLString and nsXPIDLCString are to XPIDL `wstring'
|
||||
and `string' out params as nsCOMPtr is to generic XPCOM interface
|
||||
pointers. They help you deal with object ownership.
|
||||
|
||||
Consider the following interface:
|
||||
|
||||
interface nsIFoo {
|
||||
attribute string Bar;
|
||||
};
|
||||
|
||||
This will generate the following C++ header file:
|
||||
|
||||
class nsIFoo {
|
||||
NS_IMETHOD SetBar(const PRUnichar* aValue);
|
||||
NS_IMETHOD GetBar(PRUnichar* *aValue);
|
||||
};
|
||||
|
||||
The GetBar() method will allocate a copy of the nsIFoo object's
|
||||
"bar" attribute, and leave you to deal with freeing it:
|
||||
|
||||
nsIFoo* aFoo; // assume we get this somehow
|
||||
PRUnichar* bar;
|
||||
aFoo->GetFoo(&bar);
|
||||
// Use bar here...
|
||||
printf("bar is %s!\n", bar);
|
||||
nsAllocator::Free(bar);
|
||||
|
||||
This makes your life harder, because you need to convolute your code
|
||||
to ensure that you don't leak `bar'.
|
||||
|
||||
Enter nsXPIDLString, which manages the ownership of the allocated
|
||||
string, and automatically destroys it when the nsXPIDLString goes
|
||||
out of scope:
|
||||
|
||||
nsIFoo* aFoo;
|
||||
nsXPIDLString bar;
|
||||
aFoo->GetFoo( getter_Copies(bar) );
|
||||
// Use bar here...
|
||||
printf("bar is %s!\n", (const char*) bar);
|
||||
// no need to remember to nsAllocator::Free().
|
||||
|
||||
Like nsCOMPtr, nsXPIDLString uses some syntactic sugar to make it
|
||||
painfully clear exactly what the code expects. You need to wrap an
|
||||
nsXPIDLString object with either `getter_Copies()' or
|
||||
`getter_Shares()' before passing it to a getter: these tell the
|
||||
nsXPIDLString how ownership is being handled.
|
||||
|
||||
In the case of `getter_Copies()', the callee is allocating a copy
|
||||
(which is usually the case). In the case of `getter_Shares()', the
|
||||
callee is returning a const reference to `the real deal' (this can
|
||||
be done using the [shared] attribute in XPIDL).
|
||||
|
||||
*/
|
||||
|
||||
#ifndef nsXPIDLString_h__
|
||||
#define nsXPIDLString_h__
|
||||
|
||||
#include "nsCom.h"
|
||||
#include "prtypes.h"
|
||||
|
||||
#ifndef __PRUNICHAR__
|
||||
#define __PRUNICHAR__
|
||||
typedef PRUint16 PRUnichar;
|
||||
#endif /* __PRUNICHAR__ */
|
||||
|
||||
////////////////////////////////////////////////////////////////////////
|
||||
// nsXPIDLString
|
||||
//
|
||||
// A wrapper for Unicode strings. With the |getter_Copies()| and
|
||||
// |getter_Shares()| helper functions, this can be used instead of
|
||||
// the "naked" |PRUnichar*| interface for |wstring| parameters in
|
||||
// XPIDL interfaces.
|
||||
//
|
||||
|
||||
class NS_COM nsXPIDLString {
|
||||
private:
|
||||
PRUnichar* mBuf;
|
||||
PRBool mBufOwner;
|
||||
|
||||
PRUnichar** StartAssignmentByValue();
|
||||
const PRUnichar** StartAssignmentByReference();
|
||||
|
||||
public:
|
||||
/**
|
||||
* Construct a new, uninitialized wrapper for a Unicode string.
|
||||
*/
|
||||
nsXPIDLString();
|
||||
|
||||
virtual ~nsXPIDLString();
|
||||
|
||||
/**
|
||||
* Return a reference to the immutable Unicode string.
|
||||
*/
|
||||
operator const PRUnichar*();
|
||||
|
||||
/**
|
||||
* Make a copy of the Unicode string. Use this function in the
|
||||
* callee to ensure that the correct memory allocator is used.
|
||||
*/
|
||||
static PRUnichar* Copy(const PRUnichar* aString);
|
||||
|
||||
// A helper class for assignment-by-value. This class is an
|
||||
// implementation detail and should not be considered part of the
|
||||
// public interface.
|
||||
class NS_COM GetterCopies {
|
||||
private:
|
||||
nsXPIDLString& mXPIDLString;
|
||||
|
||||
public:
|
||||
GetterCopies(nsXPIDLString& aXPIDLString)
|
||||
: mXPIDLString(aXPIDLString) {}
|
||||
|
||||
operator PRUnichar**() {
|
||||
return mXPIDLString.StartAssignmentByValue();
|
||||
}
|
||||
|
||||
friend GetterCopies getter_Copies(nsXPIDLString& aXPIDLString);
|
||||
};
|
||||
|
||||
friend class GetterCopies;
|
||||
|
||||
// A helper class for assignment-by-reference. This class is an
|
||||
// implementation detail and should not be considered part of the
|
||||
// public interface.
|
||||
class NS_COM GetterShares {
|
||||
private:
|
||||
nsXPIDLString& mXPIDLString;
|
||||
|
||||
public:
|
||||
GetterShares(nsXPIDLString& aXPIDLString)
|
||||
: mXPIDLString(aXPIDLString) {}
|
||||
|
||||
operator const PRUnichar**() {
|
||||
return mXPIDLString.StartAssignmentByReference();
|
||||
}
|
||||
|
||||
friend GetterShares getter_Shares(nsXPIDLString& aXPIDLString);
|
||||
};
|
||||
|
||||
friend class GetterShares;
|
||||
|
||||
private:
|
||||
// not to be implemented
|
||||
nsXPIDLString(nsXPIDLString& /* aXPIDLString */) {}
|
||||
nsXPIDLString& operator =(nsXPIDLString& /* aXPIDLString */) { return *this; }
|
||||
};
|
||||
|
||||
|
||||
/**
|
||||
* Use this function to "wrap" the nsXPIDLString object that is to
|
||||
* receive an |out| value.
|
||||
*/
|
||||
inline nsXPIDLString::GetterCopies
|
||||
getter_Copies(nsXPIDLString& aXPIDLString)
|
||||
{
|
||||
return nsXPIDLString::GetterCopies(aXPIDLString);
|
||||
}
|
||||
|
||||
/**
|
||||
* Use this function to "wrap" the nsXPIDLString object that is to
|
||||
* receive a |[shared] out| value.
|
||||
*/
|
||||
inline nsXPIDLString::GetterShares
|
||||
getter_Shares(nsXPIDLString& aXPIDLString)
|
||||
{
|
||||
return nsXPIDLString::GetterShares(aXPIDLString);
|
||||
}
|
||||
|
||||
|
||||
|
||||
////////////////////////////////////////////////////////////////////////
|
||||
// nsXPIDLCString
|
||||
//
|
||||
// A wrapper for Unicode strings. With the |getter_Copies()| and
|
||||
// |getter_Shares()| helper functions, this can be used instead of
|
||||
// the "naked" |char*| interface for |string| parameters in XPIDL
|
||||
// interfaces.
|
||||
//
|
||||
|
||||
class NS_COM nsXPIDLCString {
|
||||
private:
|
||||
char* mBuf;
|
||||
PRBool mBufOwner;
|
||||
|
||||
char** StartAssignmentByValue();
|
||||
const char** StartAssignmentByReference();
|
||||
|
||||
public:
|
||||
/**
|
||||
* Construct a new, uninitialized wrapper for a single-byte string.
|
||||
*/
|
||||
nsXPIDLCString();
|
||||
|
||||
virtual ~nsXPIDLCString();
|
||||
|
||||
/**
|
||||
* Assign a single-byte string to this wrapper. Copies and owns the result.
|
||||
*/
|
||||
nsXPIDLCString& operator =(const char* aString);
|
||||
|
||||
/**
|
||||
* Return a reference to the immutable single-byte string.
|
||||
*/
|
||||
operator const char*();
|
||||
|
||||
/**
|
||||
* Make a copy of the single-byte string. Use this function in the
|
||||
* callee to ensure that the correct memory allocator is used.
|
||||
*/
|
||||
static char* Copy(const char* aString);
|
||||
|
||||
// A helper class for assignment-by-value. This class is an
|
||||
// implementation detail and should not be considered part of the
|
||||
// public interface.
|
||||
class NS_COM GetterCopies {
|
||||
private:
|
||||
nsXPIDLCString& mXPIDLString;
|
||||
|
||||
public:
|
||||
GetterCopies(nsXPIDLCString& aXPIDLString)
|
||||
: mXPIDLString(aXPIDLString) {}
|
||||
|
||||
operator char**() {
|
||||
return mXPIDLString.StartAssignmentByValue();
|
||||
}
|
||||
|
||||
friend GetterCopies getter_Copies(nsXPIDLCString& aXPIDLString);
|
||||
};
|
||||
|
||||
friend class GetterCopies;
|
||||
|
||||
// A helper class for assignment-by-reference. This class is an
|
||||
// implementation detail and should not be considered part of the
|
||||
// public interface.
|
||||
class NS_COM GetterShares {
|
||||
private:
|
||||
nsXPIDLCString& mXPIDLString;
|
||||
|
||||
public:
|
||||
GetterShares(nsXPIDLCString& aXPIDLString)
|
||||
: mXPIDLString(aXPIDLString) {}
|
||||
|
||||
operator const char**() {
|
||||
return mXPIDLString.StartAssignmentByReference();
|
||||
}
|
||||
|
||||
friend GetterShares getter_Shares(nsXPIDLCString& aXPIDLString);
|
||||
};
|
||||
|
||||
friend class GetterShares;
|
||||
|
||||
private:
|
||||
// not to be implemented
|
||||
nsXPIDLCString(nsXPIDLCString& /* aXPIDLString */) {}
|
||||
nsXPIDLCString& operator =(nsXPIDLCString& /* aXPIDLCString */) { return *this; }
|
||||
};
|
||||
|
||||
/**
|
||||
* Use this function to "wrap" the nsXPIDLCString object that is to
|
||||
* receive an |out| value.
|
||||
*/
|
||||
inline nsXPIDLCString::GetterCopies
|
||||
getter_Copies(nsXPIDLCString& aXPIDLString)
|
||||
{
|
||||
return nsXPIDLCString::GetterCopies(aXPIDLString);
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
* Use this function to "wrap" the nsXPIDLCString object that is to
|
||||
* receive a |[shared] out| value.
|
||||
*/
|
||||
inline nsXPIDLCString::GetterShares
|
||||
getter_Shares(nsXPIDLCString& aXPIDLString)
|
||||
{
|
||||
return nsXPIDLCString::GetterShares(aXPIDLString);
|
||||
}
|
||||
|
||||
|
||||
|
||||
#endif // nsXPIDLString_h__
|
||||
@@ -1,743 +0,0 @@
|
||||
# -*- Mode: perl; tab-width: 4; indent-tabs-mode: nil; -*-
|
||||
# vim: syntax=perl
|
||||
################################
|
||||
# Bugzilla Module #
|
||||
################################
|
||||
|
||||
|
||||
package BotModules::Bugzilla;
|
||||
use vars qw(@ISA);
|
||||
@ISA = qw(BotModules);
|
||||
|
||||
use XML::LibXML;
|
||||
use Fcntl qw(:DEFAULT :flock);
|
||||
use File::Basename;
|
||||
|
||||
# For parsing bugmail.log records. Must be the same as
|
||||
# FIELD_SEPARATOR in bugmail.pl.
|
||||
use constant FIELD_SEPARATOR => '::::';
|
||||
# The log file that we read to report bug changes.
|
||||
# This will be put in the directory returned by dirname($0).
|
||||
use constant BUGMAIL_LOG => 'BotModules/.bugmail.log';
|
||||
1;
|
||||
|
||||
# there is a minor error in this module: bugsHistory->$target->$bug is
|
||||
# accessed even when bugsHistory->$target doesn't yet exist. XXX
|
||||
|
||||
# This is ported straight from techbot, so some of the code is a little convoluted. So sue me. I was lazy.
|
||||
|
||||
sub Initialise {
|
||||
my $self = shift;
|
||||
my $retval = $self->SUPER::Initialise(@_);
|
||||
my ($throw_away) = $self->GetBugLog();
|
||||
$throw_away->truncate(0) if $throw_away;
|
||||
$throw_away->close() if $throw_away;
|
||||
return $retval;
|
||||
}
|
||||
|
||||
# RegisterConfig - Called when initialised, should call registerVariables
|
||||
sub RegisterConfig {
|
||||
my $self = shift;
|
||||
$self->SUPER::RegisterConfig(@_);
|
||||
$self->registerVariables(
|
||||
# [ name, save?, settable? ]
|
||||
['bugsURI', 1, 1, 'https://bugzilla.mozilla.org/'],
|
||||
['bugsDWIMQueryDefault', 1, 1, 'short_desc_type=substring&short_desc='],
|
||||
['bugsDWIMQueryChannelDefault', 1, 1, {}],
|
||||
['bugsHistory', 0, 0, {}],
|
||||
['backoffTime', 1, 1, 120],
|
||||
['ignoreCommentsTo', 1, 1, ['']],
|
||||
['ignoreCommentsFrom', 1, 1, ['|']],
|
||||
['mailIgnore', 1, 1, []],
|
||||
['skipPrefixFor', 1, 1, []],
|
||||
# The keys for productReportChannels can be in the form of 'Product'
|
||||
# or 'Product::::Component'. The value is a comma-separated list of
|
||||
# channel names.
|
||||
['productReportChannels', 1, 1, {}],
|
||||
# The fields that you want notifications about.
|
||||
['reportFields', 1, 1, ['Resolution', 'Flag', 'Attachment Flag',
|
||||
'NewBug', 'NewAttach']],
|
||||
# Except in these products, you don't want notifications about
|
||||
# certain fields (key is product name, value is comma-separated
|
||||
# list of fields).
|
||||
['productMuteFields', 1, 1, {}],
|
||||
# And in these channels, you don't want notifications about certain
|
||||
# fields (the key is the channel name and the value is a
|
||||
# comma-separated list of fields).
|
||||
['channelMuteFields', 1, 1, {}],
|
||||
# How frequently we check for new bugmail we've received, in seconds.
|
||||
['updateDelay', 1, 1, 10],
|
||||
# List of products for which component of new bugs is reported instead
|
||||
# of only the product. Can also restrict to specific components
|
||||
# by using Product::::Component syntax and always report components
|
||||
# by using 'all'.
|
||||
['reportComponent', 1, 1, ['all']],
|
||||
['mutes', 1, 1, ''], # "channel channel channel"
|
||||
# Optionally skip fetching the bug details for automatic notifications
|
||||
['reportBugDetails', 1, 1, 1]
|
||||
);
|
||||
}
|
||||
|
||||
sub Help {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
my %commands = (
|
||||
'' => 'The Bugzilla module provides an interface to the bugzilla bug database. It will spot anyone mentioning bugs, too, and report on what they are. For example if someone says \'I think that\'s a dup of bug 5693, the :hover thing\', then this module will display information about bug 5693.',
|
||||
'bug' => 'Fetches a summary of bugs from bugzilla. Expert syntax: \'bugzilla [bugnumber[,]]*[&bugzillaparameter=value]*\', bug_status: UNCONFIRMED|NEW|ASSIGNED|REOPENED; *type*=substring|; bugtype: include|exclude; order: Assignee|; chfield[from|to|value] short_desc\' long_desc\' status_whiteboard\' bug_file_loc\' keywords\'; \'_type; email[|type][1|2] [reporter|qa_contact|assigned_to|cc]',
|
||||
'bug-total' => 'Same as bug (which see) but only displays the total line.',
|
||||
'bugs' => q{A simple DWIM search. Not very clever. ;-)}
|
||||
. q{ Syntax: '<query string> bugs' e.g. 'mozbot bugs'.},
|
||||
'ignore' => q{Causes the bot to stop reporting all bug changes}
|
||||
. q{ made by a particular user in the current channel.}
|
||||
. q{ Syntax: 'ignore <user@domain.com>' },
|
||||
'unignore' => q{Causes the bot to un-ignore a previously ignored}
|
||||
. q{ user. See 'ignore'}
|
||||
. q{ for more details.},
|
||||
);
|
||||
if ($self->isAdmin($event)) {
|
||||
$commands{'mute'} = 'Disable watching for bug numbers in a channel. Syntax: mute bugzilla in <channel>';
|
||||
$commands{'unmute'} = 'Enable watching for bug numbers in a channel. Syntax: unmute bugzilla in <channel>';
|
||||
}
|
||||
return \%commands;
|
||||
}
|
||||
|
||||
# Schedule - called when bot connects to a server, to install any schedulers
|
||||
# use $self->schedule($event, $delay, $times, $data)
|
||||
# where $times is 1 for a single event, -1 for recurring events,
|
||||
# and a +ve number for an event that occurs that many times.
|
||||
sub Schedule {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
$self->schedule($event, \$self->{'updateDelay'}, -1, 'Bugzilla-BugMail');
|
||||
return $self->SUPER::Schedule($event);
|
||||
}
|
||||
|
||||
sub Scheduled {
|
||||
my $self = shift;
|
||||
my ($event, @data) = @_;
|
||||
if ($data[0] eq 'Bugzilla-BugMail') {
|
||||
$self->CheckForBugMail($event);
|
||||
} else {
|
||||
return $self->SUPER::Scheduled($event, @data);
|
||||
}
|
||||
return 0;
|
||||
}
|
||||
|
||||
sub Told {
|
||||
my $self = shift;
|
||||
my ($event, $message) = @_;
|
||||
if ($message =~ /^\s*ignore (.+)[?!.\s]*$/) {
|
||||
my $user = $1;
|
||||
# If we aren't already ignoring them...
|
||||
if (!grep($_ eq $user, @{$self->{'mailIgnore'}})) {
|
||||
push (@{$self->{'mailIgnore'}}, $user);
|
||||
$self->saveConfig();
|
||||
$self->say($event,
|
||||
"$event->{'from'}: OK, ignoring changes produced by $user.");
|
||||
}
|
||||
else {
|
||||
$self->say($event,
|
||||
"$event->{'from'}: $user is already being ignored.");
|
||||
}
|
||||
}
|
||||
elsif ($message =~ /^\s*unignore (.+)[?!.\s]*$/) {
|
||||
my $user = $1;
|
||||
my %ignoredUsers = map { $_ => 1 } @{$self->{'mailIgnore'}};
|
||||
# If we are already ignoring them...
|
||||
if ($ignoredUsers{$user}) {
|
||||
delete $ignoredUsers{$user};
|
||||
$self->{'mailIgnore'} = [keys %ignoredUsers];
|
||||
$self->saveConfig();
|
||||
$self->say($event,
|
||||
"$event->{'from'}: OK, $user is no longer being ignored.");
|
||||
}
|
||||
else {
|
||||
$self->say($event, "$event->{'from'}: $user wasn't being ignored.");
|
||||
}
|
||||
}
|
||||
elsif ($message =~ m/^ \s* # some optional whitespace
|
||||
(?:please\s+)? # an optional "please", followed optionally by either:
|
||||
(?: (?:could\s+you\s+)? # 1. an optional "could you",
|
||||
(?:please\s+)? # another optional "please",
|
||||
show\s+me\s+ | # and the text "show me"
|
||||
what\s+is\s+ | # 2. the text "what is"
|
||||
what\'s\s+ )? # 3. or the text "what's"
|
||||
bug (?:\s*id)?s? [\#\s]+ # a variant on "bug", "bug id", "bugids", etc
|
||||
([0-9].*?| # a query string, either a number followed by some optional text, or
|
||||
&.+?) # a query string, starting with a &.
|
||||
(?:\s+please)? # followed by yet another optional "please"
|
||||
[?!.\s]* # ending with some optional punctuation
|
||||
$/osix) {
|
||||
my $target = $event->{'target'};
|
||||
my $bug = $1;
|
||||
# Single bugs use xml.cgi, because then we get error messages
|
||||
if ($bug =~ m/^\d+$/) {
|
||||
$self->FetchBug($event, $bug, 'bug', {'sayAlways' => 1});
|
||||
} else {
|
||||
$self->FetchBug($event, $bug, 'bugs', {'sayAlways' => 1});
|
||||
}
|
||||
$self->{'bugsHistory'}->{$target}->{$bug} = $event->{'time'} if $bug =~ m/^\d+$/os;
|
||||
} elsif ($message =~ m/^\s*bug-?total\s+(.+?)\s*$/osi) {
|
||||
$self->FetchBug($event, $1, 'total');
|
||||
} elsif ($self->isAdmin($event)) {
|
||||
if ($message =~ m/^\s*mute\s+bugzilla\s+in\s+(\S+?)\s*$/osi) {
|
||||
$self->{'mutes'} .= " $1";
|
||||
$self->saveConfig();
|
||||
$self->say($event, "$event->{'from'}: Watching for bug numbers disabled in channel $1.");
|
||||
} elsif ($message =~ m/^\s*unmute\s+bugzilla\s+in\s+(\S+)\s*$/osi) {
|
||||
my %mutedChannels = map { $_ => 1 } split(/ /o, $self->{'mutes'});
|
||||
delete($mutedChannels{$1}); # get rid of any mentions of that channel
|
||||
$self->{'mutes'} = join(' ', keys(%mutedChannels));
|
||||
$self->saveConfig();
|
||||
$self->say($event, "$event->{'from'}: Watching for bug numbers reenabled in channel $1.");
|
||||
} else {
|
||||
return $self->SUPER::Told(@_);
|
||||
}
|
||||
} else {
|
||||
return $self->SUPER::Told(@_);
|
||||
}
|
||||
return 0; # dealt with it...
|
||||
}
|
||||
|
||||
sub CheckForBugs {
|
||||
my $self = shift;
|
||||
my ($event, $message) = @_;
|
||||
if ((($event->{'channel'} eq '') or # either it was /msg'ed, or
|
||||
($self->{'mutes'} !~ m/^(?:.*\s|)\Q$event->{'channel'}\E(?:|\s.*)$/si)) and # it was sent on a channel in which we aren't muted
|
||||
(not $self->ignoringCommentsFrom($event->{'from'})) and # we aren't ignoring them
|
||||
(not $self->ignoringCommentsTo($message))) { # and they aren't talking to someone we need to ignore
|
||||
my $rest = $message;
|
||||
my $bugsFound = 0;
|
||||
my $bugsToFetch = '';
|
||||
my $bug;
|
||||
my $skipURI;
|
||||
do {
|
||||
if ($rest =~ m/ (?:^| # either the start of the string
|
||||
[]\s,.;:\\\/=?!()<>{}[-]) # or some punctuation
|
||||
bug [\s\#]* ([0-9]+) # followed a string similar to "bug # 123" (put the number in $1)
|
||||
(?:[]\s,.;:\\\/=?!()<>{}[-]+ # followed optionally by some punctuation,
|
||||
(.*))?$/osix) { # and everything else (which we put in $2)
|
||||
$bug = $1;
|
||||
$skipURI = 0;
|
||||
$rest = $2;
|
||||
} elsif ($rest =~ m/\Q$self->{'bugsURI'}\Eshow_bug.cgi\?id=([0-9]+)(?:[^0-9&](.*))?$/si) {
|
||||
$bug = $1;
|
||||
$skipURI = 1;
|
||||
$rest = $2;
|
||||
} else {
|
||||
$bug = undef;
|
||||
}
|
||||
if (defined($bug)) {
|
||||
$self->debug("Noticed someone mention bug $bug -- investigating...");
|
||||
$bugsToFetch .= "$bug ";
|
||||
$bugsFound++;
|
||||
}
|
||||
} while (defined($bug));
|
||||
if ($bugsToFetch ne '') {
|
||||
$self->FetchBug($event, $bugsToFetch, 'bug', {'skipURI' => $skipURI, 'skipZaroo' =>1});
|
||||
}
|
||||
return $bugsFound;
|
||||
}
|
||||
return 0;
|
||||
}
|
||||
|
||||
sub Heard {
|
||||
my $self = shift;
|
||||
my ($event, $message) = @_;
|
||||
unless ($self->CheckForBugs($event, $message)) {
|
||||
return $self->SUPER::Heard(@_);
|
||||
}
|
||||
return 0; # we've dealt with it, no need to do anything else.
|
||||
}
|
||||
|
||||
sub Baffled {
|
||||
my $self = shift;
|
||||
my ($event, $message) = @_;
|
||||
if ($message =~ m/^\s*(...+?)\s+bugs\s*$/osi) {
|
||||
my $target = $event->{'target'};
|
||||
$self->FetchBug($event, $1, 'dwim');
|
||||
} else {
|
||||
return $self->SUPER::Baffled(@_);
|
||||
}
|
||||
return 0;
|
||||
}
|
||||
|
||||
sub Felt {
|
||||
my $self = shift;
|
||||
my ($event, $message) = @_;
|
||||
unless ($self->CheckForBugs($event, $message)) {
|
||||
return $self->SUPER::Felt(@_);
|
||||
}
|
||||
return 0; # we've dealt with it, no need to do anything else.
|
||||
}
|
||||
|
||||
sub Saw {
|
||||
my $self = shift;
|
||||
my ($event, $message) = @_;
|
||||
unless ($self->CheckForBugs($event, $message)) {
|
||||
return $self->SUPER::Saw(@_);
|
||||
}
|
||||
return 0; # we've dealt with it, no need to do anything else.
|
||||
}
|
||||
|
||||
sub FetchBug {
|
||||
my $self = shift;
|
||||
my ($event, $bugParams, $subtype, $params) = @_;
|
||||
my $skipURI = exists($params->{'skipURI'}) ? $params->{'skipURI'} : 0;
|
||||
my $skipZaroo = exists($params->{'skipZaroo'}) ? $params->{'skipZaroo'} : 0;
|
||||
my $sayAlways = exists($params->{'sayAlways'}) ? $params->{'sayAlways'} : 0;
|
||||
my $uri;
|
||||
my $type;
|
||||
my @bugs = split(' ', $bugParams);
|
||||
my @ids = ();
|
||||
foreach my $bug (@bugs) {
|
||||
if($sayAlways || $self->needToFetchBug($event->{'target'}, $event->{'time'}, $bug)) {
|
||||
push @ids, $bug;
|
||||
$self->{'bugsHistory'}->{$event->{'target'}}->{$bug} = $event->{'time'} if $bug =~ m/^\d+$/os;
|
||||
}
|
||||
}
|
||||
return unless @ids;
|
||||
if ($subtype eq 'bug') {
|
||||
# Code taken from Bugzilla's xml.cgi
|
||||
$uri = "$self->{'bugsURI'}show_bug.cgi?ctype=xml&excludefield=long_desc&excludefield=attachmentdata&excludefield=cc".join('', map { $_ = "&id=" . $_ } @ids);
|
||||
$type = 'xml';
|
||||
} elsif ($subtype eq 'dwim') {
|
||||
# XXX should escape query string
|
||||
my $DWIMdefaultQuery = $self->{'bugsDWIMQueryDefault'};
|
||||
if (exists $self->{'bugsDWIMQueryChannelDefault'}->{$event->{'channel'}}) {
|
||||
$DWIMdefaultQuery = $self->{'bugsDWIMQueryChannelDefault'}->{$event->{'channel'}};
|
||||
}
|
||||
$uri = "$self->{'bugsURI'}buglist.cgi?format=rdf&$DWIMdefaultQuery".join(',',@ids);
|
||||
$subtype = 'bugs';
|
||||
$type = 'buglist';
|
||||
} else {
|
||||
$uri = "$self->{'bugsURI'}buglist.cgi?format=rdf&bug_id=".join(',',@ids);
|
||||
$type = 'buglist';
|
||||
}
|
||||
$self->getURI($event, $uri, $type, $subtype, $skipURI, $skipZaroo);
|
||||
}
|
||||
|
||||
sub GotURI {
|
||||
my $self = shift;
|
||||
my ($event, $uri, $output, $type, $subtype, $skipURI, $skipZaroo) = @_;
|
||||
|
||||
my @bugs;
|
||||
|
||||
# Bugzilla really needs a LIMIT option
|
||||
my $maxRes;
|
||||
if ($event->{'channel'}) {
|
||||
$maxRes = 5;
|
||||
} else {
|
||||
$maxRes = 20;
|
||||
}
|
||||
my $truncated = 0;
|
||||
|
||||
if ($type eq 'buglist') {
|
||||
# We asked for rdf, but old versions won't know how to do that
|
||||
# So lets do some simple sniffing, until mozbot gives us a way
|
||||
# to find out the server's returned mime type
|
||||
my $format;
|
||||
if ($output =~ /^<\?xml /) {
|
||||
$type = 'rdf';
|
||||
} else {
|
||||
$type = 'html';
|
||||
}
|
||||
}
|
||||
|
||||
my $lots;
|
||||
my $bugCount;
|
||||
|
||||
if ($type eq 'html') {
|
||||
my $lots;
|
||||
my @qp;
|
||||
|
||||
# magicness
|
||||
{ no warnings; # this can go _very_ wrong easily
|
||||
|
||||
$lots = ($output !~ m/<FORM\s+METHOD=POST\s+ACTION="long_list.cgi">/osi); # if we got truncated, then this will be missing
|
||||
|
||||
# Instead of relying on being able to accurately count the
|
||||
# number of bugs (which we can't do if there are more than
|
||||
# 199), use the number that bugzilla tells us.
|
||||
if ($output =~ /(One|\d+) bugs? found/o) {
|
||||
$bugCount = $1;
|
||||
if ($bugCount eq "One") {
|
||||
$bugCount = 1;
|
||||
}
|
||||
}
|
||||
|
||||
$output =~ s/<\/TABLE><TABLE .+?<\/A><\/TH>//gosi;
|
||||
(undef, $output) = split(/Summary<\/A><\/TH>/osi, $output);
|
||||
($output, undef) = split(/<\/TABLE>/osi, $output);
|
||||
$output =~ s/[\n\r]//gosi;
|
||||
@qp = split(m/<TR VALIGN=TOP ALIGN=LEFT CLASS=[-A-Za-z0-9]+(?: style='.*?')?\s*?><TD>/osi, $output);
|
||||
}
|
||||
|
||||
if (scalar(@qp) == 0) {
|
||||
$bugCount = 0;
|
||||
}
|
||||
|
||||
if (!$lots && $subtype eq 'bugs') {
|
||||
if (scalar(@qp) > $maxRes) {
|
||||
$truncated = 1;
|
||||
@qp = @qp[0..$maxRes-1];
|
||||
}
|
||||
|
||||
foreach (@qp) {
|
||||
if ($_) {
|
||||
# more magic
|
||||
if (my @d = m|<A HREF="show_bug.cgi\?id=([0-9]+)">\1</A> <td class=severity><nobr>(.*?)</nobr><td class=priority><nobr>(.*?)</nobr><td class=platform><nobr>(.*?)</nobr><td class=owner><nobr>(.*?)</nobr><td class=status><nobr>(.*?)</nobr><td class=resolution><nobr>(.*?)</nobr><td class=summary>(.*)|osi) {
|
||||
# bugid severity priority platform owner status resolution subject
|
||||
my %bug;
|
||||
($bug{'id'}, $bug{'severity'}, $bug{'priority'}, $bug{'platform'}, $bug{'owner'}, $bug{'status'}, $bug{'resolution'}, $bug{'summary'}) = @d;
|
||||
push (@bugs, \%bug);
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
} elsif ($type eq 'xml') {
|
||||
# We came from xml.cgi
|
||||
my $parser = XML::LibXML->new();
|
||||
my $tree = $parser->parse_string($output);
|
||||
my $root = $tree->getDocumentElement;
|
||||
|
||||
my @xml_bugs = $root->getElementsByTagName('bug');
|
||||
$bugCount = scalar(@xml_bugs);
|
||||
|
||||
if (scalar(@xml_bugs) > $maxRes) {
|
||||
$truncated = 1;
|
||||
@xml_bugs = @xml_bugs[0..$maxRes-1];
|
||||
}
|
||||
|
||||
# OK, xml.cgi uses different names to the query stuff
|
||||
# Take a deep breath, and use a mapping for the fields we
|
||||
# care about
|
||||
my %fieldMap = (
|
||||
'bug_id' => 'id',
|
||||
'bug_severity' => 'severity',
|
||||
'priority' => 'priority',
|
||||
'target_milestone' => 'target_milestone',
|
||||
'assigned_to' => 'owner',
|
||||
'bug_status' => 'status',
|
||||
'resolution' => 'resolution',
|
||||
'short_desc' => 'summary'
|
||||
);
|
||||
|
||||
foreach my $xml_bug(@xml_bugs) {
|
||||
my %bug = {};
|
||||
my $error = $xml_bug->getAttribute('error');
|
||||
if (!defined $error) {
|
||||
foreach my $field (keys %fieldMap) {
|
||||
my @arr = $xml_bug->getElementsByTagName($field);
|
||||
if (@arr) {
|
||||
my $firstChild = $arr[0]->getFirstChild();
|
||||
if (defined $firstChild) {
|
||||
$bug{$fieldMap{$field}} = $firstChild->getData();
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
else {
|
||||
my @arr = $xml_bug->getElementsByTagName('bug_id');
|
||||
$bug{'id'} = $arr[0]->getFirstChild->getData();
|
||||
$bug{'error'} = $error;
|
||||
}
|
||||
push @bugs, \%bug;
|
||||
}
|
||||
} elsif ($type eq 'rdf') {
|
||||
my $parser = XML::LibXML->new();
|
||||
my $tree = $parser->parse_string($output);
|
||||
my $root = $tree->getDocumentElement;
|
||||
my @rdf_bugs = $root->getElementsByTagName('bz:bug');
|
||||
|
||||
$bugCount = scalar(@rdf_bugs);
|
||||
|
||||
if (scalar(@rdf_bugs) > $maxRes) {
|
||||
$truncated = 1;
|
||||
@rdf_bugs = @rdf_bugs[0..$maxRes-1];
|
||||
}
|
||||
|
||||
foreach my $rdf_bug (@rdf_bugs) {
|
||||
my %bug = {};
|
||||
my @children = $rdf_bug->getChildnodes();
|
||||
foreach my $child (@children) {
|
||||
next if ($child->getLocalName() eq 'text');
|
||||
my $field = $child->getLocalName();
|
||||
if ($child->getFirstChild()) {
|
||||
my $val = $child->getFirstChild->getData();
|
||||
$bug{$field} = $val;
|
||||
}
|
||||
}
|
||||
push @bugs, \%bug;
|
||||
}
|
||||
} else {
|
||||
return $self->SUPER::GotURI(@_);
|
||||
}
|
||||
|
||||
# construct the response's preamble
|
||||
my $preamble;
|
||||
if ($bugCount == 0 && !$skipZaroo) {
|
||||
$preamble = 'Zarro boogs found.';
|
||||
} else {
|
||||
my $bugCountStr;
|
||||
if ($bugCount) {
|
||||
$bugCountStr = "$bugCount bug" . ($bugCount == 1 ? '' : 's')
|
||||
. " found";
|
||||
}
|
||||
|
||||
if ($subtype eq 'total') {
|
||||
$self->say($event, $bugCountStr);
|
||||
return;
|
||||
}
|
||||
|
||||
if ($lots) {
|
||||
$preamble = $bugCountStr ? "$bugCountStr, which is too many for me to handle without running out of memory."
|
||||
: 'Way too many bugs found. I gave up so as to not run out of memory.';
|
||||
$preamble .= "$bugCountStr Try to narrow your search or something!";
|
||||
$subtype = 'lots';
|
||||
} elsif ($subtype ne 'bug' && $bugCount > 1) {
|
||||
$preamble = $bugCountStr;
|
||||
if ($truncated) {
|
||||
if ($event->{'channel'}) {
|
||||
$preamble .= '. Five shown, please message me for more.';
|
||||
} else {
|
||||
$preamble .= '. Will only show 20 results, please use the Bugzilla query form if you want more.';
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
my $prefix;
|
||||
if ( !$event->{'from'}
|
||||
|| grep {$_ eq $event->{'from'}} @{$self->{'skipPrefixFor'}} )
|
||||
{
|
||||
# they don't want to have the report prefixed with their name
|
||||
$prefix = '';
|
||||
} else {
|
||||
$prefix = "$event->{'from'}: ";
|
||||
}
|
||||
|
||||
if ($preamble) {
|
||||
$self->say($event, "$prefix$preamble");
|
||||
}
|
||||
|
||||
my $bug_link = $skipURI ? "" : "$self->{'bugsURI'}show_bug.cgi?id=";
|
||||
|
||||
# now send out the output
|
||||
foreach my $bug (@bugs) {
|
||||
if (!defined $bug->{'error'}) {
|
||||
# Bugzilla doesn't give the TM by default, and we can't
|
||||
# change this without using cookies, which aren't supported
|
||||
# by the mozbot API. Later versions allow us to use a query param
|
||||
# but we can't detect that that was accepted, which would break
|
||||
# the HTML parsing
|
||||
# xml.cgi gives us everything, so we can print this if we got
|
||||
# results from there
|
||||
# Maybe the list of columns to display could be a var, one day, after
|
||||
# installations from source before Dec 2001 are no longer supported,
|
||||
# or we can pass cookies
|
||||
$self->say($event, $prefix .
|
||||
"Bug $bug_link$bug->{'id'} " .
|
||||
substr($bug->{'severity'} || $bug->{'bug_severity'}, 0, 3) . ", " .
|
||||
$bug->{'priority'} . ", " .
|
||||
($bug->{'target_milestone'} ? "$bug->{'target_milestone'}, " : "") .
|
||||
($bug->{'owner'} || $bug->{'assigned_to'}) . ", " .
|
||||
substr($bug->{'status'} || $bug->{'bug_status'}, 0, 4) .
|
||||
($bug->{'resolution'} ? " " . $bug->{'resolution'} : "") . ", " .
|
||||
substr($bug->{'summary'} || $bug->{'short_desc'} || $bug->{'short_short_desc'}, 0, 100));
|
||||
} elsif ($bug->{'error'} eq 'NotFound') {
|
||||
unless($skipZaroo) {
|
||||
$self->say($event, $prefix . "Bug $bug->{'id'} was not found.");
|
||||
}
|
||||
} elsif ($bug->{'error'} eq 'NotPermitted') {
|
||||
$self->say($event, $prefix . "Bug $bug_link$bug->{'id'} is not accessible");
|
||||
} else {
|
||||
unless($skipZaroo) {
|
||||
$self->say($prefix . "Error accessing bug $bug->{'id'}: $bug->{'error'}");
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
sub CheckForBugMail {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
|
||||
my ($bug_log, $bug_file) = $self->GetBugLog();
|
||||
|
||||
my @log_lines;
|
||||
if (defined $bug_log) {
|
||||
# We need LOCK_EX because we're going to truncate it.
|
||||
flock($bug_log, LOCK_EX);
|
||||
@log_lines = $bug_log->getlines();
|
||||
$bug_log->truncate(0)
|
||||
or ($self->debug("Failed to truncate $bug_file: $!") && return);
|
||||
flock($bug_log, LOCK_UN);
|
||||
$bug_log->close() or $self->debug("Failed to close $bug_file: $!");
|
||||
$self->debug("Read " . scalar(@log_lines) . " bugmail log lines.")
|
||||
if @log_lines;
|
||||
}
|
||||
else {
|
||||
# We will have already output a more detailed error from GetBugLog.
|
||||
$self->debug("CheckForBugMail Failed: Couldn't read bugmail log.");
|
||||
return;
|
||||
}
|
||||
|
||||
# Hash to keep track of which channels we've mentioned which bug details
|
||||
# in, so we don't spew the same bug details over and over.
|
||||
my %said_bug;
|
||||
|
||||
foreach my $line (@log_lines) {
|
||||
chomp($line);
|
||||
#$self->debug("Reading log line: $line");
|
||||
my $sep = FIELD_SEPARATOR;
|
||||
$line =~ /^(.+)$sep(.+)$sep(.+)$sep(.+)$sep(.+)$sep(.*)$sep(.*)$sep(.+)$/;
|
||||
my ($bug_id, $product, $component, $who, $field, $old, $new, $message) =
|
||||
($1, $2, $3, $4, $5, $6, $7, $8);
|
||||
|
||||
# Skip this line if we never report anything for this field.
|
||||
next if !grep($_ eq $field, @{$self->{'reportFields'}});
|
||||
|
||||
my @prod_mute_fields =
|
||||
split(/\s*,\s*/, $self->{'productMuteFields'}->{$product});
|
||||
my @chan_list;
|
||||
# Don't report to these channels if this product is muted for this field.
|
||||
push (@chan_list, $self->CreateChannelList($product, $component))
|
||||
unless grep($_ eq $field, @prod_mute_fields);
|
||||
|
||||
if ($field eq 'Product') {
|
||||
my @old_mute_fields =
|
||||
split(/\s*,\s*/, $self->{'productMuteFields'}->{$old});
|
||||
push(@chan_list, $self->CreateChannelList($old, $component))
|
||||
unless grep($_ eq $field, @old_mute_fields);
|
||||
}
|
||||
elsif ($field eq 'Component') {
|
||||
my @comp_mute_fields = @prod_mute_fields;
|
||||
push(@comp_mute_fields,
|
||||
($self->{'productMuteFields'}->{$product. $sep . $component}));
|
||||
# Don't report it if the product is muted for this field, or if
|
||||
# this specific component is muted for this field.
|
||||
push(@chan_list, $self->CreateChannelList($product, $old))
|
||||
unless grep($_ eq $field, @comp_mute_fields);
|
||||
}
|
||||
# Enable Mozbot to report both product and component of new bugs.
|
||||
if (grep(lc($_) eq 'all', @{$self->{'reportComponent'}}) ||
|
||||
grep(lc($_) eq lc($product), @{$self->{'reportComponent'}}) ||
|
||||
grep(lc($_) eq lc($product.$sep.$component), @{$self->{'reportComponent'}})) {
|
||||
$message =~ s/^New $product bug/New $product - $component bug/i;
|
||||
}
|
||||
unless ($self->ignoringMailProducedBy($who)) {
|
||||
# Keep track of which channels we've told already, to avoid
|
||||
# duplicate messages.
|
||||
my %said_to;
|
||||
foreach my $channel (@chan_list) {
|
||||
my @chan_mute_fields =
|
||||
split(/\s*,\s*/, $self->{'channelMuteFields'}->{$channel});
|
||||
# Don't say it if we've said it before, or if this
|
||||
# field is muted in this channel.
|
||||
unless ( $said_to{$channel}
|
||||
|| grep($_ eq $field, @chan_mute_fields) )
|
||||
{
|
||||
# We can't use "local" here, or the target doesn't show
|
||||
# up properly in the GotURI after FetchBug.
|
||||
$event->{'target'} = $channel;
|
||||
$self->say($event, $message);
|
||||
my $bugids = "";
|
||||
# Special case for "duplicate of messages"
|
||||
if ($message =~ /DUPLICATE of bug (\d+)/) {
|
||||
my $dup_id = $1;
|
||||
$bugids = $dup_id unless $said_bug{$channel . $dup_id};
|
||||
$said_bug{$channel . $dup_id} = 1;
|
||||
}
|
||||
# Fetch bugs mentioned for dependent field changes
|
||||
if ($field eq 'OtherBugsDependingOnThis'
|
||||
|| $field eq 'BugsThisDependsOn') {
|
||||
foreach my $id (split(/,/, $old . $new)) {
|
||||
$bugids = $id . " " . $bugids
|
||||
unless $said_bug{$channel . $id};
|
||||
$said_bug{$channel . $id} = 1;
|
||||
}
|
||||
}
|
||||
if (! $said_bug{$channel . $bug_id}) {
|
||||
$bugids = $bug_id . " " . $bugids;
|
||||
}
|
||||
if ($bugids ne '') {
|
||||
if ($self->{'reportBugDetails'}) {
|
||||
$self->FetchBug($event, $bugids, 'bug');
|
||||
}
|
||||
}
|
||||
$said_to{$channel} = 1;
|
||||
$said_bug{$channel . $bug_id} = 1;
|
||||
} # unless $said_to
|
||||
} # foreach @chan_list
|
||||
} # unless ignoringMailProducedBy
|
||||
} # foreach @log_lines
|
||||
}
|
||||
|
||||
# A helper for CheckForBugMail.
|
||||
sub CreateChannelList {
|
||||
my $self = shift;
|
||||
my ($product, $component) = @_;
|
||||
|
||||
my $chan_list = "";
|
||||
($chan_list .= $self->{'productReportChannels'}->{$product})
|
||||
if $self->{'productReportChannels'}->{$product};
|
||||
|
||||
my $prodcomp = $product . FIELD_SEPARATOR . $component;
|
||||
($chan_list .= ',' . $self->{'productReportChannels'}->{$prodcomp})
|
||||
if $self->{'productReportChannels'}->{$prodcomp};
|
||||
|
||||
return (split /\s*,\s*/, $chan_list);
|
||||
}
|
||||
|
||||
# Creates the BUGMAIL_LOG file if it doesn't exist, and returns
|
||||
# an open IO::File for it, and also the filename of that file.
|
||||
sub GetBugLog {
|
||||
my $self = shift;
|
||||
|
||||
my $file_name = dirname($0) . '/' . BUGMAIL_LOG;
|
||||
# And we generally trust $bug_log to be an OK path, so untaint it now.
|
||||
$file_name =~ /^(.*)$/;
|
||||
$file_name = $1;
|
||||
my $file = new IO::File($file_name, O_RDWR | O_CREAT, 0660)
|
||||
or $self->debug("Could not open/create $file_name for reading"
|
||||
. " incoming bugmail: $!");
|
||||
return ($file, $file_name);
|
||||
}
|
||||
|
||||
sub ignoringMailProducedBy {
|
||||
my $self = shift;
|
||||
my ($who) = @_;
|
||||
return grep($_ eq $who, @{$self->{'mailIgnore'}}) ? 1 : 0;
|
||||
}
|
||||
|
||||
sub ignoringCommentsTo {
|
||||
my $self = shift;
|
||||
my ($who) = @_;
|
||||
foreach (@{$self->{'ignoreCommentsTo'}}) {
|
||||
next unless $_; # Ignore blanks, happens when the array is empty (?)
|
||||
return 1 if $who =~ m/^(?:.*[]\s,.;:\\\/=?!()<>{}[-])?\Q$_\E(?:[]\s,.;:\\\/=?!()<>{}[-].*)?$/is;
|
||||
}
|
||||
return 0;
|
||||
}
|
||||
|
||||
sub ignoringCommentsFrom {
|
||||
my $self = shift;
|
||||
my ($who) = @_;
|
||||
foreach (@{$self->{'ignoreCommentsFrom'}}) {
|
||||
return 1 if $_ eq $who;
|
||||
}
|
||||
return 0;
|
||||
}
|
||||
|
||||
sub needToFetchBug {
|
||||
my ($self, $target, $time, $bug) = @_;
|
||||
my $last = 0;
|
||||
if (defined($self->{'bugsHistory'}->{$target}->{$bug})) {
|
||||
$last = $self->{'bugsHistory'}->{$target}->{$bug};
|
||||
}
|
||||
if (($time-$last) > $self->{'backoffTime'}) {
|
||||
return 1;
|
||||
}
|
||||
return 0;
|
||||
}
|
||||
@@ -1,530 +0,0 @@
|
||||
#!/usr/bin/perl -w
|
||||
#
|
||||
# The contents of this file are subject to the Mozilla Public
|
||||
# License Version 1.1 (the "License"); you may not use this file
|
||||
# except in compliance with the License. You may obtain a copy of
|
||||
# the License at http://www.mozilla.org/MPL/
|
||||
#
|
||||
# Software distributed under the License is distributed on an "AS
|
||||
# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express or
|
||||
# implied. See the License for the specific language governing
|
||||
# rights and limitations under the License.
|
||||
#
|
||||
# The Original Code is the Mozilla IRC Bot
|
||||
#
|
||||
# The Initial Developer of the Original Code is Max Kanat-Alexander.
|
||||
# Portions developed by Max Kanat-Alexander are Copyright (C) 2005
|
||||
# Max Kanat-Alexander. All Rights Reserved.
|
||||
#
|
||||
# Contributor(s): Max Kanat-Alexander <mkanat@bugzilla.org>
|
||||
#
|
||||
# This is loosely based off an older bugmail.pl by justdave.
|
||||
|
||||
# bugmail.pl requires that you have X-Bugzilla-Product and
|
||||
# X-Bugzilla-Component headers in your incoming email. In 2.19.2 and above,
|
||||
# this is easy. You just add two lines to your newchangedmail param:
|
||||
# X-Bugzilla-Product: %product%
|
||||
# X-Bugzilla-Component: %component%
|
||||
# If you're running 2.18, you can do the same thing, but you need to
|
||||
# apply the patch from bug 175222 <https://bugzilla.mozilla.org/show_bug.cgi?id=175222>
|
||||
# to your installation.
|
||||
|
||||
use strict;
|
||||
use Fcntl qw(:flock);
|
||||
use File::Basename;
|
||||
|
||||
use Email::MIME;
|
||||
|
||||
#####################################################################
|
||||
# Constants And Initial Setup
|
||||
#####################################################################
|
||||
|
||||
# What separates Product//Component//[Fields], etc. in a log line.
|
||||
use constant FIELD_SEPARATOR => '::::';
|
||||
|
||||
# These are fields that are multi-select fields, so when somebody
|
||||
# adds something to them, the verbs "added to " or "removed from" should
|
||||
# be used instead of the verb "changed" or "set".
|
||||
# It's a hash, where the names of the fields are the keys, and the values are 1.
|
||||
# The fields are named as they appear in the "What" part of a bugmail "changes"
|
||||
# table.
|
||||
use constant MULTI_FIELDS => {
|
||||
'CC' => 1, 'Group' => 1, 'Keywords' => 1,
|
||||
'BugsThisDependsOn' => 1, 'OtherBugsDependingOnThis' => 1,
|
||||
};
|
||||
|
||||
# Some fields have such long names for the "What" column that their names
|
||||
# wrap. Normally, our code would think that those fields were two different
|
||||
# fields. So, instead, we store a list of strings to use as an argument
|
||||
# to "grep" for the field names that we need to "unwrap."
|
||||
use constant UNWRAP_WHAT => (
|
||||
qr/^Attachment .\d+$/, qr/^Attachment .\d+ is$/, qr/^OtherBugsDep/,
|
||||
);
|
||||
|
||||
# Should be whatever Bugzilla::Util::find_wrap_point (or FindWrapPoint)
|
||||
# breaks on, in Bugzilla.
|
||||
use constant BREAKING_CHARACTERS => (' ',',','-');
|
||||
|
||||
# The maximum width, in characters, of each field of the "diffs" table.
|
||||
use constant WIDTH_WHAT => 19;
|
||||
use constant WIDTH_REMOVED => 28;
|
||||
use constant WIDTH_ADDED => 28;
|
||||
|
||||
# Our one command-line argument.
|
||||
our $debug = $ARGV[0] && $ARGV[0] eq "-d";
|
||||
|
||||
# XXX - This probably should happen in the log directory instead, but that's
|
||||
# more difficult to figure out reliably.
|
||||
my $bug_log = dirname($0) . '/.bugmail.log';
|
||||
|
||||
#####################################################################
|
||||
# Utility Functions
|
||||
#####################################################################
|
||||
|
||||
# When processing the "diffs" table in a bug, some lines wrap. This
|
||||
# function properly appends the "next" line for unwrapping to an
|
||||
# existing string.
|
||||
sub append_diffline ($$$$) {
|
||||
my ($append_to, $prev_line, $append_line, $max_width) = @_;
|
||||
my $ret_line = $append_to;
|
||||
|
||||
debug_print("Appending Line: [$append_line] Prev Line: [$prev_line]");
|
||||
debug_print("Prev Line Len: " . length($prev_line)
|
||||
. " Max Width: $max_width");
|
||||
|
||||
# If the previous line is the width of the entire column, we
|
||||
# assume that we were forcibly wrapped in the middle of a word,
|
||||
# and no space is needed. We only add the space if we were actually
|
||||
# given a non-empty string to append.
|
||||
if ($append_line && length($prev_line) != $max_width) {
|
||||
debug_print("Adding a space unless we find a breaking character.");
|
||||
# However, sometimes even if we have a very short line, if it ended
|
||||
# in a "breaking character" like '-' then we also don't need a space.
|
||||
$ret_line .= " " unless grep($prev_line =~ /$_$/, BREAKING_CHARACTERS);
|
||||
}
|
||||
$ret_line .= $append_line;
|
||||
debug_print("Appended Line: [$ret_line]");
|
||||
return $ret_line;
|
||||
}
|
||||
|
||||
# Prints a string if debugging is on. Appends a newline so you don't have to.
|
||||
sub debug_print ($) {
|
||||
(print STDERR $_[0] . "\n") if $debug;
|
||||
}
|
||||
|
||||
# Helps with generate_log for Flag messages.
|
||||
sub flag_action ($$) {
|
||||
my ($new, $old) = @_;
|
||||
|
||||
my $line = "";
|
||||
|
||||
my ($flag_name, $action, $requestee) = split_flag($new);
|
||||
debug_print("Parsing Flag Change: Name: [$flag_name] Action: [$action]")
|
||||
if $new;
|
||||
|
||||
if (!$new) {
|
||||
$line .= " cancelled $old";
|
||||
}
|
||||
elsif ($action eq '+') {
|
||||
$line .= " granted $flag_name";
|
||||
}
|
||||
elsif ($action eq '-') {
|
||||
$line .= " denied $flag_name";
|
||||
}
|
||||
else {
|
||||
$line .= " requested $flag_name from";
|
||||
if ($requestee) {
|
||||
$line .= " " . $requestee;
|
||||
}
|
||||
else {
|
||||
$line .= " the wind";
|
||||
}
|
||||
}
|
||||
|
||||
return $line;
|
||||
}
|
||||
|
||||
# Takes the $old and $new from a Flag field and returns a hash,
|
||||
# where the key is the name of the field, and the value is an
|
||||
# array, where the first item is the old flag string, and the
|
||||
# new flag string is the second item.
|
||||
sub parse_flags ($$) {
|
||||
my ($new, $old) = @_;
|
||||
|
||||
my %flags;
|
||||
foreach my $old_item (split /\s*,\s*/, $old) {
|
||||
my ($flag_name) = split_flag($old_item);
|
||||
$flags{$flag_name} = [$old_item, ''];
|
||||
}
|
||||
foreach my $new_item (split /\s*,\s*/, $new) {
|
||||
my ($flag_name) = split_flag($new_item);
|
||||
if (!exists $flags{$flag_name}) {
|
||||
$flags{$flag_name} = ['', $new_item];
|
||||
}
|
||||
else {
|
||||
$flags{$flag_name}[1] = $new_item;
|
||||
}
|
||||
}
|
||||
|
||||
return %flags;
|
||||
}
|
||||
|
||||
# Returns a list: the name of the flag, the action (+/-/?), and
|
||||
# the requestee (if that exists).
|
||||
sub split_flag ($) {
|
||||
my ($flag) = @_;
|
||||
if ($flag) {
|
||||
$flag =~ /\s*([^\?]+)(\+|-|\?)(?:\((.*)\))?$/;
|
||||
return ($1, $2, $3);
|
||||
}
|
||||
return ();
|
||||
}
|
||||
|
||||
# Cuts the whitespace off the ends of a string.
|
||||
# Lovingly borrowed from Bugzilla::Util.
|
||||
sub trim ($) {
|
||||
my ($str) = @_;
|
||||
if ($str) {
|
||||
$str =~ s/^\s+//g;
|
||||
$str =~ s/\s+$//g;
|
||||
}
|
||||
return $str;
|
||||
}
|
||||
|
||||
#####################################################################
|
||||
# Main Subroutines
|
||||
#####################################################################
|
||||
|
||||
# Returns a hash, where the keys are the names of fields. The values
|
||||
# are lists, where the first item is what was removed and the second
|
||||
# item is what was added.
|
||||
sub parse_diffs ($) {
|
||||
my ($body_lines) = @_;
|
||||
my @body = @$body_lines;
|
||||
|
||||
my %changes = ();
|
||||
my $order = 0;
|
||||
# Read in the What | Removed | Added table.
|
||||
# End|of|table will never get run
|
||||
my @diff_table = grep (/^.*\|.*\|.*$/, @body);
|
||||
# The first line is the "What|Removed|Added" line, so goes away.
|
||||
shift(@diff_table);
|
||||
|
||||
my ($prev_what, $prev_added, $prev_removed);
|
||||
# We can't use foreach because we need to modify @diff_table.
|
||||
while (defined (my $line = shift @diff_table)) {
|
||||
$line =~ /^(.*)\|(.*)\|(.*)$/;
|
||||
my ($what, $removed, $added) = (trim($1), trim($2), trim($3));
|
||||
# These are used to set $prev_removed and $prev_added later.
|
||||
my ($this_removed, $this_added) = ($removed, $added);
|
||||
|
||||
debug_print("---RawLine: $what|$removed|$added\n");
|
||||
|
||||
# If we have a field name in the What field.
|
||||
if ($what) {
|
||||
$order++;
|
||||
# If this is a two-line "What" field...
|
||||
if( grep($what =~ $_, UNWRAP_WHAT) ) {
|
||||
# Then we need to grab the next line right now.
|
||||
my $next_line = shift @diff_table;
|
||||
debug_print("Next Line: $next_line");
|
||||
$next_line =~ /^(.*)\|(.*)\|(.*)$/;
|
||||
my ($next_what, $next_removed, $next_added) =
|
||||
(trim($1), trim($2), trim($3));
|
||||
|
||||
debug_print("Two-line What: [$what][$next_what]");
|
||||
$what = append_diffline($what, $what, $next_what,
|
||||
WIDTH_WHAT);
|
||||
if ($next_added) {
|
||||
debug_print("Two-line Added: [$added][$next_added]");
|
||||
$added = append_diffline($added, $added,
|
||||
$next_added, WIDTH_ADDED);
|
||||
}
|
||||
if ($next_removed) {
|
||||
debug_print("Two-line Removed: [$removed][$next_removed]");
|
||||
$removed = append_diffline($removed, $removed,
|
||||
$next_removed, WIDTH_REMOVED);
|
||||
}
|
||||
}
|
||||
|
||||
$changes{$order} = [$what, $removed, $added];
|
||||
debug_print("Filed as $what: $removed => $added");
|
||||
|
||||
# We only set $prev_what if we actually had a $what to put in it.
|
||||
$prev_what = $what;
|
||||
}
|
||||
# Otherwise we're getting data from a previous What.
|
||||
else {
|
||||
my $prev_what = $changes{$order}[0];
|
||||
my $new_removed = append_diffline($changes{$order}[1],
|
||||
$prev_removed, $removed, WIDTH_REMOVED);
|
||||
my $new_added = append_diffline($changes{$order}[2],
|
||||
$prev_added, $added, WIDTH_ADDED);
|
||||
|
||||
$changes{$order} = [$prev_what, $new_removed, $new_added];
|
||||
debug_print("Filed as $prev_what: $removed => $added");
|
||||
}
|
||||
|
||||
($prev_removed, $prev_added) = ($this_removed, $this_added);
|
||||
}
|
||||
|
||||
return %changes;
|
||||
}
|
||||
|
||||
# Takes a reference to an array of lines and returns a hashref
|
||||
# containing data for a buglog entry.
|
||||
# Returns undef if the bug should not be entered into the log.
|
||||
sub parse_mail ($) {
|
||||
my ($mail_lines) = @_;
|
||||
my $mail_text = join('', @$mail_lines);
|
||||
my $email = Email::MIME->new($mail_text);
|
||||
|
||||
debug_print("Parsing Message " . $email->header('Message-ID'));
|
||||
|
||||
my $body = $email->body;
|
||||
my @body_lines = split("\n", $body);
|
||||
|
||||
my %bug_info;
|
||||
|
||||
# Bug ID
|
||||
my $subject = $email->header('Subject');
|
||||
|
||||
if ($subject !~ /^\s*\[Bug (\d+)\] /i) {
|
||||
debug_print("Not bug: $subject");
|
||||
return undef;
|
||||
}
|
||||
$bug_info{'bug_id'} = $1;
|
||||
debug_print("Bug $bug_info{bug_id} found.");
|
||||
|
||||
# Ignore Dependency mails
|
||||
# XXX - This should probably be an option in the mozbot instead
|
||||
if (my ($dep_line) =
|
||||
grep /bug (\d+), which changed state\.\s*$/, @body_lines)
|
||||
{
|
||||
debug_print("Dependency change ignored: $dep_line.");
|
||||
return undef;
|
||||
}
|
||||
|
||||
# Product
|
||||
$bug_info{'product'} = $email->header('X-Bugzilla-Product');
|
||||
unless ($bug_info{'product'}) {
|
||||
debug_print("X-Bugzilla-Product header not found.");
|
||||
return undef;
|
||||
}
|
||||
debug_print("Product '$bug_info{product}' found.");
|
||||
|
||||
# Component
|
||||
$bug_info{'component'} = $email->header('X-Bugzilla-Component');
|
||||
unless ($bug_info{'component'}) {
|
||||
debug_print("X-Bugzilla-Component header not found.");
|
||||
return undef;
|
||||
}
|
||||
debug_print("Component '$bug_info{component}' found.");
|
||||
|
||||
# Who
|
||||
$bug_info{'who'} = $email->header('X-Bugzilla-Who');
|
||||
|
||||
# New or Changed
|
||||
# For Bugzilla vers < 3.0, this code also decides who
|
||||
if ($subject =~ /^\s*\[Bug \d+\]\s*New: /i) {
|
||||
$bug_info{'new'} = 1;
|
||||
debug_print("Bug is New.");
|
||||
unless ($bug_info{'who'}) {
|
||||
my ($reporter) = grep /^\s+ReportedBy:\s/, @body_lines;
|
||||
$reporter =~ s/^\s+ReportedBy:\s//;
|
||||
$bug_info{'who'} = $reporter;
|
||||
}
|
||||
}
|
||||
elsif (!$bug_info{'who'}) {
|
||||
if ( my ($changer_line) = grep /^\S+\schanged:$/, @body_lines) {
|
||||
$changer_line =~ /^(\S+)\s/;
|
||||
$bug_info{'who'} = $1;
|
||||
}
|
||||
elsif ( my ($comment_line) =
|
||||
grep /^-+.*Comment.*From /i, @body_lines )
|
||||
{
|
||||
$comment_line =~ /^-+.*Comment.*From (\S+) /i;
|
||||
$bug_info{'who'} = $1;
|
||||
}
|
||||
}
|
||||
|
||||
unless ($bug_info{'who'}) {
|
||||
debug_print("Could not determine who made the change.");
|
||||
return undef;
|
||||
}
|
||||
debug_print("Who = $bug_info{who}");
|
||||
|
||||
# Attachment
|
||||
my $attachid;
|
||||
if (($attachid) = grep /^Created an attachment \(id=\d+\)/, @body_lines) {
|
||||
$attachid =~ /^Created an attachment \(id=(\d+)\)/;
|
||||
$bug_info{'attach_id'} = $1;
|
||||
debug_print("attach_id: $bug_info{attach_id}");
|
||||
}
|
||||
|
||||
# Duplicate
|
||||
my $dupid;
|
||||
if (($dupid) = grep /marked as a duplicate of (?:bug\s)?\d+/, @body_lines) {
|
||||
$dupid =~ /marked as a duplicate of (?:bug\s)?(\d+)/;
|
||||
$bug_info{'dup_of'} = $1;
|
||||
debug_print("Got dup_of: $bug_info{dup_of}");
|
||||
}
|
||||
|
||||
# Figure out where the diff table ends, and where comments start.
|
||||
my $comments_start_at = 0;
|
||||
foreach my $check_line (@body_lines) {
|
||||
last if $check_line =~ /^-+.*Comment.*From /i;
|
||||
$comments_start_at++;
|
||||
}
|
||||
|
||||
debug_print("Comments start at line $comments_start_at.");
|
||||
my @diff_lines = @body_lines[0 .. ($comments_start_at - 1)];
|
||||
my %diffs = parse_diffs(\@diff_lines);
|
||||
$bug_info{'diffs'} = \%diffs;
|
||||
|
||||
return \%bug_info;
|
||||
}
|
||||
|
||||
# Takes the %bug_info hash returned from parse_mail and
|
||||
# makes it into one or more lines for the bugmail log.
|
||||
# BugMail Log Lines have the following format:
|
||||
# ID::::Product::::Component::::Who::::FieldName::::OldValue::::NewValue::::message
|
||||
# OldValue and NewValue can be empty.
|
||||
# FieldName will be 'NewBug' for new bugs, and 'NewAttach' for new attachments.
|
||||
# Each line ends with a newline, except the last one.
|
||||
sub generate_log ($) {
|
||||
my ($bug_info) = @_;
|
||||
|
||||
my $prefix = $bug_info->{'bug_id'} . FIELD_SEPARATOR
|
||||
. $bug_info->{'product'} . FIELD_SEPARATOR
|
||||
. $bug_info->{'component'} . FIELD_SEPARATOR
|
||||
. $bug_info->{'who'} . FIELD_SEPARATOR;
|
||||
|
||||
my @lines;
|
||||
|
||||
# New bugs are easy to handle, so let's handle them first.
|
||||
if ($bug_info->{'new'}) {
|
||||
push(@lines, $prefix . 'NewBug' . FIELD_SEPARATOR
|
||||
# Old and New are empty.
|
||||
. FIELD_SEPARATOR . FIELD_SEPARATOR
|
||||
. "New $bug_info->{product} bug $bug_info->{bug_id}"
|
||||
. " filed by $bug_info->{who}.");
|
||||
}
|
||||
|
||||
if ($bug_info->{'attach_id'}) {
|
||||
push(@lines, $prefix . 'NewAttach' . FIELD_SEPARATOR
|
||||
# Old and New are empty.
|
||||
. FIELD_SEPARATOR . FIELD_SEPARATOR
|
||||
. "$bug_info->{'who'} added attachment $bug_info->{'attach_id'}"
|
||||
. " to bug $bug_info->{'bug_id'}.");
|
||||
}
|
||||
|
||||
# And now we handle changes by going over all the diffs, one by one.
|
||||
my %diffs = %{$bug_info->{'diffs'}};
|
||||
foreach my $id (sort(keys %diffs)) {
|
||||
my $field = $diffs{$id}[0];
|
||||
my $old = $diffs{$id}[1];
|
||||
my $new = $diffs{$id}[2];
|
||||
|
||||
# For attachments, we don't want to include the bug number in
|
||||
# the output.
|
||||
$field =~ s/^(Attachment)( .)(\d+)/$1/;
|
||||
my $attach_id = $3;
|
||||
|
||||
# Flags get a *very* special handling.
|
||||
if ($field =~ /Flag$/) {
|
||||
my %flags = parse_flags($new, $old);
|
||||
foreach my $flag (keys %flags) {
|
||||
my ($old_flag, $new_flag) = @{$flags{$flag}};
|
||||
my $line = $prefix . $field . FIELD_SEPARATOR
|
||||
. $old_flag . FIELD_SEPARATOR
|
||||
. $new_flag . FIELD_SEPARATOR
|
||||
. $bug_info->{'who'};
|
||||
$line .= flag_action($new_flag, $old_flag);
|
||||
if ($field =~ /^Attachment/) {
|
||||
$line .= " for attachment $attach_id";
|
||||
}
|
||||
$line .= " on bug $bug_info->{bug_id}.";
|
||||
push(@lines, $line);
|
||||
}
|
||||
}
|
||||
|
||||
# All other, non-Flag fields.
|
||||
else {
|
||||
my $line = $prefix . $field . FIELD_SEPARATOR
|
||||
. $old . FIELD_SEPARATOR . $new . FIELD_SEPARATOR
|
||||
. $bug_info->{who};
|
||||
# Some fields require the verbs "added" and "removed", like the
|
||||
# CC field.
|
||||
if (MULTI_FIELDS->{$field}) {
|
||||
($line .= " added $new to") if $new;
|
||||
($line .= " and") if $new && $old;
|
||||
($line .= " removed $old from") if $old;
|
||||
$line .= " the $field field on bug $bug_info->{bug_id}.";
|
||||
}
|
||||
# If we didn't remove anything, only added something.
|
||||
elsif (!$old) {
|
||||
$line .= " set the $field field on bug"
|
||||
. " $bug_info->{bug_id} to $new";
|
||||
# Hack for "RESOLVED DUPLICATE" messages.
|
||||
$line .= ' of bug ' . $bug_info->{dup_of} if exists $bug_info->{dup_of};
|
||||
$line .= '.';
|
||||
}
|
||||
# If we didn't add anything, only removed something.
|
||||
elsif (!$new) {
|
||||
$line .= " cleared the $field '$old' from bug"
|
||||
. " $bug_info->{bug_id}.";
|
||||
}
|
||||
# If we changed a field from one value to another.
|
||||
else {
|
||||
$line .= " changed the $field on bug"
|
||||
. " $bug_info->{bug_id} from $old to $new.";
|
||||
}
|
||||
push(@lines, $line);
|
||||
}
|
||||
}
|
||||
|
||||
debug_print("Generated Log Lines.");
|
||||
debug_print("Log Line: $_") foreach (@lines);
|
||||
|
||||
return join("\n", @lines);
|
||||
}
|
||||
|
||||
# Takes a string and appends it to the buglog.
|
||||
sub append_log ($) {
|
||||
my ($string) = @_;
|
||||
|
||||
(open FILE, ">>" . $bug_log)
|
||||
or die "Couldn't open bug log file $bug_log: $!";
|
||||
debug_print("Waiting for a lock on the log...");
|
||||
flock(FILE, LOCK_EX);
|
||||
print FILE $string . "\n";
|
||||
flock(FILE, LOCK_UN);
|
||||
debug_print("Printed lines to log and unlocked file.");
|
||||
close FILE;
|
||||
}
|
||||
|
||||
|
||||
#####################################################################
|
||||
# Main Script
|
||||
#####################################################################
|
||||
|
||||
debug_print("\n\n");
|
||||
|
||||
unless (-e $bug_log) {
|
||||
print STDERR "$bug_log does not exist, so I assume that mozbot is not"
|
||||
. " running. Discarding incoming message.\n";
|
||||
exit;
|
||||
}
|
||||
|
||||
my @mail_array = <STDIN>;
|
||||
my $bug_info = parse_mail(\@mail_array);
|
||||
|
||||
if (defined $bug_info) {
|
||||
my $log_lines = generate_log($bug_info);
|
||||
# If we got an email with just a comment, $log_lines will be empty.
|
||||
append_log($log_lines) if $log_lines;
|
||||
}
|
||||
|
||||
debug_print("All done!");
|
||||
exit;
|
||||
@@ -1,91 +0,0 @@
|
||||
BugzillaMailHandler.pl is a script that takes in mail from a
|
||||
Bugzilla installation and possibly reports information about that
|
||||
mail to specified channels.
|
||||
|
||||
Basically, with BugzillaMailHandler.pl, you can use MozBot to inform
|
||||
you about updates to bugs. For the Bugzilla project, we use this to
|
||||
inform us whenever a bug is filed, whenever an attachment is added,
|
||||
and whenever a bug is fixed. We also have it let us know about certain
|
||||
flags, so that we can go handle those flags quickly.
|
||||
|
||||
To use BugzillaMailHandler.pl:
|
||||
|
||||
1) Start mozbot, and load the Bugzilla.bm module.
|
||||
|
||||
2) Set up your MTA (sendmail, postfix, exim, qmail, etc.) to pipe all
|
||||
mail coming to a certain address into the script instead of a local
|
||||
mailbox.
|
||||
|
||||
Your MTA must be able to write to files owned by the user that mozbot
|
||||
is running as. For example, on my local system, my mozbot is run
|
||||
as a user called "mozbot." I run postfix, so I have postfix become
|
||||
the "mozbot" user before running BugzillaMailHandler.pl.
|
||||
|
||||
3) Now, all bugmail coming in to BugzillaMailHandler will start producing
|
||||
input in BotModules/.bugmail.log (a hidden file). Mail that isn't in
|
||||
the standard Bugzilla format will be discarded. Mails that just have
|
||||
comments, or just inform that a dependency has been RESOLVED will be
|
||||
ignored.
|
||||
|
||||
4) Now, you need to tell your bot to start reporting certain Bugzilla
|
||||
Products to certain channels. In the future, there will be a command
|
||||
for this, but for now you have to do it manually. There is a variable
|
||||
in the Bugzilla module called "productReportChannels." It's a hash --
|
||||
the keys are names of products, and the values are comma-separated
|
||||
lists of channels.
|
||||
|
||||
5) Once you set that variable, your mozbot will start reporting changes
|
||||
to the specified products, in the specified channels.
|
||||
|
||||
However, it won't report *all* changes -- it will only report the
|
||||
changes to fields that are specified in the "reportFields" variable,
|
||||
which is a list of fields. Most fields have the *name that they would
|
||||
have in a Bugzilla email*, in the "What" column of the table where
|
||||
the mail shows bug changes.
|
||||
|
||||
There are some special fields:
|
||||
|
||||
Attachment Flag - Any attachment flag change.
|
||||
NewBug - When a new bug is filed.
|
||||
NewAttach - When a new attachment is posted to a bug.
|
||||
|
||||
Now, your mozbot should be up and running and reporting the changes
|
||||
that you want!
|
||||
|
||||
Other Notes
|
||||
-----------
|
||||
|
||||
There are a few other features that you can use to fine-tune how MozBot
|
||||
reports bug changes. First, anybody (not just a bot admin) can tell the
|
||||
bot to temporarily stop reporting changes from a certain Bugzilla user:
|
||||
|
||||
ignore user@domain.com
|
||||
|
||||
And to turn back on notifications about that user:
|
||||
|
||||
unignore user@domain.com
|
||||
|
||||
There are also some variables you can use to configure how mozbot reports
|
||||
changes, and what changes he reports:
|
||||
|
||||
channelMuteFields - A hash, where the key is the name of a channel, and
|
||||
the value is a comma-separated list of Fields, just
|
||||
like they would show up in the reportFields var.
|
||||
Changes to these fields will *not* be reported in
|
||||
the specified channels, but will still be reported
|
||||
in the other channels mozbot is configured to announce
|
||||
things to.
|
||||
|
||||
productMuteFields - A hash, where the key is the name of a Product in
|
||||
Bugzilla, and the value is a comma-separated list
|
||||
of Fields, just like they would show up in the
|
||||
reportFields var.
|
||||
Changes to the specified Fields on the specified
|
||||
products will not be reported to any channel, ever.
|
||||
|
||||
updateDelay - How often mozbot checks for information in the
|
||||
.bugmail.log file. Usually you can keep this at the
|
||||
default, unless you want to increase it for some reason.
|
||||
|
||||
Questions about this functionality can be asked in #mozwebtools on
|
||||
irc.mozilla.org.
|
||||
@@ -1,27 +0,0 @@
|
||||
Unless otherwise stated, the contents of these file are subject to
|
||||
the Mozilla Public License Version 1.1 (the "License"); you may
|
||||
not use this file except in compliance with the License. You may
|
||||
obtain a copy of the License at http://www.mozilla.org/MPL/
|
||||
|
||||
Software distributed under the License is distributed on an "AS
|
||||
IS" basis, WITHOUT WARRANTY OF ANY KIND, either express or
|
||||
implied. See the License for the specific language governing
|
||||
rights and limitations under the License.
|
||||
|
||||
The Original Code is the Bugzilla Bug Tracking System.
|
||||
|
||||
The Initial Developer of the Original Code is Netscape
|
||||
Communications Corporation. Portions created by Netscape are
|
||||
Copyright (C) 1998 Netscape Communications Corporation. All Rights
|
||||
Reserved.
|
||||
|
||||
Contributor(s): Harrison Page <harrison@netscape.com>
|
||||
Terry Weissman <terry@mozilla.org>
|
||||
Risto Kotalampi <risto@kotalampi.com>
|
||||
Josh Soref <timeless@mac.com>
|
||||
Ian Hickson <mozbot@hixie.ch>
|
||||
Zach Lipton <zach@zachlipton.com>
|
||||
Jake Steenhagen <jake@acutex.net>
|
||||
mental <xor@ivwnet.com>
|
||||
Mohamed Elzakzoki <mhtawfiq@yifan.net>
|
||||
Jeff Bisbee <mozilla-bugs@jbisbee.com>
|
||||
@@ -1,630 +0,0 @@
|
||||
# -*- Mode: perl; tab-width: 4; indent-tabs-mode: nil; -*-
|
||||
################################
|
||||
# Converter Module #
|
||||
################################
|
||||
# Originally by GluffiS <gluffis@mean.net>
|
||||
|
||||
package BotModules::Converter;
|
||||
use vars qw(@ISA);
|
||||
@ISA = qw(BotModules);
|
||||
1;
|
||||
|
||||
# XXX support the suffixes "to <n> sf" or "to <n> dp"
|
||||
# XXX support speed, volume, twips
|
||||
# XXX support light year, parsec, furlong; fm, pm, µm, Mm, Gm, Tm, Pm
|
||||
# XXX support 1x10^1 notation as well as the already-supported 1e1 notation
|
||||
|
||||
sub Help {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
return {
|
||||
'' => 'A generic converter. Currently supports converting between positive integers in binary, octal, decimal and hexidecimal forms, and converting temperatures, lengths, times and masses.',
|
||||
'syntax' => 'To convert a number, simply give the number with units or appropriate prefixes, for example to convert from hexadecimal: \'0x2F\'',
|
||||
'integers' => 'Decimal: Simply give the number. Hexadecimal: Prefix with 0x. Octal: Prefix with 0. Binary: Prefix with 0b.',
|
||||
'temperature' => 'Kelvin: Suffix with K. Celsius: Suffix with C. Fahrenheit: Suffix with F.',
|
||||
'length' => 'Imperial: in, ft, yd, mi. Metric: A, nm, mm, cm, m, km.', # XXX should also support light year, parsec, furlong; fm, pm, µm, Mm, Gm, Tm, Pm
|
||||
'time' => 'ISO time units: year, month, week, day, hour, minute, second. Exotic time units: millifortnight.',
|
||||
'mass' => 'Imperial: lbs, oz, stone. Metric: kg, g.',
|
||||
# XXX should support speed, volume, twips
|
||||
};
|
||||
}
|
||||
|
||||
|
||||
sub Told {
|
||||
my $self = shift;
|
||||
my ($event, $message) = @_;
|
||||
|
||||
# integers
|
||||
if ($message =~ m/^\s*([1-9][0-9]*|0)\s*\??\s*$/osi) {
|
||||
$self->convertDecimal($event, $1);
|
||||
} elsif ($message =~ m/^\s*0x([a-f0-9]+)\s*\??\s*$/osi) {
|
||||
$self->convertHex($event, $1);
|
||||
} elsif ($message =~ m/^\s*0([0-9]+)\s*\??\s*$/osi) {
|
||||
$self->convertOctal($event, $1);
|
||||
} elsif ($message =~ m/^\s*0b([0-9]+)\s*\??\s*$/osi) {
|
||||
$self->convertBinary($event, $1);
|
||||
|
||||
# temperatures
|
||||
} elsif ($message =~ m/^\s*(-?(?:[0-9]+\.?|[0-9]+\.[0-9]+|\.[0-9]+)(?:e-?[0-9]+)?)\s*(?:kelvin|K)\s*\??\s*$/osi) {
|
||||
$self->convertKelvin($event, $1);
|
||||
} elsif ($message =~ m/^\s*(-?(?:[0-9]+\.?|[0-9]+\.[0-9]+|\.[0-9]+)(?:e-?[0-9]+)?)\s*(?:deg(?:rees?)|[\`°])?\s*(?:cel[sc]ius|centigrade|c)\s*\??\s*$/osi) {
|
||||
$self->convertCelsius($event, $1);
|
||||
} elsif ($message =~ m/^\s*(-?(?:[0-9]+\.?|[0-9]+\.[0-9]+|\.[0-9]+)(?:e-?[0-9]+)?)\s*(?:deg(?:rees?)|[\`°])?\s*(?:fahrenheit|f)\s*\??\s*$/osi) {
|
||||
$self->convertFahrenheit($event, $1);
|
||||
|
||||
# imperial lengths
|
||||
} elsif ($message =~ m/^\s*(-?(?:[0-9]+\.?|[0-9]+\.[0-9]+|\.[0-9]+)(?:e-?[0-9]+)?)\s*(?:ins?|inch(?:es)?)\s*\??\s*$/osi) {
|
||||
$self->convertInches($event, $1);
|
||||
} elsif ($message =~ m/^\s*(-?(?:[0-9]+\.?|[0-9]+\.[0-9]+|\.[0-9]+)(?:e-?[0-9]+)?)\s*(?:ft|feet|foot)\s*\??\s*$/osi) {
|
||||
$self->convertFeet($event, $1);
|
||||
} elsif ($message =~ m/^\s*(-?(?:[0-9]+\.?|[0-9]+\.[0-9]+|\.[0-9]+)(?:e-?[0-9]+)?)\s*(?:yds?|yards?)\s*\??\s*$/osi) {
|
||||
$self->convertYards($event, $1);
|
||||
} elsif ($message =~ m/^\s*(-?(?:[0-9]+\.?|[0-9]+\.[0-9]+|\.[0-9]+)(?:e-?[0-9]+)?)\s*(?:mi|miles?)\s*\??\s*$/osi) {
|
||||
$self->convertMiles($event, $1);
|
||||
|
||||
# metric lengths
|
||||
} elsif ($message =~ m/^\s*(-?(?:[0-9]+\.?|[0-9]+\.[0-9]+|\.[0-9]+)(?:e-?[0-9]+)?)\s*(?:Å|a|angstroms?)\s*\??\s*$/osi) {
|
||||
$self->convertAngstroms($event, $1);
|
||||
} elsif ($message =~ m/^\s*(-?(?:[0-9]+\.?|[0-9]+\.[0-9]+|\.[0-9]+)(?:e-?[0-9]+)?)\s*(?:nms?|nanometers?|nanometres?)\s*\??\s*$/osi) {
|
||||
$self->convertNanometers($event, $1);
|
||||
} elsif ($message =~ m/^\s*(-?(?:[0-9]+\.?|[0-9]+\.[0-9]+|\.[0-9]+)(?:e-?[0-9]+)?)\s*(?:mms?|millimeters?|millimetres?)\s*\??\s*$/osi) {
|
||||
$self->convertMillimeters($event, $1);
|
||||
} elsif ($message =~ m/^\s*(-?(?:[0-9]+\.?|[0-9]+\.[0-9]+|\.[0-9]+)(?:e-?[0-9]+)?)\s*(?:cms?|centimeters?|centimetres?)\s*\??\s*$/osi) {
|
||||
$self->convertCentimeters($event, $1);
|
||||
} elsif ($message =~ m/^\s*(-?(?:[0-9]+\.?|[0-9]+\.[0-9]+|\.[0-9]+)(?:e-?[0-9]+)?)\s*(?:m|meters?|metres?)\s*\??\s*$/osi) {
|
||||
$self->convertMeters($event, $1);
|
||||
} elsif ($message =~ m/^\s*(-?(?:[0-9]+\.?|[0-9]+\.[0-9]+|\.[0-9]+)(?:e-?[0-9]+)?)\s*(?:kms?|kilometers?|kilometres?|klic?ks?)\s*\??\s*$/osi) {
|
||||
$self->convertKilometers($event, $1);
|
||||
|
||||
# times
|
||||
} elsif ($message =~ m/^\s*(-?(?:[0-9]+\.?|[0-9]+\.[0-9]+|\.[0-9]+)(?:e-?[0-9]+)?)\s*(?:years|year|yr)\s*\??\s*$/osi) {
|
||||
$self->convertYears($event, $1);
|
||||
} elsif ($message =~ m/^\s*(-?(?:[0-9]+\.?|[0-9]+\.[0-9]+|\.[0-9]+)(?:e-?[0-9]+)?)\s*(?:months|month|mo)\s*\??\s*$/osi) {
|
||||
$self->convertMonths($event, $1);
|
||||
} elsif ($message =~ m/^\s*(-?(?:[0-9]+\.?|[0-9]+\.[0-9]+|\.[0-9]+)(?:e-?[0-9]+)?)\s*(?:weeks|week|wk)\s*\??\s*$/osi) {
|
||||
$self->convertWeeks($event, $1);
|
||||
} elsif ($message =~ m/^\s*(-?(?:[0-9]+\.?|[0-9]+\.[0-9]+|\.[0-9]+)(?:e-?[0-9]+)?)\s*(?:fortnights|fortnight|mf)\s*\??\s*$/osi) {
|
||||
$self->convertMillifortnights($event, $1);
|
||||
} elsif ($message =~ m/^\s*(-?(?:[0-9]+\.?|[0-9]+\.[0-9]+|\.[0-9]+)(?:e-?[0-9]+)?)\s*(?:days|day|d)\s*\??\s*$/osi) {
|
||||
$self->convertDays($event, $1);
|
||||
} elsif ($message =~ m/^\s*(-?(?:[0-9]+\.?|[0-9]+\.[0-9]+|\.[0-9]+)(?:e-?[0-9]+)?)\s*(?:hours|hour|hr|h)\s*\??\s*$/osi) {
|
||||
$self->convertHours($event, $1);
|
||||
} elsif ($message =~ m/^\s*(-?(?:[0-9]+\.?|[0-9]+\.[0-9]+|\.[0-9]+)(?:e-?[0-9]+)?)\s*(?:minutes|minute|min)\s*\??\s*$/osi) {
|
||||
$self->convertMinutes($event, $1);
|
||||
} elsif ($message =~ m/^\s*(-?(?:[0-9]+\.?|[0-9]+\.[0-9]+|\.[0-9]+)(?:e-?[0-9]+)?)\s*(?:seconds|second|sec|s)\s*\??\s*$/osi) {
|
||||
$self->convertSeconds($event, $1);
|
||||
|
||||
# masses
|
||||
} elsif ($message =~ m/^\s*(-?(?:[0-9]+\.?|[0-9]+\.[0-9]+|\.[0-9]+)(?:e-?[0-9]+)?)\s*(?:grams|gram|g)\s*\??\s*$/osi) {
|
||||
$self->convertGrams($event, $1);
|
||||
} elsif ($message =~ m/^\s*(-?(?:[0-9]+\.?|[0-9]+\.[0-9]+|\.[0-9]+)(?:e-?[0-9]+)?)\s*(?:kilograms|kilogram|kilos|kilo|kg)\s*\??\s*$/osi) {
|
||||
$self->convertKilograms($event, $1);
|
||||
} elsif ($message =~ m/^\s*(-?(?:[0-9]+\.?|[0-9]+\.[0-9]+|\.[0-9]+)(?:e-?[0-9]+)?)\s*(?:pounds|pound|lbs)\s*\??\s*$/osi) {
|
||||
$self->convertPounds($event, $1);
|
||||
} elsif ($message =~ m/^\s*(-?(?:[0-9]+\.?|[0-9]+\.[0-9]+|\.[0-9]+)(?:e-?[0-9]+)?)\s*(?:ounces|ounce|oz)\s*\??\s*$/osi) {
|
||||
$self->convertOunces($event, $1);
|
||||
} elsif ($message =~ m/^\s*(-?(?:[0-9]+\.?|[0-9]+\.[0-9]+|\.[0-9]+)(?:e-?[0-9]+)?)\s*(?:stones|stone)\s*\??\s*$/osi) {
|
||||
$self->convertStones($event, $1);
|
||||
|
||||
# oh well
|
||||
} else {
|
||||
return $self->SUPER::Told(@_);
|
||||
}
|
||||
return 0;
|
||||
}
|
||||
|
||||
|
||||
# Integers
|
||||
|
||||
sub convertDecimal {
|
||||
my $self = shift;
|
||||
my($event, $decimal) = @_;
|
||||
my $hex = sprintf('%X', $decimal);
|
||||
my $octal = sprintf('%o', $decimal);
|
||||
my $binary = sprintf('%b', $decimal);
|
||||
$self->say($event, "$event->{'from'}: $decimal = 0x$hex, 0$octal, 0b$binary");
|
||||
}
|
||||
|
||||
sub convertHex {
|
||||
my $self = shift;
|
||||
my($event, $hex) = @_;
|
||||
my $decimal = hex($hex);
|
||||
my $hex = sprintf('%X', $decimal); # normalise
|
||||
my $octal = sprintf('%o', $decimal);
|
||||
my $binary = sprintf('%b', $decimal);
|
||||
$self->say($event, "$event->{'from'}: 0x$hex = $decimal, 0$octal, 0b$binary");
|
||||
}
|
||||
|
||||
sub convertOctal {
|
||||
my $self = shift;
|
||||
my($event, $octal) = @_;
|
||||
my $decimal = oct("0$octal");
|
||||
my $hex = sprintf('%X', $decimal);
|
||||
my $binary = sprintf('%b', $decimal);
|
||||
$self->say($event, "$event->{'from'}: 0$octal = $decimal, 0x$hex, 0b$binary");
|
||||
}
|
||||
|
||||
sub convertBinary {
|
||||
my $self = shift;
|
||||
my($event, $binary) = @_;
|
||||
my $decimal = oct("0b$binary");
|
||||
my $hex = sprintf('%X', $decimal);
|
||||
my $octal = sprintf('%o', $decimal);
|
||||
$self->say($event, "$event->{'from'}: 0b$binary = $decimal, 0x$hex, 0$octal");
|
||||
}
|
||||
|
||||
|
||||
# Temperature
|
||||
|
||||
sub convertKelvin {
|
||||
my $self = shift;
|
||||
my($event, $kelvin) = @_;
|
||||
my $celsius = round(1, $kelvin - 273.14);
|
||||
my $fahrenheit = round(1, ($kelvin - 273.14) * 9 / 5 + 32);
|
||||
my $kelvin = round(1, $kelvin); # normalise
|
||||
my $prognosis = diagnoseTemperature($kelvin, $celsius, $fahrenheit);
|
||||
$self->say($event, "$event->{'from'}: ${kelvin}K = $celsius°C, $fahrenheit°F, $prognosis");
|
||||
}
|
||||
|
||||
sub convertCelsius {
|
||||
my $self = shift;
|
||||
my($event, $celsius) = @_;
|
||||
my $kelvin = round(1, $celsius + 273.14);
|
||||
my $fahrenheit = round(1, $celsius * 9 / 5 + 32);
|
||||
my $celsius = round(1, $celsius); # normalise
|
||||
my $prognosis = diagnoseTemperature($kelvin, $celsius, $fahrenheit);
|
||||
$self->say($event, "$event->{'from'}: $celsius°C = ${kelvin}K, $fahrenheit°F, $prognosis");
|
||||
}
|
||||
|
||||
sub convertFahrenheit {
|
||||
my $self = shift;
|
||||
my($event, $fahrenheit) = @_;
|
||||
my $celsius = round(1, ($fahrenheit - 32) * 5 / 9);
|
||||
my $kelvin = round(1, ($fahrenheit - 32) * 5 / 9 + 273.14);
|
||||
my $fahrenheit = round(1, $fahrenheit); # normalise
|
||||
my $prognosis = diagnoseTemperature($kelvin, $celsius, $fahrenheit);
|
||||
$self->say($event, "$event->{'from'}: $fahrenheit°F = ${kelvin}K, $celsius°C, $prognosis");
|
||||
}
|
||||
|
||||
sub diagnoseTemperature($$$) {
|
||||
my($kelvin, $celsius, $fahrenheit) = @_;
|
||||
return
|
||||
$kelvin < 0 ? 'an impossible temperature' :
|
||||
$kelvin == 0 ? 'absolute zero' :
|
||||
$fahrenheit < 0 ? 'extremely cold' :
|
||||
$celsius < 0 ? 'freezing cold' :
|
||||
$celsius == 0 ? 'freezing point of water' :
|
||||
$celsius < 18 ? 'cold' :
|
||||
$celsius == 20 ? 'standard room temperature' :
|
||||
$celsius < 25 ? 'warm' :
|
||||
$celsius < 35 ? 'hot' :
|
||||
$celsius <= 37 ? 'body temperature' :
|
||||
$celsius < 65 ? 'very hot' :
|
||||
$celsius < 95 ? 'scorching hot' :
|
||||
$celsius == 100 ? 'boiling point of water' :
|
||||
$celsius < 105 ? 'boiling hot' :
|
||||
'ridiculously hot';
|
||||
}
|
||||
|
||||
|
||||
# Imperial Lengths
|
||||
|
||||
sub convertInches {
|
||||
my $self = shift;
|
||||
my($event, $inches) = @_;
|
||||
# imperial
|
||||
# (inches)
|
||||
my $feet = sigfig(3, $inches / 12.0);
|
||||
my $yards = sigfig(3, $inches / 36.0);
|
||||
my $miles = sigfig(3, $inches / 63360.0);
|
||||
# metric
|
||||
my $kilometers = sigfig(3, $inches * 0.0000254);
|
||||
my $meters = sigfig(3, $inches * 0.0254);
|
||||
my $centimeters = sigfig(3, $inches * 2.54);
|
||||
my $millimeters = sigfig(3, $inches * 25.4);
|
||||
my $nanometers = sigfig(3, $inches * 25400000.0);
|
||||
my $angstroms = sigfig(3, $inches * 254000000.0);
|
||||
# normalise
|
||||
my $inches = sigfig(3, $inches);
|
||||
$self->say($event, "$event->{'from'}: ${inches}in = ${feet}ft, ${yards}yd, ${miles}mi; ${kilometers}Km, ${meters}m, ${centimeters}cm, ${millimeters}mm, ${nanometers}nm, ${angstroms}Å (to 3sf)");
|
||||
}
|
||||
|
||||
sub convertFeet {
|
||||
my $self = shift;
|
||||
my($event, $feet) = @_;
|
||||
my $inches = $feet * 12.0;
|
||||
# imperial
|
||||
# (inches)
|
||||
my $feet = sigfig(3, $inches / 12.0);
|
||||
my $yards = sigfig(3, $inches / 36.0);
|
||||
my $miles = sigfig(3, $inches / 63360.0);
|
||||
# metric
|
||||
my $kilometers = sigfig(3, $inches * 0.0000254);
|
||||
my $meters = sigfig(3, $inches * 0.0254);
|
||||
my $centimeters = sigfig(3, $inches * 2.54);
|
||||
my $millimeters = sigfig(3, $inches * 25.4);
|
||||
my $nanometers = sigfig(3, $inches * 25400000.0);
|
||||
my $angstroms = sigfig(3, $inches * 254000000.0);
|
||||
# normalise
|
||||
my $inches = sigfig(3, $inches);
|
||||
$self->say($event, "$event->{'from'}: ${feet}ft = ${inches}in, ${yards}yd, ${miles}mi, ${kilometers}Km, ${meters}m, ${centimeters}cm, ${millimeters}mm, ${nanometers}nm, ${angstroms}Å (to 3sf)");
|
||||
}
|
||||
|
||||
sub convertYards {
|
||||
my $self = shift;
|
||||
my($event, $yards) = @_;
|
||||
my $inches = $yards * 36.0;
|
||||
# imperial
|
||||
# (inches)
|
||||
my $feet = sigfig(3, $inches / 12.0);
|
||||
my $yards = sigfig(3, $inches / 36.0);
|
||||
my $miles = sigfig(3, $inches / 63360.0);
|
||||
# metric
|
||||
my $kilometers = sigfig(3, $inches * 0.0000254);
|
||||
my $meters = sigfig(3, $inches * 0.0254);
|
||||
my $centimeters = sigfig(3, $inches * 2.54);
|
||||
my $millimeters = sigfig(3, $inches * 25.4);
|
||||
my $nanometers = sigfig(3, $inches * 25400000.0);
|
||||
my $angstroms = sigfig(3, $inches * 254000000.0);
|
||||
# normalise
|
||||
my $inches = sigfig(3, $inches);
|
||||
$self->say($event, "$event->{'from'}: ${yards}yd = ${inches}in, ${feet}ft, ${miles}mi, ${kilometers}Km, ${meters}m, ${centimeters}cm, ${millimeters}mm, ${nanometers}nm, ${angstroms}Å (to 3sf)");
|
||||
}
|
||||
|
||||
sub convertMiles {
|
||||
my $self = shift;
|
||||
my($event, $miles) = @_;
|
||||
my $inches = $miles * 190080.0;
|
||||
# imperial
|
||||
# (inches)
|
||||
my $feet = sigfig(3, $inches / 12.0);
|
||||
my $yards = sigfig(3, $inches / 36.0);
|
||||
my $miles = sigfig(3, $inches / 63360.0);
|
||||
# metric
|
||||
my $kilometers = sigfig(3, $inches * 0.0000254);
|
||||
my $meters = sigfig(3, $inches * 0.0254);
|
||||
my $centimeters = sigfig(3, $inches * 2.54);
|
||||
my $millimeters = sigfig(3, $inches * 25.4);
|
||||
my $nanometers = sigfig(3, $inches * 25400000.0);
|
||||
my $angstroms = sigfig(3, $inches * 254000000.0);
|
||||
# normalise
|
||||
my $inches = sigfig(3, $inches);
|
||||
$self->say($event, "$event->{'from'}: ${miles}mi = ${inches}in, ${feet}ft, ${yards}yd, ${kilometers}Km, ${meters}m, ${centimeters}cm, ${millimeters}mm, ${nanometers}nm, ${angstroms}Å (to 3sf)");
|
||||
}
|
||||
|
||||
|
||||
# Metric Lengths
|
||||
|
||||
sub convertAngstroms {
|
||||
my $self = shift;
|
||||
my($event, $input) = @_;
|
||||
# get the number
|
||||
my $accurateMeters = $input / 10000000000.0;
|
||||
$self->debug("Accurate KiloMeters: ".$accurateMeters/1000);
|
||||
# imperial
|
||||
my $inches = sigfig(3, $accurateMeters / (0.0254 * 1.0));
|
||||
my $feet = sigfig(3, $accurateMeters / (0.0254 * 12.0));
|
||||
my $yards = sigfig(3, $accurateMeters / (0.0254 * 36.0));
|
||||
my $miles = sigfig(3, $accurateMeters / (0.0254 * 63360.0));
|
||||
# metric
|
||||
my $kilometers = sigfig(3, $accurateMeters / 1000.0);
|
||||
my $meters = sigfig(3, $accurateMeters);
|
||||
my $centimeters = sigfig(3, $accurateMeters * 100.0);
|
||||
my $millimeters = sigfig(3, $accurateMeters * 1000.0);
|
||||
my $nanometers = sigfig(3, $accurateMeters * 1000000000.0);
|
||||
my $angstroms = sigfig(3, $accurateMeters * 10000000000.0);
|
||||
$self->say($event, "$event->{'from'}: ${angstroms}Å = ${inches}in, ${feet}ft, ${yards}yd, ${miles}mi; ${kilometers}Km, ${meters}m, ${centimeters}cm, ${millimeters}mm, ${nanometers}nm (to 3sf)");
|
||||
}
|
||||
|
||||
sub convertNanometers {
|
||||
my $self = shift;
|
||||
my($event, $input) = @_;
|
||||
# get the number
|
||||
my $accurateMeters = $input / 1000000000.0;
|
||||
# imperial
|
||||
my $inches = sigfig(3, $accurateMeters / (0.0254 * 1.0));
|
||||
my $feet = sigfig(3, $accurateMeters / (0.0254 * 12.0));
|
||||
my $yards = sigfig(3, $accurateMeters / (0.0254 * 36.0));
|
||||
my $miles = sigfig(3, $accurateMeters / (0.0254 * 63360.0));
|
||||
# metric
|
||||
my $kilometers = sigfig(3, $accurateMeters / 1000.0);
|
||||
my $meters = sigfig(3, $accurateMeters);
|
||||
my $centimeters = sigfig(3, $accurateMeters * 100.0);
|
||||
my $millimeters = sigfig(3, $accurateMeters * 1000.0);
|
||||
my $nanometers = sigfig(3, $accurateMeters * 1000000000.0);
|
||||
my $angstroms = sigfig(3, $accurateMeters * 10000000000.0);
|
||||
$self->say($event, "$event->{'from'}: ${nanometers}nm = ${inches}in, ${feet}ft, ${yards}yd, ${miles}mi; ${kilometers}Km, ${meters}m, ${centimeters}cm, ${millimeters}mm, ${angstroms}Å (to 3sf)");
|
||||
}
|
||||
|
||||
sub convertMillimeters {
|
||||
my $self = shift;
|
||||
my($event, $input) = @_;
|
||||
# get the number
|
||||
my $accurateMeters = $input / 1000.0;
|
||||
# imperial
|
||||
my $inches = sigfig(3, $accurateMeters / (0.0254 * 1.0));
|
||||
my $feet = sigfig(3, $accurateMeters / (0.0254 * 12.0));
|
||||
my $yards = sigfig(3, $accurateMeters / (0.0254 * 36.0));
|
||||
my $miles = sigfig(3, $accurateMeters / (0.0254 * 63360.0));
|
||||
# metric
|
||||
my $kilometers = sigfig(3, $accurateMeters / 1000.0);
|
||||
my $meters = sigfig(3, $accurateMeters);
|
||||
my $centimeters = sigfig(3, $accurateMeters * 100.0);
|
||||
my $millimeters = sigfig(3, $accurateMeters * 1000.0);
|
||||
my $nanometers = sigfig(3, $accurateMeters * 1000000000.0);
|
||||
my $angstroms = sigfig(3, $accurateMeters * 10000000000.0);
|
||||
$self->say($event, "$event->{'from'}: ${millimeters}mm = ${inches}in, ${feet}ft, ${yards}yd, ${miles}mi; ${kilometers}Km, ${meters}m, ${centimeters}cm, ${nanometers}nm, ${angstroms}Å (to 3sf)");
|
||||
}
|
||||
|
||||
sub convertCentimeters {
|
||||
my $self = shift;
|
||||
my($event, $input) = @_;
|
||||
# get the number
|
||||
my $accurateMeters = $input / 100.0;
|
||||
# imperial
|
||||
my $inches = sigfig(3, $accurateMeters / (0.0254 * 1.0));
|
||||
my $feet = sigfig(3, $accurateMeters / (0.0254 * 12.0));
|
||||
my $yards = sigfig(3, $accurateMeters / (0.0254 * 36.0));
|
||||
my $miles = sigfig(3, $accurateMeters / (0.0254 * 63360.0));
|
||||
# metric
|
||||
my $kilometers = sigfig(3, $accurateMeters / 1000.0);
|
||||
my $meters = sigfig(3, $accurateMeters);
|
||||
my $centimeters = sigfig(3, $accurateMeters * 100.0);
|
||||
my $millimeters = sigfig(3, $accurateMeters * 1000.0);
|
||||
my $nanometers = sigfig(3, $accurateMeters * 1000000000.0);
|
||||
my $angstroms = sigfig(3, $accurateMeters * 10000000000.0);
|
||||
$self->say($event, "$event->{'from'}: ${centimeters}cm = ${inches}in, ${feet}ft, ${yards}yd, ${miles}mi; ${kilometers}Km, ${meters}m, ${millimeters}mm, ${nanometers}nm, ${angstroms}Å (to 3sf)");
|
||||
}
|
||||
|
||||
sub convertMeters {
|
||||
my $self = shift;
|
||||
my($event, $input) = @_;
|
||||
# get the number
|
||||
my $accurateMeters = $input * 1.0;
|
||||
# imperial
|
||||
my $inches = sigfig(3, $accurateMeters / (0.0254 * 1.0));
|
||||
my $feet = sigfig(3, $accurateMeters / (0.0254 * 12.0));
|
||||
my $yards = sigfig(3, $accurateMeters / (0.0254 * 36.0));
|
||||
my $miles = sigfig(3, $accurateMeters / (0.0254 * 63360.0));
|
||||
# metric
|
||||
my $kilometers = sigfig(3, $accurateMeters / 1000.0);
|
||||
my $meters = sigfig(3, $accurateMeters);
|
||||
my $centimeters = sigfig(3, $accurateMeters * 100.0);
|
||||
my $millimeters = sigfig(3, $accurateMeters * 1000.0);
|
||||
my $nanometers = sigfig(3, $accurateMeters * 1000000000.0);
|
||||
my $angstroms = sigfig(3, $accurateMeters * 10000000000.0);
|
||||
$self->say($event, "$event->{'from'}: ${meters}m = ${inches}in, ${feet}ft, ${yards}yd, ${miles}mi; ${kilometers}Km, ${centimeters}cm, ${millimeters}mm, ${nanometers}nm, ${angstroms}Å (to 3sf)");
|
||||
}
|
||||
|
||||
sub convertKilometers {
|
||||
my $self = shift;
|
||||
my($event, $input) = @_;
|
||||
# get the number
|
||||
my $accurateMeters = $input * 1000.0;
|
||||
# imperial
|
||||
my $inches = sigfig(3, $accurateMeters / (0.0254 * 1.0));
|
||||
my $feet = sigfig(3, $accurateMeters / (0.0254 * 12.0));
|
||||
my $yards = sigfig(3, $accurateMeters / (0.0254 * 36.0));
|
||||
my $miles = sigfig(3, $accurateMeters / (0.0254 * 63360.0));
|
||||
# metric
|
||||
my $kilometers = sigfig(3, $accurateMeters / 1000.0);
|
||||
my $meters = sigfig(3, $accurateMeters);
|
||||
my $centimeters = sigfig(3, $accurateMeters * 100.0);
|
||||
my $millimeters = sigfig(3, $accurateMeters * 1000.0);
|
||||
my $nanometers = sigfig(3, $accurateMeters * 1000000000.0);
|
||||
my $angstroms = sigfig(3, $accurateMeters * 10000000000.0);
|
||||
$self->say($event, "$event->{'from'}: ${kilometers}km = ${inches}in, ${feet}ft, ${yards}yd, ${miles}mi; ${meters}m, ${centimeters}cm, ${millimeters}mm, ${nanometers}nm, ${angstroms}Å (to 3sf)");
|
||||
}
|
||||
|
||||
|
||||
# Time
|
||||
|
||||
sub convertYears {
|
||||
my $self = shift;
|
||||
my($event, $input) = @_;
|
||||
my $accurateSeconds = $input * 60.0 * 60.0 * 24.0 * 365.25;
|
||||
my $years = sigfig(3, $input);
|
||||
my $months = sigfig(3, $accurateSeconds / (60.0 * 60.0 * 24.0 * (365.25 / 12)));
|
||||
my $weeks = sigfig(3, $accurateSeconds / (60.0 * 60.0 * 24.0 * (365.25 / (365.25 / 7.0))));
|
||||
my $millifortnights = sigfig(3, $accurateSeconds / (60.0 * 60.0 * 24.0 * (365.25 / (365.25 / 7.0)) * 2.0 / 1000.0));
|
||||
my $days = sigfig(3, $accurateSeconds / (60.0 * 60.0 * 24.0));
|
||||
my $hours = sigfig(3, $accurateSeconds / (60.0 * 60.0));
|
||||
my $minutes = sigfig(3, $accurateSeconds / 60.0);
|
||||
my $seconds = sigfig(3, $accurateSeconds);
|
||||
$self->say($event, "$event->{'from'}: ${years}yr = ${months}mo, ${weeks}wk, ${days}d, ${hours}hr, ${minutes}min, ${seconds}s, ${millifortnights}mf");
|
||||
}
|
||||
|
||||
sub convertMonths {
|
||||
my $self = shift;
|
||||
my($event, $input) = @_;
|
||||
my $accurateSeconds = $input * 60.0 * 60.0 * 24.0 * (365.25 / 12);
|
||||
my $years = sigfig(3, $accurateSeconds / (60.0 * 60.0 * 24.0 * 365.25));
|
||||
my $months = sigfig(3, $input);
|
||||
my $weeks = sigfig(3, $accurateSeconds / (60.0 * 60.0 * 24.0 * (365.25 / (365.25 / 7.0))));
|
||||
my $millifortnights = sigfig(3, $accurateSeconds / (60.0 * 60.0 * 24.0 * (365.25 / (365.25 / 7.0)) * 2.0 / 1000.0));
|
||||
my $days = sigfig(3, $accurateSeconds / (60.0 * 60.0 * 24.0));
|
||||
my $hours = sigfig(3, $accurateSeconds / (60.0 * 60.0));
|
||||
my $minutes = sigfig(3, $accurateSeconds / 60.0);
|
||||
my $seconds = sigfig(3, $accurateSeconds);
|
||||
$self->say($event, "$event->{'from'}: ${months}mo = ${years}yr, ${weeks}wk, ${days}d, ${hours}hr, ${minutes}min, ${seconds}s, ${millifortnights}mf");
|
||||
}
|
||||
|
||||
sub convertWeeks {
|
||||
my $self = shift;
|
||||
my($event, $input) = @_;
|
||||
my $accurateSeconds = $input * 60.0 * 60.0 * 24.0 * 7.0;
|
||||
my $years = sigfig(3, $accurateSeconds / (60.0 * 60.0 * 24.0 * 365.25));
|
||||
my $months = sigfig(3, $accurateSeconds / (60.0 * 60.0 * 24.0 * (365.25 / 12)));
|
||||
my $weeks = sigfig(3, $input);
|
||||
my $millifortnights = sigfig(3, $accurateSeconds / (60.0 * 60.0 * 24.0 * (365.25 / (365.25 / 7.0)) * 2.0 / 1000.0));
|
||||
my $days = sigfig(3, $accurateSeconds / (60.0 * 60.0 * 24.0));
|
||||
my $hours = sigfig(3, $accurateSeconds / (60.0 * 60.0));
|
||||
my $minutes = sigfig(3, $accurateSeconds / 60.0);
|
||||
my $seconds = sigfig(3, $accurateSeconds);
|
||||
$self->say($event, "$event->{'from'}: ${weeks}wk = ${years}yr, ${months}mo, ${days}d, ${hours}hr, ${minutes}min, ${seconds}s, ${millifortnights}mf");
|
||||
}
|
||||
|
||||
sub convertMillifortnights {
|
||||
my $self = shift;
|
||||
my($event, $input) = @_;
|
||||
my $accurateSeconds = $input * 60.0 * 60.0 * 24.0 * 7.0 * 2.0 / 1000.0;
|
||||
my $years = sigfig(3, $accurateSeconds / (60.0 * 60.0 * 24.0 * 365.25));
|
||||
my $months = sigfig(3, $accurateSeconds / (60.0 * 60.0 * 24.0 * (365.25 / 12)));
|
||||
my $weeks = sigfig(3, $accurateSeconds / (60.0 * 60.0 * 24.0 * (365.25 / (365.25 / 7.0))));
|
||||
my $millifortnights = sigfig(3, $accurateSeconds / (60.0 * 60.0 * 24.0 * (365.25 / (365.25 / 7.0)) * 2.0 / 1000.0));
|
||||
my $days = sigfig(3, $accurateSeconds / (60.0 * 60.0 * 24.0));
|
||||
my $hours = sigfig(3, $accurateSeconds / (60.0 * 60.0));
|
||||
my $minutes = sigfig(3, $accurateSeconds / 60.0);
|
||||
my $seconds = sigfig(3, $accurateSeconds);
|
||||
$self->say($event, "$event->{'from'}: ${millifortnights}mf = ${years}yr, ${months}mo, ${weeks}wk, ${days}d, ${hours}hr, ${minutes}min, ${seconds}s");
|
||||
}
|
||||
|
||||
sub convertDays {
|
||||
my $self = shift;
|
||||
my($event, $input) = @_;
|
||||
my $accurateSeconds = $input * 60.0 * 60.0 * 24.0;
|
||||
my $years = sigfig(3, $accurateSeconds / (60.0 * 60.0 * 24.0 * 365.25));
|
||||
my $months = sigfig(3, $accurateSeconds / (60.0 * 60.0 * 24.0 * (365.25 / 12)));
|
||||
my $weeks = sigfig(3, $accurateSeconds / (60.0 * 60.0 * 24.0 * (365.25 / (365.25 / 7.0))));
|
||||
my $millifortnights = sigfig(3, $accurateSeconds / (60.0 * 60.0 * 24.0 * (365.25 / (365.25 / 7.0)) * 2.0 / 1000.0));
|
||||
my $days = sigfig(3, $accurateSeconds / (60.0 * 60.0 * 24.0));
|
||||
my $hours = sigfig(3, $accurateSeconds / (60.0 * 60.0));
|
||||
my $minutes = sigfig(3, $accurateSeconds / 60.0);
|
||||
my $seconds = sigfig(3, $accurateSeconds);
|
||||
$self->say($event, "$event->{'from'}: ${days}d = ${years}yr, ${months}mo, ${weeks}wk, ${hours}hr, ${minutes}min, ${seconds}s, ${millifortnights}mf");
|
||||
}
|
||||
|
||||
sub convertHours {
|
||||
my $self = shift;
|
||||
my($event, $input) = @_;
|
||||
my $accurateSeconds = $input * 60.0 * 60.0;
|
||||
my $years = sigfig(3, $accurateSeconds / (60.0 * 60.0 * 24.0 * 365.25));
|
||||
my $months = sigfig(3, $accurateSeconds / (60.0 * 60.0 * 24.0 * (365.25 / 12)));
|
||||
my $weeks = sigfig(3, $accurateSeconds / (60.0 * 60.0 * 24.0 * (365.25 / (365.25 / 7.0))));
|
||||
my $millifortnights = sigfig(3, $accurateSeconds / (60.0 * 60.0 * 24.0 * (365.25 / (365.25 / 7.0)) * 2.0 / 1000.0));
|
||||
my $days = sigfig(3, $accurateSeconds / (60.0 * 60.0 * 24.0));
|
||||
my $hours = sigfig(3, $accurateSeconds / (60.0 * 60.0));
|
||||
my $minutes = sigfig(3, $accurateSeconds / 60.0);
|
||||
my $seconds = sigfig(3, $accurateSeconds);
|
||||
$self->say($event, "$event->{'from'}: ${hours}hr = ${years}yr, ${months}mo, ${weeks}wk, ${days}d, ${minutes}min, ${seconds}s, ${millifortnights}mf");
|
||||
}
|
||||
|
||||
sub convertMinutes {
|
||||
my $self = shift;
|
||||
my($event, $input) = @_;
|
||||
my $accurateSeconds = $input * 60.0;
|
||||
my $years = sigfig(3, $accurateSeconds / (60.0 * 60.0 * 24.0 * 365.25));
|
||||
my $months = sigfig(3, $accurateSeconds / (60.0 * 60.0 * 24.0 * (365.25 / 12)));
|
||||
my $weeks = sigfig(3, $accurateSeconds / (60.0 * 60.0 * 24.0 * (365.25 / (365.25 / 7.0))));
|
||||
my $millifortnights = sigfig(3, $accurateSeconds / (60.0 * 60.0 * 24.0 * (365.25 / (365.25 / 7.0)) * 2.0 / 1000.0));
|
||||
my $days = sigfig(3, $accurateSeconds / (60.0 * 60.0 * 24.0));
|
||||
my $hours = sigfig(3, $accurateSeconds / (60.0 * 60.0));
|
||||
my $minutes = sigfig(3, $accurateSeconds / 60.0);
|
||||
my $seconds = sigfig(3, $accurateSeconds);
|
||||
$self->say($event, "$event->{'from'}: ${minutes}min = ${years}yr, ${months}mo, ${weeks}wk, ${days}d, ${hours}hr, ${seconds}s, ${millifortnights}mf");
|
||||
}
|
||||
|
||||
sub convertSeconds {
|
||||
my $self = shift;
|
||||
my($event, $input) = @_;
|
||||
my $accurateSeconds = $input;
|
||||
my $years = sigfig(3, $accurateSeconds / (60.0 * 60.0 * 24.0 * 365.25));
|
||||
my $months = sigfig(3, $accurateSeconds / (60.0 * 60.0 * 24.0 * (365.25 / 12)));
|
||||
my $weeks = sigfig(3, $accurateSeconds / (60.0 * 60.0 * 24.0 * (365.25 / (365.25 / 7.0))));
|
||||
my $millifortnights = sigfig(3, $accurateSeconds / (60.0 * 60.0 * 24.0 * (365.25 / (365.25 / 7.0)) * 2.0 / 1000.0));
|
||||
my $days = sigfig(3, $accurateSeconds / (60.0 * 60.0 * 24.0));
|
||||
my $hours = sigfig(3, $accurateSeconds / (60.0 * 60.0));
|
||||
my $minutes = sigfig(3, $accurateSeconds / 60.0);
|
||||
my $seconds = sigfig(3, $accurateSeconds);
|
||||
$self->say($event, "$event->{'from'}: ${seconds}s = ${years}yr, ${months}mo, ${weeks}wk, ${days}d, ${hours}hr, ${minutes}min, ${millifortnights}mf");
|
||||
}
|
||||
|
||||
|
||||
# Mass
|
||||
|
||||
sub convertGrams {
|
||||
my $self = shift;
|
||||
my($event, $input) = @_;
|
||||
my $accurateGrams = $input;
|
||||
my $grams = sigfig(3, $accurateGrams);
|
||||
my $kgs = sigfig(3, $accurateGrams / 1000.0);
|
||||
my $ounces = sigfig(3, $accurateGrams * 0.03527);
|
||||
my $pounds = sigfig(3, $accurateGrams * 0.002205);
|
||||
my $stones = sigfig(3, $accurateGrams * 0.00016);
|
||||
$self->say($event, "$event->{'from'}: ${grams}g = ${kgs}kg, ${ounces}oz, ${pounds}lbs, ${stones}stone");
|
||||
}
|
||||
|
||||
sub convertKilograms {
|
||||
my $self = shift;
|
||||
my($event, $input) = @_;
|
||||
my $accurateGrams = $input * 1000.0;
|
||||
my $grams = sigfig(3, $accurateGrams);
|
||||
my $kgs = sigfig(3, $input);
|
||||
my $ounces = sigfig(3, $accurateGrams * 0.03527);
|
||||
my $pounds = sigfig(3, $accurateGrams * 0.002205);
|
||||
my $stones = sigfig(3, $accurateGrams * 0.00016);
|
||||
$self->say($event, "$event->{'from'}: ${kgs}kg = ${grams}g, ${ounces}oz, ${pounds}lbs, ${stones}stone");
|
||||
}
|
||||
|
||||
sub convertPounds {
|
||||
my $self = shift;
|
||||
my($event, $input) = @_;
|
||||
my $accurateGrams = $input * 453.6;
|
||||
my $grams = sigfig(3, $accurateGrams);
|
||||
my $kgs = sigfig(3, $accurateGrams / 1000.0);
|
||||
my $ounces = sigfig(3, $accurateGrams * 0.03527);
|
||||
my $pounds = sigfig(3, $input);
|
||||
my $stones = sigfig(3, $accurateGrams * 0.00016);
|
||||
$self->say($event, "$event->{'from'}: ${pounds}lbs = ${grams}g, ${kgs}kg, ${ounces}oz, ${stones}stone");
|
||||
}
|
||||
|
||||
sub convertOunces {
|
||||
my $self = shift;
|
||||
my($event, $input) = @_;
|
||||
my $accurateGrams = $input * 28.35;
|
||||
my $grams = sigfig(3, $accurateGrams);
|
||||
my $kgs = sigfig(3, $accurateGrams / 1000.0);
|
||||
my $ounces = sigfig(3, $input);
|
||||
my $pounds = sigfig(3, $accurateGrams * 0.002205);
|
||||
my $stones = sigfig(3, $accurateGrams * 0.00016);
|
||||
$self->say($event, "$event->{'from'}: ${ounces}oz = ${grams}g, ${kgs}kg, ${pounds}lbs, ${stones}stone");
|
||||
}
|
||||
|
||||
sub convertStones {
|
||||
my $self = shift;
|
||||
my($event, $input) = @_;
|
||||
my $accurateGrams = $input * 6350.3;
|
||||
my $grams = sigfig(3, $accurateGrams);
|
||||
my $kgs = sigfig(3, $accurateGrams / 1000.0);
|
||||
my $ounces = sigfig(3, $accurateGrams * 0.03527);
|
||||
my $pounds = sigfig(3, $accurateGrams * 0.002205);
|
||||
my $stones = sigfig(3, $accurateGrams * 0.00016);
|
||||
$self->say($event, "$event->{'from'}: ${stones}stone = ${grams}g, ${kgs}kg, ${ounces}oz, ${pounds}lbs");
|
||||
}
|
||||
|
||||
|
||||
# Utility Functions
|
||||
|
||||
sub round($$) {
|
||||
return sprintf("%.*f", @_);
|
||||
}
|
||||
|
||||
sub sigfig($$) {
|
||||
my($sf, $float) = @_;
|
||||
my $length = length(int($float));
|
||||
if ($length == $sf) {
|
||||
$float = int($float);
|
||||
} elsif ($length > $sf) {
|
||||
my $factor = (10 ** ($length - $sf));
|
||||
$float = int($float / $factor) * $factor;
|
||||
} else {
|
||||
my $factor = 0;
|
||||
while (length(int($float * 10 ** $factor)) < $sf) {
|
||||
$factor++;
|
||||
}
|
||||
$float = int($float * 10 ** $factor) / (10 ** $factor);
|
||||
}
|
||||
$float = sprintf("%g", $float);
|
||||
$float =~ s/e(?:\+|(-))0*/x10^$1/os;
|
||||
return $float;
|
||||
}
|
||||
@@ -1,60 +0,0 @@
|
||||
# -*- Mode: perl; tab-width: 4; indent-tabs-mode: nil; -*-
|
||||
################################
|
||||
# Currencies Module #
|
||||
################################
|
||||
# Originally by Alex Schuilenburg <alex@schuilenburg.org>
|
||||
|
||||
package BotModules::Currencies;
|
||||
use vars qw(@ISA);
|
||||
@ISA = qw(BotModules);
|
||||
1;
|
||||
|
||||
sub Help {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
return {
|
||||
'' => 'This module gets mid-market currency exchange rates from: http://www.xe.com/ucc/full.shtml',
|
||||
'currency' => 'Call this command with two currency symbols to get the exchange rate. Syntax: \'currency [value] SYM/SYM\'. For the list of supported currencies, see: http://www.xe.com/iso4217.htm',
|
||||
};
|
||||
}
|
||||
|
||||
sub Told {
|
||||
my $self = shift;
|
||||
my ($event, $message) = @_;
|
||||
if ($message =~ /^\s*(?:currency|how\s+much\s+is|what\s+is|what\s+are)\s+(\d*(?:.\d+)?)\s*([A-Z]{3})s?\s*(?:\/|in|as)\s*([A-Z]{3})s?[\s?!.]*$/osi) {
|
||||
my $amount = $1 || 1;
|
||||
my $from = uc $2;
|
||||
my $to = uc $3;
|
||||
$self->getURI($event, "http://www.xe.com/ucc/convert.cgi?From=$from&To=$to&Amount=$amount", 'currency', $from, $to);
|
||||
} else {
|
||||
return $self->SUPER::Told(@_);
|
||||
}
|
||||
return 0; # we've dealt with it, no need to do anything else.
|
||||
}
|
||||
|
||||
sub GotURI {
|
||||
my $self = shift;
|
||||
my ($event, $uri, $output, $cmd, $from, $to) = @_;
|
||||
$self->debug($output);
|
||||
my $message = "$event->{'from'}: ";
|
||||
if ($cmd eq 'currency') {
|
||||
my $fromval;
|
||||
if ($output =~ m/([\d,]+\.\d+)\s+$from/s) {
|
||||
$fromval = $1;
|
||||
}
|
||||
my $toval;
|
||||
if ($output =~ m/([\d,]+\.\d+)\s+$to/s) {
|
||||
$toval = $1;
|
||||
}
|
||||
if (defined $fromval and defined $toval) {
|
||||
$message .= "$fromval $from = $toval $to (mid-market rates from xe.com)";
|
||||
} elsif ($output =~ m/The following error occurred:<BR><BR>\s*(.+?)\s*<\//os) {
|
||||
$message .= "xe.com said: $1";
|
||||
} else {
|
||||
$message .= 'I\'m afraid I can\'t get currency conversions right now. Sorry.';
|
||||
}
|
||||
} else {
|
||||
return $self->SUPER::GotURI(@_);
|
||||
}
|
||||
$self->say($event, $message);
|
||||
}
|
||||
@@ -1,248 +0,0 @@
|
||||
################################
|
||||
# FTP Module #
|
||||
################################
|
||||
|
||||
package BotModules::FTP;
|
||||
use vars qw(@ISA);
|
||||
use Net::FTP;
|
||||
@ISA = qw(BotModules);
|
||||
1;
|
||||
|
||||
# RegisterConfig - Called when initialised, should call registerVariables
|
||||
sub RegisterConfig {
|
||||
my $self = shift;
|
||||
$self->SUPER::RegisterConfig(@_);
|
||||
$self->registerVariables(
|
||||
# [ name, save?, settable? ]
|
||||
['host', 1, 1, 'ftp.mozilla.org'],
|
||||
['path', 1, 1, '/pub/mozilla/nightly/latest'],
|
||||
['updateDelay', 1, 1, 600],
|
||||
['preferredLineLength', 1, 1, 80],
|
||||
['data', 0, 0, {}], # data -> file -> datetime stamp
|
||||
['mutes', 1, 1, ''], # "channel channel channel"
|
||||
);
|
||||
}
|
||||
|
||||
# Schedule - called when bot connects to a server, to install any schedulers
|
||||
# use $self->schedule($event, $delay, $times, $data)
|
||||
# where $times is 1 for a single event, -1 for recurring events,
|
||||
# and a +ve number for an event that occurs that many times.
|
||||
sub Schedule {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
$self->schedule($event, \$self->{'updateDelay'}, -1, 'ftp');
|
||||
$self->SUPER::Schedule($event);
|
||||
}
|
||||
|
||||
sub Help {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
my %commands = (
|
||||
'' => "This module monitors the FTP site 'ftp://$self->{'host'}$self->{'path'}/' and reports new files as they appear.",
|
||||
'ftp' => 'On its own, lists the currently available files. With a suffix, does a substring search and reports all files matching that pattern. Syntax: \'ftp [pattern]\'',
|
||||
);
|
||||
if ($self->isAdmin($event)) {
|
||||
$commands{'mute'} = 'Disable reporting of new files in a channel. Syntax: mute ftp in <channel>';
|
||||
$commands{'unmute'} = 'Enable reporting of new files in a channel. Syntax: unmute ftp in <channel>';
|
||||
}
|
||||
return \%commands;
|
||||
}
|
||||
|
||||
sub Told {
|
||||
my $self = shift;
|
||||
my ($event, $message) = @_;
|
||||
if ($message =~ /^\s*ftp(?:\s+(\S+?))?\s*\?*\s*$/osi) {
|
||||
$self->spawnChild($event, \&ftp_check, [$self, $self->{'path'}, $self->{'host'}], 'ftp', [$event, $1]);
|
||||
} elsif ($self->isAdmin($event)) {
|
||||
if ($message =~ /^\s*mute\s+ftp\s+in\s+(\S+?)\s*$/osi) {
|
||||
$self->{'mutes'} .= " $1";
|
||||
$self->saveConfig();
|
||||
$self->say($event, "$event->{'from'}: Reporting of new files disabled in channel $1.");
|
||||
} elsif ($message =~ /^\s*unmute\s+ftp\s+in\s+(\S+)\s*$/osi) {
|
||||
my %mutedChannels = map { $_ => 1 } split(/ /o, $self->{'mutes'});
|
||||
delete($mutedChannels{$1}); # get rid of any mentions of that channel
|
||||
$self->{'mutes'} = join(' ', keys(%mutedChannels));
|
||||
$self->saveConfig();
|
||||
$self->say($event, "$event->{'from'}: Reporting of new files reenabled in channel $1.");
|
||||
} else {
|
||||
return $self->SUPER::Told(@_);
|
||||
}
|
||||
} else {
|
||||
return $self->SUPER::Told(@_);
|
||||
}
|
||||
}
|
||||
|
||||
sub Scheduled {
|
||||
my $self = shift;
|
||||
my ($event, @data) = @_;
|
||||
if ($data[0] eq 'ftp') {
|
||||
$self->spawnChild($event, \&ftp_check, [$self, $self->{'path'}, $self->{'host'}], 'ftp', [undef]);
|
||||
} else {
|
||||
$self->SUPER::Scheduled($event, @data);
|
||||
}
|
||||
}
|
||||
|
||||
# ChildCompleted - Called when a child process has quit
|
||||
sub ChildCompleted {
|
||||
my $self = shift;
|
||||
my ($event, $type, $output, @data) = @_;
|
||||
if ($type eq 'ftp') {
|
||||
my @output = split(/\n/os, $output);
|
||||
if (shift(@output)) {
|
||||
my @new = ();
|
||||
while (@output) {
|
||||
my ($file, $stamp) = (shift(@output), shift(@output));
|
||||
if ((defined($self->{'data'}->{$file})) and ($self->{'data'}->{$file} < $stamp)) {
|
||||
push(@new, $file);
|
||||
}
|
||||
$self->{'data'}->{$file} = $stamp;
|
||||
}
|
||||
if ((defined($self->{'_ready'})) and (scalar(@new))) {
|
||||
my $s = scalar(@new) > 1 ? 's' : '';
|
||||
@output = $self->prettyPrint($self->{'preferredLineLength'},
|
||||
"New file$s in ftp://$self->{'host'}$self->{'path'}/ : ",
|
||||
'', ' ', @new);
|
||||
foreach my $channel (@{$self->{'channels'}}) {
|
||||
unless ($self->{'mutes'} =~ /^(.*\s|)\Q$channel\E(|\s.*)$/si) {
|
||||
$event->{'target'} = $channel;
|
||||
foreach (@output) {
|
||||
$self->say($event, $_);
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
$self->{'_ready'} = 1;
|
||||
if ($data[0]) {
|
||||
$self->ftp_stamp($event, $data[1]);
|
||||
}
|
||||
} else {
|
||||
if ($data[0]) {
|
||||
$self->say($event, "I could not contact $self->{'host'}, sorry.");
|
||||
}
|
||||
$self->tellAdmin($event, "Dude, I'm having a problem with FTP. Could you prod $self->{'host'} for me please? Or fix my config? Cheers.");
|
||||
}
|
||||
} else {
|
||||
$self->SUPER::ChildCompleted($event, $type, $output, @data);
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
|
||||
# The following is directly from the original techbot (mozbot 1.5), written by timeless.
|
||||
# The only changes I made were to port it to the mozbot2 architecture. Those changes
|
||||
# are commented.
|
||||
|
||||
sub day_str {
|
||||
my (@stamp,$ahr,$amn,$asc);
|
||||
($asc, $amn, $ahr, @stamp)=gmtime($_[3]);
|
||||
$asc = "0$asc" if $asc < 10; # \
|
||||
$amn = "0$amn" if $amn < 10; # -- added these to zero-pad output
|
||||
$ahr = "0$ahr" if $ahr < 10; # /
|
||||
return "$_[4] ($ahr:$amn:$asc) " # added extra space to neaten output
|
||||
if ($stamp[0]==$_[0] && $stamp[1]==$_[1] && $stamp[2]==$_[2]);
|
||||
}
|
||||
|
||||
sub ftp_stamp {
|
||||
|
||||
# It seems that the original wanted ($to, $cmd, $rest) as the arguments.
|
||||
# However, it doesn't use $to except at the end (which we replace) and
|
||||
# it doesn't use $cmd at all. This is lucky for us, since the first
|
||||
# argument of methods is always the object ref.
|
||||
my $self = $_[0];
|
||||
# This function also expects to be able to use a global (!) variable
|
||||
# called %latestbuilds. We grandfather that by making a lexically scoped
|
||||
# copy of one of our object fields.
|
||||
my %latestbuilds = %{$self->{'data'}};
|
||||
# We have to keep a copy of $event around for when we send out the
|
||||
# output, of course. So let's use the second argument for that:
|
||||
my $event = $_[1];
|
||||
# Finally, we have to work around a serious bug in the original version,
|
||||
# which assumed any pattern input was valid regexp. [XXX use eval]
|
||||
$_[2] = defined($_[2]) ? quotemeta($_[2]) : 0;
|
||||
# In summary, call this function like this:
|
||||
# $self->ftp_stamp($event, $pattern);
|
||||
|
||||
|
||||
# various instances of time() below were changed to use $event->{'time'}
|
||||
# so that we are less prone to time drift
|
||||
my @day=gmtime($event->{'time'}); my @tm=@day[0..2]; @day=@day[3..5];
|
||||
my (@filestamp, $filelist, $ahr,$amn,$asc);
|
||||
if ($_[2]){ # this code's output is *VERY* ugly. But I just took it as is, so deal with it. Patches welcome.
|
||||
foreach my $filename (keys %latestbuilds){
|
||||
my @ltm=gmtime($latestbuilds{$filename});
|
||||
$filelist.="$filename [".($ltm[5]+1900).'-'.($ltm[4]+1)."-$ltm[3] $ltm[2]:$ltm[1]:$ltm[0]]"
|
||||
if $filename=~/$_[2]/;
|
||||
}
|
||||
$filelist=$filelist||'<nothing matched>';
|
||||
$filelist="Files matching re:$_[2] [gmt] $filelist";
|
||||
}else{
|
||||
foreach my $filename (keys %latestbuilds){
|
||||
$filelist.=day_str(@day[0..2],$latestbuilds{$filename},$filename);
|
||||
}
|
||||
if ($filelist){
|
||||
$filelist="Files from today [gmt] $filelist";
|
||||
} else {
|
||||
foreach my $filename (keys %latestbuilds){
|
||||
@day=gmtime($event->{'time'}-86400); @day=@day[3..5];
|
||||
$filelist.=day_str(@day[0..2],$latestbuilds{$filename},$filename);
|
||||
}
|
||||
$filelist="Files from yesterday [gmt] $filelist"|| # next line changed from " to \' and added missing '>'
|
||||
'<No files in the past two days by gmt, try \'ftp .\' for a complete filelist>';
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
# Append the current time for those not in GMT time zones
|
||||
my @time;
|
||||
foreach (@tm) {
|
||||
# zero pad the time
|
||||
$_ = "0$_" if $_ < 10;
|
||||
# switch digits around (@tm is in reverse order)
|
||||
unshift(@time, $_);
|
||||
}
|
||||
# output
|
||||
local $";
|
||||
$" = ':';
|
||||
$filelist .= " time now: @time";
|
||||
# Ok, now we want to send out the results (held in $filelist).
|
||||
$self->say($event, $filelist);
|
||||
}
|
||||
|
||||
|
||||
sub ftp_check {
|
||||
|
||||
# ok, this function has been hacked for the new architecture.
|
||||
# ftp_check is called in a spawned child.
|
||||
# It returns the output in a fixed format back to the parent
|
||||
# process. The format is
|
||||
# 1
|
||||
# file
|
||||
# timestamp
|
||||
# file
|
||||
# timestamp
|
||||
# if it fails, the '1' will be missing (no output).
|
||||
# It should be passed the following arguments:
|
||||
# [$self, $path, $server]
|
||||
my $self = $_[0];
|
||||
my $output = '';
|
||||
|
||||
my $buf='';
|
||||
my $mdtms;
|
||||
my $ftpserver=$_[2];
|
||||
my $ftp = new Net::FTP($ftpserver, Debug => 0, Passive => 1);
|
||||
if ($ftp){
|
||||
$output .= "1\n"; # how we find out if it worked or not
|
||||
if ($ftp->login('anonymous','mozbot@localhost')){
|
||||
$ftp->cwd($_[1]); # path used to be hardcoded
|
||||
for my $f ($ftp->ls){
|
||||
$mdtms=$ftp->mdtm($f);
|
||||
$output .= "$f\n$mdtms\n"; # output to pipe instead of irc
|
||||
}
|
||||
$ftp->quit;
|
||||
};
|
||||
}
|
||||
|
||||
# now send out the buffered output
|
||||
return $output;
|
||||
|
||||
}
|
||||
@@ -1,83 +0,0 @@
|
||||
################################
|
||||
# Filter Module #
|
||||
################################
|
||||
|
||||
# The canonical filters should be installed on your path somewhere.
|
||||
# You can get the source from these from your local distributor.
|
||||
|
||||
package BotModules::Filter;
|
||||
use vars qw(@ISA);
|
||||
use IPC::Open2;
|
||||
@ISA = qw(BotModules);
|
||||
1;
|
||||
|
||||
my @Filters = (
|
||||
'b1ff',
|
||||
'chef',
|
||||
'cockney',
|
||||
'eleet',
|
||||
'jethro',
|
||||
'jibberish',
|
||||
'jive',
|
||||
'kraut',
|
||||
'nyc',
|
||||
'rasterman',
|
||||
'upside-down',
|
||||
);
|
||||
|
||||
sub Help {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
my $reply = {
|
||||
'' => 'This module is an interface to the text filter applications.',
|
||||
};
|
||||
foreach (@Filters) {
|
||||
$reply->{$_} = "Pass the text through the $_ filter. Syntax: $_ <text>";
|
||||
}
|
||||
if ($self->isAdmin($event)) {
|
||||
$reply->{'filtersay'} = "Pass text through a filter and send it to a channel. Syntax: filtersay <filter> <channel> <text>";
|
||||
}
|
||||
return $reply;
|
||||
}
|
||||
|
||||
sub Told {
|
||||
my $self = shift;
|
||||
my ($event, $message) = @_;
|
||||
foreach (@Filters) {
|
||||
if ($message =~ /^\s*\Q$_\E\s+(.+?)\s*$/si) {
|
||||
$self->spawnChild($event, sub { return $self->Filter(@_); }, [$_, $1], 'filter', []);
|
||||
return 0; # we've dealt with it, no need to do anything else.
|
||||
} elsif (($message =~ /^\s*filtersay\s+\Q$_\E\s+(\S+)\s+(.+?)\s*$/si) and ($self->isAdmin($event))) {
|
||||
$self->spawnChild($event, sub { return $self->Filter(@_); }, [$_, $2], 'filter', [$1]);
|
||||
return 0; # we've dealt with it, no need to do anything else.
|
||||
}
|
||||
}
|
||||
return $self->SUPER::Told(@_);
|
||||
}
|
||||
|
||||
sub Filter {
|
||||
my $self = shift;
|
||||
my($filter, $text) = @_;
|
||||
my $reader;
|
||||
my $writer;
|
||||
local $/ = undef;
|
||||
my $pid = open2($reader, $writer, $filter);
|
||||
print $writer $text;
|
||||
close($writer);
|
||||
my $reply = <$reader>;
|
||||
close($reader);
|
||||
waitpid($pid, 0);
|
||||
return $reply;
|
||||
}
|
||||
|
||||
# ChildCompleted - Called when a child process has quit
|
||||
sub ChildCompleted {
|
||||
my $self = shift;
|
||||
my ($event, $type, $output, @data) = @_;
|
||||
if ($type eq 'filter') {
|
||||
local $event->{'target'} = $data[0] if defined($data[0]);
|
||||
$self->say($event, $output);
|
||||
} else {
|
||||
return $self->SUPER::ChildCompleted(@_);
|
||||
}
|
||||
}
|
||||
@@ -1,102 +0,0 @@
|
||||
# -*- Mode: perl; indent-tabs-mode: nil -*-
|
||||
# $Id: Flood.bm,v 1.2 2003-10-03 15:46:54 ian%hixie.ch Exp $
|
||||
###########################
|
||||
# Flood Protection module #
|
||||
###########################
|
||||
|
||||
package BotModules::Flood;
|
||||
use vars qw(@ISA);
|
||||
@ISA = qw(BotModules);
|
||||
1;
|
||||
|
||||
sub RegisterConfig {
|
||||
my $self = shift;
|
||||
$self->SUPER::RegisterConfig(@_);
|
||||
|
||||
foreach my $chan (@{$self->{'channels'}}) {
|
||||
$self->registerVariables( ["join_$chan", 0, 0, []] );
|
||||
}
|
||||
$self->registerVariables(
|
||||
['numberOfJoins', 1, 1, '7'],
|
||||
['secondsToTrigger', 1, 1, '2'],
|
||||
['minutesToProtect', 1, 1, '5'],
|
||||
);
|
||||
}
|
||||
|
||||
sub Help {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
return {
|
||||
'' => 'This module will help control "join flood" attacks on IRC',
|
||||
};
|
||||
}
|
||||
|
||||
# Set - called to set a variable to a particular value.
|
||||
sub Set {
|
||||
my $self = shift;
|
||||
my ($event, $variable, $value) = @_;
|
||||
# If changing the setting for numberOfJoins make sure
|
||||
# that the arrays are empty. Otherwise, reducing the
|
||||
# numberOfJoins value would not work properly.
|
||||
if ($variable eq 'numberOfJoins') {
|
||||
foreach my $chan (@{$self->{'channels'}}) {
|
||||
@{$self->{"join_$chan"}} = ();
|
||||
}
|
||||
}
|
||||
# now actually do the setting of the variable
|
||||
return $self->SUPER::Set($event, $variable, $value);
|
||||
}
|
||||
|
||||
sub JoinedChannel {
|
||||
my $self = shift;
|
||||
my ($event, $channel) = @_;
|
||||
$self->registerVariables( ["join_$channel", 0, 0, []] );
|
||||
return $self->SUPER::JoinedChannel($event, $channel); # call inherited method
|
||||
}
|
||||
|
||||
sub SpottedJoin {
|
||||
my $self = shift;
|
||||
my ($event, $channel, $who) = @_;
|
||||
# If numberOfJoins or secondsToTrigger is not a positive Integer, don't do anything
|
||||
if ($self->{'numberOfJoins'} !~ m/^[1-9][0-9]*$/o || $self->{'secondsToTrigger'} !~ m/^[1-9][0-9]*$/o) {
|
||||
# We didn't do anything, so don't pretend like we did :)
|
||||
return $self->SUPER::SpottedJoin($event, $channel, $who);
|
||||
}
|
||||
# Here we have the 'join_times' array to push and shift to/from
|
||||
push(@{$self->{"join_$channel"}}, $event->{'time'});
|
||||
if (scalar(@{$self->{"join_$channel"}}) >= $self->{'numberOfJoins'}) {
|
||||
my $oldest = shift(@{$self->{"join_$channel"}});
|
||||
my $timechange = $event->{'time'} - $oldest;
|
||||
if ($self->{'secondsToTrigger'} >= $timechange) {
|
||||
# We have just seen many joins happen very quickly. This channel should
|
||||
# have its mode set to +i until an op can figure out what went wrong.
|
||||
$self->mode($event, $event->{'channel'}, '+i');
|
||||
my $extra_text = "";
|
||||
# If minutesToProtect is a positive integer we should set mode -i after
|
||||
# that number of minutes has passed.
|
||||
if ($self->{'minutesToProtect'} =~ m/^[1-9][0-9]*$/o) {
|
||||
my $seconds = $self->{'minutesToProtect'} * 60;
|
||||
my @mode = ('mode', $event->{'channel'}, '-i');
|
||||
$self->schedule($event, $seconds, 1, @mode);
|
||||
$extra_text = "I'll set it -i in $self->{'minutesToProtect'} minutes";
|
||||
}
|
||||
$self->say($event, "I just saw a lot of joins happen very quickly. Because of " .
|
||||
"that I set this channel's mode to be Invite Only... $extra_text");
|
||||
}
|
||||
}
|
||||
# By returning 0 we ensure that a join won't be processed more than once.
|
||||
return 0;
|
||||
}
|
||||
|
||||
sub Scheduled {
|
||||
my $self = shift;
|
||||
my ($event, @data) = @_;
|
||||
|
||||
my $what = shift(@data);
|
||||
if ($what eq 'mode') {
|
||||
$self->mode($event, @data);
|
||||
} else {
|
||||
# Call the inherited event
|
||||
return $self->SUPER::Schedule(@_);
|
||||
}
|
||||
}
|
||||
@@ -1,143 +0,0 @@
|
||||
################################
|
||||
# Fortune Cookie Module #
|
||||
################################
|
||||
|
||||
package BotModules::FortuneCookies;
|
||||
use vars qw(@ISA);
|
||||
@ISA = qw(BotModules);
|
||||
1;
|
||||
|
||||
sub Help {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
return {
|
||||
'' => 'A module to get random fortune cookies.',
|
||||
'fortune' => 'Same as \'cookie\', which see.',
|
||||
'cookie' => 'To get a fortune cookie, just tell me \'cookie\'. To set a new fortune cookie, see \'new\' (or \'add\'). To find out how many cookies are left, use \'cookie status\'.',
|
||||
'new' => 'To set a new fortune cookie, say \'new cookie\' followed by the text, e.g. \'new cookie: you will have a nice day\' or whatever. The string %from% will be replaced by the name of whoever requests the cookie.',
|
||||
'add' => 'To add a new fortune cookie, say \'add cookie\' followed by the text, e.g. \'add cookie: you will have a nice day\' or whatever. The string %from% will be replaced by the name of whoever requests the cookie.',
|
||||
'fetch' => 'The command \'fetch cookies from <uri>\' will add each line in <uri> to the cookie list. Cookie lists must start with one line that reads \'DATA FILE: cookies\' and must be at most 100 lines long. Blank lines and lines starting with a hash (\'#\') are ignored.',
|
||||
};
|
||||
}
|
||||
|
||||
# RegisterConfig - Called when initialised, should call registerVariables
|
||||
sub RegisterConfig {
|
||||
my $self = shift;
|
||||
$self->SUPER::RegisterConfig(@_);
|
||||
$self->registerVariables(
|
||||
# [ name, save?, settable? ]
|
||||
['cookies', 1, 1, ['The sun will rise in the east today, indicating nothing in particular.']],
|
||||
['cookiesIndex', 1, 1, 0],
|
||||
['cookiesLeft', 0, 1, 10],
|
||||
['bakingTime', 1, 1, 20],
|
||||
['cookiesMax', 1, 1, 10],
|
||||
);
|
||||
}
|
||||
|
||||
# Schedule - called when bot connects to a server, to install any schedulers
|
||||
# use $self->schedule($event, $delay, $times, $data)
|
||||
# where $times is 1 for a single event, -1 for recurring events,
|
||||
# and a +ve number for an event that occurs that many times.
|
||||
sub Schedule {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
$self->schedule($event, \$self->{'bakingTime'}, -1, 'newCookie');
|
||||
$self->SUPER::Schedule($event);
|
||||
}
|
||||
|
||||
sub Told {
|
||||
my $self = shift;
|
||||
my ($event, $message) = @_;
|
||||
if ($message =~ /^\s*(?:please[,.!1?]*\s+)?(?:(?:can|could)\s+i\s+have\s+a\s+|give\s+me\s+a\s+)?(?:fortune\s+cookie|fortune|cookie)(?:[,!1.\s]+now)?(?:[,!1.\s]+please)?\s*[?!1.]*\s*$/osi) {
|
||||
if ($self->{'cookiesLeft'} > 0) {
|
||||
$self->{'cookiesLeft'}--;
|
||||
my $cookie = $self->GetNext('cookies');
|
||||
$cookie =~ s/%from%/$event->{'from'}/gos;
|
||||
$self->say($event, $cookie);
|
||||
} else {
|
||||
$self->say($event, 'I\'m sorry, I\'ve run out of cookies! You\'ll have to wait for me to bake some more.');
|
||||
}
|
||||
} elsif ($message =~ /^\s*(?:new|add)\s+(?:fortune\s+cookie|fortune|cookie)[-!:,;.\s]+(.....+?)\s*$/osi) {
|
||||
if (not $self->findEntry('cookies', $1)) {
|
||||
push(@{$self->{'cookies'}}, $1);
|
||||
my $count = scalar(@{$self->{'cookies'}});
|
||||
$self->say($event, "$event->{'from'}: Thanks! I have added that fortune cookie to my recipe book. I now have $count fortunes!");
|
||||
$self->saveConfig();
|
||||
} else {
|
||||
$self->say($event, "$event->{'from'}: I'm pretty sure I already know that one.");
|
||||
}
|
||||
} elsif ($message =~ /^\s*cookie\s+(?:report|status|status\s+report)(?:\s+please)?[?!.1]*\s*$/osi) {
|
||||
my $count = scalar(@{$self->{'cookies'}});
|
||||
$self->say($event, "My cookie basket has $self->{'cookiesLeft'} cookies left out of possible $self->{'cookiesMax'}. I have $count fortunes in my recipe book.");
|
||||
} elsif ($message =~ /^\s*fetch\s+cookies\s+from\s+(.+?)\s*$/osi) {
|
||||
$self->getURI($event, $1, 'cookies');
|
||||
} else {
|
||||
return $self->SUPER::Told(@_);
|
||||
}
|
||||
return 0; # we've dealt with it, no need to do anything else.
|
||||
}
|
||||
|
||||
sub GetNext {
|
||||
my $self = shift;
|
||||
my ($list) = @_;
|
||||
$self->{"${list}Index"} = 0 if $self->{"${list}Index"} > $#{$self->{$list}};
|
||||
my $reply = $self->{$list}->[$self->{"${list}Index"}++];
|
||||
# should add some deterministic way of making the output appear more random here XXX
|
||||
$self->saveConfig();
|
||||
return $reply;
|
||||
}
|
||||
|
||||
sub findEntry {
|
||||
my $self = shift;
|
||||
my ($list, $cookie) = @_;
|
||||
$cookie =~ s/[\s,;.!?:]/_/gos;
|
||||
$cookie = quotemeta($cookie);
|
||||
$cookie =~ s/_/.*/gos;
|
||||
my $regexp = qr/^$cookie$/is;
|
||||
foreach my $text (@{$self->{$list}}) {
|
||||
return 1 if $text =~ /$regexp/;
|
||||
}
|
||||
return 0;
|
||||
}
|
||||
|
||||
sub Scheduled {
|
||||
my $self = shift;
|
||||
my ($event, @data) = @_;
|
||||
if ($data[0] eq 'newCookie') {
|
||||
$self->{'cookiesLeft'}++ unless $self->{'cookiesLeft'} >= $self->{'cookiesMax'};
|
||||
} else {
|
||||
$self->SUPER::Scheduled($event, @data);
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
sub GotURI {
|
||||
my $self = shift;
|
||||
my ($event, $uri, $output, $type) = @_;
|
||||
if ($type eq 'cookies') {
|
||||
my @output = split(/[\n\r]+/os, $output);
|
||||
if ((@output) and ($output[0] eq "DATA FILE: $type")) {
|
||||
if (@output <= 100) {
|
||||
my $count = 0;
|
||||
foreach (@output[1..$#output]) {
|
||||
if (/^[^#].+$/os and length($_) < 255 and not $self->findEntry($type, $_)) {
|
||||
push(@{$self->{$type}}, $_);
|
||||
$count++;
|
||||
}
|
||||
}
|
||||
my $total = scalar(@{$self->{$type}});
|
||||
my $s = $count > 1 ? 's' : '';
|
||||
if ($type eq 'cookies') {
|
||||
$self->say($event, "$event->{'from'}: Thanks! I have added $count fortune cookie$s to my recipe book. I now have $total fortunes!");
|
||||
}
|
||||
$self->saveConfig();
|
||||
} else {
|
||||
$self->say($event, "$event->{'from'}: Sorry, but you can only import 100 lines at a time.");
|
||||
}
|
||||
} else {
|
||||
$self->say($event, "$event->{'from'}: Sorry, but that's not a valid data file.");
|
||||
}
|
||||
} else {
|
||||
return $self->SUPER::GotURI(@_);
|
||||
}
|
||||
}
|
||||
@@ -1,171 +0,0 @@
|
||||
# -*- Mode: perl; tab-width: 4; indent-tabs-mode: nil; -*-
|
||||
################################
|
||||
# General Module #
|
||||
################################
|
||||
|
||||
package BotModules::General;
|
||||
use vars qw(@ISA);
|
||||
@ISA = qw(BotModules);
|
||||
1;
|
||||
|
||||
my $VERSION = '2.6';
|
||||
|
||||
# RegisterConfig - Called when initialised, should call registerVariables
|
||||
sub RegisterConfig {
|
||||
my $self = shift;
|
||||
$self->SUPER::RegisterConfig(@_);
|
||||
$self->registerVariables(
|
||||
# [ name, save?, settable?, value ]
|
||||
['preferredHelpLineLength', 1, 1, 90],
|
||||
['helpStyle', 1, 1, 'compact'], # change this to 'tidy' to use alternate style
|
||||
);
|
||||
}
|
||||
|
||||
sub Help {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
return {
|
||||
'' => 'The module that provides the bot-wide services.',
|
||||
'help' => 'Gives information about modules and commands. Syntax: help [<topic>]',
|
||||
'shutup' => 'Tells the bot to stop talking to you. Syntax: shut up',
|
||||
};
|
||||
}
|
||||
|
||||
# Told - Called for messages prefixed by the bot's nick
|
||||
sub Told {
|
||||
my $self = shift;
|
||||
my ($event, $message) = @_;
|
||||
if ($message =~ /^\s*(?:help|commands?)(?:\s+($variablepattern))?[ ?!.]*\s*$/osi) {
|
||||
if ($1) {
|
||||
# display help for that command
|
||||
# first, build the help file...
|
||||
my %topicList;
|
||||
foreach my $module (@modules) {
|
||||
my $commands;
|
||||
eval {
|
||||
$commands = $module->Help($event);
|
||||
};
|
||||
if ($@) {
|
||||
$self->debug("Module $module is having errors reporting help:\n$@");
|
||||
next;
|
||||
}
|
||||
if ($commands->{''}) {
|
||||
my @commands = grep { /./os } keys %$commands;
|
||||
$topicList{lc($module->{'_name'})} = [] unless defined($topicList{lc($module->{'_name'})});
|
||||
push(@{$topicList{lc($module->{'_name'})}}, $commands->{''});
|
||||
if (@commands) {
|
||||
local $" = ', ';
|
||||
push(@{$topicList{lc($module->{'_name'})}}, "The $module->{'_name'} module has the following help topics: @commands");
|
||||
}
|
||||
}
|
||||
foreach (keys %$commands) {
|
||||
$topicList{lc($_)} = [] unless defined($topicList{lc($_)});
|
||||
push(@{$topicList{lc($_)}}, $commands->{$_});
|
||||
}
|
||||
}
|
||||
if (defined($topicList{lc($1)})) {
|
||||
foreach (@{$topicList{lc($1)}}) {
|
||||
$self->say($event, "$1: $_");
|
||||
}
|
||||
} else {
|
||||
$self->say($event, "No help for topic '$1'.");
|
||||
}
|
||||
} else {
|
||||
my $helpline = $self->getHelpLine();
|
||||
$self->directSay($event, "Help topics for mozbot $VERSION ($helpline):");
|
||||
$self->say($event, "$event->{'from'}: help info /msg'ed") if ($event->{'channel'});
|
||||
if ($self->{'helpStyle'} eq 'compact') {
|
||||
$self->printHelpCompact($event);
|
||||
} else {
|
||||
$self->printHelpTidy($event);
|
||||
}
|
||||
$self->directSay($event, 'For help on a particular topic, type \'help <topic>\'. Note that some commands may be disabled in certain channels.');
|
||||
}
|
||||
} elsif ($message =~ /^\s*shut\s*up\s*$/osi) {
|
||||
my $queue = $self->getMessageQueue();
|
||||
my @messages = @$queue;
|
||||
@$queue = ();
|
||||
my $count = 0;
|
||||
if ($event->{'channel'}) {
|
||||
foreach my $message (@messages) {
|
||||
if ($message->[0] eq $event->{'channel'} and
|
||||
ref $message->[1] eq 'SCALAR' and
|
||||
$message->[1] =~ m/^\Q$event->{'from'}\E:/osi) {
|
||||
++$count;
|
||||
} else {
|
||||
push(@$queue, $message);
|
||||
}
|
||||
}
|
||||
} else {
|
||||
foreach my $message (@messages) {
|
||||
if (lc $message->[0] eq lc $event->{'from'}) {
|
||||
++$count;
|
||||
} else {
|
||||
push(@$queue, $message);
|
||||
}
|
||||
}
|
||||
}
|
||||
if ($count) {
|
||||
$self->say($event, "$event->{'from'}: Dropped $count messages.");
|
||||
} else {
|
||||
$self->say($event, "$event->{'from'}: I wasn't talking to you.");
|
||||
}
|
||||
} else {
|
||||
return $self->SUPER::Told(@_);
|
||||
}
|
||||
return 0; # dealt with it, do nothing else
|
||||
}
|
||||
|
||||
sub CTCPVersion {
|
||||
my $self = shift;
|
||||
my ($event, $who, $what) = @_;
|
||||
my @modulenames = $self->getModules();
|
||||
local $" = ', ';
|
||||
$self->ctcpReply($event, 'VERSION', "mozbot $VERSION (@modulenames)");
|
||||
}
|
||||
|
||||
sub printHelpCompact {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
local $" = ', '; # to reset font-lock: "
|
||||
my @helplist;
|
||||
foreach my $module ($self->getModules()) {
|
||||
$module = $self->getModule($module);
|
||||
my %commands = %{$module->Help($event)};
|
||||
my $moduleHelp = delete($commands{''});
|
||||
my @commands = sort keys %commands;
|
||||
if (@commands) {
|
||||
push(@helplist, "$module->{'_name'}: @commands");
|
||||
} elsif ($moduleHelp) {
|
||||
push(@helplist, "$module->{'_name'}");
|
||||
}
|
||||
}
|
||||
foreach ($self->prettyPrint($self->{'preferredHelpLineLength'}, undef, ' ', '; ', @helplist)) {
|
||||
$self->directSay($event, $_);
|
||||
}
|
||||
}
|
||||
|
||||
sub printHelpTidy {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
my @modules = sort $self->getModules();
|
||||
my $longestTitle = 0;
|
||||
foreach my $module (@modules) {
|
||||
$longestTitle = length($module) if length($module) > $longestTitle;
|
||||
$module = [$module, sort keys %{$self->getModule($module)->Help($event)}];
|
||||
}
|
||||
foreach my $module (@modules) {
|
||||
my $title = shift(@$module);
|
||||
my $topicCount = @$module;
|
||||
if (@$module and $module->[0] eq '') {
|
||||
shift(@$module);
|
||||
}
|
||||
my @topics = @$module;
|
||||
$module = ' ' x ($longestTitle - length($title)) . $title;
|
||||
if (@topics) {
|
||||
$self->directSay($event, $module . ': ' . join(",\n" . ' ' x ($longestTitle + 2), $self->wordWrap($self->{'preferredHelpLineLength'} - $longestTitle - 2, undef, undef, ', ', @topics)));
|
||||
} elsif ($topicCount) {
|
||||
$self->directSay($event, "$module: (no commands)");
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -1,341 +0,0 @@
|
||||
# -*- Mode: perl; indent-tabs-mode: nil -*-
|
||||
################################
|
||||
# God Module #
|
||||
################################
|
||||
|
||||
package BotModules::God;
|
||||
use vars qw(@ISA);
|
||||
@ISA = qw(BotModules);
|
||||
1;
|
||||
|
||||
# XXX should also do autovoice
|
||||
|
||||
sub Help {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
my $answer = {
|
||||
'' => 'A per-channel auto-opper.',
|
||||
'ops' => 'Lists the autoop list for a channel. Syntax: \'ops in <channel>\'',
|
||||
'opme' => 'Checks the autoop list, and ops the speaker if they are on the autoop list. Must be used in a channel. Syntax: \'op me\' or \'opme\'',
|
||||
'mask' => 'Add or remove a regexp mask from a channel\'s autoop list. Only bot and channel admins can do this. USE OF THIS FEATURE IS HIGHLY DISCOURAGED AS IT IS VERY INSECURE!!! Syntax: \'add mask <user@host> in <channel>\' to add and \'remove mask <user@host> in <channel>\' to remove. The special word \'everywhere\' can be used instead of a channel name to add a mask that works in all channels.',
|
||||
'autoop' => 'Add someone to the autoop list for a channel. Only bot and channel admins can do this. Syntax: \'autoop <user> in <channel>\'',
|
||||
'deautoop' => 'Remove someone from the autoop list for a channel. Only bot and channel admins can do this. Syntax: \'deautoop <user> in <channel>\'',
|
||||
'enable' => 'Enable a module in a channel. Only bot and channel admins can do this. Syntax: \'enable <module> in <channel>\'',
|
||||
'disable' => 'Disable a module in a channel. Only bot and channel admins can do this. Syntax: \'disable <module> in <channel>\'',
|
||||
};
|
||||
if ($self->isAdmin($event)) {
|
||||
$answer->{'opme'} .= '. As an administrator, you can also say \'op me in <channel>\' or \'op me everywhere\' which will do the obvious things.';
|
||||
$answer->{'promote'} = 'Add someone to the channel admin list for a channel. Only bot admins can do this. Syntax: \'promote <user> in <channel>\'',
|
||||
$answer->{'demote'} = 'Remove someone from the channel admin list for a channel. Only bot admins can do this. Syntax: \'demote <user> in <channel>\'',
|
||||
}
|
||||
return $answer;
|
||||
}
|
||||
|
||||
# RegisterConfig - Called when initialised, should call registerVariables
|
||||
sub RegisterConfig {
|
||||
my $self = shift;
|
||||
$self->SUPER::RegisterConfig(@_);
|
||||
$self->registerVariables(
|
||||
# [ name, save?, settable? ]
|
||||
['channelAdmins', 1, 1, {}],
|
||||
['channelOps', 1, 1, {}],
|
||||
['channelOpMasks', 1, 1, {}],
|
||||
['kickLog', 1, 1, []],
|
||||
['allowPrivateOpRequests', 1, 1, 1],
|
||||
['maxInChannel', 1, 1, 4],
|
||||
);
|
||||
}
|
||||
|
||||
sub Told {
|
||||
my $self = shift;
|
||||
my ($event, $message) = @_;
|
||||
if ($event->{'level'} == 1) {
|
||||
if ($message =~ /^\s*(?:list\s+)?ops\s+(?:in\s+|for\s+)?(\S+)\s*\??$/osi) {
|
||||
my $channel = lc($1);
|
||||
$self->listOps($event, $channel);
|
||||
} elsif ($message =~ /^\s*autoop\s+(\S+)\s+in\s+(\S+)\s*$/osi) {
|
||||
if (($self->isChannelAdmin($event, $2)) or ($self->isAdmin($event))) {
|
||||
my $channel = $2 eq 'everywhere' ? '' : lc($2);
|
||||
$self->{'channelOps'}->{$channel} .= " $1";
|
||||
$self->saveConfig();
|
||||
$self->say($event, "$event->{'from'}: User '$1' added to the autoop list of channel '$2'.");
|
||||
} else {
|
||||
$self->say($event, "$event->{'from'}: Only channel administrators may add people to a channel's autoop list.");
|
||||
}
|
||||
} elsif ($message =~ /^\s*deautoop\s+(\S+)\s+in\s+(\S+)\s*$/osi) {
|
||||
if (($self->isChannelAdmin($event, $2)) or ($self->isAdmin($event))) {
|
||||
my $channel = $2 eq 'everywhere' ? '' : lc($2);
|
||||
my %people = map { $_ => 1 } split(/ +/os, $self->{'channelOps'}->{$channel});
|
||||
delete($people{$1}); # get rid of any mentions of that person
|
||||
$self->{'channelOps'}->{$channel} = join(' ', keys(%people));
|
||||
$self->saveConfig();
|
||||
$self->say($event, "$event->{'from'}: User '$1' removed from the autoop list of channel '$2'.");
|
||||
} else {
|
||||
$self->say($event, "$event->{'from'}: Only channel administrators may remove people from a channel's autoop list.");
|
||||
}
|
||||
} elsif ($message =~ /^\s*add\s+mask\s+(\S+)\s+(?:in|to|for|from)\s+(\S+)\s*$/osi) {
|
||||
if (($self->isChannelAdmin($event, $2)) or ($self->isAdmin($event))) {
|
||||
my $channel = $2 eq 'everywhere' ? '' : lc($2);
|
||||
$self->{'channelOpMasks'}->{$channel} .= " $1";
|
||||
$self->saveConfig();
|
||||
$self->say($event, "$event->{'from'}: Mask '$1' added to the autoop list of channel '$2'.");
|
||||
} else {
|
||||
$self->say($event, "$event->{'from'}: Only channel administrators may add masks to a channel's autoop list.");
|
||||
}
|
||||
} elsif ($message =~ /^\s*remove\s+mask\s+(\S+)\s+(?:in|from|for|to)\s+(\S+)\s*$/osi) {
|
||||
if (($self->isChannelAdmin($event, $2)) or ($self->isAdmin($event))) {
|
||||
my $channel = $2 eq 'everywhere' ? '' : lc($2);
|
||||
my %people = map { $_ => 1 } split(/ +/os, $self->{'channelOpMasks'}->{$channel});
|
||||
delete($people{$1}); # get rid of any mentions of that person
|
||||
$self->{'channelOpMasks'}->{$channel} = join(' ', keys(%people));
|
||||
$self->saveConfig();
|
||||
$self->say($event, "$event->{'from'}: Mask '$1' removed from the autoop list of channel '$2'.");
|
||||
} else {
|
||||
$self->say($event, "$event->{'from'}: Only channel administrators may remove masks from a channel's autoop list.");
|
||||
}
|
||||
} elsif ($message =~ /^\s*promote\s+(\S+)\s+in\s+(\S+)\s*$/osi) {
|
||||
if ($self->isAdmin($event)) {
|
||||
$self->{'channelAdmins'}->{lc($2)} .= " $1";
|
||||
$self->saveConfig();
|
||||
$self->say($event, "$event->{'from'}: User '$1' promoted to channel administrator status in channel '$2'.");
|
||||
} else {
|
||||
$self->say($event, "$event->{'from'}: Only administrators may promote people to channel admin status.");
|
||||
}
|
||||
} elsif ($message =~ /^\s*demote\s+(\S+)\s+in\s+(\S+)\s*$/osi) {
|
||||
if ($self->isAdmin($event)) {
|
||||
my %people = map { $_ => 1 } split(/ +/os, $self->{'channelAdmins'}->{lc($2)});
|
||||
delete($people{$1}); # get rid of any mentions of that person
|
||||
$self->{'channelAdmins'}->{lc($2)} = join(' ', keys(%people));
|
||||
$self->saveConfig();
|
||||
$self->say($event, "$event->{'from'}: User '$1' removed from the channel administrator list of channel '$2'.");
|
||||
} else {
|
||||
$self->say($event, "$event->{'from'}: Only administrators may remove people's channel admin status.");
|
||||
}
|
||||
} elsif ($message =~ /^\s*enable\s+(\S+)\s+in\s+(\S+)\s*$/osi) {
|
||||
if (($self->isAdmin($event)) or ($self->isChannelAdmin($event, $2))) {
|
||||
my $module = $self->getModule($1);
|
||||
if ($1) {
|
||||
push(@{$module->{'channels'}}, lc($2));
|
||||
$module->saveConfig();
|
||||
$self->say($event, "$event->{'from'}: Module '$1' enabled in channel '$2'.");
|
||||
} else {
|
||||
$self->say($event, "$event->{'from'}: There is no module called '$1', sorry.");
|
||||
}
|
||||
} else {
|
||||
$self->say($event, "$event->{'from'}: Only channel administrators may change a module's status.");
|
||||
}
|
||||
} elsif ($message =~ /^\s*disable\s+(\S+)\s+in\s+(\S+)\s*$/osi) {
|
||||
if (($self->isAdmin($event)) or ($self->isChannelAdmin($event, $2))) {
|
||||
my $module = $self->getModule($1);
|
||||
if ($1) {
|
||||
my %channels = map { $_ => 1 } @{$module->{'channels'}};
|
||||
delete($channels{lc($2)}); # get rid of any mentions of that channel
|
||||
@{$module->{'channels'}} = keys %channels;
|
||||
$module->saveConfig();
|
||||
$self->say($event, "$event->{'from'}: Module '$1' disabled in channel '$2'.");
|
||||
} else {
|
||||
$self->say($event, "$event->{'from'}: There is no module called '$1', sorry.");
|
||||
}
|
||||
} else {
|
||||
$self->say($event, "$event->{'from'}: Only channel administrators may change a module's status.");
|
||||
}
|
||||
} elsif ($message =~ /^\s*(?:(?:(?:de)?autoop|promote|demote|enable|disable|add\s+mask|remove\s+mask)\s+(\S+)|(?:list\s+)?ops)\s*$/osi) {
|
||||
$self->say($event, "$event->{'from'}: You have to give a channel, as in \'<command> <who> in <channel>\'.");
|
||||
|
||||
# XXX next two could be merged, maybe.
|
||||
} elsif ($message =~ /^\s*op\s*meh?[!1.,\s]*(?:now\s+)?(?:please|(b+[iea]+t+c+h+))?\s*[.!1]*\s*$/osi) {
|
||||
if ($event->{'channel'}) {
|
||||
if ($event->{'userName'}) {
|
||||
unless ($self->checkOpping($event, $event->{'channel'}, $event->{'from'}, $self->isAdmin($event))) {
|
||||
if ($1) { # only true if they said bitch
|
||||
$self->say($event, "$event->{'from'}: No way, beetch!");
|
||||
} else {
|
||||
$self->say($event, "$event->{'from'}: Sorry, you are not on my auto-op list.");
|
||||
}
|
||||
}
|
||||
} else {
|
||||
unless ($self->isMatchedByMask($event, $event->{'channel'}) and
|
||||
$self->checkOpping($event, $event->{'channel'}, $event->{'from'})) {
|
||||
$self->say($event, "$event->{'from'}: You haven't authenticated yet. See 'help auth' for details.");
|
||||
}
|
||||
}
|
||||
} else {
|
||||
$self->say($event, "$event->{'from'}: You have to use this command in public.");
|
||||
}
|
||||
} elsif ($message =~ /^\s*(?:please\s+)?op\s*me(?:\s+in\s+(\S+)|\s+everywhere)?[\s!1.]*\s*$/osi) {
|
||||
if (($self->{'allowPrivateOpRequests'}) or ($self->isAdmin($event))) {
|
||||
if ($1) {
|
||||
$self->checkOpping($event, lc($1), $event->{'from'}, $self->isAdmin($event));
|
||||
} else {
|
||||
foreach (@{$self->{'channels'}}) {
|
||||
$self->checkOpping($event, $_, $event->{'from'}, $self->isAdmin($event));
|
||||
}
|
||||
}
|
||||
} else {
|
||||
$self->say($event, "$event->{'from'}: Sorry, but no. Try \'help opme\' for details on commansyntax.");
|
||||
}
|
||||
} else {
|
||||
my $parentResult = $self->SUPER::Told(@_);
|
||||
return $parentResult < 2 ? 2 : $parentResult;
|
||||
}
|
||||
return 0; # we've dealt with it, no need to do anything ese.
|
||||
} elsif ($event->{'level'} == 2) {
|
||||
if (defined($event->{'God_channel'})) {
|
||||
$event->{'God_channel_rights'} = $self->isChannelAdmin($event, $event->{'God_channel'});
|
||||
}
|
||||
}
|
||||
return $self->SUPER::Told(@_);
|
||||
}
|
||||
|
||||
# SpottedJoin - Called when someone joins a channel
|
||||
sub SpottedJoin {
|
||||
my $self = shift;
|
||||
my ($event, $channel, $who) = @_;
|
||||
$self->checkOpping(@_, 0);
|
||||
return $self->SUPER::SpottedJoin(@_); # this should not stop anything else happening
|
||||
}
|
||||
|
||||
# do all channels when someone authenticates
|
||||
sub Authed {
|
||||
my $self = shift;
|
||||
my ($event, $who) = @_;
|
||||
foreach (@{$self->{'channels'}}) {
|
||||
$self->checkOpping($event, $_, $who, 0);
|
||||
}
|
||||
return $self->SUPER::Authed(@_); # this should not stop anything else happening
|
||||
}
|
||||
|
||||
# check is someone is in the opping.
|
||||
sub checkOpping {
|
||||
my $self = shift;
|
||||
my ($event, $channel, $who, $override) = @_;
|
||||
if (($self->isAutoopped($event, $channel)) or ($self->isChannelAdmin($event, $channel)) or ($override)) {
|
||||
$self->mode($event, $channel, '+o', $who);
|
||||
return 1;
|
||||
}
|
||||
return 0;
|
||||
}
|
||||
|
||||
sub isChannelAdmin {
|
||||
my $self = shift;
|
||||
my ($event, $channel) = @_;
|
||||
return (($event->{'userName'}) and
|
||||
(defined($self->{'channelAdmins'}->{$channel})) and
|
||||
($self->{'channelAdmins'}->{$channel} =~ /^(|.*\s+)$event->{'userName'}(\s+.*|)$/s));
|
||||
}
|
||||
|
||||
sub isAutoopped {
|
||||
my $self = shift;
|
||||
my ($event, $channel) = @_;
|
||||
return ((($event->{'userName'}) and
|
||||
(defined($self->{'channelOps'}->{$channel})) and
|
||||
(($self->{'channelOps'}->{$channel} =~ /^(|.*\s+)$event->{'userName'}(\s+.*|)$/s) or
|
||||
($self->{'channelOps'}->{''} =~ /^(|.*\s+)$event->{'userName'}(\s+.*|)$/s))) or
|
||||
($self->isMatchedByMask($event, $channel)));
|
||||
}
|
||||
|
||||
# grrrr -- this insecure feature is here by popular demand
|
||||
sub isMatchedByMask {
|
||||
my $self = shift;
|
||||
my ($event, $channel) = @_;
|
||||
my $masks;
|
||||
$masks .= $self->{'channelOpMasks'}->{$channel} if defined($self->{'channelOpMasks'}->{$channel});
|
||||
$masks .= ' '.$self->{'channelOpMasks'}->{''} if defined($self->{'channelOpMasks'}->{''});
|
||||
if (defined($masks)) {
|
||||
my @masks = split(/ +/os, $masks);
|
||||
my $user = $event->{'user'};
|
||||
foreach my $regexp (@masks) {
|
||||
my $pattern;
|
||||
if ($regexp =~ m/ ^ # start at the start
|
||||
([^!@]+) # nick part
|
||||
\! # nick-username delimiter
|
||||
([^!@]+) # username part
|
||||
\@ # username-host delimiter
|
||||
([^!@]+) # host part
|
||||
$ # end at the end
|
||||
/osx) {
|
||||
|
||||
my $nick = $1;
|
||||
my $user = $2;
|
||||
my $host = $3;
|
||||
|
||||
# This was entered as an IRC hostmask so we need to
|
||||
# translate it into a regular expression.
|
||||
foreach ($nick, $user, $host) {
|
||||
$_ = quotemeta($_); # escape regular expression magic
|
||||
s/\\\*/.*/gos; # translate "*" into regexp equivalent
|
||||
}
|
||||
|
||||
# If we don't match the first part of the host-mask
|
||||
# (the user's nick) then we should not op them; we
|
||||
# should just skip to the next mask.
|
||||
next unless $event->{'from'} =~ m/^$nick$/i;
|
||||
|
||||
# ok, create hostmask regexp
|
||||
$pattern = "^$user\@$host\$";
|
||||
} else {
|
||||
# this was entered as a regexp, check it is valid.
|
||||
$pattern = $self->sanitizeRegexp($regexp);
|
||||
}
|
||||
if (($pattern =~ /[^\s.*+]/os) # pattern is non-trivial
|
||||
and ($user =~ /$pattern/si)) { # pattern matches user
|
||||
return 1; # op user (so insecure, sigh)
|
||||
}
|
||||
}
|
||||
}
|
||||
return 0;
|
||||
}
|
||||
|
||||
sub Kicked {
|
||||
my $self = shift;
|
||||
my ($event, $channel) = @_;
|
||||
push(@{$self->{'kickLog'}}, "$event->{'from'} kicked us from $channel"); # XXX karma or something... ;-)
|
||||
return $self->SUPER::Kicked(@_);
|
||||
}
|
||||
|
||||
sub getList {
|
||||
my $self = shift;
|
||||
my ($channel, $list) = @_;
|
||||
my $data;
|
||||
my @list;
|
||||
$data = defined($self->{$list}->{$channel}) ? $self->{$list}->{$channel} : '';
|
||||
$data .= defined($self->{$list}->{''}) ? ' '.$self->{$list}->{''} : '';
|
||||
if ($data =~ /^\s*$/os) {
|
||||
@list = ('(none)');
|
||||
} else {
|
||||
@list = sort(split(/\s+/os, $data));
|
||||
while ((@list) and ($list[0] =~ /^\s*$/)) { shift @list; }
|
||||
}
|
||||
return @list;
|
||||
}
|
||||
|
||||
sub listOps {
|
||||
my $self = shift;
|
||||
my ($event, $channel) = @_;
|
||||
my @admins = $self->getList($channel, 'channelAdmins');
|
||||
my @ops = $self->getList($channel, 'channelOps');
|
||||
my @masks = $self->getList($channel, 'channelOpMasks');
|
||||
|
||||
local $" = ' ';
|
||||
my @output = ();
|
||||
push(@output, "$channel admins: @admins");
|
||||
push(@output, "$channel ops: @ops");
|
||||
if (@masks > 2) {
|
||||
push(@output, "$channel autoop masks:");
|
||||
foreach (@masks) {
|
||||
push(@output, " $_");
|
||||
}
|
||||
} else {
|
||||
push(@output, "$channel autoop masks: @masks");
|
||||
}
|
||||
if (scalar(@output) > $self->{'maxInChannel'}) {
|
||||
foreach (@output) {
|
||||
$self->directSay($event, $_);
|
||||
}
|
||||
$self->channelSay($event, "$event->{'from'}: long list /msg'ed");
|
||||
} else {
|
||||
foreach (@output) {
|
||||
$self->say($event, "$event->{'from'}: $_");
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -1,150 +0,0 @@
|
||||
################################
|
||||
# Google Module #
|
||||
################################
|
||||
|
||||
# Original Author: Max Kanat-Alexander <mkanat@bugzilla.org>
|
||||
# Author: Stephen Lau <steve@grommit.com>
|
||||
#
|
||||
# stevel's notes:
|
||||
# The original version of this module used Net::Google which used the Google
|
||||
# SOAP API. I've updated it to use the REST::Google::Search module which
|
||||
# uses Google's AJAX API
|
||||
#
|
||||
# This API requires that you send a valid HTTP_REFERER, which you can set
|
||||
# with the REFERER constant below:
|
||||
|
||||
package BotModules::Google;
|
||||
use vars qw(@ISA);
|
||||
@ISA = qw(BotModules);
|
||||
use REST::Google::Search;
|
||||
|
||||
use constant SEPARATOR => ' -- ';
|
||||
use constant REFERER => 'http://www.mozilla.org/projects/mozbot/';
|
||||
1;
|
||||
|
||||
sub Help {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
return {
|
||||
'' => q{Queries Google for specified search terms. },
|
||||
'google' => q{Searches google for the specified terms.}
|
||||
. q{Syntax: 'google <terms>'},
|
||||
'fight' => q{Google fight two terms.}
|
||||
. q{Syntax: 'fight <term1> vs. <term2>'}
|
||||
};
|
||||
}
|
||||
|
||||
# RegisterConfig - Called when initialised, should call registerVariables
|
||||
sub RegisterConfig {
|
||||
my $self = shift;
|
||||
$self->SUPER::RegisterConfig(@_);
|
||||
$self->registerVariables(
|
||||
# [ name, save?, settable? ]
|
||||
['maxResults', 1, 1, 8],
|
||||
['maxInChannel', 1, 1, 1],
|
||||
['safeSearch', 1, 1, 1],
|
||||
['maxLineLength', 1, 1, 256]
|
||||
);
|
||||
}
|
||||
|
||||
sub Told {
|
||||
my $self = shift;
|
||||
my ($event, $message) = @_;
|
||||
# We take anything that occurs at the end of the line,
|
||||
# because Google will ignore punctuation anyway.
|
||||
if ($message =~ /^(\s*google\s+)(.+)$/osi) {
|
||||
my $terms = $2;
|
||||
|
||||
my @searchResults = $self->doSearch($terms);
|
||||
|
||||
if (!@searchResults) {
|
||||
$self->say($event, "Nothing found.");
|
||||
}
|
||||
# If we are in a channel, and not a /msg
|
||||
elsif ($event->{'channel'}) {
|
||||
splice(@searchResults, $self->{'maxInChannel'});
|
||||
}
|
||||
# We're in a /msg
|
||||
else {
|
||||
unshift(@searchResults, scalar(@searchResults) . " results found: ");
|
||||
}
|
||||
|
||||
foreach my $result (@searchResults) {
|
||||
$self->say($event, $event->{'from'} . ': ' . $result);
|
||||
}
|
||||
} elsif ($message =~ /^(\s*fight\s+)(.+)\s+vs\.\s+(.+)\s*$/osi) {
|
||||
my $term1 = $2;
|
||||
my $term2 = $3;
|
||||
my $results1 = $self->getNumResults($term1);
|
||||
my $results2 = $self->getNumResults($term2);
|
||||
|
||||
if ($results1 > $results2) {
|
||||
$self->say($event, "$term1 beats $term2, $results1 to $results2!");
|
||||
} elsif ($results2 > $results1) {
|
||||
$self->say($event, "$term2 beats $term1, $results2 to $results1!");
|
||||
} else {
|
||||
$self->say($event, "It's a dead tie at $results1 results!");
|
||||
}
|
||||
} else {
|
||||
return $self->SUPER::Told(@_);
|
||||
}
|
||||
return 0; # we've dealt with it, no need to do anything else.
|
||||
}
|
||||
|
||||
sub getNumResults {
|
||||
my $self = shift;
|
||||
my ($terms) = @_;
|
||||
|
||||
REST::Google::Search->http_referer(REFERER);
|
||||
my $res = REST::Google::Search->new(
|
||||
q => $terms,
|
||||
rsz => "large",
|
||||
);
|
||||
|
||||
if ($res->responseStatus != 200) {
|
||||
return 0;
|
||||
}
|
||||
|
||||
my $data = $res->responseData;
|
||||
return $data->cursor->estimatedResultCount;
|
||||
}
|
||||
# Performs the actual Google search and returns the
|
||||
# result as an array of lines to say.
|
||||
sub doSearch {
|
||||
my $self = shift;
|
||||
my ($terms) = @_;
|
||||
|
||||
my @searchLines = ();
|
||||
REST::Google::Search->http_referer(REFERER);
|
||||
my $res = REST::Google::Search->new(
|
||||
q => $terms,
|
||||
rsz => "large",
|
||||
);
|
||||
|
||||
if ($res->responseStatus != 200) {
|
||||
return @searchLines;
|
||||
}
|
||||
|
||||
my $data = $res->responseData;
|
||||
my @results = $data->results;
|
||||
|
||||
foreach my $result (@results) {
|
||||
my $title = $result->title;
|
||||
# The Google API puts <b></b> tags into the title if the search
|
||||
# terms appear in the title.
|
||||
$title =~ s|</?b>||g;
|
||||
$title = $self->unescapeXML($title);
|
||||
my $url = $result->url;
|
||||
my $line_size = (length($title) + length($result) + length(SEPARATOR));
|
||||
if ($line_size > $self->{'maxLineLength'} ) {
|
||||
# The 3 is for the '...'
|
||||
my $new_title_size = ($line_size - $self->{'maxLineLength'}) - 3;
|
||||
my $title = substr($title, 0, $new_title_size)
|
||||
. '...';
|
||||
}
|
||||
my $resultLine = $title . SEPARATOR . $url;
|
||||
push(@searchLines, $resultLine);
|
||||
}
|
||||
|
||||
return @searchLines;
|
||||
}
|
||||
@@ -1,361 +0,0 @@
|
||||
# -*- Mode: perl; tab-width: 4; indent-tabs-mode: nil; -*-
|
||||
################################
|
||||
# Greeting Module #
|
||||
################################
|
||||
|
||||
package BotModules::Greeting;
|
||||
use vars qw(@ISA);
|
||||
@ISA = qw(BotModules);
|
||||
1;
|
||||
|
||||
sub Help {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
return {
|
||||
'' => 'A polite module for saying hello and goodbye and so on.',
|
||||
'hi' => 'To greet the bot.',
|
||||
'bye' => 'To say goodbye to the bot.',
|
||||
'ping' => 'To check the bot is alive.',
|
||||
'status' => 'Gives the amount of time that the bot has been active.',
|
||||
};
|
||||
}
|
||||
|
||||
# RegisterConfig - Called when initialised, should call registerVariables
|
||||
sub RegisterConfig {
|
||||
my $self = shift;
|
||||
$self->SUPER::RegisterConfig(@_);
|
||||
$self->registerVariables(
|
||||
# [ name, save?, settable? ]
|
||||
['greetings', 1, 1, ['hi %', 'yo %', 'salut %', '%! dude!', '%: hello', '%', 'bonjour %', 'g\'day mate']],
|
||||
['greetingsIndex', 1, 1, 0],
|
||||
['byes', 1, 1, ['seeya %', 'bye %', 'night %', '/me waves goodbye to %']],
|
||||
['byesIndex', 1, 1, 0],
|
||||
['ow', 1, 1, ['%!! stop it!!', '%? You want something?', 'I\'m working! Leave me alone!', 'ow!', 'Leave me out of it!', '%: mean!']],
|
||||
['owIndex', 1, 1, 0],
|
||||
['veryow', 1, 1, ['OOOOWWWW!!!', 'GETOFF!!!', '/me fights back', 'Yikes! I\'m being attacked!!', '/me hits % over the head with a 2-by-4']],
|
||||
['veryowIndex', 1, 1, 0],
|
||||
['hit', 1, 1, ['/me smacks %target', '/me hits %target over the head with a hammer', '/me trips %target up and laughs', '%target! look over there! *smack*', '/me pokes %target in the ribs']],
|
||||
['hitIndex', 1, 1, 0],
|
||||
['hitProtected', 1, 1, {'hixie' => '%target: %source wanted me to hurt you but don\'t worry, i wuv you, i\'d never hurt you...', 'me' => '/me wacks %source in the legs with a crowbar', '' => '%source: Oh you\'d like that, wouldn\'t you, you sadist pervert.', 'yourself' => 'hey look everyone! %source likes to see others hurt themselves!', 'urself' => 'oh my! %source can\'t even spell! It\'s written "yourself", moron!'}],
|
||||
['hitEnabled', 1, 1, 1], # set to 0 to disable hitting
|
||||
['pat', 1, 1, ['/me patpats %target', '%target: yes dear, *pat* *pat*', '/me pats %target condescendingly', '%target: *pat* *pat*']],
|
||||
['patIndex', 1, 1, 0],
|
||||
['patProtected', 1, 1, {'' => '%source: what did I do now?', 'yourself' => '%source: why? what did i do wrong?'}],
|
||||
['hug', 1, 1, ['/me hugs %target', '%target: *hug*', '/me hugs %target lovingly', '%target: come \'ere! *hugs and kisses*']],
|
||||
['hugIndex', 1, 1, 0],
|
||||
['yousuck', 1, 1, ['%: no, *you* suck!', '/me pouts', '/me cries', '/me . o O ( now what have i done... )']],
|
||||
['yousuckIndex', 1, 1, 0],
|
||||
['thanks', 1, 1, ['sure thing %', 'np', '%: np', '%: just doing my job!']],
|
||||
['thanksIndex', 1, 1, 0],
|
||||
['listen', 1, 1, ['(*', '%: I\'m listening.', '%?']],
|
||||
['listenIndex', 1, 1, 0],
|
||||
['happy', 1, 1, [':)', '/me smiles', 'yay', '/me beams']],
|
||||
['happyIndex', 1, 1, 0],
|
||||
['unhappy', 1, 1, [':(', '/me sobs', '/me cries', '*sniff*', 'but... but...', '/me is all sad']],
|
||||
['unhappyIndex', 1, 1, 0],
|
||||
['vhappy', 1, 1, ['OOoh! %!', 'I love you too, %.']],
|
||||
['vhappyIndex', 1, 1, 0],
|
||||
['kinky', 1, 1, ['eep!', 'me-ow!', 'oh yeah! spank me baby!', '/me tickles %', 'he-llo, baby!']],
|
||||
['kinkyIndex', 1, 1, 0],
|
||||
['tickle', 1, 1, ['eep!', 'iiiih!', 'meep!', '/me tickles % back', 'yelp!']],
|
||||
['tickleIndex', 1, 1, 0],
|
||||
['apology', 1, 1, ['Apology accepted.', 'thanks', 's\'ok', 'heh', 'that\'s ok']],
|
||||
['apologyIndex', 1, 1, 0],
|
||||
['whoami', 1, 1, 'I am a bot. /msg me the word \'help\' for a list of commands.'],
|
||||
['lastrheet', 0, 0, 0], # time of last rheet
|
||||
['rheetbuffer', 1, 1, 10], # max of 1 rheet per this many seconds
|
||||
['rheetMaxEs', 1, 1, 100], # number of es at which to stop responding.
|
||||
['autoGreetMute', 1, 1, []], # channels to mute in
|
||||
['autoGreetings', 1, 1, {}], # people to greet and their greeting
|
||||
['autoGreeted', 0, 0, {}], # people to NOT greet, and the last time
|
||||
['autoGreetedBackoffTime', 1, 1, 20], # how long to not greet people (seconds)
|
||||
['evil', 1, 1, ['c++ is evil', '/me mumbles something about c++ being evil', 'c++ is e-- ah, nevermind.', 'c++ sucks', '/me frowns at %']],
|
||||
['evilIndex', 1, 1, 0],
|
||||
['evilBackoffTime', 1, 1, 36000], # how long to not insult c++ (10 hours by default)
|
||||
['evilMute', 1, 1, []], # channels to disable evil in, * for all channels
|
||||
['lastEvil', 1, 0, 0], # when the last c++ insult took place
|
||||
['assumeThanksTime', 1, 1, 10], # how long to assume that thanks are directed to us after hearing from them (seconds)
|
||||
['_lastSpoken', 0, 0, {}], # who has spoken to us
|
||||
['source', 1, 1, 'http://lxr.mozilla.org/mozilla/source/webtools/mozbot/'], # reply to give for CTCP SOURCE
|
||||
);
|
||||
}
|
||||
|
||||
sub Told {
|
||||
my $self = shift;
|
||||
my ($event, $message) = @_;
|
||||
my $now = $event->{'time'};
|
||||
$self->{'_lastSpoken'}->{$event->{'user'}} = $now;
|
||||
my $me = quotemeta($event->{'bot'}->nick);
|
||||
my $expandedme = join('+', split(//gos, $me)).'+';
|
||||
if ($message =~ /^\s*(?:(?:g[ood\']*\s*)?(?:mornin[g\']?|evenin[g\']?|afternoon|day)|hi|heya?|bonjour|hoi|w+a+[sz]+u+p+\?*|hello|lo|wb|welcome\s+back|greetings|yo(?:\s+yo)*(?:\s+du+de)?|m+[ayh]+(?:\s+m+a+i+n+)?\s+m+a+n+|d+u+d+e+)[?!1.\s]*(?::-?[\)Pp]\s*)*$/osi) {
|
||||
if ($self->canGreet($event)) {
|
||||
$self->Perform($event, 'greetings');
|
||||
}
|
||||
} elsif ($message =~ /^\s*(?:bye|(?:g?'?|good\s+)night|seeya|ciao)[?!1.\s]*$/osi) {
|
||||
$self->Perform($event, 'byes');
|
||||
} elsif ($message =~ /^\s*say[\s:,\"\']+(hi|hello|lo|good\s*bye|seeya)(?:\s+to\s+(\S+))(?:[,\s]*please)?[?!1.\s]*$/osi) {
|
||||
if ($2) {
|
||||
$self->say($event, "$2: $1");
|
||||
} else {
|
||||
$self->say($event, "$1");
|
||||
}
|
||||
} elsif ($message =~ /^\s*
|
||||
(?: (?:you|u) \s+
|
||||
(?:really\s+)?
|
||||
suck
|
||||
(?: \s+hard
|
||||
| (?:\s+big)? \s+ rocks)?
|
||||
| (?:you|u) \s+
|
||||
(?:smell|stick)
|
||||
| (?:you|u)
|
||||
(?:\s+are|\s+r|'re|r) \s+
|
||||
(?:an?\s+)?
|
||||
(?:really\s+)*
|
||||
(?:idiot|stupid|dumb|moron|moronic|useless)
|
||||
(?:\s+bot)?
|
||||
| i \s+ hate \s+ (?:you|u)
|
||||
| bi+tch)
|
||||
[?!1.\s]*$/osix) {
|
||||
$self->Perform($event, 'yousuck');
|
||||
} elsif ($message =~ /^\s*(?:oh[!1?.,\s]*)?(?:thanks|thank\s+you|cheers)[\s!1.]*(?:[;:8][-o]?[]()\|O0<>[]\s*)?$/osi) {
|
||||
$self->Perform($event, 'thanks');
|
||||
} elsif ($message =~ /^\s*(?:good\s+bot[.!1\s]*|(?:you|u)\s+rock(?:\s+bot)?|:-?\)|(?:have\s+a\s+)?bot\s*snack[.!1\s]*)\s*(?:[;:8][-o]?[]()\|O0<>[]\s*)?$/osi) {
|
||||
$self->Perform($event, 'happy');
|
||||
} elsif ($message =~ /^\s*(?:i|we)\s+love\s+(?:you|u)[.!1\s]*(?:[;:8][-o]?[]()\|O0<>[]\s*)?$/osi) {
|
||||
$self->Perform($event, 'happy');
|
||||
} elsif ($message =~ /^\s*(?:please[\s,.]+)?(?:(?:would|will)\s+you\s+)?(?:hit|kick|slap|smack)\s+(\S+?)(?:[\s,.]+please)?[.!?\s]*\s*$/osi) {
|
||||
if ($self->{'hitEnabled'}) {
|
||||
$self->PerformOnOther($event, 'hit', $1);
|
||||
}
|
||||
} elsif ($message =~ /^\s*(?:please[\s,.]+)?(?:(?:would|will)\s+you\s+)?(?:pat|pat\s*pat)\s+(\S+?)(?:[\s,.]+please)?[.!?\s]*\s*$/osi) {
|
||||
$self->PerformOnOther($event, 'pat', $1);
|
||||
} elsif ($message =~ /^\s*(?:please[\s,.]+)?(?:(?:would|will)\s+you\s+)?(?:hug)\s+(\S+?)(?:[\s,.]+please)?[.!?\s]*\s*$/osi) {
|
||||
$self->PerformOnOther($event, 'hug', $1);
|
||||
} elsif ($message =~ /^\s*(?:useless|die|get\s+a\s+life|kiss\s+my\s+ass|you\s+stupid\s+piece\s+o[f']?\s+code)[!1.\s]*$/osi) {
|
||||
$self->Perform($event, 'unhappy');
|
||||
} elsif ($message =~ /^\s*sorry\b/osi) { # note that any trailing text is ignored
|
||||
$self->Perform($event, 'apology');
|
||||
} elsif ($message =~ /^\s*(?:how\s+are\s+you|how\s+do\s+you\s+do|how\'?s\s+things|are\s+you\s+ok)(?:[?!1.,\s]+$expandedme)?\s*[?!1.\s]*$/osi) {
|
||||
$uptime = $self->days($^T);
|
||||
$self->say($event, "$event->{'from'}: fine thanks! I've been up $uptime so far!");
|
||||
} elsif ($message =~ /^\s*(?:who\s+are\s+you)\s*[?!1.\s]*$/osi) {
|
||||
$self->say($event, "$event->{'from'}: $self->{'whoami'}");
|
||||
} elsif ($message =~ /^\s*(?:up\s*(?:time)|status)[?!1.\s]*$/osi) {
|
||||
$uptime = $self->days($^T);
|
||||
$self->say($event, "$event->{'from'}: I've been up $uptime.");
|
||||
} elsif ($message =~ /^\s*r+h+e(e+)t+[!1.\s]*$/osi) {
|
||||
if (length($1) < $self->{'rheetMaxEs'}) {
|
||||
$self->say($event, "$event->{'from'}: rhe$1$1t!");
|
||||
} else {
|
||||
$self->say($event, "$event->{'from'}: uh, whatever.");
|
||||
}
|
||||
} elsif ($message =~ /^\s*ping\s*$/osi) {
|
||||
$self->say($event, "$event->{'from'}: pong");
|
||||
} else {
|
||||
return $self->SUPER::Told(@_);
|
||||
}
|
||||
return 0; # we've dealt with it, no need to do anything else.
|
||||
}
|
||||
|
||||
sub Heard {
|
||||
my $self = shift;
|
||||
my ($event, $message) = @_;
|
||||
my $me = quotemeta($event->{'bot'}->nick);
|
||||
my $expandedme = join('+', split(//gos, $me)).'+';
|
||||
if ($message =~ /^\s*(?:(?:(?:(?:g[ood\']*\s*)?(?:mornin[g\']?|evenin[g\']?|afternoon|day)|hi|heya?|bonjour|hoi|w+a+[sz]+u+p+|hello|lo|wb|welcome\s+back|greetings|yo(?:\s+yo)*)\s+)?$expandedme[!1\s]*|o+h[\s,.!?]+look[\s,.!?]+a\s+$me[\s.!1]*)(?::-?[\)Pp]\s*)*$/si) {
|
||||
if ($self->canGreet($event)) {
|
||||
$self->Perform($event, 'greetings');
|
||||
}
|
||||
} elsif ($message =~ /^\s*(?:bye|(?:g?\'?|good\s+)night|seeya|ciao)\s+$me[!1.\s]*$/si) {
|
||||
$self->Perform($event, 'byes');
|
||||
} elsif ($message =~ /^\s*(?:oh[!1?,.\s]*)?(?:thanks|thank\s*you|cheers)\s+$me[\s!1.]*(?:[;:8][-o]?[]()\|O0<>[]\s*)?$/si) {
|
||||
$self->Perform($event, 'thanks');
|
||||
} elsif (($message =~ /^\s*(?:oh[!1?,.\s]*)?(?:thanks|thank\s*you|cheers)[\s!1.]*(?:[;:8][-o]?[]()\|O0<>[]\s*)?$/osi) and ($self->canAssumeThanks($event))) {
|
||||
$self->Perform($event, 'thanks');
|
||||
} elsif (($message =~ /^\s*(?:good\s+bot)[!1.\s]*(?:[;:8][-o]?[]()\|O0<>[]\s*)?$/osi) and ($self->canAssumeThanks($event))) {
|
||||
$self->Perform($event, 'happy');
|
||||
} elsif (($message =~ /^\s*(?:bad|foo[l\']?|idiot|dumb|useless|moron|moronic)(?:\s+bot)?[!.\s]*?$/osi) and ($self->canAssumeThanks($event))) {
|
||||
$self->Perform($event, 'unhappy');
|
||||
} elsif (($message =~ /^\s*bad\s*$me[!.\s]*$/si) and ($self->canAssumeThanks($event))) {
|
||||
$self->Perform($event, 'unhappy');
|
||||
} elsif (($message =~ /^\s*
|
||||
(?: (?:you|u) \s+
|
||||
(?:really\s+)?
|
||||
suck
|
||||
(?: \s+hard
|
||||
| (?:\s+big)? \s+ rocks)?
|
||||
| (?:you|u) \s+
|
||||
(?:smell|stick)
|
||||
| (?:you|u)
|
||||
(?:\s+are|\s+r|'re|r) \s+
|
||||
(?:an?\s+)?
|
||||
(?:really\s+)?
|
||||
(?:idiot|stupid|dumb|moron|moronic)
|
||||
(?:\s+bot)?
|
||||
| i \s+ hate \s+ (?:you|u)
|
||||
| bi+tch)
|
||||
[?!1.\s]*$/osix) and
|
||||
($self->canAssumeThanks($event))) {
|
||||
$self->Perform($event, 'yousuck');
|
||||
} elsif ($message =~ /^\s*(?:good(?:\s$me)?|yay[\s!1.]*|i\s+love\s+(?:you|u))\s+$me[\s!1.]*(?:[;:8][-o]?[]()\|O0<>[]\s*)?$/si) {
|
||||
$self->Perform($event, 'happy');
|
||||
} elsif ($message =~ /^\s*(?:$me\s*[.?\/]+)\s*$/si) {
|
||||
$self->Perform($event, 'listen');
|
||||
} elsif ($message =~ /^\s*r+h(e+)t+[!1.\s]*$/osi) {
|
||||
if (($event->{'time'}-$self->{'lastrheet'}) > $self->{'rheetbuffer'}) {
|
||||
if (length($1) < $self->{'rheetMaxEs'}) {
|
||||
$self->say($event, "rhe$1$1t!");
|
||||
}
|
||||
$self->{'lastrheet'} = $event->{'time'};
|
||||
}
|
||||
} elsif ($message =~ /^.+\s+c\+\+\s+.+$/osi) {
|
||||
if (!(grep {$_ eq '*' or lc($_) eq $event->{'channel'}} @{$self->{'evilMute'}}) &&
|
||||
($event->{'time'} - $self->{'lastEvil'}) > $self->{'evilBackoffTime'}) {
|
||||
$self->{'lastEvil'} = $event->{'time'};
|
||||
$self->Perform($event, 'evil'); # calls GetNext which calls saveConfig
|
||||
}
|
||||
} else {
|
||||
return $self->SUPER::Heard(@_);
|
||||
}
|
||||
return 0; # we've dealt with it, no need to do anything else.
|
||||
}
|
||||
|
||||
sub Felt {
|
||||
my $self = shift;
|
||||
my ($event, $message) = @_;
|
||||
my $me = quotemeta($event->{'bot'}->nick);
|
||||
if ($message =~ /^\s*(?:greets\s+$me|shakes\s+$me'?s\s+hand)[\s!1.]*$/si) {
|
||||
$self->Perform($event, 'greetings');
|
||||
} elsif ($message =~ /^\s*(?:pokes|prods)\s+$me(?:[,\s]+too|\s+as\s+well)?[\s!1.]*$/si) {
|
||||
$self->Perform($event, 'ow');
|
||||
} elsif ($message =~ /^\s*(?:stabs|slaps|kicks|kills|hits|punches)\s+$me[\s!1.]*$/si) {
|
||||
$self->Perform($event, 'veryow');
|
||||
} elsif ($message =~ /^\s*lights\s+$me\s+on\s+fire[!1.\s]*$/si) {
|
||||
$self->Perform($event, 'veryow');
|
||||
} elsif ($message =~ /^\s*(?:pats|strokes|pets)\s+$me(:?\s+affectionately|\s+lovingly)?[!1.\s]*$/si) {
|
||||
$self->Perform($event, 'happy');
|
||||
} elsif ($message =~ /^\s*slaps\s+$me\s+(?:around\s+)?(?:a\s+(?:bit|lot|little|while)\s+)?with\s+a\s+(?:(?:big|fat|large|wet|and)[\s,]+)*trout[\s!1.]*$/si) {
|
||||
$self->Perform($event, 'ow');
|
||||
} elsif ($message =~ /^\s*(?:hits|kicks|slaps|smacks)\s+$me[\s!1.]*$/si) {
|
||||
$self->Perform($event, 'yousuck');
|
||||
} elsif ($message =~ /^\s*(?:glares|stares)\s+at\s+$me[\s!1.]*$/si) {
|
||||
$self->Perform($event, 'yousuck');
|
||||
} elsif ($message =~ /^\s*(?:hugs|cuddles|snuggles(?:\s+up\s*to|\s+with)?|kisses|loves)\s+$me[\s!1.]*$/si) {
|
||||
$self->Perform($event, 'vhappy');
|
||||
} elsif ($message =~ /^\s*(?:bites|spanks)\s+$me[\s.]*$/si) {
|
||||
$self->Perform($event, 'kinky');
|
||||
} elsif ($message =~ /^\s*(?:tickles)\s+$me[\s.]*$/si) {
|
||||
$self->Perform($event, 'tickle');
|
||||
} elsif ($message =~ /^\s*(?:gives|hands|passes|offers)\s+$me\s+(?:a\s+(?:bot\s*)?(?:snack|cookie)|a\s+present|cash|congratulations|applause|praise)[\s!1.]*$/si) {
|
||||
$self->Perform($event, 'happy');
|
||||
} elsif ($message =~ /^\s*(?:gives|hands|passes|offers)\s+$me\s+(?:a\s+hot\s+date)[\s!1.]*$/si) {
|
||||
$self->Perform($event, 'vhappy');
|
||||
} else {
|
||||
return $self->SUPER::Felt(@_);
|
||||
}
|
||||
return 0; # we've dealt with it, no need to do anything else.
|
||||
}
|
||||
|
||||
sub Saw {
|
||||
my $self = shift;
|
||||
my ($event, $message) = @_;
|
||||
if ($message =~ /^\s*r+h+e(e+)t+s?[!1.\s]*$/osi) {
|
||||
if (($event->{'time'}-$self->{'lastrheet'}) > $self->{'rheetbuffer'}) {
|
||||
$self->say($event, "rhe$1$1t!");
|
||||
$self->{'lastrheet'} = $event->{'time'};
|
||||
}
|
||||
} elsif (($message =~ /^\s*(?:smiles)\s*[!1.\s]*$/si) and ($self->canAssumeThanks($event))) {
|
||||
$self->Perform($event, 'happy');
|
||||
} else {
|
||||
return $self->SUPER::Felt(@_);
|
||||
}
|
||||
return 0; # we've dealt with it, no need to do anything else.
|
||||
}
|
||||
|
||||
# SpottedJoin - Called when someone joins a channel
|
||||
sub SpottedJoin {
|
||||
my $self = shift;
|
||||
my ($event, $channel, $who) = @_;
|
||||
return if grep lc($_) eq $channel, @{$self->{'autoGreetMute'}};
|
||||
my $user = $event->{'user'};
|
||||
if ($self->canGreet($event) and $self->{'autoGreetings'}->{$who}) {
|
||||
$self->sayOrEmote($event, $self->Expand($event, $self->{'autoGreetings'}->{$who}));
|
||||
$self->{'autoGreeted'}->{$user} = $event->{'time'};
|
||||
}
|
||||
return 1; # don't block other modules...
|
||||
}
|
||||
|
||||
sub CTCPPing {
|
||||
my $self = shift;
|
||||
my ($event, $who, $what) = @_;
|
||||
$self->ctcpReply($event, 'PING', $what);
|
||||
}
|
||||
|
||||
sub CTCPSource {
|
||||
my $self = shift;
|
||||
my ($event, $who, $what) = @_;
|
||||
$self->ctcpReply($event, 'SOURCE', $self->{'source'});
|
||||
}
|
||||
|
||||
sub GetNext {
|
||||
my $self = shift;
|
||||
my ($list) = @_;
|
||||
$self->{"${list}Index"} = 0 if $self->{"${list}Index"} > $#{$self->{$list}};
|
||||
my $reply = $self->{$list}->[$self->{"${list}Index"}++];
|
||||
$self->saveConfig();
|
||||
return $reply;
|
||||
}
|
||||
|
||||
sub canGreet {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
my $user = $event->{'user'};
|
||||
my $reply = 1;
|
||||
if (defined($self->{'autoGreeted'}->{$user})) {
|
||||
$reply = (($event->{'time'} - $self->{'autoGreeted'}->{$user}) > $self->{'autoGreetedBackoffTime'});
|
||||
delete($self->{'autoGreeted'}->{$user});
|
||||
}
|
||||
return $reply;
|
||||
}
|
||||
|
||||
sub canAssumeThanks {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
my $who = $event->{'user'};
|
||||
return ((defined($self->{'_lastSpoken'}->{$who})) and (($event->{'time'} - $self->{'_lastSpoken'}->{$who}) <= $self->{'assumeThanksTime'}));
|
||||
}
|
||||
|
||||
sub Perform {
|
||||
my $self = shift;
|
||||
my ($event, $list) = @_;
|
||||
$self->sayOrEmote($event, $self->Expand($event, $self->GetNext($list)));
|
||||
}
|
||||
|
||||
# replaces '%' with the target nick (XXX cannot escape a "%"!!!)
|
||||
sub Expand {
|
||||
my $self = shift;
|
||||
my ($event, $data) = @_;
|
||||
$data =~ s/%/$event->{'from'}/gos;
|
||||
return $data;
|
||||
}
|
||||
|
||||
sub PerformOnOther {
|
||||
my $self = shift;
|
||||
my ($event, $list, $other) = @_;
|
||||
my $data;
|
||||
my $me = quotemeta($event->{'nick'});
|
||||
if ($other =~ m/^$me$/si and
|
||||
defined $self->{"${list}Protected"}->{''}) {
|
||||
$data = $self->{"${list}Protected"}->{''};
|
||||
} elsif (defined $self->{"${list}Protected"}->{lc $other}) {
|
||||
$data = $self->{"${list}Protected"}->{lc $other};
|
||||
} else {
|
||||
$data = $self->GetNext($list);
|
||||
}
|
||||
if ($other eq 'me') {
|
||||
$other = $event->{'from'};
|
||||
}
|
||||
$data =~ s/%source/$event->{'from'}/gos;
|
||||
$data =~ s/%target/$other/gos;
|
||||
$self->sayOrEmote($event, $data);
|
||||
}
|
||||
@@ -1,29 +0,0 @@
|
||||
################################
|
||||
# Hello World Module #
|
||||
################################
|
||||
|
||||
package BotModules::HelloWorld;
|
||||
use vars qw(@ISA);
|
||||
@ISA = qw(BotModules);
|
||||
1;
|
||||
|
||||
sub Help {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
return {
|
||||
'' => 'This is the demo module that says Hello World.',
|
||||
'hi' => 'Requests that the bot emit a hello world string.',
|
||||
};
|
||||
}
|
||||
|
||||
sub Told {
|
||||
my $self = shift;
|
||||
my ($event, $message) = @_;
|
||||
if ($message =~ /^\s*hi\s*$/osi) {
|
||||
$self->say($event, 'Hello World!');
|
||||
} else {
|
||||
return $self->SUPER::Told(@_);
|
||||
}
|
||||
return 0; # we've dealt with it, no need to do anything else.
|
||||
}
|
||||
|
||||
@@ -1,790 +0,0 @@
|
||||
# -*- Mode: perl; tab-width: 4; indent-tabs-mode: nil; -*-
|
||||
################################
|
||||
# Infobot Module #
|
||||
################################
|
||||
# some of these ideas are stolen from infobot, of course.
|
||||
# see www.infobot.org
|
||||
|
||||
package BotModules::Infobot;
|
||||
use vars qw(@ISA);
|
||||
@ISA = qw(BotModules);
|
||||
use AnyDBM_File;
|
||||
use Fcntl;
|
||||
1;
|
||||
|
||||
# XXX "mozbot is a bot" fails (gets handled as a Tell of "is a bot" :-/)
|
||||
# XXX "who is foo" responds "I don't know what is foo" (should respond "I don't know _who_ is foo")
|
||||
|
||||
# it seems tie() works on scope and not on reference counting, so as
|
||||
# soon as the thing it is tying goes out of scope (even if the variable
|
||||
# in question still has active references) it loses its magic.
|
||||
our $factoids = {'is' => {}, 'are' => {}};
|
||||
tie(%{$factoids->{'is'}}, 'AnyDBM_File', 'factoids-is', O_RDWR|O_CREAT, 0666);
|
||||
tie(%{$factoids->{'are'}}, 'AnyDBM_File', 'factoids-are', O_RDWR|O_CREAT, 0666);
|
||||
|
||||
sub Help {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
return {
|
||||
'' => 'Keeps track of factoids and returns them on request. '.
|
||||
'To set factoids, just tell me something in the form \'apple is a company\' or \'apples are fruit\'. '.
|
||||
'To find out about something, say \'apple?\' or \'what are apples\'. '.
|
||||
'To correct me, you can use any of: \'no, apple is a fruit\', \'apple =~ s/company/fruit/\', or \'apple is also a fruit\'. '.
|
||||
'To make me forget a factoid, \'forget apple\'. '.
|
||||
'You can use \'|\' to separate several alternative answers.',
|
||||
'who' => 'If a definition contains $who, then it will be replaced by the name of the person who asked the question.',
|
||||
'reply' => 'If a definition starts with <reply> then when responding the initial prefix will be skipped. '.
|
||||
'e.g., \'apples are <reply>mm, apples\' will mean that \'what are apples\' will get the response \'mm, apples\'.',
|
||||
'action' => 'If a definition starts with <action> then when responding the definition will be used as an action. '.
|
||||
'e.g., \'apples are <action>eats one\' will mean that \'what are apples\' will get the response \'* bot eats one\'.',
|
||||
'alias' => 'If a definition starts with <alias> then it will be treated as a symlink to whatever follows. '.
|
||||
'e.g., \'crab apples are <alias>apples\' and \'apples are fruit\' will mean that \'what are crab apples\' will get the response \'apples are fruit\'.',
|
||||
'status' => 'Reports on how many factoids are in the database.',
|
||||
'tell' => 'Make me tell someone something. e.g., \'tell pikachu what apples are\' or \'tell fred about me\'.',
|
||||
'literal' => 'To find out exactly what is stored for an entry apples, you would say to me: literal apples',
|
||||
'remember' => 'If you are having trouble making me remember something (for example \'well, foo is bar\' '.
|
||||
'getting treated as \'foo\' is \'bar\'), then you can prefix your statement with \'remember:\' '.
|
||||
'(following the \'no,\' if you are changing an entry). For example, \'remember: well, foo is bar\'. '.
|
||||
'Note that \'well, foo?\' is treated as \'what is foo\' not is \'what is well, foo\', so this is not always useful.',
|
||||
'no' => 'To correct an entry, prefix your statement with \'no,\'. '.
|
||||
'For example, \'no, I am good\' to correct your entry from \'is bad\' to \'is good\'. :-)',
|
||||
};
|
||||
}
|
||||
|
||||
# RegisterConfig - Called when initialised, should call registerVariables
|
||||
sub RegisterConfig {
|
||||
my $self = shift;
|
||||
$self->SUPER::RegisterConfig(@_);
|
||||
$self->registerVariables(
|
||||
# [ name, save?, settable? ]
|
||||
['autoLearn', 1, 1, ['*']], # in the auto* variables, '*' means 'all channels'
|
||||
['autoHelp', 1, 1, []],
|
||||
['autoEdit', 1, 1, []],
|
||||
['neverLearn', 1, 1, []], # the never* variables override the auto* variables
|
||||
['neverHelp', 1, 1, []],
|
||||
['neverEdit', 1, 1, []],
|
||||
['eagerToHelp', 1, 1, 1], # whether to even need the "?" on questions
|
||||
['autoIgnore', 1, 1, []], # list of nicks for which to always turn off auto*
|
||||
['teachers', 1, 1, []], # list of users who may teach, leave blank to allow anyone to teach
|
||||
['factoidPositions', 0, 0, {'is' => {}, 'are' => {}}],
|
||||
['friendBots', 1, 1, []],
|
||||
['prefixes', 1, 1, ['', 'I have heard that ', '', 'Maybe ', 'I seem to recall that ', '', 'iirc, ', '',
|
||||
'Was it not... er, someone, who said: ', '', 'Well, ', 'um... ', 'Oh, I know this one! ',
|
||||
'', 'everyone knows that! ', '', 'hmm... I think ', 'well, duh. ']],
|
||||
['researchNotes', 0, 0, {}],
|
||||
['pruneDelay', 1, 1, 120], # how frequently to look through the research notes and remove expired items
|
||||
['queryTimeToLive', 1, 1, 600], # queries can be remembered up to ten minutes by default
|
||||
['dunnoTimeToLive', 1, 1, 604800], # DUNNO queries can be remembered up to a week by default
|
||||
['noIdeaDelay', 1, 1, 2], # how long to wait before admitting lack of knowledge
|
||||
['questions', 0, 0, 0], # how many questions there have been since the last load
|
||||
['edits', 0, 0, 0], # how many edits (learning, editing, forgetting) there have been since the last load
|
||||
['interbots', 0, 0, 0], # how many times we have spoken with other bots
|
||||
['maxInChannel', 1, 1, 200], # beyond this answers are /msged
|
||||
);
|
||||
}
|
||||
|
||||
# Schedule - called when bot connects to a server, to install any schedulers
|
||||
# use $self->schedule($event, $delay, $times, $data)
|
||||
# where $times is 1 for a single event, -1 for recurring events,
|
||||
# and a positive number for an event that occurs that many times.
|
||||
sub Schedule {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
$self->schedule($event, \$self->{'pruneDelay'}, -1, 'pruneInfobot');
|
||||
$self->SUPER::Schedule($event);
|
||||
}
|
||||
|
||||
sub Unload {
|
||||
# just to make sure...
|
||||
untie(%{$factoids->{'is'}});
|
||||
untie(%{$factoids->{'are'}});
|
||||
}
|
||||
|
||||
sub Told {
|
||||
my $self = shift;
|
||||
my ($event, $message) = @_;
|
||||
if ($message =~ /^\s*status[?\s]*$/osi) {
|
||||
my $sum = $self->countFactoids();
|
||||
my $questions = $self->{'questions'} == 1 ? "$self->{'questions'} question" : "$self->{'questions'} questions";
|
||||
my $edits = $self->{'edits'} == 1 ? "$self->{'edits'} edit" : "$self->{'edits'} edits";
|
||||
my $interbots = $self->{'interbots'} == 1 ? "$self->{'interbots'} time" : "$self->{'interbots'} times";
|
||||
my $friends = @{$self->{'friendBots'}} == 1 ? (scalar(@{$self->{'friendBots'}}).' bot friend') : (scalar(@{$self->{'friendBots'}}).' bot friends');
|
||||
$self->targettedSay($event, "I have $sum factoids in my database and $friends to help me answer questions. ".
|
||||
"Since the last reload, I've been asked $questions, performed $edits, and spoken with other bots $interbots.", 1);
|
||||
} elsif ($event->{'channel'} eq '' and $message =~ /^:INFOBOT:DUNNO <(\S+)> (.*)$/) {
|
||||
$self->ReceivedDunno($event, $1, $2) unless $event->{'from'} eq $event->{'nick'};
|
||||
} elsif ($event->{'channel'} eq '' and $message =~ /^:INFOBOT:QUERY <(\S+)> (.*)$/) {
|
||||
$self->ReceivedQuery($event, $2, $1) unless $event->{'from'} eq $event->{'nick'};
|
||||
} elsif ($event->{'channel'} eq '' and $message =~ /^:INFOBOT:REPLY <(\S+)> (.+?) =(is|are)?=> (.*)$/) {
|
||||
$self->ReceivedReply($event, $3, $2, $1, $4) unless $event->{'from'} eq $event->{'nick'};
|
||||
} elsif ($message =~ /^\s*literal\s+(.+?)\s*$/) {
|
||||
$self->Literal($event, $1);
|
||||
} elsif ($event->{level} < 10) {
|
||||
# make this module a very low priority
|
||||
return 10;
|
||||
} elsif (not $self->DoFactoidCheck($event, $message, 1)) {
|
||||
return $self->SUPER::Told(@_);
|
||||
}
|
||||
return 0; # we've dealt with it, no need to do anything else.
|
||||
}
|
||||
|
||||
sub Baffled {
|
||||
my $self = shift;
|
||||
my ($event, $message) = @_;
|
||||
return 10 unless $event->{level} >= 10; # make this module a very low priority
|
||||
if (not $self->DoFactoidCheck($event, $message, 2)) {
|
||||
return $self->SUPER::Heard(@_);
|
||||
}
|
||||
return 0; # we've dealt with it, no need to do anything else.
|
||||
}
|
||||
|
||||
sub Heard {
|
||||
my $self = shift;
|
||||
my ($event, $message) = @_;
|
||||
return 10 unless $event->{level} >= 10; # make this module a very low priority
|
||||
if (not $self->DoFactoidCheck($event, $message, 0)) {
|
||||
return $self->SUPER::Heard(@_);
|
||||
}
|
||||
return 0; # we've dealt with it, no need to do anything else.
|
||||
}
|
||||
|
||||
sub DoFactoidCheck {
|
||||
my $self = shift;
|
||||
my ($event, $message, $direct) = @_;
|
||||
# $direct is one of: 0 = heard, 1 = told, 2 = baffled
|
||||
|
||||
my $shortMessage;
|
||||
if ($message =~ /^\s* (?:\w+[:.!\s]+\s+)?
|
||||
(?:(?:well|and|or|yes|[uh]+m*|o+[oh]*[k]+(?:a+y+)?|still|well|so|a+h+|o+h+)[:,.!?\s]+|)*
|
||||
(?:(?:geez?|boy|du+des?|golly|gosh|wow|whee|wo+ho+)[:,.!\s]+|)*
|
||||
(?:(?:heya?|hello|hi)(?:\s+there)?(?:\s+peoples?|\s+kids?|\s+folks?)[:,!.?\s]+)*
|
||||
(?:(?:geez?|boy|du+des?|golly|gosh|wow|whee|wo+ho+)[:,.!\s]+|)*
|
||||
(?:tell\s+me[,\s]+)?
|
||||
(?:(?:(?:stupid\s+)?q(?:uestion)?|basically)[:,.!\s]+)*
|
||||
(?:tell\s+me[,\s]+)?
|
||||
(?:(?:does\s+)?(?:any|ne)\s*(?:1|one|body)\s+know[,\s]+|)?
|
||||
(.*)
|
||||
\s*$/osix) {
|
||||
$shortMessage = $1;
|
||||
}
|
||||
$self->debug("message: '$message'");
|
||||
$self->debug("shortMessage: '$shortMessage'");
|
||||
|
||||
if ($message =~ /^\s*tell\s+(\S+)\s+about\s+me(?:[,\s]+please)?[\s!?.]*$/osi) {
|
||||
$self->GiveFactoid($event,
|
||||
undef, # database
|
||||
$event->{'from'}, # what
|
||||
$direct,
|
||||
$1); # who
|
||||
} elsif ($message =~ /^\s*tell\s+(\S+)\s+about\s+(.+?)(?:[,\s]+please)?[\s!?.]*$/osi) {
|
||||
$self->GiveFactoid($event,
|
||||
undef, # database
|
||||
$2, # what
|
||||
$direct,
|
||||
$1); # who
|
||||
} elsif ($message =~ /^\s*tell\s+(\S+)\s+(?:what|who|where)\s+(?:am\s+I|I\s+am)(?:[,\s]+please)?[\s!?.]*$/osi) {
|
||||
$self->GiveFactoid($event,
|
||||
'is', # database
|
||||
$event->{'from'}, # what
|
||||
$direct,
|
||||
$1); # who
|
||||
} elsif ($message =~ /^\s*tell\s+(\S+)\s+(?:what|who|where)\s+(is|are)\s+(.+?)(?:[,\s]+please)?[\s!?.]*$/osi) {
|
||||
$self->GiveFactoid($event,
|
||||
lc($2), # database
|
||||
$3, # what
|
||||
$direct,
|
||||
$1); # who
|
||||
} elsif ($message =~ /^\s*tell\s+(\S+)\s+(?:what|who|where)\s+(.+?)\s+(is|are)(?:[,\s]+please)?[\s!?.]*$/osi) {
|
||||
$self->GiveFactoid($event,
|
||||
lc($3), # database
|
||||
$2, # what
|
||||
$direct,
|
||||
$1); # who
|
||||
} elsif ($message =~ /^\s*(.+?)\s*=~\s*s?\/(.+?)\/(.*?)\/(i)?(g)?(i)?\s*$/osi) {
|
||||
$self->EditFactoid($event,
|
||||
$1, # subject
|
||||
$2, # first part to remove
|
||||
$3, # second part to remove
|
||||
defined($5), # global?
|
||||
defined($4) || defined($6), # case insensitive?
|
||||
$direct);
|
||||
} elsif ($message =~ /^\s*forget\s+(?:about\s+)?me\s*$/osi) {
|
||||
$self->ForgetFactoid($event, $event->{'from'}, $direct);
|
||||
} elsif ($message =~ /^\s*forget\s+(?:about\s+)?(.+?)\s*$/osi) {
|
||||
$self->ForgetFactoid($event, $1, $direct);
|
||||
} elsif ($shortMessage =~ /^(?:what|where|who)
|
||||
(?:\s+the\s+hell|\s+on\s+earth|\s+the\s+fuck)?
|
||||
\s+ (is|are) \s+ (.+?) [?!\s]* $/osix) {
|
||||
$self->GiveFactoid($event,
|
||||
lc($1), # is/are (optional)
|
||||
$2, # subject
|
||||
$direct);
|
||||
} elsif ($shortMessage =~ /^(?:(?:where|how)
|
||||
(?:\s+the\s+hell|\s+on\s+earth|\s+the\s+fuck)?
|
||||
\s+ can \s+ (?:i|one|s?he|we) \s+ (?:find|learn|read)
|
||||
(?:\s+about)?
|
||||
| how\s+about
|
||||
| what\'?s)
|
||||
\s+ (.+?) [?!\s]* $/osix) {
|
||||
$self->GiveFactoid($event,
|
||||
undef, # is/are (optional)
|
||||
$1, # subject
|
||||
$direct);
|
||||
} elsif ($shortMessage =~ /^(.+?) \s+ (is|are) \s+ (?:what|where|who) [?!\s]* $/osix) {
|
||||
$self->GiveFactoid($event,
|
||||
lc($2), # is/are (optional)
|
||||
$1, # subject
|
||||
$direct);
|
||||
} elsif ($shortMessage =~ /^(?:what|where|who)
|
||||
(?:\s+the\s+hell|\s+on\s+earth|\s+the\s+fuck)? \s+
|
||||
(?:am\s+I|I\s+am) [?\s]* $/osix) {
|
||||
$self->GiveFactoid($event,
|
||||
'is', # am => is
|
||||
$event->{'from'}, # subject
|
||||
$direct);
|
||||
} elsif ($shortMessage =~ /^(no\s*, (\s*\Q$event->{'nick'}\E\s*,)? \s+)? (?:remember\s*:\s+)? (.+?) \s+ (is|are) \s+ (also\s+)? (.*?[^?\s]) \s* $/six) {
|
||||
# the "remember:" prefix can be used to delimit the start of the actual content, if necessary.
|
||||
$self->SetFactoid($event,
|
||||
defined($1) &&
|
||||
($direct || defined($2)),
|
||||
# replace existing answer?
|
||||
$3, # subject
|
||||
lc($4), # is/are
|
||||
defined($5), # add to existing answer?
|
||||
$6, # object
|
||||
$direct || defined($2));
|
||||
} elsif ($shortMessage =~ /^(no\s*, (?:\s*\Q$event->{'nick'}\E\s*,)? \s+)? (?:remember\s*:\s+)? I \s+ am \s+ (also\s+)? (.+?) $/osix) {
|
||||
# the "remember:" prefix can be used to delimit the start of the actual content, if necessary.
|
||||
$self->SetFactoid($event,
|
||||
defined($1), # replace existing answer?
|
||||
$event->{'from'}, # subject
|
||||
'is', # I am = Foo is
|
||||
defined($2), # add to existing answer?
|
||||
$3, # object
|
||||
$direct);
|
||||
} elsif ((not $direct or $direct == 2) and $shortMessage =~ /^(.+?)\s+(is|are)[?\s]*(\?)?[?\s]*$/osi) {
|
||||
$self->GiveFactoid($event,
|
||||
lc($2), # is/are (optional)
|
||||
$1, # subject
|
||||
$direct)
|
||||
if ($3 or ($direct == 2 and $self->{'eagerToHelp'}));
|
||||
} elsif ((not $direct or $direct == 2) and $shortMessage =~ /^(.+?)[?!.\s]*(\?)?[?!.\s]*$/osi) {
|
||||
$self->GiveFactoid($event,
|
||||
undef, # is/are (optional)
|
||||
$1, # subject
|
||||
$direct)
|
||||
if ($2 or ($direct == 2 and $self->{'eagerToHelp'}));
|
||||
} else {
|
||||
return 0;
|
||||
}
|
||||
return 1;
|
||||
}
|
||||
|
||||
sub SetFactoid {
|
||||
my $self = shift;
|
||||
my($event, $replace, $subject, $database, $add, $object, $direct, $fromBot) = @_;
|
||||
if ($direct or $self->allowed($event, 'Learn')) {
|
||||
|
||||
teacher: {
|
||||
if (@{$self->{'teachers'}}) {
|
||||
foreach my $user (@{$self->{'teachers'}}) {
|
||||
if ($user eq $event->{'userName'}) {
|
||||
last teacher;
|
||||
}
|
||||
}
|
||||
return 0;
|
||||
}
|
||||
}
|
||||
|
||||
# update the database
|
||||
if (not $replace) {
|
||||
$subject = $self->CanonicalizeFactoid($database, $subject);
|
||||
} else {
|
||||
my $oldSubject = $self->CanonicalizeFactoid($database, $subject);
|
||||
if (defined($factoids->{$database}->{$oldSubject})) {
|
||||
delete($factoids->{$database}->{$oldSubject});
|
||||
}
|
||||
}
|
||||
if ($replace or not defined($factoids->{$database}->{$subject})) {
|
||||
$self->debug("Learning that $subject $database '$object'.");
|
||||
$factoids->{$database}->{$subject} = $object;
|
||||
} elsif (not $add) {
|
||||
my @what = split(/\|/o, $factoids->{$database}->{$subject});
|
||||
local $" = '\' or \'';
|
||||
if (not defined($fromBot)) {
|
||||
if (@what == 1 and $what[0] eq $object) {
|
||||
$self->targettedSay($event, 'Yep, that\'s what I thought. Thanks for confirming it.', $direct);
|
||||
} else {
|
||||
# XXX "that's one of the alternatives, sure..."
|
||||
$self->targettedSay($event, "But $subject $database '@what'...", $direct);
|
||||
}
|
||||
}
|
||||
return 0; # failed to update database
|
||||
} else {
|
||||
$self->debug("Learning that $subject $database also '$object'.");
|
||||
$factoids->{$database}->{$subject} .= "|$object";
|
||||
}
|
||||
if (not defined($fromBot)) {
|
||||
$self->targettedSay($event, 'ok', $direct);
|
||||
}
|
||||
if (defined($self->{'researchNotes'}->{lc($subject)})) {
|
||||
my @queue = @{$self->{'researchNotes'}->{lc($subject)}};
|
||||
foreach my $entry (@queue) {
|
||||
my($eventE, $typeE, $databaseE, $subjectE, $targetE, $directE, $visitedAliasesE, $timeE) = @$entry;
|
||||
if ($typeE eq 'QUERY') {
|
||||
if ((defined($targetE) and $event->{'from'} ne $targetE) or
|
||||
($event->{'from'} ne $eventE->{'from'} and
|
||||
($event->{'channel'} eq '' or $event->{'channel'} ne $eventE->{'channel'}))) {
|
||||
my($how, $what, $propagated) = $self->GetFactoid($eventE, $databaseE, $subjectE,
|
||||
$targetE, $directE, $visitedAliasesE, $event->{'from'});
|
||||
if (defined($how)) {
|
||||
if (defined($targetE)) {
|
||||
$self->debug("I now know what '$subject' $database, so telling $targetE, since $eventE->{'from'} told me to.");
|
||||
} else {
|
||||
$self->debug("I now know what '$subject' $database, so telling $eventE->{'from'} who wanted to know.");
|
||||
}
|
||||
$self->factoidSay($eventE, $how, $what, $directE, $targetE);
|
||||
$entry->[1] = 'OLD';
|
||||
} else {
|
||||
# either $propagated, or database doesn't match requested database, or internal error
|
||||
$self->debug("I now know what '$subject' $database, but for some reason that ".
|
||||
"didn't help me help $eventE->{'from'} who needed to know what '$subjectE' $databaseE.");
|
||||
}
|
||||
}
|
||||
} elsif ($typeE eq 'DUNNO') {
|
||||
my $who = defined($targetE) ? $targetE : $eventE->{'from'};
|
||||
$self->directSay($eventE, ":INFOBOT:REPLY <$who> $subject =$database=> $factoids->{$database}->{$subject}");
|
||||
$entry->[1] = 'OLD';
|
||||
}
|
||||
}
|
||||
}
|
||||
$self->{'edits'}++;
|
||||
return 1;
|
||||
} else {
|
||||
return 0;
|
||||
}
|
||||
}
|
||||
|
||||
sub GiveFactoid {
|
||||
my $self = shift;
|
||||
my($event, $database, $subject, $direct, $target) = @_;
|
||||
if ($direct or $self->allowed($event, 'Help')) {
|
||||
if ($target =~ m/^$event->{'nick'}$/i) {
|
||||
$self->targettedSay($event, 'Oh, yeah, great idea, get me to talk to myself.', $direct);
|
||||
} else {
|
||||
if (lc($subject) eq 'you') {
|
||||
# first, skip some words that are handled by other commonly-used modules
|
||||
# in particular, 'who are you' is handled by Greeting.bm
|
||||
return;
|
||||
}
|
||||
$self->{'questions'}++;
|
||||
my($how, $what, $propagated) = $self->GetFactoid($event, $database, $subject, $target, $direct);
|
||||
if (not defined($how)) {
|
||||
$self->scheduleNoIdea($event, $database, $subject, $direct, $propagated);
|
||||
} else {
|
||||
$self->debug("Telling $event->{'from'} about $subject.");
|
||||
$self->factoidSay($event, $how, $what, $direct, $target);
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
sub Literal {
|
||||
my $self = shift;
|
||||
my($event, $subject) = @_;
|
||||
my $is = $self->CanonicalizeFactoid('is', $subject);
|
||||
my $are = $self->CanonicalizeFactoid('are', $subject);
|
||||
if (defined($is) or defined($are)) {
|
||||
local $" = '\' or \'';
|
||||
if (defined($factoids->{'is'}->{$is})) {
|
||||
my @what = split(/\|/o, $factoids->{'is'}->{$is});
|
||||
$self->targettedSay($event, "$is is '@what'.", 1);
|
||||
}
|
||||
if (defined($factoids->{'are'}->{$are})) {
|
||||
my @what = split(/\|/o, $factoids->{'are'}->{$is});
|
||||
$self->targettedSay($event, "$are are '@what'.", 1);
|
||||
}
|
||||
} else {
|
||||
$self->targettedSay($event, "I have no record of anything called '$subject'.", 1);
|
||||
}
|
||||
}
|
||||
|
||||
sub scheduleNoIdea {
|
||||
my $self = shift;
|
||||
my($event, $database, $subject, $direct, $propagated) = @_;
|
||||
if (ref($propagated)) {
|
||||
$self->schedule($event, \$self->{'noIdeaDelay'}, 1, 'noIdea', $database, $subject, $direct, $propagated);
|
||||
} else {
|
||||
$self->noIdea($event, $database, $subject, $direct);
|
||||
}
|
||||
}
|
||||
|
||||
sub GetFactoid {
|
||||
my $self = shift;
|
||||
my($event, $originalDatabase, $subject, $target, $direct, $visitedAliases, $friend) = @_;
|
||||
if (not defined($visitedAliases)) {
|
||||
$visitedAliases = {};
|
||||
}
|
||||
my $database;
|
||||
($database, $subject) = $self->FindFactoid($originalDatabase, $subject);
|
||||
if (defined($factoids->{$database}->{$subject})) {
|
||||
my @alternatives = split(/\|/o, $factoids->{$database}->{$subject});
|
||||
my $answer;
|
||||
if (@alternatives) {
|
||||
if (not defined($self->{'factoidPositions'}->{$database}->{$subject})
|
||||
or $self->{'factoidPositions'}->{$database}->{$subject} >= scalar(@alternatives)) {
|
||||
$self->{'factoidPositions'}->{$database}->{$subject} = 0;
|
||||
}
|
||||
$answer = @alternatives[$self->{'factoidPositions'}->{$database}->{$subject}];
|
||||
$self->{'factoidPositions'}->{$database}->{$subject}++;
|
||||
} else {
|
||||
$answer = @alternatives[0];
|
||||
}
|
||||
my $who = defined($target) ? $target : $event->{'from'};
|
||||
$answer =~ s/\$who/$who/go;
|
||||
if ($answer =~ /^<alias>(.*)$/o) {
|
||||
if ($visitedAliases->{$1}) {
|
||||
return ('msg', "see $subject", 0);
|
||||
} else {
|
||||
$visitedAliases->{$subject}++;
|
||||
my($how, $what, $propagated) = $self->GetFactoid($event, undef, $1, $target, $direct, $visitedAliases);
|
||||
if (not defined($how)) {
|
||||
return ('msg', "see $1", $propagated);
|
||||
} else {
|
||||
return ($how, $what, $propagated);
|
||||
}
|
||||
}
|
||||
} elsif ($answer =~ /^<action>/o) {
|
||||
$answer =~ s/^<action>\s*//o;
|
||||
return ('me', $answer, 0);
|
||||
} else {
|
||||
if ($answer =~ /^<reply>/o) {
|
||||
$answer =~ s/^<reply>\s*//o;
|
||||
} else {
|
||||
# pick a 'random' prefix
|
||||
my $prefix = $self->{'prefixes'}->[$event->{'time'} % @{$self->{'prefixes'}}];
|
||||
if (lc($who) eq lc($subject)) {
|
||||
$answer = "${prefix}you are $answer";
|
||||
} else {
|
||||
$answer = "$prefix$subject $database $answer";
|
||||
}
|
||||
if (defined($friend)) {
|
||||
$answer = "$friend knew: $answer";
|
||||
}
|
||||
}
|
||||
return ('msg', $answer, 0);
|
||||
}
|
||||
} else {
|
||||
# we have no idea what this is
|
||||
return (undef, undef, $self->Research($event, $originalDatabase, $subject, $target, $direct, $visitedAliases));
|
||||
}
|
||||
}
|
||||
|
||||
sub CanonicalizeFactoid {
|
||||
my $self = shift;
|
||||
my($database, $subject) = @_;
|
||||
if (not defined($factoids->{$database}->{$subject})) {
|
||||
while (my $key = each %{$factoids->{$database}}) {
|
||||
if (lc($key) eq lc($subject)) {
|
||||
$subject = $key;
|
||||
# can't return or 'each' iterator won't be reset XXX
|
||||
}
|
||||
}
|
||||
}
|
||||
return $subject;
|
||||
}
|
||||
|
||||
sub FindFactoid {
|
||||
my $self = shift;
|
||||
my($database, $subject) = @_;
|
||||
if (not defined($database)) {
|
||||
$database = 'is';
|
||||
$subject = $self->CanonicalizeFactoid('is', $subject);
|
||||
if (not defined($factoids->{'is'}->{$subject})) {
|
||||
$subject = $self->CanonicalizeFactoid('are', $subject);
|
||||
if (defined($factoids->{'are'}->{$subject})) {
|
||||
$database = 'are';
|
||||
}
|
||||
}
|
||||
} else {
|
||||
$subject = $self->CanonicalizeFactoid($database, $subject);
|
||||
}
|
||||
return ($database, $subject);
|
||||
}
|
||||
|
||||
sub EditFactoid {
|
||||
my $self = shift;
|
||||
my($event, $subject, $search, $replace, $global, $caseInsensitive, $direct) = @_;
|
||||
if ($direct or $self->allowed($event, 'Edit')) {
|
||||
my $database;
|
||||
($database, $subject) = $self->FindFactoid($database, $subject);
|
||||
if (not defined($factoids->{$database}->{$subject})) {
|
||||
$self->targettedSay($event, "Er, I don't know about this $subject thingy...", $direct);
|
||||
return;
|
||||
}
|
||||
$self->debug("Editing the $subject entry.");
|
||||
my @output;
|
||||
foreach my $factoid (split(/\|/o, $factoids->{$database}->{$subject})) {
|
||||
$search = $self->sanitizeRegexp($search);
|
||||
if ($global and $caseInsensitive) {
|
||||
$factoid =~ s/$search/$replace/gi;
|
||||
} elsif ($global) {
|
||||
$factoid =~ s/$search/$replace/g;
|
||||
} elsif ($caseInsensitive) {
|
||||
$factoid =~ s/$search/$replace/i;
|
||||
} else {
|
||||
$factoid =~ s/$search/$replace/;
|
||||
}
|
||||
push(@output, $factoid);
|
||||
}
|
||||
$factoids->{$database}->{$subject} = join('|', @output);
|
||||
$self->targettedSay($event, 'ok', $direct);
|
||||
$self->{'edits'}++;
|
||||
}
|
||||
}
|
||||
|
||||
sub ForgetFactoid {
|
||||
my $self = shift;
|
||||
my($event, $subject, $direct) = @_;
|
||||
if ($direct or $self->allowed($event, 'Edit')) {
|
||||
my $count = 0;
|
||||
my $database;
|
||||
foreach my $db ('is', 'are') {
|
||||
($database, $subject) = $self->FindFactoid($db, $subject);
|
||||
if (defined($factoids->{$database}->{$subject})) {
|
||||
delete($factoids->{$database}->{$subject});
|
||||
$count++;
|
||||
}
|
||||
}
|
||||
if ($count) {
|
||||
$self->targettedSay($event, "I've forgotten what I knew about '$subject'.", $direct);
|
||||
$self->{'edits'}++;
|
||||
} else {
|
||||
$self->targettedSay($event, "I never knew anything about '$subject' in the first place!", $direct);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
# interbot communications
|
||||
sub Research {
|
||||
my $self = shift;
|
||||
my($event, $database, $subject, $target, $direct, $visitedAliases) = @_;
|
||||
if (not @{$self->{'friendBots'}}) {
|
||||
# no bots to ask, bail out
|
||||
return 0;
|
||||
}
|
||||
# now check that we need to ask the bots about it:
|
||||
my $asked = 0;
|
||||
if (not defined($self->{'researchNotes'}->{$subject})) {
|
||||
$self->{'researchNotes'}->{$subject} = [];
|
||||
} else {
|
||||
entry: foreach my $entry (@{$self->{'researchNotes'}->{lc($subject)}}) {
|
||||
my($eventE, $typeE, $databaseE, $subjectE, $targetE, $directE, $visitedAliasesE, $timeE) = @$entry;
|
||||
if ($typeE eq 'QUERY') {
|
||||
$asked++; # at least one bot was already asked quite recently
|
||||
if ((defined($targetE) and lc($targetE) eq lc($targetE)) or
|
||||
(not defined($targetE) and lc($event->{'from'}) eq lc($eventE->{'from'}))) {
|
||||
# already queued
|
||||
return 1;
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
# remember to tell these people about $subject if we ever find out about it:
|
||||
my $entry = [$event, 'QUERY', $database, $subject, $target, $direct, $visitedAliases, $event->{'time'}];
|
||||
push(@{$self->{'researchNotes'}->{lc($subject)}}, $entry);
|
||||
my $who = defined($target) ? $target : $event->{'from'};
|
||||
if (not $asked) {
|
||||
# not yet asked, so ask each bot about $subject
|
||||
foreach my $bot (@{$self->{'friendBots'}}) {
|
||||
next if $bot eq $event->{'nick'};
|
||||
local $event->{'from'} = $bot;
|
||||
$self->directSay($event, ":INFOBOT:QUERY <$who> $subject");
|
||||
}
|
||||
$self->{'interbots'}++;
|
||||
return $entry; # return reference to entry so that we can check if it has been replied or not
|
||||
} else {
|
||||
return $asked;
|
||||
}
|
||||
}
|
||||
|
||||
sub ReceivedReply {
|
||||
my $self = shift;
|
||||
my($event, $database, $subject, $target, $object) = @_;
|
||||
$self->{'interbots'}++;
|
||||
if (not $self->SetFactoid($event, 0, $subject, $database, 0, $object, 1, 1) and
|
||||
defined($self->{'researchNotes'}->{lc($subject)})) {
|
||||
# we didn't believe $event->{'from'}, but we might as well
|
||||
# tell any users that were wondering.
|
||||
foreach my $entry (@{$self->{'researchNotes'}->{lc($subject)}}) {
|
||||
my($eventE, $typeE, $databaseE, $subjectE, $targetE, $directE, $visitedAliasesE, $timeE) = @$entry;
|
||||
if ($typeE eq 'QUERY') {
|
||||
$self->factoidSay($eventE, 'msg', "According to $event->{'from'}, $subject $database '$object'.", $directE, $targetE);
|
||||
} elsif ($typeE eq 'DUNNO') {
|
||||
my $who = defined($targetE) ? $targetE : $eventE->{'from'};
|
||||
$self->directSay($eventE, ":INFOBOT:REPLY <$who> $subject =$database=> $object");
|
||||
}
|
||||
$entry->[1] = 'OLD';
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
sub ReceivedQuery {
|
||||
my $self = shift;
|
||||
my($event, $subject, $target) = @_;
|
||||
$self->{'interbots'}++;
|
||||
if (not $self->tellBot($event, $subject, $target)) {
|
||||
# in the spirit of embrace-and-extend, we're going to say that
|
||||
# :INFOBOT:DUNNO means "I don't know, but if you ever find
|
||||
# out, please tell me".
|
||||
$self->directSay($event, ":INFOBOT:DUNNO <$event->{'nick'}> $subject");
|
||||
}
|
||||
}
|
||||
|
||||
sub ReceivedDunno {
|
||||
my $self = shift;
|
||||
my($event, $target, $subject) = @_;
|
||||
$self->{'interbots'}++;
|
||||
if (not $self->tellBot($event, $subject, $target)) {
|
||||
# store the request
|
||||
push(@{$self->{'researchNotes'}->{lc($subject)}}, [$event, 'DUNNO', undef, $1, $target, 0, {}, $event->{'time'}]);
|
||||
}
|
||||
}
|
||||
|
||||
sub tellBot {
|
||||
my $self = shift;
|
||||
my($event, $subject, $target) = @_;
|
||||
my $count = 0;
|
||||
my $database;
|
||||
foreach my $db ('is', 'are') {
|
||||
($database, $subject) = $self->FindFactoid($db, $subject);
|
||||
if (defined($factoids->{$database}->{$subject})) {
|
||||
$self->directSay($event, ":INFOBOT:REPLY <$target> $subject =$database=> $factoids->{$database}->{$subject}");
|
||||
$count++;
|
||||
}
|
||||
}
|
||||
return $count;
|
||||
}
|
||||
|
||||
sub Scheduled {
|
||||
my $self = shift;
|
||||
my ($event, @data) = @_;
|
||||
if ($data[0] eq 'pruneInfobot') {
|
||||
my $now = $event->{'time'};
|
||||
foreach my $key (keys %{$self->{'researchNotes'}}) {
|
||||
my @new;
|
||||
foreach my $entry (@{$self->{'researchNotes'}->{$key}}) {
|
||||
my($eventE, $typeE, $databaseE, $subjectE, $targetE, $directE, $visitedAliasesE, $timeE) = @$entry;
|
||||
if (($typeE eq 'QUERY' and ($now - $timeE) < $self->{'queryTimeToLive'}) or
|
||||
($typeE eq 'DUNNO' and ($now - $timeE) < $self->{'dunnoTimeToLive'})) {
|
||||
push(@new, $entry);
|
||||
}
|
||||
}
|
||||
if (@new) {
|
||||
$self->{'researchNotes'}->{$key} = \@new;
|
||||
} else {
|
||||
delete($self->{'researchNotes'}->{$key});
|
||||
}
|
||||
}
|
||||
} elsif ($data[0] eq 'noIdea') {
|
||||
my(undef, $database, $subject, $direct, $propagated) = @data;
|
||||
my($eventE, $typeE, $databaseE, $subjectE, $targetE, $directE, $visitedAliasesE, $timeE) = @$propagated;
|
||||
# in theory, $eventE = $event, $databaseE = $database,
|
||||
# $subjectE = $subject, $targetE depends on if this was
|
||||
# triggered by a tell, $directE = $direct, $visitedAliasesE is
|
||||
# opaque, and $timeE is opaque.
|
||||
if ($typeE ne 'OLD') {
|
||||
$self->noIdea($event, $database, $subject, $direct);
|
||||
}
|
||||
} else {
|
||||
$self->SUPER::Scheduled($event, @data);
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
# internal helper routines
|
||||
|
||||
sub factoidSay {
|
||||
my $self = shift;
|
||||
my($event, $how, $what, $direct, $target) = @_;
|
||||
if (defined($target)) {
|
||||
$self->targettedSay($event, "told $target", 1);
|
||||
my $helper = $event->{'from'};
|
||||
local $event->{'from'} = $target;
|
||||
if ($how eq 'me') {
|
||||
$self->directEmote($event, $what);
|
||||
} else {
|
||||
if (length($what)) {
|
||||
$self->directSay($event, "$helper wanted you to know: $what");
|
||||
}
|
||||
}
|
||||
} elsif ($how eq 'me') {
|
||||
$self->emote($event, $what);
|
||||
} else {
|
||||
if ($event->{'channel'} eq '' or length($what) < $self->{'maxInChannel'}) {
|
||||
$self->targettedSay($event, $what, 1);
|
||||
} else {
|
||||
if ($direct) {
|
||||
$self->targettedSay($event, substr($what, 0, $self->{'maxInChannel'}) . '... (rest /msged)' , 1);
|
||||
$self->directSay($event, $what);
|
||||
} else {
|
||||
$self->targettedSay($event, substr($what, 0, $self->{'maxInChannel'}) . '... (there is more; ask me in a /msg)' , 1);
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
sub targettedSay {
|
||||
my $self = shift;
|
||||
my($event, $message, $direct) = @_;
|
||||
if ($direct and length($message)) {
|
||||
$self->say($event, "$event->{from}: $message");
|
||||
}
|
||||
}
|
||||
|
||||
sub countFactoids {
|
||||
my $self = shift;
|
||||
# don't want to use keys() as that would load the whole database index into memory.
|
||||
my $sum = 0;
|
||||
while (my $factoid = each %{$factoids->{'is'}}) { $sum++; }
|
||||
while (my $factoid = each %{$factoids->{'are'}}) { $sum++; }
|
||||
return $sum;
|
||||
}
|
||||
|
||||
sub allowed {
|
||||
my $self = shift;
|
||||
my($event, $type) = @_;
|
||||
if ($event->{'channel'} ne '') {
|
||||
foreach my $user (@{$self->{'autoIgnore'}}) {
|
||||
if ($user eq $event->{'from'}) {
|
||||
return 0;
|
||||
}
|
||||
}
|
||||
foreach my $channel (@{$self->{"never$type"}}) {
|
||||
if ($channel eq $event->{'channel'} or
|
||||
$channel eq '*') {
|
||||
return 0;
|
||||
}
|
||||
}
|
||||
foreach my $channel (@{$self->{"auto$type"}}) {
|
||||
if ($channel eq $event->{'channel'} or
|
||||
$channel eq '*') {
|
||||
return 1;
|
||||
}
|
||||
}
|
||||
}
|
||||
return 0;
|
||||
}
|
||||
|
||||
sub noIdea {
|
||||
my $self = shift;
|
||||
my($event, $database, $subject, $direct) = @_;
|
||||
if (lc($subject) eq lc($event->{'from'})) {
|
||||
$self->targettedSay($event, "Sorry, I've no idea who you are.", $direct);
|
||||
} else {
|
||||
if (not defined($database)) {
|
||||
$database = 'might be';
|
||||
}
|
||||
$self->targettedSay($event, "Sorry, I've no idea what '$subject' $database.", $direct);
|
||||
}
|
||||
}
|
||||
@@ -1,69 +0,0 @@
|
||||
#!/usr/bin/perl -w
|
||||
######################################
|
||||
# Infobot Factoid Import/Export Tool #
|
||||
######################################
|
||||
|
||||
use strict;
|
||||
use AnyDBM_File;
|
||||
use Fcntl;
|
||||
|
||||
if (not @ARGV == 2) {
|
||||
&use();
|
||||
} else {
|
||||
my $command = shift @ARGV;
|
||||
my $filename = shift @ARGV;
|
||||
if ($command eq '-d') {
|
||||
&dump($filename);
|
||||
} elsif ($command eq '-i') {
|
||||
&import($filename);
|
||||
} else {
|
||||
&use();
|
||||
}
|
||||
}
|
||||
|
||||
sub use {
|
||||
print "\n";
|
||||
print " usage: $0 -d dbname\n";
|
||||
print " prints out an ascii flat file of the database listed.\n";
|
||||
print " dbname should be the basename of the db, e.g.\n";
|
||||
print " $0 -d ../factoids-is > is.fact\n";
|
||||
print " $0 -d ../factoids-are > are.fact\n";
|
||||
print "\n";
|
||||
print " $0 -i dbname\n";
|
||||
print " imports an ascii flat file into the database listed.\n";
|
||||
print " dbname should be the basename of the db, e.g.\n";
|
||||
print " $0 -i ../factoids-is < chemicals.fact\n";
|
||||
print " $0 -i ../factoids-is < is.fact\n";
|
||||
print " $0 -i ../factoids-are < are.fact\n";
|
||||
print "\n";
|
||||
exit(1);
|
||||
}
|
||||
|
||||
sub dump {
|
||||
my %db;
|
||||
tie(%db, 'AnyDBM_File', shift, O_RDONLY, 0666);
|
||||
while (my ($key, $val) = each %db) {
|
||||
chomp $val;
|
||||
print "$key => $val\n";
|
||||
}
|
||||
}
|
||||
|
||||
sub import {
|
||||
my %db;
|
||||
tie(%db, 'AnyDBM_File', shift, O_WRONLY|O_CREAT, 0666);
|
||||
while (<STDIN>) {
|
||||
chomp;
|
||||
unless (m/\s*(.+?)\s+=(?:is=|are=)?>\s+(.+?)\s*$/o) {
|
||||
m/\s*(.+?)\s+(?:is|are)?\s+(.+?)\s*$/o;
|
||||
}
|
||||
if (length($1) and length($2)) {
|
||||
if (defined($db{$1})) {
|
||||
if (not $db{$1} =~ m/^(|.*\|)\Q$2\E(|.*\|)$/s) {
|
||||
$db{$1} .= "|$2";
|
||||
}
|
||||
} else {
|
||||
$db{$1} = $2;
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -1,195 +0,0 @@
|
||||
The Infobot Protocol
|
||||
====================
|
||||
|
||||
Reverse engineered from infobot 0.45.3 by Ian Hickson.
|
||||
|
||||
|
||||
QUERY
|
||||
-----
|
||||
|
||||
If a bot is asked something by a user and does not know the answer, it
|
||||
may send queries to all the bots it knows. Queries must be in private
|
||||
messages and should have the following form:
|
||||
|
||||
:INFOBOT:QUERY <target> subject
|
||||
|
||||
...where "target" is the name of the user who sent the query in the
|
||||
first place, and "subject" is the question that was asked.
|
||||
|
||||
In reality, "target" may be any string of non-whitespace character, so
|
||||
it could be used as an internal ID.
|
||||
|
||||
A bot receiving a QUERY message must not try to contact the user given
|
||||
by "target" (that string should be treated as opaque) and must not
|
||||
make any assumptions about the "subject" string (it could contain
|
||||
*anything*, including high bit characters and the works).
|
||||
|
||||
It is an error for the "subject" string to contain either "=is=>" or
|
||||
"=are=>". Receiving bots may ignore this error, however.
|
||||
|
||||
Bot authors should carefully consider the potential for cascades
|
||||
before writing bots that chain QUERY messages. (As in, send out QUERY
|
||||
messages if they are unable to respond to a QUERY message themselves).
|
||||
In general, this is not a recommended behaviour.
|
||||
|
||||
Bot authors are urged to write protection into their bots to avoid
|
||||
being affected by poorly written bots that cause cascades.
|
||||
|
||||
|
||||
REPLY
|
||||
-----
|
||||
|
||||
Upon receiving a QUERY message, a bot may, if it has information on
|
||||
"subject", opt to send a private message back to the originating bot
|
||||
in the form of a REPLY message. Bots must not send unsolicited REPLY
|
||||
messages. The form of the REPLY message is:
|
||||
|
||||
:INFOBOT:REPLY <target> subject =database=> object
|
||||
|
||||
...where "target" is the string of the same name from the original
|
||||
QUERY message, "subject" is the second string from the original QUERY
|
||||
message, "database" is one of "is" or "are" depending on the whether
|
||||
"subject" is determined to be singular or plural respectively, and
|
||||
"object" is the string that should be assumed to be the answer to
|
||||
"subject". The string may contain special formatting codes, these are
|
||||
described below.
|
||||
|
||||
Upon receiving a REPLY message, bots should first check that they are
|
||||
expecting one. If they are, the user identified by the "target" string
|
||||
should be contacted and given the information represented by the
|
||||
"object" string. (Remember that the "target" string need not actually
|
||||
be the nick of the original user; it could be an internal key that
|
||||
indirectly identifies a user.)
|
||||
|
||||
Bots should carefully check the integrity and authenticity of the
|
||||
"target" string, and must check that "database" is one of "is" or
|
||||
"are". The "subject" string ends at the first occurance of either
|
||||
"=is=>" or "=are=>". It is *not* an error for the "object" string to
|
||||
contain either of those substrings.
|
||||
|
||||
Bots may opt to store the information given by a REPLY request so that
|
||||
future questions may be answered without depending on other bots.
|
||||
|
||||
It is suggested that bots credit which bot actually knew the
|
||||
information when reporting back to the user.
|
||||
|
||||
|
||||
DUNNO
|
||||
-----
|
||||
|
||||
(This is not part of the original infobot protocol. And is, as of
|
||||
2002-02-05, only supported by the mozbot2 Infobot module.)
|
||||
|
||||
Upon receiving a QUERY message, a bot may, if it has no information on
|
||||
the "subject" in question, reply with a DUNNO message. This message
|
||||
has basically the same form as the QUERY message:
|
||||
|
||||
:INFOBOT:DUNNO <target> subject
|
||||
|
||||
The DUNNO message indicates that the bot is not aware of the answer to
|
||||
the question, but would like to be informed of the answer, should the
|
||||
first bot ever find out about it. The "target" string should, as with
|
||||
the QUERY string, be considered opaque.
|
||||
|
||||
Upon receiving a DUNNO message, there are several possible responses.
|
||||
If the bot is aware of the answer to "subject", then it should treat
|
||||
the DUNNO message as if it was a QUERY message (typically resulting in
|
||||
a REPLY message). This can occur if, for example, another bot has sent
|
||||
a REPLY to the original QUERY before this bot has had the chance to
|
||||
send the DUNNO message.
|
||||
|
||||
If the first bot still doesn't know the answer, however, it may store
|
||||
the DUNNO request internally. If, at a future time, the bot is
|
||||
informed (either directly by a user or through a REPLY message) about
|
||||
the answer to "subject", then it may send a REPLY message to the bot
|
||||
that sent the DUNNO request, informing the bot of the value it learnt.
|
||||
|
||||
|
||||
SPECIAL STRINGS
|
||||
---------------
|
||||
|
||||
The "object" string in the REPLY message may contain several special
|
||||
flags.
|
||||
|
||||
$who
|
||||
If the string contains the string "$who" then, when the string is
|
||||
given to the user, it should be replaced by the name of the user.
|
||||
|
||||
|
|
||||
Multiple alternative replies may be encoded in one reply, those
|
||||
should be separated by a vertical bar.
|
||||
|
||||
<reply>
|
||||
If the string is prefixed by "<reply>" then the string should not
|
||||
be prefixed by "subject is" or "subject are" as usual.
|
||||
|
||||
<action>
|
||||
The string should be returned via a CTCP ACTION.
|
||||
|
||||
<alias>
|
||||
The string should be taken as the name of another entry to look up.
|
||||
|
||||
|
||||
EXAMPLES
|
||||
--------
|
||||
|
||||
In these examples, A, B and C are bots, and x, y and z are people.
|
||||
|
||||
The first example shows a simple case of one bots asking two other
|
||||
bots for help, one of which gives a reply and the other of which says
|
||||
it has no idea.
|
||||
|
||||
+-------- originator of private message
|
||||
|
|
||||
| +--- target of private message
|
||||
| |
|
||||
V V
|
||||
z -> A: what is foo?
|
||||
A -> z: I have no idea.
|
||||
A -> B: :INFOBOT:QUERY <z> foo
|
||||
A -> C: :INFOBOT:QUERY <z> foo
|
||||
B -> A: :INFOBOT:REPLY <x> foo =is=> bar
|
||||
C -> A: :INFOBOT:DUNNO <C> foo
|
||||
A -> x: B knew: foo is bar
|
||||
A -> C: :INFOBOT:REPLY <C> foo =is=> bar
|
||||
|
||||
Note how the DUNNO in this case comes after the REPLY and thus is
|
||||
immediately answered.
|
||||
|
||||
The next example uses <alias>. One bot knows the answer to the
|
||||
question as an alias to another word, but when the original bot asks
|
||||
about _that_ word, it is the second bot that can help.
|
||||
|
||||
z -> A: what is foo?
|
||||
A -> z: I have no idea.
|
||||
A -> B: :INFOBOT:QUERY <z> foo
|
||||
A -> C: :INFOBOT:QUERY <z> foo
|
||||
B -> A: :INFOBOT:REPLY <x> foo =is=> <alias>bar
|
||||
C -> A: :INFOBOT:DUNNO <C> foo
|
||||
A -> B: :INFOBOT:QUERY <z> bar
|
||||
A -> C: :INFOBOT:QUERY <z> bar
|
||||
A -> C: :INFOBOT:REPLY <C> foo =is=> <alias>bar
|
||||
B -> A: :INFOBOT:DUNNO <B> bar
|
||||
C -> A: :INFOBOT:REPLY <x> bar =is=> baz
|
||||
A -> z: C knew: bar is baz
|
||||
A -> B: :INFOBOT:REPLY <B> bar =is=> baz
|
||||
|
||||
Note how the credit actually goes to the second bot. A better bot
|
||||
might remember all the bots involved and credit all of them. A better
|
||||
bot might also remember what the original question was and reply "foo
|
||||
is baz" instead of "bar is baz".
|
||||
|
||||
Next we have some examples of special codes. If we have:
|
||||
|
||||
foo is bar|<alias>baz|<reply>foo to you too|<action>foos|$who
|
||||
baz is foo
|
||||
|
||||
...then the following are valid responses when asked about foo:
|
||||
|
||||
<A> foo is bar
|
||||
<A> baz is foo
|
||||
<A> foo to you too
|
||||
* A foos
|
||||
<A> foo is z
|
||||
|
||||
-- end --
|
||||
@@ -1,136 +0,0 @@
|
||||
################################
|
||||
# Insult Module #
|
||||
################################
|
||||
|
||||
# This is basically a loose port of insultd, a random insult server,
|
||||
# for self-flagellating maniacs, written on 1991-12-09 by
|
||||
# garnett@colorado.edu. See http://insulthost.colorado.edu/
|
||||
|
||||
package BotModules::Insult;
|
||||
use vars qw(@ISA);
|
||||
@ISA = qw(BotModules);
|
||||
1;
|
||||
|
||||
our @adjectives = qw( acidic antique contemptible culturally-unsound
|
||||
despicable evil fermented festering foul fulminating humid impure
|
||||
inept inferior industrial left-over low-quality malodorous off-color
|
||||
penguin-molesting petrified pointy-nosed salty sausage-snorfling
|
||||
tasteless tempestuous tepid tofu-nibbling unintelligent unoriginal
|
||||
uninspiring weasel-smelling wretched spam-sucking egg-sucking decayed
|
||||
halfbaked infected squishy porous pickled coughed-up thick vapid
|
||||
hacked-up unmuzzled bawdy vain lumpish churlish fobbing rank craven
|
||||
puking jarring fly-bitten pox-marked fen-sucked spongy droning
|
||||
gleeking warped currish milk-livered surly mammering ill-borne
|
||||
beef-witted tickle-brained half-faced headless wayward rump-fed
|
||||
onion-eyed beslubbering villainous lewd-minded cockered full-gorged
|
||||
rude-snouted crook-pated pribbling dread-bolted fool-born puny fawning
|
||||
sheep-biting dankish goatish weather-bitten knotty-pated malt-wormy
|
||||
saucyspleened motley-mind it-fowling vassal-willed loggerheaded
|
||||
clapper-clawed frothy ruttish clouted common-kissing pignutted
|
||||
folly-fallen plume-plucked flap-mouthed swag-bellied dizzy-eyed
|
||||
gorbellied weedy reeky measled spur-galled mangled impertinent
|
||||
bootless toad-spotted hasty-witted horn-beat yeasty
|
||||
imp-bladdereddle-headed boil-brained tottering hedge-born
|
||||
hugger-muggered elf-skinned Microsoft-loving );
|
||||
|
||||
our @amounts = qw( accumulation bucket coagulation enema-bucketful gob
|
||||
half-mouthful heap mass mound petrification pile puddle stack
|
||||
thimbleful tongueful ooze quart bag plate ass-full assload );
|
||||
|
||||
our @nouns = ('bat toenails', 'bug spit', 'cat hair', 'chicken piss',
|
||||
'dog vomit', 'dung', 'fat woman\'s stomach-bile', 'fish heads',
|
||||
'guano', 'gunk', 'pond scum', 'rat retch', 'red dye number-9',
|
||||
'Sun IPC manuals', 'waffle-house grits', 'yoo-hoo', 'dog balls',
|
||||
'seagull puke', 'cat bladders', 'pus', 'urine samples', 'squirrel guts',
|
||||
'snake assholes', 'snake bait', 'buzzard gizzards', 'cat-hair-balls',
|
||||
'rat-farts', 'pods', 'armadillo snouts', 'entrails', 'snake snot',
|
||||
'eel ooze', 'slurpee-backwash', 'toxic waste', 'Stimpy-drool',
|
||||
'poopy', 'poop', 'craptacular carpet droppings', 'jizzum',
|
||||
'cold sores', 'anal warts', 'IE user');
|
||||
|
||||
sub Help {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
return {
|
||||
'' => 'Generate insults on the fly, for when you\'re too lazy to invent some yourself.',
|
||||
'insult' => 'Insults someone. Syntax: \'insult <who>\'',
|
||||
};
|
||||
}
|
||||
|
||||
# RegisterConfig - Called when initialised, should call registerVariables
|
||||
sub RegisterConfig {
|
||||
my $self = shift;
|
||||
$self->SUPER::RegisterConfig(@_);
|
||||
$self->registerVariables(
|
||||
# [ name, save?, settable? ]
|
||||
['insultOverrides', 1, 1, { # overrides for the insults (keys must be lowercase)
|
||||
'' => '%source: exactly how stupid do you think i am?',
|
||||
'yourself' => '%source: nice try, fool',
|
||||
'urself' => '%source: at least learn to spell, you moronic noodle',
|
||||
'mozilla' => '%target: You are nothing but the best browser on the planet.',
|
||||
'mozilla.org' => '%target: You are nothing but the best caretaker Mozilla ever had.',
|
||||
'c++' => '%target: you are evil',
|
||||
}],
|
||||
);
|
||||
}
|
||||
|
||||
sub Told {
|
||||
my $self = shift;
|
||||
my ($event, $message) = @_;
|
||||
if ($message =~ /^\s*(?:will\s+you\s+)?(?:insult|harass)\s+(\S+?)(?:[\s,.]+please)?[\s.?!]*$/osi) {
|
||||
my $who = $1;
|
||||
my $line;
|
||||
|
||||
if (lc $who eq 'me') {
|
||||
$who = $event->{'from'};
|
||||
}
|
||||
|
||||
my $me = quotemeta($event->{'nick'});
|
||||
if ($who =~ m/^$me$/si and
|
||||
defined $self->{'insultOverrides'}->{''}) {
|
||||
$line = $self->{'insultOverrides'}->{''};
|
||||
} elsif (defined $self->{'insultOverrides'}->{lc $who}) {
|
||||
$line = $self->{'insultOverrides'}->{lc $who};
|
||||
} else {
|
||||
$line = $who . ': ' . $self->generateInsult();
|
||||
}
|
||||
$line =~ s/%source/$event->{'from'}/gos;
|
||||
$line =~ s/%target/$who/gos;
|
||||
$self->sayOrEmote($event, $line);
|
||||
} else {
|
||||
return $self->SUPER::Told(@_);
|
||||
}
|
||||
return 0; # we've dealt with it, no need to do anything else.
|
||||
}
|
||||
|
||||
sub generateInsult {
|
||||
my $self = shift;
|
||||
#
|
||||
# Insults are formed by making combinations of:
|
||||
#
|
||||
# You are nothing but a(n) {adj} {amt} of {adj} {noun}
|
||||
#
|
||||
my $adj1 = $self->rand_idx(\@adjectives);
|
||||
my $adj2; # musn't be the same as $adj1
|
||||
my $count = @adjectives;
|
||||
if ($count > 1) {
|
||||
my $index = int(rand($count));
|
||||
if ($adjectives[$index] eq $adj1) {
|
||||
++$index;
|
||||
$index = 0 if $index >= $count;
|
||||
}
|
||||
$adj2 = $adjectives[$index];
|
||||
} else {
|
||||
$adj2 = 'err... of... some';
|
||||
}
|
||||
my $amnt = $self->rand_idx(\@amounts);
|
||||
my $noun = $self->rand_idx(\@nouns);
|
||||
my $an = $adj1 =~ m/^[aeiou]/ois ? 'an' : 'a';
|
||||
return "You are nothing but $an $adj1 $amnt of $adj2 $noun.";
|
||||
}
|
||||
|
||||
sub rand_idx {
|
||||
my $self = shift;
|
||||
my($array) = @_;
|
||||
return $array->[int(rand(@$array))];
|
||||
}
|
||||
@@ -1,196 +0,0 @@
|
||||
# -*- Mode: perl; tab-width: 4; indent-tabs-mode: nil; -*-
|
||||
################################
|
||||
# Karma Module #
|
||||
################################
|
||||
|
||||
package BotModules::Karma;
|
||||
use vars qw(@ISA);
|
||||
@ISA = qw(BotModules);
|
||||
1;
|
||||
|
||||
# RegisterConfig - Called when initialised, should call registerVariables
|
||||
sub RegisterConfig {
|
||||
my $self = shift;
|
||||
$self->SUPER::RegisterConfig(@_);
|
||||
$self->registerVariables(
|
||||
# [ name, save?, settable? ]
|
||||
['scores', 1, 1, {}], # nick => total karma.
|
||||
['privateScores', 1, 1, {}], # nick => nick karma nick karma...
|
||||
['secondsDelayRequired', 1, 1, 20],
|
||||
['_lastspoken', 0, 0, {}], # nick => nick => time
|
||||
);
|
||||
}
|
||||
|
||||
sub Help {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
return {
|
||||
'' => 'A karma tracker. If you have authenticated (using the \'auth\' command) then it will also keep track of your own setting of people\'s karma, as well as the total of everyone\'s settings. Use the \'rank\' command to find someone\'s karma rank.',
|
||||
'++' => 'Increase someone\'s karma. Syntax: victim++',
|
||||
'--' => 'Decrease someone\'s karma. Syntax: victim--',
|
||||
'rank' => 'Find someone\'s karma level. Omit the victim\'s name to get a complete listing of everyone\'s karma (long). Syntax: \'rank victim\' or just \'rank\'',
|
||||
};
|
||||
}
|
||||
|
||||
sub Told {
|
||||
my $self = shift;
|
||||
my ($event, $message) = @_;
|
||||
if ($message =~ /^(\S+)\+\+$/os) {
|
||||
$self->ChangeKarma($event, $1, 1);
|
||||
} elsif ($message =~ /^(\S+)\-\-$/os) {
|
||||
$self->ChangeKarma($event, $1, -1);
|
||||
} elsif ($message =~ /^\s*(?:karma\s+)?ranks?[?\s]*$/os) {
|
||||
$self->ReportKarmaRanks($event, $1);
|
||||
} elsif ($message =~ /^\s*karma(?:\s+rank)?\s+(\S+)[?\s]*$/os or
|
||||
$message =~ /^\s*(?:karma\s+)?rank\s+(\S+)[?\s]*$/os) {
|
||||
$self->ReportKarma($event, $1);
|
||||
} else {
|
||||
return $self->SUPER::Told(@_);
|
||||
}
|
||||
return 0; # dealt with it...
|
||||
}
|
||||
|
||||
sub Heard {
|
||||
my $self = shift;
|
||||
my ($event, $message) = @_;
|
||||
if ($message =~ /^(\S*[^-+\s])\+\+$/os) {
|
||||
$self->ChangeKarma($event, $1, 1);
|
||||
} elsif ($message =~ /^(\S*[^-+\s])\-\-$/os) {
|
||||
$self->ChangeKarma($event, $1, -1);
|
||||
} else {
|
||||
return $self->SUPER::Told(@_);
|
||||
}
|
||||
return 0; # we've dealt with it, no need to do anything else.
|
||||
}
|
||||
|
||||
sub ChangeKarma {
|
||||
my $self = shift;
|
||||
my ($event, $who, $delta) = @_;
|
||||
$self->debug("$who += $delta requested");
|
||||
if ((defined($self->{'_lastSpoken'}->{$event->{'user'}})) and
|
||||
(defined($self->{'_lastSpoken'}->{$event->{'user'}}->{lc $who})) and
|
||||
(($event->{'time'} - $self->{'_lastSpoken'}->{$event->{'user'}}->{lc $who}) <= $self->{'secondsDelayRequired'})) {
|
||||
$self->{'_lastSpoken'}->{$event->{'user'}}->{lc $who} = $self->{'_lastSpoken'}->{$event->{'user'}}->{lc $who}+5;
|
||||
my $delay = $self->{'secondsDelayRequired'} - ($event->{'time'} - $self->{'_lastSpoken'}->{$event->{'user'}}->{lc $who});
|
||||
$self->directSay($event, "You will have to wait another $delay seconds before being able to change ${who}'s karma.");
|
||||
} else {
|
||||
if (not defined($self->{'_lastSpoken'}->{$event->{'user'}})) {
|
||||
$self->{'_lastSpoken'}->{$event->{'user'}} = {};
|
||||
}
|
||||
$self->{'_lastSpoken'}->{$event->{'user'}}->{lc $who} = $event->{'time'};
|
||||
if (lc $event->{'from'} eq lc $who) {
|
||||
if ($delta > 0) {
|
||||
$delta = -$delta;
|
||||
}
|
||||
}
|
||||
if ($event->{'channel'} ne '') {
|
||||
$self->{'scores'}->{lc $who} += $delta;
|
||||
if ($self->{'scores'}->{lc $who} == 0) {
|
||||
delete($self->{'scores'}->{lc $who});
|
||||
}
|
||||
}
|
||||
my $nick = lc $event->{'userName'};
|
||||
if ($nick) {
|
||||
if (not defined($self->{"privateScores"}->{$nick})) {
|
||||
$self->{"privateScores"}->{$nick} = (lc($who) . ' ' . $delta);
|
||||
} else {
|
||||
my %privateScores = split(' ', $self->{"privateScores"}->{$nick});
|
||||
$privateScores{lc $who} += $delta;
|
||||
if ($privateScores{lc $who} == 0) {
|
||||
delete($privateScores{lc $who});
|
||||
}
|
||||
my @privateScores = %privateScores;
|
||||
local $" = ' ';
|
||||
$self->{'privateScores'}->{$nick} = "@privateScores";
|
||||
}
|
||||
} elsif ($event->{'channel'} eq '') {
|
||||
$self->say($event, 'For private stats, you need to authenticate. Use the \'newuser\' and \'auth\' commands.');
|
||||
}
|
||||
$self->saveConfig();
|
||||
}
|
||||
}
|
||||
|
||||
sub ReportKarma {
|
||||
my $self = shift;
|
||||
my ($event, $who) = @_;
|
||||
if (not defined($self->{'scores'}->{lc $who})) {
|
||||
$self->say($event, "$who has no karma.");
|
||||
} else {
|
||||
my $karma = $self->{'scores'}->{lc $who};
|
||||
my @order = sort { $self->{'scores'}->{$b} <=> $self->{'scores'}->{$a} } keys(%{$self->{'scores'}});
|
||||
my $rank = 0;
|
||||
if (scalar(@order)) {
|
||||
user: foreach my $user (@order) {
|
||||
$rank++;
|
||||
if (lc $user eq lc $who) {
|
||||
last user;
|
||||
}
|
||||
}
|
||||
}
|
||||
$self->say($event, "$who has $karma points of karma (rank $rank).");
|
||||
}
|
||||
if ($event->{'channel'} eq '') {
|
||||
$nick = lc $event->{'userName'};
|
||||
if ($nick) {
|
||||
if (not defined($self->{"privateScores"}->{$nick})) {
|
||||
$self->say($event, "You have not given anyone any karma.");
|
||||
} else {
|
||||
my %privateScores = split(' ', $self->{"privateScores"}->{$nick});
|
||||
my $karma = $privateScores{lc $who};
|
||||
|
||||
if (not defined($karma)) {
|
||||
$self->say($event, "You have not given $who any karma.");
|
||||
} else {
|
||||
$self->say($event, "You have given $who $karma points of karma.");
|
||||
}
|
||||
}
|
||||
} else {
|
||||
$self->say($event, 'For private stats, you need to authenticate. Use the \'newuser\' and \'auth\' commands.');
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
sub ReportKarmaRanks {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
my @order = sort { $self->{'scores'}->{$b} <=> $self->{'scores'}->{$a} } keys(%{$self->{'scores'}});
|
||||
if (scalar(@order)) {
|
||||
if ($event->{'channel'} ne '') {
|
||||
my $top = $order[0];
|
||||
my $score = $self->{'scores'}->{$top};
|
||||
$self->say($event, "The person with the most karma is $top with $score points.");
|
||||
}
|
||||
$self->directSay($event, "Global rankings:");
|
||||
$self->ReportKarmaRanksList($event, \@order, $self->{'scores'});
|
||||
}
|
||||
if ($event->{'channel'} eq '') {
|
||||
$nick = lc $event->{'userName'};
|
||||
if ($nick) {
|
||||
if (defined($self->{"privateScores"}->{$nick})) {
|
||||
my %privateScores = split(' ', $self->{"privateScores"}->{$nick});
|
||||
@order = sort { $privateScores{$b} <=> $privateScores{$a} } keys(%privateScores);
|
||||
if (scalar(@order)) {
|
||||
$self->directSay($event, "Personal rankings:");
|
||||
$self->ReportKarmaRanksList($event, \@order, \%privateScores);
|
||||
} else {
|
||||
$self->say($event, "I seem to have lost track of the people to which you gave karma points.");
|
||||
}
|
||||
} else {
|
||||
$self->say($event, "You have not given anyone karma.");
|
||||
}
|
||||
} else {
|
||||
$self->say($event, 'For private stats, you need to authenticate. Use the \'newuser\' and \'auth\' commands.');
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
sub ReportKarmaRanksList {
|
||||
my $self = shift;
|
||||
my($event, $order, $scores) = @_;
|
||||
my $rank = 1;
|
||||
foreach my $entry (@$order) {
|
||||
my $score = $scores->{$entry};
|
||||
$self->directSay($event, "$rank. $entry ($score)");
|
||||
$rank++;
|
||||
}
|
||||
}
|
||||
@@ -1,51 +0,0 @@
|
||||
################################
|
||||
# KeepAlive Module #
|
||||
################################
|
||||
|
||||
package BotModules::KeepAlive;
|
||||
use vars qw(@ISA);
|
||||
@ISA = qw(BotModules);
|
||||
1;
|
||||
|
||||
# RegisterConfig - Called when initialised, should call registerVariables
|
||||
sub RegisterConfig {
|
||||
my $self = shift;
|
||||
$self->SUPER::RegisterConfig(@_);
|
||||
$self->registerVariables(
|
||||
# [ name, save?, settable? ]
|
||||
['delay', 1, 1, 20],
|
||||
['string', 1, 1, 'ping'],
|
||||
['target', 1, 1, '#spam'],
|
||||
);
|
||||
}
|
||||
|
||||
# Schedule - called when bot connects to a server, to install any schedulers
|
||||
# use $self->schedule($event, $delay, $times, $data)
|
||||
# where $times is 1 for a single event, -1 for recurring events,
|
||||
# and a +ve number for an event that occurs that many times.
|
||||
sub Schedule {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
$self->schedule($event, \$self->{'delay'}, -1, 'keepalive');
|
||||
$self->SUPER::Schedule($event);
|
||||
}
|
||||
|
||||
sub Help {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
return {
|
||||
'' => 'This is a simple keep-alive module, it regularly sends text out. This has been known to help with network lag.',
|
||||
} if $self->isAdmin($event);
|
||||
return {};
|
||||
}
|
||||
|
||||
sub Scheduled {
|
||||
my $self = shift;
|
||||
my ($event, @data) = @_;
|
||||
if ($data[0] eq 'keepalive') {
|
||||
local $event->{'target'} = $self->{'target'};
|
||||
$self->say($event, $self->{'string'});
|
||||
} else {
|
||||
$self->SUPER::Scheduled($event, @data);
|
||||
}
|
||||
}
|
||||
@@ -1,109 +0,0 @@
|
||||
# -*- Mode: perl; tab-width: 4; indent-tabs-mode: nil; -*-
|
||||
################################
|
||||
# KookBot Module #
|
||||
################################
|
||||
#
|
||||
# Based on kookbot.pl by Keunwoo Lee
|
||||
# http://www.cs.washington.edu/homes/klee/misc/kookbot.html
|
||||
#
|
||||
# Whacked by Axel Hecht <axel@pike.org>
|
||||
|
||||
package BotModules::KookBot;
|
||||
use vars qw(@ISA);
|
||||
@ISA = qw(BotModules);
|
||||
1;
|
||||
|
||||
sub Help {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
return {
|
||||
'' => 'This is the KookBot module. See http://www.cs.washington.edu/homes/klee/misc/kookbot.html for details',
|
||||
'kook' => 'Requests that the bot kook around.',
|
||||
};
|
||||
}
|
||||
|
||||
# RegisterConfig - Called when initialised, should call registerVariables
|
||||
sub RegisterConfig {
|
||||
my $self = shift;
|
||||
$self->SUPER::RegisterConfig(@_);
|
||||
$self->registerVariables(
|
||||
# [ name, save?, settable? ]
|
||||
['sentences', 1, 1, 1], # how many sentences to say each time
|
||||
['good-adjectives', 1, 1, ['intelligent', 'open-minded', 'honest', 'clear', 'practical', 'flexible yet critical', 'harmonious', 'truthful', 'well-constructed', ]],
|
||||
['good-nouns', 1, 1, ['freedom', 'justice', 'straightforwardness', 'subtlety', 'strength', 'compassion', 'fairness', 'rational approach', 'democracy', 'realism', ]],
|
||||
['bad-adjectives', 1, 1, ['orthodox', 'malignant', 'malevolent', 'dangerous', 'fascist', 'foolish', 'closed-minded', 'annoying', 'unjust', 'long-winded', 'lacking in support', 'shameful', ]],
|
||||
['bad-nouns', 1, 1, ['oppression', 'tyranny', 'stupidity', 'ignorance', 'discrimination', 'indifference', 'propaganda', 'prejudice', ]],
|
||||
['tactics-agree', 1, 1, ['apply principles of', 'embrace', 'think along the same lines as', 'commune with the spirit of', 'would prefer', 'argue strenuously for', 'try to posit', 'show the validity in', ]],
|
||||
['tactics-object', 1, 1, ['object to', 'reject anything involved with', 'refuse to accept', 'argue strenuously against', 'completely disagree with', 'rebut', 'take issue with']],
|
||||
['productions', 1, 1, [
|
||||
# OK, so here's the key:
|
||||
# \0 = good_adjective
|
||||
# \1 = good_noun
|
||||
# \2 = bad_adjective
|
||||
# \3 = bad_noun
|
||||
# \4 = tactics_agree
|
||||
# \5 = tactics_object
|
||||
'You \4 the \2 \3 to \1.',
|
||||
'True \0 \1 proceeds from examining \1, not \3.',
|
||||
'One must consider \1 versus \3.',
|
||||
'I can only imagine that you \4 \3.',
|
||||
'You \4 \2 \3. I \5 that.',
|
||||
'The argument you \4 would result in \3.',
|
||||
'Think about the \3, \2 and \2, and how it compares with \0 \1.',
|
||||
'I ask you to be \0, not \2. You \5 any appearance of \1.',
|
||||
'Is this \0? I think it is obvious that your statement is \2 and \2.',
|
||||
'But there is a \0 \1, and your argument would \5 it.',
|
||||
'Can there be any doubt? I \4 \0, \0 \1, and you obviously do not.',
|
||||
'You \5 the fact that your evidence is shallow, the result of \2 propaganda and \3.',
|
||||
'Yet your argument tries to \5 everything that is \0.',
|
||||
'It is only the \0 evidence that you \5, and it is because you \5 \1.',
|
||||
'I \5 your arguments only. There is no personal attack here.',
|
||||
]],
|
||||
);
|
||||
}
|
||||
|
||||
sub Told {
|
||||
my $self = shift;
|
||||
my ($event, $message) = @_;
|
||||
my $dokook = undef;
|
||||
if ((($event->{'level'} == 1) and ($self->isAdmin($event))) or
|
||||
(($event->{'level'} == 3) and ($event->{'God_channel_rights'}) and
|
||||
($event->{'KookBot_channel'} eq $event->{'God_channel'}))) {
|
||||
if ($message =~ /^\s*kook\s+(\S+)\s*$/osi) {
|
||||
$dokook = $1;
|
||||
}
|
||||
}
|
||||
if (($message =~ /^\s*kook\s*$/osi) or defined($dokook)) {
|
||||
my @output;
|
||||
for (my $i = 0; $i < $self->{'sentences'}; $i++) {
|
||||
my $line = $self->rand_idx('productions');
|
||||
$line =~ s/\\0/$self->rand_idx('good-adjectives')/goe;
|
||||
$line =~ s/\\1/$self->rand_idx('good-nouns')/goe;
|
||||
$line =~ s/\\2/$self->rand_idx('bad-adjectives')/goe;
|
||||
$line =~ s/\\3/$self->rand_idx('bad-nouns')/goe;
|
||||
$line =~ s/\\4/$self->rand_idx('tactics-agree')/goe;
|
||||
$line =~ s/\\5/$self->rand_idx('tactics-object')/goe;
|
||||
push(@output, $line);
|
||||
}
|
||||
local $event->{'target'} = $event->{'target'};
|
||||
if (defined($dokook)) {
|
||||
$event->{'target'} = $dokook;
|
||||
}
|
||||
local $" = ' ';
|
||||
$self->say($event, "@output");
|
||||
} else {
|
||||
if (($event->{'level'} == 1) and ($message =~ /^\s*kook\s+(\S+)\s*$/osi)) {
|
||||
$event->{'God_channel'} = lc($1);
|
||||
$event->{'KookBot_channel'} = lc($1);
|
||||
}
|
||||
my $result = $self->SUPER::Told(@_);
|
||||
return $result < (3 * defined($event->{'KookBot_channel'})) ? 3 : $result;
|
||||
}
|
||||
return 0; # we've dealt with it, no need to do anything else.
|
||||
}
|
||||
|
||||
sub rand_idx {
|
||||
my $self = shift;
|
||||
my($array) = @_;
|
||||
return $self->{$array}->[int(rand(@{$self->{$array}}))];
|
||||
}
|
||||
@@ -1,179 +0,0 @@
|
||||
# -*- Mode: perl; tab-width: 4; indent-tabs-mode: nil; -*-
|
||||
################################
|
||||
# List Module #
|
||||
################################
|
||||
|
||||
package BotModules::List;
|
||||
use vars qw(@ISA);
|
||||
@ISA = qw(BotModules);
|
||||
1;
|
||||
|
||||
# XXX Wipe entire list command
|
||||
|
||||
# RegisterConfig - Called when initialised, should call registerVariables
|
||||
sub RegisterConfig {
|
||||
my $self = shift;
|
||||
$self->SUPER::RegisterConfig(@_);
|
||||
$self->registerVariables(
|
||||
# [ name, save?, settable? ]
|
||||
['lists', 1, 1, {}], # user => 'list name|item 1|item 2||list name|item1|item 2'
|
||||
['preferredLineLength', 1, 1, 80], # the usual
|
||||
['maxItemsInChannel', 1, 1, 20], # max number of items to print in the channel (above this and direct messages are used)
|
||||
);
|
||||
}
|
||||
|
||||
sub Help {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
return {
|
||||
'' => 'A personal list tracker. Store your lists here. You must be authenticated to use this (see \'newuser\'). Use the \'add\' command to add items to a list.',
|
||||
'add' => 'Add an item to a personal list. List names shouldn\'t contain the word \'to\' otherwise things will be too ambiguous. Syntax: \'add <thing to add> to <list name> list\', e.g. \'add bug 5693 to critical bug list\'.',
|
||||
'remove' => 'Remove an item from a personal list. Syntax: \'remove <thing to add> from <list name> list\', e.g. \'remove bug 5693 from critical bug list\'.',
|
||||
'list' => 'List the items in your list. Syntax: \'list items in <name of list> list\', e.g. \'list items in critical bug list\' or just \'critical bug list\'.',
|
||||
'lists' => 'Tells you what lists you have set up.',
|
||||
};
|
||||
}
|
||||
|
||||
sub Told {
|
||||
my $self = shift;
|
||||
my ($event, $message) = @_;
|
||||
if ($message =~ /^\s*add\s+(\S(?:.*\S)?)\s+to\s+(?:my\s+)?(\S(?:.*\S)?)\s+list[\s!.]*$/osi and $message !~ /\|/o and $event->{'userName'}) {
|
||||
$self->AddItem($event, $1, $2);
|
||||
} elsif ($message =~ /^\s*remove\s+(\S(?:.*\S)?)\s+from\s+(?:my\s+)?(\S(?:.*\S)?)\s+list[\s!.]*$/osi and $message !~ /\|/o and $event->{'userName'}) {
|
||||
$self->RemoveItem($event, $1, $2);
|
||||
} elsif ($message =~ /^\s* (?:examine \s+ |
|
||||
list \s+ items \s+ in \s+ |
|
||||
what (?:\s+is|'s) \s+ (?:in\s+)? )
|
||||
(?: my \s+ | the \s+ )?
|
||||
( \S (?:.*\S)? )
|
||||
\s+ list [\s!?.]* $/osix
|
||||
and $message !~ /\|/o and $event->{'userName'}) {
|
||||
$self->ListItems($event, $1);
|
||||
} elsif ($message =~ /^\s*lists[?\s.!]*$/osi and $event->{'userName'}) {
|
||||
$self->ListLists($event, $1);
|
||||
} else {
|
||||
return $self->SUPER::Told(@_);
|
||||
}
|
||||
return 0; # dealt with it...
|
||||
}
|
||||
|
||||
sub Baffled {
|
||||
my $self = shift;
|
||||
my ($event, $message) = @_;
|
||||
if ($message =~ /^\s*(\S(?:.*\S)?)\s+list[\s!?.]*$/osi and $message !~ /\|/o and $event->{'userName'}) {
|
||||
$self->ListItems($event, $1);
|
||||
} else {
|
||||
return $self->SUPER::Baffled(@_);
|
||||
}
|
||||
return 0; # dealt with it...
|
||||
}
|
||||
|
||||
sub Heard {
|
||||
my $self = shift;
|
||||
my ($event, $message) = @_;
|
||||
if ($message =~ /^\s*add\s+(\S(?:.*\S)?)\s+to\s+(?:my\s+)?(\S(?:.*\S)?)\s+list[\s!.]*$/osi and $message !~ /\|/o and $event->{'userName'}) {
|
||||
$self->AddItem($event, $1, $2);
|
||||
} elsif ($message =~ /^\s*remove\s+(\S(?:.*\S)?)\s+from\s+(?:my\s+)?(\S(?:.*\S)?)\s+list[\s!.]*$/osi and $message !~ /\|/o and $event->{'userName'}) {
|
||||
$self->RemoveItem($event, $1, $2);
|
||||
} else {
|
||||
return $self->SUPER::Told(@_);
|
||||
}
|
||||
return 0; # dealt with it...
|
||||
}
|
||||
|
||||
sub AddItem {
|
||||
my $self = shift;
|
||||
my ($event, $what, $list) = @_;
|
||||
my @lists = split(/\|\|/o, $self->{'lists'}->{$event->{'userName'}});
|
||||
local $" = '\', \'';
|
||||
my %lists;
|
||||
foreach my $sublist (@lists) {
|
||||
my @items = split(/\|/o, $sublist);
|
||||
$lists{shift @items} = \@items;
|
||||
}
|
||||
push(@{$lists{lc $list}}, $what);
|
||||
local $" = '|';
|
||||
my $compoundLists = '';
|
||||
foreach my $list (keys(%lists)) {
|
||||
if ($compoundLists ne '') {
|
||||
$compoundLists .= '||';
|
||||
}
|
||||
$compoundLists .= "$list|@{$lists{$list}}";
|
||||
}
|
||||
$self->{'lists'}->{$event->{'userName'}} = $compoundLists;
|
||||
$self->saveConfig();
|
||||
$self->say($event, "$event->{'from'}: stored '$what' in '$list' list");
|
||||
}
|
||||
|
||||
sub RemoveItem {
|
||||
my $self = shift;
|
||||
my ($event, $what, $list) = @_;
|
||||
my @lists = split(/\|\|/o, $self->{'lists'}->{$event->{'userName'}});
|
||||
local $" = '\', \'';
|
||||
my %lists;
|
||||
my $removed = 0;
|
||||
foreach my $sublist (@lists) {
|
||||
my @items = split(/\|/o, $sublist);
|
||||
if (lc $list eq $items[0]) {
|
||||
my $listName = shift @items;
|
||||
foreach my $item (@items) {
|
||||
if (lc $what ne lc $item) {
|
||||
push(@{$lists{$listName}}, $item);
|
||||
} else {
|
||||
$removed++;
|
||||
}
|
||||
}
|
||||
} else {
|
||||
$lists{shift @items} = \@items;
|
||||
}
|
||||
}
|
||||
local $" = '|';
|
||||
my $compoundLists = '';
|
||||
foreach my $list (keys(%lists)) {
|
||||
if ($compoundLists ne '') {
|
||||
$compoundLists .= '||';
|
||||
}
|
||||
$compoundLists .= "$list|@{$lists{$list}}";
|
||||
}
|
||||
$self->{'lists'}->{$event->{'userName'}} = $compoundLists;
|
||||
$self->saveConfig();
|
||||
if ($removed) {
|
||||
$self->say($event, "$event->{'from'}: removed '$what' from '$list' list");
|
||||
} else {
|
||||
$self->say($event, "$event->{'from'}: could not find '$what' in '$list' list");
|
||||
}
|
||||
}
|
||||
|
||||
sub ListItems {
|
||||
my $self = shift;
|
||||
my ($event, $list) = @_;
|
||||
my @lists = split(/\|\|/o, $self->{'lists'}->{$event->{'userName'}});
|
||||
my %lists;
|
||||
foreach my $list (@lists) {
|
||||
my @items = split(/\|/o, $list);
|
||||
$lists{lc shift @items} = \@items;
|
||||
}
|
||||
if (defined(@{$lists{lc $list}})) {
|
||||
my $size = scalar(@{$lists{lc $list}});
|
||||
if ($size > $self->{'maxItemsInChannel'}) {
|
||||
$self->channelSay($event, "$event->{'from'}: Your $list list contains $size items, which I am /msg'ing you.");
|
||||
$self->directSay($event, $self->prettyPrint($self->{'preferredLineLength'}, "Your $list list contains: ", '', ', ', @{$lists{lc $list}}));
|
||||
} else {
|
||||
$self->say($event, $self->prettyPrint($self->{'preferredLineLength'}, "Your $list list contains: ", $event->{'channel'} eq '' ? '' : "$event->{'from'}: ", ', ', @{$lists{lc $list}}));
|
||||
}
|
||||
} else {
|
||||
$self->say($event, "You don't have a $list list, sorry.");
|
||||
}
|
||||
}
|
||||
|
||||
sub ListLists {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
my @lists = split(/\|\|/o, $self->{'lists'}->{$event->{'userName'}});
|
||||
my @listNames;
|
||||
foreach my $list (@lists) {
|
||||
my @items = split(/\|/o, $list);
|
||||
push(@listNames, $items[0]);
|
||||
}
|
||||
$self->say($event, $self->prettyPrint($self->{'preferredLineLength'}, "Your lists are: ", $event->{'channel'} eq '' ? '' : "$event->{'from'}: ", ', ', @listNames));
|
||||
}
|
||||
@@ -1,77 +0,0 @@
|
||||
# -*- Mode: perl; tab-width: 4; indent-tabs-mode: nil; -*-
|
||||
################################
|
||||
# Magic Eight Ball #
|
||||
################################
|
||||
|
||||
package BotModules::MagicEightBall;
|
||||
use vars qw(@ISA);
|
||||
@ISA = qw(BotModules);
|
||||
1;
|
||||
|
||||
sub Help {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
return {
|
||||
'' => 'The all knowing magic eight ball, in electronic form. Ask a question and the answer shall be provided.',
|
||||
$self->{'prefix'}.'ball' => "Ask the Magic Eight Ball a question. Syntax: '$self->{'prefix'}ball: will it happen?'",
|
||||
};
|
||||
}
|
||||
|
||||
# RegisterConfig - Called when initialised, should call registerVariables
|
||||
sub RegisterConfig {
|
||||
my $self = shift;
|
||||
$self->SUPER::RegisterConfig(@_);
|
||||
$self->registerVariables(
|
||||
# [ name, save?, settable? ]
|
||||
['prefix', 1, 1, '!8'], # the prefix to put before the 'ball' command
|
||||
['responses-positive', 1, 1, ['It is possible.', 'Yes!', 'Of course.', 'Naturally.', 'Obviously.',
|
||||
'One would be wise to think so.', 'The outlook is good.', 'It shall be.',
|
||||
'The answer is certainly yes.', 'It is so.']],
|
||||
['responses-negative', 1, 1, ['In your dreams.', 'No.', 'No chance.', 'Unlikely.', 'About as likely as pigs flying.',
|
||||
'You\'re kidding, right?', 'The outlook is poor.', 'I doubt it very much.',
|
||||
'The answer is a resounding no.', 'NO!', 'NO.']],
|
||||
['responses-unknown', 1, 1, ['Maybe...', 'The outlook is hazy, please ask again later.', 'No clue.',
|
||||
'What are you asking me for?', '_I_ don\'t know.', 'Come again?',
|
||||
'You know the answer better than I.', 'The answer is def-- oooh! shiny thing!']],
|
||||
);
|
||||
}
|
||||
|
||||
sub Told {
|
||||
my $self = shift;
|
||||
return ($self->CheckTheBall(@_) and $self->SUPER::Told(@_));
|
||||
}
|
||||
|
||||
sub Heard {
|
||||
my $self = shift;
|
||||
return ($self->CheckTheBall(@_) and $self->SUPER::Told(@_));
|
||||
}
|
||||
|
||||
sub CheckTheBall {
|
||||
my $self = shift;
|
||||
my ($event, $message) = @_;
|
||||
if ($message =~ m/$self->{'prefix'}ball[\s:,]+(\S.+\w.+)$/si) {
|
||||
|
||||
# -- #buncs was here --
|
||||
# <Kam> !8ball: are you a fish?
|
||||
# <oopsbot> Kam: About as likely as pigs flying.
|
||||
# <Kam> !8ball: is the world flat?
|
||||
# <oopsbot> Kam: The answer is a resounding no.
|
||||
# <Kam> !8ball: is the world round?
|
||||
# <oopsbot> Kam: _I_ don't know.
|
||||
# <Kam> !8ball: is the world spherical?
|
||||
# <oopsbot> Kam: The answer is certainly yes.
|
||||
# <Kam> how DOES it do that? :)
|
||||
# <Hixie> it's gooood :-)
|
||||
|
||||
# trim the fat from the question
|
||||
$message =~ s/\W//gos;
|
||||
# pick a reply category that will always be the same for this exact question
|
||||
my $response = $self->{['responses-positive', 'responses-negative', 'responses-unknown']->[(length($message) % 3)]};
|
||||
# pick a specific reply that will be different to recent ones
|
||||
$response = $response->[$event->{'time'} % @$response];
|
||||
$self->say($event, "$event->{'from'}: $response");
|
||||
} else {
|
||||
return 1;
|
||||
}
|
||||
return 0;
|
||||
}
|
||||
@@ -1,155 +0,0 @@
|
||||
################################
|
||||
# MiniLogger Module #
|
||||
################################
|
||||
|
||||
package BotModules::MiniLogger;
|
||||
use vars qw(@ISA);
|
||||
@ISA = qw(BotModules);
|
||||
1;
|
||||
|
||||
sub Help {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
my %help = (
|
||||
'' => 'This module keeps a log of the last few comments that match some patterns. For example, it can be used to remember URIs that have recently been mentioned.',
|
||||
);
|
||||
foreach (keys %{$self->{'patterns'}}) {
|
||||
$help{$_} = 'Returns any recent comment that matched the pattern /'.$self->sanitizeRegexp($self->{'patterns'}->{$_})."/. To narrow the search down even more, you can include a search string after the $_, as in '$_ goats'. To restrict the search to a particular channel, append \'in <channel>\' at the end.";
|
||||
}
|
||||
if ($self->isAdmin($event)) {
|
||||
$help{''} .= ' To add a new pattern, use the following syntax: vars MiniLogger patterns \'+|name|pattern\'';
|
||||
$help{'flush'} = 'Deletes any logs for patterns or channels that are no longer relevant, makes sure all the logs are no longer than the \'bufferSize\' length. Syntax: \'flush minilogs\'.';
|
||||
}
|
||||
return \%help;
|
||||
}
|
||||
|
||||
# RegisterConfig - Called when initialised, should call registerVariables
|
||||
sub RegisterConfig {
|
||||
my $self = shift;
|
||||
$self->SUPER::RegisterConfig(@_);
|
||||
$self->registerVariables(
|
||||
# [ name, save?, settable? ]
|
||||
['log', 0, 0, {}], # log -> channel -> patternName -> [<who> text]
|
||||
['bufferSize', 1, 1, 20], # number of comments to remember, per channel/pattern combination
|
||||
['patterns', 1, 1, {'links'=>'<?(:?[Uu][Rr][LlIi]:)?\s*(?:https?|ftp)://[^\s>"]+>?'}], # list of patternNames and patterns (regexp)
|
||||
['blockedPatterns', 1, 1, []], # list of patterns (regexp) to ignore
|
||||
);
|
||||
}
|
||||
|
||||
sub Told {
|
||||
my $self = shift;
|
||||
my ($event, $message) = @_;
|
||||
if (($message =~ /^\s*([a-zA-Z0-9]+)(?:\s+(.+?))?(?:\s+in\s+(.+?))?\s*$/osi) and ($self->{'patterns'}->{$1})) {
|
||||
$self->Report($event, $3, $1, $2); # event, channel, log, pattern
|
||||
} elsif ($self->isAdmin($event)) {
|
||||
if ($message =~ /^\s*flush\s+minilogs\s*$/osi) {
|
||||
$self->FlushMinilogs($event);
|
||||
} else {
|
||||
return $self->SUPER::Told(@_);
|
||||
}
|
||||
} else {
|
||||
return $self->SUPER::Told(@_);
|
||||
}
|
||||
return 0; # we've dealt with it, no need to do anything else.
|
||||
}
|
||||
|
||||
sub Log {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
if (($event->{'firsttype'} eq 'Told') or ($event->{'firsttype'} eq 'Heard')) {
|
||||
$self->DoLog($event, "<$event->{'from'}> $event->{'data'}");
|
||||
} elsif (($event->{'firsttype'} eq 'Felt') or ($event->{'firsttype'} eq 'Saw')) {
|
||||
$self->DoLog($event, "* $event->{'from'} $event->{'data'}");
|
||||
}
|
||||
}
|
||||
|
||||
sub DoLog {
|
||||
my $self = shift;
|
||||
my ($event, $message) = @_;
|
||||
if ($event->{'channel'} ne '') {
|
||||
# don't log private messages
|
||||
foreach my $pattern (keys %{$self->{'patterns'}}) {
|
||||
my $regexp = $self->sanitizeRegexp($self->{'patterns'}->{$pattern});
|
||||
if ($message =~ /$regexp/s) {
|
||||
# wohay, we have a candidate!
|
||||
# now check for possible blockers...
|
||||
unless ($self->isBlocked($message)) {
|
||||
$self->debug("LOGGING: $message");
|
||||
push(@{$self->{'log'}->{$event->{'channel'}}->{$pattern}}, $message);
|
||||
if (@{$self->{'log'}->{$event->{'channel'}}->{$pattern}} > $self->{'bufferSize'}) {
|
||||
shift(@{$self->{'log'}->{$event->{'channel'}}->{$pattern}});
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
sub isBlocked {
|
||||
my $self = shift;
|
||||
my ($message) = @_;
|
||||
foreach my $blockedPattern (@{$self->{'blockedPatterns'}}) {
|
||||
my $regexp = $self->sanitizeRegexp($blockedPattern);
|
||||
if ($message =~ /$regexp/s) {
|
||||
return 1;
|
||||
}
|
||||
}
|
||||
return 0;
|
||||
}
|
||||
|
||||
sub Report {
|
||||
my $self = shift;
|
||||
my ($event, $channel, $log, $pattern) = @_;
|
||||
my @channels = $channel ? lc($channel) : @{$self->{'channels'}};
|
||||
my $count;
|
||||
$pattern = $self->sanitizeRegexp($pattern);
|
||||
foreach $channel (@channels) {
|
||||
foreach my $match (@{$self->{'log'}->{$channel}->{$log}}) {
|
||||
if ((!$pattern) or ($match =~ /$pattern/s)) {
|
||||
$self->directSay($event, $match);
|
||||
$count++;
|
||||
}
|
||||
}
|
||||
}
|
||||
unless ($count) {
|
||||
$self->directSay($event, 'No matches, sorry.');
|
||||
}
|
||||
$self->channelSay($event, "$event->{'from'}: minilog matches /msg'ed");
|
||||
}
|
||||
|
||||
sub FlushMinilogs {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
# remove dead channels
|
||||
my %channels = map { lc($_) => 1 } @{$self->{'channels'}};
|
||||
foreach my $channel (keys %{$self->{'log'}}) {
|
||||
if ($channels{$channel}) {
|
||||
# remove dead logs
|
||||
foreach my $pattern (keys %{$self->{'log'}->{$channel}}) {
|
||||
if ($self->{'patterns'}) {
|
||||
# remove any newly blocked patterns
|
||||
my @newpatterns;
|
||||
foreach my $match (@{$self->{'log'}->{$channel}->{$pattern}}) {
|
||||
unless ($self->isBlocked($match)) {
|
||||
push (@newpatterns, $match);
|
||||
}
|
||||
}
|
||||
# remove excess logs
|
||||
if (@newpatterns) {
|
||||
@{$self->{'log'}->{$channel}->{$pattern}} = (@newpatterns[
|
||||
@newpatterns - $self->{'bufferSize'} < 0 ? 0 : @newpatterns - $self->{'bufferSize'},
|
||||
$#newpatterns]
|
||||
);
|
||||
} else {
|
||||
@{$self->{'log'}->{$channel}->{$pattern}} = ();
|
||||
}
|
||||
} else {
|
||||
delete($self->{'log'}->{$channel}->{$pattern});
|
||||
}
|
||||
}
|
||||
} else {
|
||||
delete($self->{'log'}->{$channel});
|
||||
}
|
||||
}
|
||||
$self->say($event, 'Minilogs flushed.');
|
||||
}
|
||||
@@ -1,66 +0,0 @@
|
||||
################################
|
||||
# Parrot Module #
|
||||
################################
|
||||
|
||||
package BotModules::Parrot;
|
||||
use vars qw(@ISA);
|
||||
@ISA = qw(BotModules);
|
||||
1;
|
||||
|
||||
sub Help {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
if ($self->isAdmin($event)) {
|
||||
return {
|
||||
'' => 'This module allows you to make the bot do stuff.',
|
||||
'say' => 'Makes the bot say something. The <target> can be a person or channel. Syntax: say <target> <text>',
|
||||
'do' => 'Makes the bot do (/me) something. The <target> can be a person or channel. Syntax: do <target> <text>',
|
||||
'invite' => 'Makes the bot invite (/invite) somebody to a channel. Syntax: invite <who> <channel>',
|
||||
'announce' => 'Makes the bot announce something to every channel in which this module is enabled. Syntax: announce <text>',
|
||||
};
|
||||
} else {
|
||||
return $self->SUPER::Help($event);
|
||||
}
|
||||
}
|
||||
|
||||
sub Told {
|
||||
my $self = shift;
|
||||
my ($event, $message) = @_;
|
||||
if ((($event->{'level'} == 1) and ($self->isAdmin($event))) or
|
||||
(($event->{'level'} == 3) and ($event->{'God_channel_rights'}) and ($event->{'Parrot_channel'} eq $event->{'God_channel'}))) {
|
||||
if ($message =~ /^\s*say\s+(\S+)\s+(.*)$/osi) {
|
||||
local $event->{'target'} = $1;
|
||||
$self->say($event, $2);
|
||||
} elsif ($message =~ /^\s*do\s+(\S+)\s+(.*)$/osi) {
|
||||
local $event->{'target'} = $1;
|
||||
$self->emote($event, $2);
|
||||
} elsif ($message =~ /^\s*announce\s+(.*)$/osi) {
|
||||
$self->announce($event, $1);
|
||||
} elsif ($message =~ /^\s* invite \s+
|
||||
(\S+) \s+
|
||||
(?: (?:in|to|into) \s+
|
||||
(?:channel \s+)? )?
|
||||
(\S+) \s*$/osix) {
|
||||
$self->invite($event, $1, $2);
|
||||
} else {
|
||||
return $self->SUPER::Told(@_);
|
||||
}
|
||||
} else {
|
||||
if (($event->{'level'} == 1) and (($message =~ /^\s*say\s+(\S+)\s+(.*)$/osi) or ($message =~ /^\s*do\s+(\S+)\s+(.*)$/osi))) {
|
||||
$event->{'God_channel'} = lc($1);
|
||||
$event->{'Parrot_channel'} = lc($1);
|
||||
}
|
||||
my $result = $self->SUPER::Told(@_);
|
||||
return $result < (3 * defined($event->{'Parrot_channel'})) ? 3 : $result;
|
||||
|
||||
# Note: We go through some contortions here because if the parent
|
||||
# returns 3 or more, some other module sets God_channel, and
|
||||
# the command is either not 'say' or 'do' (or the God_channel happens
|
||||
# to be different to the channel we are looking at) then it is theoretically
|
||||
# possible that God_channel_rights could be set, but not for the channel
|
||||
# we care about. Or something..... ;-)
|
||||
|
||||
}
|
||||
return 0; # we've dealt with it, no need to do anything else.
|
||||
}
|
||||
|
||||
@@ -1,571 +0,0 @@
|
||||
# -*- Mode: perl; tab-width: 4; indent-tabs-mode: nil; -*-
|
||||
################################
|
||||
# Quiz Module #
|
||||
################################
|
||||
# some of these ideas are stolen from moxquizz (an eggdrop module)
|
||||
# see http://www.meta-x.de/moxquizz/
|
||||
|
||||
package BotModules::Quiz;
|
||||
use vars qw(@ISA);
|
||||
@ISA = qw(BotModules);
|
||||
1;
|
||||
|
||||
# XXX high score table
|
||||
# XXX do something with level
|
||||
# XXX make bot able to self-abort if no-one is taking part
|
||||
# XXX implement feature so that users that can be quiz admins in certain channels
|
||||
# XXX accept user submission
|
||||
# XXX README for database format (for now see http://www.meta-x.de/moxquizz/README.database)
|
||||
# XXX pause doesn't stop count of how long answer takes to answer
|
||||
# XXX different quiz formats, e.g. university challenge, weakest link (maybe implement by inheritance?)
|
||||
# XXX stats, e.g. number of questions skipped
|
||||
# XXX category filtering
|
||||
|
||||
sub Help {
|
||||
my $self = shift;
|
||||
my($event) = @_;
|
||||
my $help = {
|
||||
'' => "Runs quizzes. Start a quiz with the $self->{'prefix'}ask command.",
|
||||
$self->{'prefix'}.'ask' => 'Starts a quiz.',
|
||||
$self->{'prefix'}.'pause' => "Pauses the current quiz. Resume with $self->{'prefix'}resume.",
|
||||
$self->{'prefix'}.'resume' => 'Resumes the current quiz.',
|
||||
$self->{'prefix'}.'repeat' => 'Repeats the current question.',
|
||||
$self->{'prefix'}.'endquiz' => 'Ends the current quiz.',
|
||||
$self->{'prefix'}.'next' => 'Jump to the next question (at least half of the active participants have to say this for the question to be skipped).',
|
||||
$self->{'prefix'}.'score' => 'Show the current scores for the round.',
|
||||
};
|
||||
if ($self->isAdmin($event)) {
|
||||
$help->{'reload'} = 'To just reload the quiz data files instead of the whole module, use: reload Quiz Data';
|
||||
}
|
||||
return $help;
|
||||
}
|
||||
|
||||
# RegisterConfig - Called when initialised, should call registerVariables
|
||||
sub RegisterConfig {
|
||||
my $self = shift;
|
||||
$self->SUPER::RegisterConfig(@_);
|
||||
$self->registerVariables(
|
||||
# [ name, save?, settable? ]
|
||||
['questionSets', 1, 1, ['trivia.en']], # the list of files to read (from the Quiz/ directory)
|
||||
['questions', 0, 0, []], # the list of questions (hashes)
|
||||
['categories', 0, 0, {}], # hash of arrays whose values are indexes into questions
|
||||
['questionsPerRound', 1, 1, -1], # how many questions per round (-1 = infinite)
|
||||
['currentQuestion', 1, 0, {}], # the active question (per-channel hash)
|
||||
['questionIndex', 1, 0, 0], # where to start when picking the next question
|
||||
['skipMargin', 1, 1, 10], # maximum number of questions to skip at a time
|
||||
['remainingQuestions', 1, 0, {}], # how many more questions this round (per-channel hash)
|
||||
['questionsTime', 1, 0, {}], # when the question was asked
|
||||
['quizTime', 1, 0, {}], # when the quiz was started
|
||||
['paused', 1, 0, {}], # if the game is paused
|
||||
['totalScores', 1, 1, {}], # user => score
|
||||
['quizScores', 1, 0, {}], # channel => "user score"
|
||||
['skip', 1, 0, {}], # channel => "user 1"
|
||||
['players', 1, 0, {}], # channel => "user last time"
|
||||
['tip', 1, 0, {}], # which tip should next be given on this channel
|
||||
['tipDelay', 1, 1, 10], # seconds to wait before giving a tip
|
||||
['timeout', 1, 1, 120], # seconds to wait before giving up
|
||||
['skipFractionRequired', 1, 1, 0.5], # fraction of players that must say !skip to skip
|
||||
['askDelay', 1, 1, 2], # how long to wait between answer and question
|
||||
['prefix', 1, 1, '!'], # the prefix to have at the start of commands
|
||||
);
|
||||
}
|
||||
|
||||
sub Schedule {
|
||||
my $self = shift;
|
||||
my($event) = @_;
|
||||
$self->reloadData($event);
|
||||
my $fakeEvent = {%$event};
|
||||
foreach my $channel (keys %{$self->{'currentQuestion'}}) {
|
||||
$fakeEvent->{'channel'} = $channel;
|
||||
$fakeEvent->{'target'} = $channel;
|
||||
$self->debug("Restarting quiz in $channel... (qid $self->{'questionsTime'}->{$channel})");
|
||||
$self->schedule($fakeEvent, \$self->{'tipDelay'}, 1, 'tip', $self->{'questionsTime'}->{$channel});
|
||||
$self->schedule($fakeEvent, \$self->{'timeout'}, 1, 'timeout', $self->{'questionsTime'}->{$channel});
|
||||
if ($self->{'questionsTime'}->{$event->{'channel'}} == 0) {
|
||||
$self->schedule($event, \$self->{'askDelay'}, 1, 'ask');
|
||||
}
|
||||
}
|
||||
$self->SUPER::Schedule($event);
|
||||
}
|
||||
|
||||
sub Told {
|
||||
my $self = shift;
|
||||
my($event, $message) = @_;
|
||||
if ($message =~ /^\s*reload\s+quiz\s+data\s*$/osi and $self->isAdmin($event)) {
|
||||
my $count = $self->reloadData($event);
|
||||
$self->say($event, "$count questions loaded");
|
||||
} elsif ($message =~ /^\s*status[?\s]*$/osi) {
|
||||
my $questions = @{$self->{'questions'}};
|
||||
my $quizzes = keys %{$self->{'currentQuestion'}};
|
||||
$self->say($event, "$event->{'from'}: I have $questions questions and am running $quizzes quizzes.", 1); # XXX 1 quizzes
|
||||
} elsif (not $self->DoQuizCheck($event, $message, 1)) {
|
||||
return $self->SUPER::Told(@_);
|
||||
}
|
||||
return 0; # we've dealt with it, no need to do anything else.
|
||||
}
|
||||
|
||||
sub Baffled {
|
||||
my $self = shift;
|
||||
my($event, $message) = @_;
|
||||
if (not $self->quizAnswer($event, $message)) {
|
||||
return $self->SUPER::Baffled(@_);
|
||||
}
|
||||
return 0; # we've dealt with it, no need to do anything else.
|
||||
}
|
||||
|
||||
sub Heard {
|
||||
my $self = shift;
|
||||
my($event, $message) = @_;
|
||||
if (not $self->DoQuizCheck($event, $message, 0) and
|
||||
not $self->quizAnswer($event, $message)) {
|
||||
return $self->SUPER::Heard(@_);
|
||||
}
|
||||
return 0; # we've dealt with it, no need to do anything else.
|
||||
}
|
||||
|
||||
sub DoQuizCheck {
|
||||
my $self = shift;
|
||||
my($event, $message, $direct) = @_;
|
||||
if ($message =~ /^\s*\Q$self->{'prefix'}\Eask\s*$/si) {
|
||||
$self->quizStart($event);
|
||||
} elsif ($message =~ /^\s*\Q$self->{'prefix'}\Epause\s*$/si) {
|
||||
$self->quizPause($event);
|
||||
} elsif ($message =~ /^\s*\Q$self->{'prefix'}\E(?:resume|unpause)\s*$/si) {
|
||||
$self->quizResume($event);
|
||||
} elsif ($message =~ /^\s*\Q$self->{'prefix'}\Erepeat\s*$/si) {
|
||||
$self->quizRepeat($event);
|
||||
} elsif ($message =~ /^\s*\Q$self->{'prefix'}\E(?:end|stop|strivia|exit)(?:quiz)?\s*$/si) {
|
||||
$self->quizEnd($event);
|
||||
} elsif ($message =~ /^\s*\Q$self->{'prefix'}\E(?:dunno|skip|next)\s*$/si) {
|
||||
$self->quizSkip($event);
|
||||
} elsif ($message =~ /^\s*\Q$self->{'prefix'}\E(?:scores)\s*$/si) {
|
||||
$self->quizScores($event);
|
||||
} else {
|
||||
return 0;
|
||||
}
|
||||
return 1;
|
||||
}
|
||||
|
||||
sub reloadData {
|
||||
my $self = shift;
|
||||
my($event) = @_;
|
||||
$self->{'questions'} = [];
|
||||
$self->{'categories'} = {};
|
||||
$self->debug('Loading quiz data...');
|
||||
foreach my $set (@{$self->{'questionSets'}}) {
|
||||
if ($set =~ m/^[a-zA-Z0-9-][a-zA-Z0-9.-]*$/os) {
|
||||
local *FILE;
|
||||
if (not open(FILE, "<BotModules/Quiz/$set")) { # XXX what if the directory has changed?
|
||||
$self->debug(" * $set (Not loaded; $!)");
|
||||
next;
|
||||
}
|
||||
$self->debug(" * $set");
|
||||
my $category;
|
||||
my $question = {'tip' => []};
|
||||
while (defined($_ = <FILE>)) {
|
||||
chomp;
|
||||
next if m/^\#/os; # skip comment lines
|
||||
next if m/^\s*$/os; # skip blank lines
|
||||
if (m/^Category:\s*(.*?)\s*$/os) {
|
||||
# Category? (should always be on top!)
|
||||
$category = $1;
|
||||
if (not defined($self->{'categories'}->{$category})) {
|
||||
$self->{'categories'}->{$category} = [];
|
||||
}
|
||||
} elsif (m/^Question:\s*(.*?)\s*$/os) {
|
||||
# Question (should always stand after Category)
|
||||
$question = {'question' => $1, 'tip' => []};
|
||||
if (defined($category)) {
|
||||
$question->{'category'} = $category;
|
||||
undef($category);
|
||||
}
|
||||
push(@{$self->{'questions'}}, $question);
|
||||
push(@{$self->{'categories'}->{$category}}, $#{$self->{'questions'}});
|
||||
} elsif (m/^Answer:\s*(?:(.*?)\#(.*?)\#(.*?)|(.*?))\s*$/os) {
|
||||
# Answer (will be matched if no regexp is provided)
|
||||
if (defined($1)) {
|
||||
$question->{'answer-long'} = "$1$2$3";
|
||||
$question->{'answer-short'} = $2;
|
||||
} else {
|
||||
$question->{'answer-long'} = $4;
|
||||
$question->{'answer-short'} = $4;
|
||||
}
|
||||
} elsif (m/^Regexp:\s*(.*?)\s*$/os) {
|
||||
# Regexp? (use UNIX-style expressions)
|
||||
$question->{'answer-regexp'} = $1;
|
||||
} elsif (m/^Author:\s*(.*?)\s*$/os) {
|
||||
# Author? (the brain behind this question)
|
||||
$question->{'author'} = $1;
|
||||
} elsif (m/^Level:\s*(.*?)\s*$/os) {
|
||||
# Level? [baby|easy|normal|hard|extreme] (difficulty)
|
||||
$question->{'level'} = $1;
|
||||
} elsif (m/^Comment:\s*(.*?)\s*$/os) {
|
||||
# Comment? (comment line)
|
||||
$question->{'comment'} = $1;
|
||||
} elsif (m/^Score:\s*(.*?)\s*$/os) {
|
||||
# Score? [#] (credits for answering this question)
|
||||
$question->{'score'} = $1;
|
||||
} elsif (m/^Tip:\s*(.*?)\s*$/os) {
|
||||
# Tip* (provide one or more hints)
|
||||
push(@{$question->{'tip'}}, $1);
|
||||
} elsif (m/^TipCycle:\s*(.*?)\s*$/os) {
|
||||
# TipCycle? [#] (Specify number of generated tips)
|
||||
$question->{'tip-cycle'} = $1;
|
||||
} else {
|
||||
# XXX error handling
|
||||
}
|
||||
}
|
||||
close(FILE);
|
||||
} # else XXX invalid filename, ignore it
|
||||
}
|
||||
# if no more questions, abort running quizes.
|
||||
if (not @{$self->{'questions'}}) {
|
||||
foreach my $channel (keys %{$self->{'currentQuestion'}}) {
|
||||
local $event->{'channel'} = $channel;
|
||||
$self->say($event, 'There are no more questions.');
|
||||
$self->quizEnd($event);
|
||||
}
|
||||
}
|
||||
return scalar(@{$self->{'questions'}});
|
||||
}
|
||||
|
||||
|
||||
# game implementation
|
||||
|
||||
sub Scheduled {
|
||||
my $self = shift;
|
||||
my($event, @data) = @_;
|
||||
if ($data[0] eq 'tip') {
|
||||
if ($self->{'questionsTime'}->{$event->{'channel'}} == $data[1] and
|
||||
defined($self->{'currentQuestion'}->{$event->{'channel'}})) {
|
||||
# $self->debug('time for a tip');
|
||||
if ($self->{'paused'}->{$event->{'channel'}} or
|
||||
$self->quizTip($event)) {
|
||||
$self->schedule($event, \$self->{'tipDelay'}, 1, @data);
|
||||
}
|
||||
}
|
||||
} elsif ($data[0] eq 'timeout') {
|
||||
if ($self->{'questionsTime'}->{$event->{'channel'}} == $data[1] and
|
||||
defined($self->{'currentQuestion'}->{$event->{'channel'}})) {
|
||||
if ($self->{'paused'}->{$event->{'channel'}}) {
|
||||
$self->schedule($event, \$self->{'timeout'}, 1, @data);
|
||||
} else {
|
||||
my $answer = $self->{'questions'}->[$self->{'currentQuestion'}->{$event->{'channel'}}]->{'answer-long'};
|
||||
$self->say($event, "Too late! The answer was: $answer");
|
||||
$self->quizQuestion($event);
|
||||
}
|
||||
}
|
||||
} elsif ($data[0] eq 'ask') {
|
||||
if (defined($self->{'currentQuestion'}->{$event->{'channel'}})) {
|
||||
$self->quizQuestion($event);
|
||||
}
|
||||
} else {
|
||||
$self->SUPER::Scheduled($event, @data);
|
||||
}
|
||||
}
|
||||
|
||||
sub quizStart { # called by user
|
||||
my $self = shift;
|
||||
my($event) = @_;
|
||||
if ($event->{'channel'} ne '' and
|
||||
not defined($self->{'currentQuestion'}->{$event->{'channel'}})) {
|
||||
if (@{$self->{'questions'}} == 0) {
|
||||
# if no questions, complain.
|
||||
$self->say($event, 'I cannot run a quiz with no questions!');
|
||||
} else {
|
||||
# no game in progress, start one
|
||||
$self->{'remainingQuestions'}->{$event->{'channel'}} = $self->{'questionsPerRound'};
|
||||
$self->{'paused'}->{$event->{'channel'}} = 0;
|
||||
$self->{'quizTime'}->{$event->{'channel'}} = $event->{'time'};
|
||||
$self->{'quizScores'}->{$event->{'channel'}} = '';
|
||||
$self->{'players'}->{$event->{'channel'}} = '';
|
||||
$self->quizQuestion($event);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
sub quizQuestion { # called from quizStart or delayed from quizAnswer
|
||||
my $self = shift;
|
||||
my($event) = @_;
|
||||
if ($event->{'channel'} ne '' and # in channel
|
||||
not $self->{'paused'}->{$event->{'channel'}}) { # quiz not paused
|
||||
if ($self->{'remainingQuestions'}->{$event->{'channel'}} != 0) {
|
||||
$self->{'remainingQuestions'}->{$event->{'channel'}}--;
|
||||
my $category = $self->{'questions'}->[$self->{'currentQuestion'}->{$event->{'channel'}}]->{'category'};
|
||||
my $try = 0;
|
||||
my $questionCount = scalar keys %{$self->{'questions'}};
|
||||
while ($self->{'questions'}->[$self->{'currentQuestion'}->{$event->{'channel'}}]->{'category'} eq $category
|
||||
and $try++ < $questionCount) {
|
||||
$self->{'currentQuestion'}->{$event->{'channel'}} = $self->pickQuestion($event);
|
||||
}
|
||||
$self->{'questionsTime'}->{$event->{'channel'}} = $event->{'time'};
|
||||
$self->{'tip'}->{$event->{'channel'}} = 0;
|
||||
$self->{'skip'}->{$event->{'channel'}} = '';
|
||||
$self->schedule($event, \$self->{'tipDelay'}, 1, 'tip', $self->{'questionsTime'}->{$event->{'channel'}});
|
||||
$self->schedule($event, \$self->{'timeout'}, 1, 'timeout', $self->{'questionsTime'}->{$event->{'channel'}});
|
||||
$self->say($event, "Question: $self->{'questions'}->[$self->{'currentQuestion'}->{$event->{'channel'}}]->{'question'}");
|
||||
$self->debug("Question: $self->{'questions'}->[$self->{'currentQuestion'}->{$event->{'channel'}}]->{'question'}");
|
||||
$self->debug("Answer: $self->{'questions'}->[$self->{'currentQuestion'}->{$event->{'channel'}}]->{'answer-long'}");
|
||||
$self->saveConfig();
|
||||
} else {
|
||||
$self->quizEnd($event);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
sub quizAnswer { # called by user
|
||||
my $self = shift;
|
||||
my($event, $message) = @_;
|
||||
if ($event->{'channel'} ne '' and # in channel
|
||||
defined($self->{'currentQuestion'}->{$event->{'channel'}}) and # in quiz
|
||||
$self->{'questionsTime'}->{$event->{'channel'}} and # not answered
|
||||
not $self->{'paused'}->{$event->{'channel'}}) { # quiz not paused
|
||||
$self->stringHash(\$self->{'players'}->{$event->{'channel'}}, $event->{'from'}, $event->{'time'});
|
||||
if (lc($message) eq lc($self->{'questions'}->[$self->{'currentQuestion'}->{$event->{'channel'}}]->{'answer-long'}) or
|
||||
(defined($self->{'questions'}->[$self->{'currentQuestion'}->{$event->{'channel'}}]->{'answer-short'}) and
|
||||
lc($message) eq lc($self->{'questions'}->[$self->{'currentQuestion'}->{$event->{'channel'}}]->{'answer-short'})) or
|
||||
(defined($self->{'questions'}->[$self->{'currentQuestion'}->{$event->{'channel'}}]->{'answer-regexp'}) and
|
||||
$message =~ /$self->{'questions'}->[$self->{'currentQuestion'}->{$event->{'channel'}}]->{'answer-regexp'}/si)) {
|
||||
# they got it right
|
||||
my $who = $event->{'from'};
|
||||
my $answer = $self->{'questions'}->[$self->{'currentQuestion'}->{$event->{'channel'}}]->{'answer-long'};
|
||||
my $score = $self->{'questions'}->[$self->{'currentQuestion'}->{$event->{'channel'}}]->{'score'};
|
||||
if (not defined($score)) {
|
||||
$score = 1; # use difficulty XXX
|
||||
}
|
||||
my $time = $event->{'time'} - $self->{'questionsTime'}->{$event->{'channel'}};
|
||||
my $total = $self->score($event, $who, $score);
|
||||
$self->debug("Answered by: $who");
|
||||
$self->say($event, "$who got the right answer in $time seconds (+$score points giving $total). The answer was: $answer");
|
||||
$self->saveConfig();
|
||||
$self->{'questionsTime'}->{$event->{'channel'}} = 0;
|
||||
$self->schedule($event, \$self->{'askDelay'}, 1, 'ask');
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
sub quizTip { # called by timer, only during game
|
||||
my $self = shift;
|
||||
my($event) = @_;
|
||||
my $tip;
|
||||
if (defined($self->{'questions'}->[$self->{'currentQuestion'}->{$event->{'channel'}}]->{'tips'}) and
|
||||
$self->{'tip'}->{$event->{'channel'}} < @{$self->{'questions'}->[$self->{'currentQuestion'}->{$event->{'channel'}}]->{'tips'}}) {
|
||||
$tip = $self->{'questions'}->[$self->{'currentQuestion'}->{$event->{'channel'}}]->{'tips'}->[$self->{'tip'}->{$event->{'channel'}}];
|
||||
} else {
|
||||
if (not defined($self->{'questions'}->[$self->{'currentQuestion'}->{$event->{'channel'}}]->{'tips'}) and
|
||||
(not defined($self->{'questions'}->[$self->{'currentQuestion'}->{$event->{'channel'}}]->{'tipCycle'}) or
|
||||
$self->{'tip'}->{$event->{'channel'}} < $self->{'questions'}->[$self->{'currentQuestion'}->{$event->{'channel'}}]->{'tipCycle'})) {
|
||||
$tip = $self->generateTip($self->{'questions'}->[$self->{'currentQuestion'}->{$event->{'channel'}}]->{'answer-long'},
|
||||
$self->{'tip'}->{$event->{'channel'}},
|
||||
$self->{'questions'}->[$self->{'currentQuestion'}->{$event->{'channel'}}]->{'tipCycle'});
|
||||
}
|
||||
}
|
||||
if (defined($tip)) {
|
||||
$self->{'tip'}->{$event->{'channel'}} += 1;
|
||||
$self->say($event, "Hint: $tip...");
|
||||
$self->saveConfig();
|
||||
return 1;
|
||||
} else {
|
||||
return 0;
|
||||
}
|
||||
}
|
||||
|
||||
sub quizPause { # called by user
|
||||
my $self = shift;
|
||||
my($event) = @_;
|
||||
if (defined($self->{'currentQuestion'}->{$event->{'channel'}})) { # game in progress
|
||||
if (not $self->{'paused'}->{$event->{'channel'}}) { # not paused
|
||||
# pause game
|
||||
$self->{'paused'}->{$event->{'channel'}} = 1;
|
||||
$self->saveConfig();
|
||||
$self->say($event, "Quiz paused. Use $self->{'prefix'}resume to continue.");
|
||||
} else {
|
||||
$self->say($event, "Quiz already paused. Use $self->{'prefix'}resume to continue.");
|
||||
}
|
||||
} else {
|
||||
$self->say($event, "No quiz in progress, use $self->{'prefix'}ask to start one.");
|
||||
}
|
||||
}
|
||||
|
||||
sub quizResume { # called by user
|
||||
my $self = shift;
|
||||
my($event) = @_;
|
||||
if (defined($self->{'currentQuestion'}->{$event->{'channel'}})) { # game in progress
|
||||
if ($self->{'paused'}->{$event->{'channel'}}) { # paused
|
||||
# unpause game
|
||||
$self->{'paused'}->{$event->{'channel'}} = 0;
|
||||
$self->saveConfig();
|
||||
$self->say($event, "Quiz resumed. Question: $self->{'questions'}->[$self->{'currentQuestion'}->{$event->{'channel'}}]->{'question'}");
|
||||
} else {
|
||||
$self->say($event, "Quiz already in progress. Use $self->{'prefix'}repeat to be told the question again, and $self->{'prefix'}pause to pause the quiz.");
|
||||
}
|
||||
} else {
|
||||
$self->say($event, "No quiz in progress, use $self->{'prefix'}ask to start one.");
|
||||
}
|
||||
}
|
||||
|
||||
sub quizRepeat { # called by user
|
||||
my $self = shift;
|
||||
my($event) = @_;
|
||||
if (defined($self->{'currentQuestion'}->{$event->{'channel'}})) { # game in progress
|
||||
$self->say($event, "Question: $self->{'questions'}->[$self->{'currentQuestion'}->{$event->{'channel'}}]->{'question'}");
|
||||
} else {
|
||||
$self->say($event, "No quiz in progress, use $self->{'prefix'}ask to start one.");
|
||||
}
|
||||
}
|
||||
|
||||
sub quizEnd { # called by question and user
|
||||
my $self = shift;
|
||||
my($event) = @_;
|
||||
if (defined($self->{'currentQuestion'}->{$event->{'channel'}})) {
|
||||
# get the scores for each player that player in the game
|
||||
my @scores = $self->getScores($event, sub {
|
||||
my($event, $score) = @_;
|
||||
# XXX this means that a user has to be there till the end
|
||||
# of the game to get points added to his high score table.
|
||||
# XXX it also means a user can get better simply by
|
||||
# playing more games.
|
||||
$self->{'totalScores'}->{$score->[1]} += $score->[2];
|
||||
});
|
||||
# print them
|
||||
if (@scores) {
|
||||
local $" = ', ';
|
||||
$self->say($event, "Quiz Ended. Scores: @scores");
|
||||
} else {
|
||||
$self->say($event, 'Quiz Ended. No questions were answered.');
|
||||
}
|
||||
delete($self->{'currentQuestion'}->{$event->{'channel'}});
|
||||
$self->saveConfig();
|
||||
}
|
||||
}
|
||||
|
||||
sub quizScores { # called by user
|
||||
my $self = shift;
|
||||
my($event) = @_;
|
||||
if (defined($self->{'currentQuestion'}->{$event->{'channel'}})) {
|
||||
# get the scores for each player that player in the game
|
||||
my @scores = $self->getScores($event, sub {});
|
||||
# get other stats
|
||||
my $remaining = '';
|
||||
if ($self->{'remainingQuestions'}->{$event->{'channel'}} > 0) {
|
||||
$remaining = " There are $self->{'remainingQuestions'}->{$event->{'channel'}} more questions to go.";
|
||||
}
|
||||
# print them
|
||||
if (@scores) {
|
||||
local $" = ', ';
|
||||
$self->say($event, "Current Scores: @scores$remaining");
|
||||
} else {
|
||||
$self->say($event, "No questions have been answered yet.$remaining");
|
||||
}
|
||||
} else {
|
||||
$self->say($event, "No quiz in progress, use $self->{'prefix'}ask to start one.");
|
||||
}
|
||||
}
|
||||
|
||||
sub quizSkip { # called by user
|
||||
my $self = shift;
|
||||
my($event) = @_;
|
||||
if (defined($self->{'currentQuestion'}->{$event->{'channel'}})) { # game in progress
|
||||
if (not $self->{'paused'}->{$event->{'channel'}}) { # not paused
|
||||
if ($self->{'questionsTime'}->{$event->{'channel'}}) { # question asked and not answered
|
||||
# XXX should only let players skip (at the moment even someone who has not tried to answer any question can skip)
|
||||
# Get number of users who have said !skip (and set current user)
|
||||
my(undef, $skipCount) = $self->stringHash(\$self->{'skip'}->{$event->{'channel'}}, $event->{'from'}, 1);
|
||||
# Get number of users who are playing
|
||||
my $playerCount = $self->getActivePlayers($event);
|
||||
if ($skipCount >= $playerCount * $self->{'skipFractionRequired'}) {
|
||||
my $answer = $self->{'questions'}->[$self->{'currentQuestion'}->{$event->{'channel'}}]->{'answer-long'};
|
||||
$self->say($event, "$skipCount players wanted to skip. Moving to next question. The answer was: $answer");
|
||||
$self->quizQuestion($event);
|
||||
}
|
||||
} # else drop it
|
||||
} else {
|
||||
$self->say($event, "Quiz paused. Use $self->{'prefix'}resume to continue the quiz.");
|
||||
}
|
||||
} else {
|
||||
$self->say($event, "No quiz in progress, use $self->{'prefix'}ask to start one.");
|
||||
}
|
||||
}
|
||||
|
||||
sub pickQuestion {
|
||||
my $self = shift;
|
||||
my($event) = @_;
|
||||
$self->{'questionIndex'} += 1 + $event->{'time'} % $self->{'skipMargin'};
|
||||
$self->{'questionIndex'} %= @{$self->{'questions'}};
|
||||
return $self->{'questionIndex'};
|
||||
}
|
||||
|
||||
sub score {
|
||||
my $self = shift;
|
||||
my($event, $who, $score) = @_;
|
||||
if (defined($self->{'currentQuestion'}->{$event->{'channel'}})) {
|
||||
my($score, undef) = $self->stringHash(\$self->{'quizScores'}->{$event->{'channel'}}, $who, $score, 1);
|
||||
$self->saveConfig();
|
||||
return $score;
|
||||
}
|
||||
}
|
||||
|
||||
sub getScores {
|
||||
my $self = shift;
|
||||
my($event, $perUser) = @_;
|
||||
my @scores;
|
||||
foreach my $player ($self->getActivePlayers($event)) {
|
||||
my($score, undef) = $self->stringHash(\$self->{'quizScores'}->{$event->{'channel'}}, $player);
|
||||
if (defined($score)) {
|
||||
push(@scores, ["$player: $score", $player, $score]);
|
||||
}
|
||||
}
|
||||
# sort the scores by number
|
||||
@scores = sort {$a->[2] <=> $b->[2]} @scores;
|
||||
foreach my $score (@scores) {
|
||||
&$perUser($event, $score);
|
||||
$score = $score->[0];
|
||||
}
|
||||
return @scores;
|
||||
}
|
||||
|
||||
sub generateTip {
|
||||
my $self = shift;
|
||||
my($answer, $tipID, $maxTips) = @_;
|
||||
if (length($answer) > $tipID+1) {
|
||||
return substr($answer, 0, $tipID+1);
|
||||
} else {
|
||||
return undef;
|
||||
}
|
||||
}
|
||||
|
||||
sub getActivePlayers {
|
||||
my $self = shift;
|
||||
my($event) = @_;
|
||||
my @players;
|
||||
if (defined($self->{'currentQuestion'}->{$event->{'channel'}})) { # game in progress
|
||||
my $start = $self->{'quizTime'}->{$event->{'channel'}};
|
||||
my %players = split(' ', $self->{'players'}->{$event->{'channel'}});
|
||||
foreach my $player (keys %players) {
|
||||
if ($players{$player} > $start) {
|
||||
push(@players, $player);
|
||||
}
|
||||
}
|
||||
}
|
||||
return @players;
|
||||
}
|
||||
|
||||
sub stringHash {
|
||||
my $self = shift;
|
||||
my($string, $key, $value, $multiple) = @_;
|
||||
my %hash = split(' ', $$string);
|
||||
my @hash;
|
||||
if (defined($value)) {
|
||||
if (defined($multiple)) {
|
||||
$hash{$key} = $hash{$key} * $multiple + $value;
|
||||
} else {
|
||||
$hash{$key} = $value;
|
||||
}
|
||||
local $" = ' ';
|
||||
@hash = %hash;
|
||||
$$string = "@hash";
|
||||
} else {
|
||||
@hash = %hash;
|
||||
}
|
||||
return ($hash{$key}, scalar(@hash) / 2);
|
||||
}
|
||||
@@ -1,651 +0,0 @@
|
||||
# -*- Mode: perl; tab-width: 4; indent-tabs-mode: nil; -*-
|
||||
################################
|
||||
# Quotes Module #
|
||||
################################
|
||||
# Based on a request from Nortis http://www.blomstereng.org/
|
||||
|
||||
# XXX need to support multiple quote servers:
|
||||
# !discworld
|
||||
|
||||
package BotModules::Quotes;
|
||||
use vars qw(@ISA);
|
||||
@ISA = qw(BotModules);
|
||||
use Fcntl;
|
||||
use DBI;
|
||||
1;
|
||||
|
||||
# This uses a number of MySQL-specific features.
|
||||
|
||||
sub Help {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
my $help = {
|
||||
'' => 'A module to manage quotes.',
|
||||
'quote' => 'Search for a quote, or return a random one. To search for a quote, you must specify search parameters, see the help entries for id, text, author, note, match. Otherwise, a random quote is returned.',
|
||||
'match' => 'If there are multiple matches, you can specify which match you want by appending the match number to your search terms, for example \'quote author=blake 4\' will return the fourth quote whose author is \'blake\'. The default is 1.',
|
||||
'id' => 'To search for a quote by its numeric ID, append the ID to the \'quote\' command. For example, \'quote 42\'. If you specify other search parameters, this will return the relevant match from that list, see the help entry for \'match\'.',
|
||||
'text' => 'To search for a quote by text, append \'text="foo"\' to the \'quote\' command. For example, \'quote text="meaning of life"\' or \'quote text=life\'. You could also just say \'quote hello world\' or \'quote hello world 2\' (to get the second match).',
|
||||
'author' => 'To search for a quote by author or attribution, append \'author="foo"\' to the \'quote\' command. For example, \'quote author="Douglas Adams"\' or \'quote author=asimov\'.',
|
||||
'note' => 'To search for a quote by text in its note, append \'note="foo"\' to the \'quote\' command. For example, \'quote note=""\' or \'quote author=asimov\'.',
|
||||
'quotelast' => 'Returns the last quote added. Append a numer to return the nth but last quote added, as in \'lastquote 2\'.',
|
||||
'status' => 'Prints some information about the status of the quotes database.',
|
||||
};
|
||||
if ($self->canAdd($event)) {
|
||||
$help->{'addquote'} = 'Add a quote to the database. The format is \'addquote quote - author (note)\'. The \'(note)\' part may be omitted. The author may not.';
|
||||
}
|
||||
if ($self->canDelete($event)) {
|
||||
$help->{'delquote'} = 'Delete a quote from the database. The format is \'delquote id\'.';
|
||||
}
|
||||
if ($self->canEdit($event)) {
|
||||
$help->{'editquote'} = 'Edit a quote in the database. The format is \'editquote id quote - author (note)\' which will update the quote with that ID, using the new text, author, etc, in the same way as for \'addquote\'.';
|
||||
}
|
||||
if ($self->isAdmin($event)) {
|
||||
$help->{'setupquotes'} = 'Configure the quotes database connection. Format: \'setupquotes dbhost.example.com:dbport dbname dbuser dbpass\'. Port is optional (default 3306). You can also just say \'setupquotes\' to check on the configuration. See also \'help quote-defaults\'.';
|
||||
$help->{'quote-defaults'} = 'To get the default configuration, use \'setupquotes mozbotquotes.damowmow.com:3306 mozbotquotes mozbotquotes mozbotquotes\'.';
|
||||
}
|
||||
return $help;
|
||||
}
|
||||
|
||||
# RegisterConfig - Called when initialised, should call registerVariables
|
||||
sub RegisterConfig {
|
||||
my $self = shift;
|
||||
$self->SUPER::RegisterConfig(@_);
|
||||
$self->registerVariables(
|
||||
# [ name, save?, settable? ]
|
||||
['prefix', 1, 1, '!'], # the prefix to put before the undirected quote commands
|
||||
['dbhost', 1, 1, 'mozbotquotes.damowmow.com'],
|
||||
['dbport', 1, 1, '3306'],
|
||||
['dbname', 1, 1, 'mozbotquotes'],
|
||||
['dbuser', 1, 1, 'mozbotquotes'],
|
||||
['dbpass', 1, 1, 'mozbotquotes'],
|
||||
['tableName', 1, 1, 'quotes'],
|
||||
['usersAdd', 1, 1, []],
|
||||
['usersDelete', 1, 1, []],
|
||||
['usersEdit', 1, 1, []],
|
||||
);
|
||||
}
|
||||
|
||||
# call this at the top of any function that uses tableName
|
||||
sub sanitiseTableName {
|
||||
my $self = shift;
|
||||
$self->{tableName} =~ s/[^a-zA-Z]//gos;
|
||||
if (length($self->{tableName}) < 1) {
|
||||
$self->{tableName} = 'quotes';
|
||||
}
|
||||
$self->saveConfig();
|
||||
}
|
||||
|
||||
sub canAdd {
|
||||
my $self = shift;
|
||||
return $self->checkRights('Add', @_);
|
||||
}
|
||||
|
||||
sub canDelete {
|
||||
my $self = shift;
|
||||
return $self->checkRights('Delete', @_);
|
||||
}
|
||||
|
||||
sub canEdit {
|
||||
my $self = shift;
|
||||
return $self->checkRights('Edit', @_);
|
||||
}
|
||||
|
||||
sub checkRights {
|
||||
my $self = shift;
|
||||
my ($right, $event) = @_;
|
||||
return 1 if $self->isAdmin($event);
|
||||
foreach my $user (@{$self->{"users$right"}}) {
|
||||
return 1 if $user eq $event->{userName};
|
||||
}
|
||||
return 0;
|
||||
}
|
||||
|
||||
sub Schedule {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
unless ($self->dbconnect()) {
|
||||
$self->say($event, "Failed to connect to quotes database: $self->{dberror}");
|
||||
$self->say($event, 'Use the \'setupquotes\' command to configure the database.');
|
||||
}
|
||||
$self->SUPER::Schedule($event);
|
||||
}
|
||||
|
||||
sub dbconnect {
|
||||
my $self = shift;
|
||||
eval {
|
||||
$self->{dbhandle} =
|
||||
DBI->connect("DBI:mysql:$self->{dbname}:$self->{dbhost}:$self->{dbport}",
|
||||
$self->{dbuser}, $self->{dbpass},
|
||||
{RaiseError => 1, PrintError => 1, AutoCommit => 1, Taint => 0});
|
||||
};
|
||||
if (not $self->{dbhandle}) {
|
||||
$self->{dberror} = $@;
|
||||
$self->debug("Failed to connect to quotes database: $self->{dberror}");
|
||||
return 0;
|
||||
}
|
||||
return 1;
|
||||
}
|
||||
|
||||
sub dbdisconnect {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
if ($self->{dbhandle}) {
|
||||
$self->{dbhandle}->disconnect();
|
||||
$self->{dbhandle} = undef;
|
||||
}
|
||||
}
|
||||
|
||||
sub Unload {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
$self->dbdisconnect($event);
|
||||
}
|
||||
|
||||
sub dbcheckconfig {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
|
||||
$self->sanitiseTableName();
|
||||
|
||||
# count tables
|
||||
my $tables = $self->{dbhandle}->selectall_arrayref('SHOW TABLES');
|
||||
my $wantedTable = undef;
|
||||
$tables = [] unless defined $tables;
|
||||
foreach (@$tables) {
|
||||
$_ = $_->[0];
|
||||
}
|
||||
if (@$tables == 1) {
|
||||
# if only one, assume that's the one we want to use
|
||||
$wantedTable = $tables->[0];
|
||||
} else {
|
||||
# otherwise, assume the name is 'quotes'
|
||||
$wantedTable = $self->{tableName} || 'quotes';
|
||||
}
|
||||
|
||||
# check table exists
|
||||
$self->{dbtables} = $tables;
|
||||
foreach my $table (@$tables) {
|
||||
if (lc $table eq lc $wantedTable) {
|
||||
$self->{tableName} = $table;
|
||||
$self->saveConfig();
|
||||
return 1;
|
||||
}
|
||||
}
|
||||
return 0;
|
||||
}
|
||||
|
||||
sub dbcreatetables {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
|
||||
$self->sanitiseTableName();
|
||||
|
||||
# create table
|
||||
eval {
|
||||
$self->{dbhandle}->do("CREATE TABLE IF NOT EXISTS $self->{tableName} (
|
||||
id INTEGER UNSIGNED NOT NULL AUTO_INCREMENT PRIMARY KEY,
|
||||
quote TEXT NOT NULL DEFAULT '',
|
||||
author VARCHAR(100) NOT NULL DEFAULT 'Unknown',
|
||||
date DATETIME NOT NULL DEFAULT 0,
|
||||
note TEXT NULL DEFAULT NULL,
|
||||
shown INTEGER UNSIGNED NOT NULL DEFAULT 0,
|
||||
age INTEGER UNSIGNED NOT NULL DEFAULT 1,
|
||||
INDEX (author), INDEX(shown), INDEX(age)
|
||||
)");
|
||||
};
|
||||
if ($@) {
|
||||
$self->{dberror} = $@;
|
||||
$self->debug("Failed to create quotes table: $self->{dberror}");
|
||||
return 0;
|
||||
}
|
||||
return 1;
|
||||
}
|
||||
|
||||
sub verifyConnection {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
if ($self->dbconnect()) {
|
||||
if (not $self->dbcheckconfig($event)) {
|
||||
if (@{$self->{dbtables}}) {
|
||||
local $" = '\', \'';
|
||||
$self->say($event, "Connected, but I there were several tables and I wasn't sure which to use. The tables in this database are: '@{$self->{dbtables}}'");
|
||||
$self->say($event, "To make me create a new table (called '$self->{tableName}') use 'setupquotes table'. To make me use a particular table from the list above, use 'setupquotes use table $self->{dbtables}->[0]' (or whatever table you want to use).");
|
||||
} else {
|
||||
$self->say($event, "Connected, but I couldn't find a quotes table in the database. If you want me to create a table (named '$self->{tableName}') for you, use 'setupquotes tables'. To create one with a specific name, e.g. 'mozQuotes', use 'setupquotes tables mozQuotes'.");
|
||||
}
|
||||
} else {
|
||||
$self->say($event, "Connected (using table '$self->{tableName}').");
|
||||
}
|
||||
} else {
|
||||
$self->say($event, "Failed to connect to quotes database: $self->{dberror}");
|
||||
}
|
||||
}
|
||||
|
||||
sub Told {
|
||||
my $self = shift;
|
||||
my ($event, $message) = @_;
|
||||
if ($message =~ /^\s*set\s*up\s*quotes?(?:\s+(.*?))?\s*$/osi and $self->isAdmin($event)) {
|
||||
my $data = $1;
|
||||
if ($data =~ m/^(\S+?)(?::(\S+))?\s+(\S+)\s+(\S+)\s+(\S+)$/osi) {
|
||||
$self->dbdisconnect($event);
|
||||
$self->{'dbhost'} = $1;
|
||||
$self->{'dbport'} = $2 || 3306;
|
||||
$self->{'dbname'} = $3;
|
||||
$self->{'dbuser'} = $4;
|
||||
$self->{'dbpass'} = $5;
|
||||
$self->saveConfig();
|
||||
$self->say($event, "Ok, trying to connect...");
|
||||
$self->verifyConnection($event);
|
||||
} elsif ($data =~ m/^tables?(?:\s+(\S+))?$/osi) {
|
||||
if ($self->{dbhandle}) {
|
||||
if ($1) {
|
||||
$self->{tableName} = $1;
|
||||
$self->sanitiseTableName();
|
||||
}
|
||||
if ($self->dbcreatetables($event)) {
|
||||
$self->say($event, "Connected (using table '$self->{tableName}').");
|
||||
} else {
|
||||
$self->say($event, "Failed to create the table ('$self->{dberror}') -- make sure you have the right permissions set up.");
|
||||
}
|
||||
} else {
|
||||
$self->say($event, 'I haven\'t yet successfully connected to a database. Please select a MySQL server to connect to, e.g. \'setupquotes mozbotquotes.damowmow.com:3306 mozbotquotes mozbotquotes mozbotquotes\'');
|
||||
}
|
||||
} elsif ($data =~ m/^use\s*tables?\s+(\S+)$/osi) {
|
||||
$self->{tableName} = $1;
|
||||
$self->sanitiseTableName();
|
||||
if ($self->{dbhandle}) {
|
||||
if (not $self->dbcheckconfig($event)) {
|
||||
if (@{$self->{dbtables}}) {
|
||||
local $" = '\', \'';
|
||||
$self->say($event, "The table you requested, '$self->{tableName}', doesn't exist in this database. The tables in this database are: '@{$self->{dbtables}}'");
|
||||
$self->say($event, "To make me create this new table (called '$self->{tableName}') use 'setupquotes table'. To make me use one of the tables from the list above, use 'setupquotes use table $self->{dbtables}->[0]' (or whatever table you want to use).");
|
||||
} else {
|
||||
$self->say($event, "The table you requested, '$self->{tableName}', doesn't exist in this database. In fact this database has no tables at all. If you want me to create a table (called '$self->{tableName}') for you, use 'setupquotes tables'.");
|
||||
}
|
||||
} else {
|
||||
$self->say($event, "Connected (using table '$self->{tableName}').");
|
||||
}
|
||||
} else {
|
||||
$self->say($event, 'Noted. However, I haven\'t yet successfully connected to a database, so this is not enough to complete configuration.');
|
||||
$self->say($event, 'Please select a MySQL server to connect to, e.g. \'setupquotes mozbotquotes.damowmow.com:3306 mozbotquotes mozbotquotes mozbotquotes\'');
|
||||
}
|
||||
} elsif ($data =~ m/^\s*$/osi) {
|
||||
$self->dbdisconnect($event);
|
||||
$self->say($event, "Checking connection...");
|
||||
$self->verifyConnection($event);
|
||||
} else {
|
||||
$self->say($event, 'The format is: \'setupquotes host.domain.tld:port database username password\' (\':port\' is optional, defaults to 3306) or just \'setupquotes\' to check the configuration.');
|
||||
}
|
||||
} elsif ($message =~ /^\s*quote(?:\s+(.+?))?\s*$/osi) {
|
||||
$self->getQuote($event, $1);
|
||||
} elsif ($message =~ /^\s*(?:quotelast|last\s*quote)(?:\s+(.+?))?\s*$/osi) {
|
||||
$self->getLastQuote($event, $1);
|
||||
} elsif ($message =~ /^\s*add\s*quote(?:\s+(.+?))?\s*$/osi) {
|
||||
$self->addQuote($event, $1);
|
||||
} elsif ($message =~ /^\s*(?:delete|del|remove|rem)?\s*quote(?:\s+(.+?))?\s*$/osi) {
|
||||
$self->deleteQuote($event, $1);
|
||||
} elsif ($message =~ /^\s*edit\s*quote(?:\s+(.+?))?\s*$/osi) {
|
||||
$self->editQuote($event, $1);
|
||||
} elsif ($message =~ /^\s*(?:quotes?\s*)?status\s*$/osi) {
|
||||
$self->printStatus($event);
|
||||
} elsif ($self->checkBangCommands(@_)) {
|
||||
return $self->SUPER::Told(@_);
|
||||
}
|
||||
return 0; # we've dealt with it, no need to do anything else.
|
||||
}
|
||||
|
||||
sub Heard {
|
||||
my $self = shift;
|
||||
if ($self->checkBangCommands(@_)) {
|
||||
return $self->SUPER::Heard(@_);
|
||||
}
|
||||
return 0; # we've dealt with it, no need to do anything else.
|
||||
}
|
||||
|
||||
sub checkBangCommands {
|
||||
my $self = shift;
|
||||
my ($event, $message) = @_;
|
||||
if ($message =~ /^$self->{prefix}quote(?:\s+(.+?))?\s*$/si) {
|
||||
$self->getQuote($event, $1);
|
||||
} elsif ($message =~ /^$self->{prefix}(?:quotelast|lastquote)(?:\s+(.+?))?\s*$/si) {
|
||||
$self->getLastQuote($event, $1);
|
||||
} elsif ($message =~ /^$self->{prefix}addquote(?:\s+(.+?))?\s*$/si) {
|
||||
$self->addQuote($event, $1);
|
||||
} elsif ($message =~ /^$self->{prefix}delquote(?:\s+(.+?))?\s*$/si) {
|
||||
$self->deleteQuote($event, $1);
|
||||
} elsif ($message =~ /^$self->{prefix}editquote(?:\s+(.+?))?\s*$/si) {
|
||||
$self->editQuote($event, $1);
|
||||
} else {
|
||||
return 1; # nope
|
||||
}
|
||||
return 0; # we've dealt with it, no need to do anything else.
|
||||
}
|
||||
|
||||
sub markRead {
|
||||
my $self = shift;
|
||||
my ($id) = @_;
|
||||
eval {
|
||||
$self->{dbhandle}->do("UPDATE $self->{tableName} SET shown = shown + 1 WHERE id = ?", undef, $id);
|
||||
$self->{dbhandle}->do("UPDATE $self->{tableName} SET age = age + 1");
|
||||
};
|
||||
# ignore errors (don't have to worry about timeouts, this is only
|
||||
# ever done after recent db access)
|
||||
}
|
||||
|
||||
sub getQuote {
|
||||
my $self = shift;
|
||||
my ($event, $data) = @_;
|
||||
if (not $self->{dbhandle}) {
|
||||
$self->say($event, "$event->{from}: I haven't got a connection to a database yet, sorry.");
|
||||
return;
|
||||
}
|
||||
if (defined $data) {
|
||||
if ($data =~ m/^\s*([0-9]+)\s*$/os) {
|
||||
$self->getQuoteById($event, $1);
|
||||
} else {
|
||||
$self->searchQuote($event, $data);
|
||||
}
|
||||
} else {
|
||||
$self->randomQuote($event);
|
||||
}
|
||||
}
|
||||
|
||||
sub randomQuoteInternal {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
my($id, $quote, $author, $note);
|
||||
return 0 unless $self->attempt($event, sub { ($id, $quote, $author, $note) = $self->{dbhandle}->selectrow_array("SELECT id, quote, author, note, shown/age AS freq FROM $self->{tableName} ORDER BY freq, RAND() LIMIT 1", undef); }, 'read from the database for some reason', 'read a random quote from');
|
||||
if (defined $quote) {
|
||||
$self->markRead($id);
|
||||
$note = defined $note ? " ($note)" : '';
|
||||
$self->say($event, "Quote $id: $quote - $author$note");
|
||||
return 0;
|
||||
}
|
||||
return 1; # try again
|
||||
}
|
||||
|
||||
sub randomQuote {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
$self->sanitiseTableName();
|
||||
if ($self->randomQuoteInternal($event)) {
|
||||
# no quotes?
|
||||
# weird... let's see if reconnecting helps
|
||||
if ($self->dbconnect()) {
|
||||
if ($self->randomQuoteInternal($event)) {
|
||||
# there must really be no quotes
|
||||
$self->say($event, "$event->{from}: There are no quotes in the database yet.");
|
||||
} # else ok
|
||||
} else {
|
||||
$self->say($event, "$event->{from}: I'm sorry, I can't reach the database right now.");
|
||||
$self->tellAdmin($event, "While trying to get a random quote from the database, I found no quotes, so I tried reconnecting to the database, but it said '$self->{dberror}'!");
|
||||
}
|
||||
} # else ok
|
||||
}
|
||||
|
||||
sub getQuoteById {
|
||||
my $self = shift;
|
||||
my ($event, $id, $action) = @_;
|
||||
$self->sanitiseTableName();
|
||||
my($quote, $author, $note);
|
||||
return unless $self->attempt($event, sub {
|
||||
($quote, $author, $note) = $self->{dbhandle}->selectrow_array("SELECT quote, author, note FROM $self->{tableName} WHERE id=?", undef, $id);
|
||||
}, 'read from the database for some reason', 'read a quote from');
|
||||
if (defined $quote) {
|
||||
$self->markRead($id);
|
||||
$note = defined $note ? " ($note)" : '';
|
||||
$action = defined $action ? "$action: " : '';
|
||||
$self->say($event, "\u${action}Quote $id: $quote - $author$note");
|
||||
} elsif (defined $action) {
|
||||
return 0;
|
||||
} else {
|
||||
$self->say($event, "$event->{from}: There is no quote with ID $id as far as I can tell.");
|
||||
}
|
||||
return 1;
|
||||
}
|
||||
|
||||
sub searchQuote {
|
||||
my $self = shift;
|
||||
my ($event, $data) = @_;
|
||||
# [author=""] [text=""] [note=""] [text] [n]
|
||||
my (@columns, @values);
|
||||
my $skip = 0;
|
||||
while (length $data) {
|
||||
if ($data =~ s/^\s*text="([^"]*)"(?:\s|\z)//osi or
|
||||
$data =~ s/^\s*text='([^']*)'(?:\s|\z)//osi or
|
||||
$data =~ s/^\s*text=(\S+)(?:\s|\z)//osi) {
|
||||
push(@columns, 'quote LIKE ?');
|
||||
push(@values, "%$1%");
|
||||
} elsif ($data =~ s/^\s*author="([^"]*)"(?:\s|\z)//osi or
|
||||
$data =~ s/^\s*author='([^']*)'(?:\s|\z)//osi or
|
||||
$data =~ s/^\s*author=(\S+)(?:\s|\z)//osi) {
|
||||
push(@columns, 'author LIKE ?');
|
||||
push(@values, "%$1%");
|
||||
} elsif ($data =~ s/^\s*note="([^"]*)"(?:\s|\z)//osi or
|
||||
$data =~ s/^\s*note='([^']*)'(?:\s|\z)//osi or
|
||||
$data =~ s/^\s*note=(\S+)(?:\s|\z)//osi) {
|
||||
push(@columns, 'note LIKE ?');
|
||||
push(@values, "%$1%");
|
||||
} elsif ($data =~ s/^\s*(\w+)="([^"]*)"(?:\s|\z)//osi or
|
||||
$data =~ s/^\s*(\w+)='([^']*)'(?:\s|\z)//osi or
|
||||
$data =~ s/^\s*(\w+)=(\S+)(?:\s|\z)//osi) {
|
||||
$self->say($event, "$event->{from}: I don't know how to search for '$1'. The valid search types are 'author', 'note', and 'text'. See the help entry for 'quote' for more information on the quote searching syntax.");
|
||||
return;
|
||||
} elsif ($data =~ s/^\s*([0-9]+)\s*$//osi) {
|
||||
$skip = $1 - 1;
|
||||
} elsif ($data =~ s/^\s*"([^"]+)"(?:\s|\z)//osi or
|
||||
$data =~ s/^\s*'([^']+)'(?:\s|\z)//osi or
|
||||
$data =~ s/^\s*(\S+)(?:\s|\z)//osi) {
|
||||
push(@columns, 'quote LIKE ?');
|
||||
push(@values, "%$1%");
|
||||
} else {
|
||||
# wtf
|
||||
$self->say($event, "$event->{from}: I didn't quite understand what you were looking for ('$data'?). See the help entry for 'quote' for more information on the quote searching syntax.");
|
||||
return;
|
||||
}
|
||||
}
|
||||
|
||||
$self->sanitiseTableName();
|
||||
my($id, $count, $quote, $author, $note);
|
||||
return unless $self->attempt($event, sub {
|
||||
local $" = ' AND ';
|
||||
($count) = $self->{dbhandle}->selectrow_array("SELECT COUNT(*) FROM $self->{tableName} WHERE @columns", undef, @values);
|
||||
($id, $quote, $author, $note) = $self->{dbhandle}->selectrow_array("SELECT id, quote, author, note FROM $self->{tableName} WHERE @columns LIMIT $skip,1", undef, @values);
|
||||
}, 'read from the database for some reason', 'search for a quote in');
|
||||
if (defined $quote) {
|
||||
$self->markRead($id);
|
||||
$note = defined $note ? " ($note)" : '';
|
||||
my $n = $skip + 1;
|
||||
$count = "about $n" if $count < $n; # sanitise output in case of race condition
|
||||
my $match = $count == 1 ? 'only match' : "match $n of $count";
|
||||
$self->say($event, "Quote $id ($match): $quote - $author$note");
|
||||
} else {
|
||||
$self->say($event, "$event->{from}: No matching quotes found.");
|
||||
}
|
||||
}
|
||||
|
||||
sub getLastQuote {
|
||||
my $self = shift;
|
||||
my ($event, $data) = @_;
|
||||
if (not $self->{dbhandle}) {
|
||||
$self->say($event, "$event->{from}: I haven't got a connection to a database yet, sorry.");
|
||||
return;
|
||||
}
|
||||
if ($data !~ m/^\s*([0-9]+)?\s*$/os) {
|
||||
$self->say($event, "$event->{from}: The syntax is 'lastquote 2', where 2 is the number of the quote to show (counting from the end). You can omit the number to get the last quote added.");
|
||||
return;
|
||||
}
|
||||
my $skip = ($1 || 1) - 1;
|
||||
$self->sanitiseTableName();
|
||||
my($id, $quote, $author, $note);
|
||||
return unless $self->attempt($event, sub {
|
||||
($id, $quote, $author, $note) = $self->{dbhandle}->selectrow_array("SELECT id, quote, author, note FROM $self->{tableName} ORDER BY id DESC LIMIT $skip,1", undef);
|
||||
}, 'read from the database for some reason', 'read the last few quotes from the database');
|
||||
if (defined $quote) {
|
||||
$self->markRead($id);
|
||||
$note = defined $note ? " ($note)" : '';
|
||||
$self->say($event, "Quote $id: $quote - $author$note");
|
||||
} else {
|
||||
$self->say($event, "$event->{from}: There are no quotes in the database yet.");
|
||||
}
|
||||
}
|
||||
|
||||
sub addQuote {
|
||||
my $self = shift;
|
||||
my ($event, $data) = @_;
|
||||
if (not $self->canAdd($event)) {
|
||||
$self->say($event, "$event->{from}: You are not allowed to add quotes, sorry.");
|
||||
return;
|
||||
}
|
||||
if (not $self->{dbhandle}) {
|
||||
$self->say($event, "$event->{from}: I haven't got a connection to a database yet, sorry.");
|
||||
return;
|
||||
}
|
||||
# quote - author (note)
|
||||
if ($data =~ m/^ (.+\S)
|
||||
\s* - \s*
|
||||
(.+?)
|
||||
(?:\s+\((.+)\))?
|
||||
$/osx) {
|
||||
my $quote = $1;
|
||||
my $author = $2;
|
||||
my $note = $3;
|
||||
# insert data
|
||||
$self->sanitiseTableName();
|
||||
return unless $self->attempt($event, sub {
|
||||
$self->{dbhandle}->do("INSERT INTO $self->{tableName} SET
|
||||
quote = ?, author = ?, date = NOW(), note = ?",
|
||||
undef, $quote, $author, $note);
|
||||
my $id = $self->{dbhandle}->{mysql_insertid};
|
||||
if (not $self->getQuoteById($event, $id, 'inserted')) {
|
||||
$self->say($event, "$event->{from}: Your quote disappeared after I inserted it into the database. You may wish to speak to the other people who have access to the quotes database about this... :-)");
|
||||
}
|
||||
}, 'seem to add that quote to the database.', 'add a quote to');
|
||||
} else {
|
||||
$self->say($event, "$event->{from}: The syntax for adding a quote is 'quote - author' or 'quote - author (note)'.");
|
||||
}
|
||||
}
|
||||
|
||||
sub deleteQuote {
|
||||
my $self = shift;
|
||||
my ($event, $data) = @_;
|
||||
if (not $self->canDelete($event)) {
|
||||
$self->say($event, "$event->{from}: You are not allowed to delete quotes, sorry.");
|
||||
return;
|
||||
}
|
||||
if (not $self->{dbhandle}) {
|
||||
$self->say($event, "$event->{from}: I haven't got a connection to a database yet, sorry.");
|
||||
return;
|
||||
}
|
||||
if ($data !~ m/^\s*([0-9]+)\s*$/os) {
|
||||
$self->say($event, "$event->{from}: The syntax is 'delquote 5', where 5 is the id of the quote to delete.");
|
||||
return;
|
||||
}
|
||||
my $id = $1;
|
||||
$self->sanitiseTableName();
|
||||
my($quote, $author, $note);
|
||||
return unless $self->attempt($event, sub {
|
||||
($quote, $author, $note) = $self->{dbhandle}->selectrow_array("SELECT quote, author, note FROM $self->{tableName} WHERE ID=?", undef, $id);
|
||||
}, 'read from the database for some reason', 'read a quote to delete from');
|
||||
if (defined $quote) {
|
||||
return unless $self->attempt($event, sub {
|
||||
$self->{dbhandle}->do("DELETE FROM $self->{tableName} WHERE ID=?", undef, $id);
|
||||
}, 'delete from the database. Maybe I don\'t have enough privileges on the database server', 'delete from');
|
||||
$note = defined $note ? " ($note)" : '';
|
||||
$self->say($event, "Deleted: Quote $id: $quote - $author$note");
|
||||
} else {
|
||||
$self->say($event, "$event->{from}: There is no quote with ID $id as far as I can tell.");
|
||||
}
|
||||
}
|
||||
|
||||
sub editQuote {
|
||||
my $self = shift;
|
||||
my ($event, $data) = @_;
|
||||
if (not $self->canEdit($event)) {
|
||||
$self->say($event, "$event->{from}: You are not allowed to edit quotes, sorry.");
|
||||
return;
|
||||
}
|
||||
if (not $self->{dbhandle}) {
|
||||
$self->say($event, "$event->{from}: I haven't got a connection to a database yet, sorry.");
|
||||
return;
|
||||
}
|
||||
if ($data =~ m/^ ([0-9]+) \s+
|
||||
(.+\S)
|
||||
\s* - \s*
|
||||
(.+?)
|
||||
(?:\s+\((.+)\))?
|
||||
$/osx) {
|
||||
my $id = $1;
|
||||
my $quote = $2;
|
||||
my $author = $3;
|
||||
my $note = $4;
|
||||
# insert data
|
||||
$self->sanitiseTableName();
|
||||
return unless $self->attempt($event, sub {
|
||||
$self->{dbhandle}->do("UPDATE $self->{tableName} SET
|
||||
quote = ?, author = ?, note = ?
|
||||
WHERE id = ?",
|
||||
undef, $quote, $author, $note, $id);
|
||||
if (not $self->getQuoteById($event, $id, 'edited')) {
|
||||
$self->say($event, "$event->{from}: I couldn't find a quote with ID $id.");
|
||||
}
|
||||
}, 'seem to edit that quote', 'edit a quote in');
|
||||
} else {
|
||||
$self->say($event, "$event->{from}: The syntax for editing a quote is 'id quote - author' or 'id quote - author (note)', much like for adding a quote but with the id of the quote to edit at the start.");
|
||||
}
|
||||
}
|
||||
|
||||
sub printStatus {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
if (not $self->{dbhandle}) {
|
||||
$self->say($event, "$event->{from}: No connection could be established to the quotes datbase.");
|
||||
return;
|
||||
}
|
||||
$self->sanitiseTableName();
|
||||
my ($quotes, $sources, $shown, $id) = @_;
|
||||
return unless $self->attempt($event, sub {
|
||||
($quotes, $sources, $shown) = $self->{dbhandle}->selectrow_array("SELECT COUNT(*), COUNT(DISTINCT author), SUM(shown) FROM $self->{tableName}");
|
||||
($id) = $self->{dbhandle}->selectrow_array("SELECT id, shown/age AS freq FROM $self->{tableName} ORDER BY freq, shown LIMIT 1");
|
||||
}, 'connect to the quotes database', 'obtain statistics of');
|
||||
if ($quotes) {
|
||||
my $s1 = $quotes == 1 ? '' : 's';
|
||||
my $s2 = $sources == 1 ? '' : 's';
|
||||
my $s3 = $shown == 1 ? '' : 's';
|
||||
$self->say($event, "$event->{from}: The database contains $quotes quote$s1 attributed to $sources source$s2. I have shown these quotes $shown time$s3 in total. The most popular quote (relatively speaking) is quote ID $id.");
|
||||
} else {
|
||||
$self->say($event, "$event->{from}: The database contains 0 quotes.");
|
||||
}
|
||||
}
|
||||
|
||||
sub attempt {
|
||||
my $self = shift;
|
||||
my($event, $sub, $action1, $action2) = @_;
|
||||
eval { &$sub };
|
||||
if ($@) {
|
||||
chomp $@;
|
||||
my $error = $@;
|
||||
# A common error is:
|
||||
# "DBD::mysql::db selectrow_array failed: MySQL server has
|
||||
# gone away at (eval 34) line 357."
|
||||
# ...so we try to reconnect and do it again
|
||||
if ($self->dbconnect()) {
|
||||
eval { &$sub };
|
||||
if ($@) {
|
||||
chomp $@;
|
||||
$self->say($event, "$event->{from}: I'm sorry, I can't $action1.");
|
||||
if ($@ eq $error) {
|
||||
$self->tellAdmin($event, "While trying to $action2 the database, I got '$@'. I tried reconnecting but that didn't help.");
|
||||
} else {
|
||||
$self->tellAdmin($event, "While trying to $action2 the database, I got '$error'. Then I tried reconnecting and it worked but when I tried to $action2 the database a second time, it said '$@'.");
|
||||
}
|
||||
return 0;
|
||||
}
|
||||
} else {
|
||||
$self->say($event, "$event->{from}: I'm sorry, I can't $action1.");
|
||||
$self->tellAdmin($event, "While trying to $action2 the database, I got '$error', so I tried reconnecting to the database but I got '$self->{dberror}'. Help!");
|
||||
return 0;
|
||||
}
|
||||
}
|
||||
return 1;
|
||||
}
|
||||
@@ -1,268 +0,0 @@
|
||||
################################
|
||||
# RDF Module #
|
||||
################################
|
||||
# this is really an RSS module, not an RDF module.
|
||||
# but oh well.
|
||||
|
||||
package BotModules::RDF;
|
||||
use XML::RSS;
|
||||
use vars qw(@ISA);
|
||||
@ISA = qw(BotModules);
|
||||
1;
|
||||
|
||||
# RegisterConfig - Called when initialised, should call registerVariables
|
||||
sub RegisterConfig {
|
||||
my $self = shift;
|
||||
$self->SUPER::RegisterConfig(@_);
|
||||
$self->registerVariables(
|
||||
# [ name, save?, settable? ]
|
||||
['sites', 1, 1, {}],
|
||||
['updateDelay', 1, 1, 600],
|
||||
['preferredLineLength', 1, 1, 80],
|
||||
['maxInChannel', 1, 1, 5],
|
||||
['maxLines', 1, 1, 20],
|
||||
['trimTitles', 1, 1, '0'],
|
||||
['data', 0, 0, {}], # data -> uri -> (title, link, last, items -> uri)
|
||||
['mutes', 1, 1, {}], # uri -> "channel channel channel"
|
||||
);
|
||||
}
|
||||
|
||||
# Schedule - called when bot connects to a server, to install any schedulers
|
||||
# use $self->schedule($event, $delay, $times, $data)
|
||||
# where $times is 1 for a single event, -1 for recurring events,
|
||||
# and a +ve number for an event that occurs that many times.
|
||||
sub Schedule {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
$self->schedule($event, \$self->{'updateDelay'}, -1, 'rdf');
|
||||
$self->SUPER::Schedule($event);
|
||||
}
|
||||
|
||||
sub Help {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
my %commands;
|
||||
if ($self->isAdmin($event)) {
|
||||
$commands{''} = "The RDF module monitors various websites. Add new RDF channels to the 'sites' hash. Duplicates with different nicknames are fine. For example, \"vars $self->{'_name'} sites '+|slashdot|http://...'\" and \"vars $self->{'_name'} sites '+|/.|http://...'\" is fine. To remove a site from the RDF 'sites' hash, use this syntax \"vars $self->{_name} sites '-slashdot'";
|
||||
$commands{'mute'} = 'Disable reporting of a site in a channel. (Only does something if the given site exists.) Syntax: mute <site> in <channel>';
|
||||
$commands{'unmute'} = 'Enable reporting of a site in a channel. By default, sites are reported in all channels that the module is active in. Syntax: unmute <site> in <channel>';
|
||||
} else {
|
||||
$commands{''} = 'The RDF module monitors various websites.';
|
||||
}
|
||||
foreach my $site (keys(%{$self->{'sites'}})) {
|
||||
if ($self->{'data'}->{$self->{'sites'}->{$site}}) {
|
||||
$commands{$site} = "Reports the headlines listed in $self->{'data'}->{$self->{'sites'}->{$site}}->{'title'}";
|
||||
|
||||
# -- #mozilla was here --
|
||||
# <Hixie> anyway, $self->{'data'}->{$self->{'sites'}->{$site}}->{'title'} is
|
||||
# another nice piece of perl (embedded in a quoted string in this case)
|
||||
# <moogle> yeah, that's a bit more familiar
|
||||
# <jag> Oooh, nice one
|
||||
# <jag> Reminds me of Java, a bit :-)
|
||||
# <jag> Without all the casting about from Object to Hashtable
|
||||
# <Hixie> all this, BTW, is from the RDF module (the one that mozbot uses to
|
||||
# report changes in mozillazine and so on)
|
||||
# <moogle> I still tend to comment these things a bit just for maintainability
|
||||
# by others who might not wish to do mental gymnastics :)
|
||||
# <Hixie> :-)
|
||||
|
||||
} else {
|
||||
$commands{$site} = "Reports the headlines listed in $self->{'sites'}->{$site}";
|
||||
}
|
||||
|
||||
}
|
||||
return \%commands;
|
||||
}
|
||||
|
||||
sub Told {
|
||||
my $self = shift;
|
||||
my ($event, $message) = @_;
|
||||
foreach my $site (keys(%{$self->{'sites'}})) {
|
||||
if ($message =~ /^\s*(\Q$site\E)\s*$/si) {
|
||||
$self->GetSite($event, $1, 'request');
|
||||
return 0; # dealt with it...
|
||||
}
|
||||
}
|
||||
if ($self->isAdmin($event)) {
|
||||
if ($message =~ /^\s*mute\s+(\S+?)\s+in\s+(\S+?)\s*$/osi) {
|
||||
my $site = $1 eq 'RDF' ? '' : $self->{'sites'}->{$1};
|
||||
my $siteName = $site eq '' ? 'all sites' : $site;
|
||||
if (defined($site)) {
|
||||
$self->{'mutes'}->{$site} .= " $2";
|
||||
$self->saveConfig();
|
||||
$self->say($event, "$event->{'from'}: RDF notifications for $siteName muted in channel $2.");
|
||||
} else {
|
||||
# can't say this, other modules might recognise it: $self->say($event, "$event->{'from'}: I don't know about any '$1' site...");
|
||||
}
|
||||
} elsif ($message =~ /^\s*unmute\s+(\S+?)\s+in\s+(\S+?)\s*$/osi) {
|
||||
my $site = $1 eq 'RDF' ? '' : $self->{'sites'}->{$1};
|
||||
my $siteName = $site eq '' ? 'all sites' : $site;
|
||||
if (defined($site)) {
|
||||
my %mutedChannels = map { lc($_) => 1 } split(/ /o, $self->{'mutes'}->{$site});
|
||||
delete($mutedChannels{lc($2)}); # get rid of any mentions of that channel
|
||||
$self->{'mutes'}->{$site} = join(' ', keys(%mutedChannels));
|
||||
$self->saveConfig();
|
||||
$self->say($event, "$event->{'from'}: RDF notifications for $siteName resumed in channel $2.");
|
||||
} else {
|
||||
# can't say this, other modules might recognise it: $self->say($event, "$event->{'from'}: I don't know about any '$1' site...");
|
||||
}
|
||||
} else {
|
||||
return $self->SUPER::Told(@_);
|
||||
}
|
||||
} else {
|
||||
return $self->SUPER::Told(@_);
|
||||
}
|
||||
return 0;
|
||||
}
|
||||
|
||||
sub GetSite {
|
||||
my $self = shift;
|
||||
my ($event, $site, $intent) = @_;
|
||||
if (defined($self->{'sites'}->{$site})) {
|
||||
my $uri = $self->{'sites'}->{$site};
|
||||
$self->getURI($event, $uri, $intent);
|
||||
} else {
|
||||
# XXX
|
||||
}
|
||||
}
|
||||
|
||||
sub GotURI {
|
||||
my $self = shift;
|
||||
my ($event, $uri, $output, $intent) = @_;
|
||||
|
||||
$self->{'data'}->{$uri}->{'ready'} = defined($self->{'data'}->{$uri});
|
||||
|
||||
if ($output) {
|
||||
|
||||
# last update stamp
|
||||
my $last = $event->{'time'};
|
||||
$self->{'data'}->{$uri}->{'last'} = $last;
|
||||
|
||||
# Parse It
|
||||
my $rss = XML::RSS->new();
|
||||
eval { $rss->parse($output) };
|
||||
if ($@) {
|
||||
$self->debug("$uri is not a valid RSS file");
|
||||
if ($intent eq 'request') {
|
||||
$self->say($event, "$event->{'from'}: Dude, the file is not valid RSS! ($uri)");
|
||||
}
|
||||
return;
|
||||
}
|
||||
|
||||
# Set Link and Title
|
||||
$self->{data}->{$uri}->{'link'} = $rss->{'channel'}->{'link'};
|
||||
$self->{data}->{$uri}->{'title'} = $rss->{'channel'}->{'title'};
|
||||
|
||||
foreach my $item (@{$rss->{'items'}}) {
|
||||
unless (($item->{title} =~ /^last update/osi) ||
|
||||
(defined($self->{'data'}->{$uri}->{'items'}->{$item->{'title'}}))) {
|
||||
$self->{'data'}->{$uri}->{'items'}->{$item->{'title'}} = $last;
|
||||
}
|
||||
}
|
||||
|
||||
$self->ReportDiffs($event, $uri, $intent);
|
||||
if ($intent eq 'request') {
|
||||
$self->ReportAll($event, $uri);
|
||||
}
|
||||
|
||||
} else {
|
||||
|
||||
if ($intent eq 'request') {
|
||||
$self->say($event, "$event->{'from'}: Dude, the file was empty! ($uri)");
|
||||
}
|
||||
|
||||
}
|
||||
|
||||
}
|
||||
|
||||
sub Scheduled {
|
||||
my $self = shift;
|
||||
my ($event, @data) = @_;
|
||||
if ($data[0] eq 'rdf') {
|
||||
my %sites = map { $_ => 1 } values(%{$self->{'sites'}});
|
||||
foreach (keys(%sites)) {
|
||||
$self->getURI($event, $_, 'update');
|
||||
}
|
||||
} else {
|
||||
$self->SUPER::Scheduled($event, @data);
|
||||
}
|
||||
}
|
||||
|
||||
sub ReportDiffs {
|
||||
my $self = shift;
|
||||
my ($event, $uri, $request) = @_;
|
||||
return unless $self->{'data'}->{$uri}->{'ready'};
|
||||
my $last = $self->{'data'}->{$uri}->{'last'};
|
||||
my @output;
|
||||
foreach (keys(%{$self->{'data'}->{$uri}->{'items'}})) {
|
||||
push(@output, $_) if ($self->{'data'}->{$uri}->{'items'}->{$_} == $last);
|
||||
}
|
||||
|
||||
# -- #mrt was here --
|
||||
# <mozbot> Friday's security advisories -- The first stable
|
||||
# Xen release -- Linux Gazette #95
|
||||
# <mozbot> KDE Under The Microscope -- Additional OpenSSL info
|
||||
# <Hixie> wtf
|
||||
# <mozbot> Just appeared in jbisbee.com -
|
||||
# http://www.jbisbee.com/ : PoCo::RSS::Aggregator
|
||||
# <Hixie> why is it repeating the same thing over and over
|
||||
# <mozbot> PoCo::RSSAggregator & XML::RSS::Feed Uploaded to
|
||||
# CPAN -- More PoCo::RSSAggregator
|
||||
# <Hixie> mozbot: shutup please
|
||||
# <mozbot> Ok, threw away 2558 messages.
|
||||
|
||||
# Ahem. So now we limit the diff reporting code to maxInChannel
|
||||
# items at a time...
|
||||
|
||||
if (@output and @output < $self->{'maxInChannel'}) {
|
||||
my %mutedChannels = ();
|
||||
if (defined($self->{'mutes'}->{$uri})) {
|
||||
%mutedChannels = map { lc($_) => 1 } split(/\s+/os, $self->{'mutes'}->{$uri});
|
||||
}
|
||||
if (defined($self->{'mutes'}->{''})) {
|
||||
%mutedChannels = (%mutedChannels, map { lc($_) => 1 } split(/\s+/os, $self->{'mutes'}->{''}));
|
||||
}
|
||||
if ($request eq 'request') {
|
||||
$mutedChannels{$event->{'channel'}} = 1;
|
||||
}
|
||||
foreach (@{$self->{'channels'}}) {
|
||||
unless ($mutedChannels{$_}) {
|
||||
local $event->{'target'} = $_;
|
||||
$self->say($event, "Just appeared in $self->{'data'}->{$uri}->{'title'} - $self->{'data'}->{$uri}->{'link'} :");
|
||||
foreach (@output) {
|
||||
$self->say($event, " " . $_);
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
sub ReportAll {
|
||||
my $self = shift;
|
||||
my ($event, $uri) = @_;
|
||||
my @output;
|
||||
foreach (keys(%{$self->{'data'}->{$uri}->{'items'}})) {
|
||||
push(@output, $_);
|
||||
}
|
||||
|
||||
@output = $self->prettyPrint($self->{'preferredLineLength'},
|
||||
"Items in $self->{'data'}->{$uri}->{'title'} - $self->{'data'}->{$uri}->{'link'}: ",
|
||||
"$event->{'from'}: ", ' -- ', @output);
|
||||
|
||||
if (@output > $self->{'maxLines'}) {
|
||||
splice(@output, $self->{'maxLines'} + 1);
|
||||
unshift(@output, "The list is longer than $self->{'maxLines'}"
|
||||
. " lines, only the first $self->{'maxLines'} will be shown.");
|
||||
}
|
||||
|
||||
if (@output > $self->{'maxInChannel'}) {
|
||||
foreach (@output) {
|
||||
$self->directSay($event, $_);
|
||||
}
|
||||
$self->channelSay($event, "$event->{'from'}: /msg'ed");
|
||||
} else {
|
||||
foreach (@output) {
|
||||
$self->say($event, $_);
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -1,94 +0,0 @@
|
||||
################################
|
||||
# Rude Module #
|
||||
################################
|
||||
|
||||
# This module implements the same functionality as Insult.bm and
|
||||
# Excuse.bm but using remote servers. Those servers are currently (and
|
||||
# probably forever) down. This module is therefore mainly here for
|
||||
# historical interest, and may be removed from future distributions.
|
||||
# If you use, or need, this module, please let me know. - ian@hixie.ch
|
||||
|
||||
package BotModules::Rude;
|
||||
use vars qw(@ISA);
|
||||
use Net::Telnet;
|
||||
@ISA = qw(BotModules);
|
||||
1;
|
||||
|
||||
sub Help {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
return {
|
||||
'' => 'The Rude Module is... rude. Very rude! So rude!!!',
|
||||
'insult' => 'Insults someone. Syntax: \'insult <who>\'',
|
||||
'excuse' => 'Gives you an excuse for the system being down. Syntax: \'excuse\'',
|
||||
};
|
||||
}
|
||||
|
||||
# -- timeless was here --
|
||||
# <timeless> Rude module is missing a jar jar quote ~how wude~
|
||||
|
||||
# RegisterConfig - Called when initialised, should call registerVariables
|
||||
sub RegisterConfig {
|
||||
my $self = shift;
|
||||
$self->SUPER::RegisterConfig(@_);
|
||||
$self->registerVariables(
|
||||
# [ name, save?, settable? ]
|
||||
['insultHost', 1, 1, 'insulthost.colorado.edu'],
|
||||
['insultPort', 1, 1, '1695'],
|
||||
['excuseHost', 1, 1, 'bofh.engr.wisc.edu'], # same host as bofh.jive.org
|
||||
['excusePort', 1, 1, '666'],
|
||||
['insultOverrides', 1, 1, { # overrides for the insults (keys must be lowercase)
|
||||
'mozilla' => 'You are nothing but the best browser on the planet.',
|
||||
'mozilla.org' => 'You are nothing but the best caretaker Mozilla ever had.',
|
||||
'c++' => 'you are evil',
|
||||
}],
|
||||
);
|
||||
}
|
||||
|
||||
sub Told {
|
||||
my $self = shift;
|
||||
my ($event, $message) = @_;
|
||||
if ($message =~ /^\s*(?:will\s+you\s+)?(?:insult|harass)\s+(\S+?)(?:[\s,.]+please)?[\s.?!]*$/osi) {
|
||||
my $line;
|
||||
if (defined($self->{'insultOverrides'}->{lc $1})) {
|
||||
$line = "$1: ".$self->{'insultOverrides'}->{lc $1};
|
||||
} else {
|
||||
eval {
|
||||
my $t = new Net::Telnet (Timeout => 3);
|
||||
$t->Net::Telnet::open(Host => $self->{'insultHost'}, Port => $self->{'insultPort'});
|
||||
$line = "$1: ".$t->Net::Telnet::getline(Timeout => 4);
|
||||
};
|
||||
}
|
||||
if ($line) {
|
||||
$self->say($event, $line);
|
||||
} else {
|
||||
$self->say($event, "$event->{'from'}: What have they ever done to you! Leave 'em alone!");
|
||||
$self->debug("yikes, $self->{'insultHost'}:$self->{'insultPort'} is down!");
|
||||
}
|
||||
} elsif ($message =~ /^\s*(?:please\s+)?(?:can\s+i\s+have\s+an\s+|(?:(?:can|could)\s+you\s+)?give\s+me\s+an\s+)?excuse(?:[?,.!1\s]+please)?\s*[!?,.1]*\s*$/osi) {
|
||||
my $line;
|
||||
eval {
|
||||
my $t = new Net::Telnet (Timeout => 3);
|
||||
$t->Net::Telnet::open(Host => $self->{'excuseHost'}, Port => $self->{'excusePort'});
|
||||
# print "=== The BOFH-style Excuse Server --- Feel The Power!\n";
|
||||
$t->Net::Telnet::getline(Timeout => 4);
|
||||
# print "=== By Jeff Ballard <ballard\@cs.wisc.edu>\n";
|
||||
$t->Net::Telnet::getline(Timeout => 4);
|
||||
# print "=== See http://www.cs.wisc.edu/~ballard/bofh/ for more info.\n";
|
||||
$t->Net::Telnet::getline(Timeout => 4);
|
||||
# print "Your excuse is: $excuses[$j]";
|
||||
$line = $t->Net::Telnet::getline(Timeout => 4);
|
||||
};
|
||||
if ($line) {
|
||||
# $line =~ s/^.*?Your excuse is: //gosi;
|
||||
# $self->say($event, "$event->{'from'}: '$line'");
|
||||
$self->say($event, "$line");
|
||||
} else {
|
||||
$self->say($event, "$event->{'from'}: Don't ask *me* for an excuse! Sheesh!");
|
||||
$self->debug("yikes, $self->{'excuseHost'}:$self->{'excusePort'} is down!");
|
||||
}
|
||||
} else {
|
||||
return $self->SUPER::Told(@_);
|
||||
}
|
||||
return 0; # we've dealt with it, no need to do anything else.
|
||||
}
|
||||
@@ -1,290 +0,0 @@
|
||||
# -*- Mode: perl; tab-width: 4; indent-tabs-mode: nil; -*-
|
||||
################################
|
||||
# Seen Module #
|
||||
################################
|
||||
|
||||
package BotModules::Seen;
|
||||
use vars qw(@ISA);
|
||||
@ISA = qw(BotModules);
|
||||
use AnyDBM_File;
|
||||
use Fcntl;
|
||||
1;
|
||||
|
||||
# SpottedNickChange would be a nice one to do if you
|
||||
# can solve the problem of working out which channel
|
||||
# to say stuff in...
|
||||
|
||||
# database for seen data
|
||||
our $seen = {'times' => {}, 'states' => {}};
|
||||
# the times that the relevant nicks were last seen active
|
||||
tie(%{$seen->{'times'}}, 'AnyDBM_File', 'seen-times', O_RDWR|O_CREAT, 0666);
|
||||
# what the relevant nicks were last seen doing
|
||||
tie(%{$seen->{'states'}}, 'AnyDBM_File', 'seen-states', O_RDWR|O_CREAT, 0666);
|
||||
|
||||
sub Help {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
my %commands = {
|
||||
'seen' => 'Says how long it\'s been since the last time someone was seen. Syntax: seen victim',
|
||||
};
|
||||
if ($self->isAdmin($event)) {
|
||||
$commands{'mute'} = 'Stop responding to !seen <name> in a channel unless told directly. Syntax: mute seen in <channel>';
|
||||
$commands{'unmute'} = 'Start responding to !seen <name> in a channel. Syntax: unmute seen in <channel>';
|
||||
}
|
||||
return \%commands;
|
||||
}
|
||||
|
||||
# RegisterConfig - Called when initialised, should call registerVariables
|
||||
sub RegisterConfig {
|
||||
my $self = shift;
|
||||
$self->SUPER::RegisterConfig(@_);
|
||||
$self->registerVariables(
|
||||
# [ name, save?, settable? ]
|
||||
['overrides', 1, 1, {'therapist' => 'Look, dude, I\'m feeling fine, mm\'k?'}], # canned responses
|
||||
['maxLines', 1, 1, 5],
|
||||
['directOnlyChannels', 1, 1, []], #list of channels where we're only observing and not responding to !seen unless told.
|
||||
);
|
||||
}
|
||||
|
||||
sub Told {
|
||||
my $self = shift;
|
||||
my ($event, $message) = @_;
|
||||
my $now = $event->{'time'};
|
||||
$self->{'_lastSpoken'}->{$event->{'user'}} = $now;
|
||||
if ($event->{'channel'} ne '') {
|
||||
my $channel = $event->{'channel'};
|
||||
$seen->{'times'}->{lc $event->{'from'}} = $now;
|
||||
$seen->{'states'}->{lc $event->{'from'}} = "saying '$message' to me in $channel.";
|
||||
}
|
||||
if ($self->isAdmin($event) and $message =~ /^\s*(un)?mute\s+seen\s+in\s+(\S+)\s*$/osi){
|
||||
my $mute = !defined($1);
|
||||
my $channel = lc $2;
|
||||
$channel =~ s/^\#?/\#/; # Add # character if needed.
|
||||
$self->MuteOrUnmuteChannel($event, $mute, $channel);
|
||||
}elsif ($message =~ /^\s*!?seen\s+(\S+?)[\s?.!]*$/osi) {
|
||||
$self->DoSeen($event, $1);
|
||||
} else {
|
||||
return $self->SUPER::Told(@_);
|
||||
}
|
||||
return 0; # we've dealt with it, no need to do anything else.
|
||||
}
|
||||
|
||||
sub Heard {
|
||||
my $self = shift;
|
||||
my ($event, $message) = @_;
|
||||
if ($event->{'channel'} ne '') {
|
||||
my $channel = $event->{'channel'};
|
||||
$seen->{'times'}->{lc $event->{'from'}} = $event->{'time'};
|
||||
$seen->{'states'}->{lc $event->{'from'}} = "saying '$message' in $channel.";
|
||||
}
|
||||
if (!(grep {$event->{'channel'} eq $_} @{$self->{'directOnlyChannels'}}) and $message =~ /^\s*!seen\s+(\S+)\s*$/osi) {
|
||||
$self->DoSeen($event, $1);
|
||||
} else {
|
||||
return $self->SUPER::Heard(@_);
|
||||
}
|
||||
return 0; # we've dealt with it, no need to do anything else.
|
||||
}
|
||||
|
||||
sub Felt {
|
||||
my $self = shift;
|
||||
my ($event, $message) = @_;
|
||||
if ($event->{'channel'} ne '') {
|
||||
my $nick = $event->{'from'};
|
||||
my $channel = $event->{'channel'};
|
||||
$seen->{'times'}->{lc $event->{'from'}} = $event->{'time'};
|
||||
$seen->{'states'}->{lc $event->{'from'}} = "saying '* $nick $message' in $channel.";
|
||||
} else {
|
||||
return $self->SUPER::Felt(@_);
|
||||
}
|
||||
return 0; # we've dealt with it, no need to do anything else.
|
||||
}
|
||||
|
||||
sub Saw {
|
||||
my $self = shift;
|
||||
my ($event, $message) = @_;
|
||||
if ($event->{'channel'} ne '') {
|
||||
my $nick = $event->{'from'};
|
||||
my $channel = $event->{'channel'};
|
||||
$seen->{'times'}->{lc $event->{'from'}} = $event->{'time'};
|
||||
$seen->{'states'}->{lc $event->{'from'}} = "saying '* $nick $message' in $channel.";
|
||||
} else {
|
||||
return $self->SUPER::Felt(@_);
|
||||
}
|
||||
return 0; # we've dealt with it, no need to do anything else.
|
||||
}
|
||||
|
||||
# SpottedNickChange - Called when someone changes nick
|
||||
sub SpottedNickChange {
|
||||
my $self = shift;
|
||||
my ($event, $from, $to) = @_;
|
||||
$seen->{'times'}->{lc $event->{'from'}} = $event->{'time'};
|
||||
$seen->{'states'}->{lc $event->{'from'}} = "changing nick to $to.";
|
||||
return $self->SUPER::SpottedNickChange(@_);
|
||||
}
|
||||
|
||||
sub DoSeen {
|
||||
my $self = shift;
|
||||
my ($event, $who) = @_;
|
||||
my $pattern;
|
||||
if (lc $who eq lc $event->{'from'}) {
|
||||
$self->say($event, 'You\'re right here, duh!');
|
||||
} elsif (lc $who eq lc $event->{'nick'}) {
|
||||
$self->say($event, 'I\'m right here, duh!');
|
||||
} elsif (defined($self->{'overrides'}->{$who})) {
|
||||
$self->say($event, $self->{'overrides'}->{$who});
|
||||
} else {
|
||||
my $regexp;
|
||||
my @nicksToList = ();
|
||||
if ($who =~ m!^/(\S+)/$!) { # shouldn't allow mix and match or blank RE or spaces.
|
||||
$regexp = $1;
|
||||
my $re = $self->sanitizeRegexp($regexp); # security + safety first!
|
||||
$re = qr/$re/i; #precompile for performance
|
||||
if ('' =~ $re){ # will match everything, throw error.
|
||||
$self->say($event, 'That pattern matches everything, please be more specific.');
|
||||
return;
|
||||
}
|
||||
@nicksToList = grep {$_ =~ $re} (keys %{$seen->{'times'}});
|
||||
$pattern = 1;
|
||||
} else {
|
||||
if ($who =~ /\*/){ # no point going through the motions if there's no wildcard.
|
||||
$regexp = quotemeta(lc $who);
|
||||
$regexp =~ s/\\\*/\\S*/g; # replace the escaped * from quotemeta with a \S* (XXX wanted: the ? wildcard)
|
||||
my $re = qr/^$regexp$/;
|
||||
if ('' =~ $re){ # will match everything, throw error.
|
||||
$self->say($event, 'That pattern matches everything, please be more specific.');
|
||||
return;
|
||||
}
|
||||
@nicksToList = grep {$_ =~ $re} (keys %{$seen->{'times'}});
|
||||
} else {
|
||||
@nicksToList = (lc $who) if defined($seen->{'times'}{lc $who}); # short circuit for the majority of uses
|
||||
}
|
||||
$pattern = 0;
|
||||
}
|
||||
if (@nicksToList > $self->{'maxLines'}) { # if it's more than the set threshold, don't flood :)
|
||||
$self->say($event,"There are more than $self->{'maxLines'} nicks matching that wildcard, please be more specific.");
|
||||
} elsif (@nicksToList > 0) {
|
||||
foreach my $nick (@nicksToList) {
|
||||
my $seconds = $seen->{'times'}->{$nick};
|
||||
$seconds = $event->{'time'} - $seconds;
|
||||
my $time = '';
|
||||
|
||||
if ($seconds > 90) {
|
||||
my $minutes = int $seconds / 60;
|
||||
$seconds %= 60;
|
||||
if ($minutes > 90) {
|
||||
my $hours = int $minutes / 60;
|
||||
$minutes %= 60;
|
||||
if ($hours > 36) {
|
||||
my $days = int $hours / 24;
|
||||
$hours %= 24;
|
||||
if ($days > 10) {
|
||||
my $weeks = int $days / 7;
|
||||
$days %= 7;
|
||||
if ($weeks > 10) {
|
||||
# good god, nice connection
|
||||
}
|
||||
if ($weeks != 0) {
|
||||
if ($time ne '') {
|
||||
$time .= ', ';
|
||||
}
|
||||
if ($weeks == 1) {
|
||||
$time .= "$weeks week";
|
||||
} else {
|
||||
$time .= "$weeks weeks";
|
||||
}
|
||||
}
|
||||
}
|
||||
if ($days != 0) {
|
||||
if ($time ne '') {
|
||||
$time .= ', ';
|
||||
}
|
||||
if ($days == 1) {
|
||||
$time .= "$days day";
|
||||
} else {
|
||||
$time .= "$days days";
|
||||
}
|
||||
}
|
||||
}
|
||||
if ($hours != 0) {
|
||||
if ($time ne '') {
|
||||
$time .= ', ';
|
||||
}
|
||||
if ($hours == 1) {
|
||||
$time .= "$hours hour";
|
||||
} else {
|
||||
$time .= "$hours hours";
|
||||
}
|
||||
}
|
||||
}
|
||||
if ($minutes != 0) {
|
||||
if ($time ne '') {
|
||||
$time .= ', ';
|
||||
}
|
||||
if ($minutes == 1) {
|
||||
$time .= "$minutes minute";
|
||||
} else {
|
||||
$time .= "$minutes minutes";
|
||||
}
|
||||
}
|
||||
}
|
||||
if ($seconds == 0) {
|
||||
if ($time eq '') {
|
||||
$time .= 'right about now';
|
||||
} else {
|
||||
$time .= ' ago';
|
||||
}
|
||||
} else {
|
||||
if ($time ne '') {
|
||||
$time .= ' and ';
|
||||
}
|
||||
if ($seconds == 1) {
|
||||
$time .= 'a second ago';
|
||||
} elsif ($seconds == 2) {
|
||||
$time .= 'a couple of seconds ago';
|
||||
} else {
|
||||
$time .= "$seconds seconds ago";
|
||||
}
|
||||
}
|
||||
my $what = $seen->{'states'}->{$nick};
|
||||
$self->say($event, "$nick was last seen $time, $what");
|
||||
}
|
||||
} else {
|
||||
my $n = '';
|
||||
if ($who =~ /^[aeiou]/o) {
|
||||
$n = 'n';
|
||||
}
|
||||
if ($pattern == 1) {
|
||||
$self->say($event, "I've never seen anyone matching the pattern '$who', sorry.");
|
||||
} else {
|
||||
$self->say($event, "I've never seen a$n '$who', sorry.");
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
sub Unload {
|
||||
untie(%{$seen->{'times'}});
|
||||
untie(%{$seen->{'states'}});
|
||||
}
|
||||
|
||||
sub MuteOrUnmuteChannel {
|
||||
my $self = shift;
|
||||
my ($event, $mute, $channel) = @_;
|
||||
if ($mute){
|
||||
if (grep {$_ eq $channel} @{$self->{'directOnlyChannels'}}){
|
||||
$self->say($event,"I'm already ignoring !seen <name> in $channel.");
|
||||
} else{
|
||||
push @{$self->{'directOnlyChannels'}}, $channel;
|
||||
$self->say($event, "I won't respond to !seen <name> in $channel anymore unless told directly.");
|
||||
$self->saveConfig();
|
||||
}
|
||||
} else {
|
||||
if (grep {$_ eq $channel} @{$self->{'directOnlyChannels'}}){
|
||||
@{$self->{'directOnlyChannels'}} = map {$_ ne $channel} @{$self->{'directOnlyChannels'}};
|
||||
$self->say($event,"I'll start responding to !seen <name> in $channel now.");
|
||||
$self->saveConfig();
|
||||
} else{
|
||||
$self->say($event, "I'm already responding to !seen <name> in $channel.");
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -1,88 +0,0 @@
|
||||
################################
|
||||
# Services Login Module #
|
||||
################################
|
||||
|
||||
package BotModules::ServicesLogin;
|
||||
use vars qw(@ISA);
|
||||
@ISA = qw(BotModules);
|
||||
1;
|
||||
|
||||
# This module allows your mozbot to login to Network Services such as
|
||||
# Nickserv, K9, Q on Quakenet, or X on Undernet.
|
||||
#
|
||||
# It works in two ways:
|
||||
# * it logs in when the bot connects to IRC
|
||||
# * it reauthenticates at regular intervals, to assure that mozbot is
|
||||
# logged in at all times
|
||||
#
|
||||
# This module was originally written by Mohamed Elzakzoki
|
||||
# <mhtawfiq@earthlink.net>.
|
||||
|
||||
|
||||
sub RegisterConfig {
|
||||
my $self = shift;
|
||||
$self->SUPER::RegisterConfig(@_);
|
||||
$self->registerVariables(
|
||||
# [ name, save?, settable? ]
|
||||
['loginCommand', 1, 1, undef],
|
||||
['servicesNick', 1, 1, undef],
|
||||
['delay', 1, 1, 900], # defaults to every 15 minutes
|
||||
);
|
||||
}
|
||||
|
||||
sub Schedule {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
unless ($self->login($event)) {
|
||||
$self->tellAdmin($event, 'To make me log in to a particular service, use the \'setupServicesLogin\' command, as in \'setupServicesLogin x@services.undernet.org login foobot p455w0rd\'. Type \'help setupServicesLogin\' for more information.');
|
||||
}
|
||||
$self->schedule($event, \$self->{'delay'}, -1, 'login');
|
||||
$self->SUPER::Schedule($event);
|
||||
}
|
||||
|
||||
sub Help {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
return {
|
||||
'' => 'The ServicesLogin module logs mozbot into services such as X on Undernet, Q on Quakenet, or NickServ or K9 on other networks. To setup the ServicesLogin command, use the setupServicesLogin command. See \'help setupServicesLogin\'.',
|
||||
'setupServicesLogin' => 'The syntax of this command is \'setupServicesLogin <servicesNick> <loginCommand>\'. If the services nick is \'q@cserve.quakenet.org\', and the login command is \'auth mozbot mypass\', then you would type \'setupServicesLogin q@cserve.quakenet.org auth mozbot mypass\'. This will then cause mozbot to do: /msg q@cserve.quakenet.org auth mozbot mypass',
|
||||
} if $self->isAdmin($event);
|
||||
return {};
|
||||
}
|
||||
|
||||
sub Scheduled {
|
||||
my $self = shift;
|
||||
my ($event, @data) = @_;
|
||||
if ($data[0] eq 'login') {
|
||||
$self->login($event);
|
||||
} else {
|
||||
$self->SUPER::Scheduled($event, @data);
|
||||
}
|
||||
}
|
||||
|
||||
sub Told {
|
||||
my $self = shift;
|
||||
my ($event, $message) = @_;
|
||||
if ($message =~ /^\s*setup\s*services\s*login\s+(\S+)\s+(.+?)\s*$/osi) {
|
||||
$self->{'servicesNick'} = $1;
|
||||
$self->{'loginCommand'} = $2;
|
||||
$self->saveConfig();
|
||||
$self->say($event, "Ok, I'll contact $self->{'servicesNick'} regularly from now on.");
|
||||
$self->login($event);
|
||||
} else {
|
||||
return $self->SUPER::Told(@_);
|
||||
}
|
||||
return 0; # we've dealt with it, no need to do anything else.
|
||||
}
|
||||
|
||||
sub login {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
if (defined $self->{'servicesNick'} and
|
||||
defined $self->{'loginCommand'}) {
|
||||
local $event->{'target'} = $self->{'servicesNick'};
|
||||
$self->privsay($event, $self->{'loginCommand'});
|
||||
return 1;
|
||||
}
|
||||
return 0;
|
||||
}
|
||||
@@ -1,140 +0,0 @@
|
||||
################################
|
||||
# Sheriff Module #
|
||||
################################
|
||||
|
||||
package BotModules::Sheriff;
|
||||
use vars qw(@ISA);
|
||||
@ISA = qw(BotModules);
|
||||
1;
|
||||
|
||||
# RegisterConfig - Called when initialised, should call registerVariables
|
||||
sub RegisterConfig {
|
||||
my $self = shift;
|
||||
$self->SUPER::RegisterConfig(@_);
|
||||
$self->registerVariables(
|
||||
# [ name, save?, settable? ]
|
||||
['tree', 1, 1, 'SeaMonkey'],
|
||||
['baseURI', 1, 1, 'http://tinderbox.mozilla.org/'],
|
||||
['_sheriff', 1, 0, undef], # the undef actually means "don't touch", of course
|
||||
['updateDelay', 1, 1, 360],
|
||||
# XXX implement per-channel muting of the update notification
|
||||
);
|
||||
}
|
||||
|
||||
# Schedule - called when bot connects to a server, to install any schedulers
|
||||
# use $self->schedule($event, $delay, $times, $data)
|
||||
# where $times is 1 for a single event, -1 for recurring events,
|
||||
# and a +ve number for an event that occurs that many times.
|
||||
sub Schedule {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
$self->schedule($event, \$self->{'updateDelay'}, -1, 'sheriff');
|
||||
$self->SUPER::Schedule($event);
|
||||
}
|
||||
|
||||
sub Help {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
return {
|
||||
'' => 'The Sheriff module keeps track of the current sheriff.',
|
||||
'sheriff' => 'Display the current sheriff. Syntax: sheriff [tree]',
|
||||
};
|
||||
}
|
||||
|
||||
sub Told {
|
||||
my $self = shift;
|
||||
my ($event, $message) = @_;
|
||||
if ($message =~ /^\s*(?:who's\s+|whose\s+|whos\s+|who\s+is\s+the\s+|who\s+is\s+|who\s+)?sheriff(?:\s+(?:of\s+)?(.*?))?(?:[\s,]+today)?[.?!1]*\s*$/osi) {
|
||||
$self->GetSheriff($event, $1 || $self->{'tree'}, 'requested');
|
||||
} else {
|
||||
return $self->SUPER::Told(@_);
|
||||
}
|
||||
return 0; # dealt with it...
|
||||
}
|
||||
|
||||
sub GetSheriff {
|
||||
my $self = shift;
|
||||
my ($event, $tree, $requested) = @_;
|
||||
my $url = "$self->{'baseURI'}$tree/sheriff.pl";
|
||||
$self->getURI($event, $url, $tree, $requested);
|
||||
}
|
||||
|
||||
sub GotURI {
|
||||
my $self = shift;
|
||||
my ($event, $uri, $output, $tree, $requested) = @_;
|
||||
# someone please pretty up the logic here... XXX
|
||||
if ($output) {
|
||||
# magicness
|
||||
{ no warnings; # this can go _very_ wrong easily
|
||||
# sheriff.pl is created using the following lines:
|
||||
# $m =~ s/\'/\\\'/g;
|
||||
# print SHERIFF "\$current_sheriff = '$m';\n1;";
|
||||
$output =~ s/^\$current_sheriff = '//gosi; # strip front
|
||||
$output =~ s/';\n1;$//gosi; # strip back
|
||||
$output =~ s/\\\'/\'/gosi; # dequote quotes
|
||||
# heuristics
|
||||
$output =~ s/<!--.*?-->//gos;
|
||||
$output =~ s/\n|\r|<a\s+href="|<\/a>//gosi;
|
||||
$output =~ s/">/, /gosi;
|
||||
$output =~ s/<br>|<\/?p><\/?div>/ /gosi;
|
||||
$output =~ s/<\/?(?:b|strong)>/*/gosi;
|
||||
$output =~ s/<\/?(?:u|em)>/_/gosi;
|
||||
$output =~ s/<\/?(?:q)>/"/gosi;
|
||||
$output =~ s/<\/?(?:i|dfn|cite)>/\//gosi;
|
||||
}
|
||||
if (defined($output)) {
|
||||
if ($tree eq $self->{'tree'}) {
|
||||
if ((defined($self->{'_sheriff'})) and ($self->{'_sheriff'} ne '')) { # not first time
|
||||
if ($output ne $self->{'_sheriff'}) { # changed.
|
||||
$self->announce($event, "Sheriff change: $output");
|
||||
if (($requested) and (not ($event->{'channel'}))) {
|
||||
$self->directSay($event, "$output");
|
||||
}
|
||||
} elsif ($requested) {
|
||||
$self->say($event, "$event->{'from'}: $output");
|
||||
}
|
||||
} else { # first time
|
||||
$self->say($event, "$event->{'from'}: $output") if ($requested);
|
||||
}
|
||||
$self->{'_sheriff'} = $output; # update internal cache
|
||||
} else { # not default tree
|
||||
if ($requested) {
|
||||
$self->say($event, "$event->{'from'}: $output");
|
||||
} # else EH!?
|
||||
}
|
||||
} else {
|
||||
# something went very wrong
|
||||
$self->say($event, "$event->{'from'}: I have no idea -- the '$tree' tree probably doesn't have a sheriff.") if ($requested);
|
||||
if ($tree eq $self->{'tree'}) {
|
||||
if (defined($self->{'_sheriff'})) {
|
||||
# only do it once
|
||||
$self->tellAdmin($event, "Oh dear lord what happened to the '$tree' sheriff line on the tinderbox page!!");
|
||||
$self->{'_sheriff'} = undef;
|
||||
}
|
||||
}
|
||||
}
|
||||
} else {
|
||||
if ($tree eq $self->{'tree'}) {
|
||||
$self->say($event, "$event->{'from'}: Call an admin, I couldn't find the Sheriff page. Sorry!") if ($requested);
|
||||
if (defined($self->{'_sheriff'})) {
|
||||
# only do it once
|
||||
$self->tellAdmin($event, "Looks like either I am badly configured or tinderbox is down - '$tree' came up blank when I went looking for the Sheriff.");
|
||||
$self->{'_sheriff'} = undef;
|
||||
}
|
||||
} else {
|
||||
if ($requested) {
|
||||
$self->say($event, "$event->{'from'}: Are you sure there is a tree called '$tree'? I couldn't find one...");
|
||||
} # else EH!?
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
sub Scheduled {
|
||||
my $self = shift;
|
||||
my ($event, @data) = @_;
|
||||
if ($data[0] eq 'sheriff') {
|
||||
$self->GetSheriff($event, $self->{'tree'}, 0);
|
||||
} else {
|
||||
$self->SUPER::Scheduled($event, @data);
|
||||
}
|
||||
}
|
||||
@@ -1,119 +0,0 @@
|
||||
# -*- Mode: perl; tab-width: 4; indent-tabs-mode: nil; -*-
|
||||
################################
|
||||
# Spell Checker Module #
|
||||
################################
|
||||
|
||||
package BotModules::Spell;
|
||||
use vars qw(@ISA);
|
||||
@ISA = qw(BotModules);
|
||||
1;
|
||||
|
||||
# XXX Ideally we should move to using www.dict.org
|
||||
|
||||
sub Help {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
return {
|
||||
'' => 'This module checks for spelling errors.',
|
||||
'sp' => 'If you aren\'t sure of the spelling of a word, append \'(sp)\' to the word, and it will be checked for you. '.
|
||||
'For example: \'My speling (sp?) is awful!\''
|
||||
};
|
||||
}
|
||||
|
||||
sub Told {
|
||||
my $self = shift;
|
||||
my ($event, $message) = @_;
|
||||
if ($self->checkSpelling($event, $message)) {
|
||||
# we checked the spelling, abort
|
||||
return 0;
|
||||
}
|
||||
return $self->SUPER::Heard(@_);
|
||||
}
|
||||
|
||||
sub Heard {
|
||||
my $self = shift;
|
||||
my ($event, $text) = @_;
|
||||
$self->checkSpelling($event, $text);
|
||||
return $self->SUPER::Heard(@_);
|
||||
}
|
||||
|
||||
sub checkSpelling {
|
||||
my $self = shift;
|
||||
my ($event, $text) = @_;
|
||||
while ($text =~ s/^.*? # take everything up to the first word to check
|
||||
\b # look for a word break
|
||||
(\w+) # take the word to spell
|
||||
\s* # look for whitespace following it
|
||||
\(sp\??\) # followed by (sp) or (sp?)
|
||||
//isox) { # and remove everything up to here so we can do another check in a minute
|
||||
my $word = $1;
|
||||
# XXX escape $word
|
||||
$self->getURI($event, "http://www.merriam-webster.com/dictionary/$word", 'word', $1); # XXX should be configurable!
|
||||
return 1;
|
||||
}
|
||||
return 0;
|
||||
}
|
||||
|
||||
sub GotURI {
|
||||
my $self = shift;
|
||||
my ($event, $query, $result, $command, $word) = @_;
|
||||
if ($command ne 'word') {
|
||||
return $self->SUPER::GorURI(@_);
|
||||
} else {
|
||||
my $reply;
|
||||
# Determine if page is error or not
|
||||
if (!length($result)) {
|
||||
$self->debug("Waah, failed utterly to get a response for '$word' from the dictionary server.");
|
||||
$reply = "The dictionary service is not accessible right now, sorry.";
|
||||
} elsif ($result =~ / # Match
|
||||
The\ word\ you've\ entered\ # literal string
|
||||
isn't\ in\ the\ dictionary\. # (not very smart),
|
||||
.*? # anything (non-greedy),
|
||||
<PRE> # PRE tag,
|
||||
(.*?) # our suggestions,
|
||||
<\/PRE> # PRE tag
|
||||
/osx
|
||||
|
||||
|| $result =~ / # Match
|
||||
The\ word\ you've\ entered\ # literal string
|
||||
isn't\ in\ the\ dictionary\. # (not very smart),
|
||||
.*? # anything (non-greedy),
|
||||
<ol.*?\"> # OL tag,
|
||||
(.*?) # our suggestions,
|
||||
<\/ol> # OL tag
|
||||
/osx
|
||||
# XXX this is hardcoded to m-w.com!
|
||||
) {
|
||||
# Strip line numbering and anchor tags
|
||||
my $suggestions = $1;
|
||||
$suggestions =~ s/\s+[\d]+\.\s+//go;
|
||||
$suggestions =~ s/<a href.*?>(.*?)<\/a>/$1 /go;
|
||||
$suggestions =~ s/<li>(.*?)<\/li>/$1 /go;
|
||||
|
||||
# get them in list format
|
||||
my @suggestions = split(' ', $suggestions);
|
||||
|
||||
# Comma delimit suggestions
|
||||
local $" = ', ';
|
||||
if (@suggestions > 7) {
|
||||
# lots of suggestions!
|
||||
# 7 is not arbitrary, it's supposed to be the number
|
||||
# of items people can remember at once.
|
||||
@suggestions = @suggestions[0..6];
|
||||
$reply = "Suggestions for '$word': @suggestions[0..6]...";
|
||||
} elsif (@suggestions) {
|
||||
# just a few suggestions
|
||||
$reply = "Suggestions for '$word': @suggestions";
|
||||
} else {
|
||||
# eh? Weird. Some problem on the server probably.
|
||||
$self->debug("Didn't get any suggestions for '$word'!");
|
||||
$reply = "I have no idea what '$word' is supposed to be, sorry.";
|
||||
}
|
||||
} else {
|
||||
# horrah!
|
||||
$reply = "'$word' seems to be the correct spelling.";
|
||||
}
|
||||
$self->say($event, $reply);
|
||||
return 0;
|
||||
}
|
||||
}
|
||||
@@ -1,54 +0,0 @@
|
||||
# -*- Mode: perl; tab-width: 4; indent-tabs-mode: nil; -*-
|
||||
################################
|
||||
# Stocks Module #
|
||||
################################
|
||||
|
||||
package BotModules::Stocks;
|
||||
use vars qw(@ISA);
|
||||
@ISA = qw(BotModules);
|
||||
1;
|
||||
|
||||
# XXX Per-channel configurable notification of stock changes
|
||||
# XXX Non-US markets
|
||||
|
||||
sub Help {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
return {
|
||||
'' => 'This module gets stock quotes. Ask me a ticker symbol, I will retrieve the quote.',
|
||||
'stock' => 'Call this command with a ticker symbol to get the current stock price and change. Syntax: stock FBAR',
|
||||
};
|
||||
}
|
||||
|
||||
sub Told {
|
||||
my $self = shift;
|
||||
my ($event, $message) = @_;
|
||||
if ($message =~ /^\s*stocks?\s+(.+?)\s*$/osi) {
|
||||
$self->getURI($event, "http://download.finance.yahoo.com/d/quotes.csv?f=sl1d1t1c1ohgv&e=.csv&s=$1", $1);
|
||||
} else {
|
||||
return $self->SUPER::Told(@_);
|
||||
}
|
||||
return 0; # we've dealt with it, no need to do anything else.
|
||||
}
|
||||
|
||||
sub GotURI {
|
||||
my $self = shift;
|
||||
my ($event, $uri, $output, $stock) = @_;
|
||||
$self->debug($output);
|
||||
my $message = "$event->{'from'}: ";
|
||||
# The data currently listed in this format are: ticker symbol, last price, date, time, change, open price, daily high, daily low, and volume.
|
||||
# -- http://help.yahoo.com/help/us/fin/quote/quote-05.html
|
||||
my @stockValues = split(',', $output);
|
||||
foreach my $part (@stockValues) {
|
||||
$part =~ s/"//gos; # remove all quotes. Bit of a hack, but... XXX
|
||||
}
|
||||
if ($stockValues[4] > 0) {
|
||||
$stockValues[4] = 'up ' . (0+$stockValues[4]);
|
||||
} elsif ($stockValues[4] < 0) {
|
||||
$stockValues[4] = 'down ' . (0-$stockValues[4]);
|
||||
} else {
|
||||
$stockValues[4] = 'no change';
|
||||
}
|
||||
$message .= "Stock quote for $stockValues[0]: $stockValues[1], $stockValues[4] (low: $stockValues[7], high: $stockValues[6])";
|
||||
$self->say($event, $message);
|
||||
}
|
||||
@@ -1,508 +0,0 @@
|
||||
# -*- Mode: perl; tab-width: 4; indent-tabs-mode: nil; -*-
|
||||
################################
|
||||
# Tinderbox Module #
|
||||
################################
|
||||
|
||||
package BotModules::Tinderbox;
|
||||
use vars qw(@ISA);
|
||||
@ISA = qw(BotModules);
|
||||
1;
|
||||
|
||||
# RegisterConfig - Called when initialised, should call registerVariables
|
||||
sub RegisterConfig {
|
||||
my $self = shift;
|
||||
$self->SUPER::RegisterConfig(@_);
|
||||
$self->registerVariables(
|
||||
# [ name, save?, settable? ]
|
||||
['trees', 1, 1, ['SeaMonkey', 'SeaMonkey-Ports', 'MozillaTest', 'Grendel']],
|
||||
['treesAnnounced', 1, 1, ['SeaMonkey', 'SeaMonkey-Ports']],
|
||||
['treesDefault', 1, 1, ['SeaMonkey']],
|
||||
['treeStates', 0, 0, {}], # ->tree->(current, previous, lastupdate)
|
||||
['lasttreesStates', 0, 0, []], # copy of trees in last test
|
||||
['tinderboxStates', 0, 0, {}], # ->tree->build->(current, previous, lastupdate)
|
||||
['updateDelay', 1, 1, 120],
|
||||
['useNotice', 1, 1, 1], # set to 1 to use notice and 0 to use a normal message
|
||||
['_lastupdate', 0, 0, 0],
|
||||
['preferredLineLength', 1, 1, 100],
|
||||
['mutes', 1, 1, {}], # tree -> "channel channel channel"
|
||||
['states', 1, 1, {'success' => 'Success', 'testfailed' => 'Test Failed', 'busted' => 'Burning', }],
|
||||
['maxInChannel', 1, 1, 5], # maximum number of lines to report in a channel
|
||||
['tinderboxURI', 1, 1, "http://tinderbox.mozilla.org/"], # base URL for Tinderbox
|
||||
['isTinderbox2', 1, 1, 0], # whether this is tinderbox2 or not
|
||||
);
|
||||
}
|
||||
|
||||
# Schedule - called when bot connects to a server, to install any schedulers
|
||||
# use $self->schedule($event, $delay, $times, $data)
|
||||
# where $times is 1 for a single event, -1 for recurring events,
|
||||
# and a +ve number for an event that occurs that many times.
|
||||
sub Schedule {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
$self->schedule($event, \$self->{'updateDelay'}, -1, 'tinderbox');
|
||||
$self->SUPER::Schedule($event);
|
||||
}
|
||||
|
||||
sub Help {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
my %commands = (
|
||||
'' => 'The Tinderbox module monitors who the state of the tinderboxen.',
|
||||
'qt' => 'Quick trees, same as \'trees terse\'. You can give it a <tree> argument if you like, for example \'qt seamonkey\'.',
|
||||
'builds' => 'Gives the status of all the builds in all the trees that match a particular pattern. Syntax: \'builds <build>\'. For example: \'builds Mac\'.',
|
||||
'trees' => 'Reports on the current state of the tinderboxen. Syntax: \'trees <options> <tree>\' where <options> is any number of: '.
|
||||
'all (show all trees and all builds), main (show only main trees), burning (show only burning builds), '.
|
||||
'long, medium, short, terse (how much detail to include), and <tree> is the name of the tree to show (or a regexp matching it).',
|
||||
);
|
||||
if ($self->isAdmin($event)) {
|
||||
$commands{'mute'} = 'Disable reporting of a tree in a channel. (Only does something if the given tree exists.) Syntax: mute tinderbox <tree> in <channel>';
|
||||
$commands{'unmute'} = 'Enable reporting of a tree in a channel. By default, trees are reported in all channels that the module is active in. Syntax: unmute tinderbox <tree> in <channel>';
|
||||
}
|
||||
return \%commands;
|
||||
}
|
||||
|
||||
sub Told {
|
||||
my $self = shift;
|
||||
my ($event, $message) = @_;
|
||||
if ($message =~ /^\s*trees?(?:\s+(.*?))?\s*(?:[, ]\s*please)?\?*\s*$/osi) {
|
||||
|
||||
# initial setup
|
||||
my $trees = -1; # 0=default; 1=all; 'x'=pattern match
|
||||
my $builds = -1; # 0=all; 1=horked and test failed; 2=horked only
|
||||
my $verbosity = -1; # 1=terse; 2; 3; 4=verbose
|
||||
|
||||
# parse parameters
|
||||
if (defined($1)) {
|
||||
foreach (split(/\s+/, $1)) {
|
||||
if (/^all$/osi) { $trees = '1' if $trees < 0; $builds = 0 if $builds < 0; }
|
||||
elsif (/^main$/osi) { $trees = '0'; }
|
||||
elsif (/^burning$/osi) { $builds = 2; }
|
||||
elsif (/^long$/osi) { $verbosity = 4; }
|
||||
elsif (/^medium$/osi) { $verbosity = 3; }
|
||||
elsif (/^short$/osi) { $verbosity = 2; }
|
||||
elsif (/^terse$/osi) { $verbosity = 1; }
|
||||
else { $trees = $_; }
|
||||
}
|
||||
}
|
||||
|
||||
# defaults
|
||||
$trees = '0' if $trees < 0;
|
||||
$builds = 1 if $builds < 0;
|
||||
$verbosity = 2 if $verbosity < 0;
|
||||
|
||||
# go
|
||||
$self->GetTrees($event, 1, $trees, $builds, $verbosity);
|
||||
|
||||
} elsif ($message =~ /^\s*builds?\s+(.*?)\s*\?*\s*$/osi) {
|
||||
$self->GetTrees($event, 2, $1);
|
||||
} elsif ($message =~ /^\s*qt(?:\s+(.+?))?\s*$/osi) {
|
||||
$self->GetTrees($event, 1, defined($1) ? $1 : 0, 1, 1);
|
||||
} elsif ($self->isAdmin($event)) {
|
||||
if ($message =~ /^\s*mute tinderbox\s+(\S+?)\s+in\s+(\S+?)\s*$/osi) {
|
||||
my $tree = $1 eq 'Tinderbox' ? '' : $1;
|
||||
my $treeName = $tree eq '' ? 'all trees' : "trees named $tree";
|
||||
if (($tree eq '') or (grep $_ eq $tree, @{$self->{'trees'}})) {
|
||||
$self->{'mutes'}->{$tree} .= " $2";
|
||||
$self->saveConfig();
|
||||
$self->say($event, "$event->{'from'}: Tinderbox notifications for $treeName muted in channel $2.");
|
||||
} else {
|
||||
$self->say($event, "$event->{'from'}: There is no tree called $tree is there?.");
|
||||
}
|
||||
} elsif ($message =~ /^\s*unmute tinderbox\s+(\S+?)\s+in\s+(\S+?)\s*$/osi) {
|
||||
my $tree = $1 eq 'Tinderbox' ? '' : $1;
|
||||
my $treeName = $tree eq '' ? 'all trees' : "trees named $tree";
|
||||
if (($tree eq '') or (grep $_ eq $tree, @{$self->{'trees'}})) {
|
||||
my %mutedChannels = map { lc($_) => 1 } split(/ /o, $self->{'mutes'}->{$1});
|
||||
delete($mutedChannels{lc($2)}); # get rid of any mentions of that channel
|
||||
$self->{'mutes'}->{$1} = join(' ', keys(%mutedChannels));
|
||||
$self->saveConfig();
|
||||
$self->say($event, "$event->{'from'}: Tinderbox notifications for trees named $1 resumed in channel $2.");
|
||||
} else {
|
||||
$self->say($event, "$event->{'from'}: There is no tree called $tree is there?.");
|
||||
}
|
||||
} else {
|
||||
return $self->SUPER::Told(@_);
|
||||
}
|
||||
} else {
|
||||
return $self->SUPER::Told(@_);
|
||||
}
|
||||
return 0; # dealt with it...
|
||||
}
|
||||
|
||||
sub GetTrees {
|
||||
my $self = shift;
|
||||
my ($event, $requested, @mode) = @_;
|
||||
my @trees = @{$self->{'trees'}};
|
||||
if ($self->{'isTinderbox2'}) {
|
||||
foreach (@trees) {
|
||||
my $uri = $self->{'tinderboxURI'} . $_ . "/quickparse.html";
|
||||
$self->getURI($event, $uri, $requested, @mode);
|
||||
}
|
||||
} else {
|
||||
local $" = ','; # XXX %-escape this
|
||||
my $uri = $self->{'tinderboxURI'} . "showbuilds.cgi?quickparse=1&tree=@trees";
|
||||
$self->getURI($event, $uri, $requested, @mode);
|
||||
}
|
||||
}
|
||||
|
||||
sub GotURI {
|
||||
my $self = shift;
|
||||
my ($event, $uri, $output, $requested, @mode) = @_;
|
||||
if ($output) {
|
||||
my $now = $event->{'time'};
|
||||
$self->{'_lastupdate'} = $now;
|
||||
my @lines = split(/\n/os, $output);
|
||||
|
||||
# loop through quickparse output
|
||||
foreach my $line (@lines) {
|
||||
my ($type, $tree, $build, $state) = split(/\|/os, $line);
|
||||
if ($type eq 'State') {
|
||||
$self->{'treeStates'}->{$tree}->{'lastupdate'} = $now;
|
||||
if (defined($self->{'treeStates'}->{$tree}->{'current'})) {
|
||||
$self->{'treeStates'}->{$tree}->{'previous'} = $self->{'treeStates'}->{$tree}->{'current'};
|
||||
}
|
||||
$self->{'treeStates'}->{$tree}->{'current'} = $state;
|
||||
$self->{'states'}->{$state} = $state unless defined($self->{'states'}->{$state});
|
||||
} elsif ($type eq 'Build') {
|
||||
$self->{'tinderboxStates'}->{$tree}->{$build}->{'lastupdate'} = $now;
|
||||
if (defined($self->{'tinderboxStates'}->{$tree}->{$build}->{'current'})) {
|
||||
$self->{'tinderboxStates'}->{$tree}->{$build}->{'previous'} = $self->{'tinderboxStates'}->{$tree}->{$build}->{'current'};
|
||||
}
|
||||
$self->{'tinderboxStates'}->{$tree}->{$build}->{'current'} = $state;
|
||||
$self->{'states'}->{$state} = $state unless defined($self->{'states'}->{$state});
|
||||
} # else unsupported type XXX
|
||||
}
|
||||
|
||||
#If a Tinderbox tree is configured without Bonsai, it lacks a state line and doesn't
|
||||
# appear properly in the trees output (even though machine state changes work.)
|
||||
# Work around this by setting a default state of Unknown to trees w/o a state line.
|
||||
my $state = "unknown";
|
||||
foreach my $tree (keys(%{$self->{'tinderboxStates'}})) {
|
||||
if (!defined($self->{'treeStates'}->{$tree})) {
|
||||
$self->{'treeStates'}->{$tree}->{'current'} = $state;
|
||||
$self->{'treeStates'}->{$tree}->{'lastupdate'} = $now;
|
||||
if (defined($self->{'treeStates'}->{$tree}->{'current'})) {
|
||||
$self->{'treeStates'}->{$tree}->{'previous'} = $self->{'treeStates'}->{$tree}->{'current'};
|
||||
}
|
||||
$self->{'states'}->{$state} = $state unless defined($self->{'states'}->{$state});
|
||||
}
|
||||
#Update timestamps on trees we're 'managing' state on.
|
||||
if (($self->{'treeStates'}->{$tree}->{'current'} eq $state) and
|
||||
($self->{'treeStates'}->{$tree}->{'lastupdate'} < $now)) {
|
||||
$self->{'treeStates'}->{$tree}->{'lastupdate'} = $now;
|
||||
}
|
||||
}
|
||||
|
||||
$self->CheckForUpdates($event, $requested);
|
||||
if ($requested == 1) {
|
||||
$self->ReportState($event, @mode);
|
||||
} elsif ($requested == 2) {
|
||||
$self->ReportBuild($event, @mode);
|
||||
}
|
||||
# update list of active trees
|
||||
@{$self->{'lasttreesState'}} = @{$self->{'trees'}};
|
||||
} else {
|
||||
if ($requested) {
|
||||
$self->say($event, "$event->{'from'}: I can't access tinderbox right now, sorry.");
|
||||
}
|
||||
$self->debug('failed to get tinderbox data');
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
sub Scheduled {
|
||||
my $self = shift;
|
||||
my ($event, @data) = @_;
|
||||
if ($data[0] eq 'tinderbox') {
|
||||
$self->GetTrees($event, 0);
|
||||
} else {
|
||||
$self->SUPER::Scheduled($event, @data);
|
||||
}
|
||||
}
|
||||
|
||||
sub CheckForUpdates {
|
||||
my $self = shift;
|
||||
my ($event, $avoidTarget) = @_;
|
||||
my $a; # disclaimer: I was asleep when I wrote the next line. I've no longer any idea what it does.
|
||||
my @trees = map { $a = $_; grep { $_ eq $a } @{$self->{'lasttreesState'}}; } @{$self->{'treesAnnounced'}};
|
||||
# After staring at it for a few minutes, I think what it does is get a list of the trees that should
|
||||
# be announced, AND that have already been found to exist. But I'm not 100% sure.
|
||||
foreach my $tree (@trees) {
|
||||
my @newTrees;
|
||||
my @newBuilds;
|
||||
my @lostBuilds;
|
||||
my @lostTrees;
|
||||
my @changes;
|
||||
|
||||
# check trees
|
||||
if (defined($self->{'treeStates'}->{$tree})) {
|
||||
if ($self->{'treeStates'}->{$tree}->{'lastupdate'} == $self->{'_lastupdate'}) {
|
||||
if (defined($self->{'treeStates'}->{$tree}->{'previous'})) {
|
||||
if ($self->{'treeStates'}->{$tree}->{'previous'} ne $self->{'treeStates'}->{$tree}->{'current'}) {
|
||||
push(@changes, "$tree has changed state from $self->{'states'}->{$self->{'treeStates'}->{$tree}->{'previous'}} to $self->{'states'}->{$self->{'treeStates'}->{$tree}->{'current'}}.");
|
||||
}
|
||||
} else {
|
||||
push(@newTrees, "New tree added to tinderbox: $tree (state: $self->{'states'}->{$self->{'treeStates'}->{$tree}->{'current'}}).");
|
||||
}
|
||||
} else {
|
||||
# tree has dissappeared!
|
||||
delete($self->{'treeStates'}->{$tree});
|
||||
push(@lostTrees, "Eek!!! Tree '$tree' has been removed from tinderbox!");
|
||||
}
|
||||
} # else tree doesn't exist
|
||||
|
||||
# check builds
|
||||
if (defined($self->{'tinderboxStates'}->{$tree})) {
|
||||
foreach my $build (keys(%{$self->{'tinderboxStates'}->{$tree}})) {
|
||||
if ($self->{'tinderboxStates'}->{$tree}->{$build}->{'lastupdate'} == $self->{'_lastupdate'}) {
|
||||
if (defined($self->{'tinderboxStates'}->{$tree}->{$build}->{'previous'})) {
|
||||
if ($self->{'tinderboxStates'}->{$tree}->{$build}->{'previous'} ne $self->{'tinderboxStates'}->{$tree}->{$build}->{'current'}) {
|
||||
push(@changes, "$tree: '$build' has changed state from $self->{'states'}->{$self->{'tinderboxStates'}->{$tree}->{$build}->{'previous'}} to $self->{'states'}->{$self->{'tinderboxStates'}->{$tree}->{$build}->{'current'}}.");
|
||||
}
|
||||
} else {
|
||||
push(@newBuilds, "$tree: Build '$build' added to tinderbox. (Status: $self->{'states'}->{$self->{'tinderboxStates'}->{$tree}->{$build}->{'current'}}).");
|
||||
}
|
||||
} else {
|
||||
# build has dissappeared!
|
||||
delete($self->{'tinderboxStates'}->{$tree}->{$build});
|
||||
push(@lostBuilds, "$tree: Build '$build' has dropped from tinderbox.");
|
||||
}
|
||||
}
|
||||
} # else tree doesn't exist
|
||||
|
||||
# sort out which channels to talk to
|
||||
my %mutedChannels = ();
|
||||
if (defined($self->{'mutes'}->{$tree})) {
|
||||
%mutedChannels = map { lc($_) => 1 } split(/\s+/os, $self->{'mutes'}->{$tree});
|
||||
}
|
||||
if (defined($self->{'mutes'}->{''})) {
|
||||
%mutedChannels = (%mutedChannels, map { lc($_) => 1 } split(/\s+/os, $self->{'mutes'}->{''}));
|
||||
}
|
||||
if (($avoidTarget) and ($event->{'target'} eq $event->{'channel'})) {
|
||||
$mutedChannels{$event->{'channel'}} = 1;
|
||||
}
|
||||
|
||||
# speak!
|
||||
my @output = (@newTrees, @lostTrees, @newBuilds, @lostBuilds);
|
||||
foreach (@{$self->{'channels'}}) {
|
||||
unless ($mutedChannels{$_}) {
|
||||
local $event->{'target'} = $_;
|
||||
foreach (@changes) {
|
||||
$self->sayOrNotice($event, $_);
|
||||
}
|
||||
if (@output < $self->{'maxInChannel'}) {
|
||||
foreach (@output) {
|
||||
$self->sayOrNotice($event, $_);
|
||||
}
|
||||
} else {
|
||||
$self->sayOrNotice($event, "Many tree changes just occured. Check tinderbox to see what they were.");
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
sub ReportState {
|
||||
my $self = shift;
|
||||
my ($event, $trees, $builds, $verbosity) = @_;
|
||||
|
||||
# $trees: 0=default; 1=all; 'x'=pattern match
|
||||
# $builds: 0=all; 1=horked and test failed; 2=horked only
|
||||
# $verbosity: 1=terse; 2; 3; 4=verbose
|
||||
|
||||
# the complete output
|
||||
my @lines;
|
||||
|
||||
# work out which trees we want
|
||||
my @trees;
|
||||
if ($trees eq '0') {
|
||||
@trees = @{$self->{'treesDefault'}};
|
||||
} elsif ($trees eq '1') {
|
||||
@trees = @{$self->{'trees'}};
|
||||
} else {
|
||||
my $pattern = $self->sanitizeRegexp($trees);
|
||||
foreach my $tree (keys %{$self->{'treeStates'}}) {
|
||||
push(@trees, $tree) if $tree =~ /$pattern/si;
|
||||
}
|
||||
}
|
||||
|
||||
if (@trees) {
|
||||
|
||||
foreach my $tree (@trees) {
|
||||
if ((defined($self->{'treeStates'}->{$tree})) and ($self->{'treeStates'}->{$tree}->{'lastupdate'} == $self->{'_lastupdate'})) {
|
||||
|
||||
# setup
|
||||
my @output;
|
||||
my ($redShort) = ($self->{'states'}->{'bustedShort'} or split(//osi, $self->{'states'}->{'busted'}));
|
||||
my $red = 0;
|
||||
my ($orangeShort) = ($self->{'states'}->{'testfailedShort'} or split(//osi, $self->{'states'}->{'testfailed'}));
|
||||
my $orange = 0;
|
||||
my ($greenShort) = ($self->{'states'}->{'successShort'} or split(//osi, $self->{'states'}->{'success'}));
|
||||
my $green = 0;
|
||||
|
||||
# foreach build
|
||||
if (defined($self->{'tinderboxStates'}->{$tree})) {
|
||||
foreach my $build (keys(%{$self->{'tinderboxStates'}->{$tree}})) {
|
||||
if ($self->{'tinderboxStates'}->{$tree}->{$build}->{'lastupdate'} == $self->{'_lastupdate'}) {
|
||||
|
||||
my $state = $self->{'tinderboxStates'}->{$tree}->{$build}->{'current'};
|
||||
|
||||
# count results
|
||||
if ($state eq 'success') {
|
||||
$green++;
|
||||
} elsif ($state eq 'testfailed') {
|
||||
$orange++;
|
||||
} else {
|
||||
$red++;
|
||||
}
|
||||
|
||||
# make sure we should list this build
|
||||
if ($state eq 'success') {
|
||||
next if $builds >= 1;
|
||||
} elsif ($state eq 'testfailed') {
|
||||
next if $builds >= 2;
|
||||
}
|
||||
|
||||
if ($verbosity == 1) {
|
||||
my($minibuild) = split(/\s/osi, $build);
|
||||
my $ministate = $self->{'states'}->{$state.'Short'};
|
||||
if (not $ministate) {
|
||||
($ministate) = split(//osi, $self->{'states'}->{$state});
|
||||
}
|
||||
push(@output, "$minibuild: $ministate;");
|
||||
} elsif (($verbosity == 2) || ($verbosity == 3)) {
|
||||
my($minibuild) = $verbosity == 2 ? split(/\s/osi, $build) : ($build);
|
||||
my $ministate = $self->{'states'}->{$state.'Medium'};
|
||||
if (not $ministate) {
|
||||
$ministate = $self->{'states'}->{$state};
|
||||
}
|
||||
push(@output, "$minibuild ($ministate),");
|
||||
} else {
|
||||
push(@output, "[$build: $self->{'states'}->{$state}]")
|
||||
}
|
||||
|
||||
} # else build is dead
|
||||
} # (foreach build)
|
||||
} # else tree is dead
|
||||
|
||||
# pretty print it
|
||||
my @newoutput;
|
||||
if ($verbosity == 1) {
|
||||
if (@output == 0) {
|
||||
unless ($red + $green + $orange) {
|
||||
push(@output, "(none)");
|
||||
} elsif ($builds <= 1) {
|
||||
push(@output, "(all green)");
|
||||
} else {
|
||||
push(@output, "(none red)");
|
||||
}
|
||||
}
|
||||
my $ministate = $self->{'states'}->{$self->{'treeStates'}->{$tree}->{'current'}.'Short'};
|
||||
if (not $ministate) {
|
||||
($ministate) = split(//osi, $self->{'states'}->{$self->{'treeStates'}->{$tree}->{'current'}});
|
||||
}
|
||||
@newoutput = $self->wordWrap($self->{'preferredLineLength'},
|
||||
"$tree <$ministate> $redShort:${red} $orangeShort:${orange} $greenShort:${green} ",
|
||||
' ', ' ', @output);
|
||||
$newoutput[0] =~ s/^ //o;
|
||||
$newoutput[$#newoutput] =~ s/;$//o;
|
||||
push(@lines, @newoutput);
|
||||
} elsif (($verbosity == 2) || ($verbosity == 3)) {
|
||||
unless ($red+$orange+$green) {
|
||||
push(@lines, "$tree <$self->{'states'}->{$self->{'treeStates'}->{$tree}->{'current'}}>: no tinderboxen for this tree.");
|
||||
} elsif (($red) or ($orange)) {
|
||||
if (@output == 0) {
|
||||
# can only happen if $red is 0 and $builds is 1.
|
||||
push(@output, "all tinderboxen compile");
|
||||
}
|
||||
my @newoutput = $self->wordWrap($self->{'preferredLineLength'},
|
||||
"$tree <$self->{'states'}->{$self->{'treeStates'}->{$tree}->{'current'}}> $red red, $orange orange, $green green: ",
|
||||
' ', ' ', @output);
|
||||
$newoutput[0] =~ s/^ //o;
|
||||
$newoutput[$#newoutput] =~ s/,$//o;
|
||||
# if (length(@newoutput[$#newoutput]) < $self->{'preferredLineLength'} - 33) {
|
||||
# $newoutput[$#newoutput] .= " Summary: $red red, $orange orange, $green green";
|
||||
# } else {
|
||||
# push(@newoutput, " Summary: $red red, $orange orange, $green green");
|
||||
# }
|
||||
push(@lines, @newoutput);
|
||||
} else {
|
||||
push(@lines, "$tree <$self->{'states'}->{$self->{'treeStates'}->{$tree}->{'current'}}>: all $green tinderboxen green!");
|
||||
}
|
||||
} else {
|
||||
if (@output == 0) {
|
||||
unless ($red + $green + $orange) {
|
||||
push(@output, "no tinderboxen for this tree.");
|
||||
} elsif ($builds <= 1) {
|
||||
push(@output, "all tinderboxen for this tree are green!");
|
||||
} else {
|
||||
push(@output, "all tinderboxen for this tree compile successfully.");
|
||||
}
|
||||
}
|
||||
@newoutput = $self->wordWrap($self->{'preferredLineLength'},
|
||||
"$tree <$self->{'states'}->{$self->{'treeStates'}->{$tree}->{'current'}}> $red red, $orange orange, $green green: ",
|
||||
' ', ' ', @output);
|
||||
$newoutput[0] =~ s/^ //o;
|
||||
push(@lines, @newoutput);
|
||||
}
|
||||
|
||||
} # else tree is dead
|
||||
|
||||
} # (foreach tree)
|
||||
|
||||
} else { # no tree selected
|
||||
@lines = ("No tree matches the pattern '$trees', sorry!");
|
||||
}
|
||||
|
||||
$self->Report($event, 'tree status', @lines);
|
||||
}
|
||||
|
||||
sub ReportBuild {
|
||||
my $self = shift;
|
||||
my ($event, $pattern) = @_;
|
||||
|
||||
# the complete output
|
||||
my @output;
|
||||
|
||||
foreach my $tree (@{$self->{'trees'}}) {
|
||||
if ((defined($self->{'treeStates'}->{$tree})) and
|
||||
($self->{'treeStates'}->{$tree}->{'lastupdate'} == $self->{'_lastupdate'}) and
|
||||
(defined($self->{'tinderboxStates'}->{$tree}))) {
|
||||
foreach my $build (keys(%{$self->{'tinderboxStates'}->{$tree}})) {
|
||||
if (($self->{'tinderboxStates'}->{$tree}->{$build}->{'lastupdate'} == $self->{'_lastupdate'}) and
|
||||
($build =~ /\Q$pattern\E/is)) {
|
||||
push(@output, "[$build: $self->{'states'}->{$self->{'tinderboxStates'}->{$tree}->{$build}->{'current'}}]")
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
@output = ('There are no matching builds.') unless @output;
|
||||
@output = $self->prettyPrint($self->{'preferredLineLength'}, undef, "$event->{'from'}: ", ' ', @output);
|
||||
|
||||
$self->Report($event, 'tree status', @output);
|
||||
}
|
||||
|
||||
sub Report {
|
||||
my $self = shift;
|
||||
my ($event, $what, @output) = @_;
|
||||
if (scalar(@output) > $self->{'maxInChannel'}) {
|
||||
foreach (@output) {
|
||||
$self->directSay($event, $_);
|
||||
}
|
||||
$self->channelSay($event, "$event->{'from'}: $what /msg'ed");
|
||||
} else {
|
||||
foreach (@output) {
|
||||
$self->say($event, $_);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
sub sayOrNotice {
|
||||
my $self = shift;
|
||||
if ($self->{'useNotice'}) {
|
||||
$self->notice(@_);
|
||||
} else {
|
||||
$self->say(@_);
|
||||
}
|
||||
}
|
||||
@@ -1,179 +0,0 @@
|
||||
################################
|
||||
# Translate Module #
|
||||
################################
|
||||
|
||||
package BotModules::Translate;
|
||||
use vars qw(@ISA);
|
||||
use WWW::Babelfish;
|
||||
|
||||
# Ah, the previous line looks so innocent. Yet it hides horrible
|
||||
# evil. Yes, this module requires the following:
|
||||
#
|
||||
# WWW::Babelfish
|
||||
# libwww (a bundle)
|
||||
# URI
|
||||
# MIME-Base64
|
||||
# HTML::Parser
|
||||
# HTML-Tagset
|
||||
# libnet (you probably already have this)
|
||||
# Digest::MD5
|
||||
# IO::String
|
||||
|
||||
@ISA = qw(BotModules);
|
||||
1;
|
||||
|
||||
# -- #mozilla was here! --
|
||||
# *** Signoff: techbot_Hixie (~techbot_Hixie@129.59.231.42) has left IRC [Leaving]
|
||||
# <timeless> oops, i killed your techbot
|
||||
|
||||
# RegisterConfig - Called when initialised, should call registerVariables
|
||||
sub RegisterConfig {
|
||||
my $self = shift;
|
||||
$self->SUPER::RegisterConfig(@_);
|
||||
$self->registerVariables(
|
||||
# [ name, save?, settable? ]
|
||||
['supportedservices', 1, 1, {
|
||||
'Babelfish' => '', #Original WWW::Babelfish Service
|
||||
'Yahoo' => '', #Available since WWW::Babelfish 0.14
|
||||
'Google' => '', #Available since WWW::Babelfish 0.12
|
||||
}],
|
||||
['languages', 1, 1, {
|
||||
'en' => 'English',
|
||||
'fr' => 'French',
|
||||
'de' => 'German',
|
||||
'it' => 'Italian',
|
||||
'es' => 'Spanish',
|
||||
'ar' => 'Arabic',
|
||||
'zh' => 'Chinese-simp',
|
||||
'zt' => 'Chinese-trad',
|
||||
'zh-CN' => 'Chinese (Simp)', #Google-only
|
||||
'nl' => 'Dutch',
|
||||
'el' => 'Greek',
|
||||
'ja' => 'Japanese',
|
||||
'pt' => 'Portuguese',
|
||||
'ru' => 'Russian',
|
||||
}], # short code => Babelfish Language Name
|
||||
['defaultLanguage', 1, 1, 'en'],
|
||||
['defaultservice', 1, 1, 'Babelfish'],
|
||||
);
|
||||
}
|
||||
|
||||
sub Help {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
my @languages = keys(%{$self->{'languages'}});
|
||||
my @services = keys(%{$self->{'supportedservices'}});
|
||||
local $";
|
||||
$" = '|';
|
||||
return {
|
||||
'' => 'Translate text between languages using Babelfish or Google.',
|
||||
'translate' => "Syntax: \'translate [using (@services)] [from (@languages)] [to (@languages)] sentence\'",
|
||||
'x' => 'Same as translate.',
|
||||
'languages' => "Returns list of available languages to translate. Syntax: languages [(@services)]"
|
||||
};
|
||||
}
|
||||
|
||||
sub Told {
|
||||
my $self = shift;
|
||||
my ($event, $message) = @_;
|
||||
if ($message =~ /^\s*(?:translate|x)\s+(.*?)\s*$/osi) {
|
||||
$self->Translate($event, $1);
|
||||
} elsif ($message =~ /^\s*languages?(?:\s+(.*?))?\s*(?:[, ]\s*please)?\?*\s*$/osi) {
|
||||
$self->GetLanguages($event, $1);
|
||||
} else {
|
||||
return $self->SUPER::Told(@_);
|
||||
}
|
||||
return 0; # dealt with it...
|
||||
}
|
||||
|
||||
sub translate_do {
|
||||
my $self = shift;
|
||||
my ($event, $service, $lang1, $lang2, $words) = @_;
|
||||
my $translate_babelfish = new WWW::Babelfish('service' => $service);
|
||||
my $result = $translate_babelfish->translate(
|
||||
'source' => $self->{'languages'}->{$lang1},
|
||||
'destination' => $self->{'languages'}->{$lang2},
|
||||
'text' => $words,
|
||||
);
|
||||
if ($result !~ /^ *$/os) {
|
||||
return "$event->{'from'}: $result";
|
||||
} else {
|
||||
my $error = $translate_babelfish->error;
|
||||
if ($error =~ /^ *$/os) {
|
||||
return "$event->{'from'}: I'm afraid I cannot translate that from $self->{'languages'}->{$lang1} to $self->{'languages'}->{$lang2}.";
|
||||
} else {
|
||||
return "$event->{'from'}: $error";
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
# ChildCompleted - Called when a child process has quit
|
||||
sub ChildCompleted {
|
||||
my $self = shift;
|
||||
my ($event, $type, $output, @data) = @_;
|
||||
if ($type eq 'babelfish') {
|
||||
$self->say($event, $output);
|
||||
} else {
|
||||
$self->SUPER::ChildCompleted($event, $type, $output, @data);
|
||||
}
|
||||
}
|
||||
|
||||
sub GetLanguages {
|
||||
my $self = shift;
|
||||
my ($event, $rest) = @_;
|
||||
my @services = keys(%{$self->{'supportedservices'}});
|
||||
my $service = $self->{'defaultservice'};
|
||||
$service = $rest if ($rest);
|
||||
|
||||
my $languages_babelfish = new WWW::Babelfish('service' => $service);
|
||||
$self->say($event,"$event->{'from'}: Available Translation Languages (for $service): " . join(", ", $languages_babelfish->languages)."");
|
||||
|
||||
}
|
||||
|
||||
sub Translate {
|
||||
my $self = shift;
|
||||
my ($event, $rest) = @_;
|
||||
my ($service, $lang1, $lang2, $words) = (
|
||||
$self->{'defaultservice'},
|
||||
$self->{'defaultLanguage'},
|
||||
$self->{'defaultLanguage'},
|
||||
);
|
||||
|
||||
my @services = keys(%{$self->{'supportedservices'}});
|
||||
my @languages = keys(%{$self->{'languages'}});
|
||||
local $";
|
||||
$" = '|';
|
||||
|
||||
|
||||
#check service syntax
|
||||
if ($rest =~ /^\s*using\s+(@services)\s+(.+)$/os) {
|
||||
$service = $1 if defined($1);
|
||||
$rest = $2;
|
||||
}
|
||||
|
||||
# check syntax
|
||||
if ($rest =~ /^\s*from\s+(@languages)\s+to\s+(@languages)\s+(.+)$/os) {
|
||||
$lang1 = $1;
|
||||
$lang2 = $2;
|
||||
$words = $3;
|
||||
} elsif ($rest =~ /^\s*to\s+(@languages)\s+from\s+(@languages)\s+(.+)$/os) {
|
||||
$lang2 = $1;
|
||||
$lang1 = $2;
|
||||
$words = $3;
|
||||
} elsif ($rest =~ /^\s*(from|to)\s+(@languages)\s+(.+)$/os) {
|
||||
$lang1 = $2 if $1 eq 'from';
|
||||
$lang2 = $2 if $1 eq 'to';
|
||||
$words = $3;
|
||||
} else {
|
||||
$self->say($event, "$event->{'from'}: Noooo... That\'s not the right syntax at all! Try something like \'translate [using (@services)] [from (@languages)] [to (@languages)] sentence\'");
|
||||
return;
|
||||
}
|
||||
|
||||
# translate
|
||||
if ($lang1 eq $lang2) {
|
||||
$self->say($event, "$event->{'from'}: Erm, well, translating from one language to the same language... doesn't change anything!");
|
||||
} else {
|
||||
$self->spawnChild($event, \&translate_do, [$self, $event, $service, $lang1, $lang2, $words], 'babelfish', []);
|
||||
}
|
||||
}
|
||||
|
||||
@@ -1,68 +0,0 @@
|
||||
################################
|
||||
# UUIDGen Module #
|
||||
################################
|
||||
|
||||
# "uuidgen" should be installed on the path somewhere.
|
||||
# you can get the source of uuidgen from CVS, see:
|
||||
# http://lxr.mozilla.org/mozilla/source/webtools/mozbot/uuidgen/
|
||||
|
||||
package BotModules::UUIDGen;
|
||||
use vars qw(@ISA);
|
||||
@ISA = qw(BotModules);
|
||||
1;
|
||||
|
||||
sub Help {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
return {
|
||||
'' => 'This module is an interface to the uuidgen application.',
|
||||
'uuid' => 'Generates a UUID.',
|
||||
'cid' => 'Generates a UUID but outputs format suitable for components (CID).',
|
||||
};
|
||||
}
|
||||
|
||||
sub Told {
|
||||
my $self = shift;
|
||||
my ($event, $message) = @_;
|
||||
if ($message =~ /^\s*uuid(?:[\s,!?]+please)?[\s,!?]*\s*$/osi) {
|
||||
$self->spawnChild($event, 'uuidgen', [], 'UUID', []);
|
||||
} elsif ($message =~ /^\s*cid(?:[\s,!?]+please)?[\s,!?]*\s*$/osi) {
|
||||
$self->spawnChild($event, 'uuidgen', [], 'CID', []);
|
||||
} else {
|
||||
return $self->SUPER::Told(@_);
|
||||
}
|
||||
return 0; # we've dealt with it, no need to do anything else.
|
||||
}
|
||||
|
||||
# ChildCompleted - Called when a child process has quit
|
||||
sub ChildCompleted {
|
||||
my $self = shift;
|
||||
my ($event, $type, $output, @data) = @_;
|
||||
if ($type eq 'UUID') {
|
||||
chop($output);
|
||||
$output .= " (/msg $nicks[$nick] cid for CID form)";
|
||||
$self->say($event, $output);
|
||||
} elsif ($type eq 'CID') {
|
||||
# remove newline
|
||||
chop($output);
|
||||
my @split = split(/-/, $output);
|
||||
$output = "{0x$split[0], 0x$split[1], 0x$split[2], {";
|
||||
|
||||
my @rest = $split[3] =~ m/(..)(..)/;
|
||||
push(@rest, $split[4] =~ m/(..)(..)(..)(..)(..)(..)/);
|
||||
|
||||
foreach (@rest) {
|
||||
$output .= "0x$_, ";
|
||||
}
|
||||
|
||||
# remove the space and comma
|
||||
chop($output);
|
||||
chop($output);
|
||||
|
||||
$output .= "}}\n";
|
||||
$self->say($event, $output);
|
||||
} else {
|
||||
return $self->SUPER::ChildCompleted(@_);
|
||||
}
|
||||
}
|
||||
|
||||
@@ -1,136 +0,0 @@
|
||||
################################
|
||||
# WWW Module #
|
||||
################################
|
||||
|
||||
package BotModules::WWW;
|
||||
use vars qw(@ISA);
|
||||
# Need HTML::Entities for decode_entities() in wwwtitle
|
||||
use HTML::Entities;
|
||||
@ISA = qw(BotModules);
|
||||
1;
|
||||
|
||||
# RegisterConfig - Called when initialised, should call registerVariables
|
||||
sub RegisterConfig {
|
||||
my $self = shift;
|
||||
$self->SUPER::RegisterConfig(@_);
|
||||
# $self->registerVariables(
|
||||
# # [ name, save?, settable? ]
|
||||
# ['x', 1, 1, 0],
|
||||
# );
|
||||
}
|
||||
|
||||
sub Help {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
return {
|
||||
'' => 'The WWW module provides a web interface.',
|
||||
'wwwsize' => 'Reports on the size of a webpage. Syntax: \'wwwsize http://...\'',
|
||||
'wwwlint' => 'Reports on whether the webpage contains any obvious (I mean _really_ obvious) no-nos like <layer> or document.all. Syntax: \'wwwlint http://...\'',
|
||||
'wwwdoctype' => 'Reports on the doctype of a webpage. (Warning: Does not check that the doctype is not commented out!) Syntax: \'wwwdoctype http://...\'',
|
||||
'wwwtitle' => 'Tries to heuristically determine a web page\'s title. Syntax: \'wwwtitle http://...\'',
|
||||
};
|
||||
}
|
||||
|
||||
sub Told {
|
||||
my $self = shift;
|
||||
my ($event, $message) = @_;
|
||||
if ($message =~ /^\s*wwwsize\s+(.+?)\s*$/osi) {
|
||||
$self->Fetch($event, $1, 'size');
|
||||
} elsif ($message =~ /^\s*wwwlint\s+(.+?)\s*$/osi) {
|
||||
$self->Fetch($event, $1, 'lint');
|
||||
} elsif ($message =~ /^\s*wwwdoctype\s+(.+?)\s*$/osi) {
|
||||
$self->Fetch($event, $1, 'doctype');
|
||||
} elsif ($message =~ /^\s*wwwtitle\s+(.+?)\s*$/osi) {
|
||||
$self->Fetch($event, $1, 'title');
|
||||
} else {
|
||||
return $self->SUPER::Told(@_);
|
||||
}
|
||||
return 0; # dealt with it...
|
||||
}
|
||||
|
||||
sub Fetch {
|
||||
my $self = shift;
|
||||
my ($event, $uri, $type) = @_;
|
||||
$self->getURI($event, $uri, $type);
|
||||
}
|
||||
|
||||
sub GotURI {
|
||||
my $self = shift;
|
||||
my ($event, $uri, $output, $type) = @_;
|
||||
my $chars = length($output);
|
||||
if ($type eq 'size') {
|
||||
if ($chars) {
|
||||
$self->say($event, "$uri is $chars bytes long.");
|
||||
} else {
|
||||
$self->say($event, "$uri is either empty, or I could not download it.");
|
||||
}
|
||||
} elsif ($type eq 'lint') {
|
||||
# ignore whether things are commented out or not.
|
||||
unless ($chars) {
|
||||
$self->say($event, "$uri is either empty, or I could not download it.");
|
||||
} else {
|
||||
my @status;
|
||||
if ($output =~ /document\.all/os) {
|
||||
push(@status, 'document.all');
|
||||
}
|
||||
if ($output =~ /document\.layers/os) {
|
||||
push(@status, 'document.layers');
|
||||
}
|
||||
if ($output =~ /<i?layer/osi) {
|
||||
push(@status, 'the <layer> tag');
|
||||
}
|
||||
if (@status) {
|
||||
my $status = shift(@status);
|
||||
if (@status) {
|
||||
while (scalar(@status) > 1) {
|
||||
$status .= ', '.shift(@status);
|
||||
}
|
||||
$status .= ' and '.shift(@status);
|
||||
}
|
||||
$self->say($event, "$uri contains $status.");
|
||||
} else {
|
||||
$self->say($event, "$uri doesn't have any _obvious_ flaws..."); # XXX doesn't work! try php.net
|
||||
}
|
||||
}
|
||||
} elsif ($type eq 'doctype') {
|
||||
# assume doctype is not commented.
|
||||
unless ($chars) {
|
||||
$self->say($event, "$uri is either empty, or I could not download it.");
|
||||
} elsif ($output =~ /(<!DOCTYPE\s[^>]*>)/osi) {
|
||||
my $doctype = $1;
|
||||
$doctype =~ s/[\n\r]+/ /gosi;
|
||||
|
||||
# -- #mozilla was here --
|
||||
# <Hixie> it would break 99% of the web if we didn't do it that way.
|
||||
# <Hixie> including most of my test cases ;-)
|
||||
# <dbaron> test cases don't matter...
|
||||
# <dbaron> you'll fix them if we decide they're wrong
|
||||
# <dbaron> but the web is a problem
|
||||
|
||||
if (length($doctype) > 220) { # arbitrary length greater than two 80 character lines
|
||||
$self->say($event, "$uri has a very long and possibly corrupted doctype (maybe it has an internal subset).");
|
||||
} else {
|
||||
$self->say($event, "$uri has the following doctype: $doctype");
|
||||
}
|
||||
} else {
|
||||
$self->say($event, "$uri has no specified doctype.");
|
||||
}
|
||||
} elsif ($type eq 'title') {
|
||||
# assume doctype is not commented.
|
||||
unless ($chars) {
|
||||
$self->say($event, "$uri is either empty, or I could not download it.");
|
||||
} elsif ($output =~ /<title\s*>(.*?)<\/title\s*>/osi or
|
||||
$output =~ /<h1\s*>(.*?)<\/h1\s*>/osi) {
|
||||
my $title = $1;
|
||||
$title =~ s/\s+/ /gosi;
|
||||
if (length($title) > 100) { # arbitrary length
|
||||
$title = substr($title, 0, 100) . '...';
|
||||
}
|
||||
$self->say($event, "$uri has the following title: " . decode_entities($title));
|
||||
} else {
|
||||
$self->say($event, "$uri has no specified title.");
|
||||
}
|
||||
} else {
|
||||
return $self->SUPER::GotURI(@_);
|
||||
}
|
||||
}
|
||||
@@ -1,55 +0,0 @@
|
||||
################################
|
||||
# Wishlist Module #
|
||||
################################
|
||||
|
||||
package BotModules::Wishlist;
|
||||
use vars qw(@ISA);
|
||||
@ISA = qw(BotModules);
|
||||
1;
|
||||
|
||||
sub Help {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
my $reply = {
|
||||
'' => 'A module to store wishlist items, typically used to file bugs on the bot, but really for that you should use Bugzilla -- https://bugzilla.mozilla.org/ -- component MozBot in product Webtools.',
|
||||
'wish' => 'Adds an item to the wishlist. Please use Bugzilla for this purpose though, see https://bugzilla.mozilla.org/ product Webtools, component Mozbot. Syntax: \'wish <text of wish>\'',
|
||||
'wishes' => 'Causes the bot to list all the wishes that have been made. Since this may be long, it may only be done in a /msg. Syntax: \'wishes\'',
|
||||
};
|
||||
$$reply{''} .= ' To remove wishes, use the following command: vars Wishlist wishes \'-<full text of the wish to remove>\'' if $self->isAdmin($event);
|
||||
return $reply;
|
||||
}
|
||||
|
||||
# RegisterConfig - Called when initialised, should call registerVariables
|
||||
sub RegisterConfig {
|
||||
my $self = shift;
|
||||
$self->SUPER::RegisterConfig(@_);
|
||||
$self->registerVariables(
|
||||
# [ name, save?, settable? ]
|
||||
['wishes', 1, 1, []],
|
||||
['reply', 1, 1, 'Noted!'],
|
||||
);
|
||||
}
|
||||
|
||||
sub Told {
|
||||
my $self = shift;
|
||||
my ($event, $message) = @_;
|
||||
if ($message =~ /^\s*(?:i\s+)?wish(?:list)?[-\s:.,;!]+(...+?)\s*$/osi) {
|
||||
push(@{$self->{'wishes'}}, "<$event->{'from'}> $1");
|
||||
$self->say($event, "$event->{'from'}: $self->{'reply'}");
|
||||
$self->saveConfig();
|
||||
} elsif ($message =~ /^\s*wishes[\s?]*$/osi) {
|
||||
if (@{$self->{'wishes'}}) {
|
||||
$self->directSay($event, 'Wishes:');
|
||||
foreach (@{$self->{'wishes'}}) {
|
||||
$self->directSay($event, " $_");
|
||||
}
|
||||
$self->directSay($event, 'End of wishes.');
|
||||
} else {
|
||||
$self->directSay($event, 'No-one has wished for anything!');
|
||||
}
|
||||
$self->channelSay($event, "$event->{'from'}: wishlist /msg'ed");
|
||||
} else {
|
||||
return $self->SUPER::Told(@_);
|
||||
}
|
||||
return 0; # we've dealt with it, no need to do anything else.
|
||||
}
|
||||
@@ -1,219 +0,0 @@
|
||||
# -*- Mode: perl; tab-width: 4; indent-tabs-mode: nil; -*-
|
||||
################################
|
||||
# XMLLogger Module #
|
||||
################################
|
||||
# Original Author: Matt Jones
|
||||
# National Center for Ecological Analysis and Synthesis (NCEAS)
|
||||
# University of California Santa Barbara
|
||||
#
|
||||
# This package creates an XML log file of the messages sent to IRC channels
|
||||
# which mozbot has joined. The content that is logged can be selected using
|
||||
# regular expression filters, although by default all messages are logged
|
||||
|
||||
package BotModules::XMLLogger;
|
||||
use vars qw(@ISA);
|
||||
@ISA = qw(BotModules);
|
||||
1;
|
||||
|
||||
sub Help {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
my $help = {
|
||||
'' => 'This module keeps an XML log of channels.',
|
||||
};
|
||||
if ($self->isAdmin($event)) {
|
||||
$help->{''} .= ' It can be configured to only accept messages matching certain patterns. The \'acceptedPatterns\' module variable is a list of regular expressions to use when determining what to log. The \'blockedPatterns\' list is the opposite.';
|
||||
$help->{'rotatelogs'} = 'Creates a new log file for each channel and moves the old one to a date-stamped version, making sure that the XML is valid. Syntax: \'rotatelogs\'.';
|
||||
}
|
||||
return $help;
|
||||
}
|
||||
|
||||
# RegisterConfig - Called when initialised, should call registerVariables
|
||||
sub RegisterConfig {
|
||||
my $self = shift;
|
||||
$self->SUPER::RegisterConfig(@_);
|
||||
$self->registerVariables(
|
||||
# [ name, save?, settable? ]
|
||||
['acceptedPatterns', 1, 1, ['']], # by default match everything
|
||||
['blockedPatterns', 1, 1, []], # by default block nothing
|
||||
);
|
||||
}
|
||||
|
||||
sub Told {
|
||||
my $self = shift;
|
||||
my ($event, $message) = @_;
|
||||
if ($self->isAdmin($event)) {
|
||||
if ($message =~ /^\s*rotate\s*logs?\s*$/osi) {
|
||||
$self->RotateLogs($event);
|
||||
} else {
|
||||
return $self->SUPER::Told(@_);
|
||||
}
|
||||
} else {
|
||||
return $self->SUPER::Told(@_);
|
||||
}
|
||||
return 0; # we've dealt with it, no need to do anything else.
|
||||
}
|
||||
|
||||
sub Log {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
if (($event->{'firsttype'} eq 'Told') or
|
||||
($event->{'firsttype'} eq 'Heard')) {
|
||||
$self->DoLog($event, 'msg');
|
||||
} elsif (($event->{'firsttype'} eq 'Felt') or
|
||||
($event->{'firsttype'} eq 'Saw')) {
|
||||
$self->DoLog($event, 'emote');
|
||||
} elsif (($event->{'firsttype'} eq 'SpottedKick') or
|
||||
($event->{'firsttype'} eq 'Kicked')) {
|
||||
$self->DoLog($event, 'kick');
|
||||
} elsif ($event->{'firsttype'} eq 'SpottedPart') {
|
||||
$self->DoLog($event, 'part');
|
||||
} elsif ($event->{'firsttype'} eq 'SpottedQuit') {
|
||||
$self->DoLog($event, 'quit');
|
||||
} elsif ($event->{'firsttype'} eq 'SpottedJoin') {
|
||||
$self->DoLog($event, 'join');
|
||||
} elsif ($event->{'firsttype'} eq 'SpottedNickChange') {
|
||||
$self->DoLog($event, 'nick');
|
||||
} elsif ($event->{'firsttype'} eq 'ModeChange') {
|
||||
$self->DoLog($event, 'mode');
|
||||
} elsif ($event->{'firsttype'} eq 'SpottedTopicChange') {
|
||||
$self->DoLog($event, 'topic');
|
||||
} # XXX should log notices
|
||||
return $self->SUPER::Log(@_);
|
||||
}
|
||||
|
||||
sub DoLog {
|
||||
my $self = shift;
|
||||
my ($event, $messageType) = @_;
|
||||
if ($event->{'channel'} ne '') { # don't log private messages
|
||||
foreach my $pattern (@{$self->{'acceptedPatterns'}}) {
|
||||
my $regexp = $self->sanitizeRegexp($pattern);
|
||||
if (($regexp eq '') ||
|
||||
($event->{'fulldata'} =~ /$regexp/s) ||
|
||||
($event->{'from'} =~ /$regexp/s)) {
|
||||
# wohay, we have a candidate!
|
||||
# now check for possible blockers...
|
||||
unless ($self->isBlocked($event)) {
|
||||
$self->WriteMessage($event->{'time'},
|
||||
$event->{'channel'},
|
||||
$event->{'from'},
|
||||
$event->{'fulldata'},
|
||||
$messageType);
|
||||
return; # only store each message once, regardless of how many patterns it matches
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
sub isBlocked {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
foreach my $blockedPattern (@{$self->{'blockedPatterns'}}) {
|
||||
my $regexp = $self->sanitizeRegexp($blockedPattern);
|
||||
if ($event->{'data'} =~ /$regexp/s) {
|
||||
return 1;
|
||||
}
|
||||
}
|
||||
return 0;
|
||||
}
|
||||
|
||||
sub WriteMessage {
|
||||
my $self = shift;
|
||||
my ($time, $channel, $from, $message, $messageType) = @_;
|
||||
# Open the log file and append the message
|
||||
$channel = $self->sanitiseChannelName($channel);
|
||||
my $logName = $self->getLogFilename("$channel.xml.part");
|
||||
if (open(LOG, ">>$logName")) {
|
||||
my $msgtime = $self->logdate($time);
|
||||
# sanitise the output
|
||||
$_ = $self->escapeXML($_) for ($messageType, $channel, $from, $msgtime, $message);
|
||||
print LOG "<$messageType channel=\"$channel\" nick=\"$from\" time=\"$msgtime\">$message</$messageType>\n";
|
||||
close(LOG);
|
||||
} else {
|
||||
$self->debug("Error logging, failed to open log $logName");
|
||||
}
|
||||
}
|
||||
|
||||
sub RotateLogs {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
my $errors = 0;
|
||||
foreach my $channel (@{$self->{'channels'}}) {
|
||||
$self->debug("Rotating log for $channel...");
|
||||
# XXX could (optionally) output message to channel saying so
|
||||
$errors += $self->RotateLogFile($event, $channel);
|
||||
}
|
||||
$errors = $errors == 1 ? "$errors error" : "$errors errors";
|
||||
$self->say($event, "Finished rotating logs, $errors.");
|
||||
}
|
||||
|
||||
sub RotateLogFile {
|
||||
my $self = shift;
|
||||
my ($event, $channel) = @_;
|
||||
|
||||
# create new names
|
||||
$channel = $self->sanitiseChannelName($channel);
|
||||
my $time = $self->filedate($event->{'time'});
|
||||
my $partName = $self->getLogFilename("$channel.xml.part");
|
||||
my $finalName = $self->getLogFilename("$channel-$time.xml");
|
||||
|
||||
# try to finalise file
|
||||
if (-e $finalName) {
|
||||
$self->debug("error rotating log for $channel, destination already existed");
|
||||
return 1; # report error
|
||||
} elsif (not (-e $partName and -s $partName)) {
|
||||
$self->debug("skipping $channel log rotation, log was empty");
|
||||
return 0; # not an error condition
|
||||
} elsif (open(FinalLog, ">$finalName")) {
|
||||
# opened new file, add the XML and copy the data over
|
||||
print FinalLog "<?xml version=\"1.0\"?>\n"; # XXX optional -- do we really want to add this?
|
||||
print FinalLog "<irclog>\n";
|
||||
open(PartLog, "<$partName"); # XXX error checking
|
||||
while (defined($_ = <PartLog>)) {
|
||||
print FinalLog;
|
||||
}
|
||||
close(PartLog);
|
||||
print FinalLog "</irclog>";
|
||||
close(FinalLog);
|
||||
unlink($partName); # delete the part log, ready for new data
|
||||
} else {
|
||||
$self->debug("error rotating log for $channel, failed to open $finalName");
|
||||
return 1; # doh, report error
|
||||
}
|
||||
return 0
|
||||
}
|
||||
|
||||
# logdate: return nice looking date and time stamp
|
||||
sub logdate {
|
||||
my $self = shift;
|
||||
my ($sec, $min, $hour, $mday, $mon, $year) = gmtime(shift or time());
|
||||
return sprintf("%d-%02d-%02dT%02d:%02d:%02dZ", $year + 1900, $mon + 1, $mday, $hour, $min, $sec);
|
||||
}
|
||||
|
||||
# return a date and time stamp suitable for file names
|
||||
sub filedate {
|
||||
my $self = shift;
|
||||
my ($sec, $min, $hour, $mday, $mon, $year) = gmtime(shift or time());
|
||||
return sprintf('%d%02d%02d-%02d%02d%02d', $year + 1900, $mon + 1, $mday, $hour, $min, $sec);
|
||||
}
|
||||
|
||||
sub sanitiseChannelName {
|
||||
my $self = shift;
|
||||
my($channel) = @_;
|
||||
$channel =~ s/([^\#&+a-zA-Z0-9-])//gosi; # sanitize
|
||||
$channel =~ m/^(.*)$/os; # detaint
|
||||
return $1;
|
||||
}
|
||||
|
||||
# escape XML characters as needed
|
||||
sub escapeXML {
|
||||
my $self = shift;
|
||||
my ($string) = @_;
|
||||
$string =~ s/&/&/gos;
|
||||
$string =~ s/'/'/gos;
|
||||
$string =~ s/"/"/gos;
|
||||
$string =~ s/</</gos;
|
||||
$string =~ s/>/>/gos;
|
||||
return $string;
|
||||
}
|
||||
@@ -1,993 +0,0 @@
|
||||
MODULE API DOCUMENTATION
|
||||
========================
|
||||
|
||||
This file documents the mozbot 2.5 bot module API.
|
||||
Revisions are welcome.
|
||||
|
||||
Sample module
|
||||
-------------
|
||||
|
||||
Here is the HelloWorld module:
|
||||
|
||||
################################
|
||||
# Hello World Module #
|
||||
################################
|
||||
|
||||
package BotModules::HelloWorld;
|
||||
use vars qw(@ISA);
|
||||
@ISA = qw(BotModules);
|
||||
1;
|
||||
|
||||
sub Help {
|
||||
my $self = shift;
|
||||
my ($event) = @_;
|
||||
return {
|
||||
'' => 'This is the demo module that says Hello World.',
|
||||
'hi' => 'Requests that the bot emit a hello world string.',
|
||||
};
|
||||
}
|
||||
|
||||
sub Told {
|
||||
my $self = shift;
|
||||
my ($event, $message) = @_;
|
||||
if ($message =~ /^\s*hi\s*$/osi) {
|
||||
$self->say($event, 'Hello World!');
|
||||
} else {
|
||||
return $self->SUPER::Told(@_);
|
||||
}
|
||||
}
|
||||
|
||||
################################
|
||||
|
||||
|
||||
Creating a module
|
||||
-----------------
|
||||
|
||||
Modules are perl objects with names that start with 'BotModules::'
|
||||
and that are stored in files with the '.bm' extension in the
|
||||
'BotModules' directory. The first non-comment line of each module
|
||||
should be the 'package' line, which in the HelloWorld module reads:
|
||||
|
||||
package BotModules::HelloWorld;
|
||||
|
||||
For a module to work correctly, it should inherit from the
|
||||
'BotModules' module (which is implemented internally in the main bot
|
||||
executable). This is done by including the following two lines
|
||||
immediately after the 'package' line:
|
||||
|
||||
use vars qw(@ISA);
|
||||
@ISA = qw(BotModules);
|
||||
|
||||
Since modules are dynamically loaded and unloaded, they should avoid
|
||||
using package globals. All variables should be stored in the '$self'
|
||||
blessed hashref. For more details, see the documentation of the
|
||||
'Initialise' function (below). Another result of the dynamic nature
|
||||
of modules is that they should not use BEGIN {} or END {} blocks, nor
|
||||
should they execute any code during their evaluation. Thus,
|
||||
immediately after the @ISA... line, the module should return success.
|
||||
This can be done easily:
|
||||
|
||||
1;
|
||||
|
||||
Following this, you are free to implement all the functions you need
|
||||
for your module. Certain functions have certain calling semantics,
|
||||
these are described below.
|
||||
|
||||
|
||||
Module Functions
|
||||
----------------
|
||||
|
||||
This section contains the names and descriptions of the functions in
|
||||
your module that will be called automatically depending on what is
|
||||
happening on IRC.
|
||||
|
||||
All your functions should start by shifting the $self variable from
|
||||
the argument list:
|
||||
|
||||
my $self = shift;
|
||||
|
||||
After this, it is common to get the other variables too:
|
||||
|
||||
my ($event, @anythingElse) = @_;
|
||||
|
||||
...where the bit in the brackets is given in the brackets of the
|
||||
definitions of the functions as shown below. For example, for
|
||||
JoinedChannel it would be ($event, $channel), so a function to
|
||||
override the default JoinedChannel action would be something like:
|
||||
|
||||
sub JoinedChannel {
|
||||
my $self = shift;
|
||||
my ($event, $channel) = @_;
|
||||
# ...
|
||||
return $self->SUPER::JoinedChannel($event, $channel); # call inherited method
|
||||
}
|
||||
|
||||
Many functions have to return a special value, typically 0 if the
|
||||
event was handled, and 1 if it was not.
|
||||
|
||||
For these functions, what actually happens is that for the relevant
|
||||
event, the bot has a list of event handlers it should call. For
|
||||
example, if someone says 'bot: hi' then the bot wants to call the
|
||||
Told() handler and the Baffled() handler. It first calls the Told()
|
||||
handler of every module. It then looks to see if any of the handlers
|
||||
returned 0. If so, it stops. Note, though, that every Told() handler
|
||||
got called! If none of the handlers returned 0, then it looks to see
|
||||
what the highest return value was. If it was greater than 1, then it
|
||||
increments the 'level' field of the $event hash (see below) and calls
|
||||
all the Told() handlers that returned 1 or more again. This means that
|
||||
if your module decides whether or not to respond by looking at a
|
||||
random number, it is prone to being confused by another module!
|
||||
|
||||
YOU SHOULD NOT USE RANDOM NUMBERS TO DECIDE WHETHER OR NOT TO
|
||||
RESPOND TO A MESSAGE!
|
||||
|
||||
Once all the relevant Told() handlers have been called again, the
|
||||
bot once again examines all the return results, and stops if any
|
||||
returned 0. If none did and if the current value of the level field
|
||||
is less than the highest number returned from any of the modules,
|
||||
then it repeats the whole process again. Once the level field is
|
||||
equal to the highest number returned, then, if no module has ever
|
||||
returned 0 in that whole loopy time, it moves on to the next
|
||||
handler in the list (in this case Baffled()), and does the
|
||||
_entire_ process again.
|
||||
|
||||
You may be asking yourself "Why oh why!". It is to allow you to
|
||||
implement priority based responses. If your module returns '5' to
|
||||
the Told() function, and only handles the event (i.e., only
|
||||
returns 0) once the level field is 5, then it will only handle the
|
||||
event if no other module has wanted to handle the event in any of
|
||||
the prior levels.
|
||||
|
||||
It also allows inter-module communication, although since that is
|
||||
dodgy, the details are left as an exercise to the reader.
|
||||
|
||||
Important: if you use this, make sure that you only reply to the
|
||||
user once, based on the $event->{'level'} field. e.g., if you
|
||||
replied when level was zero, then don't reply _again_ when it is
|
||||
set to 1. This won't be a problem if your module only returns 1
|
||||
(the default) or 0 (indicating success).
|
||||
|
||||
|
||||
*** Help($event)
|
||||
|
||||
Every module that does anything visible should provide a 'Help'
|
||||
function. This is called by the General module's 'help' command
|
||||
implementation.
|
||||
|
||||
This function should return a hashref, with each key representing a
|
||||
topic (probably a command) and each value the relevant help string.
|
||||
The '' topic is special and should contain the help string for the
|
||||
module itself.
|
||||
|
||||
|
||||
*** Initialise()
|
||||
|
||||
Called when the module is loaded.
|
||||
|
||||
No special return values.
|
||||
|
||||
|
||||
*** Schedule($event)
|
||||
|
||||
Schedule - Called after bot is set up, to set up any scheduled
|
||||
tasks. See 'schedule' in the API documentation below for information
|
||||
on how to do this.
|
||||
|
||||
No special return values. Always call inherited function!
|
||||
|
||||
|
||||
*** JoinedIRC($event)
|
||||
|
||||
Called before joining any channels (but after module is setup). This
|
||||
does not get called for dynamically installed modules.
|
||||
|
||||
No special return values. Always call inherited function!
|
||||
|
||||
|
||||
*** JoinedChannel($event, $channel)
|
||||
|
||||
Called after joining a channel for the first time, for example if
|
||||
the bot has been /invited.
|
||||
|
||||
No special return values. Always call inherited the function, as this
|
||||
is where the autojoin function is implemented.
|
||||
|
||||
|
||||
*** PartedChannel($event, $channel)
|
||||
|
||||
Called after the bot has left a channel, for example if the bot has
|
||||
been /kicked.
|
||||
|
||||
No special return values. Always call inherited the function, as this
|
||||
is where the autopart function is implemented.
|
||||
|
||||
|
||||
*** InChannel($event)
|
||||
|
||||
Called to determine if the module is 'in' the channel or not.
|
||||
Generally you will not need to override this.
|
||||
|
||||
Return 0 if the module is not enabled in the channel in which the
|
||||
event occured, non zero otherwise.
|
||||
|
||||
|
||||
*** IsBanned($event)
|
||||
|
||||
Same as InChannel(), but for determining if the user is banned or
|
||||
not.
|
||||
|
||||
Return 1 if the user that caused the event is banned from this
|
||||
module, non zero otherwise.
|
||||
|
||||
|
||||
*** Log($event)
|
||||
|
||||
Called once for most events, regardless of the result of the
|
||||
other handlers. This is the event to use if you wish to log
|
||||
everything that happens on IRC (duh).
|
||||
|
||||
No return value.
|
||||
|
||||
|
||||
*** Baffled($event, $message)
|
||||
|
||||
Called for messages prefixed by the bot's nick which we don't
|
||||
understand (i.e., that Told couldn't deal with).
|
||||
|
||||
Return 1 if you can't do anything (this is all the default
|
||||
implementation of Baffled() does).
|
||||
|
||||
|
||||
*** Told($event, $message)
|
||||
|
||||
Called for messages heard that are prefixed by the bot's nick. See
|
||||
also Baffled.
|
||||
|
||||
Return 1 if you can't do anything (this is all the default
|
||||
implementation of Told() does).
|
||||
|
||||
|
||||
*** Heard($event, $message)
|
||||
|
||||
Called for all messages not aimed directly at the bot, or those
|
||||
aimed at the bot but with no content (e.g., "bot!!!").
|
||||
|
||||
Return 1 if you can't do anything (this is all the default
|
||||
implementation of Heard() does).
|
||||
|
||||
|
||||
*** Noticed($event, $message)
|
||||
|
||||
Called for all 'notice' messages, whether aimed directly at the bot
|
||||
or not. Don't use this message to trigger responses! Doing so is a
|
||||
violation of the IRC protocol.
|
||||
|
||||
To quote RFC 1459:
|
||||
|
||||
# [...] automatic replies must never be sent in response to a NOTICE
|
||||
# message. [...] The object of this rule is to avoid loops between a
|
||||
# client automatically sending something in response to something it
|
||||
# received. This is typically used by automatons (clients with either
|
||||
# an AI or other interactive program controlling their actions) which
|
||||
# are always seen to be replying lest they end up in a loop with
|
||||
# another automaton.
|
||||
|
||||
Return 1 if you can't do anything (this is all the default
|
||||
implementation of Noticed() does).
|
||||
|
||||
|
||||
*** Felt($event, $message)
|
||||
|
||||
Called for all emotes containing bot's nick.
|
||||
|
||||
Return 1 if you can't do anything (this is all the default
|
||||
implementation of Felt() does).
|
||||
|
||||
|
||||
*** Saw($event, $message)
|
||||
|
||||
Called for all emotes except those directly at the bot.
|
||||
|
||||
Return 1 if you can't do anything (this is all the default
|
||||
implementation does).
|
||||
|
||||
|
||||
*** Invited($event, $channel)
|
||||
|
||||
Called when bot is invited into another channel.
|
||||
|
||||
Return 1 if you can't do anything (this is all the default
|
||||
implementation does).
|
||||
|
||||
|
||||
*** Kicked($event, $channel)
|
||||
|
||||
Called when bot is kicked out of a channel.
|
||||
|
||||
Return 1 if you can't do anything (this is all the default
|
||||
implementation does).
|
||||
|
||||
|
||||
*** ModeChange($event, $what, $change, $who)
|
||||
|
||||
Called when either the channel or a person has a mode flag changed.
|
||||
|
||||
Return 1 if you can't do anything (this is all the default
|
||||
implementation does).
|
||||
|
||||
|
||||
*** GotOpped($event, $channel, $who)
|
||||
|
||||
Called when the bot is opped. (Not currently implemented.)
|
||||
|
||||
Return 1 if you can't do anything (this is all the default
|
||||
implementation does).
|
||||
|
||||
|
||||
*** GotDeopped($event, $channel, $who)
|
||||
|
||||
Called when the bot is deopped. (Not currently implemented.)
|
||||
|
||||
Return 1 if you can't do anything (this is all the default
|
||||
implementation does).
|
||||
|
||||
|
||||
*** Authed($event, $who)
|
||||
|
||||
Called when someone authenticates with us. Note that you cannot
|
||||
do any channel-specific operations here since authentication is
|
||||
done directly and without any channels involved. (Of course,
|
||||
you can always do channel-wide stuff based on a channel list...)
|
||||
|
||||
Return 1 if you can't do anything (this is all the default
|
||||
implementation does).
|
||||
|
||||
|
||||
*** SpottedNickChange($event, $from, $to)
|
||||
|
||||
Called when someone changes their nick. You cannot use directSay
|
||||
here, since $event has the details of the old nick. And 'say' is
|
||||
useless since the channel is the old userhost string... This may be
|
||||
changed in a future implementation.
|
||||
|
||||
Return 1 if you can't do anything (this is all the default
|
||||
implementation does).
|
||||
|
||||
|
||||
*** SpottedTopicChange($event, $channel, $newtopic)
|
||||
|
||||
Called when the topic in a channel is changed.
|
||||
|
||||
Return 1 if you can't do anything (this is all the default
|
||||
implementation does).
|
||||
|
||||
|
||||
*** SpottedJoin($event, $channel, $who)
|
||||
|
||||
Called when someone joins a channel (including the bot).
|
||||
|
||||
Return 1 if you can't do anything (this is all the default
|
||||
implementation does).
|
||||
|
||||
|
||||
*** SpottedPart($event, $channel, $who)
|
||||
|
||||
Called when someone leaves a channel (including the bot).
|
||||
|
||||
Return 1 if you can't do anything (this is all the default
|
||||
implementation does).
|
||||
|
||||
|
||||
*** SpottedKick($event, $channel, $who)
|
||||
|
||||
Called when someone leaves a channel, um, forcibly (including the
|
||||
bot).
|
||||
|
||||
Return 1 if you can't do anything (this is all the default
|
||||
implementation does).
|
||||
|
||||
|
||||
*** SpottedQuit($event, $who, $why)
|
||||
|
||||
Called when someone leaves a server. You can't use say or directSay
|
||||
as no channel involved and the user has quit, anyway (obviously).
|
||||
This may change in future implementations (don't ask me how, please...).
|
||||
|
||||
This does not get called for the bot itself. There is no way to
|
||||
reliably detect this (the core code itself has difficulty detecting
|
||||
this case, and sometimes only detects it when it is not really in a
|
||||
position to call into the modules). You may wish to use the 'unload'
|
||||
handler or 'DESTROY' function instead.
|
||||
|
||||
Return 1 if you can't do anything (this is all the default
|
||||
implementation does).
|
||||
|
||||
|
||||
*** SpottedOpping($event, $channel, $who)
|
||||
|
||||
Called when someone is opped. (Not currently implemented.)
|
||||
|
||||
Return 1 if you can't do anything (this is all the default
|
||||
implementation does).
|
||||
|
||||
|
||||
*** SpottedDeopping($event, $channel, $who)
|
||||
|
||||
Called when someone is... deopped, maybe? (Not currently implemented.)
|
||||
|
||||
Return 1 if you can't do anything (this is all the default
|
||||
implementation does).
|
||||
|
||||
|
||||
*** CTCPPing($event, $who, $what)
|
||||
|
||||
Called when the bot receives a CTCP ping.
|
||||
|
||||
Return 1 if you can't do anything (this is all the default
|
||||
implementation does).
|
||||
|
||||
|
||||
*** CTCPVerson($event, $who, $what)
|
||||
|
||||
Called when the bot receives a CTCP verson.
|
||||
|
||||
Return 1 if you can't do anything (this is all the default
|
||||
implementation does).
|
||||
|
||||
|
||||
*** CTCPSource($event, $who, $what)
|
||||
|
||||
Called when the bot receives a CTCP source.
|
||||
|
||||
Return 1 if you can't do anything (this is all the default
|
||||
implementation does).
|
||||
|
||||
|
||||
*** Scheduled($event, @data)
|
||||
|
||||
Called when a scheduled timer triggers. (See 'schedule' in the next
|
||||
section to see how to schedule stuff.) By default, if the first
|
||||
element of the @data array is a coderef, then the coderef is called
|
||||
with ($event,@data) as the arguments. Otherwise, 'debug' is called
|
||||
(see below).
|
||||
|
||||
No special return values. Always call inherited function if you
|
||||
cannot handle the scheduled event yourself.
|
||||
|
||||
|
||||
*** GotURI($event, $uri, $contents, @data)
|
||||
|
||||
Called when a requested URI has been downloaded. $contents contains
|
||||
the actual contents of the file. See getURI().
|
||||
|
||||
No special return values.
|
||||
|
||||
|
||||
*** ChildCompleted($event, $type, $output, @data)
|
||||
|
||||
Called when a spawned child has completed. $output contains
|
||||
the output of the process. $type contains the child type as
|
||||
given to the spawnChild() API function (which see).
|
||||
|
||||
No special return values. Always call the inherited function if
|
||||
you cannot handle the given '$type'!
|
||||
|
||||
|
||||
*** DataAvailable($event, $handle, $data, $closed)
|
||||
|
||||
Called when $handle has data available. See registerDataHandle().
|
||||
$data is the string that was read from the handle. Don't perform
|
||||
blocking read I/O on $handle, since all the data that was available
|
||||
has been read. (The handle is only returned because it is expected
|
||||
you will use that as a key to work out who is talking to you.)
|
||||
The $closed argument will be set to true if the handle is now closed.
|
||||
|
||||
No special return values. Make sure to call the inherited function if
|
||||
you did not expect to see data on the specified $handle.
|
||||
|
||||
|
||||
*** RegisterConfig()
|
||||
|
||||
Called when initialised, should call registerVariables(), which see
|
||||
below.
|
||||
|
||||
No special return values. Always call inherited function!
|
||||
|
||||
|
||||
*** Set($event, $variable, $value)
|
||||
|
||||
Called to set a variable to a particular value.
|
||||
|
||||
Should return one of the following:
|
||||
-1 - silent success (caller should not report back to user)
|
||||
0 - success
|
||||
1 - can't set variable because it is of type ref($module->{$variable})
|
||||
2 - variable not found or not writable (if $module->{$variable})
|
||||
3 - variable is list and wrong format was used
|
||||
4 - variable is hash and wrong format was used
|
||||
9 - unknown error
|
||||
|
||||
Note that error codes 1-4 are probably too specific to the default
|
||||
'Set' function to be of any use. Reporting your own error messages
|
||||
is fine.
|
||||
|
||||
Always call inherited function if you cannot set the variable yourself!
|
||||
|
||||
|
||||
*** Get($event, $variable)
|
||||
|
||||
Called to get a particular variable.
|
||||
|
||||
Should return the value of the variable. Default returns the value
|
||||
of $self->{$variable}.
|
||||
|
||||
Always call inherited function if you cannot get the variable yourself!
|
||||
|
||||
|
||||
*** Unload()
|
||||
|
||||
Called when the module is unloaded. However, this is not always
|
||||
reliably called when the module is unloaded immediately prior to the
|
||||
bot shutting down or branching to a different process.
|
||||
|
||||
In general, relying on this function is poor design. It should only
|
||||
really be used for things like untie-ing from hashes or disconnecting
|
||||
from databases, where the code executing is not critical, merely good
|
||||
manners or helpful.
|
||||
|
||||
No special return values. You are encouraged not to use this method.
|
||||
It is documented for completeness only.
|
||||
|
||||
Default implementation does nothing.
|
||||
|
||||
|
||||
|
||||
The $event variable is a hash with the following keys:
|
||||
|
||||
'bot' => the IRC bot object - DO NOT USE THIS!!! [1]
|
||||
'channel' => the channel the event occured in, or '' if n/a [2]
|
||||
'from' => the nick of the person who created the event, if any
|
||||
'target' => the target of the 'say' function (channel || from)
|
||||
'user' => the userhost of the event
|
||||
'data' => the main data of the event
|
||||
'fulldata' => the data of the event before it got mangled [3]
|
||||
'to' => the target of the event
|
||||
'subtype' => the IRC module's idea of what the event was [1]
|
||||
'maintype' => the name of the first handler called (eg. 'Told')
|
||||
'level' => the number of times the handler has been called in a row
|
||||
'userName' => the name of the user as they authenticated
|
||||
'userFlags' => used internally for the implementation of isAdmin() [1]
|
||||
'nick' => the nick of the bot
|
||||
'time' => the value of time() when the event was constructed [4]
|
||||
|
||||
It is passed to most functions, as the first parameter. Modify at your
|
||||
own risk! ;-) If you do write to this hash at all, ensure that you make
|
||||
a 'local' copy first. See the 'Parrot' module for an example of safely
|
||||
modifying the $event hash. Note that some of these fields may be
|
||||
inaccurate at times, due to peculiarities of the IRC protocol.
|
||||
|
||||
[1]: These fields are dependent on the underlying implementation, so
|
||||
if you use them then your modules will not be compatible with any other
|
||||
implementations that use the same API. The 'bot' field in particular is
|
||||
a blessed reference to a Net::IRC::Connection object in this
|
||||
implementation, and is passed around so that the API functions know
|
||||
what to operate on. However, in a POE implementation it could be
|
||||
something totally different, maybe even undef. There are some other
|
||||
fields in the $event hash that start with an underscore (in particular
|
||||
there is '_event'). Do not even _think_ about using those. Using them
|
||||
is akin to hard-coding the ionode of the 'ls' program into your source
|
||||
so that you can read directories by branching to a disk address.
|
||||
|
||||
[2]: The 'channel' field is ALWAYS lowercase. You should always lowercase
|
||||
any channel names you get from users before using them in comparisons or
|
||||
hash lookups.
|
||||
|
||||
[3]: This is the same as the 'data' slot except for Told and Baffled
|
||||
events where it also contains the prefix that was stripped.
|
||||
|
||||
[4]: Use this instead of calling time() so as to avoid time drift when
|
||||
comparing times at various points.
|
||||
|
||||
|
||||
Module API
|
||||
----------
|
||||
|
||||
This section contains the names and descriptions of the functions
|
||||
that your module can call. While you can override these, it is not
|
||||
recommended.
|
||||
|
||||
*** debug(@messages)
|
||||
|
||||
Outputs each item in @messages to the console (or the log file if
|
||||
the bot has lost its controlling tty).
|
||||
|
||||
Example:
|
||||
$self->debug('about to fetch listing from FTP...');
|
||||
|
||||
|
||||
*** saveConfig()
|
||||
|
||||
Saves the state of the module's registered variables to the
|
||||
configuration file. This should be called when the variables have
|
||||
changed.
|
||||
|
||||
Example:
|
||||
$self->saveConfig(); # save our state!
|
||||
|
||||
|
||||
*** registerVariables( [ $name, $persistent, $settable, $value ] )
|
||||
|
||||
Registers variables (duh). It actually takes a list of arrayrefs.
|
||||
The first item in each arrayref is the name to use (the name of the
|
||||
variable in the blessed hashref that is the module's object, i.e.
|
||||
$self). The second controls if the variable is saved when
|
||||
saveConfig() is called. If it is set to 1 then the variable is
|
||||
saved, if 0 then it is not, and if undef then the current setting is
|
||||
not changed. Similarly, the third item controls whether or not the
|
||||
variable can be set using the 'vars' command (in the Admin
|
||||
module). 1 = yes, 0 = no, undef = leave unchanged. The fourth value,
|
||||
if defined, is used to set the variable. See the Initialise
|
||||
function's entry for more details.
|
||||
|
||||
Example:
|
||||
$self->registerVariables(
|
||||
[ 'ftpDelay', 1, 1, 60 ],
|
||||
[ 'ftpSite', 1, 1, 'ftp.mozilla.org' ],
|
||||
);
|
||||
|
||||
Only simple scalars, references to arrays of scalars, and references
|
||||
to hashes of scalars, can be stored in registered variables.
|
||||
|
||||
|
||||
*** schedule($event, $time, $times, @data)
|
||||
|
||||
Schedules one or more events. $event is the usual event hash. $time
|
||||
is the number of seconds to wait. It can be a scalarref to a
|
||||
variable that contains this number, too, in which case it is
|
||||
dereferenced. This comes in useful for making the frequency of
|
||||
repeating events customisable. $times is the number of times to
|
||||
perform the event, which can also be -1 meaning 'forever'. @data
|
||||
(the remainder of the parameters) will be passed, untouched, to the
|
||||
event handler, Scheduled. See the previous section.
|
||||
|
||||
Example:
|
||||
$self->schedule($event, \$self->{'ftpDelay'}, -1, 'ftp', \$ftpsite);
|
||||
|
||||
|
||||
*** getURI($event, $uri, @data)
|
||||
|
||||
Gets a URI in the background then calls GotURI (which see, above).
|
||||
|
||||
Example:
|
||||
$self->getURI($event, $ftpsite, 'ftp');
|
||||
|
||||
|
||||
*** spawnChild($event, $command, $arguments, $type, $data)
|
||||
|
||||
Spawns a child in the background then calls ChildCompleted (which see,
|
||||
above). $arguments and $data are array refs! $command is either a
|
||||
command name (e.g., 'wget', 'ls') or a CODEREF. If it is a CODEREF,
|
||||
then you will be wanting to make sure that the first argument is
|
||||
the object reference, unless we are talking inlined code or something...
|
||||
|
||||
Example:
|
||||
$self->spawnChild($event, '/usr/games/fortune', ['-s', '-o'],
|
||||
'fortune', [@data]);
|
||||
|
||||
|
||||
*** registerDataHandle($event, $handle)
|
||||
|
||||
Adds $handle to the list of file handles and sockets to watch. When
|
||||
data is available on that socket, DataAvailable() will be called.
|
||||
|
||||
|
||||
*** getModule($name)
|
||||
|
||||
Returns a reference to the module with the given name. In general you
|
||||
should not need to use this, but if you write a management module, for
|
||||
instance, then this could be useful. See God.bm for an example of this.
|
||||
|
||||
IT IS VITAL THAT YOU DO NOT KEEP THE REFERENCE
|
||||
THAT THIS FUNCTION RETURNS!!!
|
||||
|
||||
If you did so, the module would not get garbage collected if it ever
|
||||
got unloaded or some such.
|
||||
|
||||
Example:
|
||||
my $module = $self->getModule('Admin');
|
||||
push(@{$module->{'files'}}, 'BotModules/SupportFile.pm');
|
||||
|
||||
|
||||
*** getModules()
|
||||
|
||||
Returns the list of module names that are loaded, in alphabetical
|
||||
order, which you can then use with getModule().
|
||||
|
||||
Example:
|
||||
my @modulenames = $self->getModules();
|
||||
local $" = ', ';
|
||||
$self->ctcpReply($event, 'VERSION', "mozbot $VERSION (@modulenames)");
|
||||
|
||||
|
||||
*** getMessageQueue()
|
||||
|
||||
Returns a reference to the message queue. Manipulating this is
|
||||
probably not a good idea. In particular, don't add anything to this
|
||||
array, use the say(), directSay(), channelSay(), announce(),
|
||||
tellAdmin(), etc, methods defined below.
|
||||
|
||||
Each item in this array is an array ref, consisting of three
|
||||
subitems. The first subitem is a scalar with the name of the channel
|
||||
or nick targetted, the second is the message to send, and the third
|
||||
is a scalar equal to one of: 'msg', 'me', 'notice', 'ctcpSend',
|
||||
'ctcpReply'. The second subitem is a scalar, except in the case of
|
||||
'ctcpSend' messages, in which case it's an array ref consisting of
|
||||
first the type of the CTCP message, and then the data.
|
||||
|
||||
Note: Don't use 'delete' to remove items from this array, since that
|
||||
leaves undefs in the array, which will later cause a crash.
|
||||
|
||||
Example:
|
||||
my $queue = $self->getMessageQueue();
|
||||
foreach my $message (@$queue) {
|
||||
++$count if $message->[0] eq $event->{'from'};
|
||||
}
|
||||
|
||||
|
||||
*** getHelpLine()
|
||||
|
||||
Returns the bot's help line.
|
||||
|
||||
Example:
|
||||
$self->say($event, $self->getHelpLine());
|
||||
|
||||
|
||||
*** getLogFilename($name)
|
||||
|
||||
Returns a filename (with path) appropriate to use for logging. $name
|
||||
should be the filename wanted, without a path.
|
||||
|
||||
Example:
|
||||
my $logName = $self->getLogFilename("$channel.log");
|
||||
if (open(LOG, ">>$logName")) {
|
||||
print LOG $data;
|
||||
close LOG;
|
||||
} else {
|
||||
# XXX error handling
|
||||
}
|
||||
|
||||
|
||||
*** unescapeXML($xml)
|
||||
|
||||
Performs the following conversions on the argument and returns the result:
|
||||
' => '
|
||||
" => "
|
||||
< => <
|
||||
> => >
|
||||
& => &
|
||||
|
||||
Example:
|
||||
my $text = $self->unescapeXML($output);
|
||||
|
||||
|
||||
*** tellAdmin($event, $data);
|
||||
|
||||
Tries to tell an administrator $data. As currently implemented, only
|
||||
one administrator will get the message, and there is no guarentee
|
||||
that they will read it or even that the admin in question is
|
||||
actually on IRC at the time.
|
||||
|
||||
Example:
|
||||
$self->tellAdmin($event, 'Someone just tried to crack me...');
|
||||
|
||||
|
||||
*** say($event, $data)
|
||||
|
||||
Says $data in whatever channel the event was spotted in (this can be
|
||||
/msg if that is how the event occured).
|
||||
|
||||
Example:
|
||||
$self->say($event, 'Yo, dude.');
|
||||
|
||||
|
||||
*** announce($event, $data)
|
||||
|
||||
Says $data in all the channels the module is in.
|
||||
|
||||
Example:
|
||||
$self->announce($event, 'Bugzilla is back up.');
|
||||
|
||||
|
||||
*** directSay($event, $data)
|
||||
|
||||
Sends a message directly to the cause of the last event (i.e., like
|
||||
/msg). It is recommended to use 'say' normally, so that users have a
|
||||
choice of whether or not to get the answer in the channel (they
|
||||
would say their command there) or not (they would /msg their
|
||||
command).
|
||||
|
||||
Example:
|
||||
$self->directSay($event, 'Actually, that\'s not right.');
|
||||
|
||||
|
||||
*** channelSay($event, $data)
|
||||
|
||||
Sends a message to the channel in which the message was given.
|
||||
If the original command was sent in a /msg, then this will result
|
||||
in precisely nothing. Useful in conjunction with directSay() to
|
||||
make it clear that a reply was sent privately.
|
||||
|
||||
Example:
|
||||
$self->directSay($event, $veryLongReply);
|
||||
$self->channelSay($event, "$event->{'from'}: data /msg'ed");
|
||||
|
||||
|
||||
*** emote($event, $what)
|
||||
*** directEmote($event, $what)
|
||||
|
||||
Same as say() and directSay(), but do the equivalent of /me instead.
|
||||
|
||||
Examples:
|
||||
$self->emote($event, "slaps $event->{'from'} with a big smelly trout.");
|
||||
$self->directEmote($event, "waves.");
|
||||
|
||||
|
||||
*** sayOrEmote($event, $what)
|
||||
*** directSayOrEmote($event, $what)
|
||||
|
||||
Call say (directSay) or emote (directEmote) based on the contents of $what.
|
||||
If $what starts with '/me' then the relevant emote variation is called,
|
||||
otherwise the say variations are used. The leading '/me' is trimmed before
|
||||
being passed on.
|
||||
|
||||
Examples:
|
||||
$self->sayOrEmote($event, $greeting);
|
||||
$self->directSayOrEmote($event, $privateMessage);
|
||||
|
||||
|
||||
*** ctcpSend($event, $type, $data)
|
||||
|
||||
Same as say() but for sending CTCP messages.
|
||||
|
||||
Examples:
|
||||
$self->ctcpSend($event, 'PING', $event->{'time'});
|
||||
|
||||
|
||||
*** ctcpReply($event, $type, $data)
|
||||
|
||||
Same as ctcpSend() but for sending CTCP replies.
|
||||
|
||||
Examples:
|
||||
$self->ctcpReply($event, 'VERSION', "Version $major.$minor");
|
||||
|
||||
|
||||
*** notice($event, $data)
|
||||
|
||||
Sends a notice containing $data to whatever channel the event was
|
||||
spotted in (this can be /msg if that is how the event occured).
|
||||
|
||||
Example:
|
||||
foreach (@{$self->{'channels'}}) {
|
||||
local $event->{'target'} = $_;
|
||||
$self->notice($event, 'This is a test of the emergency announcement system.');
|
||||
}
|
||||
|
||||
|
||||
*** isAdmin($event)
|
||||
|
||||
Returns true if the cause of the event was an authenticated administrator.
|
||||
|
||||
Example:
|
||||
if ($self->isAdmin($event)) { ... }
|
||||
|
||||
|
||||
*** setAway($event, $message)
|
||||
|
||||
Set the bot's 'away' flag. A blank message will mark the bot as
|
||||
back. Note: If you need this you are doing something wrong!!!
|
||||
Remember that you should not be doing any lengthy processes since if
|
||||
you are away for any length of time, the bot will be disconnected!
|
||||
|
||||
Also note that in 2.0 this is not throttled, so DO NOT call this
|
||||
repeatedly, or put yourself in any position where you allow IRC
|
||||
users to cause your module to call this. Otherwise, you open
|
||||
yourself to denial of service attacks.
|
||||
|
||||
Finally, note that calling 'do', 'emote', 'say', and all the
|
||||
related functions will also reset the 'away' flag.
|
||||
|
||||
Example:
|
||||
$self->setAway($event, 'brb...');
|
||||
|
||||
|
||||
*** setNick($event, $nick)
|
||||
|
||||
Set the bot's nick. This handles all the changing of the internal
|
||||
state variables and saving the configuration and everything.
|
||||
It will also add the nick to the list of nicks to try when
|
||||
the bot finds its nick is already in use.
|
||||
|
||||
Note that in 2.0 this is not throttled, so DO NOT call this
|
||||
repeatedly, or put yourself in any position where you allow IRC
|
||||
users to cause your module to call this. Otherwise, you open
|
||||
yourself to denial of service attacks.
|
||||
|
||||
Example:
|
||||
$self->setNick($event, 'zippy');
|
||||
|
||||
|
||||
*** mode($event, $channel, $mode, $argument)
|
||||
|
||||
Changes a mode of channel $channel.
|
||||
|
||||
Example:
|
||||
$self->mode($event, $event->{'channel'}, '+o', 'Hixie');
|
||||
|
||||
|
||||
*** invite($event, $who, $channel)
|
||||
|
||||
Invite $who to channel $channel. This can be used for intrabot
|
||||
control, or to get people into a +i channel, for instance.
|
||||
|
||||
Example:
|
||||
$self->invite($event, 'Hixie', '#privateChannel');
|
||||
|
||||
|
||||
*** prettyPrint($preferredLineLength, $prefix, $indent, $divider, @input)
|
||||
|
||||
Takes @input, and resorts it so that the lines are of roughly the same
|
||||
length, aiming optimally at $preferredLineLength, prefixing each line
|
||||
with $indent, placing $divider between each item in @input if they
|
||||
appear on the same line, and sticking $prefix at the start of it all on
|
||||
the first line. The $prefix may be undef.
|
||||
|
||||
Returns the result of all that.
|
||||
|
||||
This is what the 'help' command uses to pretty print its output.
|
||||
|
||||
This is basically the same as wordWrap() but it can change the order
|
||||
of the input.
|
||||
|
||||
Example:
|
||||
my @result = $self->prettyPrint($linelength, undef, 'Info: ', ' -- ', @infoItems);
|
||||
|
||||
|
||||
*** wordWrap($preferredLineLength, $prefix, $indent, $divider, @input)
|
||||
|
||||
Takes @input, and places each item sequentially on lines, aiming optimally
|
||||
at $preferredLineLength, prefixing each line with $indent, placing $divider
|
||||
between each item in @input if they appear on the same line, and sticking
|
||||
$prefix at the start of it all on the first line, without ever cutting
|
||||
items across lines. The $prefix may be undef.
|
||||
|
||||
Returns the result of all that.
|
||||
|
||||
This is basically the same as prettyPrint() but it doesn't change the
|
||||
order of the input.
|
||||
|
||||
Example:
|
||||
my @result = $self->wordWrap($linelength, undef, 'Info: ', ' ', split(/\s+/os, @lines);
|
||||
|
||||
|
||||
*** days($time)
|
||||
|
||||
Returns a string describing the length of time between $time and now.
|
||||
|
||||
Example:
|
||||
$self->debug('uptime: '.$self->days($^T));
|
||||
|
||||
|
||||
*** sanitizeRegexp($regexp)
|
||||
|
||||
Checks to see if $regexp is a valid regular expression. If it is, returns
|
||||
the argument unchanged. Otherwise, returns quotemeta($regexp), which should
|
||||
be safe to use in regular expressions as a plain text search string.
|
||||
|
||||
Do not add prefixes or suffixes to the pattern after sanitizing it.
|
||||
|
||||
Example:
|
||||
$pattern = $self->sanitizeRegexp($pattern);
|
||||
$data =~ /$pattern//gsi;
|
||||
|
||||
|
||||
-- end --
|
||||
@@ -1,443 +0,0 @@
|
||||
_ _
|
||||
m o z i l l a |.| o r g | |
|
||||
_ __ ___ ___ ___| |__ ___ | |_
|
||||
| '_ ` _ \ / _ \_ / '_ \ / _ \| __|
|
||||
| | | | | | (_) / /| |_) | (_) | |_
|
||||
|_| |_| |_|\___/___|_.__/ \___/ \__|
|
||||
====================================
|
||||
|
||||
|
||||
INSTALLATION
|
||||
------------
|
||||
|
||||
You will need the following programs and libraries to run mozbot2:
|
||||
|
||||
perl
|
||||
wget
|
||||
Net::IRC
|
||||
Net::SMTP
|
||||
IO::Select
|
||||
IO::Pipe
|
||||
|
||||
These packages may have additional requirements of their own.
|
||||
|
||||
In order to do anything useful with mozbot2, you will need some Bot
|
||||
Modules. Several are included in this distribution, and they may have
|
||||
requirements above and beyond those given above.
|
||||
|
||||
Once you have set up all the packages on which mozbot2 depends, make
|
||||
mozbot.pl executable:
|
||||
|
||||
chmod +x mozbot.pl
|
||||
|
||||
This is needed since mozbot2 will occasionally attempt to restart
|
||||
itself (e.g. if its source code is changed).
|
||||
|
||||
Then, simply run mozbot.pl:
|
||||
|
||||
./mozbot.pl
|
||||
|
||||
Currently, you MUST run mozbot from the directory in which mozbot.pl
|
||||
is placed. This may be changed in a future version.
|
||||
|
||||
|
||||
SECURITY
|
||||
--------
|
||||
|
||||
Since mozbot interacts with the outside world, do not run it as a
|
||||
privileged user!!!
|
||||
|
||||
In addition, since mozbot calls external programs (currently perl and
|
||||
wget, possibly others in future versions) make sure that none of the
|
||||
directories on your path are writable by untrusted users! (e.g., do
|
||||
not put /tmp into your path!)
|
||||
|
||||
Make sure that '.' is not in your path! This is a security risk in a
|
||||
situation like this, and perl will rightly refuse to execute external
|
||||
programs (like wget, used to get remote URIs for many functions) if
|
||||
'.' is on your path.
|
||||
|
||||
Do not run the bot straight into a public channel on the first run!
|
||||
|
||||
One important reason not to load the bot straight into a public
|
||||
channel on the first run is that until it has been properly
|
||||
configured, it will have a well defined username and password to
|
||||
access all its admin functions. Thus a malicious user could hijack the
|
||||
bot the moment it joined the channel.
|
||||
|
||||
If this is a serious problem for you (e.g., your users are of a
|
||||
particularly high calibre and are doing regular polls of the /who
|
||||
command to see if any bots join) then use another server, such as one
|
||||
that you control, on localhost!
|
||||
|
||||
See the "Administration" section for instructions on how to change the
|
||||
administration password (important!).
|
||||
|
||||
Note: Passwords are printed in clear text on the console and in the
|
||||
log files. Secure them accordingly. Of course, IRC is an inherently
|
||||
insecure protocol anyway, and any machine between your IRC client's
|
||||
and your bot's, going through the IRC network's servers, will have
|
||||
access to the passwords. For this reason, change them often, and don't
|
||||
use passwords that you use for important things here.
|
||||
|
||||
The default setting is for mozbot to run with taint checking
|
||||
enabled. I *STRONGLY* recommend not changing this.
|
||||
|
||||
|
||||
CONFIGURATION
|
||||
-------------
|
||||
|
||||
When you start up mozbot for the first time, it will prompt you for
|
||||
the following information:
|
||||
|
||||
1. IRC server.
|
||||
What machine you want the bot to connect to. At the moment,
|
||||
mozbot only supports connecting to a single server at a time. It
|
||||
would require a *significant* amount of work to change this.
|
||||
|
||||
2. Port.
|
||||
What port to connect to on the IRC server. Typically, this will
|
||||
be 6667 or therabouts.
|
||||
|
||||
3. Password.
|
||||
If your server has a password, enter it here. If there isn't one
|
||||
(and this is almost certainly the case) then just hit enter.
|
||||
|
||||
4. Channels.
|
||||
What channels the bot should initially connect to. It is
|
||||
recommended that this just be a bot channel or a test channel,
|
||||
for example #mozbot, since running a bot for the first time
|
||||
before it is known to be ready is a bad idea. You can enter more
|
||||
than one channel, just hit enter after each one (leave a blank
|
||||
line when you have finished). (To make mozbot join a keyed
|
||||
channel, you must first add the channel's key to the
|
||||
'channelKeys' variable. To do this, the bot will have to be on
|
||||
IRC first, so don't worry about it for now.)
|
||||
|
||||
5. Your e-mail address.
|
||||
In case of great difficulties, mozbot may try to e-mail you. If
|
||||
this happens, it will use the e-mail address you gave here. This
|
||||
only happens if (a) it absolutely cannot connect to the server
|
||||
you gave it, or (b) it cannot find a nick that is not in use.
|
||||
|
||||
6. SMTP server.
|
||||
The name of the SMTP server it should try to talk with in order
|
||||
to send you mail. If you type in an invalid server name, it will
|
||||
just fail to send mail and instead will complain bitterly to its
|
||||
console.
|
||||
|
||||
7. Nicks.
|
||||
Some nicks for IRC. For example, 'mozbot'. It is customary to
|
||||
clearly mark the bot as being non-human, for example by putting
|
||||
'bot' in the name. You should enter several possibilities
|
||||
here. Hit enter after each one. Leave a blank line to finish.
|
||||
|
||||
Once the bot is running, there are many other things that can be
|
||||
configured with it. See "variables".
|
||||
|
||||
Note. The bot will treat all channel names as lowercase to avoid case
|
||||
sensitivity issues.
|
||||
|
||||
|
||||
LOGGING
|
||||
-------
|
||||
|
||||
Normally, mozbot will output its complaints to the console
|
||||
(stdout). If you run mozbot in an xterm or screen session, you can
|
||||
therefore easily keep track of what is going on.
|
||||
|
||||
It will also continuously log output to ~/logs/$0.$$.log, where $0 is
|
||||
the file name and $$ is the PID. You may wish to set up a cron job to
|
||||
prune this file on a regular basis, it gets LARGE. However, it can
|
||||
sometimes be the only way to track down how your system was
|
||||
compromised if it turns out that mozbot has a security flaw.
|
||||
|
||||
Control over the logging is currently not available. This may change
|
||||
in future versions.
|
||||
|
||||
Note that when the bot forks and then outputs a message, which happens
|
||||
occasionally, it will therefore use a new log file for the forked
|
||||
process. This should only happen when something bad happens,
|
||||
e.g. something forces the bot to restart or the bot forks and then the
|
||||
child enters a bad state.
|
||||
|
||||
Note. Authentication passwords will be displayed in cleartext on the
|
||||
console and in the log files.
|
||||
|
||||
|
||||
ADMINISTRATION
|
||||
--------------
|
||||
|
||||
Once the bot is active and on the IRC server, it starts to listen to
|
||||
all messages seen on any channels on which it is present, and all
|
||||
messages sent to it using /msg.
|
||||
|
||||
Your first task should be to change the admin password. To do this,
|
||||
authenticate yourself using the "auth" command. The default username
|
||||
is "admin", and the default password is "password". If the bot is
|
||||
called "mozbot", then the command to authenticate would be as follows:
|
||||
|
||||
/msg mozbot auth admin password
|
||||
|
||||
The bot should respond with "Hi admin!".
|
||||
|
||||
Now create yourself an account by adding a username/password pair to
|
||||
the bot. You do this with the "newuser" command. Next, you should
|
||||
bless this new user, making it a bot administrator. This is done using
|
||||
these commands:
|
||||
|
||||
/msg mozbot newuser <username> <password> <password>
|
||||
/msg mozbot bless <username>
|
||||
|
||||
Now authenticate yourself again, as the new user:
|
||||
|
||||
/msg mozbot auth <username> <password>
|
||||
|
||||
The moment you authenticate as the new admin, the default admin
|
||||
account is deleted.
|
||||
|
||||
You are now in a position to add the modules you want and to put the
|
||||
bot in the channels you want it in.
|
||||
|
||||
To load modules is easy.
|
||||
|
||||
/msg mozbot load module
|
||||
|
||||
...where "module" is a module name, such as "HelloWorld" (note that
|
||||
the ".bm" extension is not included). By default, the General,
|
||||
Greeting, Infobot and Parrot modules are loaded. The General module
|
||||
provides the 'help' command and responds to CTCP VERSION messages. The
|
||||
Greeting module responds to greetings and generally tries to be
|
||||
friendly. The Infobot module provides information storage and
|
||||
retrieval functions. The Parrot module lets an admin control the bot
|
||||
much like a puppet.
|
||||
|
||||
By default, modules will be enabled in all channels. See the
|
||||
"variables" section below to change this.
|
||||
|
||||
|
||||
HINTS
|
||||
-----
|
||||
|
||||
If the bot goes mad and starts flooding a channel -- e.g., if someone
|
||||
keeps asking it for information -- then authenticate and then send it
|
||||
the following message:
|
||||
|
||||
/msg mozbot shutup please
|
||||
|
||||
It should respond within a few seconds. You can authenticate while it
|
||||
is speaking, that's not a problem.
|
||||
|
||||
|
||||
VARIABLES
|
||||
---------
|
||||
|
||||
For information on changing variables on the fly, use the "vars"
|
||||
command:
|
||||
|
||||
/msg mozbot vars
|
||||
|
||||
Each module has several variables that you can change. You can see
|
||||
what they are by typing:
|
||||
|
||||
/msg mozbot vars module
|
||||
|
||||
...where module is the module in question. These always include
|
||||
"Admin" and "General". Admin provides the commands such as "auth",
|
||||
"newuser", "password", and provides additional commands to admins,
|
||||
such as "shutdown", "cycle", "leave", "restart", and so on. "General"
|
||||
provides the "help" command to everyone.
|
||||
|
||||
The main variables are:
|
||||
|
||||
channels -- which channels the module should listen in, and which
|
||||
channels the module should send announcements to. Must be in
|
||||
lowercase!
|
||||
|
||||
channelKeys -- a mapping of (lowercase) channel names to keys. It
|
||||
is assumed that any channel without an entry in this variable has
|
||||
no key. For example, to tell mozbot that the key for channel
|
||||
#channel is 'password', you would use:
|
||||
|
||||
/msg mozbot vars Admin channelKeys '+|#channel|password'
|
||||
|
||||
autojoin -- whether (1) or not (0) the module should automatically
|
||||
add a new channel to its "channels" list when the bot joins a new
|
||||
channel. If this is not enabled, then you will have to add new
|
||||
channels to the "channels" list of this module each time.
|
||||
|
||||
channelsBlocked -- channels that will not be autojoined, so if a
|
||||
module has been disabled, it won't rejoin the channel if the bot is
|
||||
kicked then reinvited.
|
||||
|
||||
denyusers -- user@host regexp masks of users that should be
|
||||
completely ignored (for this module). The regexp will be placed
|
||||
between "^" and "$" modifiers, so do not include them, and *do*
|
||||
include everything required to make the whole user@host mask match.
|
||||
|
||||
allowusers -- identical in usage to denyusers, but checked first to
|
||||
override it. So to give access to everyone but a few people, leave
|
||||
allowusers blank and add some masks to denyusers, but to give
|
||||
access to only a few people, add their user@host masks to
|
||||
allowusers, and add ".*" to denyusers.
|
||||
|
||||
In addition, other modules may have extra variables.
|
||||
|
||||
The admin variable has quite a few variables, including all those that
|
||||
are prompted for during initial startup. The interesting ones are:
|
||||
|
||||
currentnick -- the nick. This can be changed on the fly.
|
||||
|
||||
server, port, password -- the server and port to connect to, and
|
||||
the server password to use. If you change these and then cycle the
|
||||
bot (/msg mozbot cycle) then the bot will change servers without
|
||||
shutting down.
|
||||
|
||||
localAddr -- if you don't seem to be able to establish a
|
||||
connection, but it works fine with other software, then you should
|
||||
try setting the localAddr variable to your IP address. Technically,
|
||||
this variable sets which interface to use to form the outgoing
|
||||
connection. (This is to work around a limitation of Net::IRC.)
|
||||
Typically you would set this variable directly in the configuration
|
||||
file, by adding a line that says "localAddr=10.11.12.13" or
|
||||
whatever your IP address is.
|
||||
|
||||
simpleIRCNameServer -- if the value of this variable equals the
|
||||
name of the server, then the IRC Name sent to the server will be
|
||||
simplified so that it doesn't include the URI of the mozbot help
|
||||
files. This is usually dealt with automatically, but if you are
|
||||
having troubles connecting, you could try setting it. (It is set to
|
||||
the name of the server so that if you change servers, by default
|
||||
mozbot will use a complete IRC Name again.)
|
||||
|
||||
username -- if this variable has a true value, then the bot will
|
||||
use its value as its IRC username. By default, the bot uses
|
||||
"pid-1234" as the username, where "1234" is the bot's process ID.
|
||||
This can cause problems on networks or with BNCs that require a
|
||||
valid and accurate ident, in which case this variable can provide a
|
||||
solution. (You can also set this variable by entering
|
||||
"username=blah" into the configuration file, where blah is the
|
||||
username you want to use.)
|
||||
|
||||
channels -- unlike other modules, the channels variable for the
|
||||
Admin module actually controls which channels the bot itself
|
||||
appears in. The preferred method for controlling this is using
|
||||
/invite and /kick or "join" and "part", though (since editing the
|
||||
list directly will probably require a cycle of the bot to take
|
||||
effect).
|
||||
|
||||
admins -- the administrators. See "Administration" above.
|
||||
|
||||
allowInviting -- this controls whether the /invite IRC command will
|
||||
be obeyed or not.
|
||||
|
||||
allowChannelAdmin -- this controls whether or not the bot will
|
||||
accept admin commands that are given in a channel or not. In any
|
||||
case, the "auth" command is never accepted in a channel.
|
||||
|
||||
files -- this is a list of files whose timestamps are monitored to
|
||||
decide if the source code has changed. If it is established that
|
||||
any of these files have changed while the bot is running, then the
|
||||
bot will shutdown and restart itself. Modules are dealt with
|
||||
separately, and need not be listed here. (And when modules change,
|
||||
the whole bot is not restarted, only the module.)
|
||||
|
||||
sourceCodeCheckDelay -- number of seconds between checks of the bot
|
||||
and module sources. Note that changes will only take effect after
|
||||
the previous timer has passed, so changing it from 3600 (an hour)
|
||||
to 10 (10 seconds) may not be of much immediate use. In these
|
||||
cases, setting the variable to the new value then cycling the bot
|
||||
is a good plan.
|
||||
|
||||
ignoredUsers -- a list of regular expressions that are matched
|
||||
against the user@host strings of everything that is said. If a user
|
||||
matches one of the entires in this list, then that user will be
|
||||
completely ignored. (^ and $ symbols are implied at the start and
|
||||
end of this regular expression.) Use this sparingly. It will stop
|
||||
the user's statements from having _any_ effect on the bot,
|
||||
including in any statistic-collecting modules, etc. If you just
|
||||
want to block a user from certain modules, add a regular expression
|
||||
to the 'denyusers' variable of those modules.
|
||||
Example:
|
||||
>mozbot< vars Admin ignoredUsers '+root@.*'
|
||||
*** moron (root@example.org) has joined #mozbot
|
||||
<moron> mozbot: help
|
||||
* you watch the tumbleweed roll on by
|
||||
|
||||
ignoredTargets -- when someone says something to someone who
|
||||
matches one of the regular expressions in this list, the line will
|
||||
be ignored as if the person saying it was banned with ignoreUsers.
|
||||
This is useful when you have other bots in the channel, and don't
|
||||
want the mozbot to respond in place of the other bots (e.g. with an
|
||||
auto-helping Infobot module). Note: It is safe to user a regular
|
||||
expression that matches the mozbot bot's name; it will always
|
||||
respond to messages to itself (as well as messages that are sent
|
||||
via /msg) irrespective of this setting.
|
||||
Example:
|
||||
<user> foobot: what is green?
|
||||
<foobot> user: green is good.
|
||||
<mozbot> user: green is good.
|
||||
<user> mozbot: vars Admin ignoredTargets '+.*bot[0-9]*'
|
||||
<mozbot> Variable 'ignoredTargets' in module 'Admin' has changed.
|
||||
<user> foobot: what is green?
|
||||
<foobot> user: green is good.
|
||||
* user patpats mozbot
|
||||
|
||||
Changes to variables are usually immediately recorded in the
|
||||
configuration file and will be saved for the next time the bot is
|
||||
loaded.
|
||||
|
||||
There are three types of editable variables: scalars, arrays of
|
||||
scalars, and hashes of scalars.
|
||||
|
||||
Scalars are easy, and lists are explained by the bot quite well, just
|
||||
try to set a list and it will tell you if you are doing something
|
||||
wrong!
|
||||
|
||||
To add a value to a hash, there is a more complex syntax. For example,
|
||||
to add a new site to the list of sites that the RDF module monitors,
|
||||
use the following command:
|
||||
|
||||
/msg mozbot vars RDF sites '+|slashdot|http://slashdot.org/slashdot.rdf'
|
||||
|
||||
First, note that the value is surrounded by quotes. You can nest
|
||||
quotes without any problems, the quotes are just needed to
|
||||
differentiate significant trailing whitespace from mistakes.
|
||||
|
||||
The "+" means you want to add a value to the hash (as you'll see in a
|
||||
minute, to remove an item you use "-"). Then, since a hash is a
|
||||
key/value pair, you have to delimit the two. In this case, we have
|
||||
used "|" as a delimiter. However, you could use anything. The first
|
||||
occurance tells mozbot what delimiter you have picked. The second
|
||||
separates the key (in this case the site nickname) from the value (in
|
||||
this case the URI). For example:
|
||||
|
||||
/msg mozbot vars RDF sites '+*key*value'
|
||||
|
||||
You could even use a letter as a delimiter, but since that is usually
|
||||
a sign that you have forgotten to declare which delimiter you are
|
||||
using, mozbot will warn you about this. For example (the 'users' hash,
|
||||
BTW, is the hash in which all the username/password pairs are kept):
|
||||
|
||||
/msg mozbot vars Admin users '+sarah|lisa'
|
||||
|
||||
...will be treated the same as:
|
||||
|
||||
/msg mozbot vars Admin users '+*arah|li*a'
|
||||
|
||||
..., i.e. the username added would be "arah|li" and the password would
|
||||
be "a". This is not a bug, it's a feature. It means you can include
|
||||
any character, including "'", "|", and so on, in the key, without fear
|
||||
of it being interpreted as a delimiter.
|
||||
|
||||
To remove a user, or any key/value pair in a hash, you use this
|
||||
syntax:
|
||||
|
||||
/msg mozbot vars Admin users '-admin'
|
||||
|
||||
That's it. No need to say what the value is, since each key in a hash
|
||||
has to be unique. (Although, in this particular case, it should be
|
||||
noted that the preferred way to remove users is actually the
|
||||
'deleteuser' command.)
|
||||
|
||||
-- end --
|
||||
@@ -1,514 +0,0 @@
|
||||
_ _
|
||||
m o z i l l a |.| o r g | |
|
||||
_ __ ___ ___ ___| |__ ___ | |_
|
||||
| '_ ` _ \ / _ \_ / '_ \ / _ \| __|
|
||||
| | | | | | (_) / /| |_) | (_) | |_
|
||||
|_| |_| |_|\___/___|_.__/ \___/ \__|
|
||||
====================================
|
||||
|
||||
|
||||
INTRODUCTION
|
||||
------------
|
||||
|
||||
This was written as a living document. I (the author of mozbot 2.0)
|
||||
tried (successfully!) to set up mozbot in a secure environment,
|
||||
chrooted and setuided. This requires much more than a usual
|
||||
installation. So, without further ado, over to myself in the field:
|
||||
|
||||
|
||||
GETTING STARTED
|
||||
---------------
|
||||
|
||||
I will first be trying to install mozbot 2.0 on a SPARC machine
|
||||
running Sun Solaris. These instructions will probably work for any
|
||||
sane UNIX system. If you use Windows, see the INSTALL.WIN32 file.
|
||||
|
||||
<ianh:~> mkdir mozbot
|
||||
<ianh:~> cd mozbot
|
||||
<ianh:~/mozbot> version
|
||||
Machine hardware: sun4u
|
||||
OS version: 5.7
|
||||
Processor type: sparc
|
||||
Hardware: SUNW,Ultra-60
|
||||
|
||||
I already had Emacs 20.7 installed on the machine, for which I must
|
||||
thank Pavlov. You may, of course, use any editor of your choosing when
|
||||
doing this, although if you use vi or one of its siblings then don't
|
||||
even _think_ about asking me for help. (If you can understand vi I
|
||||
figure mozbot should no problem.)
|
||||
|
||||
<ianh:~> mkdir mozbot
|
||||
<ianh:~> cd mozbot
|
||||
|
||||
I also had several gigabytes of free disk space. You'll probably need
|
||||
several hundred megabytes to do all of this (including scratch space).
|
||||
(I believe the end result was around 30 megs for everything in the
|
||||
chroot jail directory.)
|
||||
|
||||
|
||||
PERL
|
||||
----
|
||||
|
||||
The first thing on my list was to install Perl.
|
||||
|
||||
<ianh:~/mozbot> mkdir resources
|
||||
<ianh:~/mozbot> cd resources
|
||||
<ianh:~/mozbot/resources> wget http://www.perl.com/CPAN/src/stable.tar.gz
|
||||
<ianh:~/mozbot/resources> tar xvfz stable.tar.gz
|
||||
|
||||
Next I read the README and INSTALL files:
|
||||
|
||||
<ianh:~/mozbot/resources> cd perl-5.6.0/
|
||||
<ianh:~/mozbot/resources/perl-5.6.0> emacs-20.7 README INSTALL
|
||||
|
||||
This told me how to do the next few bits.
|
||||
|
||||
<ianh:~/mozbot/resources/perl-5.6.0> rm -f config.sh Policy.sh
|
||||
<ianh:~/mozbot/resources/perl-5.6.0> sh Configure -Dprefix=/u/ianh/mozbot
|
||||
|
||||
By providing a prefix, the default installation directory for a lot of
|
||||
modules I am about to install is automatically set up correctly. So if
|
||||
you don't install Perl yourself, remember to take this into account!
|
||||
|
||||
Note: I didn't change any of the build options, so threads, debugging
|
||||
and the like are all disabled (or at their defaults). The only things
|
||||
I changed were that I answered 'n' to the question 'Binary
|
||||
compatibility with Perl 5.005?', which defaulted to 'y', and I told it
|
||||
not to install into '/usr/bin/perl'.
|
||||
|
||||
<ianh:~/mozbot/resources/perl-5.6.0> make
|
||||
<ianh:~/mozbot/resources/perl-5.6.0> make test
|
||||
<ianh:~/mozbot/resources/perl-5.6.0> make install
|
||||
<ianh:~/mozbot/resources/perl-5.6.0> cd ..
|
||||
|
||||
At this point I had Perl installed correctly in my mozbot directory.
|
||||
|
||||
|
||||
WGET
|
||||
----
|
||||
|
||||
The next thing to install was wget.
|
||||
|
||||
<ianh:~/mozbot/resources> wget ftp://ftp.gnu.org/pub/gnu/wget/wget-1.6.tar.gz
|
||||
<ianh:~/mozbot/resources> tar xvfz wget-1.6.tar.gz
|
||||
<ianh:~/mozbot/resources> cd wget-1.6
|
||||
<ianh:~/mozbot/resources/wget-1.6> emacs-20.7 README INSTALL
|
||||
<ianh:~/mozbot/resources/wget-1.6> ./configure --prefix=/u/ianh/mozbot
|
||||
<ianh:~/mozbot/resources/wget-1.6> make
|
||||
<ianh:~/mozbot/resources/wget-1.6> make install
|
||||
<ianh:~/mozbot/resources/wget-1.6> cd ..
|
||||
|
||||
No problems, no difficulties.
|
||||
|
||||
|
||||
MOZBOT
|
||||
------
|
||||
|
||||
Now, before going on any further with installing the required modules,
|
||||
I needed to find what those were. Ergo, the next thing to install was
|
||||
mozbot. Presumably you already have the relevant files, or know where
|
||||
to get them, since you are reading a file that comes with the source.
|
||||
|
||||
<ianh:~/mozbot/resources> wget http://www.damowmow.com/mozilla/mozbot/mozbot.tar.gz
|
||||
|
||||
There is no configuration, makefile or install script for mozbot,
|
||||
since there is nothing to compile or particularly install. So, I just
|
||||
extracted the mozbot tarball directly inside what would be the root of
|
||||
the file system when I eventually chroot()ed.
|
||||
|
||||
<ianh:~/mozbot/resources> cd ../..
|
||||
<ianh:~> tar xvfz mozbot/resources/mozbot.tar.gz
|
||||
|
||||
Like all shell scripts, one thing to change about it is the location
|
||||
of the Perl executable in the shebang.
|
||||
|
||||
<ianh:~> cd mozbot
|
||||
<ianh:~/mozbot> emacs-20.7 mozbot.pl
|
||||
|
||||
Since I'll be running it from the version of Perl I just installed, I
|
||||
changed the first line to read:
|
||||
|
||||
#!./bin/perl -wT
|
||||
|
||||
Note that this requires me to run mozbot from the mozbot directory. If
|
||||
you've read the README file, you'll know that this is a prerequisite
|
||||
of running mozbot anyway.
|
||||
|
||||
|
||||
Net::IRC
|
||||
--------
|
||||
|
||||
If you tried running mozbot now, you'd find it was missing
|
||||
Net::IRC. So, guess what I installed next? ;-)
|
||||
|
||||
<ianh:~/mozbot> cd resources
|
||||
<ianh:~/mozbot/resources> wget http://www.cpan.org/authors/id/FIMM/Net-IRC-0.70.tar.gz
|
||||
<ianh:~/mozbot/resources> tar xvfz Net-IRC-0.70.tar.gz
|
||||
<ianh:~/mozbot/resources> cd Net-IRC-0.70
|
||||
<ianh:~/mozbot/resources/Net-IRC-0.70> emacs-20.7 README
|
||||
<ianh:~/mozbot/resources/Net-IRC-0.70> ../../bin/perl Makefile.PL
|
||||
<ianh:~/mozbot/resources/Net-IRC-0.70> make
|
||||
<ianh:~/mozbot/resources/Net-IRC-0.70> make install
|
||||
<ianh:~/mozbot/resources/Net-IRC-0.70> cd ..
|
||||
|
||||
It is important to use the Perl we just installed and not any other
|
||||
Perl on the system, otherwise you'll get incorrect prefixes and
|
||||
stuff. (I didn't bother to use the wget I just installed...)
|
||||
|
||||
|
||||
Net::SMTP
|
||||
---------
|
||||
|
||||
Yup, you guessed it, Net::SMTP is next.
|
||||
|
||||
<ianh:~/mozbot/resources> wget http://www.cpan.org/authors/id/GBARR/libnet-1.0703.tar.gz
|
||||
<ianh:~/mozbot/resources> tar xvfz libnet-1.0703.tar.gz
|
||||
<ianh:~/mozbot/resources> cd libnet-1.0703
|
||||
<ianh:~/mozbot/resources/libnet-1.0703> emacs-20.7 README
|
||||
<ianh:~/mozbot/resources/libnet-1.0703> ../../bin/perl Makefile.PL
|
||||
|
||||
I answered 'y' to the question 'Do you want to modify/update your
|
||||
configuration (y|n) ? [no]', which was asked because the system
|
||||
had already had libnet installed once.
|
||||
|
||||
I kept the defaults for all the options though.
|
||||
|
||||
<ianh:~/mozbot/resources/libnet-1.0703> make
|
||||
<ianh:~/mozbot/resources/libnet-1.0703> make test
|
||||
<ianh:~/mozbot/resources/libnet-1.0703> make install
|
||||
<ianh:~/mozbot/resources/libnet-1.0703> cd ..
|
||||
|
||||
This also installed Net::FTP, which is required by some of the modules
|
||||
(in particular, the FTP module!).
|
||||
|
||||
|
||||
INITIAL CONFIGURATION
|
||||
---------------------
|
||||
|
||||
Now I needed to set up the environment for mozbot. The only real thing
|
||||
that needs setting up is the PATH variable. So:
|
||||
|
||||
<ianh:~/mozbot/resources> cd ..
|
||||
<ianh:~/mozbot> emacs-20.7 run-mozbot-chrooted
|
||||
|
||||
Here are the contents of my run-mozbot-chrooted script:
|
||||
|
||||
export PATH=/u/ianh/mozbot/bin
|
||||
./mozbot.pl
|
||||
|
||||
It is absolutely imperative that the path not contain '::' or '.'
|
||||
anywhere, as this will be treated as the current directory, which will
|
||||
then result in perl exiting with taint errors.
|
||||
|
||||
Now we make it executable:
|
||||
|
||||
<ianh:~/mozbot> chmod +x run-mozbot-chrooted
|
||||
|
||||
(Note. a sample run-mozbot-chrooted script is shipped with mozbot --
|
||||
it still requires you to follow all these steps though.)
|
||||
|
||||
|
||||
INITIAL RUN
|
||||
-----------
|
||||
|
||||
At this point, mozbot is runnable... so I ran it!
|
||||
|
||||
<ianh:~/mozbot> ./run-mozbot-chrooted
|
||||
|
||||
Note that I'm running it via my script and not directly. If you were
|
||||
not intending to run mozbot in a chroot() jail environment, then
|
||||
'./mozbot.pl' would be sufficient.
|
||||
|
||||
It prompted me for various things, like servers and so on. Then it
|
||||
connected without problems but with no modules set up, as I expected.
|
||||
|
||||
On IRC, I configured mozbot as I wanted it:
|
||||
|
||||
/query mozbot
|
||||
mozbot auth admin password
|
||||
newuser Hixie newpass newpass
|
||||
bless Hixie
|
||||
auth Hixie newpass
|
||||
|
||||
I also played a bit with the configuration variables:
|
||||
|
||||
vars Admin throttleTime '2.2'
|
||||
|
||||
This was all very well, but no modules makes mozbot a boring bot, so
|
||||
the next thing was...
|
||||
|
||||
|
||||
FILTERS
|
||||
-------
|
||||
|
||||
I shut down mozbot ('shutdown please') and installed the filters
|
||||
required by the 'Filters' BotModule.
|
||||
|
||||
<ianh:~/mozbot> cd resources
|
||||
<ianh:~/mozbot/resources> wget ftp://ftp.debian.org/pub/mirrors/debian/dists/potato/main/source/games/filters_2.9.tar.gz
|
||||
<ianh:~/mozbot/resources> tar xvfz filters_2.9.tar.gz
|
||||
<ianh:~/mozbot/resources> cd filters
|
||||
<ianh:~/mozbot/resources/filters> emacs-20.7 README
|
||||
<ianh:~/mozbot/resources/filters> make
|
||||
|
||||
At this point, I edited the Makefile to change /usr/.../ so as to
|
||||
point in the places we used for installing Perl.
|
||||
|
||||
<ianh:~/mozbot/resources/filters> make install PREFIX=/u/ianh/mozbot
|
||||
<ianh:~/mozbot/resources/filters> cd ..
|
||||
|
||||
I should point out that this didn't go too well and I had to hack
|
||||
about with the Makefile and my environment and so on, so good luck
|
||||
(admittedly, Pavlov happened to install a new compiler at the same
|
||||
time, and didn't bother to install a license for it, so I had a few
|
||||
more problems than you should, but...).
|
||||
|
||||
You should also make sure that the shebang lines in the five relevant
|
||||
perl scripts that you should make sure ended up in ~/mozbot/bin
|
||||
actually point to the right perl executable. I had to edit the files
|
||||
by hand.
|
||||
|
||||
|
||||
Net::Telnet
|
||||
-----------
|
||||
|
||||
In order to insult people, the Rude module needs to Telnet:
|
||||
|
||||
<ianh:~/mozbot/resources> wget http://www.cpan.org/authors/id/JROGERS/Net-Telnet-3.02.tar.gz
|
||||
<ianh:~/mozbot/resources> tar xvfz Net-Telnet-3.02.tar.gz
|
||||
<ianh:~/mozbot/resources> cd Net-Telnet-3.02
|
||||
<ianh:~/mozbot/resources/Net-Telnet-3.02> emacs-20.7 README
|
||||
<ianh:~/mozbot/resources/Net-Telnet-3.02> ../../bin/perl Makefile.PL
|
||||
<ianh:~/mozbot/resources/Net-Telnet-3.02> make
|
||||
<ianh:~/mozbot/resources/Net-Telnet-3.02> make test
|
||||
<ianh:~/mozbot/resources/Net-Telnet-3.02> make install
|
||||
<ianh:~/mozbot/resources/Net-Telnet-3.02> cd ..
|
||||
|
||||
That went a lot smoother than the filters installation, let me tell
|
||||
you! ;-)
|
||||
|
||||
|
||||
WWW::Babelfish
|
||||
--------------
|
||||
|
||||
The translation module requires a whole bunch of other modules, mainly
|
||||
due to its dependency on WWW::Babelfish, which requires half of libwww
|
||||
and also IO::String. libwww itself requires another half a dozen
|
||||
modules, namely URI, MIME-Base64, HTML::Parser, libnet (which I
|
||||
installed earlier, thankfully), and Digest::MD5. And HTML-Parser
|
||||
requires HTML-Tagset!
|
||||
|
||||
I found these dependencies out by browsing CPAN reading README files.
|
||||
|
||||
<ianh:~/mozbot/resources> lynx http://www.cpan.org/
|
||||
|
||||
Thankfully, they all installed rather smoothly. Here is the complete
|
||||
list of commands I used to install WWW::Babelfish (starting in the
|
||||
'resources' directory):
|
||||
|
||||
wget http://www.cpan.org/authors/id/GAAS/MIME-Base64-2.12.tar.gz
|
||||
tar xvfz MIME-Base64-2.12.tar.gz
|
||||
cd MIME-Base64-2.12
|
||||
../../bin/perl Makefile.PL
|
||||
make
|
||||
make test
|
||||
make install
|
||||
cd ..
|
||||
|
||||
wget http://www.cpan.org/authors/id/GAAS/URI-1.11.tar.gz
|
||||
tar xvfz URI-1.11.tar.gz
|
||||
cd URI-1.11
|
||||
../../bin/perl Makefile.PL
|
||||
make
|
||||
make test
|
||||
make install
|
||||
cd ..
|
||||
|
||||
wget http://www.cpan.org/authors/id/S/SB/SBURKE/HTML-Tagset-3.03.tar.gz
|
||||
tar xvfz HTML-Tagset-3.03.tar.gz
|
||||
cd HTML-Tagset-3.03
|
||||
../../bin/perl Makefile.PL
|
||||
make
|
||||
make test
|
||||
make install
|
||||
cd ..
|
||||
|
||||
wget http://www.cpan.org/authors/id/GAAS/HTML-Parser-3.19_91.tar.gz
|
||||
tar xvfz HTML-Parser-3.19_91.tar.gz
|
||||
cd HTML-Parser-3.1991
|
||||
../../bin/perl Makefile.PL
|
||||
make
|
||||
make test
|
||||
make install
|
||||
cd ..
|
||||
|
||||
wget http://www.cpan.org/authors/id/GAAS/Digest-MD5-2.13.tar.gz
|
||||
tar xvfz Digest-MD5-2.13.tar.gz
|
||||
cd Digest-MD5-2.13
|
||||
../../bin/perl Makefile.PL
|
||||
make
|
||||
make test
|
||||
make install
|
||||
cd ..
|
||||
|
||||
wget http://www.cpan.org/authors/id/GAAS/libwww-perl-5.51.tar.gz
|
||||
tar xvfz libwww-perl-5.51.tar.gz
|
||||
cd libwww-perl-5.51
|
||||
../../bin/perl Makefile.PL
|
||||
make
|
||||
make test
|
||||
make install
|
||||
cd ..
|
||||
|
||||
wget http://www.cpan.org/authors/id/GAAS/IO-String-1.01.tar.gz
|
||||
tar xvfz IO-String-1.01.tar.gz
|
||||
cd IO-String-1.01
|
||||
../../bin/perl Makefile.PL
|
||||
make
|
||||
make test
|
||||
make install
|
||||
cd ..
|
||||
|
||||
wget http://www.cpan.org/authors/id/D/DU/DURIST/WWW-Babelfish-0.09.tar.gz
|
||||
tar xvfz WWW-Babelfish-0.09.tar.gz
|
||||
cd WWW-Babelfish-0.09/
|
||||
../../bin/perl Makefile.PL
|
||||
make
|
||||
make test
|
||||
make install
|
||||
cd ..
|
||||
|
||||
Yes, this is surreal. I always knew languages were hard.
|
||||
|
||||
|
||||
UUIDGEN
|
||||
-------
|
||||
|
||||
The last module, the UUID generator, requires a program that you'll
|
||||
find along with mozbot in CVS. You may have this already. If you
|
||||
don't, then here's how I got my copy:
|
||||
|
||||
<ianh:~/mozbot/resources> export CVSROOT=:pserver:anonymous@cvs-mirror.mozilla.org:/cvsroot
|
||||
<ianh:~/mozbot/resources> cvs login
|
||||
|
||||
The password is 'anonymous'.
|
||||
|
||||
<ianh:~/mozbot/resources> cvs checkout mozilla/webtools/mozbot/uuidgen
|
||||
<ianh:~/mozbot/resources> cd mozilla/webtools/mozbot/uuidgen/
|
||||
<ianh:~/mozbot/resources/mozilla/webtools/mozbot/uuidgen> make
|
||||
<ianh:~/mozbot/resources/mozilla/webtools/mozbot/uuidgen> cp uuidgen ../../../../../bin
|
||||
<ianh:~/mozbot/resources/mozilla/webtools/mozbot/uuidgen> cd ../../../../../
|
||||
|
||||
At this point I think I had all the required programs.
|
||||
|
||||
|
||||
MORE THOROUGH CONFIGURATION
|
||||
---------------------------
|
||||
|
||||
Now that I'm ready to run mozbot chroot()ed, it is time to make the
|
||||
final preparations. Firts, I moved the resources directory out of the
|
||||
way, since I had finished with it:
|
||||
|
||||
<ianh:~/mozbot> mv resources ../installed-resources
|
||||
|
||||
Next I made sure all the rights were set to read-only for people other
|
||||
than the user:
|
||||
|
||||
<ianh:~/mozbot> chmod -R go-w .
|
||||
|
||||
At this point I wanted to make sure the bot started ok, so I ran the
|
||||
run-mozbot-chrooted script:
|
||||
|
||||
<ianh:~/mozbot> ./run-mozbot-chrooted
|
||||
|
||||
That worked. I changed the script to:
|
||||
|
||||
export PATH=/bin
|
||||
./mozbot.pl --chroot /config/default
|
||||
|
||||
What's this 'config' thing? Well, since we're about to chown() all the
|
||||
files to root and then setuid the script to nobody, the bot wouldn't
|
||||
be able to edit the config file if it was in the same directory as the
|
||||
source -- so I created a new directory with no rights restrictions,
|
||||
and moved the configuration file into it:
|
||||
|
||||
<ianh:~/mozbot> mkdir config
|
||||
<ianh:~/mozbot> mv mozbot.pl.cfg config/default
|
||||
<ianh:~/mozbot> chmod ugo=rwx config
|
||||
<ianh:~/mozbot> chmod ugo=rw config/default
|
||||
|
||||
In order to not have to change all the perl scripts, I gave them a
|
||||
fake 'mozbot' directory:
|
||||
|
||||
<ianh:~/mozbot> mkdir u
|
||||
<ianh:~/mozbot> mkdir u/ianh
|
||||
<ianh:~/mozbot> cd u/ianh
|
||||
<ianh:~/mozbot/u/ianh> ln -s / mozbot
|
||||
<ianh:~/mozbot/u/ianh> cd ../../
|
||||
|
||||
At this point I ran 'su' to drop down to a root shell. Be careful!
|
||||
|
||||
I had to copy several library files to a usr/lib directory. To do
|
||||
this, the 'truss' and 'ldd' tools came in very useful. In particular,
|
||||
I used 'truss' to watch what calls mozbot was attempting, and 'ldd' to
|
||||
find what modules dependencies Perl, wget, and the modules had.
|
||||
|
||||
Credit should be given to Pavlov for actually doing most of this for
|
||||
me... I didn't even know 'ldd' existed until he showed me. ;-)
|
||||
|
||||
Here is the list of the modules I copied:
|
||||
|
||||
usr/lib:
|
||||
ld.so.1 libdl.so.1 libgen.so.1 libmp.so.2
|
||||
libresolv.so.1 libsec.so.1 nscd_nischeck nss_files.so.1
|
||||
libc.so.1 libdoor.so.1 libld.so.2 libnsl.so.1
|
||||
libresolv.so.2 libsocket.so.1 nss_compat.so.1 nss_nis.so.1
|
||||
libcrypt_i.so.1 libelf.so.1 liblddbg.so.4 libpthread.so.1
|
||||
librtld.so.1 libthread.so.1 nss_dns.so.1 nss_nisplus.so.1
|
||||
|
||||
usr/platform/SUNW,Ultra-60:
|
||||
libc_psr.so.1
|
||||
|
||||
You may not need all of these.
|
||||
|
||||
I also had to copy /dev/null, /dev/zero, /dev/tcp, /dev/ticotsord and
|
||||
/dev/udp into a new dev/ directory (hint: use 'tar' to copy devices,
|
||||
it won't work if you try to do it with 'cp'). I may not have needed
|
||||
all of these (this was slightly complicated by the fact that on
|
||||
Solaris the /dev devices are symlinks; I used 'tar' to copy the real
|
||||
devices from /devices and renamed them when I extracted the tarball):
|
||||
|
||||
total 4
|
||||
drwxrwxr-x 2 root other 512 Mar 30 14:34 .
|
||||
drwxr-xr-x 16 root staff 512 Mar 30 15:47 ..
|
||||
crw-rw-r-- 1 root sys 13, 2 Mar 30 14:25 null
|
||||
crw-rw-rw- 1 root sys 11, 42 Jun 6 2000 tcp
|
||||
crw-rw-rw- 1 root sys 105, 1 Jun 6 2000 ticotsord
|
||||
crw-rw-rw- 1 root sys 11, 41 Jun 6 2000 udp
|
||||
crw-rw-r-- 1 root sys 13, 12 Jun 6 2000 zero
|
||||
|
||||
I had to copy several files from /etc into a new 'etc' directory, in
|
||||
particular:
|
||||
|
||||
etc:
|
||||
group hosts netconfig nsswitch.conf
|
||||
passwd protocols resolv.conf wgetrc
|
||||
|
||||
You may wish to sanitize your 'passwd' file. For the nsswitch.conf
|
||||
file you should use the 'nsswitch.dns' file (if you have one) -- make
|
||||
sure the DNS line is 'dns files' and not 'files dns'. (Profuse thanks
|
||||
go to rfm from Sun who helped me with this.)
|
||||
|
||||
Now I used 'chown' to make every file in /u/ianh/mozbot/ be owned by
|
||||
root, except the config directory. I also edited 'mozbot.pl' to ensure
|
||||
that the correct arguments were passed to 'setuid' and 'setgid' --
|
||||
search for 'setuid' in the source to find the right place.
|
||||
|
||||
With that all set up, I finally could run the bot safe in the
|
||||
knowledge that it was relatively secure:
|
||||
|
||||
<root:/u/ianh/mozbot> ./run-mozbot-chrooted
|
||||
|
||||
I hope this has helped you in some way!!!
|
||||
|
||||
-- end --
|
||||
@@ -1,29 +0,0 @@
|
||||
_ _
|
||||
m o z i l l a |.| o r g | |
|
||||
_ __ ___ ___ ___| |__ ___ | |_
|
||||
| '_ ` _ \ / _ \_ / '_ \ / _ \| __|
|
||||
| | | | | | (_) / /| |_) | (_) | |_
|
||||
|_| |_| |_|\___/___|_.__/ \___/ \__|
|
||||
====================================
|
||||
|
||||
|
||||
INTRODUCTION
|
||||
------------
|
||||
|
||||
Running mozbot on windows is officially unsupported, and does not
|
||||
work at all when using ActiveState Perl, as it does not support
|
||||
forking which mozbot uses extensively.
|
||||
|
||||
However, mozbot runs successfully on Windows with Cygwin Perl. Tested
|
||||
on Microsoft Windows XP and Windows Server 2003, Perl 5.8.4 and higher,
|
||||
including 5.10. Windows Vista and Windows Server 2008 may also work, but
|
||||
have not been tested, you're on your own.
|
||||
|
||||
Once you have Cygwin (http://www.cygwin.com) installed with the Perl
|
||||
package, follow the instructions in the INSTALL file. You will need
|
||||
to use CPAN and install the required modules for mozbot to work
|
||||
properly.
|
||||
|
||||
Your mileage may vary, it may not work at all for you. Good luck.
|
||||
|
||||
-- end --
|
||||
@@ -1,4 +0,0 @@
|
||||
This is the source code for "mozbot", the IRC bot who hangs out in the
|
||||
#mozilla channel at irc.mozilla.org.
|
||||
|
||||
See the INSTALL file for installation and configuration instructions.
|
||||
@@ -1,130 +0,0 @@
|
||||
connectTimeout=120
|
||||
helpline=see http://www.mozilla.org/projects/mozbot/
|
||||
sleep=60
|
||||
throttleTime=2.2
|
||||
Admin::files=lib/Configuration.pm
|
||||
Admin::files=lib/Mails.pm
|
||||
Admin::files=mozbot.pl
|
||||
Admin::files=lib/IO/SecurePipe.pm
|
||||
Bugzilla::ignoreCommentsFrom=|
|
||||
FortuneCookies::bakingTime=20
|
||||
FortuneCookies::cookies=* UNIX is a Trademark of Bell Laboratories.
|
||||
FortuneCookies::cookies=/earth is 98% full ... please delete anyone you can.
|
||||
FortuneCookies::cookies=A man is not complete until he is married -- then he is finished.
|
||||
FortuneCookies::cookies=A man with his hands in pockets feels foolish, but a man with holes in pockets feels nuts.
|
||||
FortuneCookies::cookies=A meeting is an event at which the minutes are kept and the hours are lost.
|
||||
FortuneCookies::cookies=A modem is a baudy house.
|
||||
FortuneCookies::cookies=A thunderstorm in .nl here can startle a butterfly in .au
|
||||
FortuneCookies::cookies=Anyone can make an omelet with eggs. The trick is to make one with none.
|
||||
FortuneCookies::cookies=Best of all is never to have been born. Second best is to die soon.
|
||||
FortuneCookies::cookies=Better to sleep with chicken than to choke it.
|
||||
FortuneCookies::cookies=Confession is good for the soul, but bad for the career.
|
||||
FortuneCookies::cookies=Confucius not: know what to say!
|
||||
FortuneCookies::cookies=Confucius say: "Is more to running BBS than finding ON.
|
||||
FortuneCookies::cookies=Confucius say: A bird in hand makes hard to blow nose.
|
||||
FortuneCookies::cookies=Confucius say: Baby conceived in automatic car shiftless bastard.
|
||||
FortuneCookies::cookies=Confucius say: I didn't say that!
|
||||
FortuneCookies::cookies=Confucius say: Is stuffy inside fortune cookie.
|
||||
FortuneCookies::cookies=Confucius say: Man who Farts in Church sits in own pew.
|
||||
FortuneCookies::cookies=Confucius say: Man who pull out too fast leave rubber.
|
||||
FortuneCookies::cookies=Confucius say: Man who stand on toilet is high on pot.
|
||||
FortuneCookies::cookies=Confucius say: Man with hand in pocket is having a ball.
|
||||
FortuneCookies::cookies=Confucius say: Man with no legs bums around.
|
||||
FortuneCookies::cookies=Confucius say: Put Rooster in Freezer Get A Stiff Cock.
|
||||
FortuneCookies::cookies=Confucius say: Shit happens.
|
||||
FortuneCookies::cookies=Confucius say: Show off always shown up in showdown.
|
||||
FortuneCookies::cookies=Confucius say: Woman who cook carrots and peas in same pot not sanitary!
|
||||
FortuneCookies::cookies=Confucius say: `A Watched Tandy Never Boots!
|
||||
FortuneCookies::cookies=Confucius say: man who smoke pot choke on handle.
|
||||
FortuneCookies::cookies=Confucius say: nothing - Because he's dead!
|
||||
FortuneCookies::cookies=Confucius say: too damn much!
|
||||
FortuneCookies::cookies=Death is nature's way of telling you to slow down.
|
||||
FortuneCookies::cookies=Debug is human, de-fix divine.
|
||||
FortuneCookies::cookies=Despite all appearances, your boss is a thinking, feeling, human being.
|
||||
FortuneCookies::cookies=Do not drink coffee in early A.M. It will keep you awake until noon.
|
||||
FortuneCookies::cookies=Do not simplify the design of a program if a way can be found to make it complex and wonderful.
|
||||
FortuneCookies::cookies=Due to lack of disk space, this fortune database has been discontinued.
|
||||
FortuneCookies::cookies=Early to bed and early to rise and you'll be groggy when everyone else is wide awake.
|
||||
FortuneCookies::cookies=Every path has its puddle.
|
||||
FortuneCookies::cookies=Everything that you know is wrong, but you can be straightened out.
|
||||
FortuneCookies::cookies=Experience is the worst teacher. It always gives the test first and the instruction afterward.
|
||||
FortuneCookies::cookies=Future looks spotty. You will spill soup in late evening.
|
||||
FortuneCookies::cookies=God made machine language; all the rest is the work of man.
|
||||
FortuneCookies::cookies=He that teaches himself has a fool for a master.
|
||||
FortuneCookies::cookies=He who crosses the ocean twice without washing is a dirty double crosser.
|
||||
FortuneCookies::cookies=He who has a shady past knows that nice guys finish last.
|
||||
FortuneCookies::cookies=History repeats itself. That's one thing wrong with history.
|
||||
FortuneCookies::cookies=Hope that the day after you die is a nice day.
|
||||
FortuneCookies::cookies=House without toilet is uncanny.
|
||||
FortuneCookies::cookies=I have a theory that it's impossible to prove anything, but I can't prove it.
|
||||
FortuneCookies::cookies=I know you're in search of yourself, I just haven't seen you anywhere.
|
||||
FortuneCookies::cookies=If at first you don't succeed, redefine success.
|
||||
FortuneCookies::cookies=If life isn't what you wanted, have you asked for anything else?
|
||||
FortuneCookies::cookies=If this fortune didn't exist, somebody would have invented it.
|
||||
FortuneCookies::cookies=If we meet a man of rare intellect, we should ask him what book he reads.
|
||||
FortuneCookies::cookies=If you are too busy to read, then you are too busy.
|
||||
FortuneCookies::cookies=If you do something right once, someone will ask you to do it again.
|
||||
FortuneCookies::cookies=If you park, don't drink, accidents cause people.
|
||||
FortuneCookies::cookies=If your aim in life is nothing, you can't miss.
|
||||
FortuneCookies::cookies=In English, every word can be verbed. Would that it were so in our programming languages.
|
||||
FortuneCookies::cookies=In an orderly world, there's always a place for the disorderly.
|
||||
FortuneCookies::cookies=In the force if Yoda's so strong, construct a sentence with words in the proper order then why can't he?
|
||||
FortuneCookies::cookies=It is not well to be thought of as one who meekly submits to insolence and intimidation.
|
||||
FortuneCookies::cookies=It is very difficult to prophesy, especially when it pertains to the future.
|
||||
FortuneCookies::cookies=Life is too short to be taken seriously.
|
||||
FortuneCookies::cookies=Logic is a systematic method of coming to the wrong conclusion with confidence.
|
||||
FortuneCookies::cookies=Ma Bell is a mean mother!
|
||||
FortuneCookies::cookies=Man who arrives at party two hours late will find he has been beaten to the punch.
|
||||
FortuneCookies::cookies=Man who eat many prunes, sit on toilet many moons.
|
||||
FortuneCookies::cookies=Man who fight with wife all day, get no peace at night!
|
||||
FortuneCookies::cookies=Man who put head on Rail Road track to listen for train likely to end up with sudden splitting headache.
|
||||
FortuneCookies::cookies=May all your PUSHes be POPped.
|
||||
FortuneCookies::cookies=Measure with a micrometer. Mark with chalk. Cut with an axe.
|
||||
FortuneCookies::cookies=Message will arrive in the mail. Destroy, before the FBI sees it.
|
||||
FortuneCookies::cookies=Never trust a computer you can't repair yourself.
|
||||
FortuneCookies::cookies=Never underestimate the power of human stupidity.
|
||||
FortuneCookies::cookies=No matter what happens, there is always someone who knew it would.
|
||||
FortuneCookies::cookies=Nondeterminism means never having to say you are wrong.
|
||||
FortuneCookies::cookies=On the eighth day, God created FORTRAN.
|
||||
FortuneCookies::cookies=One person's error is another person's data.
|
||||
FortuneCookies::cookies=One possible reason that things aren't going according to plan is that there never was a plan in the first place.
|
||||
FortuneCookies::cookies=One seldom sees a monument to a committee.
|
||||
FortuneCookies::cookies=Others can stop you temporarily, only you can do it permanently.
|
||||
FortuneCookies::cookies=Overflow on /dev/null, please empty the bit bucket.
|
||||
FortuneCookies::cookies=Passwords are implemented as a result of insecurity.
|
||||
FortuneCookies::cookies=Pause for storage relocation.
|
||||
FortuneCookies::cookies=Pretend to spank me -- I'm a pseudo-masochist!
|
||||
FortuneCookies::cookies=Quantity is no substitute for quality, but its the only one we've got.
|
||||
FortuneCookies::cookies=Real computer scientists don't comment their code. The identifiers are so long they can't afford the disk space.
|
||||
FortuneCookies::cookies=Recursion is the root of computation since it trades description for time.
|
||||
FortuneCookies::cookies=Standards are crucial. And the best thing about standards is: there are so many to choose from!
|
||||
FortuneCookies::cookies=The first version always gets thrown away.
|
||||
FortuneCookies::cookies=The important thing is not to stop questioning.
|
||||
FortuneCookies::cookies=The light of a hundred stars does not equal the light of the moon.
|
||||
FortuneCookies::cookies=The meek shall inherit the earth; the rest of us will go to the stars.
|
||||
FortuneCookies::cookies=The more you sweat in peace, the less you bleed in war.
|
||||
FortuneCookies::cookies=The most important early product on the way to developing a good product is an imperfect version.
|
||||
FortuneCookies::cookies=The number of feet in a yard is directly proportional to the success of the barbecue.
|
||||
FortuneCookies::cookies=The only person who always got his work done by Friday was Robinson Crusoe.
|
||||
FortuneCookies::cookies=The sun will rise in the east today, indicating nothing in particular.
|
||||
FortuneCookies::cookies=The trouble with computers is that they do what you tell them, not what you want.
|
||||
FortuneCookies::cookies=There are two ways to write error-free programs; only the third one works.
|
||||
FortuneCookies::cookies=This life is yours. Some of it was given to you; the rest, you made yourself.
|
||||
FortuneCookies::cookies=This system will self-destruct in five minutes.
|
||||
FortuneCookies::cookies=This will be a memorable month -- no matter how hard you try to forget it.
|
||||
FortuneCookies::cookies=Those who do not understand Unix are condemned to reinvent it, poorly.
|
||||
FortuneCookies::cookies=Those who smile bring light to others
|
||||
FortuneCookies::cookies=Tomorrow will be cancelled due to lack of interest.
|
||||
FortuneCookies::cookies=War doesn't determine who's right, war determines who's left.
|
||||
FortuneCookies::cookies=War is peace. Freedom is slavery. Ketchup is a vegetable.
|
||||
FortuneCookies::cookies=We promise according to our hopes, and perform according to our fears.
|
||||
FortuneCookies::cookies=Wife who put husband in doghouse soon find him in cat house.
|
||||
FortuneCookies::cookies=You can always tell the people that are forging the new frontier. They're the ones with arrows sticking out of their backs.
|
||||
FortuneCookies::cookies=You have many friends and very few living enemies.
|
||||
FortuneCookies::cookies=You may attend a party where strange customs prevail.
|
||||
FortuneCookies::cookies=You might have mail.
|
||||
FortuneCookies::cookies=You will be advanced socially, without any special effort on your part.
|
||||
FortuneCookies::cookies=You're currently going through a difficult transition period called "Life."
|
||||
FortuneCookies::cookies=panic: kernel segmentation violation. core dumped (only kidding)
|
||||
FortuneCookies::cookiesIndex=38
|
||||
FortuneCookies::cookiesMax=10
|
||||
@@ -1,209 +0,0 @@
|
||||
# -*- Mode: perl; indent-tabs-mode: nil -*-
|
||||
#
|
||||
# The contents of this file are subject to the Mozilla Public
|
||||
# License Version 1.1 (the "License"); you may not use this file
|
||||
# except in compliance with the License. You may obtain a copy of
|
||||
# the License at http://www.mozilla.org/MPL/
|
||||
#
|
||||
# Software distributed under the License is distributed on an "AS
|
||||
# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express or
|
||||
# implied. See the License for the specific language governing
|
||||
# rights and limitations under the License.
|
||||
#
|
||||
# The Original Code is the Bugzilla Bug Tracking System.
|
||||
#
|
||||
# The Initial Developer of the Original Code is Netscape Communications
|
||||
# Corporation. Portions created by Netscape are
|
||||
# Copyright (C) 1998 Netscape Communications Corporation. All
|
||||
# Rights Reserved.
|
||||
#
|
||||
# Contributor(s): Harrison Page <harrison@netscape.com>
|
||||
# Terry Weissman <terry@mozilla.org>
|
||||
# Ian Hickson <py8ieh=mozbot@bath.ac.uk>
|
||||
|
||||
package Configuration;
|
||||
use strict;
|
||||
use Carp;
|
||||
|
||||
sub Get {
|
||||
my ($file, $config) = @_;
|
||||
my %seen;
|
||||
open FILE, "<$file" or return 0;
|
||||
my $line = 0;
|
||||
while (<FILE>) {
|
||||
$line++; chomp;
|
||||
if (/^ *([^#;][^=\n\r]*)(?:=(.*))?$/os) {
|
||||
my $value = $$config{$1};
|
||||
if (defined($value)) {
|
||||
$value = $$value while ref($value) eq 'REF';
|
||||
if (ref($value) eq 'SCALAR') {
|
||||
$$value = $2;
|
||||
} elsif (ref($value) eq 'ARRAY') {
|
||||
unless ($seen{$1}) {
|
||||
@$value = ();
|
||||
}
|
||||
if (defined($2)) {
|
||||
push(@$value, $2);
|
||||
}
|
||||
} elsif (ref($value) eq 'HASH') {
|
||||
unless ($seen{$1}) {
|
||||
%$value = ();
|
||||
}
|
||||
if (defined($2)) {
|
||||
$2 =~ /^(.)(.*?)\1=>(.*)$/so;
|
||||
$$value{$2} = $3;
|
||||
}
|
||||
}
|
||||
} # else unknown variable, ignore
|
||||
$seen{$1} = 1;
|
||||
} # else ignore (probably comment)
|
||||
}
|
||||
close FILE;
|
||||
return $line;
|
||||
}
|
||||
|
||||
sub Save {
|
||||
my ($file, $config) = @_;
|
||||
local $_;
|
||||
|
||||
# Try to keep file structure if possible
|
||||
my @lines;
|
||||
if (open FILE, "<$file") {
|
||||
while (<FILE>) {
|
||||
push @lines, $_;
|
||||
}
|
||||
close FILE;
|
||||
}
|
||||
|
||||
# but make sure we put in all the data (dups are dealt with)
|
||||
foreach (sort keys %$config) {
|
||||
push @lines, "$_=";
|
||||
}
|
||||
|
||||
# Open file to which we are saving
|
||||
open FILE, ">$file.~$$~" or confess("Could not save configuration: $!");
|
||||
|
||||
# ok, save file back again
|
||||
# make sure we only write parameters once by
|
||||
# keeping a log of those done
|
||||
my %seen;
|
||||
foreach (@lines) {
|
||||
chomp;
|
||||
if (/^ *([^#;][^=\n\r]*)(?:=(.*))?$/os) {
|
||||
my $variable = $1;
|
||||
my $value = $2;
|
||||
if (defined($$config{$variable})) {
|
||||
unless ($seen{$variable}) {
|
||||
$value = $$config{$variable};
|
||||
$value = $$value while ref($value) eq 'REF';
|
||||
if (ref($value) eq 'SCALAR') {
|
||||
if (defined($$value)) {
|
||||
print FILE $variable.'='.$$value."\n" or confess("Could not save configuration: $!");
|
||||
}
|
||||
} elsif (ref($value) eq 'HASH') {
|
||||
my @keys = keys %$value;
|
||||
if (@keys > 0) {
|
||||
foreach my $item (@keys) {
|
||||
my $data = $$value{$item};
|
||||
$item = '' unless defined $item;
|
||||
$data = '' unless defined $data;
|
||||
my $delimiter;
|
||||
foreach ('"','\'','|',':','#','*','<','>','/','[',']','{','}',
|
||||
'(',')','\\','=','-','@','!','\$','%','&',' ','\`','~') {
|
||||
if ($item !~ /\Q$_\E=>/os) {
|
||||
$delimiter = $_;
|
||||
last;
|
||||
}
|
||||
}
|
||||
if (defined($delimiter)) {
|
||||
print FILE "$variable=$delimiter$item$delimiter=>$data\n"
|
||||
or confess("Could not save configuration: $!");
|
||||
}
|
||||
# else, silent data loss... XXX
|
||||
}
|
||||
} else {
|
||||
print FILE "$variable\n" or confess("Could not save configuration: $!");
|
||||
}
|
||||
} elsif (ref($value) eq 'ARRAY') {
|
||||
if (@$value > 0) {
|
||||
foreach my $item (@$value) {
|
||||
if (defined($item)) {
|
||||
print FILE "$variable=$item\n" or confess("Could not save configuration: $!");
|
||||
} else {
|
||||
print FILE "$variable=\n" or confess("Could not save configuration: $!");
|
||||
}
|
||||
}
|
||||
} else {
|
||||
print FILE "$variable\n" or confess("Could not save configuration: $!");
|
||||
}
|
||||
} else {
|
||||
confess("Unsupported data type '".ref($value)."' writing $variable (".$$config{$variable}.')');
|
||||
}
|
||||
$seen{$variable} = 1;
|
||||
} # else seen it already
|
||||
} else { # unknown
|
||||
if (defined($value)) {
|
||||
print FILE "$variable=$value\n" or confess("Could not save configuration: $!");
|
||||
} else {
|
||||
print FILE "$variable\n" or confess("Could not save configuration: $!");
|
||||
}
|
||||
}
|
||||
} else {
|
||||
# might be a comment
|
||||
print FILE $_."\n" or confess("Could not save configuration: $!");
|
||||
}
|
||||
}
|
||||
# actually do make a change to the real file
|
||||
close FILE or confess("Could not save configuration: $!");
|
||||
|
||||
# -- #mozwebtools was here --
|
||||
# * Hixie is sad as his bot crashes.
|
||||
# * Hixie adds in a check to make sure that the file he tries
|
||||
# to delete actually exists first.
|
||||
# <timeless> delete??
|
||||
|
||||
unlink $file or confess("Could not delete $file: $!") if (-e $file);
|
||||
rename("$file.~$$~", $file) or confess("Could not rename to $file: $!");
|
||||
}
|
||||
|
||||
sub Ensure {
|
||||
my ($config) = @_;
|
||||
my $changed;
|
||||
foreach (@$config) {
|
||||
if (ref($$_[1]) eq 'SCALAR') {
|
||||
unless (defined(${$$_[1]})) {
|
||||
if (-t) {
|
||||
print $$_[0]. ' ';
|
||||
<> =~ /^(.*)$/os;
|
||||
${$$_[1]} = $1;
|
||||
${$$_[1]} = '' unless defined ${$$_[1]};
|
||||
chomp(${$$_[1]});
|
||||
$changed++;
|
||||
} else {
|
||||
confess("Terminal is not interactive, so could not ask '$$_[0]'. Gave up");
|
||||
}
|
||||
}
|
||||
} elsif (ref($$_[1]) eq 'ARRAY') {
|
||||
unless (defined(@{$$_[1]})) {
|
||||
if (-t) {
|
||||
print $$_[0]. " (enter a blank line to finish)\n";
|
||||
my $input;
|
||||
do {
|
||||
$input = <>;
|
||||
$input = '' unless defined $input;
|
||||
chomp($input);
|
||||
push @{$$_[1]}, $input if $input;
|
||||
$changed++;
|
||||
} while $input;
|
||||
} else {
|
||||
confess("Terminal is not interactive, so could not ask '$$_[0]'. Gave up");
|
||||
}
|
||||
}
|
||||
} else {
|
||||
confess("Unsupported data type expected for question '$$_[0]'");
|
||||
}
|
||||
}
|
||||
return $changed;
|
||||
}
|
||||
|
||||
1; # end
|
||||
@@ -1,67 +0,0 @@
|
||||
# IO::SecurePipe.pm
|
||||
# Created by Ian Hickson to make exec() call if IO::Pipe more secure.
|
||||
# Distributed under exactly the same licence terms as IO::Pipe.
|
||||
|
||||
package IO::SecurePipe;
|
||||
use strict;
|
||||
#use Carp;
|
||||
use IO::Pipe;
|
||||
use vars qw(@ISA);
|
||||
@ISA = qw(IO::Pipe);
|
||||
|
||||
my $do_spawn = $^O eq 'os2';
|
||||
|
||||
sub croak {
|
||||
$0 =~ m/^(.*)$/os; # untaint $0 so that we can call it below:
|
||||
exec { $1 } ($1, '--abort'); # do not call shutdown handlers
|
||||
exit(); # exit (implicit in exec() actually)
|
||||
}
|
||||
|
||||
sub _doit {
|
||||
my $me = shift;
|
||||
my $rw = shift;
|
||||
|
||||
my $pid = $do_spawn ? 0 : fork();
|
||||
|
||||
if($pid) { # Parent
|
||||
return $pid;
|
||||
}
|
||||
elsif(defined $pid) { # Child or spawn
|
||||
my $fh;
|
||||
my $io = $rw ? \*STDIN : \*STDOUT;
|
||||
my ($mode, $save) = $rw ? "r" : "w";
|
||||
if ($do_spawn) {
|
||||
require Fcntl;
|
||||
$save = IO::Handle->new_from_fd($io, $mode);
|
||||
# Close in child:
|
||||
fcntl(shift, Fcntl::F_SETFD(), 1) or croak "fcntl: $!";
|
||||
$fh = $rw ? ${*$me}[0] : ${*$me}[1];
|
||||
} else {
|
||||
shift;
|
||||
$fh = $rw ? $me->reader() : $me->writer(); # close the other end
|
||||
}
|
||||
bless $io, "IO::Handle";
|
||||
$io->fdopen($fh, $mode);
|
||||
$fh->close;
|
||||
|
||||
if ($do_spawn) {
|
||||
$pid = eval { system 1, @_ }; # 1 == P_NOWAIT
|
||||
my $err = $!;
|
||||
|
||||
$io->fdopen($save, $mode);
|
||||
$save->close or croak "Cannot close $!";
|
||||
croak "IO::Pipe: Cannot spawn-NOWAIT: $err" if not $pid or $pid < 0;
|
||||
return $pid;
|
||||
} else {
|
||||
exec { $_[0] } @_ or # XXX change here
|
||||
croak "IO::Pipe: Cannot exec: $!";
|
||||
}
|
||||
}
|
||||
else {
|
||||
croak "IO::Pipe: Cannot fork: $!";
|
||||
}
|
||||
|
||||
# NOT Reached
|
||||
}
|
||||
|
||||
1;
|
||||
@@ -1,196 +0,0 @@
|
||||
# -*- Mode: perl; indent-tabs-mode: nil -*-
|
||||
#
|
||||
# The contents of this file are subject to the Mozilla Public
|
||||
# License Version 1.1 (the "License"); you may not use this file
|
||||
# except in compliance with the License. You may obtain a copy of
|
||||
# the License at http://www.mozilla.org/MPL/
|
||||
#
|
||||
# Software distributed under the License is distributed on an "AS
|
||||
# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express or
|
||||
# implied. See the License for the specific language governing
|
||||
# rights and limitations under the License.
|
||||
#
|
||||
# The Original Code is the Bugzilla Bug Tracking System.
|
||||
#
|
||||
# The Initial Developer of the Original Code is Netscape Communications
|
||||
# Corporation. Portions created by Netscape are
|
||||
# Copyright (C) 1998 Netscape Communications Corporation. All
|
||||
# Rights Reserved.
|
||||
#
|
||||
# Contributor(s): Harrison Page <harrison@netscape.com>
|
||||
# Terry Weissman <terry@mozilla.org>
|
||||
# Ian Hickson <mozbot@hixie.ch>
|
||||
|
||||
package Mails;
|
||||
use strict;
|
||||
use Carp;
|
||||
|
||||
# User must declare the following package global variables:
|
||||
# $Mails::owner = \'e-mail address of owner';
|
||||
# $Mails::smtphost = 'name of SMTP server';
|
||||
# $Mails::debug = \&function to print debug messages # better solutions welcome
|
||||
|
||||
# send mail to the owner
|
||||
sub mailowner {
|
||||
my ($subject, $text) = @_;
|
||||
&$Mails::debug('I am going to mail the owner!!!');
|
||||
return &sendmail($$Mails::owner, $0, $subject, $text);
|
||||
}
|
||||
|
||||
sub RFC822time {
|
||||
# Returns today's date as an RFC822 compliant string with the
|
||||
# exception that the year is returned as four digits. In my
|
||||
# extremely valuable opinion RFC822 was wrong to specify the year
|
||||
# as two digits. Many email systems generate four-digit years.
|
||||
|
||||
# Today is defined as the first parameter, if given, or else the
|
||||
# value that time() gives.
|
||||
|
||||
my ($tsec,$tmin,$thour,$tmday,$tmon,$tyear,$twday,$tyday,$tisdst) = gmtime(shift || time());
|
||||
$tyear += 1900; # as mentioned above, this is not RFC822 compliant, but is Y2K-safe.
|
||||
$tsec = "0$tsec" if $tsec < 10;
|
||||
$tmin = "0$tmin" if $tmin < 10;
|
||||
$thour = "0$thour" if $thour < 10;
|
||||
$tmon = ('Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec')[$tmon];
|
||||
$twday = ('Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat')[$twday];
|
||||
return "$twday, $tmday $tmon $tyear $thour:$tmin:$tsec GMT";
|
||||
|
||||
}
|
||||
|
||||
sub sendmail {
|
||||
my ($to, $from, $subject, $text, $sig) = (@_, $0);
|
||||
eval {
|
||||
use Net::SMTP;
|
||||
my $date = &RFC822time();
|
||||
my $smtp = Net::SMTP->new($Mails::smtphost) or confess("Could not create SMTP connection to $Mails::smtphost! Giving Up");
|
||||
$smtp->mail($ENV{USER}); # XXX ?
|
||||
$smtp->to($to);
|
||||
$smtp->data(<<end);
|
||||
X-Mailer: $0, Mails.pm; $$Mails::owner
|
||||
To: $to
|
||||
From: $from
|
||||
Subject: $subject
|
||||
Date: $date
|
||||
|
||||
$text
|
||||
--
|
||||
$sig
|
||||
end
|
||||
$smtp->quit;
|
||||
} or do {
|
||||
&$Mails::debug('Failed to send e-mail.');
|
||||
&$Mails::debug($@);
|
||||
&$Mails::debug('-'x40);
|
||||
&$Mails::debug("To: $to");
|
||||
&$Mails::debug("From: $from");
|
||||
&$Mails::debug("Subject: $subject");
|
||||
&$Mails::debug("\n$text\n-- \n$sig");
|
||||
&$Mails::debug('-'x40);
|
||||
return 0;
|
||||
};
|
||||
return 1;
|
||||
}
|
||||
|
||||
|
||||
##########################################################
|
||||
#### The Mails ##########################################
|
||||
##########################################################
|
||||
|
||||
sub ServerDown {
|
||||
my ($server, $port, $localAddr, $nick, $ircname, $username) = @_;
|
||||
my $localAddrMessage;
|
||||
if (defined($localAddr)) {
|
||||
$localAddrMessage = <<end;
|
||||
You've configured me to assume that '$localAddr' is the address of the
|
||||
network interface to use. If this is wrong, change the localAddr
|
||||
setting in the configuration file (or remove it to enable autodetect).
|
||||
end
|
||||
} else {
|
||||
$localAddrMessage = <<end;
|
||||
I'm currently autodetecting the address of the network interface to
|
||||
use. If this host has more than one interface, set the localAddr
|
||||
setting in the configuration file to the IP address of the outgoing
|
||||
connection I should use.
|
||||
end
|
||||
}
|
||||
return &mailowner("Help! I can't talk to $server:$port!", <<end);
|
||||
|
||||
Hello Sir or Madam!
|
||||
|
||||
I'm afraid I could not connect to the IRC server. I tried, and will
|
||||
try and try again (unless you kill me...) but it was fruitless.
|
||||
|
||||
Could you kick the IRC server for me? Give it a right ol' booting.
|
||||
And hit the network connection while you are at it, would you please?
|
||||
|
||||
Thanks.
|
||||
|
||||
Here is what I was trying to connect to:
|
||||
|
||||
Server: $server
|
||||
Port: $port
|
||||
Nick: $nick
|
||||
Ircname: $ircname
|
||||
Username: $username
|
||||
|
||||
$localAddrMessage
|
||||
|
||||
Hope that helps.
|
||||
|
||||
Cheers,
|
||||
end
|
||||
}
|
||||
|
||||
sub ServerUp {
|
||||
my ($server) = @_;
|
||||
return &mailowner("Woohoo! $server let me in!", <<end);
|
||||
|
||||
Hello again.
|
||||
|
||||
You'll be happy to know that everything turned out for the better.
|
||||
|
||||
Seeya later,
|
||||
end
|
||||
}
|
||||
|
||||
sub NickShortage {
|
||||
my ($cfgfile, $hostname, $port, $username, $ircname, @nicks) = @_;
|
||||
local $" = "\n ";
|
||||
return &mailowner('There is a nick shortage!', <<end);
|
||||
|
||||
Hello Sir or Madam.
|
||||
|
||||
I could not find an unused nick on IRC.
|
||||
|
||||
I tried all of these:
|
||||
@nicks
|
||||
|
||||
If you like you could add some more nicks manually by
|
||||
editing my configuration file, "$cfgfile"... *hint* *hint*
|
||||
|
||||
Here is what I think I am connected to:
|
||||
|
||||
Hostname: $hostname
|
||||
Port: $port
|
||||
Username: $username
|
||||
IRC Name: $ircname
|
||||
|
||||
I'll e-mail you again when I manage to get on.
|
||||
|
||||
Seeya,
|
||||
end
|
||||
}
|
||||
|
||||
sub NickOk {
|
||||
my ($nick) = @_;
|
||||
return &mailowner("It's ok, I'm now using $nick as my nick.", <<end);
|
||||
|
||||
Hello again.
|
||||
|
||||
You'll be happy to know that everything turned out for the better.
|
||||
|
||||
Seeya later,
|
||||
end
|
||||
}
|
||||
|
||||
1; # end
|
||||
File diff suppressed because it is too large
Load Diff
@@ -1,5 +0,0 @@
|
||||
export PATH=/bin
|
||||
./mozbot.pl --chroot /config/default
|
||||
|
||||
# NOTE. This file requires that you follow the steps described in the
|
||||
# included INSTALL file.
|
||||
@@ -1,22 +0,0 @@
|
||||
#!/bin/bash
|
||||
#
|
||||
# run-mozbot-from-crontab: Script for restarting mozbot from crontab
|
||||
# Originally written by Joel Thornton <joelpt@eml.cc>
|
||||
#
|
||||
# This is good to use in your crontab for rebooting the bot
|
||||
# automagically upon its untimely demise. Use a line such as this in
|
||||
# your crontab:
|
||||
#
|
||||
# 0,5,10,15,20,25,30,35,40,45,50,55 * * * * $HOME/mozbot/run-mozbot-from-crontab
|
||||
#
|
||||
# Change the paths to your mozbot accordingly above and in the next
|
||||
# line.
|
||||
|
||||
cd $HOME/mozbot
|
||||
|
||||
# Create an empty .pid file first if it doesn't exist.
|
||||
touch ./mozbot.pid
|
||||
|
||||
ps -C mozbot.pl -o pid= | grep "`cat ./mozbot.pid`" ||
|
||||
( ( ./mozbot.pl >& /dev/null & ) ;
|
||||
ps -C mozbot.pl -o pid= | head --lines=1 > ./mozbot.pid )
|
||||
@@ -1,17 +0,0 @@
|
||||
CFLAGS=-g
|
||||
|
||||
OBJS=md5.o token.o main.o
|
||||
|
||||
all: $(OBJS) uuidgen
|
||||
|
||||
uuidgen: $(OBJS)
|
||||
gcc -o uuidgen $(OBJS)
|
||||
|
||||
md5.o: md5.c md5.h
|
||||
|
||||
token.o: token.c token.h
|
||||
|
||||
main.o: main.c
|
||||
|
||||
clean:
|
||||
rm -f *.o *~ core uuidgen
|
||||
@@ -1,17 +0,0 @@
|
||||
/* copyright? hah! it's 10 lines of code! */
|
||||
|
||||
#include <stdio.h>
|
||||
#include "token.h"
|
||||
|
||||
int main(int argc, char **argv) {
|
||||
uuid_state state;
|
||||
uuid_t uuid;
|
||||
char output[1024];
|
||||
|
||||
create_uuid_state(&state);
|
||||
create_token(&state, &uuid);
|
||||
format_token(output, &uuid);
|
||||
|
||||
printf("%s\n", output);
|
||||
|
||||
}
|
||||
@@ -1,263 +0,0 @@
|
||||
/*
|
||||
* This code implements the MD5 message-digest algorithm.
|
||||
* The algorithm is due to Ron Rivest. This code was
|
||||
* written by Colin Plumb in 1993, no copyright is claimed.
|
||||
* This code is in the public domain; do with it what you wish.
|
||||
*
|
||||
* Equivalent code is available from RSA Data Security, Inc.
|
||||
* This code has been tested against that, and is equivalent,
|
||||
* except that you don't need to include two pages of legalese
|
||||
* with every copy.
|
||||
*
|
||||
* To compute the message digest of a chunk of bytes, declare an
|
||||
* MD5Context structure, pass it to MD5Init, call MD5Update as
|
||||
* needed on buffers full of bytes, and then call MD5Final, which
|
||||
* will fill a supplied 16-byte array with the digest.
|
||||
*/
|
||||
|
||||
/* Brutally hacked by John Walker back from ANSI C to K&R (no
|
||||
prototypes) to maintain the tradition that Netfone will compile
|
||||
with Sun's original "cc". */
|
||||
|
||||
#include <memory.h> /* for memcpy() */
|
||||
#include "md5.h"
|
||||
|
||||
#ifdef sgi
|
||||
#define HIGHFIRST
|
||||
#endif
|
||||
|
||||
#ifdef sun
|
||||
#define HIGHFIRST
|
||||
#endif
|
||||
|
||||
#ifndef HIGHFIRST
|
||||
#define byteReverse(buf, len) /* Nothing */
|
||||
#else
|
||||
/*
|
||||
* Note: this code is harmless on little-endian machines.
|
||||
*/
|
||||
void byteReverse(buf, longs)
|
||||
unsigned char *buf; unsigned longs;
|
||||
{
|
||||
uint32 t;
|
||||
do {
|
||||
t = (uint32) ((unsigned) buf[3] << 8 | buf[2]) << 16 |
|
||||
((unsigned) buf[1] << 8 | buf[0]);
|
||||
*(uint32 *) buf = t;
|
||||
buf += 4;
|
||||
} while (--longs);
|
||||
}
|
||||
#endif
|
||||
|
||||
/*
|
||||
* Start MD5 accumulation. Set bit count to 0 and buffer to mysterious
|
||||
* initialization constants.
|
||||
*/
|
||||
void MD5Init(ctx)
|
||||
struct MD5Context *ctx;
|
||||
{
|
||||
ctx->buf[0] = 0x67452301;
|
||||
ctx->buf[1] = 0xefcdab89;
|
||||
ctx->buf[2] = 0x98badcfe;
|
||||
ctx->buf[3] = 0x10325476;
|
||||
|
||||
ctx->bits[0] = 0;
|
||||
ctx->bits[1] = 0;
|
||||
}
|
||||
|
||||
/*
|
||||
* Update context to reflect the concatenation of another buffer full
|
||||
* of bytes.
|
||||
*/
|
||||
void MD5Update(ctx, buf, len)
|
||||
struct MD5Context *ctx; unsigned char *buf; unsigned len;
|
||||
{
|
||||
uint32 t;
|
||||
|
||||
/* Update bitcount */
|
||||
|
||||
t = ctx->bits[0];
|
||||
if ((ctx->bits[0] = t + ((uint32) len << 3)) < t)
|
||||
ctx->bits[1]++; /* Carry from low to high */
|
||||
ctx->bits[1] += len >> 29;
|
||||
|
||||
t = (t >> 3) & 0x3f; /* Bytes already in shsInfo->data */
|
||||
|
||||
/* Handle any leading odd-sized chunks */
|
||||
|
||||
if (t) {
|
||||
unsigned char *p = (unsigned char *) ctx->in + t;
|
||||
|
||||
t = 64 - t;
|
||||
if (len < t) {
|
||||
memcpy(p, buf, len);
|
||||
return;
|
||||
}
|
||||
memcpy(p, buf, t);
|
||||
byteReverse(ctx->in, 16);
|
||||
MD5Transform(ctx->buf, (uint32 *) ctx->in);
|
||||
buf += t;
|
||||
len -= t;
|
||||
}
|
||||
/* Process data in 64-byte chunks */
|
||||
|
||||
while (len >= 64) {
|
||||
memcpy(ctx->in, buf, 64);
|
||||
byteReverse(ctx->in, 16);
|
||||
MD5Transform(ctx->buf, (uint32 *) ctx->in);
|
||||
buf += 64;
|
||||
len -= 64;
|
||||
}
|
||||
|
||||
/* Handle any remaining bytes of data. */
|
||||
|
||||
memcpy(ctx->in, buf, len);
|
||||
}
|
||||
|
||||
/*
|
||||
* Final wrapup - pad to 64-byte boundary with the bit pattern
|
||||
* 1 0* (64-bit count of bits processed, MSB-first)
|
||||
*/
|
||||
void MD5Final(digest, ctx)
|
||||
unsigned char digest[16]; struct MD5Context *ctx;
|
||||
{
|
||||
unsigned count;
|
||||
unsigned char *p;
|
||||
|
||||
/* Compute number of bytes mod 64 */
|
||||
count = (ctx->bits[0] >> 3) & 0x3F;
|
||||
|
||||
/* Set the first char of padding to 0x80. This is safe since there is
|
||||
always at least one byte free */
|
||||
p = ctx->in + count;
|
||||
*p++ = 0x80;
|
||||
|
||||
/* Bytes of padding needed to make 64 bytes */
|
||||
count = 64 - 1 - count;
|
||||
|
||||
/* Pad out to 56 mod 64 */
|
||||
if (count < 8) {
|
||||
/* Two lots of padding: Pad the first block to 64 bytes */
|
||||
memset(p, 0, count);
|
||||
byteReverse(ctx->in, 16);
|
||||
MD5Transform(ctx->buf, (uint32 *) ctx->in);
|
||||
|
||||
/* Now fill the next block with 56 bytes */
|
||||
memset(ctx->in, 0, 56);
|
||||
} else {
|
||||
/* Pad block to 56 bytes */
|
||||
memset(p, 0, count - 8);
|
||||
}
|
||||
byteReverse(ctx->in, 14);
|
||||
|
||||
/* Append length in bits and transform */
|
||||
((uint32 *) ctx->in)[14] = ctx->bits[0];
|
||||
((uint32 *) ctx->in)[15] = ctx->bits[1];
|
||||
|
||||
MD5Transform(ctx->buf, (uint32 *) ctx->in);
|
||||
byteReverse((unsigned char *) ctx->buf, 4);
|
||||
memcpy(digest, ctx->buf, 16);
|
||||
memset(ctx, 0, sizeof(ctx)); /* In case it's sensitive */
|
||||
}
|
||||
|
||||
|
||||
/* The four core functions - F1 is optimized somewhat */
|
||||
|
||||
/* #define F1(x, y, z) (x & y | ~x & z) */
|
||||
#define F1(x, y, z) (z ^ (x & (y ^ z)))
|
||||
#define F2(x, y, z) F1(z, x, y)
|
||||
#define F3(x, y, z) (x ^ y ^ z)
|
||||
#define F4(x, y, z) (y ^ (x | ~z))
|
||||
|
||||
/* This is the central step in the MD5 algorithm. */
|
||||
#define MD5STEP(f, w, x, y, z, data, s) \
|
||||
( w += f(x, y, z) + data, w = w<<s | w>>(32-s), w += x )
|
||||
|
||||
/*
|
||||
* The core of the MD5 algorithm, this alters an existing MD5 hash to
|
||||
* reflect the addition of 16 longwords of new data. MD5Update blocks
|
||||
* the data and converts bytes into longwords for this routine.
|
||||
*/
|
||||
void MD5Transform(buf, in)
|
||||
uint32 buf[4]; uint32 in[16];
|
||||
{
|
||||
register uint32 a, b, c, d;
|
||||
|
||||
a = buf[0];
|
||||
b = buf[1];
|
||||
c = buf[2];
|
||||
d = buf[3];
|
||||
|
||||
MD5STEP(F1, a, b, c, d, in[0] + 0xd76aa478, 7);
|
||||
MD5STEP(F1, d, a, b, c, in[1] + 0xe8c7b756, 12);
|
||||
MD5STEP(F1, c, d, a, b, in[2] + 0x242070db, 17);
|
||||
MD5STEP(F1, b, c, d, a, in[3] + 0xc1bdceee, 22);
|
||||
MD5STEP(F1, a, b, c, d, in[4] + 0xf57c0faf, 7);
|
||||
MD5STEP(F1, d, a, b, c, in[5] + 0x4787c62a, 12);
|
||||
MD5STEP(F1, c, d, a, b, in[6] + 0xa8304613, 17);
|
||||
MD5STEP(F1, b, c, d, a, in[7] + 0xfd469501, 22);
|
||||
MD5STEP(F1, a, b, c, d, in[8] + 0x698098d8, 7);
|
||||
MD5STEP(F1, d, a, b, c, in[9] + 0x8b44f7af, 12);
|
||||
MD5STEP(F1, c, d, a, b, in[10] + 0xffff5bb1, 17);
|
||||
MD5STEP(F1, b, c, d, a, in[11] + 0x895cd7be, 22);
|
||||
MD5STEP(F1, a, b, c, d, in[12] + 0x6b901122, 7);
|
||||
MD5STEP(F1, d, a, b, c, in[13] + 0xfd987193, 12);
|
||||
MD5STEP(F1, c, d, a, b, in[14] + 0xa679438e, 17);
|
||||
MD5STEP(F1, b, c, d, a, in[15] + 0x49b40821, 22);
|
||||
|
||||
MD5STEP(F2, a, b, c, d, in[1] + 0xf61e2562, 5);
|
||||
MD5STEP(F2, d, a, b, c, in[6] + 0xc040b340, 9);
|
||||
MD5STEP(F2, c, d, a, b, in[11] + 0x265e5a51, 14);
|
||||
MD5STEP(F2, b, c, d, a, in[0] + 0xe9b6c7aa, 20);
|
||||
MD5STEP(F2, a, b, c, d, in[5] + 0xd62f105d, 5);
|
||||
MD5STEP(F2, d, a, b, c, in[10] + 0x02441453, 9);
|
||||
MD5STEP(F2, c, d, a, b, in[15] + 0xd8a1e681, 14);
|
||||
MD5STEP(F2, b, c, d, a, in[4] + 0xe7d3fbc8, 20);
|
||||
MD5STEP(F2, a, b, c, d, in[9] + 0x21e1cde6, 5);
|
||||
MD5STEP(F2, d, a, b, c, in[14] + 0xc33707d6, 9);
|
||||
MD5STEP(F2, c, d, a, b, in[3] + 0xf4d50d87, 14);
|
||||
MD5STEP(F2, b, c, d, a, in[8] + 0x455a14ed, 20);
|
||||
MD5STEP(F2, a, b, c, d, in[13] + 0xa9e3e905, 5);
|
||||
MD5STEP(F2, d, a, b, c, in[2] + 0xfcefa3f8, 9);
|
||||
MD5STEP(F2, c, d, a, b, in[7] + 0x676f02d9, 14);
|
||||
MD5STEP(F2, b, c, d, a, in[12] + 0x8d2a4c8a, 20);
|
||||
|
||||
MD5STEP(F3, a, b, c, d, in[5] + 0xfffa3942, 4);
|
||||
MD5STEP(F3, d, a, b, c, in[8] + 0x8771f681, 11);
|
||||
MD5STEP(F3, c, d, a, b, in[11] + 0x6d9d6122, 16);
|
||||
MD5STEP(F3, b, c, d, a, in[14] + 0xfde5380c, 23);
|
||||
MD5STEP(F3, a, b, c, d, in[1] + 0xa4beea44, 4);
|
||||
MD5STEP(F3, d, a, b, c, in[4] + 0x4bdecfa9, 11);
|
||||
MD5STEP(F3, c, d, a, b, in[7] + 0xf6bb4b60, 16);
|
||||
MD5STEP(F3, b, c, d, a, in[10] + 0xbebfbc70, 23);
|
||||
MD5STEP(F3, a, b, c, d, in[13] + 0x289b7ec6, 4);
|
||||
MD5STEP(F3, d, a, b, c, in[0] + 0xeaa127fa, 11);
|
||||
MD5STEP(F3, c, d, a, b, in[3] + 0xd4ef3085, 16);
|
||||
MD5STEP(F3, b, c, d, a, in[6] + 0x04881d05, 23);
|
||||
MD5STEP(F3, a, b, c, d, in[9] + 0xd9d4d039, 4);
|
||||
MD5STEP(F3, d, a, b, c, in[12] + 0xe6db99e5, 11);
|
||||
MD5STEP(F3, c, d, a, b, in[15] + 0x1fa27cf8, 16);
|
||||
MD5STEP(F3, b, c, d, a, in[2] + 0xc4ac5665, 23);
|
||||
|
||||
MD5STEP(F4, a, b, c, d, in[0] + 0xf4292244, 6);
|
||||
MD5STEP(F4, d, a, b, c, in[7] + 0x432aff97, 10);
|
||||
MD5STEP(F4, c, d, a, b, in[14] + 0xab9423a7, 15);
|
||||
MD5STEP(F4, b, c, d, a, in[5] + 0xfc93a039, 21);
|
||||
MD5STEP(F4, a, b, c, d, in[12] + 0x655b59c3, 6);
|
||||
MD5STEP(F4, d, a, b, c, in[3] + 0x8f0ccc92, 10);
|
||||
MD5STEP(F4, c, d, a, b, in[10] + 0xffeff47d, 15);
|
||||
MD5STEP(F4, b, c, d, a, in[1] + 0x85845dd1, 21);
|
||||
MD5STEP(F4, a, b, c, d, in[8] + 0x6fa87e4f, 6);
|
||||
MD5STEP(F4, d, a, b, c, in[15] + 0xfe2ce6e0, 10);
|
||||
MD5STEP(F4, c, d, a, b, in[6] + 0xa3014314, 15);
|
||||
MD5STEP(F4, b, c, d, a, in[13] + 0x4e0811a1, 21);
|
||||
MD5STEP(F4, a, b, c, d, in[4] + 0xf7537e82, 6);
|
||||
MD5STEP(F4, d, a, b, c, in[11] + 0xbd3af235, 10);
|
||||
MD5STEP(F4, c, d, a, b, in[2] + 0x2ad7d2bb, 15);
|
||||
MD5STEP(F4, b, c, d, a, in[9] + 0xeb86d391, 21);
|
||||
|
||||
buf[0] += a;
|
||||
buf[1] += b;
|
||||
buf[2] += c;
|
||||
buf[3] += d;
|
||||
}
|
||||
@@ -1,26 +0,0 @@
|
||||
#ifndef MD5_H
|
||||
#define MD5_H
|
||||
|
||||
#ifdef __alpha
|
||||
typedef unsigned int uint32;
|
||||
#else
|
||||
typedef unsigned long uint32;
|
||||
#endif
|
||||
|
||||
struct MD5Context {
|
||||
uint32 buf[4];
|
||||
uint32 bits[2];
|
||||
unsigned char in[64];
|
||||
};
|
||||
|
||||
extern void MD5Init();
|
||||
extern void MD5Update();
|
||||
extern void MD5Final();
|
||||
extern void MD5Transform();
|
||||
|
||||
/*
|
||||
* This is needed to make RSAREF happy on some MS-DOS compilers.
|
||||
*/
|
||||
typedef struct MD5Context MD5_CTX;
|
||||
|
||||
#endif /* !MD5_H */
|
||||
@@ -1,356 +0,0 @@
|
||||
/*
|
||||
** Copyright (C) 1998-1999 Greg Stein. All Rights Reserved.
|
||||
**
|
||||
** By using this file, you agree to the terms and conditions set forth in
|
||||
** the LICENSE.html file which can be found at the top level of the mod_dav
|
||||
** distribution or at http://www.webdav.org/mod_dav/license-1.html.
|
||||
**
|
||||
** Contact information:
|
||||
** Greg Stein, PO Box 3151, Redmond, WA, 98073
|
||||
** gstein@lyra.org, http://www.webdav.org/mod_dav/
|
||||
*/
|
||||
|
||||
/*
|
||||
** DAV opaquelocktoken scheme implementation
|
||||
**
|
||||
** Written 5/99 by Keith Wannamaker, wannamak@us.ibm.com
|
||||
** Adapted from ISO/DCE RPC spec and a former Internet Draft
|
||||
** by Leach and Salz:
|
||||
** http://www.ics.uci.edu/pub/ietf/webdav/uuid-guid/draft-leach-uuids-guids-01
|
||||
**
|
||||
** Portions of the code are covered by the following license:
|
||||
**
|
||||
** Copyright (c) 1990- 1993, 1996 Open Software Foundation, Inc.
|
||||
** Copyright (c) 1989 by Hewlett-Packard Company, Palo Alto, Ca. &
|
||||
** Digital Equipment Corporation, Maynard, Mass.
|
||||
** Copyright (c) 1998 Microsoft.
|
||||
** To anyone who acknowledges that this file is provided "AS IS"
|
||||
** without any express or implied warranty: permission to use, copy,
|
||||
** modify, and distribute this file for any purpose is hereby
|
||||
** granted without fee, provided that the above copyright notices and
|
||||
** this notice appears in all source code copies, and that none of
|
||||
** the names of Open Software Foundation, Inc., Hewlett-Packard
|
||||
** Company, or Digital Equipment Corporation be used in advertising
|
||||
** or publicity pertaining to distribution of the software without
|
||||
** specific, written prior permission. Neither Open Software
|
||||
** Foundation, Inc., Hewlett-Packard Company, Microsoft, nor Digital Equipment
|
||||
** Corporation makes any representations about the suitability of
|
||||
** this software for any purpose.
|
||||
*/
|
||||
|
||||
#include <string.h>
|
||||
#include <stdio.h>
|
||||
#include <stdlib.h>
|
||||
#include <time.h>
|
||||
|
||||
#include "md5.h"
|
||||
#include "token.h"
|
||||
|
||||
#ifdef WIN32
|
||||
#include <windows.h>
|
||||
#else
|
||||
#include <sys/types.h>
|
||||
#include <sys/time.h>
|
||||
#include <sys/sysinfo.h>
|
||||
#endif
|
||||
|
||||
/* set the following to the number of 100ns ticks of the actual resolution of
|
||||
your system's clock */
|
||||
#define UUIDS_PER_TICK 1024
|
||||
|
||||
/* Set this to what your compiler uses for 64 bit data type */
|
||||
#ifdef WIN32
|
||||
#define unsigned64_t unsigned __int64
|
||||
#define I64(C) C
|
||||
#else
|
||||
#define unsigned64_t unsigned long long
|
||||
#define I64(C) C##LL
|
||||
#endif
|
||||
|
||||
typedef unsigned64_t uuid_time_t;
|
||||
|
||||
const uuid_t null_locktoken = {0};
|
||||
|
||||
static void format_uuid_v1(uuid_t * uuid, unsigned16 clockseq, uuid_time_t timestamp, uuid_node_t node);
|
||||
static void get_current_time(uuid_time_t * timestamp);
|
||||
static unsigned16 true_random(void);
|
||||
static void get_pseudo_node_identifier(uuid_node_t *node);
|
||||
static void get_system_time(uuid_time_t *uuid_time);
|
||||
static void get_random_info(unsigned char seed[16]);
|
||||
|
||||
|
||||
/* dav_create_opaquelocktoken - generates a UUID version 1 token.
|
||||
* Clock_sequence and node_address set to pseudo-random
|
||||
* numbers during init.
|
||||
*
|
||||
* Should postpend pid to account for non-seralized creation?
|
||||
*/
|
||||
int create_token(uuid_state *st, uuid_t *u)
|
||||
{
|
||||
uuid_time_t timestamp;
|
||||
|
||||
get_current_time(×tamp);
|
||||
format_uuid_v1(u, st->cs, timestamp, st->node);
|
||||
|
||||
return 1;
|
||||
}
|
||||
|
||||
/*
|
||||
* dav_create_uuid_state - seed UUID state with pseudorandom data
|
||||
*/
|
||||
void create_uuid_state(uuid_state *st)
|
||||
{
|
||||
st->cs = true_random();
|
||||
get_pseudo_node_identifier(&st->node);
|
||||
}
|
||||
|
||||
/*
|
||||
* dav_format_opaquelocktoken - generates a text representation
|
||||
* of an opaquelocktoken
|
||||
*/
|
||||
void format_token(char *target, const uuid_t *u)
|
||||
{
|
||||
sprintf(target, "%08lx-%04x-%04x-%02x%02x-%02x%02x%02x%02x%02x%02x",
|
||||
u->time_low, u->time_mid, u->time_hi_and_version,
|
||||
u->clock_seq_hi_and_reserved, u->clock_seq_low,
|
||||
u->node[0], u->node[1], u->node[2],
|
||||
u->node[3], u->node[4], u->node[5]);
|
||||
}
|
||||
|
||||
/* convert a pair of hex digits to an integer value [0,255] */
|
||||
static int dav_parse_hexpair(const char *s)
|
||||
{
|
||||
int result;
|
||||
int temp;
|
||||
|
||||
result = s[0] - '0';
|
||||
if (result > 48)
|
||||
result = (result - 39) << 4;
|
||||
else if (result > 16)
|
||||
result = (result - 7) << 4;
|
||||
else
|
||||
result = result << 4;
|
||||
|
||||
temp = s[1] - '0';
|
||||
if (temp > 48)
|
||||
result |= temp - 39;
|
||||
else if (temp > 16)
|
||||
result |= temp - 7;
|
||||
else
|
||||
result |= temp;
|
||||
|
||||
return result;
|
||||
}
|
||||
|
||||
/* dav_parse_locktoken: Parses string produced from
|
||||
* dav_format_opaquelocktoken back into a uuid_t
|
||||
* structure. On failure, return DAV_IF_ERROR_PARSE,
|
||||
* else DAV_IF_ERROR_NONE.
|
||||
*/
|
||||
int parse_token(const char *char_token, uuid_t *bin_token)
|
||||
{
|
||||
int i;
|
||||
|
||||
for (i = 0; i < 36; ++i) {
|
||||
char c = char_token[i];
|
||||
if (!isxdigit(c) &&
|
||||
!(c == '-' && (i == 8 || i == 13 || i == 18 || i == 23)))
|
||||
return -1;
|
||||
}
|
||||
if (char_token[36] != '\0')
|
||||
return -1;
|
||||
|
||||
bin_token->time_low =
|
||||
(dav_parse_hexpair(&char_token[0]) << 24) |
|
||||
(dav_parse_hexpair(&char_token[2]) << 16) |
|
||||
(dav_parse_hexpair(&char_token[4]) << 8) |
|
||||
dav_parse_hexpair(&char_token[6]);
|
||||
|
||||
bin_token->time_mid =
|
||||
(dav_parse_hexpair(&char_token[9]) << 8) |
|
||||
dav_parse_hexpair(&char_token[11]);
|
||||
|
||||
bin_token->time_hi_and_version =
|
||||
(dav_parse_hexpair(&char_token[14]) << 8) |
|
||||
dav_parse_hexpair(&char_token[16]);
|
||||
|
||||
bin_token->clock_seq_hi_and_reserved = dav_parse_hexpair(&char_token[19]);
|
||||
bin_token->clock_seq_low = dav_parse_hexpair(&char_token[21]);
|
||||
|
||||
for (i = 6; i--;)
|
||||
bin_token->node[i] = dav_parse_hexpair(&char_token[i*2+24]);
|
||||
|
||||
return -1;
|
||||
}
|
||||
|
||||
/* dav_compare_opaquelocktoken:
|
||||
* < 0 : a < b
|
||||
* == 0 : a = b
|
||||
* > 0 : a > b
|
||||
*/
|
||||
int compare_token(const uuid_t a, const uuid_t b)
|
||||
{
|
||||
return memcmp(&a, &b, sizeof(uuid_t));
|
||||
}
|
||||
|
||||
/* format_uuid_v1 -- make a UUID from the timestamp, clockseq, and node ID */
|
||||
static void format_uuid_v1(uuid_t * uuid, unsigned16 clock_seq,
|
||||
uuid_time_t timestamp, uuid_node_t node)
|
||||
{
|
||||
/* Construct a version 1 uuid with the information we've gathered
|
||||
* plus a few constants. */
|
||||
uuid->time_low = (unsigned long)(timestamp & 0xFFFFFFFF);
|
||||
uuid->time_mid = (unsigned short)((timestamp >> 32) & 0xFFFF);
|
||||
uuid->time_hi_and_version = (unsigned short)((timestamp >> 48) & 0x0FFF);
|
||||
uuid->time_hi_and_version |= (1 << 12);
|
||||
uuid->clock_seq_low = clock_seq & 0xFF;
|
||||
uuid->clock_seq_hi_and_reserved = (clock_seq & 0x3F00) >> 8;
|
||||
uuid->clock_seq_hi_and_reserved |= 0x80;
|
||||
memcpy(&uuid->node, &node, sizeof uuid->node);
|
||||
}
|
||||
|
||||
/* get-current_time -- get time as 60 bit 100ns ticks since whenever.
|
||||
Compensate for the fact that real clock resolution is less than 100ns. */
|
||||
static void get_current_time(uuid_time_t * timestamp)
|
||||
{
|
||||
uuid_time_t time_now;
|
||||
static uuid_time_t time_last;
|
||||
static unsigned16 uuids_this_tick;
|
||||
static int inited = 0;
|
||||
|
||||
if (!inited) {
|
||||
get_system_time(&time_now);
|
||||
uuids_this_tick = UUIDS_PER_TICK;
|
||||
inited = 1;
|
||||
};
|
||||
|
||||
while (1) {
|
||||
get_system_time(&time_now);
|
||||
|
||||
/* if clock reading changed since last UUID generated... */
|
||||
if (time_last != time_now) {
|
||||
/* reset count of uuids gen'd with this clock reading */
|
||||
uuids_this_tick = 0;
|
||||
break;
|
||||
};
|
||||
if (uuids_this_tick < UUIDS_PER_TICK) {
|
||||
uuids_this_tick++;
|
||||
break;
|
||||
}; /* going too fast for our clock; spin */
|
||||
}; /* add the count of uuids to low order bits of the clock reading */
|
||||
|
||||
*timestamp = time_now + uuids_this_tick;
|
||||
}
|
||||
|
||||
/* true_random -- generate a crypto-quality random number.
|
||||
This sample doesn't do that. */
|
||||
static unsigned16 true_random(void)
|
||||
{
|
||||
uuid_time_t time_now;
|
||||
|
||||
get_system_time(&time_now);
|
||||
time_now = time_now/UUIDS_PER_TICK;
|
||||
srand((unsigned int)(((time_now >> 32) ^ time_now)&0xffffffff));
|
||||
|
||||
return rand();
|
||||
}
|
||||
|
||||
/* This sample implementation generates a random node ID *
|
||||
* in lieu of a system dependent call to get IEEE node ID. */
|
||||
static void get_pseudo_node_identifier(uuid_node_t *node)
|
||||
{
|
||||
unsigned char seed[16];
|
||||
|
||||
get_random_info(seed);
|
||||
seed[0] |= 0x80;
|
||||
memcpy(node, seed, sizeof(*node));
|
||||
}
|
||||
|
||||
/* system dependent call to get the current system time.
|
||||
Returned as 100ns ticks since Oct 15, 1582, but resolution may be
|
||||
less than 100ns. */
|
||||
|
||||
#ifdef WIN32
|
||||
|
||||
static void get_system_time(uuid_time_t *uuid_time)
|
||||
{
|
||||
ULARGE_INTEGER time;
|
||||
|
||||
GetSystemTimeAsFileTime((FILETIME *)&time);
|
||||
|
||||
/* NT keeps time in FILETIME format which is 100ns ticks since
|
||||
Jan 1, 1601. UUIDs use time in 100ns ticks since Oct 15, 1582.
|
||||
The difference is 17 Days in Oct + 30 (Nov) + 31 (Dec)
|
||||
+ 18 years and 5 leap days. */
|
||||
|
||||
time.QuadPart +=
|
||||
(unsigned __int64) (1000*1000*10) // seconds
|
||||
* (unsigned __int64) (60 * 60 * 24) // days
|
||||
* (unsigned __int64) (17+30+31+365*18+5); // # of days
|
||||
*uuid_time = time.QuadPart;
|
||||
}
|
||||
|
||||
static void get_random_info(unsigned char seed[16])
|
||||
{
|
||||
MD5_CTX c;
|
||||
struct {
|
||||
MEMORYSTATUS m;
|
||||
SYSTEM_INFO s;
|
||||
FILETIME t;
|
||||
LARGE_INTEGER pc;
|
||||
DWORD tc;
|
||||
DWORD l;
|
||||
char hostname[MAX_COMPUTERNAME_LENGTH + 1];
|
||||
|
||||
} r;
|
||||
|
||||
MD5Init(&c); /* memory usage stats */
|
||||
GlobalMemoryStatus(&r.m); /* random system stats */
|
||||
GetSystemInfo(&r.s); /* 100ns resolution (nominally) time of day */
|
||||
GetSystemTimeAsFileTime(&r.t); /* high resolution performance counter */
|
||||
QueryPerformanceCounter(&r.pc); /* milliseconds since last boot */
|
||||
r.tc = GetTickCount();
|
||||
r.l = MAX_COMPUTERNAME_LENGTH + 1;
|
||||
|
||||
GetComputerName(r.hostname, &r.l );
|
||||
MD5Update(&c, (const unsigned char *) &r, sizeof(r));
|
||||
MD5Final(seed, &c);
|
||||
}
|
||||
|
||||
#else /* WIN32 */
|
||||
|
||||
static void get_system_time(uuid_time_t *uuid_time)
|
||||
{
|
||||
struct timeval tp;
|
||||
|
||||
gettimeofday(&tp, (struct timezone *)0);
|
||||
|
||||
/* Offset between UUID formatted times and Unix formatted times.
|
||||
UUID UTC base time is October 15, 1582.
|
||||
Unix base time is January 1, 1970. */
|
||||
*uuid_time = (tp.tv_sec * 10000000) + (tp.tv_usec * 10) +
|
||||
I64(0x01B21DD213814000);
|
||||
}
|
||||
|
||||
static void get_random_info(unsigned char seed[16])
|
||||
{
|
||||
MD5_CTX c;
|
||||
/* Leech & Salz use Linux-specific struct sysinfo;
|
||||
* replace with pid/tid for portability (in the spirit of mod_unique_id) */
|
||||
struct {
|
||||
/* Add thread id here, if applicable, when we get to pthread or apr */
|
||||
pid_t pid;
|
||||
struct timeval t;
|
||||
char hostname[257];
|
||||
|
||||
} r;
|
||||
|
||||
MD5Init(&c);
|
||||
r.pid = getpid();
|
||||
gettimeofday(&r.t, (struct timezone *)0);
|
||||
gethostname(r.hostname, 256);
|
||||
MD5Update(&c, (const unsigned char *)&r, sizeof(r));
|
||||
MD5Final(seed, &c);
|
||||
}
|
||||
|
||||
#endif /* WIN32 */
|
||||
@@ -1,80 +0,0 @@
|
||||
/*
|
||||
** Copyright (C) 1998-1999 Greg Stein. All Rights Reserved.
|
||||
**
|
||||
** By using this file, you agree to the terms and conditions set forth in
|
||||
** the LICENSE.html file which can be found at the top level of the mod_dav
|
||||
** distribution or at http://www.webdav.org/mod_dav/license-1.html.
|
||||
**
|
||||
** Contact information:
|
||||
** Greg Stein, PO Box 3151, Redmond, WA, 98073
|
||||
** gstein@lyra.org, http://www.webdav.org/mod_dav/
|
||||
*/
|
||||
|
||||
/*
|
||||
** DAV opaquelocktoken scheme implementation
|
||||
**
|
||||
** Written 5/99 by Keith Wannamaker, wannamak@us.ibm.com
|
||||
** Adapted from ISO/DCE RPC spec and a former Internet Draft
|
||||
** by Leach and Salz:
|
||||
** http://www.ics.uci.edu/pub/ietf/webdav/uuid-guid/draft-leach-uuids-guids-01
|
||||
**
|
||||
** Portions of the code are covered by the following license:
|
||||
**
|
||||
** Copyright (c) 1990- 1993, 1996 Open Software Foundation, Inc.
|
||||
** Copyright (c) 1989 by Hewlett-Packard Company, Palo Alto, Ca. &
|
||||
** Digital Equipment Corporation, Maynard, Mass.
|
||||
** Copyright (c) 1998 Microsoft.
|
||||
** To anyone who acknowledges that this file is provided "AS IS"
|
||||
** without any express or implied warranty: permission to use, copy,
|
||||
** modify, and distribute this file for any purpose is hereby
|
||||
** granted without fee, provided that the above copyright notices and
|
||||
** this notice appears in all source code copies, and that none of
|
||||
** the names of Open Software Foundation, Inc., Hewlett-Packard
|
||||
** Company, or Digital Equipment Corporation be used in advertising
|
||||
** or publicity pertaining to distribution of the software without
|
||||
** specific, written prior permission. Neither Open Software
|
||||
** Foundation, Inc., Hewlett-Packard Company, Microsoft, nor Digital Equipment
|
||||
** Corporation makes any representations about the suitability of
|
||||
** this software for any purpose.
|
||||
*/
|
||||
|
||||
#ifndef _TOKEN_H_
|
||||
#define _TOKEN_H_
|
||||
|
||||
typedef unsigned long unsigned32;
|
||||
typedef unsigned short unsigned16;
|
||||
typedef unsigned char unsigned8;
|
||||
|
||||
typedef struct {
|
||||
char nodeID[6];
|
||||
} uuid_node_t;
|
||||
|
||||
#undef uuid_t
|
||||
|
||||
typedef struct _uuid_t
|
||||
{
|
||||
unsigned32 time_low;
|
||||
unsigned16 time_mid;
|
||||
unsigned16 time_hi_and_version;
|
||||
unsigned8 clock_seq_hi_and_reserved;
|
||||
unsigned8 clock_seq_low;
|
||||
unsigned8 node[6];
|
||||
} uuid_t;
|
||||
|
||||
/* data type for UUID generator persistent state */
|
||||
|
||||
typedef struct {
|
||||
uuid_node_t node; /* saved node ID */
|
||||
unsigned16 cs; /* saved clock sequence */
|
||||
} uuid_state;
|
||||
|
||||
extern const uuid_t null_locktoken;
|
||||
|
||||
/* in dav_opaquelock.c */
|
||||
int create_token(uuid_state *st, uuid_t *u);
|
||||
void create_uuid_state(uuid_state *st);
|
||||
void format_token(char *target, const uuid_t *u);
|
||||
int compare_token(const uuid_t a, const uuid_t b);
|
||||
int parse_token(const char *char_token, uuid_t *bin_token);
|
||||
|
||||
#endif /* _TOKEN_H_ */
|
||||
30
mozilla/xpcom/ds/MANIFEST
Normal file
30
mozilla/xpcom/ds/MANIFEST
Normal file
@@ -0,0 +1,30 @@
|
||||
nsAVLTree.h
|
||||
nsCppSharedAllocator.h
|
||||
nsCRT.h
|
||||
nsDeque.h
|
||||
nsEnumeratorUtils.h
|
||||
nsHashtable.h
|
||||
nsHashtableEnumerator.h
|
||||
nsIArena.h
|
||||
nsIBuffer.h
|
||||
nsIByteBuffer.h
|
||||
nsIObserverList.h
|
||||
nsIPageManager.h
|
||||
nsIProperties.h
|
||||
nsISimpleEnumerator.h
|
||||
nsISizeOfHandler.h
|
||||
nsIUnicharBuffer.h
|
||||
nsIVariant.h
|
||||
nsInt64.h
|
||||
nsQuickSort.h
|
||||
nsStr.h
|
||||
nsString.h
|
||||
nsString2.h
|
||||
nsSupportsPrimitives.h
|
||||
nsTime.h
|
||||
nsUnitConversion.h
|
||||
nsVector.h
|
||||
nsVoidArray.h
|
||||
nsXPIDLString.h
|
||||
plvector.h
|
||||
nsTextFormater.h
|
||||
6
mozilla/xpcom/ds/MANIFEST_IDL
Normal file
6
mozilla/xpcom/ds/MANIFEST_IDL
Normal file
@@ -0,0 +1,6 @@
|
||||
nsIAtom.idl
|
||||
nsICollection.idl
|
||||
nsIEnumerator.idl
|
||||
nsIObserver.idl
|
||||
nsIObserverService.idl
|
||||
nsISupportsArray.idl
|
||||
113
mozilla/xpcom/ds/Makefile.in
Normal file
113
mozilla/xpcom/ds/Makefile.in
Normal file
@@ -0,0 +1,113 @@
|
||||
#
|
||||
# The contents of this file are subject to the Netscape Public License
|
||||
# Version 1.0 (the "NPL"); you may not use this file except in
|
||||
# compliance with the NPL. You may obtain a copy of the NPL at
|
||||
# http://www.mozilla.org/NPL/
|
||||
#
|
||||
# Software distributed under the NPL is distributed on an "AS IS" basis,
|
||||
# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
|
||||
# for the specific language governing rights and limitations under the
|
||||
# NPL.
|
||||
#
|
||||
# The Initial Developer of this code under the NPL is Netscape
|
||||
# Communications Corporation. Portions created by Netscape are
|
||||
# Copyright (C) 1998 Netscape Communications Corporation. All Rights
|
||||
# Reserved.
|
||||
#
|
||||
|
||||
DEPTH = ../..
|
||||
topsrcdir = @top_srcdir@
|
||||
srcdir = @srcdir@
|
||||
VPATH = @srcdir@
|
||||
|
||||
include $(DEPTH)/config/autoconf.mk
|
||||
|
||||
MODULE = xpcom
|
||||
XPIDL_MODULE = xpcom_ds
|
||||
LIBRARY_NAME = xpcomds_s
|
||||
|
||||
REQUIRES = xpcom uconv unicharutil
|
||||
|
||||
CPPSRCS = \
|
||||
nsArena.cpp \
|
||||
nsAtomTable.cpp \
|
||||
nsAVLTree.cpp \
|
||||
nsByteBuffer.cpp \
|
||||
nsCRT.cpp \
|
||||
nsConjoiningEnumerator.cpp \
|
||||
nsDeque.cpp \
|
||||
nsEmptyEnumerator.cpp \
|
||||
nsEnumeratorUtils.cpp \
|
||||
nsHashtable.cpp \
|
||||
nsHashtableEnumerator.cpp \
|
||||
nsObserver.cpp \
|
||||
nsObserverList.cpp \
|
||||
nsObserverService.cpp \
|
||||
nsProperties.cpp \
|
||||
nsQuickSort.cpp \
|
||||
nsSizeOfHandler.cpp \
|
||||
nsStr.cpp \
|
||||
nsString.cpp \
|
||||
nsString2.cpp \
|
||||
nsSupportsArray.cpp \
|
||||
nsSupportsArrayEnumerator.cpp \
|
||||
nsSupportsPrimitives.cpp \
|
||||
nsUnicharBuffer.cpp \
|
||||
nsVariant.cpp \
|
||||
nsVoidArray.cpp \
|
||||
nsXPIDLString.cpp \
|
||||
plvector.cpp \
|
||||
nsTextFormater.cpp \
|
||||
$(NULL)
|
||||
|
||||
EXPORTS = \
|
||||
nsAVLTree.h \
|
||||
nsCppSharedAllocator.h \
|
||||
nsCRT.h \
|
||||
nsDeque.h \
|
||||
nsEnumeratorUtils.h \
|
||||
nsHashtable.h \
|
||||
nsHashtableEnumerator.h \
|
||||
nsIArena.h \
|
||||
nsIByteBuffer.h \
|
||||
nsIObserverList.h \
|
||||
nsIProperties.h \
|
||||
nsISimpleEnumerator.h \
|
||||
nsISizeOfHandler.h \
|
||||
nsIUnicharBuffer.h \
|
||||
nsIVariant.h \
|
||||
nsInt64.h \
|
||||
nsQuickSort.h \
|
||||
nsStr.h \
|
||||
nsString.h \
|
||||
nsString2.h \
|
||||
nsSupportsPrimitives.h \
|
||||
nsTime.h \
|
||||
nsUnitConversion.h \
|
||||
nsVector.h \
|
||||
nsVoidArray.h \
|
||||
nsXPIDLString.h \
|
||||
plvector.h \
|
||||
nsTextFormater.h \
|
||||
$(NULL)
|
||||
|
||||
XPIDLSRCS = \
|
||||
nsIAtom.idl \
|
||||
nsICollection.idl \
|
||||
nsIEnumerator.idl \
|
||||
nsIObserver.idl \
|
||||
nsIObserverService.idl \
|
||||
nsISupportsArray.idl \
|
||||
nsISupportsPrimitives.idl \
|
||||
$(NULL)
|
||||
|
||||
EXPORTS := $(addprefix $(srcdir)/, $(EXPORTS))
|
||||
|
||||
# we don't want the shared lib, but we want to force the creation of a static lib.
|
||||
override NO_SHARED_LIB=1
|
||||
override NO_STATIC_LIB=
|
||||
|
||||
include $(topsrcdir)/config/rules.mk
|
||||
|
||||
DEFINES += -D_IMPL_NS_COM -D_IMPL_NS_BASE
|
||||
|
||||
758
mozilla/xpcom/ds/bufferRoutines.h
Normal file
758
mozilla/xpcom/ds/bufferRoutines.h
Normal file
@@ -0,0 +1,758 @@
|
||||
/* -*- Mode: C++; tab-width: 2; indent-tabs-mode: nil; c-basic-offset: 2 -*- */
|
||||
/*
|
||||
* The contents of this file are subject to the Netscape Public License
|
||||
* Version 1.0 (the "NPL"); you may not use this file except in
|
||||
* compliance with the NPL. You may obtain a copy of the NPL at
|
||||
* http://www.mozilla.org/NPL/
|
||||
*
|
||||
* Software distributed under the NPL is distributed on an "AS IS" basis,
|
||||
* WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
|
||||
* for the specific language governing rights and limitations under the
|
||||
* NPL.
|
||||
*
|
||||
* The Initial Developer of this code under the NPL is Netscape
|
||||
* Communications Corporation. Portions created by Netscape are
|
||||
* Copyright (C) 1998 Netscape Communications Corporation. All Rights
|
||||
* Reserved.
|
||||
*/
|
||||
|
||||
/******************************************************************************************
|
||||
MODULE NOTES:
|
||||
|
||||
This file contains the workhorse copy and shift functions used in nsStrStruct.
|
||||
Ultimately, I plan to make the function pointers in this system available for
|
||||
use by external modules. They'll be able to install their own "handlers".
|
||||
Not so, today though.
|
||||
|
||||
*******************************************************************************************/
|
||||
|
||||
#ifndef _BUFFERROUTINES_H
|
||||
#define _BUFFERROUTINES_H
|
||||
|
||||
#include "nsCRT.h"
|
||||
|
||||
#ifndef RICKG_TESTBED
|
||||
#include "nsUnicharUtilCIID.h"
|
||||
#include "nsIServiceManager.h"
|
||||
#include "nsICaseConversion.h"
|
||||
#endif
|
||||
|
||||
#define KSHIFTLEFT (0)
|
||||
#define KSHIFTRIGHT (1)
|
||||
|
||||
|
||||
inline PRUnichar GetUnicharAt(const char* aString,PRUint32 anIndex) {
|
||||
return ((PRUnichar*)aString)[anIndex];
|
||||
}
|
||||
|
||||
inline PRUnichar GetCharAt(const char* aString,PRUint32 anIndex) {
|
||||
return (PRUnichar)aString[anIndex];
|
||||
}
|
||||
|
||||
//----------------------------------------------------------------------------------------
|
||||
//
|
||||
// This set of methods is used to shift the contents of a char buffer.
|
||||
// The functions are differentiated by shift direction and the underlying charsize.
|
||||
//
|
||||
|
||||
/**
|
||||
* This method shifts single byte characters left by a given amount from an given offset.
|
||||
* @update gess 01/04/99
|
||||
* @param aDest is a ptr to a cstring where left-shift is to be performed
|
||||
* @param aLength is the known length of aDest
|
||||
* @param anOffset is the index into aDest where shifting shall begin
|
||||
* @param aCount is the number of chars to be "cut"
|
||||
*/
|
||||
void ShiftCharsLeft(char* aDest,PRUint32 aLength,PRUint32 anOffset,PRUint32 aCount) {
|
||||
char* dst = aDest+anOffset;
|
||||
char* src = aDest+anOffset+aCount;
|
||||
|
||||
memmove(dst,src,aLength-(aCount+anOffset));
|
||||
}
|
||||
|
||||
/**
|
||||
* This method shifts single byte characters right by a given amount from an given offset.
|
||||
* @update gess 01/04/99
|
||||
* @param aDest is a ptr to a cstring where the shift is to be performed
|
||||
* @param aLength is the known length of aDest
|
||||
* @param anOffset is the index into aDest where shifting shall begin
|
||||
* @param aCount is the number of chars to be "inserted"
|
||||
*/
|
||||
void ShiftCharsRight(char* aDest,PRUint32 aLength,PRUint32 anOffset,PRUint32 aCount) {
|
||||
char* src = aDest+anOffset;
|
||||
char* dst = aDest+anOffset+aCount;
|
||||
|
||||
memmove(dst,src,aLength-anOffset);
|
||||
}
|
||||
|
||||
/**
|
||||
* This method shifts unicode characters by a given amount from an given offset.
|
||||
* @update gess 01/04/99
|
||||
* @param aDest is a ptr to a cstring where the shift is to be performed
|
||||
* @param aLength is the known length of aDest
|
||||
* @param anOffset is the index into aDest where shifting shall begin
|
||||
* @param aCount is the number of chars to be "cut"
|
||||
*/
|
||||
void ShiftDoubleCharsLeft(char* aDest,PRUint32 aLength,PRUint32 anOffset,PRUint32 aCount) {
|
||||
PRUnichar* root=(PRUnichar*)aDest;
|
||||
PRUnichar* dst = root+anOffset;
|
||||
PRUnichar* src = root+anOffset+aCount;
|
||||
|
||||
memmove(dst,src,(aLength-(aCount+anOffset))*sizeof(PRUnichar));
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
* This method shifts unicode characters by a given amount from an given offset.
|
||||
* @update gess 01/04/99
|
||||
* @param aDest is a ptr to a cstring where the shift is to be performed
|
||||
* @param aLength is the known length of aDest
|
||||
* @param anOffset is the index into aDest where shifting shall begin
|
||||
* @param aCount is the number of chars to be "inserted"
|
||||
*/
|
||||
void ShiftDoubleCharsRight(char* aDest,PRUint32 aLength,PRUint32 anOffset,PRUint32 aCount) {
|
||||
PRUnichar* root=(PRUnichar*)aDest;
|
||||
PRUnichar* src = root+anOffset;
|
||||
PRUnichar* dst = root+anOffset+aCount;
|
||||
|
||||
memmove(dst,src,sizeof(PRUnichar)*(aLength-anOffset));
|
||||
}
|
||||
|
||||
|
||||
typedef void (*ShiftChars)(char* aDest,PRUint32 aLength,PRUint32 anOffset,PRUint32 aCount);
|
||||
ShiftChars gShiftChars[2][2]= {
|
||||
{&ShiftCharsLeft,&ShiftCharsRight},
|
||||
{&ShiftDoubleCharsLeft,&ShiftDoubleCharsRight}
|
||||
};
|
||||
|
||||
|
||||
//----------------------------------------------------------------------------------------
|
||||
//
|
||||
// This set of methods is used to copy one buffer onto another.
|
||||
// The functions are differentiated by the size of source and dest character sizes.
|
||||
// WARNING: Your destination buffer MUST be big enough to hold all the source bytes.
|
||||
// We don't validate these ranges here (this should be done in higher level routines).
|
||||
//
|
||||
|
||||
|
||||
/**
|
||||
* Going 1 to 1 is easy, since we assume ascii. No conversions are necessary.
|
||||
* @update gess 01/04/99
|
||||
* @param aDest is the destination buffer
|
||||
* @param aDestOffset is the pos to start copy to in the dest buffer
|
||||
* @param aSource is the source buffer
|
||||
* @param anOffset is the offset to start copying from in the source buffer
|
||||
* @param aCount is the (max) number of chars to copy
|
||||
*/
|
||||
void CopyChars1To1(char* aDest,PRInt32 anDestOffset,const char* aSource,PRUint32 anOffset,PRUint32 aCount) {
|
||||
|
||||
char* dst = aDest+anDestOffset;
|
||||
char* src = (char*)aSource+anOffset;
|
||||
|
||||
memcpy(dst,src,aCount);
|
||||
}
|
||||
|
||||
/**
|
||||
* Going 1 to 2 requires a conversion from ascii to unicode. This can be expensive.
|
||||
* @param aDest is the destination buffer
|
||||
* @param aDestOffset is the pos to start copy to in the dest buffer
|
||||
* @param aSource is the source buffer
|
||||
* @param anOffset is the offset to start copying from in the source buffer
|
||||
* @param aCount is the (max) number of chars to copy
|
||||
*/
|
||||
void CopyChars1To2(char* aDest,PRInt32 anDestOffset,const char* aSource,PRUint32 anOffset,PRUint32 aCount) {
|
||||
|
||||
PRUnichar* theDest=(PRUnichar*)aDest;
|
||||
PRUnichar* to = theDest+anDestOffset;
|
||||
const unsigned char* first= (const unsigned char*)aSource+anOffset;
|
||||
const unsigned char* last = first+aCount;
|
||||
|
||||
//now loop over characters, shifting them left...
|
||||
while(first<last) {
|
||||
*to=(PRUnichar)(*first);
|
||||
to++;
|
||||
first++;
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
* Going 2 to 1 requires a conversion from unicode down to ascii. This can be lossy.
|
||||
* @update gess 01/04/99
|
||||
* @param aDest is the destination buffer
|
||||
* @param aDestOffset is the pos to start copy to in the dest buffer
|
||||
* @param aSource is the source buffer
|
||||
* @param anOffset is the offset to start copying from in the source buffer
|
||||
* @param aCount is the (max) number of chars to copy
|
||||
*/
|
||||
void CopyChars2To1(char* aDest,PRInt32 anDestOffset,const char* aSource,PRUint32 anOffset,PRUint32 aCount) {
|
||||
char* to = aDest+anDestOffset;
|
||||
PRUnichar* theSource=(PRUnichar*)aSource;
|
||||
const PRUnichar* first= theSource+anOffset;
|
||||
const PRUnichar* last = first+aCount;
|
||||
|
||||
//now loop over characters, shifting them left...
|
||||
while(first<last) {
|
||||
if(*first<256)
|
||||
*to=(char)*first;
|
||||
else *to='.';
|
||||
to++;
|
||||
first++;
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Going 2 to 2 is fast and efficient.
|
||||
* @update gess 01/04/99
|
||||
* @param aDest is the destination buffer
|
||||
* @param aDestOffset is the pos to start copy to in the dest buffer
|
||||
* @param aSource is the source buffer
|
||||
* @param anOffset is the offset to start copying from in the source buffer
|
||||
* @param aCount is the (max) number of chars to copy
|
||||
*/
|
||||
void CopyChars2To2(char* aDest,PRInt32 anDestOffset,const char* aSource,PRUint32 anOffset,PRUint32 aCount) {
|
||||
PRUnichar* theDest=(PRUnichar*)aDest;
|
||||
PRUnichar* to = theDest+anDestOffset;
|
||||
PRUnichar* theSource=(PRUnichar*)aSource;
|
||||
PRUnichar* from= theSource+anOffset;
|
||||
|
||||
memcpy((void*)to,(void*)from,aCount*sizeof(PRUnichar));
|
||||
}
|
||||
|
||||
|
||||
//--------------------------------------------------------------------------------------
|
||||
|
||||
|
||||
typedef void (*CopyChars)(char* aDest,PRInt32 anDestOffset,const char* aSource,PRUint32 anOffset,PRUint32 aCount);
|
||||
|
||||
CopyChars gCopyChars[2][2]={
|
||||
{&CopyChars1To1,&CopyChars1To2},
|
||||
{&CopyChars2To1,&CopyChars2To2}
|
||||
};
|
||||
|
||||
|
||||
//----------------------------------------------------------------------------------------
|
||||
//
|
||||
// This set of methods is used to search a buffer looking for a char.
|
||||
//
|
||||
|
||||
|
||||
/**
|
||||
* This methods cans the given buffer for the given char
|
||||
*
|
||||
* @update gess 3/25/98
|
||||
* @param aDest is the buffer to be searched
|
||||
* @param aLength is the size (in char-units, not bytes) of the buffer
|
||||
* @param anOffset is the start pos to begin searching
|
||||
* @param aChar is the target character we're looking for
|
||||
* @param aIgnorecase tells us whether to use a case sensitive search
|
||||
* @return index of pos if found, else -1 (kNotFound)
|
||||
*/
|
||||
inline PRInt32 FindChar1(const char* aDest,PRUint32 aLength,PRUint32 anOffset,const PRUnichar aChar,PRBool aIgnoreCase) {
|
||||
|
||||
if(aIgnoreCase) {
|
||||
char theChar=(char)nsCRT::ToUpper(aChar);
|
||||
const char* ptr=aDest+(anOffset-1);
|
||||
const char* last=aDest+aLength;
|
||||
while(++ptr<last){
|
||||
if(nsCRT::ToUpper(*ptr)==theChar)
|
||||
return ptr-aDest;
|
||||
}
|
||||
}
|
||||
else {
|
||||
|
||||
const char* ptr = aDest+anOffset;
|
||||
char theChar=(char)aChar;
|
||||
const char* result=(const char*)memchr(ptr, theChar,aLength-anOffset);
|
||||
if(result) {
|
||||
return result-aDest;
|
||||
}
|
||||
}
|
||||
return kNotFound;
|
||||
}
|
||||
|
||||
/**
|
||||
* This methods cans the given buffer for the given char
|
||||
*
|
||||
* @update gess 3/25/98
|
||||
* @param aDest is the buffer to be searched
|
||||
* @param aLength is the size (in char-units, not bytes) of the buffer
|
||||
* @param anOffset is the start pos to begin searching
|
||||
* @param aChar is the target character we're looking for
|
||||
* @param aIgnorecase tells us whether to use a case sensitive search
|
||||
* @return index of pos if found, else -1 (kNotFound)
|
||||
*/
|
||||
inline PRInt32 FindChar2(const char* aDest,PRUint32 aLength,PRUint32 anOffset,const PRUnichar aChar,PRBool aIgnoreCase) {
|
||||
const PRUnichar* root=(PRUnichar*)aDest;
|
||||
const PRUnichar* ptr=root+(anOffset-1);
|
||||
const PRUnichar* last=root+aLength;
|
||||
|
||||
if(aIgnoreCase) {
|
||||
PRUnichar theChar=nsCRT::ToUpper(aChar);
|
||||
while(++ptr<last){
|
||||
if(nsCRT::ToUpper(*ptr)==theChar)
|
||||
return ptr-root;
|
||||
}
|
||||
}
|
||||
else {
|
||||
while(++ptr<last){
|
||||
if(*ptr==aChar)
|
||||
return (ptr-root);
|
||||
}
|
||||
}
|
||||
|
||||
return kNotFound;
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
* This methods cans the given buffer (in reverse) for the given char
|
||||
*
|
||||
* @update gess 3/25/98
|
||||
* @param aDest is the buffer to be searched
|
||||
* @param aLength is the size (in char-units, not bytes) of the buffer
|
||||
* @param anOffset is the start pos to begin searching
|
||||
* @param aChar is the target character we're looking for
|
||||
* @param aIgnorecase tells us whether to use a case sensitive search
|
||||
* @return index of pos if found, else -1 (kNotFound)
|
||||
*/
|
||||
inline PRInt32 RFindChar1(const char* aDest,PRUint32 aDestLength,PRUint32 anOffset,const PRUnichar aChar,PRBool aIgnoreCase) {
|
||||
PRInt32 theIndex=0;
|
||||
|
||||
if(aIgnoreCase) {
|
||||
PRUnichar theChar=nsCRT::ToUpper(aChar);
|
||||
for(theIndex=(PRInt32)anOffset;theIndex>=0;theIndex--){
|
||||
if(nsCRT::ToUpper(aDest[theIndex])==theChar)
|
||||
return theIndex;
|
||||
}
|
||||
}
|
||||
else {
|
||||
for(theIndex=(PRInt32)anOffset;theIndex>=0;theIndex--){
|
||||
if(aDest[theIndex]==aChar)
|
||||
return theIndex;
|
||||
}
|
||||
}
|
||||
|
||||
return kNotFound;
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
* This methods cans the given buffer for the given char
|
||||
*
|
||||
* @update gess 3/25/98
|
||||
* @param aDest is the buffer to be searched
|
||||
* @param aLength is the size (in char-units, not bytes) of the buffer
|
||||
* @param anOffset is the start pos to begin searching
|
||||
* @param aChar is the target character we're looking for
|
||||
* @param aIgnorecase tells us whether to use a case sensitive search
|
||||
* @return index of pos if found, else -1 (kNotFound)
|
||||
*/
|
||||
inline PRInt32 RFindChar2(const char* aDest,PRUint32 aDestLength,PRUint32 anOffset,const PRUnichar aChar,PRBool aIgnoreCase) {
|
||||
|
||||
PRInt32 theIndex=0;
|
||||
PRUnichar* theBuf=(PRUnichar*)aDest;
|
||||
|
||||
if(aIgnoreCase) {
|
||||
PRUnichar theChar=nsCRT::ToUpper(aChar);
|
||||
for(theIndex=(PRInt32)anOffset;theIndex>=0;theIndex--){
|
||||
if(nsCRT::ToUpper(theBuf[theIndex])==theChar)
|
||||
return theIndex;
|
||||
}
|
||||
}
|
||||
else {
|
||||
for(theIndex=(PRInt32)anOffset;theIndex>=0;theIndex--){
|
||||
if(theBuf[theIndex]==aChar)
|
||||
return theIndex;
|
||||
}
|
||||
}
|
||||
|
||||
return kNotFound;
|
||||
}
|
||||
|
||||
typedef PRInt32 (*FindChars)(const char* aDest,PRUint32 aDestLength,PRUint32 anOffset,const PRUnichar aChar,PRBool aIgnoreCase);
|
||||
FindChars gFindChars[]={&FindChar1,&FindChar2};
|
||||
FindChars gRFindChars[]={&RFindChar1,&RFindChar2};
|
||||
|
||||
//----------------------------------------------------------------------------------------
|
||||
//
|
||||
// This set of methods is used to compare one buffer onto another.
|
||||
// The functions are differentiated by the size of source and dest character sizes.
|
||||
// WARNING: Your destination buffer MUST be big enough to hold all the source bytes.
|
||||
// We don't validate these ranges here (this should be done in higher level routines).
|
||||
//
|
||||
|
||||
|
||||
/**
|
||||
* This method compares the data in one buffer with another
|
||||
* @update gess 01/04/99
|
||||
* @param aStr1 is the first buffer to be compared
|
||||
* @param aStr2 is the 2nd buffer to be compared
|
||||
* @param aCount is the number of chars to compare
|
||||
* @param aIgnorecase tells us whether to use a case-sensitive comparison
|
||||
* @return -1,0,1 depending on <,==,>
|
||||
*/
|
||||
PRInt32 Compare1To1(const char* aStr1,const char* aStr2,PRUint32 aCount,PRBool aIgnoreCase){
|
||||
PRInt32 result=0;
|
||||
if(aIgnoreCase)
|
||||
result=nsCRT::strncasecmp(aStr1,aStr2,aCount);
|
||||
else result=strncmp(aStr1,aStr2,aCount);
|
||||
return result;
|
||||
}
|
||||
|
||||
/**
|
||||
* This method compares the data in one buffer with another
|
||||
* @update gess 01/04/99
|
||||
* @param aStr1 is the first buffer to be compared
|
||||
* @param aStr2 is the 2nd buffer to be compared
|
||||
* @param aCount is the number of chars to compare
|
||||
* @param aIgnorecase tells us whether to use a case-sensitive comparison
|
||||
* @return -1,0,1 depending on <,==,>
|
||||
*/
|
||||
PRInt32 Compare2To2(const char* aStr1,const char* aStr2,PRUint32 aCount,PRBool aIgnoreCase){
|
||||
PRInt32 result=0;
|
||||
if(aIgnoreCase)
|
||||
result=nsCRT::strncasecmp((PRUnichar*)aStr1,(PRUnichar*)aStr2,aCount);
|
||||
else result=nsCRT::strncmp((PRUnichar*)aStr1,(PRUnichar*)aStr2,aCount);
|
||||
return result;
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
* This method compares the data in one buffer with another
|
||||
* @update gess 01/04/99
|
||||
* @param aStr1 is the first buffer to be compared
|
||||
* @param aStr2 is the 2nd buffer to be compared
|
||||
* @param aCount is the number of chars to compare
|
||||
* @param aIgnorecase tells us whether to use a case-sensitive comparison
|
||||
* @return -1,0,1 depending on <,==,>
|
||||
*/
|
||||
PRInt32 Compare2To1(const char* aStr1,const char* aStr2,PRUint32 aCount,PRBool aIgnoreCase){
|
||||
PRInt32 result;
|
||||
if(aIgnoreCase)
|
||||
result=nsCRT::strncasecmp((PRUnichar*)aStr1,aStr2,aCount);
|
||||
else result=nsCRT::strncmp((PRUnichar*)aStr1,aStr2,aCount);
|
||||
return result;
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
* This method compares the data in one buffer with another
|
||||
* @update gess 01/04/99
|
||||
* @param aStr1 is the first buffer to be compared
|
||||
* @param aStr2 is the 2nd buffer to be compared
|
||||
* @param aCount is the number of chars to compare
|
||||
* @param aIgnorecase tells us whether to use a case-sensitive comparison
|
||||
* @return -1,0,1 depending on <,==,>
|
||||
*/
|
||||
PRInt32 Compare1To2(const char* aStr1,const char* aStr2,PRUint32 aCount,PRBool aIgnoreCase){
|
||||
PRInt32 result;
|
||||
if(aIgnoreCase)
|
||||
result=nsCRT::strncasecmp((PRUnichar*)aStr2,aStr1,aCount)*-1;
|
||||
else result=nsCRT::strncmp((PRUnichar*)aStr2,aStr1,aCount)*-1;
|
||||
return result;
|
||||
}
|
||||
|
||||
|
||||
typedef PRInt32 (*CompareChars)(const char* aStr1,const char* aStr2,PRUint32 aCount,PRBool aIgnoreCase);
|
||||
CompareChars gCompare[2][2]={
|
||||
{&Compare1To1,&Compare1To2},
|
||||
{&Compare2To1,&Compare2To2},
|
||||
};
|
||||
|
||||
//----------------------------------------------------------------------------------------
|
||||
//
|
||||
// This set of methods is used to convert the case of strings...
|
||||
//
|
||||
|
||||
|
||||
/**
|
||||
* This method performs a case conversion the data in the given buffer
|
||||
*
|
||||
* @update gess 01/04/99
|
||||
* @param aString is the buffer to be case shifted
|
||||
* @param aCount is the number of chars to compare
|
||||
* @param aToUpper tells us whether to convert to upper or lower
|
||||
* @return 0
|
||||
*/
|
||||
PRInt32 ConvertCase1(char* aString,PRUint32 aCount,PRBool aToUpper){
|
||||
PRInt32 result=0;
|
||||
|
||||
typedef char chartype;
|
||||
chartype* cp = (chartype*)aString;
|
||||
chartype* end = cp + aCount-1;
|
||||
while (cp <= end) {
|
||||
chartype ch = *cp;
|
||||
if(aToUpper) {
|
||||
if ((ch >= 'a') && (ch <= 'z')) {
|
||||
*cp = 'A' + (ch - 'a');
|
||||
}
|
||||
}
|
||||
else {
|
||||
if ((ch >= 'A') && (ch <= 'Z')) {
|
||||
*cp = 'a' + (ch - 'A');
|
||||
}
|
||||
}
|
||||
cp++;
|
||||
}
|
||||
return result;
|
||||
}
|
||||
|
||||
//----------------------------------------------------------------------------------------
|
||||
|
||||
#ifndef RICKG_TESTBED
|
||||
class HandleCaseConversionShutdown3 : public nsIShutdownListener {
|
||||
public :
|
||||
NS_IMETHOD OnShutdown(const nsCID& cid, nsISupports* service);
|
||||
HandleCaseConversionShutdown3(void) { NS_INIT_REFCNT(); }
|
||||
virtual ~HandleCaseConversionShutdown3(void) {}
|
||||
NS_DECL_ISUPPORTS
|
||||
};
|
||||
|
||||
static NS_DEFINE_CID(kUnicharUtilCID, NS_UNICHARUTIL_CID);
|
||||
static NS_DEFINE_IID(kICaseConversionIID, NS_ICASECONVERSION_IID);
|
||||
static NS_DEFINE_IID(kIShutdownListenerIID, NS_ISHUTDOWNLISTENER_IID);
|
||||
static nsICaseConversion * gCaseConv = 0;
|
||||
|
||||
NS_IMPL_ISUPPORTS(HandleCaseConversionShutdown3, kIShutdownListenerIID);
|
||||
|
||||
nsresult HandleCaseConversionShutdown3::OnShutdown(const nsCID& cid, nsISupports* service) {
|
||||
if (cid.Equals(kUnicharUtilCID)) {
|
||||
NS_ASSERTION(service == gCaseConv, "wrong service!");
|
||||
if(gCaseConv){
|
||||
gCaseConv->Release();
|
||||
gCaseConv = 0;
|
||||
}
|
||||
}
|
||||
return NS_OK;
|
||||
}
|
||||
|
||||
|
||||
class CCaseConversionServiceInitializer {
|
||||
public:
|
||||
CCaseConversionServiceInitializer(){
|
||||
mListener = new HandleCaseConversionShutdown3();
|
||||
if(mListener){
|
||||
mListener->AddRef();
|
||||
nsServiceManager::GetService(kUnicharUtilCID, kICaseConversionIID,(nsISupports**) &gCaseConv, mListener);
|
||||
}
|
||||
}
|
||||
protected:
|
||||
HandleCaseConversionShutdown3* mListener;
|
||||
};
|
||||
|
||||
#endif
|
||||
|
||||
//----------------------------------------------------------------------------------------
|
||||
|
||||
/**
|
||||
* This method performs a case conversion the data in the given buffer
|
||||
*
|
||||
* @update gess 01/04/99
|
||||
* @param aString is the buffer to be case shifted
|
||||
* @param aCount is the number of chars to compare
|
||||
* @param aToUpper tells us whether to convert to upper or lower
|
||||
* @return 0
|
||||
*/
|
||||
PRInt32 ConvertCase2(char* aString,PRUint32 aCount,PRBool aToUpper){
|
||||
PRUnichar* cp = (PRUnichar*)aString;
|
||||
PRUnichar* end = cp + aCount-1;
|
||||
PRInt32 result=0;
|
||||
|
||||
#ifndef RICKG_TESTBED
|
||||
static CCaseConversionServiceInitializer gCaseConversionServiceInitializer;
|
||||
|
||||
// I18N code begin
|
||||
if(gCaseConv) {
|
||||
nsresult err=(aToUpper) ? gCaseConv->ToUpper(cp, cp, aCount) : gCaseConv->ToLower(cp, cp, aCount);
|
||||
if(NS_SUCCEEDED(err))
|
||||
return 0;
|
||||
}
|
||||
// I18N code end
|
||||
#endif
|
||||
|
||||
|
||||
while (cp <= end) {
|
||||
PRUnichar ch = *cp;
|
||||
if(aToUpper) {
|
||||
if ((ch >= 'a') && (ch <= 'z')) {
|
||||
*cp = 'A' + (ch - 'a');
|
||||
}
|
||||
}
|
||||
else {
|
||||
if ((ch >= 'A') && (ch <= 'Z')) {
|
||||
*cp = 'a' + (ch - 'A');
|
||||
}
|
||||
}
|
||||
cp++;
|
||||
}
|
||||
|
||||
return result;
|
||||
}
|
||||
|
||||
typedef PRInt32 (*CaseConverters)(char*,PRUint32,PRBool);
|
||||
CaseConverters gCaseConverters[]={&ConvertCase1,&ConvertCase2};
|
||||
|
||||
|
||||
|
||||
//----------------------------------------------------------------------------------------
|
||||
//
|
||||
// This set of methods is used compress char sequences in a buffer...
|
||||
//
|
||||
|
||||
|
||||
/**
|
||||
* This method compresses duplicate runs of a given char from the given buffer
|
||||
*
|
||||
* @update gess 01/04/99
|
||||
* @param aString is the buffer to be manipulated
|
||||
* @param aLength is the length of the buffer
|
||||
* @param aSet tells us which chars to compress from given buffer
|
||||
* @param aEliminateLeading tells us whether to strip chars from the start of the buffer
|
||||
* @param aEliminateTrailing tells us whether to strip chars from the start of the buffer
|
||||
* @return the new length of the given buffer
|
||||
*/
|
||||
PRInt32 CompressChars1(char* aString,PRUint32 aLength,const char* aSet){
|
||||
|
||||
typedef char chartype;
|
||||
chartype* from = aString;
|
||||
chartype* end = aString + aLength-1;
|
||||
chartype* to = from;
|
||||
|
||||
//this code converts /n, /t, /r into normal space ' ';
|
||||
//it also compresses runs of whitespace down to a single char...
|
||||
if(aSet && aString && (0 < aLength)){
|
||||
PRUint32 aSetLen=strlen(aSet);
|
||||
while (from <= end) {
|
||||
chartype theChar = *from++;
|
||||
if(kNotFound!=FindChar1(aSet,aSetLen,0,theChar,PR_FALSE)){
|
||||
*to++=theChar;
|
||||
while (from <= end) {
|
||||
theChar = *from++;
|
||||
if(kNotFound==FindChar1(aSet,aSetLen,0,theChar,PR_FALSE)){
|
||||
*to++ = theChar;
|
||||
break;
|
||||
}
|
||||
}
|
||||
} else {
|
||||
*to++ = theChar;
|
||||
}
|
||||
}
|
||||
*to = 0;
|
||||
}
|
||||
return to - (chartype*)aString;
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
* This method compresses duplicate runs of a given char from the given buffer
|
||||
*
|
||||
* @update gess 01/04/99
|
||||
* @param aString is the buffer to be manipulated
|
||||
* @param aLength is the length of the buffer
|
||||
* @param aSet tells us which chars to compress from given buffer
|
||||
* @param aEliminateLeading tells us whether to strip chars from the start of the buffer
|
||||
* @param aEliminateTrailing tells us whether to strip chars from the start of the buffer
|
||||
* @return the new length of the given buffer
|
||||
*/
|
||||
PRInt32 CompressChars2(char* aString,PRUint32 aLength,const char* aSet){
|
||||
|
||||
typedef PRUnichar chartype;
|
||||
chartype* from = (chartype*)aString;
|
||||
chartype* end = from + aLength-1;
|
||||
chartype* to = from;
|
||||
|
||||
//this code converts /n, /t, /r into normal space ' ';
|
||||
//it also compresses runs of whitespace down to a single char...
|
||||
if(aSet && aString && (0 < aLength)){
|
||||
PRUint32 aSetLen=strlen(aSet);
|
||||
while (from <= end) {
|
||||
chartype theChar = *from++;
|
||||
if(kNotFound!=FindChar1(aSet,aSetLen,0,theChar,PR_FALSE)){
|
||||
*to++=theChar;
|
||||
while (from <= end) {
|
||||
theChar = *from++;
|
||||
if(kNotFound==FindChar1(aSet,aSetLen,0,theChar,PR_FALSE)){
|
||||
*to++ = theChar;
|
||||
break;
|
||||
}
|
||||
}
|
||||
} else {
|
||||
*to++ = theChar;
|
||||
}
|
||||
}
|
||||
*to = 0;
|
||||
}
|
||||
return to - (chartype*)aString;
|
||||
}
|
||||
|
||||
typedef PRInt32 (*CompressChars)(char* aString,PRUint32 aCount,const char* aSet);
|
||||
CompressChars gCompressChars[]={&CompressChars1,&CompressChars2};
|
||||
|
||||
/**
|
||||
* This method strips chars in a given set from the given buffer
|
||||
*
|
||||
* @update gess 01/04/99
|
||||
* @param aString is the buffer to be manipulated
|
||||
* @param aLength is the length of the buffer
|
||||
* @param aSet tells us which chars to compress from given buffer
|
||||
* @param aEliminateLeading tells us whether to strip chars from the start of the buffer
|
||||
* @param aEliminateTrailing tells us whether to strip chars from the start of the buffer
|
||||
* @return the new length of the given buffer
|
||||
*/
|
||||
PRInt32 StripChars1(char* aString,PRUint32 aLength,const char* aSet){
|
||||
|
||||
typedef char chartype;
|
||||
chartype* to = aString;
|
||||
chartype* from = aString-1;
|
||||
chartype* end = aString + aLength;
|
||||
|
||||
if(aSet && aString && (0 < aLength)){
|
||||
PRUint32 aSetLen=strlen(aSet);
|
||||
while (++from < end) {
|
||||
chartype theChar = *from;
|
||||
if(kNotFound==FindChar1(aSet,aSetLen,0,theChar,PR_FALSE)){
|
||||
*to++ = theChar;
|
||||
}
|
||||
}
|
||||
*to = 0;
|
||||
}
|
||||
return to - (chartype*)aString;
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
* This method strips chars in a given set from the given buffer
|
||||
*
|
||||
* @update gess 01/04/99
|
||||
* @param aString is the buffer to be manipulated
|
||||
* @param aLength is the length of the buffer
|
||||
* @param aSet tells us which chars to compress from given buffer
|
||||
* @param aEliminateLeading tells us whether to strip chars from the start of the buffer
|
||||
* @param aEliminateTrailing tells us whether to strip chars from the start of the buffer
|
||||
* @return the new length of the given buffer
|
||||
*/
|
||||
PRInt32 StripChars2(char* aString,PRUint32 aLength,const char* aSet){
|
||||
|
||||
typedef PRUnichar chartype;
|
||||
chartype* to = (chartype*)aString;
|
||||
chartype* from = (chartype*)aString-1;
|
||||
chartype* end = to + aLength;
|
||||
|
||||
if(aSet && aString && (0 < aLength)){
|
||||
PRUint32 aSetLen=strlen(aSet);
|
||||
while (++from < end) {
|
||||
chartype theChar = *from;
|
||||
if(kNotFound==FindChar1(aSet,aSetLen,0,theChar,PR_FALSE)){
|
||||
*to++ = theChar;
|
||||
}
|
||||
}
|
||||
*to = 0;
|
||||
}
|
||||
return to - (chartype*)aString;
|
||||
}
|
||||
|
||||
typedef PRInt32 (*StripChars)(char* aString,PRUint32 aCount,const char* aSet);
|
||||
StripChars gStripChars[]={&StripChars1,&StripChars2};
|
||||
|
||||
#endif
|
||||
120
mozilla/xpcom/ds/makefile.win
Normal file
120
mozilla/xpcom/ds/makefile.win
Normal file
@@ -0,0 +1,120 @@
|
||||
#!nmake
|
||||
#
|
||||
# The contents of this file are subject to the Netscape Public License
|
||||
# Version 1.0 (the "NPL"); you may not use this file except in
|
||||
# compliance with the NPL. You may obtain a copy of the NPL at
|
||||
# http://www.mozilla.org/NPL/
|
||||
#
|
||||
# Software distributed under the NPL is distributed on an "AS IS" basis,
|
||||
# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
|
||||
# for the specific language governing rights and limitations under the
|
||||
# NPL.
|
||||
#
|
||||
# The Initial Developer of this code under the NPL is Netscape
|
||||
# Communications Corporation. Portions created by Netscape are
|
||||
# Copyright (C) 1998 Netscape Communications Corporation. All Rights
|
||||
# Reserved.
|
||||
|
||||
|
||||
|
||||
DEPTH=..\..
|
||||
MODULE = xpcom
|
||||
|
||||
################################################################################
|
||||
## exports
|
||||
|
||||
EXPORTS = \
|
||||
nsTextFormater.h \
|
||||
nsAVLTree.h \
|
||||
nsCppSharedAllocator.h \
|
||||
nsCRT.h \
|
||||
nsDeque.h \
|
||||
nsEnumeratorUtils.h \
|
||||
nsHashtable.h \
|
||||
nsHashtableEnumerator.h \
|
||||
nsIArena.h \
|
||||
nsIByteBuffer.h \
|
||||
nsIObserverList.h \
|
||||
nsIProperties.h \
|
||||
nsISimpleEnumerator.h \
|
||||
nsISizeOfHandler.h \
|
||||
nsIUnicharBuffer.h \
|
||||
nsIVariant.h \
|
||||
nsInt64.h \
|
||||
nsQuickSort.h \
|
||||
nsStr.h \
|
||||
nsString.h \
|
||||
nsString2.h \
|
||||
nsSupportsPrimitives.h \
|
||||
nsTime.h \
|
||||
nsUnitConversion.h \
|
||||
nsVector.h \
|
||||
nsVoidArray.h \
|
||||
nsXPIDLString.h \
|
||||
plvector.h \
|
||||
$(NULL)
|
||||
|
||||
XPIDL_MODULE = xpcom_ds
|
||||
|
||||
XPIDLSRCS = \
|
||||
.\nsIAtom.idl \
|
||||
.\nsICollection.idl \
|
||||
.\nsIEnumerator.idl \
|
||||
.\nsIObserver.idl \
|
||||
.\nsIObserverService.idl \
|
||||
.\nsISupportsArray.idl \
|
||||
.\nsISupportsPrimitives.idl \
|
||||
$(NULL)
|
||||
|
||||
################################################################################
|
||||
## library
|
||||
|
||||
LIBRARY_NAME=xpcomds_s
|
||||
|
||||
LINCS = \
|
||||
-I$(PUBLIC)\xpcom \
|
||||
-I$(PUBLIC)\uconv \
|
||||
-I$(PUBLIC)\unicharutil \
|
||||
$(NULL)
|
||||
|
||||
LCFLAGS = -D_IMPL_NS_COM -D_IMPL_NS_BASE -DWIN32_LEAN_AND_MEAN
|
||||
|
||||
CPP_OBJS = \
|
||||
.\$(OBJDIR)\nsTextFormater.obj \
|
||||
.\$(OBJDIR)\nsArena.obj \
|
||||
.\$(OBJDIR)\nsAtomTable.obj \
|
||||
.\$(OBJDIR)\nsAVLTree.obj \
|
||||
.\$(OBJDIR)\nsByteBuffer.obj \
|
||||
.\$(OBJDIR)\nsCRT.obj \
|
||||
.\$(OBJDIR)\nsConjoiningEnumerator.obj \
|
||||
.\$(OBJDIR)\nsDeque.obj \
|
||||
.\$(OBJDIR)\nsEmptyEnumerator.obj \
|
||||
.\$(OBJDIR)\nsEnumeratorUtils.obj \
|
||||
.\$(OBJDIR)\nsHashtable.obj \
|
||||
.\$(OBJDIR)\nsHashtableEnumerator.obj \
|
||||
.\$(OBJDIR)\nsObserver.obj \
|
||||
.\$(OBJDIR)\nsObserverList.obj \
|
||||
.\$(OBJDIR)\nsObserverService.obj \
|
||||
.\$(OBJDIR)\nsProperties.obj \
|
||||
.\$(OBJDIR)\nsQuickSort.obj \
|
||||
.\$(OBJDIR)\nsSizeOfHandler.obj \
|
||||
.\$(OBJDIR)\nsStr.obj \
|
||||
.\$(OBJDIR)\nsString.obj \
|
||||
.\$(OBJDIR)\nsString2.obj \
|
||||
.\$(OBJDIR)\nsSupportsArray.obj \
|
||||
.\$(OBJDIR)\nsSupportsArrayEnumerator.obj \
|
||||
.\$(OBJDIR)\nsSupportsPrimitives.obj \
|
||||
.\$(OBJDIR)\nsUnicharBuffer.obj \
|
||||
.\$(OBJDIR)\nsVariant.obj \
|
||||
.\$(OBJDIR)\nsVoidArray.obj \
|
||||
.\$(OBJDIR)\nsXPIDLString.obj \
|
||||
.\$(OBJDIR)\plvector.obj \
|
||||
$(NULL)
|
||||
|
||||
include <$(DEPTH)\config\rules.mak>
|
||||
|
||||
libs:: $(LIBRARY)
|
||||
$(MAKE_INSTALL) $(LIBRARY) $(DIST)\lib
|
||||
|
||||
clobber::
|
||||
rm -f $(DIST)\lib\$(LIBRARY_NAME).lib
|
||||
617
mozilla/xpcom/ds/nsAVLTree.cpp
Normal file
617
mozilla/xpcom/ds/nsAVLTree.cpp
Normal file
@@ -0,0 +1,617 @@
|
||||
/* -*- Mode: C++; tab-width: 2; indent-tabs-mode: nil; c-basic-offset: 2 -*-
|
||||
*
|
||||
* The contents of this file are subject to the Netscape Public License
|
||||
* Version 1.0 (the "NPL"); you may not use this file except in
|
||||
* compliance with the NPL. You may obtain a copy of the NPL at
|
||||
* http://www.mozilla.org/NPL/
|
||||
*
|
||||
* Software distributed under the NPL is distributed on an "AS IS" basis,
|
||||
* WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
|
||||
* for the specific language governing rights and limitations under the
|
||||
* NPL.
|
||||
*
|
||||
* The Initial Developer of this code under the NPL is Netscape
|
||||
* Communications Corporation. Portions created by Netscape are
|
||||
* Copyright (C) 1999 Netscape Communications Corporation. All Rights
|
||||
* Reserved.
|
||||
*/
|
||||
|
||||
#include "nsAVLTree.h"
|
||||
|
||||
|
||||
enum eLean {eLeft,eNeutral,eRight};
|
||||
|
||||
struct NS_COM nsAVLNode {
|
||||
public:
|
||||
|
||||
nsAVLNode(void* aValue) {
|
||||
mLeft=0;
|
||||
mRight=0;
|
||||
mSkew=eNeutral;
|
||||
mValue=aValue;
|
||||
}
|
||||
|
||||
nsAVLNode* mLeft;
|
||||
nsAVLNode* mRight;
|
||||
eLean mSkew;
|
||||
void* mValue;
|
||||
};
|
||||
|
||||
|
||||
/************************************************************
|
||||
Now begin the tree class. Don't forget that the comparison
|
||||
between nodes must occur via the comparitor function,
|
||||
otherwise all you're testing is pointer addresses.
|
||||
************************************************************/
|
||||
|
||||
/** ------------------------------------------------
|
||||
*
|
||||
*
|
||||
* @update gess 4/22/98
|
||||
* @param
|
||||
* @return
|
||||
*/ //----------------------------------------------
|
||||
nsAVLTree::nsAVLTree(nsAVLNodeComparitor& aComparitor,
|
||||
nsAVLNodeFunctor* aDeallocator) :
|
||||
mComparitor(aComparitor), mDeallocator(aDeallocator) {
|
||||
mRoot=0;
|
||||
mCount=0;
|
||||
}
|
||||
|
||||
|
||||
static void
|
||||
avlDeleteTree(nsAVLNode* aNode){
|
||||
if (aNode) {
|
||||
avlDeleteTree(aNode->mLeft);
|
||||
avlDeleteTree(aNode->mRight);
|
||||
delete aNode;
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
*
|
||||
* @update gess12/27/98
|
||||
* @param
|
||||
* @return
|
||||
*/
|
||||
nsAVLTree::~nsAVLTree(){
|
||||
if (mDeallocator) {
|
||||
ForEachDepthFirst(*mDeallocator);
|
||||
}
|
||||
avlDeleteTree(mRoot);
|
||||
}
|
||||
|
||||
|
||||
class CDoesntExist: public nsAVLNodeFunctor {
|
||||
public:
|
||||
CDoesntExist(const nsAVLTree& anotherTree) : mOtherTree(anotherTree) {
|
||||
}
|
||||
virtual void* operator()(void* anItem) {
|
||||
void* result=mOtherTree.FindItem(anItem);
|
||||
if(result)
|
||||
return nsnull;
|
||||
return anItem;
|
||||
}
|
||||
protected:
|
||||
const nsAVLTree& mOtherTree;
|
||||
};
|
||||
|
||||
/**
|
||||
* This method compares two trees (members by identity).
|
||||
* @update gess12/27/98
|
||||
* @param tree to compare against
|
||||
* @return true if they are identical (contain same stuff).
|
||||
*/
|
||||
PRBool nsAVLTree::operator==(const nsAVLTree& aCopy) const{
|
||||
CDoesntExist functor(aCopy);
|
||||
void* theItem=FirstThat(functor);
|
||||
PRBool result=PRBool(!theItem);
|
||||
return result;
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
*
|
||||
* @update gess12/27/98
|
||||
* @param
|
||||
* @return
|
||||
*/
|
||||
static void
|
||||
avlRotateRight(nsAVLNode*& aRootNode){
|
||||
nsAVLNode* ptr2;
|
||||
nsAVLNode* ptr3;
|
||||
|
||||
ptr2=aRootNode->mRight;
|
||||
if(ptr2->mSkew==eRight) {
|
||||
aRootNode->mRight=ptr2->mLeft;
|
||||
ptr2->mLeft=aRootNode;
|
||||
aRootNode->mSkew=eNeutral;
|
||||
aRootNode=ptr2;
|
||||
}
|
||||
else {
|
||||
ptr3=ptr2->mLeft;
|
||||
ptr2->mLeft=ptr3->mRight;
|
||||
ptr3->mRight=ptr2;
|
||||
aRootNode->mRight=ptr3->mLeft;
|
||||
ptr3->mLeft=aRootNode;
|
||||
if(ptr3->mSkew==eLeft)
|
||||
ptr2->mSkew=eRight;
|
||||
else ptr2->mSkew=eNeutral;
|
||||
if(ptr3->mSkew==eRight)
|
||||
aRootNode->mSkew=eLeft;
|
||||
else aRootNode->mSkew=eNeutral;
|
||||
aRootNode=ptr3;
|
||||
}
|
||||
aRootNode->mSkew=eNeutral;
|
||||
return;
|
||||
}
|
||||
|
||||
|
||||
|
||||
/**
|
||||
*
|
||||
* @update gess12/27/98
|
||||
* @param
|
||||
* @return
|
||||
*/
|
||||
static void
|
||||
avlRotateLeft(nsAVLNode*& aRootNode){
|
||||
nsAVLNode* ptr2;
|
||||
nsAVLNode* ptr3;
|
||||
|
||||
ptr2=aRootNode->mLeft;
|
||||
if(ptr2->mSkew==eLeft) {
|
||||
aRootNode->mLeft=ptr2->mRight;
|
||||
ptr2->mRight=aRootNode;
|
||||
aRootNode->mSkew=eNeutral;
|
||||
aRootNode=ptr2;
|
||||
}
|
||||
else {
|
||||
ptr3=ptr2->mRight;
|
||||
ptr2->mRight=ptr3->mLeft;
|
||||
ptr3->mLeft=ptr2;
|
||||
aRootNode->mLeft=ptr3->mRight;
|
||||
ptr3->mRight=aRootNode;
|
||||
if(ptr3->mSkew==eRight)
|
||||
ptr2->mSkew=eLeft;
|
||||
else ptr2->mSkew=eNeutral;
|
||||
if(ptr3->mSkew==eLeft)
|
||||
aRootNode->mSkew=eRight;
|
||||
else aRootNode->mSkew=eNeutral;
|
||||
aRootNode=ptr3;
|
||||
}
|
||||
aRootNode->mSkew=eNeutral;
|
||||
return;
|
||||
}
|
||||
|
||||
|
||||
/** ------------------------------------------------
|
||||
*
|
||||
*
|
||||
* @update gess 4/22/98
|
||||
* @param
|
||||
* @return
|
||||
*/ //----------------------------------------------
|
||||
static eAVLStatus
|
||||
avlInsert(nsAVLNode*& aRootNode, nsAVLNode* aNewNode,
|
||||
nsAVLNodeComparitor& aComparitor) {
|
||||
eAVLStatus result=eAVL_unknown;
|
||||
|
||||
if(!aRootNode) {
|
||||
aRootNode = aNewNode;
|
||||
return eAVL_ok;
|
||||
}
|
||||
|
||||
if(aNewNode==aRootNode->mValue) {
|
||||
return eAVL_duplicate;
|
||||
}
|
||||
|
||||
PRInt32 theCompareResult=aComparitor(aRootNode->mValue,aNewNode->mValue);
|
||||
if(0 < theCompareResult) { //if(anItem<aRootNode->mValue)
|
||||
result=avlInsert(aRootNode->mLeft,aNewNode,aComparitor);
|
||||
if(eAVL_ok==result) {
|
||||
switch(aRootNode->mSkew){
|
||||
case eLeft:
|
||||
avlRotateLeft(aRootNode);
|
||||
result=eAVL_fail;
|
||||
break;
|
||||
case eRight:
|
||||
aRootNode->mSkew=eNeutral;
|
||||
result=eAVL_fail;
|
||||
break;
|
||||
case eNeutral:
|
||||
aRootNode->mSkew=eLeft;
|
||||
break;
|
||||
} //switch
|
||||
}//if
|
||||
} //if
|
||||
else {
|
||||
result=avlInsert(aRootNode->mRight,aNewNode,aComparitor);
|
||||
if(eAVL_ok==result) {
|
||||
switch(aRootNode->mSkew){
|
||||
case eLeft:
|
||||
aRootNode->mSkew=eNeutral;
|
||||
result=eAVL_fail;
|
||||
break;
|
||||
case eRight:
|
||||
avlRotateRight(aRootNode);
|
||||
result=eAVL_fail;
|
||||
break;
|
||||
case eNeutral:
|
||||
aRootNode->mSkew=eRight;
|
||||
break;
|
||||
} //switch
|
||||
}
|
||||
} //if
|
||||
return result;
|
||||
}
|
||||
|
||||
/** ------------------------------------------------
|
||||
*
|
||||
*
|
||||
* @update gess 4/22/98
|
||||
* @param
|
||||
* @return
|
||||
*/ //----------------------------------------------
|
||||
static void
|
||||
avlBalanceLeft(nsAVLNode*& aRootNode, PRBool& delOk){
|
||||
nsAVLNode* ptr2;
|
||||
nsAVLNode* ptr3;
|
||||
eLean balnc2;
|
||||
eLean balnc3;
|
||||
|
||||
switch(aRootNode->mSkew){
|
||||
case eLeft:
|
||||
ptr2=aRootNode->mLeft;
|
||||
balnc2=ptr2->mSkew;
|
||||
if(balnc2!=eRight) {
|
||||
aRootNode->mLeft=ptr2->mRight;
|
||||
ptr2->mRight=aRootNode;
|
||||
if(balnc2==eNeutral){
|
||||
aRootNode->mSkew=eLeft;
|
||||
ptr2->mSkew=eRight;
|
||||
delOk=PR_FALSE;
|
||||
}
|
||||
else{
|
||||
aRootNode->mSkew=eNeutral;
|
||||
ptr2->mSkew=eNeutral;
|
||||
}
|
||||
aRootNode=ptr2;
|
||||
}
|
||||
else{
|
||||
ptr3=ptr2->mRight;
|
||||
balnc3=ptr3->mSkew;
|
||||
ptr2->mRight=ptr3->mLeft;
|
||||
ptr3->mLeft=ptr2;
|
||||
aRootNode->mLeft=ptr3->mRight;
|
||||
ptr3->mRight=aRootNode;
|
||||
if(balnc3==eRight) {
|
||||
ptr2->mSkew=eLeft;
|
||||
}
|
||||
else {
|
||||
ptr2->mSkew=eNeutral;
|
||||
}
|
||||
if(balnc3==eLeft) {
|
||||
aRootNode->mSkew=eRight;
|
||||
}
|
||||
else {
|
||||
aRootNode->mSkew=eNeutral;
|
||||
}
|
||||
aRootNode=ptr3;
|
||||
ptr3->mSkew=eNeutral;
|
||||
}
|
||||
break;
|
||||
|
||||
case eRight:
|
||||
aRootNode->mSkew=eNeutral;
|
||||
break;
|
||||
|
||||
case eNeutral:
|
||||
aRootNode->mSkew=eLeft;
|
||||
delOk=PR_FALSE;
|
||||
break;
|
||||
}//switch
|
||||
return;
|
||||
}
|
||||
|
||||
/** ------------------------------------------------
|
||||
*
|
||||
*
|
||||
* @update gess 4/22/98
|
||||
* @param
|
||||
* @return
|
||||
*/ //----------------------------------------------
|
||||
static void
|
||||
avlBalanceRight(nsAVLNode*& aRootNode, PRBool& delOk){
|
||||
nsAVLNode* ptr2;
|
||||
nsAVLNode* ptr3;
|
||||
eLean balnc2;
|
||||
eLean balnc3;
|
||||
|
||||
switch(aRootNode->mSkew){
|
||||
case eLeft:
|
||||
aRootNode->mSkew=eNeutral;
|
||||
break;
|
||||
|
||||
case eRight:
|
||||
ptr2=aRootNode->mRight;
|
||||
balnc2=ptr2->mSkew;
|
||||
if(balnc2!=eLeft) {
|
||||
aRootNode->mRight=ptr2->mLeft;
|
||||
ptr2->mLeft=aRootNode;
|
||||
if(balnc2==eNeutral){
|
||||
aRootNode->mSkew=eRight;
|
||||
ptr2->mSkew=eLeft;
|
||||
delOk=PR_FALSE;
|
||||
}
|
||||
else{
|
||||
aRootNode->mSkew=eNeutral;
|
||||
ptr2->mSkew=eNeutral;
|
||||
}
|
||||
aRootNode=ptr2;
|
||||
}
|
||||
else{
|
||||
ptr3=ptr2->mLeft;
|
||||
balnc3=ptr3->mSkew;
|
||||
ptr2->mLeft=ptr3->mRight;
|
||||
ptr3->mRight=ptr2;
|
||||
aRootNode->mRight=ptr3->mLeft;
|
||||
ptr3->mLeft=aRootNode;
|
||||
if(balnc3==eLeft) {
|
||||
ptr2->mSkew=eRight;
|
||||
}
|
||||
else {
|
||||
ptr2->mSkew=eNeutral;
|
||||
}
|
||||
if(balnc3==eRight) {
|
||||
aRootNode->mSkew=eLeft;
|
||||
}
|
||||
else {
|
||||
aRootNode->mSkew=eNeutral;
|
||||
}
|
||||
aRootNode=ptr3;
|
||||
ptr3->mSkew=eNeutral;
|
||||
}
|
||||
break;
|
||||
|
||||
case eNeutral:
|
||||
aRootNode->mSkew=eRight;
|
||||
delOk=PR_FALSE;
|
||||
break;
|
||||
}//switch
|
||||
return;
|
||||
}
|
||||
|
||||
/** ------------------------------------------------
|
||||
*
|
||||
*
|
||||
* @update gess 4/22/98
|
||||
* @param
|
||||
* @return
|
||||
*/ //----------------------------------------------
|
||||
static eAVLStatus
|
||||
avlRemoveChildren(nsAVLNode*& aRootNode,nsAVLNode*& anotherNode, PRBool& delOk){
|
||||
eAVLStatus result=eAVL_ok;
|
||||
|
||||
if(!anotherNode->mRight){
|
||||
aRootNode->mValue=anotherNode->mValue; //swap
|
||||
anotherNode=anotherNode->mLeft;
|
||||
delOk=PR_TRUE;
|
||||
}
|
||||
else{
|
||||
avlRemoveChildren(aRootNode,anotherNode->mRight,delOk);
|
||||
if(delOk)
|
||||
avlBalanceLeft(anotherNode,delOk);
|
||||
}
|
||||
|
||||
return result;
|
||||
}
|
||||
|
||||
|
||||
/** ------------------------------------------------
|
||||
*
|
||||
*
|
||||
* @update gess 4/22/98
|
||||
* @param
|
||||
* @return
|
||||
*/ //----------------------------------------------
|
||||
static eAVLStatus
|
||||
avlRemove(nsAVLNode*& aRootNode, void* anItem, PRBool& delOk,
|
||||
nsAVLNodeComparitor& aComparitor){
|
||||
eAVLStatus result=eAVL_ok;
|
||||
|
||||
if(!aRootNode)
|
||||
delOk=PR_FALSE;
|
||||
else {
|
||||
PRInt32 cmp=aComparitor(anItem,aRootNode->mValue);
|
||||
if(cmp<0){
|
||||
avlRemove(aRootNode->mLeft,anItem,delOk,aComparitor);
|
||||
if(delOk)
|
||||
avlBalanceRight(aRootNode,delOk);
|
||||
}
|
||||
else if(cmp>0){
|
||||
avlRemove(aRootNode->mRight,anItem,delOk,aComparitor);
|
||||
if(delOk)
|
||||
avlBalanceLeft(aRootNode,delOk);
|
||||
}
|
||||
else{ //they match...
|
||||
nsAVLNode* temp=aRootNode;
|
||||
if(!aRootNode->mRight) {
|
||||
aRootNode=aRootNode->mLeft;
|
||||
delOk=PR_TRUE;
|
||||
delete temp;
|
||||
}
|
||||
else if(!aRootNode->mLeft) {
|
||||
aRootNode=aRootNode->mRight;
|
||||
delOk=PR_TRUE;
|
||||
delete temp;
|
||||
}
|
||||
else {
|
||||
avlRemoveChildren(aRootNode,aRootNode->mLeft,delOk);
|
||||
if(delOk)
|
||||
avlBalanceRight(aRootNode,delOk);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
return result;
|
||||
}
|
||||
|
||||
/** ------------------------------------------------
|
||||
*
|
||||
*
|
||||
* @update gess 4/22/98
|
||||
* @param
|
||||
* @return
|
||||
*/ //----------------------------------------------
|
||||
eAVLStatus
|
||||
nsAVLTree::AddItem(void* anItem){
|
||||
eAVLStatus result=eAVL_ok;
|
||||
|
||||
nsAVLNode* theNewNode=new nsAVLNode(anItem);
|
||||
result=avlInsert(mRoot,theNewNode,mComparitor);
|
||||
if(eAVL_duplicate!=result)
|
||||
mCount++;
|
||||
else {
|
||||
delete theNewNode;
|
||||
}
|
||||
return result;
|
||||
}
|
||||
|
||||
/** ------------------------------------------------
|
||||
*
|
||||
*
|
||||
* @update gess 4/22/98
|
||||
* @param
|
||||
* @return
|
||||
*/ //----------------------------------------------
|
||||
void* nsAVLTree::FindItem(void* aValue) const{
|
||||
nsAVLNode* result=mRoot;
|
||||
PRInt32 count=0;
|
||||
while(result) {
|
||||
count++;
|
||||
PRInt32 cmp=mComparitor(aValue,result->mValue);
|
||||
if(0==cmp) {
|
||||
//we matched...
|
||||
break;
|
||||
}
|
||||
else if(0>cmp){
|
||||
//theNode was greater...
|
||||
result=result->mLeft;
|
||||
}
|
||||
else {
|
||||
//aValue is greater...
|
||||
result=result->mRight;
|
||||
}
|
||||
}
|
||||
if(result) {
|
||||
return result->mValue;
|
||||
}
|
||||
return nsnull;
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
*
|
||||
* @update gess12/30/98
|
||||
* @param
|
||||
* @return
|
||||
*/
|
||||
eAVLStatus
|
||||
nsAVLTree::RemoveItem(void* aValue){
|
||||
PRBool delOk=PR_TRUE;
|
||||
eAVLStatus result=avlRemove(mRoot,aValue,delOk,mComparitor);
|
||||
if(eAVL_ok==result)
|
||||
mCount--;
|
||||
return result;
|
||||
}
|
||||
|
||||
/**
|
||||
*
|
||||
* @update gess9/11/98
|
||||
* @param
|
||||
* @return
|
||||
*/
|
||||
static void
|
||||
avlForEachDepthFirst(nsAVLNode* aNode, nsAVLNodeFunctor& aFunctor){
|
||||
if(aNode) {
|
||||
avlForEachDepthFirst(aNode->mLeft,aFunctor);
|
||||
avlForEachDepthFirst(aNode->mRight,aFunctor);
|
||||
aFunctor(aNode->mValue);
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
*
|
||||
* @update gess9/11/98
|
||||
* @param
|
||||
* @return
|
||||
*/
|
||||
void
|
||||
nsAVLTree::ForEachDepthFirst(nsAVLNodeFunctor& aFunctor) const{
|
||||
::avlForEachDepthFirst(mRoot,aFunctor);
|
||||
}
|
||||
|
||||
/**
|
||||
*
|
||||
* @update gess9/11/98
|
||||
* @param
|
||||
* @return
|
||||
*/
|
||||
static void
|
||||
avlForEach(nsAVLNode* aNode, nsAVLNodeFunctor& aFunctor) {
|
||||
if(aNode) {
|
||||
avlForEach(aNode->mLeft,aFunctor);
|
||||
aFunctor(aNode->mValue);
|
||||
avlForEach(aNode->mRight,aFunctor);
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
*
|
||||
* @update gess9/11/98
|
||||
* @param
|
||||
* @return
|
||||
*/
|
||||
void
|
||||
nsAVLTree::ForEach(nsAVLNodeFunctor& aFunctor) const{
|
||||
::avlForEach(mRoot,aFunctor);
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
*
|
||||
* @update gess9/11/98
|
||||
* @param
|
||||
* @return
|
||||
*/
|
||||
static void*
|
||||
avlFirstThat(nsAVLNode* aNode, nsAVLNodeFunctor& aFunctor) {
|
||||
void* result=nsnull;
|
||||
if(aNode) {
|
||||
result = avlFirstThat(aNode->mLeft,aFunctor);
|
||||
if (result) {
|
||||
return result;
|
||||
}
|
||||
result = aFunctor(aNode->mValue);
|
||||
if (result) {
|
||||
return result;
|
||||
}
|
||||
result = avlFirstThat(aNode->mRight,aFunctor);
|
||||
}
|
||||
return result;
|
||||
}
|
||||
|
||||
/**
|
||||
*
|
||||
* @update gess9/11/98
|
||||
* @param
|
||||
* @return
|
||||
*/
|
||||
void*
|
||||
nsAVLTree::FirstThat(nsAVLNodeFunctor& aFunctor) const{
|
||||
return ::avlFirstThat(mRoot,aFunctor);
|
||||
}
|
||||
|
||||
74
mozilla/xpcom/ds/nsAVLTree.h
Normal file
74
mozilla/xpcom/ds/nsAVLTree.h
Normal file
@@ -0,0 +1,74 @@
|
||||
/* -*- Mode: C++; tab-width: 2; indent-tabs-mode: nil; c-basic-offset: 2 -*-
|
||||
*
|
||||
* The contents of this file are subject to the Netscape Public License
|
||||
* Version 1.0 (the "NPL"); you may not use this file except in
|
||||
* compliance with the NPL. You may obtain a copy of the NPL at
|
||||
* http://www.mozilla.org/NPL/
|
||||
*
|
||||
* Software distributed under the NPL is distributed on an "AS IS" basis,
|
||||
* WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
|
||||
* for the specific language governing rights and limitations under the
|
||||
* NPL.
|
||||
*
|
||||
* The Initial Developer of this code under the NPL is Netscape
|
||||
* Communications Corporation. Portions created by Netscape are
|
||||
* Copyright (C) 1999 Netscape Communications Corporation. All Rights
|
||||
* Reserved.
|
||||
*/
|
||||
|
||||
#ifndef nsAVLTree_h___
|
||||
#define nsAVLTree_h___
|
||||
|
||||
|
||||
#include "nscore.h"
|
||||
|
||||
|
||||
enum eAVLStatus {eAVL_unknown,eAVL_ok,eAVL_fail,eAVL_duplicate};
|
||||
|
||||
|
||||
struct nsAVLNode;
|
||||
|
||||
/**
|
||||
*
|
||||
* @update gess12/26/98
|
||||
* @param anObject1 is the first object to be compared
|
||||
* @param anObject2 is the second object to be compared
|
||||
* @return -1,0,1 if object1 is less, equal, greater than object2
|
||||
*/
|
||||
class NS_COM nsAVLNodeComparitor {
|
||||
public:
|
||||
virtual PRInt32 operator()(void* anItem1,void* anItem2)=0;
|
||||
};
|
||||
|
||||
class NS_COM nsAVLNodeFunctor {
|
||||
public:
|
||||
virtual void* operator()(void* anItem)=0;
|
||||
};
|
||||
|
||||
class NS_COM nsAVLTree {
|
||||
public:
|
||||
nsAVLTree(nsAVLNodeComparitor& aComparitor, nsAVLNodeFunctor* aDeallocator);
|
||||
~nsAVLTree(void);
|
||||
|
||||
PRBool operator==(const nsAVLTree& aOther) const;
|
||||
PRInt32 GetCount(void) const {return mCount;}
|
||||
|
||||
//main functions...
|
||||
eAVLStatus AddItem(void* anItem);
|
||||
eAVLStatus RemoveItem(void* anItem);
|
||||
void* FindItem(void* anItem) const;
|
||||
void ForEach(nsAVLNodeFunctor& aFunctor) const;
|
||||
void ForEachDepthFirst(nsAVLNodeFunctor& aFunctor) const;
|
||||
void* FirstThat(nsAVLNodeFunctor& aFunctor) const;
|
||||
|
||||
protected:
|
||||
|
||||
nsAVLNode* mRoot;
|
||||
PRInt32 mCount;
|
||||
nsAVLNodeComparitor& mComparitor;
|
||||
nsAVLNodeFunctor* mDeallocator;
|
||||
};
|
||||
|
||||
|
||||
#endif /* nsAVLTree_h___ */
|
||||
|
||||
97
mozilla/xpcom/ds/nsArena.cpp
Normal file
97
mozilla/xpcom/ds/nsArena.cpp
Normal file
@@ -0,0 +1,97 @@
|
||||
/* -*- Mode: C++; tab-width: 2; indent-tabs-mode: nil; c-basic-offset: 2 -*-
|
||||
*
|
||||
* The contents of this file are subject to the Netscape Public License
|
||||
* Version 1.0 (the "NPL"); you may not use this file except in
|
||||
* compliance with the NPL. You may obtain a copy of the NPL at
|
||||
* http://www.mozilla.org/NPL/
|
||||
*
|
||||
* Software distributed under the NPL is distributed on an "AS IS" basis,
|
||||
* WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
|
||||
* for the specific language governing rights and limitations under the
|
||||
* NPL.
|
||||
*
|
||||
* The Initial Developer of this code under the NPL is Netscape
|
||||
* Communications Corporation. Portions created by Netscape are
|
||||
* Copyright (C) 1998 Netscape Communications Corporation. All Rights
|
||||
* Reserved.
|
||||
*/
|
||||
|
||||
#include "nsArena.h"
|
||||
#include "nsCRT.h"
|
||||
|
||||
ArenaImpl::ArenaImpl(void)
|
||||
: mInitialized(PR_FALSE)
|
||||
{
|
||||
NS_INIT_REFCNT();
|
||||
nsCRT::memset(&mPool, 0, sizeof(PLArenaPool));
|
||||
}
|
||||
|
||||
NS_IMETHODIMP
|
||||
ArenaImpl::Init(PRUint32 aBlockSize)
|
||||
{
|
||||
if (aBlockSize < NS_MIN_ARENA_BLOCK_SIZE) {
|
||||
aBlockSize = NS_DEFAULT_ARENA_BLOCK_SIZE;
|
||||
}
|
||||
PL_INIT_ARENA_POOL(&mPool, "nsIArena", aBlockSize);
|
||||
mBlockSize = aBlockSize;
|
||||
mInitialized = PR_TRUE;
|
||||
return NS_OK;
|
||||
}
|
||||
|
||||
NS_IMPL_ISUPPORTS1(ArenaImpl, nsIArena)
|
||||
|
||||
ArenaImpl::~ArenaImpl()
|
||||
{
|
||||
if (mInitialized)
|
||||
PL_FinishArenaPool(&mPool);
|
||||
|
||||
mInitialized = PR_FALSE;
|
||||
}
|
||||
|
||||
NS_IMETHODIMP_(void*)
|
||||
ArenaImpl::Alloc(PRUint32 size)
|
||||
{
|
||||
// Adjust size so that it's a multiple of sizeof(double)
|
||||
PRUint32 align = size & (sizeof(double) - 1);
|
||||
if (0 != align) {
|
||||
size += sizeof(double) - align;
|
||||
}
|
||||
|
||||
void* p;
|
||||
PL_ARENA_ALLOCATE(p, &mPool, size);
|
||||
return p;
|
||||
}
|
||||
|
||||
NS_METHOD
|
||||
ArenaImpl::Create(nsISupports *aOuter, REFNSIID aIID, void **aResult)
|
||||
{
|
||||
if (aOuter)
|
||||
return NS_ERROR_NO_AGGREGATION;
|
||||
|
||||
ArenaImpl* it = new ArenaImpl();
|
||||
if (nsnull == it)
|
||||
return NS_ERROR_OUT_OF_MEMORY;
|
||||
|
||||
NS_ADDREF(it);
|
||||
nsresult rv = it->QueryInterface(aIID, aResult);
|
||||
NS_RELEASE(it);
|
||||
return rv;
|
||||
}
|
||||
|
||||
NS_COM nsresult NS_NewHeapArena(nsIArena** aInstancePtrResult,
|
||||
PRUint32 aArenaBlockSize)
|
||||
{
|
||||
nsresult rv;
|
||||
nsIArena* arena;
|
||||
rv = ArenaImpl::Create(NULL, nsIArena::GetIID(), (void**)&arena);
|
||||
if (NS_FAILED(rv)) return rv;
|
||||
|
||||
rv = arena->Init(aArenaBlockSize);
|
||||
if (NS_FAILED(rv)) {
|
||||
NS_RELEASE(arena);
|
||||
return rv;
|
||||
}
|
||||
|
||||
*aInstancePtrResult = arena;
|
||||
return rv;
|
||||
}
|
||||
50
mozilla/xpcom/ds/nsArena.h
Normal file
50
mozilla/xpcom/ds/nsArena.h
Normal file
@@ -0,0 +1,50 @@
|
||||
/* -*- Mode: C++; tab-width: 2; indent-tabs-mode: nil; c-basic-offset: 2 -*-
|
||||
*
|
||||
* The contents of this file are subject to the Netscape Public License
|
||||
* Version 1.0 (the "NPL"); you may not use this file except in
|
||||
* compliance with the NPL. You may obtain a copy of the NPL at
|
||||
* http://www.mozilla.org/NPL/
|
||||
*
|
||||
* Software distributed under the NPL is distributed on an "AS IS" basis,
|
||||
* WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
|
||||
* for the specific language governing rights and limitations under the
|
||||
* NPL.
|
||||
*
|
||||
* The Initial Developer of this code under the NPL is Netscape
|
||||
* Communications Corporation. Portions created by Netscape are
|
||||
* Copyright (C) 1998 Netscape Communications Corporation. All Rights
|
||||
* Reserved.
|
||||
*/
|
||||
|
||||
#ifndef nsArena_h__
|
||||
#define nsArena_h__
|
||||
|
||||
#include "nsIArena.h"
|
||||
|
||||
#define PL_ARENA_CONST_ALIGN_MASK 7
|
||||
#include "plarena.h"
|
||||
|
||||
// Simple arena implementation layered on plarena
|
||||
class ArenaImpl : public nsIArena {
|
||||
public:
|
||||
ArenaImpl(void);
|
||||
virtual ~ArenaImpl();
|
||||
|
||||
NS_DECL_ISUPPORTS
|
||||
|
||||
static NS_METHOD
|
||||
Create(nsISupports *aOuter, REFNSIID aIID, void **aResult);
|
||||
|
||||
NS_IMETHOD Init(PRUint32 arenaBlockSize);
|
||||
|
||||
NS_IMETHOD_(void*) Alloc(PRUint32 size);
|
||||
|
||||
protected:
|
||||
PLArenaPool mPool;
|
||||
PRUint32 mBlockSize;
|
||||
|
||||
private:
|
||||
PRBool mInitialized;
|
||||
};
|
||||
|
||||
#endif // nsArena_h__
|
||||
172
mozilla/xpcom/ds/nsAtomTable.cpp
Normal file
172
mozilla/xpcom/ds/nsAtomTable.cpp
Normal file
@@ -0,0 +1,172 @@
|
||||
/* -*- Mode: C++; tab-width: 2; indent-tabs-mode: nil; c-basic-offset: 2 -*-
|
||||
*
|
||||
* The contents of this file are subject to the Netscape Public License
|
||||
* Version 1.0 (the "NPL"); you may not use this file except in
|
||||
* compliance with the NPL. You may obtain a copy of the NPL at
|
||||
* http://www.mozilla.org/NPL/
|
||||
*
|
||||
* Software distributed under the NPL is distributed on an "AS IS" basis,
|
||||
* WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
|
||||
* for the specific language governing rights and limitations under the
|
||||
* NPL.
|
||||
*
|
||||
* The Initial Developer of this code under the NPL is Netscape
|
||||
* Communications Corporation. Portions created by Netscape are
|
||||
* Copyright (C) 1998 Netscape Communications Corporation. All Rights
|
||||
* Reserved.
|
||||
*/
|
||||
|
||||
#include "nsAtomTable.h"
|
||||
#include "nsString.h"
|
||||
#include "nsCRT.h"
|
||||
#include "plhash.h"
|
||||
#include "nsISizeOfHandler.h"
|
||||
|
||||
/**
|
||||
* The shared hash table for atom lookups.
|
||||
*/
|
||||
static nsrefcnt gAtoms;
|
||||
static struct PLHashTable* gAtomHashTable;
|
||||
|
||||
#if defined(DEBUG) && (defined(XP_UNIX) || defined(XP_PC))
|
||||
static PRIntn
|
||||
DumpAtomLeaks(PLHashEntry *he, PRIntn index, void *arg)
|
||||
{
|
||||
AtomImpl* atom = (AtomImpl*) he->value;
|
||||
if (atom) {
|
||||
nsAutoString tmp;
|
||||
atom->ToString(tmp);
|
||||
fputs(tmp, stdout);
|
||||
fputs("\n", stdout);
|
||||
}
|
||||
return HT_ENUMERATE_NEXT;
|
||||
}
|
||||
#endif
|
||||
|
||||
NS_COM void NS_PurgeAtomTable(void)
|
||||
{
|
||||
if (gAtomHashTable) {
|
||||
#if defined(DEBUG) && (defined(XP_UNIX) || defined(XP_PC))
|
||||
if (gAtoms) {
|
||||
if (getenv("MOZ_DUMP_ATOM_LEAKS")) {
|
||||
printf("*** leaking %d atoms\n", gAtoms);
|
||||
PL_HashTableEnumerateEntries(gAtomHashTable, DumpAtomLeaks, 0);
|
||||
}
|
||||
}
|
||||
#endif
|
||||
PL_HashTableDestroy(gAtomHashTable);
|
||||
gAtomHashTable = nsnull;
|
||||
}
|
||||
}
|
||||
|
||||
AtomImpl::AtomImpl()
|
||||
{
|
||||
NS_INIT_REFCNT();
|
||||
// Every live atom holds a reference on the atom hashtable
|
||||
gAtoms++;
|
||||
}
|
||||
|
||||
AtomImpl::~AtomImpl()
|
||||
{
|
||||
NS_PRECONDITION(nsnull != gAtomHashTable, "null atom hashtable");
|
||||
if (nsnull != gAtomHashTable) {
|
||||
PL_HashTableRemove(gAtomHashTable, mString);
|
||||
nsrefcnt cnt = --gAtoms;
|
||||
if (0 == cnt) {
|
||||
// When the last atom is destroyed, the atom arena is destroyed
|
||||
NS_ASSERTION(0 == gAtomHashTable->nentries, "bad atom table");
|
||||
PL_HashTableDestroy(gAtomHashTable);
|
||||
gAtomHashTable = nsnull;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
NS_IMPL_ISUPPORTS1(AtomImpl, nsIAtom)
|
||||
|
||||
void* AtomImpl::operator new(size_t size, const PRUnichar* us, PRInt32 uslen)
|
||||
{
|
||||
size = size + uslen * sizeof(PRUnichar);
|
||||
AtomImpl* ii = (AtomImpl*) ::operator new(size);
|
||||
nsCRT::memcpy(ii->mString, us, uslen * sizeof(PRUnichar));
|
||||
ii->mString[uslen] = 0;
|
||||
return ii;
|
||||
}
|
||||
|
||||
NS_IMETHODIMP
|
||||
AtomImpl::ToString(nsString& aBuf) /*FIX: const */
|
||||
{
|
||||
aBuf.SetLength(0);
|
||||
aBuf.Append(mString, nsCRT::strlen(mString));
|
||||
return NS_OK;
|
||||
}
|
||||
|
||||
NS_IMETHODIMP
|
||||
AtomImpl::GetUnicode(const PRUnichar **aResult) /*FIX: const */
|
||||
{
|
||||
NS_ENSURE_ARG_POINTER(aResult);
|
||||
*aResult = mString;
|
||||
return NS_OK;
|
||||
}
|
||||
|
||||
NS_IMETHODIMP
|
||||
AtomImpl::SizeOf(nsISizeOfHandler* aHandler, PRUint32* _retval) /*FIX: const */
|
||||
{
|
||||
NS_ENSURE_ARG_POINTER(_retval);
|
||||
PRUint32 sum = sizeof(*this) + nsCRT::strlen(mString) * sizeof(PRUnichar);
|
||||
*_retval = sum;
|
||||
return NS_OK;
|
||||
}
|
||||
|
||||
//----------------------------------------------------------------------
|
||||
|
||||
static PLHashNumber HashKey(const PRUnichar* k)
|
||||
{
|
||||
return (PLHashNumber) nsCRT::HashValue(k);
|
||||
}
|
||||
|
||||
static PRIntn CompareKeys(const PRUnichar* k1, const PRUnichar* k2)
|
||||
{
|
||||
return nsCRT::strcmp(k1, k2) == 0;
|
||||
}
|
||||
|
||||
NS_COM nsIAtom* NS_NewAtom(const char* isolatin1)
|
||||
{
|
||||
nsAutoString tmp(isolatin1);
|
||||
return NS_NewAtom(tmp.GetUnicode());
|
||||
}
|
||||
|
||||
NS_COM nsIAtom* NS_NewAtom(const nsString& aString)
|
||||
{
|
||||
return NS_NewAtom(aString.GetUnicode());
|
||||
}
|
||||
|
||||
NS_COM nsIAtom* NS_NewAtom(const PRUnichar* us)
|
||||
{
|
||||
if (nsnull == gAtomHashTable) {
|
||||
gAtomHashTable = PL_NewHashTable(8, (PLHashFunction) HashKey,
|
||||
(PLHashComparator) CompareKeys,
|
||||
(PLHashComparator) nsnull,
|
||||
nsnull, nsnull);
|
||||
}
|
||||
PRUint32 uslen;
|
||||
PRUint32 hashCode = nsCRT::HashValue(us, &uslen);
|
||||
PLHashEntry** hep = PL_HashTableRawLookup(gAtomHashTable, hashCode, us);
|
||||
PLHashEntry* he = *hep;
|
||||
if (nsnull != he) {
|
||||
nsIAtom* id = (nsIAtom*) he->value;
|
||||
NS_ADDREF(id);
|
||||
return id;
|
||||
}
|
||||
AtomImpl* id = new(us, uslen) AtomImpl();
|
||||
PL_HashTableRawAdd(gAtomHashTable, hep, hashCode, id->mString, id);
|
||||
NS_ADDREF(id);
|
||||
return id;
|
||||
}
|
||||
|
||||
NS_COM nsrefcnt NS_GetNumberOfAtoms(void)
|
||||
{
|
||||
if (nsnull != gAtomHashTable) {
|
||||
NS_PRECONDITION(nsrefcnt(gAtomHashTable->nentries) == gAtoms, "bad atom table");
|
||||
}
|
||||
return gAtoms;
|
||||
}
|
||||
43
mozilla/xpcom/ds/nsAtomTable.h
Normal file
43
mozilla/xpcom/ds/nsAtomTable.h
Normal file
@@ -0,0 +1,43 @@
|
||||
/* -*- Mode: C++; tab-width: 2; indent-tabs-mode: nil; c-basic-offset: 2 -*-
|
||||
*
|
||||
* The contents of this file are subject to the Netscape Public License
|
||||
* Version 1.0 (the "NPL"); you may not use this file except in
|
||||
* compliance with the NPL. You may obtain a copy of the NPL at
|
||||
* http://www.mozilla.org/NPL/
|
||||
*
|
||||
* Software distributed under the NPL is distributed on an "AS IS" basis,
|
||||
* WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
|
||||
* for the specific language governing rights and limitations under the
|
||||
* NPL.
|
||||
*
|
||||
* The Initial Developer of this code under the NPL is Netscape
|
||||
* Communications Corporation. Portions created by Netscape are
|
||||
* Copyright (C) 1998 Netscape Communications Corporation. All Rights
|
||||
* Reserved.
|
||||
*/
|
||||
|
||||
#ifndef nsAtomTable_h__
|
||||
#define nsAtomTable_h__
|
||||
|
||||
#include "nsIAtom.h"
|
||||
|
||||
class AtomImpl : public nsIAtom {
|
||||
public:
|
||||
AtomImpl();
|
||||
virtual ~AtomImpl();
|
||||
|
||||
NS_DECL_ISUPPORTS
|
||||
NS_DECL_NSIATOM
|
||||
|
||||
void* operator new(size_t size, const PRUnichar* us, PRInt32 uslen);
|
||||
|
||||
void operator delete(void* ptr) {
|
||||
::operator delete(ptr);
|
||||
}
|
||||
|
||||
// Actually more; 0 terminated. This slot is reserved for the
|
||||
// terminating zero.
|
||||
PRUnichar mString[1];
|
||||
};
|
||||
|
||||
#endif // nsAtomTable_h__
|
||||
723
mozilla/xpcom/ds/nsBuffer.cpp
Normal file
723
mozilla/xpcom/ds/nsBuffer.cpp
Normal file
@@ -0,0 +1,723 @@
|
||||
/* -*- Mode: C++; tab-width: 4; indent-tabs-mode: nil; c-basic-offset: 4 -*-
|
||||
*
|
||||
* The contents of this file are subject to the Netscape Public License
|
||||
* Version 1.0 (the "NPL"); you may not use this file except in
|
||||
* compliance with the NPL. You may obtain a copy of the NPL at
|
||||
* http://www.mozilla.org/NPL/
|
||||
*
|
||||
* Software distributed under the NPL is distributed on an "AS IS" basis,
|
||||
* WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
|
||||
* for the specific language governing rights and limitations under the
|
||||
* NPL.
|
||||
*
|
||||
* The Initial Developer of this code under the NPL is Netscape
|
||||
* Communications Corporation. Portions created by Netscape are
|
||||
* Copyright (C) 1998 Netscape Communications Corporation. All Rights
|
||||
* Reserved.
|
||||
*/
|
||||
|
||||
#include "nsBuffer.h"
|
||||
#include "nsAutoLock.h"
|
||||
#include "nsCRT.h"
|
||||
#include "nsIInputStream.h"
|
||||
#include "nsIServiceManager.h"
|
||||
#include "nsIPageManager.h"
|
||||
|
||||
////////////////////////////////////////////////////////////////////////////////
|
||||
|
||||
nsBuffer::nsBuffer()
|
||||
: mGrowBySize(0),
|
||||
mMaxSize(0),
|
||||
mAllocator(nsnull),
|
||||
mObserver(nsnull),
|
||||
mBufferSize(0),
|
||||
mReadSegment(nsnull),
|
||||
mReadCursor(0),
|
||||
mWriteSegment(nsnull),
|
||||
mWriteCursor(0),
|
||||
mReaderClosed(PR_FALSE),
|
||||
mCondition(NS_OK)
|
||||
{
|
||||
NS_INIT_REFCNT();
|
||||
PR_INIT_CLIST(&mSegments);
|
||||
}
|
||||
|
||||
NS_IMETHODIMP
|
||||
nsBuffer::Init(PRUint32 growBySize, PRUint32 maxSize,
|
||||
nsIBufferObserver* observer, nsIAllocator* allocator)
|
||||
{
|
||||
NS_ASSERTION(sizeof(PRCList) <= SEGMENT_OVERHEAD,
|
||||
"need to change SEGMENT_OVERHEAD size");
|
||||
NS_ASSERTION(growBySize > SEGMENT_OVERHEAD, "bad growBySize");
|
||||
mGrowBySize = growBySize;
|
||||
mMaxSize = maxSize;
|
||||
mObserver = observer;
|
||||
NS_IF_ADDREF(mObserver);
|
||||
mAllocator = allocator;
|
||||
NS_ADDREF(mAllocator);
|
||||
return NS_OK;
|
||||
}
|
||||
|
||||
nsBuffer::~nsBuffer()
|
||||
{
|
||||
// Free any allocated pages...
|
||||
while (!PR_CLIST_IS_EMPTY(&mSegments)) {
|
||||
PRCList* header = (PRCList*)mSegments.next;
|
||||
char* segment = (char*)header;
|
||||
|
||||
PR_REMOVE_LINK(header); // unlink from mSegments
|
||||
(void) mAllocator->Free(segment);
|
||||
}
|
||||
|
||||
NS_IF_RELEASE(mObserver);
|
||||
NS_IF_RELEASE(mAllocator);
|
||||
}
|
||||
|
||||
NS_IMPL_ISUPPORTS1(nsBuffer, nsIBuffer)
|
||||
|
||||
NS_METHOD
|
||||
nsBuffer::Create(nsISupports *aOuter, REFNSIID aIID, void **aResult)
|
||||
{
|
||||
if (aOuter)
|
||||
return NS_ERROR_NO_AGGREGATION;
|
||||
|
||||
nsBuffer* buf = new nsBuffer();
|
||||
if (buf == nsnull)
|
||||
return NS_ERROR_OUT_OF_MEMORY;
|
||||
|
||||
NS_ADDREF(buf);
|
||||
nsresult rv = buf->QueryInterface(aIID, aResult);
|
||||
NS_RELEASE(buf);
|
||||
return rv;
|
||||
}
|
||||
|
||||
////////////////////////////////////////////////////////////////////////////////
|
||||
|
||||
nsresult
|
||||
nsBuffer::PushWriteSegment()
|
||||
{
|
||||
nsAutoCMonitor mon(this); // protect mSegments
|
||||
|
||||
if (mBufferSize >= mMaxSize) {
|
||||
if (mObserver) {
|
||||
nsresult rv = mObserver->OnFull(this);
|
||||
if (NS_FAILED(rv)) return rv;
|
||||
}
|
||||
return NS_BASE_STREAM_WOULD_BLOCK;
|
||||
}
|
||||
|
||||
// allocate a new segment to write into
|
||||
PRCList* header;
|
||||
|
||||
header = (PRCList*)mAllocator->Alloc(mGrowBySize);
|
||||
if (header == nsnull)
|
||||
return NS_ERROR_OUT_OF_MEMORY;
|
||||
|
||||
mBufferSize += mGrowBySize;
|
||||
|
||||
PR_INSERT_BEFORE(header, &mSegments); // insert at end
|
||||
|
||||
// initialize the write segment
|
||||
mWriteSegment = header;
|
||||
mWriteSegmentEnd = (char*)mWriteSegment + mGrowBySize;
|
||||
mWriteCursor = (char*)mWriteSegment + sizeof(PRCList);
|
||||
|
||||
return NS_OK;
|
||||
}
|
||||
|
||||
nsresult
|
||||
nsBuffer::PopReadSegment()
|
||||
{
|
||||
nsresult rv;
|
||||
nsAutoCMonitor mon(this); // protect mSegments
|
||||
|
||||
PRCList* header = (PRCList*)mSegments.next;
|
||||
char* segment = (char*)header;
|
||||
|
||||
NS_ASSERTION(mReadSegment == header, "wrong segment");
|
||||
|
||||
// make sure that the writer isn't still in this segment (that the
|
||||
// reader is removing)
|
||||
NS_ASSERTION(!(segment <= mWriteCursor && mWriteCursor < segment + mGrowBySize),
|
||||
"removing writer's segment");
|
||||
|
||||
PR_REMOVE_LINK(header); // unlink from mSegments
|
||||
|
||||
mBufferSize -= mGrowBySize;
|
||||
|
||||
rv = mAllocator->Free(segment);
|
||||
if (NS_FAILED(rv)) return rv;
|
||||
|
||||
// initialize the read segment
|
||||
if (PR_CLIST_IS_EMPTY(&mSegments)) {
|
||||
mReadSegment = nsnull;
|
||||
mReadSegmentEnd = nsnull;
|
||||
mReadCursor = nsnull;
|
||||
if (mObserver) {
|
||||
rv = mObserver->OnEmpty(this);
|
||||
if (NS_FAILED(rv)) return rv;
|
||||
}
|
||||
return NS_BASE_STREAM_WOULD_BLOCK;
|
||||
}
|
||||
else {
|
||||
mReadSegment = mSegments.next;
|
||||
mReadSegmentEnd = (char*)mReadSegment + mGrowBySize;
|
||||
mReadCursor = (char*)mReadSegment + sizeof(PRCList);
|
||||
}
|
||||
return NS_OK;
|
||||
}
|
||||
|
||||
////////////////////////////////////////////////////////////////////////////////
|
||||
// nsIBuffer methods:
|
||||
|
||||
NS_IMETHODIMP
|
||||
nsBuffer::ReadSegments(nsWriteSegmentFun writer, void* closure, PRUint32 count,
|
||||
PRUint32 *readCount)
|
||||
{
|
||||
NS_ASSERTION(!mReaderClosed, "state change error");
|
||||
|
||||
nsAutoCMonitor mon(this);
|
||||
nsresult rv = NS_OK;
|
||||
PRUint32 readBufferLen;
|
||||
const char* readBuffer;
|
||||
|
||||
*readCount = 0;
|
||||
while (count > 0) {
|
||||
rv = GetReadSegment(0, &readBuffer, &readBufferLen);
|
||||
if (NS_FAILED(rv) || readBufferLen == 0) {
|
||||
return *readCount == 0 ? rv : NS_OK;
|
||||
}
|
||||
|
||||
readBufferLen = PR_MIN(readBufferLen, count);
|
||||
while (readBufferLen > 0) {
|
||||
PRUint32 writeCount;
|
||||
rv = writer(closure, readBuffer, *readCount, readBufferLen, &writeCount);
|
||||
NS_ASSERTION(rv != NS_BASE_STREAM_EOF, "Write should not return EOF");
|
||||
if (rv == NS_BASE_STREAM_WOULD_BLOCK || NS_FAILED(rv) || writeCount == 0) {
|
||||
// if we failed to write just report what we were
|
||||
// able to read so far
|
||||
return *readCount == 0 ? rv : NS_OK;
|
||||
}
|
||||
NS_ASSERTION(writeCount <= readBufferLen, "writer returned bad writeCount");
|
||||
readBuffer += writeCount;
|
||||
readBufferLen -= writeCount;
|
||||
*readCount += writeCount;
|
||||
count -= writeCount;
|
||||
|
||||
if (mReadCursor + writeCount == mReadSegmentEnd) {
|
||||
rv = PopReadSegment();
|
||||
if (NS_FAILED(rv)) {
|
||||
return *readCount == 0 ? rv : NS_OK;
|
||||
}
|
||||
}
|
||||
else {
|
||||
mReadCursor += writeCount;
|
||||
}
|
||||
}
|
||||
}
|
||||
return NS_OK;
|
||||
}
|
||||
|
||||
static NS_METHOD
|
||||
nsWriteToRawBuffer(void* closure,
|
||||
const char* fromRawSegment,
|
||||
PRUint32 offset,
|
||||
PRUint32 count,
|
||||
PRUint32 *writeCount)
|
||||
{
|
||||
char* toBuf = (char*)closure;
|
||||
nsCRT::memcpy(&toBuf[offset], fromRawSegment, count);
|
||||
*writeCount = count;
|
||||
return NS_OK;
|
||||
}
|
||||
|
||||
NS_IMETHODIMP
|
||||
nsBuffer::Read(char* toBuf, PRUint32 bufLen, PRUint32 *readCount)
|
||||
{
|
||||
return ReadSegments(nsWriteToRawBuffer, toBuf, bufLen, readCount);
|
||||
}
|
||||
|
||||
NS_IMETHODIMP
|
||||
nsBuffer::GetReadSegment(PRUint32 segmentLogicalOffset,
|
||||
const char* *resultSegment,
|
||||
PRUint32 *resultSegmentLen)
|
||||
{
|
||||
nsAutoCMonitor mon(this);
|
||||
|
||||
// set the read segment and cursor if not already set
|
||||
if (mReadSegment == nsnull) {
|
||||
if (PR_CLIST_IS_EMPTY(&mSegments)) {
|
||||
*resultSegmentLen = 0;
|
||||
*resultSegment = nsnull;
|
||||
return mCondition;
|
||||
}
|
||||
else {
|
||||
mReadSegment = mSegments.next;
|
||||
mReadSegmentEnd = (char*)mReadSegment + mGrowBySize;
|
||||
mReadCursor = (char*)mReadSegment + sizeof(PRCList);
|
||||
}
|
||||
}
|
||||
|
||||
// now search for the segment starting from segmentLogicalOffset and return it
|
||||
PRCList* curSeg = mReadSegment;
|
||||
char* curSegStart = mReadCursor;
|
||||
char* curSegEnd = mReadSegmentEnd;
|
||||
PRInt32 amt;
|
||||
PRInt32 offset = (PRInt32)segmentLogicalOffset;
|
||||
while (offset >= 0) {
|
||||
// snapshot the write cursor into a local variable -- this allows
|
||||
// a writer to freely change it while we're reading while avoiding
|
||||
// using a lock
|
||||
char* snapshotWriteCursor = mWriteCursor; // atomic
|
||||
|
||||
// next check if the write cursor is in our segment
|
||||
if (curSegStart <= snapshotWriteCursor &&
|
||||
snapshotWriteCursor < curSegEnd) {
|
||||
// same segment -- read up to the snapshotWriteCursor
|
||||
curSegEnd = snapshotWriteCursor;
|
||||
|
||||
amt = curSegEnd - curSegStart;
|
||||
if (offset < amt) {
|
||||
// segmentLogicalOffset is in this segment, so read up to its end
|
||||
*resultSegmentLen = amt - offset;
|
||||
*resultSegment = curSegStart + offset;
|
||||
return NS_OK;
|
||||
}
|
||||
else {
|
||||
// don't continue past the write segment
|
||||
*resultSegmentLen = 0;
|
||||
*resultSegment = nsnull;
|
||||
return mCondition;
|
||||
}
|
||||
}
|
||||
else {
|
||||
amt = curSegEnd - curSegStart;
|
||||
if (offset < amt) {
|
||||
// segmentLogicalOffset is in this segment, so read up to its end
|
||||
*resultSegmentLen = amt - offset;
|
||||
*resultSegment = curSegStart + offset;
|
||||
return NS_OK;
|
||||
}
|
||||
else {
|
||||
curSeg = PR_NEXT_LINK(curSeg);
|
||||
if (curSeg == mReadSegment) {
|
||||
// been all the way around
|
||||
*resultSegmentLen = 0;
|
||||
*resultSegment = nsnull;
|
||||
return mCondition;
|
||||
}
|
||||
curSegEnd = (char*)curSeg + mGrowBySize;
|
||||
curSegStart = (char*)curSeg + sizeof(PRCList);
|
||||
offset -= amt;
|
||||
}
|
||||
}
|
||||
}
|
||||
NS_NOTREACHED("nsBuffer::GetReadSegment failed");
|
||||
return NS_ERROR_FAILURE;
|
||||
}
|
||||
|
||||
NS_IMETHODIMP
|
||||
nsBuffer::GetReadableAmount(PRUint32 *result)
|
||||
{
|
||||
NS_ASSERTION(!mReaderClosed, "state change error");
|
||||
|
||||
nsAutoCMonitor mon(this);
|
||||
*result = 0;
|
||||
|
||||
// first set the read segment and cursor if not already set
|
||||
if (mReadSegment == nsnull) {
|
||||
if (PR_CLIST_IS_EMPTY(&mSegments)) {
|
||||
return NS_OK;
|
||||
}
|
||||
else {
|
||||
mReadSegment = mSegments.next;
|
||||
mReadSegmentEnd = (char*)mReadSegment + mGrowBySize;
|
||||
mReadCursor = (char*)mReadSegment + sizeof(PRCList);
|
||||
}
|
||||
}
|
||||
|
||||
// now search for the segment starting from segmentLogicalOffset and return it
|
||||
PRCList* curSeg = mReadSegment;
|
||||
char* curSegStart = mReadCursor;
|
||||
char* curSegEnd = mReadSegmentEnd;
|
||||
PRInt32 amt;
|
||||
while (PR_TRUE) {
|
||||
// snapshot the write cursor into a local variable -- this allows
|
||||
// a writer to freely change it while we're reading while avoiding
|
||||
// using a lock
|
||||
char* snapshotWriteCursor = mWriteCursor; // atomic
|
||||
|
||||
// next check if the write cursor is in our segment
|
||||
if (curSegStart <= snapshotWriteCursor &&
|
||||
snapshotWriteCursor < curSegEnd) {
|
||||
// same segment -- read up to the snapshotWriteCursor
|
||||
curSegEnd = snapshotWriteCursor;
|
||||
|
||||
amt = curSegEnd - curSegStart;
|
||||
*result += amt;
|
||||
return NS_OK;
|
||||
}
|
||||
else {
|
||||
amt = curSegEnd - curSegStart;
|
||||
*result += amt;
|
||||
curSeg = PR_NEXT_LINK(curSeg);
|
||||
if (curSeg == mReadSegment) {
|
||||
// been all the way around
|
||||
return NS_OK;
|
||||
}
|
||||
curSegEnd = (char*)curSeg + mGrowBySize;
|
||||
curSegStart = (char*)curSeg + sizeof(PRCList);
|
||||
}
|
||||
}
|
||||
return NS_ERROR_FAILURE;
|
||||
}
|
||||
|
||||
#define COMPARE(s1, s2, i) ignoreCase ? nsCRT::strncasecmp((const char *)s1, (const char *)s2, (PRUint32)i) : nsCRT::strncmp((const char *)s1, (const char *)s2, (PRUint32)i)
|
||||
|
||||
NS_IMETHODIMP
|
||||
nsBuffer::Search(const char* string, PRBool ignoreCase,
|
||||
PRBool *found, PRUint32 *offsetSearchedTo)
|
||||
{
|
||||
NS_ASSERTION(!mReaderClosed, "state change error");
|
||||
|
||||
nsresult rv;
|
||||
const char* bufSeg1;
|
||||
PRUint32 bufSegLen1;
|
||||
PRUint32 segmentPos = 0;
|
||||
PRUint32 strLen = nsCRT::strlen(string);
|
||||
|
||||
rv = GetReadSegment(segmentPos, &bufSeg1, &bufSegLen1);
|
||||
if (NS_FAILED(rv) || bufSegLen1 == 0) {
|
||||
*found = PR_FALSE;
|
||||
*offsetSearchedTo = segmentPos;
|
||||
return NS_OK;
|
||||
}
|
||||
|
||||
while (PR_TRUE) {
|
||||
PRUint32 i;
|
||||
// check if the string is in the buffer segment
|
||||
for (i = 0; i < bufSegLen1 - strLen + 1; i++) {
|
||||
if (COMPARE(&bufSeg1[i], string, strLen) == 0) {
|
||||
*found = PR_TRUE;
|
||||
*offsetSearchedTo = segmentPos + i;
|
||||
return NS_OK;
|
||||
}
|
||||
}
|
||||
|
||||
// get the next segment
|
||||
const char* bufSeg2;
|
||||
PRUint32 bufSegLen2;
|
||||
segmentPos += bufSegLen1;
|
||||
rv = GetReadSegment(segmentPos, &bufSeg2, &bufSegLen2);
|
||||
if (NS_FAILED(rv) || bufSegLen2 == 0) {
|
||||
*found = PR_FALSE;
|
||||
if (mCondition != NS_OK) // XXX NS_FAILED?
|
||||
*offsetSearchedTo = segmentPos - bufSegLen1;
|
||||
else
|
||||
*offsetSearchedTo = segmentPos - bufSegLen1 - strLen + 1;
|
||||
return NS_OK;
|
||||
}
|
||||
|
||||
// check if the string is straddling the next buffer segment
|
||||
PRUint32 limit = PR_MIN(strLen, bufSegLen2 + 1);
|
||||
for (i = 0; i < limit; i++) {
|
||||
PRUint32 strPart1Len = strLen - i - 1;
|
||||
PRUint32 strPart2Len = strLen - strPart1Len;
|
||||
const char* strPart2 = &string[strLen - strPart2Len];
|
||||
PRUint32 bufSeg1Offset = bufSegLen1 - strPart1Len;
|
||||
if (COMPARE(&bufSeg1[bufSeg1Offset], string, strPart1Len) == 0 &&
|
||||
COMPARE(bufSeg2, strPart2, strPart2Len) == 0) {
|
||||
*found = PR_TRUE;
|
||||
*offsetSearchedTo = segmentPos - strPart1Len;
|
||||
return NS_OK;
|
||||
}
|
||||
}
|
||||
|
||||
// finally continue with the next buffer
|
||||
bufSeg1 = bufSeg2;
|
||||
bufSegLen1 = bufSegLen2;
|
||||
}
|
||||
NS_NOTREACHED("can't get here");
|
||||
return NS_ERROR_FAILURE; // keep compiler happy
|
||||
}
|
||||
|
||||
NS_IMETHODIMP
|
||||
nsBuffer::ReaderClosed()
|
||||
{
|
||||
nsresult rv = NS_OK;
|
||||
nsAutoCMonitor mon(this); // protect mSegments
|
||||
|
||||
// first prevent any more writing
|
||||
mReaderClosed = PR_TRUE;
|
||||
|
||||
// then free any unread segments...
|
||||
|
||||
// first set the read segment and cursor if not already set
|
||||
if (mReadSegment == nsnull) {
|
||||
if (!PR_CLIST_IS_EMPTY(&mSegments)) {
|
||||
mReadSegment = mSegments.next;
|
||||
mReadSegmentEnd = (char*)mReadSegment + mGrowBySize;
|
||||
mReadCursor = (char*)mReadSegment + sizeof(PRCList);
|
||||
}
|
||||
}
|
||||
|
||||
while (mReadSegment) {
|
||||
// snapshot the write cursor into a local variable -- this allows
|
||||
// a writer to freely change it while we're reading while avoiding
|
||||
// using a lock
|
||||
char* snapshotWriteCursor = mWriteCursor; // atomic
|
||||
|
||||
// next check if the write cursor is in our segment
|
||||
if (mReadCursor <= snapshotWriteCursor &&
|
||||
snapshotWriteCursor < mReadSegmentEnd) {
|
||||
// same segment -- we've discarded all the unread segments we
|
||||
// can, so just updatethe read cursor
|
||||
mReadCursor = mWriteCursor;
|
||||
break;
|
||||
}
|
||||
// else advance to the next segment, freeing this one
|
||||
rv = PopReadSegment();
|
||||
if (NS_FAILED(rv)) break;
|
||||
}
|
||||
|
||||
#ifdef DEBUG
|
||||
PRUint32 amt;
|
||||
const char* buf;
|
||||
rv = GetReadSegment(0, &buf, &amt);
|
||||
NS_ASSERTION(rv == NS_BASE_STREAM_EOF ||
|
||||
(NS_SUCCEEDED(rv) && amt == 0), "ReaderClosed failed");
|
||||
#endif
|
||||
|
||||
return rv;
|
||||
}
|
||||
|
||||
NS_IMETHODIMP
|
||||
nsBuffer::GetCondition(nsresult *result)
|
||||
{
|
||||
*result = mCondition;
|
||||
return NS_OK;
|
||||
}
|
||||
|
||||
////////////////////////////////////////////////////////////////////////////////
|
||||
|
||||
NS_IMETHODIMP
|
||||
nsBuffer::WriteSegments(nsReadSegmentFun reader, void* closure, PRUint32 count,
|
||||
PRUint32 *writeCount)
|
||||
{
|
||||
nsresult rv = NS_OK;
|
||||
|
||||
nsAutoCMonitor mon(this);
|
||||
*writeCount = 0;
|
||||
|
||||
if (mReaderClosed) {
|
||||
rv = NS_BASE_STREAM_CLOSED;
|
||||
goto done;
|
||||
}
|
||||
|
||||
if (NS_FAILED(mCondition)) {
|
||||
rv = mCondition;
|
||||
goto done;
|
||||
}
|
||||
|
||||
while (count > 0) {
|
||||
PRUint32 writeBufLen;
|
||||
char* writeBuf;
|
||||
rv = GetWriteSegment(&writeBuf, &writeBufLen);
|
||||
if (NS_FAILED(rv) || writeBufLen == 0) {
|
||||
// if we failed to allocate a new segment, we're probably out
|
||||
// of memory, but we don't care -- just report what we were
|
||||
// able to write so far
|
||||
rv = (*writeCount == 0) ? rv : NS_OK;
|
||||
goto done;
|
||||
}
|
||||
|
||||
writeBufLen = PR_MIN(writeBufLen, count);
|
||||
while (writeBufLen > 0) {
|
||||
PRUint32 readCount = 0;
|
||||
rv = reader(closure, writeBuf, *writeCount, writeBufLen, &readCount);
|
||||
if (rv == NS_BASE_STREAM_WOULD_BLOCK || readCount == 0) {
|
||||
// if the place we're putting the data would block (probably ran
|
||||
// out of room) just return what we were able to write so far
|
||||
rv = (*writeCount == 0) ? rv : NS_OK;
|
||||
goto done;
|
||||
}
|
||||
if (NS_FAILED(rv)) {
|
||||
// save the failure condition so that we can get it again later
|
||||
nsresult rv2 = SetCondition(rv);
|
||||
NS_ASSERTION(NS_SUCCEEDED(rv2), "SetCondition failed");
|
||||
// if we failed to read just report what we were
|
||||
// able to write so far
|
||||
rv = (*writeCount == 0) ? rv : NS_OK;
|
||||
goto done;
|
||||
}
|
||||
NS_ASSERTION(readCount <= writeBufLen, "reader returned bad readCount");
|
||||
writeBuf += readCount;
|
||||
writeBufLen -= readCount;
|
||||
*writeCount += readCount;
|
||||
count -= readCount;
|
||||
|
||||
// set the write cursor after the data is valid
|
||||
if (mWriteCursor + readCount == mWriteSegmentEnd) {
|
||||
mWriteSegment = nsnull; // allocate a new segment next time around
|
||||
mWriteSegmentEnd = nsnull;
|
||||
mWriteCursor = nsnull;
|
||||
}
|
||||
else
|
||||
mWriteCursor += readCount;
|
||||
}
|
||||
}
|
||||
done:
|
||||
if (mObserver && *writeCount) {
|
||||
mObserver->OnWrite(this, *writeCount);
|
||||
}
|
||||
return rv;
|
||||
}
|
||||
|
||||
static NS_METHOD
|
||||
nsReadFromRawBuffer(void* closure,
|
||||
char* toRawSegment,
|
||||
PRUint32 offset,
|
||||
PRUint32 count,
|
||||
PRUint32 *readCount)
|
||||
{
|
||||
const char* fromBuf = (const char*)closure;
|
||||
nsCRT::memcpy(toRawSegment, &fromBuf[offset], count);
|
||||
*readCount = count;
|
||||
return NS_OK;
|
||||
}
|
||||
|
||||
NS_IMETHODIMP
|
||||
nsBuffer::Write(const char* fromBuf, PRUint32 bufLen, PRUint32 *writeCount)
|
||||
{
|
||||
return WriteSegments(nsReadFromRawBuffer, (void*)fromBuf, bufLen, writeCount);
|
||||
}
|
||||
|
||||
static NS_METHOD
|
||||
nsReadFromInputStream(void* closure,
|
||||
char* toRawSegment,
|
||||
PRUint32 offset,
|
||||
PRUint32 count,
|
||||
PRUint32 *readCount)
|
||||
{
|
||||
nsIInputStream* fromStream = (nsIInputStream*)closure;
|
||||
return fromStream->Read(toRawSegment, count, readCount);
|
||||
}
|
||||
|
||||
NS_IMETHODIMP
|
||||
nsBuffer::WriteFrom(nsIInputStream* fromStream, PRUint32 count, PRUint32 *writeCount)
|
||||
{
|
||||
return WriteSegments(nsReadFromInputStream, fromStream, count, writeCount);
|
||||
}
|
||||
|
||||
NS_IMETHODIMP
|
||||
nsBuffer::GetWriteSegment(char* *resultSegment,
|
||||
PRUint32 *resultSegmentLen)
|
||||
{
|
||||
nsAutoCMonitor mon(this);
|
||||
if (mReaderClosed)
|
||||
return NS_BASE_STREAM_CLOSED;
|
||||
|
||||
nsresult rv;
|
||||
*resultSegmentLen = 0;
|
||||
*resultSegment = nsnull;
|
||||
if (mWriteSegment == nsnull) {
|
||||
rv = PushWriteSegment();
|
||||
if (NS_FAILED(rv) || rv == NS_BASE_STREAM_WOULD_BLOCK) return rv;
|
||||
|
||||
NS_ASSERTION(mWriteSegment != nsnull, "failed to allocate segment");
|
||||
}
|
||||
|
||||
*resultSegmentLen = mWriteSegmentEnd - mWriteCursor;
|
||||
*resultSegment = mWriteCursor;
|
||||
NS_ASSERTION(*resultSegmentLen > 0, "Failed to get write segment.");
|
||||
return NS_OK;
|
||||
}
|
||||
|
||||
NS_IMETHODIMP
|
||||
nsBuffer::GetWritableAmount(PRUint32 *amount)
|
||||
{
|
||||
if (mReaderClosed)
|
||||
return NS_BASE_STREAM_CLOSED;
|
||||
|
||||
nsresult rv;
|
||||
PRUint32 readableAmount;
|
||||
rv = GetReadableAmount(&readableAmount);
|
||||
if (NS_FAILED(rv)) return rv;
|
||||
*amount = mMaxSize - readableAmount;
|
||||
return NS_OK;
|
||||
}
|
||||
|
||||
NS_IMETHODIMP
|
||||
nsBuffer::GetReaderClosed(PRBool *result)
|
||||
{
|
||||
*result = mReaderClosed;
|
||||
return NS_OK;
|
||||
}
|
||||
|
||||
NS_IMETHODIMP
|
||||
nsBuffer::SetCondition(nsresult condition)
|
||||
{
|
||||
nsAutoCMonitor mon(this);
|
||||
if (mReaderClosed)
|
||||
return NS_BASE_STREAM_CLOSED;
|
||||
|
||||
mCondition = condition;
|
||||
mWriteSegment = nsnull; // allows reader to free last segment w/o asserting
|
||||
mWriteSegmentEnd = nsnull;
|
||||
// don't reset mWriteCursor here -- we need it for the EOF point in the buffer
|
||||
return NS_OK;
|
||||
}
|
||||
|
||||
////////////////////////////////////////////////////////////////////////////////
|
||||
|
||||
static NS_DEFINE_CID(kAllocatorCID, NS_ALLOCATOR_CID);
|
||||
|
||||
NS_COM nsresult
|
||||
NS_NewBuffer(nsIBuffer* *result,
|
||||
PRUint32 growBySize, PRUint32 maxSize,
|
||||
nsIBufferObserver* observer)
|
||||
{
|
||||
nsresult rv;
|
||||
NS_WITH_SERVICE(nsIAllocator, alloc, kAllocatorCID, &rv);
|
||||
if (NS_FAILED(rv)) return rv;
|
||||
|
||||
nsBuffer* buf;
|
||||
rv = nsBuffer::Create(NULL, nsIBuffer::GetIID(), (void**)&buf);
|
||||
if (NS_FAILED(rv)) return rv;
|
||||
|
||||
rv = buf->Init(growBySize, maxSize, observer, alloc);
|
||||
if (NS_FAILED(rv)) {
|
||||
NS_RELEASE(buf);
|
||||
return rv;
|
||||
}
|
||||
|
||||
*result = buf;
|
||||
return NS_OK;
|
||||
}
|
||||
|
||||
static NS_DEFINE_CID(kPageManagerCID, NS_PAGEMANAGER_CID);
|
||||
|
||||
NS_COM nsresult
|
||||
NS_NewPageBuffer(nsIBuffer* *result,
|
||||
PRUint32 growBySize, PRUint32 maxSize,
|
||||
nsIBufferObserver* observer)
|
||||
{
|
||||
nsresult rv;
|
||||
NS_WITH_SERVICE(nsIAllocator, alloc, kPageManagerCID, &rv);
|
||||
if (NS_FAILED(rv)) return rv;
|
||||
|
||||
nsBuffer* buf;
|
||||
rv = nsBuffer::Create(NULL, nsIBuffer::GetIID(), (void**)&buf);
|
||||
if (NS_FAILED(rv)) return rv;
|
||||
|
||||
rv = buf->Init(growBySize, maxSize, observer, alloc);
|
||||
if (NS_FAILED(rv)) {
|
||||
NS_RELEASE(buf);
|
||||
return rv;
|
||||
}
|
||||
|
||||
*result = buf;
|
||||
return NS_OK;
|
||||
}
|
||||
|
||||
////////////////////////////////////////////////////////////////////////////////
|
||||
87
mozilla/xpcom/ds/nsBuffer.h
Normal file
87
mozilla/xpcom/ds/nsBuffer.h
Normal file
@@ -0,0 +1,87 @@
|
||||
/* -*- Mode: C++; tab-width: 4; indent-tabs-mode: nil; c-basic-offset: 4 -*-
|
||||
*
|
||||
* The contents of this file are subject to the Netscape Public License
|
||||
* Version 1.0 (the "NPL"); you may not use this file except in
|
||||
* compliance with the NPL. You may obtain a copy of the NPL at
|
||||
* http://www.mozilla.org/NPL/
|
||||
*
|
||||
* Software distributed under the NPL is distributed on an "AS IS" basis,
|
||||
* WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
|
||||
* for the specific language governing rights and limitations under the
|
||||
* NPL.
|
||||
*
|
||||
* The Initial Developer of this code under the NPL is Netscape
|
||||
* Communications Corporation. Portions created by Netscape are
|
||||
* Copyright (C) 1998 Netscape Communications Corporation. All Rights
|
||||
* Reserved.
|
||||
*/
|
||||
|
||||
#ifndef nsBuffer_h___
|
||||
#define nsBuffer_h___
|
||||
|
||||
#include "nsIBuffer.h"
|
||||
#include "nscore.h"
|
||||
#include "prclist.h"
|
||||
#include "nsIAllocator.h"
|
||||
|
||||
class nsBuffer : public nsIBuffer {
|
||||
public:
|
||||
NS_DECL_ISUPPORTS
|
||||
|
||||
static NS_METHOD
|
||||
Create(nsISupports *aOuter, REFNSIID aIID, void **aResult);
|
||||
|
||||
// nsIBuffer methods:
|
||||
NS_IMETHOD Init(PRUint32 growBySize, PRUint32 maxSize,
|
||||
nsIBufferObserver* observer, nsIAllocator* allocator);
|
||||
NS_IMETHOD Read(char* toBuf, PRUint32 bufLen, PRUint32 *readCount);
|
||||
NS_IMETHOD ReadSegments(nsWriteSegmentFun writer, void* closure, PRUint32 count,
|
||||
PRUint32 *readCount);
|
||||
NS_IMETHOD GetReadSegment(PRUint32 segmentLogicalOffset,
|
||||
const char* *resultSegment,
|
||||
PRUint32 *resultSegmentLen);
|
||||
NS_IMETHOD GetReadableAmount(PRUint32 *amount);
|
||||
NS_IMETHOD Search(const char* forString, PRBool ignoreCase,
|
||||
PRBool *found, PRUint32 *offsetSearchedTo);
|
||||
NS_IMETHOD ReaderClosed(void);
|
||||
NS_IMETHOD GetCondition(nsresult *result);
|
||||
|
||||
NS_IMETHOD Write(const char* fromBuf, PRUint32 bufLen, PRUint32 *writeCount);
|
||||
NS_IMETHOD WriteFrom(nsIInputStream* fromStream, PRUint32 count, PRUint32 *writeCount);
|
||||
NS_IMETHOD WriteSegments(nsReadSegmentFun reader, void* closure, PRUint32 count,
|
||||
PRUint32 *writeCount);
|
||||
NS_IMETHOD GetWriteSegment(char* *resultSegment,
|
||||
PRUint32 *resultSegmentLen);
|
||||
NS_IMETHOD GetWritableAmount(PRUint32 *amount);
|
||||
NS_IMETHOD GetReaderClosed(PRBool *result);
|
||||
NS_IMETHOD SetCondition(nsresult condition);
|
||||
|
||||
// nsBuffer methods:
|
||||
nsBuffer();
|
||||
virtual ~nsBuffer();
|
||||
|
||||
nsresult PushWriteSegment();
|
||||
nsresult PopReadSegment();
|
||||
|
||||
protected:
|
||||
PRUint32 mGrowBySize;
|
||||
PRUint32 mMaxSize;
|
||||
nsIAllocator* mAllocator;
|
||||
nsIBufferObserver* mObserver;
|
||||
|
||||
PRCList mSegments;
|
||||
PRUint32 mBufferSize;
|
||||
|
||||
PRCList* mReadSegment;
|
||||
char* mReadSegmentEnd;
|
||||
char* mReadCursor;
|
||||
|
||||
PRCList* mWriteSegment;
|
||||
char* mWriteSegmentEnd;
|
||||
char* mWriteCursor;
|
||||
|
||||
PRBool mReaderClosed;
|
||||
nsresult mCondition;
|
||||
};
|
||||
|
||||
#endif // nsBuffer_h___
|
||||
40
mozilla/xpcom/ds/nsBufferPoolService.h
Normal file
40
mozilla/xpcom/ds/nsBufferPoolService.h
Normal file
@@ -0,0 +1,40 @@
|
||||
/* -*- Mode: C++; tab-width: 4; indent-tabs-mode: nil; c-basic-offset: 4 -*-
|
||||
*
|
||||
* The contents of this file are subject to the Netscape Public License
|
||||
* Version 1.0 (the "NPL"); you may not use this file except in
|
||||
* compliance with the NPL. You may obtain a copy of the NPL at
|
||||
* http://www.mozilla.org/NPL/
|
||||
*
|
||||
* Software distributed under the NPL is distributed on an "AS IS" basis,
|
||||
* WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
|
||||
* for the specific language governing rights and limitations under the
|
||||
* NPL.
|
||||
*
|
||||
* The Initial Developer of this code under the NPL is Netscape
|
||||
* Communications Corporation. Portions created by Netscape are
|
||||
* Copyright (C) 1998 Netscape Communications Corporation. All Rights
|
||||
* Reserved.
|
||||
*/
|
||||
|
||||
#ifndef nsBufferPoolService_h___
|
||||
#define nsBufferPoolService_h___
|
||||
|
||||
#include "nsIBufferPoolService.h"
|
||||
|
||||
class nsBufferPoolService : public nsIBufferPoolService {
|
||||
public:
|
||||
NS_DECL_ISUPPORTS
|
||||
|
||||
// nsIBufferPoolService methods:
|
||||
NS_IMETHOD NewBuffer(PRUint32 minSize, PRUint32 maxSize,
|
||||
nsIByteBuffer* *result);
|
||||
|
||||
// nsBufferPoolService methods:
|
||||
nsBufferPoolService();
|
||||
virtual ~nsBufferPoolService();
|
||||
|
||||
protected:
|
||||
|
||||
};
|
||||
|
||||
#endif // nsBufferPoolService_h___
|
||||
151
mozilla/xpcom/ds/nsByteBuffer.cpp
Normal file
151
mozilla/xpcom/ds/nsByteBuffer.cpp
Normal file
@@ -0,0 +1,151 @@
|
||||
/* -*- Mode: C++; tab-width: 2; indent-tabs-mode: nil; c-basic-offset: 2 -*-
|
||||
*
|
||||
* The contents of this file are subject to the Netscape Public License
|
||||
* Version 1.0 (the "NPL"); you may not use this file except in
|
||||
* compliance with the NPL. You may obtain a copy of the NPL at
|
||||
* http://www.mozilla.org/NPL/
|
||||
*
|
||||
* Software distributed under the NPL is distributed on an "AS IS" basis,
|
||||
* WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
|
||||
* for the specific language governing rights and limitations under the
|
||||
* NPL.
|
||||
*
|
||||
* The Initial Developer of this code under the NPL is Netscape
|
||||
* Communications Corporation. Portions created by Netscape are
|
||||
* Copyright (C) 1998 Netscape Communications Corporation. All Rights
|
||||
* Reserved.
|
||||
*/
|
||||
|
||||
#include "nsByteBuffer.h"
|
||||
#include "nsIInputStream.h"
|
||||
#include "nsCRT.h"
|
||||
|
||||
#define MIN_BUFFER_SIZE 32
|
||||
|
||||
ByteBufferImpl::ByteBufferImpl(void)
|
||||
: mBuffer(NULL), mSpace(0), mLength(0)
|
||||
{
|
||||
NS_INIT_REFCNT();
|
||||
}
|
||||
|
||||
NS_IMETHODIMP
|
||||
ByteBufferImpl::Init(PRUint32 aBufferSize)
|
||||
{
|
||||
if (aBufferSize < MIN_BUFFER_SIZE) {
|
||||
aBufferSize = MIN_BUFFER_SIZE;
|
||||
}
|
||||
mSpace = aBufferSize;
|
||||
mLength = 0;
|
||||
mBuffer = new char[aBufferSize];
|
||||
return mBuffer ? NS_OK : NS_ERROR_OUT_OF_MEMORY;
|
||||
}
|
||||
|
||||
NS_IMPL_ISUPPORTS1(ByteBufferImpl,nsIByteBuffer)
|
||||
|
||||
ByteBufferImpl::~ByteBufferImpl()
|
||||
{
|
||||
if (nsnull != mBuffer) {
|
||||
delete[] mBuffer;
|
||||
mBuffer = nsnull;
|
||||
}
|
||||
mLength = 0;
|
||||
}
|
||||
|
||||
NS_METHOD
|
||||
ByteBufferImpl::Create(nsISupports *aOuter, REFNSIID aIID, void **aResult)
|
||||
{
|
||||
if (aOuter)
|
||||
return NS_ERROR_NO_AGGREGATION;
|
||||
|
||||
ByteBufferImpl* it = new ByteBufferImpl();
|
||||
if (nsnull == it)
|
||||
return NS_ERROR_OUT_OF_MEMORY;
|
||||
|
||||
NS_ADDREF(it);
|
||||
nsresult rv = it->QueryInterface(aIID, (void**)aResult);
|
||||
NS_RELEASE(it);
|
||||
return rv;
|
||||
}
|
||||
|
||||
NS_IMETHODIMP_(PRUint32)
|
||||
ByteBufferImpl::GetLength(void) const
|
||||
{
|
||||
return mLength;
|
||||
}
|
||||
|
||||
NS_IMETHODIMP_(PRUint32)
|
||||
ByteBufferImpl::GetBufferSize(void) const
|
||||
{
|
||||
return mSpace;
|
||||
}
|
||||
|
||||
NS_IMETHODIMP_(char*)
|
||||
ByteBufferImpl::GetBuffer(void) const
|
||||
{
|
||||
return mBuffer;
|
||||
}
|
||||
|
||||
NS_IMETHODIMP_(PRBool)
|
||||
ByteBufferImpl::Grow(PRUint32 aNewSize)
|
||||
{
|
||||
if (aNewSize < MIN_BUFFER_SIZE) {
|
||||
aNewSize = MIN_BUFFER_SIZE;
|
||||
}
|
||||
char* newbuf = new char[aNewSize];
|
||||
if (nsnull != newbuf) {
|
||||
if (0 != mLength) {
|
||||
nsCRT::memcpy(newbuf, mBuffer, mLength);
|
||||
}
|
||||
delete[] mBuffer;
|
||||
mBuffer = newbuf;
|
||||
return PR_TRUE;
|
||||
}
|
||||
return PR_FALSE;
|
||||
}
|
||||
|
||||
NS_IMETHODIMP_(PRInt32)
|
||||
ByteBufferImpl::Fill(nsresult* aErrorCode, nsIInputStream* aStream,
|
||||
PRUint32 aKeep)
|
||||
{
|
||||
NS_PRECONDITION(nsnull != aStream, "null stream");
|
||||
NS_PRECONDITION(aKeep <= mLength, "illegal keep count");
|
||||
if ((nsnull == aStream) || (PRUint32(aKeep) > PRUint32(mLength))) {
|
||||
// whoops
|
||||
*aErrorCode = NS_BASE_STREAM_ILLEGAL_ARGS;
|
||||
return -1;
|
||||
}
|
||||
|
||||
if (0 != aKeep) {
|
||||
// Slide over kept data
|
||||
nsCRT::memmove(mBuffer, mBuffer + (mLength - aKeep), aKeep);
|
||||
}
|
||||
|
||||
// Read in some new data
|
||||
mLength = aKeep;
|
||||
PRUint32 nb;
|
||||
*aErrorCode = aStream->Read(mBuffer + aKeep, mSpace - aKeep, &nb);
|
||||
if (NS_SUCCEEDED(*aErrorCode)) {
|
||||
mLength += nb;
|
||||
}
|
||||
else
|
||||
nb = 0;
|
||||
return nb;
|
||||
}
|
||||
|
||||
NS_COM nsresult NS_NewByteBuffer(nsIByteBuffer** aInstancePtrResult,
|
||||
nsISupports* aOuter,
|
||||
PRUint32 aBufferSize)
|
||||
{
|
||||
nsresult rv;
|
||||
nsIByteBuffer* buf;
|
||||
rv = ByteBufferImpl::Create(aOuter, nsIByteBuffer::GetIID(), (void**)&buf);
|
||||
if (NS_FAILED(rv)) return rv;
|
||||
|
||||
rv = buf->Init(aBufferSize);
|
||||
if (NS_FAILED(rv)) {
|
||||
NS_RELEASE(buf);
|
||||
return rv;
|
||||
}
|
||||
*aInstancePtrResult = buf;
|
||||
return rv;
|
||||
}
|
||||
47
mozilla/xpcom/ds/nsByteBuffer.h
Normal file
47
mozilla/xpcom/ds/nsByteBuffer.h
Normal file
@@ -0,0 +1,47 @@
|
||||
/* -*- Mode: C++; tab-width: 2; indent-tabs-mode: nil; c-basic-offset: 2 -*-
|
||||
*
|
||||
* The contents of this file are subject to the Netscape Public License
|
||||
* Version 1.0 (the "NPL"); you may not use this file except in
|
||||
* compliance with the NPL. You may obtain a copy of the NPL at
|
||||
* http://www.mozilla.org/NPL/
|
||||
*
|
||||
* Software distributed under the NPL is distributed on an "AS IS" basis,
|
||||
* WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
|
||||
* for the specific language governing rights and limitations under the
|
||||
* NPL.
|
||||
*
|
||||
* The Initial Developer of this code under the NPL is Netscape
|
||||
* Communications Corporation. Portions created by Netscape are
|
||||
* Copyright (C) 1998 Netscape Communications Corporation. All Rights
|
||||
* Reserved.
|
||||
*/
|
||||
|
||||
#ifndef nsByteBuffer_h__
|
||||
#define nsByteBuffer_h__
|
||||
|
||||
#include "nsIByteBuffer.h"
|
||||
|
||||
class ByteBufferImpl : public nsIByteBuffer {
|
||||
public:
|
||||
ByteBufferImpl(void);
|
||||
virtual ~ByteBufferImpl();
|
||||
|
||||
NS_DECL_ISUPPORTS
|
||||
|
||||
static NS_METHOD
|
||||
Create(nsISupports *aOuter, REFNSIID aIID, void **aResult);
|
||||
|
||||
NS_IMETHOD Init(PRUint32 aBufferSize);
|
||||
NS_IMETHOD_(PRUint32) GetLength(void) const;
|
||||
NS_IMETHOD_(PRUint32) GetBufferSize(void) const;
|
||||
NS_IMETHOD_(char*) GetBuffer() const;
|
||||
NS_IMETHOD_(PRBool) Grow(PRUint32 aNewSize);
|
||||
NS_IMETHOD_(PRInt32) Fill(nsresult* aErrorCode, nsIInputStream* aStream,
|
||||
PRUint32 aKeep);
|
||||
|
||||
char* mBuffer;
|
||||
PRUint32 mSpace;
|
||||
PRUint32 mLength;
|
||||
};
|
||||
|
||||
#endif // nsByteBuffer_h__
|
||||
555
mozilla/xpcom/ds/nsCRT.cpp
Normal file
555
mozilla/xpcom/ds/nsCRT.cpp
Normal file
@@ -0,0 +1,555 @@
|
||||
/* -*- Mode: C++; tab-width: 2; indent-tabs-mode: nil; c-basic-offset: 2 -*-
|
||||
*
|
||||
* The contents of this file are subject to the Netscape Public License
|
||||
* Version 1.0 (the "NPL"); you may not use this file except in
|
||||
* compliance with the NPL. You may obtain a copy of the NPL at
|
||||
* http://www.mozilla.org/NPL/
|
||||
*
|
||||
* Software distributed under the NPL is distributed on an "AS IS" basis,
|
||||
* WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
|
||||
* for the specific language governing rights and limitations under the
|
||||
* NPL.
|
||||
*
|
||||
* The Initial Developer of this code under the NPL is Netscape
|
||||
* Communications Corporation. Portions created by Netscape are
|
||||
* Copyright (C) 1998 Netscape Communications Corporation. All Rights
|
||||
* Reserved.
|
||||
*/
|
||||
|
||||
|
||||
/**
|
||||
* MODULE NOTES:
|
||||
* @update gess7/30/98
|
||||
*
|
||||
* Much as I hate to do it, we were using string compares wrong.
|
||||
* Often, programmers call functions like strcmp(s1,s2), and pass
|
||||
* one or more null strings. Rather than blow up on these, I've
|
||||
* added quick checks to ensure that cases like this don't cause
|
||||
* us to fail.
|
||||
*
|
||||
* In general, if you pass a null into any of these string compare
|
||||
* routines, we simply return 0.
|
||||
*/
|
||||
|
||||
|
||||
#include "nsCRT.h"
|
||||
#include "nsUnicharUtilCIID.h"
|
||||
#include "nsIServiceManager.h"
|
||||
#include "nsICaseConversion.h"
|
||||
|
||||
|
||||
// XXX Bug: These tables don't lowercase the upper 128 characters properly
|
||||
|
||||
// This table maps uppercase characters to lower case characters;
|
||||
// characters that are neither upper nor lower case are unaffected.
|
||||
static const unsigned char kUpper2Lower[256] = {
|
||||
0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15,
|
||||
16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31,
|
||||
32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47,
|
||||
48, 49, 50, 51, 52, 53, 54, 55, 56, 57, 58, 59, 60, 61, 62, 63,
|
||||
64,
|
||||
|
||||
// upper band mapped to lower [A-Z] => [a-z]
|
||||
97, 98, 99,100,101,102,103,104,105,106,107,108,109,110,111,
|
||||
112,113,114,115,116,117,118,119,120,121,122,
|
||||
|
||||
91, 92, 93, 94, 95,
|
||||
96, 97, 98, 99,100,101,102,103,104,105,106,107,108,109,110,111,
|
||||
112,113,114,115,116,117,118,119,120,121,122,123,124,125,126,127,
|
||||
128,129,130,131,132,133,134,135,136,137,138,139,140,141,142,143,
|
||||
144,145,146,147,148,149,150,151,152,153,154,155,156,157,158,159,
|
||||
160,161,162,163,164,165,166,167,168,169,170,171,172,173,174,175,
|
||||
176,177,178,179,180,181,182,183,184,185,186,187,188,189,190,191,
|
||||
192,193,194,195,196,197,198,199,200,201,202,203,204,205,206,207,
|
||||
208,209,210,211,212,213,214,215,216,217,218,219,220,221,222,223,
|
||||
224,225,226,227,228,229,230,231,232,233,234,235,236,237,238,239,
|
||||
240,241,242,243,244,245,246,247,248,249,250,251,252,253,254,255
|
||||
};
|
||||
|
||||
static const unsigned char kLower2Upper[256] = {
|
||||
0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15,
|
||||
16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31,
|
||||
32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47,
|
||||
48, 49, 50, 51, 52, 53, 54, 55, 56, 57, 58, 59, 60, 61, 62, 63,
|
||||
64, 65, 66, 67, 68, 69, 70, 71, 72, 73, 74, 75, 76, 77, 78, 79,
|
||||
80, 81, 82, 83, 84, 85, 86, 87, 88, 89, 90, 91, 92, 93, 94, 95,
|
||||
96,
|
||||
|
||||
// lower band mapped to upper [a-z] => [A-Z]
|
||||
65, 66, 67, 68, 69, 70, 71, 72, 73, 74, 75, 76, 77, 78, 79,
|
||||
80, 81, 82, 83, 84, 85, 86, 87, 88, 89, 90,
|
||||
|
||||
123,124,125,126,127,
|
||||
128,129,130,131,132,133,134,135,136,137,138,139,140,141,142,143,
|
||||
144,145,146,147,148,149,150,151,152,153,154,155,156,157,158,159,
|
||||
160,161,162,163,164,165,166,167,168,169,170,171,172,173,174,175,
|
||||
176,177,178,179,180,181,182,183,184,185,186,187,188,189,190,191,
|
||||
192,193,194,195,196,197,198,199,200,201,202,203,204,205,206,207,
|
||||
208,209,210,211,212,213,214,215,216,217,218,219,220,221,222,223,
|
||||
224,225,226,227,228,229,230,231,232,233,234,235,236,237,238,239,
|
||||
240,241,242,243,244,245,246,247,248,249,250,251,252,253,254,255
|
||||
};
|
||||
|
||||
// XXX bug: this doesn't map 0x80 to 0x9f properly
|
||||
const PRUnichar kIsoLatin1ToUCS2[256] = {
|
||||
0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15,
|
||||
16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29, 30, 31,
|
||||
32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47,
|
||||
48, 49, 50, 51, 52, 53, 54, 55, 56, 57, 58, 59, 60, 61, 62, 63,
|
||||
64, 65, 66, 67, 68, 69, 70, 71, 72, 73, 74, 75, 76, 77, 78, 79,
|
||||
80, 81, 82, 83, 84, 85, 86, 87, 88, 89, 90, 91, 92, 93, 94, 95,
|
||||
96, 97, 98, 99,100,101,102,103,104,105,106,107,108,109,110,111,
|
||||
112,113,114,115,116,117,118,119,120,121,122,123,124,125,126,127,
|
||||
128,129,130,131,132,133,134,135,136,137,138,139,140,141,142,143,
|
||||
144,145,146,147,148,149,150,151,152,153,154,155,156,157,158,159,
|
||||
160,161,162,163,164,165,166,167,168,169,170,171,172,173,174,175,
|
||||
176,177,178,179,180,181,182,183,184,185,186,187,188,189,190,191,
|
||||
192,193,194,195,196,197,198,199,200,201,202,203,204,205,206,207,
|
||||
208,209,210,211,212,213,214,215,216,217,218,219,220,221,222,223,
|
||||
224,225,226,227,228,229,230,231,232,233,234,235,236,237,238,239,
|
||||
240,241,242,243,244,245,246,247,248,249,250,251,252,253,254,255
|
||||
};
|
||||
|
||||
//----------------------------------------------------------------------
|
||||
|
||||
#define TOLOWER(_ucs2) \
|
||||
(((_ucs2) < 128) ? PRUnichar(kUpper2Lower[_ucs2]) : _ToLower(_ucs2))
|
||||
|
||||
#define TOUPPER(_ucs2) \
|
||||
(((_ucs2) < 128) ? PRUnichar(kLower2Upper[_ucs2]) : _ToUpper(_ucs2))
|
||||
|
||||
class HandleCaseConversionShutdown : public nsIShutdownListener {
|
||||
public :
|
||||
NS_IMETHOD OnShutdown(const nsCID& cid, nsISupports* service);
|
||||
HandleCaseConversionShutdown(void) { NS_INIT_REFCNT(); }
|
||||
virtual ~HandleCaseConversionShutdown(void) {}
|
||||
NS_DECL_ISUPPORTS
|
||||
};
|
||||
static NS_DEFINE_CID(kUnicharUtilCID, NS_UNICHARUTIL_CID);
|
||||
|
||||
static nsICaseConversion * gCaseConv = NULL;
|
||||
|
||||
NS_IMPL_ISUPPORTS1(HandleCaseConversionShutdown, nsIShutdownListener)
|
||||
|
||||
nsresult
|
||||
HandleCaseConversionShutdown::OnShutdown(const nsCID& cid,
|
||||
nsISupports* aService)
|
||||
{
|
||||
if (cid.Equals(kUnicharUtilCID)) {
|
||||
NS_ASSERTION(aService == gCaseConv, "wrong service!");
|
||||
gCaseConv->Release();
|
||||
gCaseConv = NULL;
|
||||
}
|
||||
return NS_OK;
|
||||
}
|
||||
|
||||
static HandleCaseConversionShutdown* gListener = NULL;
|
||||
|
||||
static void StartUpCaseConversion()
|
||||
{
|
||||
nsresult err;
|
||||
|
||||
if ( NULL == gListener )
|
||||
{
|
||||
gListener = new HandleCaseConversionShutdown();
|
||||
gListener->AddRef();
|
||||
}
|
||||
err = nsServiceManager::GetService(kUnicharUtilCID, NS_GET_IID(nsICaseConversion),
|
||||
(nsISupports**) &gCaseConv, gListener);
|
||||
}
|
||||
static void CheckCaseConversion()
|
||||
{
|
||||
if(NULL == gCaseConv )
|
||||
StartUpCaseConversion();
|
||||
|
||||
NS_ASSERTION( gCaseConv != NULL , "cannot obtain UnicharUtil");
|
||||
|
||||
}
|
||||
|
||||
static PRUnichar _ToLower(PRUnichar aChar)
|
||||
{
|
||||
PRUnichar oLower;
|
||||
CheckCaseConversion();
|
||||
nsresult err = gCaseConv->ToLower(aChar, &oLower);
|
||||
NS_ASSERTION( NS_SUCCEEDED(err), "failed to communicate to UnicharUtil");
|
||||
return ( NS_SUCCEEDED(err) ) ? oLower : aChar ;
|
||||
}
|
||||
|
||||
static PRUnichar _ToUpper(PRUnichar aChar)
|
||||
{
|
||||
nsresult err;
|
||||
PRUnichar oUpper;
|
||||
CheckCaseConversion();
|
||||
err = gCaseConv->ToUpper(aChar, &oUpper);
|
||||
NS_ASSERTION( NS_SUCCEEDED(err), "failed to communicate to UnicharUtil");
|
||||
return ( NS_SUCCEEDED(err) ) ? oUpper : aChar ;
|
||||
}
|
||||
|
||||
//----------------------------------------------------------------------
|
||||
|
||||
PRUnichar nsCRT::ToUpper(PRUnichar aChar)
|
||||
{
|
||||
return TOUPPER(aChar);
|
||||
}
|
||||
|
||||
PRUnichar nsCRT::ToLower(PRUnichar aChar)
|
||||
{
|
||||
return TOLOWER(aChar);
|
||||
}
|
||||
|
||||
PRBool nsCRT::IsUpper(PRUnichar aChar)
|
||||
{
|
||||
return aChar != nsCRT::ToLower(aChar);
|
||||
}
|
||||
|
||||
PRBool nsCRT::IsLower(PRUnichar aChar)
|
||||
{
|
||||
return aChar != nsCRT::ToUpper(aChar);
|
||||
}
|
||||
|
||||
////////////////////////////////////////////////////////////////////////////////
|
||||
// My lovely strtok routine
|
||||
|
||||
#define IS_DELIM(m, c) ((m)[(c) >> 3] & (1 << ((c) & 7)))
|
||||
#define SET_DELIM(m, c) ((m)[(c) >> 3] |= (1 << ((c) & 7)))
|
||||
#define DELIM_TABLE_SIZE 32
|
||||
|
||||
char* nsCRT::strtok(char* string, const char* delims, char* *newStr)
|
||||
{
|
||||
NS_ASSERTION(string, "Unlike regular strtok, the first argument cannot be null.");
|
||||
|
||||
char delimTable[DELIM_TABLE_SIZE];
|
||||
PRUint32 i;
|
||||
char* result;
|
||||
char* str = string;
|
||||
|
||||
for (i = 0; i < DELIM_TABLE_SIZE; i++)
|
||||
delimTable[i] = '\0';
|
||||
|
||||
for (i = 0; i < DELIM_TABLE_SIZE && delims[i]; i++) {
|
||||
SET_DELIM(delimTable, delims[i]);
|
||||
}
|
||||
NS_ASSERTION(delims[i] == '\0', "too many delimiters");
|
||||
|
||||
// skip to beginning
|
||||
while (*str && IS_DELIM(delimTable, *str)) {
|
||||
str++;
|
||||
}
|
||||
result = str;
|
||||
|
||||
// fix up the end of the token
|
||||
while (*str) {
|
||||
if (IS_DELIM(delimTable, *str)) {
|
||||
*str++ = '\0';
|
||||
break;
|
||||
}
|
||||
str++;
|
||||
}
|
||||
*newStr = str;
|
||||
|
||||
return str == result ? NULL : result;
|
||||
}
|
||||
|
||||
////////////////////////////////////////////////////////////////////////////////
|
||||
|
||||
PRUint32 nsCRT::strlen(const PRUnichar* s)
|
||||
{
|
||||
PRUint32 len = 0;
|
||||
if(s) {
|
||||
while (*s++ != 0) {
|
||||
len++;
|
||||
}
|
||||
}
|
||||
return len;
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
* Compare unichar string ptrs, stopping at the 1st null
|
||||
* NOTE: If both are null, we return 0.
|
||||
* @update gess7/30/98
|
||||
* @param s1 and s2 both point to unichar strings
|
||||
* @return 0 if they match, -1 if s1<s2; 1 if s1>s2
|
||||
*/
|
||||
PRInt32 nsCRT::strcmp(const PRUnichar* s1, const PRUnichar* s2)
|
||||
{
|
||||
if(s1 && s2) {
|
||||
for (;;) {
|
||||
PRUnichar c1 = *s1++;
|
||||
PRUnichar c2 = *s2++;
|
||||
if (c1 != c2) {
|
||||
if (c1 < c2) return -1;
|
||||
return 1;
|
||||
}
|
||||
if ((0==c1) || (0==c2)) break;
|
||||
}
|
||||
}
|
||||
return 0;
|
||||
}
|
||||
|
||||
/**
|
||||
* Compare unichar string ptrs, stopping at the 1st null or nth char.
|
||||
* NOTE: If either is null, we return 0.
|
||||
* @update gess7/30/98
|
||||
* @param s1 and s2 both point to unichar strings
|
||||
* @return 0 if they match, -1 if s1<s2; 1 if s1>s2
|
||||
*/
|
||||
PRInt32 nsCRT::strncmp(const PRUnichar* s1, const PRUnichar* s2, PRUint32 n)
|
||||
{
|
||||
if(s1 && s2) {
|
||||
if(n != 0) {
|
||||
do {
|
||||
PRUnichar c1 = *s1++;
|
||||
PRUnichar c2 = *s2++;
|
||||
if (c1 != c2) {
|
||||
if (c1 < c2) return -1;
|
||||
return 1;
|
||||
}
|
||||
if ((0==c1) || (0==c2)) break;
|
||||
} while (--n != 0);
|
||||
}
|
||||
}
|
||||
return 0;
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
* Compare unichar string ptrs without regard to case
|
||||
* NOTE: If both are null, we return 0.
|
||||
* @update gess7/30/98
|
||||
* @param s1 and s2 both point to unichar strings
|
||||
* @return 0 if they match, -1 if s1<s2; 1 if s1>s2
|
||||
*/
|
||||
PRInt32 nsCRT::strcasecmp(const PRUnichar* s1, const PRUnichar* s2)
|
||||
{
|
||||
if(s1 && s2) {
|
||||
for (;;) {
|
||||
PRUnichar c1 = *s1++;
|
||||
PRUnichar c2 = *s2++;
|
||||
if (c1 != c2) {
|
||||
c1 = TOLOWER(c1);
|
||||
c2 = TOLOWER(c2);
|
||||
if (c1 != c2) {
|
||||
if (c1 < c2) return -1;
|
||||
return 1;
|
||||
}
|
||||
}
|
||||
if ((0==c1) || (0==c2)) break;
|
||||
}
|
||||
}
|
||||
return 0;
|
||||
}
|
||||
|
||||
/**
|
||||
* Compare unichar string ptrs, stopping at the 1st null or nth char;
|
||||
* also ignoring the case of characters.
|
||||
* NOTE: If both are null, we return 0.
|
||||
* @update gess7/30/98
|
||||
* @param s1 and s2 both point to unichar strings
|
||||
* @return 0 if they match, -1 if s1<s2; 1 if s1>s2
|
||||
*/
|
||||
PRInt32 nsCRT::strncasecmp(const PRUnichar* s1, const PRUnichar* s2, PRUint32 n)
|
||||
{
|
||||
if(s1 && s2) {
|
||||
if(n != 0){
|
||||
do {
|
||||
PRUnichar c1 = *s1++;
|
||||
PRUnichar c2 = *s2++;
|
||||
if (c1 != c2) {
|
||||
c1 = TOLOWER(c1);
|
||||
c2 = TOLOWER(c2);
|
||||
if (c1 != c2) {
|
||||
if (c1 < c2) return -1;
|
||||
return 1;
|
||||
}
|
||||
}
|
||||
if ((0==c1) || (0==c2)) break;
|
||||
} while (--n != 0);
|
||||
}
|
||||
}
|
||||
return 0;
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
* Compare a unichar string ptr to cstring.
|
||||
* NOTE: If both are null, we return 0.
|
||||
* @update gess7/30/98
|
||||
* @param s1 points to unichar string
|
||||
* @param s2 points to cstring
|
||||
* @return 0 if they match, -1 if s1<s2; 1 if s1>s2
|
||||
*/
|
||||
PRInt32 nsCRT::strcmp(const PRUnichar* s1, const char* s2)
|
||||
{
|
||||
if(s1 && s2) {
|
||||
for (;;) {
|
||||
PRUnichar c1 = *s1++;
|
||||
PRUnichar c2 = kIsoLatin1ToUCS2[*(const unsigned char*)s2++];
|
||||
if (c1 != c2) {
|
||||
if (c1 < c2) return -1;
|
||||
return 1;
|
||||
}
|
||||
if ((0==c1) || (0==c2)) break;
|
||||
}
|
||||
}
|
||||
return 0;
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
* Compare a unichar string ptr to cstring, up to N chars.
|
||||
* NOTE: If both are null, we return 0.
|
||||
* @update gess7/30/98
|
||||
* @param s1 points to unichar string
|
||||
* @param s2 points to cstring
|
||||
* @return 0 if they match, -1 if s1<s2; 1 if s1>s2
|
||||
*/
|
||||
PRInt32 nsCRT::strncmp(const PRUnichar* s1, const char* s2, PRUint32 n)
|
||||
{
|
||||
if(s1 && s2) {
|
||||
if(n != 0){
|
||||
do {
|
||||
PRUnichar c1 = *s1++;
|
||||
PRUnichar c2 = kIsoLatin1ToUCS2[*(const unsigned char*)s2++];
|
||||
if (c1 != c2) {
|
||||
if (c1 < c2) return -1;
|
||||
return 1;
|
||||
}
|
||||
if ((0==c1) || (0==c2)) break;
|
||||
} while (--n != 0);
|
||||
}
|
||||
}
|
||||
return 0;
|
||||
}
|
||||
|
||||
/**
|
||||
* Compare a unichar string ptr to cstring without regard to case
|
||||
* NOTE: If both are null, we return 0.
|
||||
* @update gess7/30/98
|
||||
* @param s1 points to unichar string
|
||||
* @param s2 points to cstring
|
||||
* @return 0 if they match, -1 if s1<s2; 1 if s1>s2
|
||||
*/
|
||||
PRInt32 nsCRT::strcasecmp(const PRUnichar* s1, const char* s2)
|
||||
{
|
||||
if(s1 && s2) {
|
||||
for (;;) {
|
||||
PRUnichar c1 = *s1++;
|
||||
PRUnichar c2 = kIsoLatin1ToUCS2[*(const unsigned char*)s2++];
|
||||
if (c1 != c2) {
|
||||
c1 = TOLOWER(c1);
|
||||
c2 = TOLOWER(c2);
|
||||
if (c1 != c2) {
|
||||
if (c1 < c2) return -1;
|
||||
return 1;
|
||||
}
|
||||
}
|
||||
if ((0==c1) || (0==c2)) break;
|
||||
}
|
||||
}
|
||||
return 0;
|
||||
}
|
||||
|
||||
/**
|
||||
* Caseless compare up to N chars between unichar string ptr to cstring.
|
||||
* NOTE: If both are null, we return 0.
|
||||
* @update gess7/30/98
|
||||
* @param s1 points to unichar string
|
||||
* @param s2 points to cstring
|
||||
* @return 0 if they match, -1 if s1<s2; 1 if s1>s2
|
||||
*/
|
||||
PRInt32 nsCRT::strncasecmp(const PRUnichar* s1, const char* s2, PRUint32 n)
|
||||
{
|
||||
if(s1 && s2){
|
||||
if(n != 0){
|
||||
do {
|
||||
PRUnichar c1 = *s1++;
|
||||
PRUnichar c2 = kIsoLatin1ToUCS2[*(const unsigned char*)s2++];
|
||||
if (c1 != c2) {
|
||||
c1 = TOLOWER(c1);
|
||||
c2 = TOLOWER(c2);
|
||||
if (c1 != c2) {
|
||||
if (c1 < c2) return -1;
|
||||
return 1;
|
||||
}
|
||||
}
|
||||
if (c1 == 0) break;
|
||||
} while (--n != 0);
|
||||
}
|
||||
}
|
||||
return 0;
|
||||
}
|
||||
|
||||
PRUnichar* nsCRT::strdup(const PRUnichar* str)
|
||||
{
|
||||
PRUint32 len = nsCRT::strlen(str) + 1; // add one for null
|
||||
|
||||
|
||||
nsCppSharedAllocator<PRUnichar> shared_allocator;
|
||||
PRUnichar* rslt = shared_allocator.allocate(len);
|
||||
// PRUnichar* rslt = new PRUnichar[len];
|
||||
|
||||
if (rslt == NULL) return NULL;
|
||||
nsCRT::memcpy(rslt, str, len * sizeof(PRUnichar));
|
||||
return rslt;
|
||||
}
|
||||
|
||||
PRUint32 nsCRT::HashValue(const char* us)
|
||||
{
|
||||
PRUint32 rv = 0;
|
||||
if(us) {
|
||||
char ch;
|
||||
while ((ch = *us++) != 0) {
|
||||
// FYI: rv = rv*37 + ch
|
||||
rv = ((rv << 5) + (rv << 2) + rv) + ch;
|
||||
}
|
||||
}
|
||||
return rv;
|
||||
}
|
||||
|
||||
PRUint32 nsCRT::HashValue(const char* us, PRUint32* uslenp)
|
||||
{
|
||||
PRUint32 rv = 0;
|
||||
PRUint32 len = 0;
|
||||
char ch;
|
||||
while ((ch = *us++) != 0) {
|
||||
// FYI: rv = rv*37 + ch
|
||||
rv = ((rv << 5) + (rv << 2) + rv) + ch;
|
||||
len++;
|
||||
}
|
||||
*uslenp = len;
|
||||
return rv;
|
||||
}
|
||||
|
||||
PRUint32 nsCRT::HashValue(const PRUnichar* us)
|
||||
{
|
||||
PRUint32 rv = 0;
|
||||
if(us) {
|
||||
PRUnichar ch;
|
||||
while ((ch = *us++) != 0) {
|
||||
// FYI: rv = rv*37 + ch
|
||||
rv = ((rv << 5) + (rv << 2) + rv) + ch;
|
||||
}
|
||||
}
|
||||
return rv;
|
||||
}
|
||||
|
||||
PRUint32 nsCRT::HashValue(const PRUnichar* us, PRUint32* uslenp)
|
||||
{
|
||||
PRUint32 rv = 0;
|
||||
PRUint32 len = 0;
|
||||
PRUnichar ch;
|
||||
while ((ch = *us++) != 0) {
|
||||
// FYI: rv = rv*37 + ch
|
||||
rv = ((rv << 5) + (rv << 2) + rv) + ch;
|
||||
len++;
|
||||
}
|
||||
*uslenp = len;
|
||||
return rv;
|
||||
}
|
||||
|
||||
PRInt32 nsCRT::atoi( const PRUnichar *string )
|
||||
{
|
||||
return atoi(string);
|
||||
}
|
||||
|
||||
239
mozilla/xpcom/ds/nsCRT.h
Normal file
239
mozilla/xpcom/ds/nsCRT.h
Normal file
@@ -0,0 +1,239 @@
|
||||
/* -*- Mode: C++; tab-width: 2; indent-tabs-mode: nil; c-basic-offset: 2 -*-
|
||||
*
|
||||
* The contents of this file are subject to the Netscape Public License
|
||||
* Version 1.0 (the "NPL"); you may not use this file except in
|
||||
* compliance with the NPL. You may obtain a copy of the NPL at
|
||||
* http://www.mozilla.org/NPL/
|
||||
*
|
||||
* Software distributed under the NPL is distributed on an "AS IS" basis,
|
||||
* WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
|
||||
* for the specific language governing rights and limitations under the
|
||||
* NPL.
|
||||
*
|
||||
* The Initial Developer of this code under the NPL is Netscape
|
||||
* Communications Corporation. Portions created by Netscape are
|
||||
* Copyright (C) 1998 Netscape Communications Corporation. All Rights
|
||||
* Reserved.
|
||||
*/
|
||||
#ifndef nsCRT_h___
|
||||
#define nsCRT_h___
|
||||
|
||||
#include <stdlib.h>
|
||||
#include <string.h>
|
||||
#include "plstr.h"
|
||||
#include "nscore.h"
|
||||
#include "prtypes.h"
|
||||
#include "nsCppSharedAllocator.h"
|
||||
|
||||
#define CR '\015'
|
||||
#define LF '\012'
|
||||
#define VTAB '\013'
|
||||
#define FF '\014'
|
||||
#define TAB '\011'
|
||||
#define CRLF "\015\012" /* A CR LF equivalent string */
|
||||
|
||||
#ifdef XP_MAC
|
||||
# define NS_LINEBREAK "\015"
|
||||
# define NS_LINEBREAK_LEN 1
|
||||
#else
|
||||
# ifdef XP_PC
|
||||
# define NS_LINEBREAK "\015\012"
|
||||
# define NS_LINEBREAK_LEN 2
|
||||
# else
|
||||
# if defined(XP_UNIX) || defined(XP_BEOS)
|
||||
# define NS_LINEBREAK "\012"
|
||||
# define NS_LINEBREAK_LEN 1
|
||||
# endif /* XP_UNIX */
|
||||
# endif /* XP_PC */
|
||||
#endif /* XP_MAC */
|
||||
|
||||
|
||||
extern const PRUnichar kIsoLatin1ToUCS2[256];
|
||||
|
||||
|
||||
// This macro can be used in a class declaration for classes that want
|
||||
// to ensure that their instance memory is zeroed.
|
||||
#define NS_DECL_AND_IMPL_ZEROING_OPERATOR_NEW \
|
||||
void* operator new(size_t sz) { \
|
||||
void* rv = ::operator new(sz); \
|
||||
if (rv) { \
|
||||
nsCRT::zero(rv, sz); \
|
||||
} \
|
||||
return rv; \
|
||||
} \
|
||||
void operator delete(void* ptr) { \
|
||||
::operator delete(ptr); \
|
||||
}
|
||||
|
||||
// This macro works with the next macro to declare a non-inlined
|
||||
// version of the above.
|
||||
#define NS_DECL_ZEROING_OPERATOR_NEW \
|
||||
void* operator new(size_t sz); \
|
||||
void operator delete(void* ptr);
|
||||
|
||||
#define NS_IMPL_ZEROING_OPERATOR_NEW(_class) \
|
||||
void* _class::operator new(size_t sz) { \
|
||||
void* rv = ::operator new(sz); \
|
||||
if (rv) { \
|
||||
nsCRT::zero(rv, sz); \
|
||||
} \
|
||||
return rv; \
|
||||
} \
|
||||
void _class::operator delete(void* ptr) { \
|
||||
::operator delete(ptr); \
|
||||
}
|
||||
|
||||
// Freeing helper
|
||||
#define CRTFREEIF(x) if (x) { nsCRT::free(x); x = 0; }
|
||||
|
||||
/// This is a wrapper class around all the C runtime functions.
|
||||
|
||||
class NS_COM nsCRT {
|
||||
public:
|
||||
|
||||
/** Copy bytes from aSrc to aDest.
|
||||
@param aDest the destination address
|
||||
@param aSrc the source address
|
||||
@param aCount the number of bytes to copy
|
||||
*/
|
||||
static void memcpy(void* aDest, const void* aSrc, PRUint32 aCount) {
|
||||
::memcpy(aDest, aSrc, (size_t)aCount);
|
||||
}
|
||||
|
||||
static void memmove(void* aDest, const void* aSrc, PRUint32 aCount) {
|
||||
::memmove(aDest, aSrc, (size_t)aCount);
|
||||
}
|
||||
|
||||
static void memset(void* aDest, PRUint8 aByte, PRUint32 aCount) {
|
||||
::memset(aDest, aByte, aCount);
|
||||
}
|
||||
|
||||
static void zero(void* aDest, PRUint32 aCount) {
|
||||
::memset(aDest, 0, (size_t)aCount);
|
||||
}
|
||||
|
||||
/** Compute the string length of s
|
||||
@param s the string in question
|
||||
@return the length of s
|
||||
*/
|
||||
static PRUint32 strlen(const char* s) {
|
||||
return PRUint32(::strlen(s));
|
||||
}
|
||||
|
||||
/// Compare s1 and s2.
|
||||
static PRInt32 strcmp(const char* s1, const char* s2) {
|
||||
return PRUint32(PL_strcmp(s1, s2));
|
||||
}
|
||||
|
||||
static PRInt32 strncmp(const char* s1, const char* s2,
|
||||
PRUint32 aMaxLen) {
|
||||
return PRInt32(PL_strncmp(s1, s2, aMaxLen));
|
||||
}
|
||||
|
||||
/// Case-insensitive string comparison.
|
||||
static PRInt32 strcasecmp(const char* s1, const char* s2) {
|
||||
return PRInt32(PL_strcasecmp(s1, s2));
|
||||
}
|
||||
|
||||
/// Case-insensitive string comparison with length
|
||||
static PRInt32 strncasecmp(const char* s1, const char* s2, PRUint32 aMaxLen) {
|
||||
return PRInt32(PL_strncasecmp(s1, s2, aMaxLen));
|
||||
}
|
||||
|
||||
static PRInt32 strncmp(const char* s1, const char* s2, PRInt32 aMaxLen) {
|
||||
// inline the first test (assumes strings are not null):
|
||||
PRInt32 diff = ((const unsigned char*)s1)[0] - ((const unsigned char*)s2)[0];
|
||||
if (diff != 0) return diff;
|
||||
return PRInt32(PL_strncmp(s1,s2,aMaxLen));
|
||||
}
|
||||
|
||||
static char* strdup(const char* str) {
|
||||
return PL_strdup(str);
|
||||
}
|
||||
|
||||
static void free(char* str) {
|
||||
PL_strfree(str);
|
||||
}
|
||||
|
||||
/**
|
||||
|
||||
How to use this fancy (thread-safe) version of strtok:
|
||||
|
||||
void main( void ) {
|
||||
printf( "%s\n\nTokens:\n", string );
|
||||
// Establish string and get the first token:
|
||||
char* newStr;
|
||||
token = nsCRT::strtok( string, seps, &newStr );
|
||||
while( token != NULL ) {
|
||||
// While there are tokens in "string"
|
||||
printf( " %s\n", token );
|
||||
// Get next token:
|
||||
token = nsCRT::strtok( newStr, seps, &newStr );
|
||||
}
|
||||
}
|
||||
* WARNING - STRTOK WHACKS str THE FIRST TIME IT IS CALLED *
|
||||
* MAKE A COPY OF str IF YOU NEED TO USE IT AFTER strtok() *
|
||||
*/
|
||||
static char* strtok(char* str, const char* delims, char* *newStr);
|
||||
|
||||
/// Like strlen except for ucs2 strings
|
||||
static PRUint32 strlen(const PRUnichar* s);
|
||||
|
||||
/// Like strcmp except for ucs2 strings
|
||||
static PRInt32 strcmp(const PRUnichar* s1, const PRUnichar* s2);
|
||||
/// Like strcmp except for ucs2 strings
|
||||
static PRInt32 strncmp(const PRUnichar* s1, const PRUnichar* s2,
|
||||
PRUint32 aMaxLen);
|
||||
|
||||
/// Like strcasecmp except for ucs2 strings
|
||||
static PRInt32 strcasecmp(const PRUnichar* s1, const PRUnichar* s2);
|
||||
/// Like strncasecmp except for ucs2 strings
|
||||
static PRInt32 strncasecmp(const PRUnichar* s1, const PRUnichar* s2,
|
||||
PRUint32 aMaxLen);
|
||||
|
||||
/// Like strcmp with a char* and a ucs2 string
|
||||
static PRInt32 strcmp(const PRUnichar* s1, const char* s2);
|
||||
/// Like strncmp with a char* and a ucs2 string
|
||||
static PRInt32 strncmp(const PRUnichar* s1, const char* s2,
|
||||
PRUint32 aMaxLen);
|
||||
|
||||
/// Like strcasecmp with a char* and a ucs2 string
|
||||
static PRInt32 strcasecmp(const PRUnichar* s1, const char* s2);
|
||||
/// Like strncasecmp with a char* and a ucs2 string
|
||||
static PRInt32 strncasecmp(const PRUnichar* s1, const char* s2,
|
||||
PRUint32 aMaxLen);
|
||||
|
||||
// Note: uses new[] to allocate memory, so you must use delete[] to
|
||||
// free the memory
|
||||
static PRUnichar* strdup(const PRUnichar* str);
|
||||
|
||||
static void free(PRUnichar* str) {
|
||||
nsCppSharedAllocator<PRUnichar> shared_allocator;
|
||||
shared_allocator.deallocate(str, 0 /*we never new or kept the size*/);
|
||||
}
|
||||
|
||||
/// Compute a hashcode for a C string
|
||||
static PRUint32 HashValue(const char* s1);
|
||||
|
||||
/// Same as above except that we return the length in s1len
|
||||
static PRUint32 HashValue(const char* s1, PRUint32* s1len);
|
||||
|
||||
/// Compute a hashcode for a ucs2 string
|
||||
static PRUint32 HashValue(const PRUnichar* s1);
|
||||
|
||||
/// Same as above except that we return the length in s1len
|
||||
static PRUint32 HashValue(const PRUnichar* s1, PRUint32* s1len);
|
||||
|
||||
/// String to integer.
|
||||
static PRInt32 atoi( const PRUnichar *string );
|
||||
|
||||
static PRUnichar ToUpper(PRUnichar aChar);
|
||||
|
||||
static PRUnichar ToLower(PRUnichar aChar);
|
||||
|
||||
static PRBool IsUpper(PRUnichar aChar);
|
||||
|
||||
static PRBool IsLower(PRUnichar aChar);
|
||||
};
|
||||
|
||||
#endif /* nsCRT_h___ */
|
||||
365
mozilla/xpcom/ds/nsConjoiningEnumerator.cpp
Normal file
365
mozilla/xpcom/ds/nsConjoiningEnumerator.cpp
Normal file
@@ -0,0 +1,365 @@
|
||||
/* -*- Mode: C++; tab-width: 2; indent-tabs-mode: nil; c-basic-offset: 2 -*-
|
||||
*
|
||||
* The contents of this file are subject to the Netscape Public License
|
||||
* Version 1.0 (the "NPL"); you may not use this file except in
|
||||
* compliance with the NPL. You may obtain a copy of the NPL at
|
||||
* http://www.mozilla.org/NPL/
|
||||
*
|
||||
* Software distributed under the NPL is distributed on an "AS IS" basis,
|
||||
* WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
|
||||
* for the specific language governing rights and limitations under the
|
||||
* NPL.
|
||||
*
|
||||
* The Initial Developer of this code under the NPL is Netscape
|
||||
* Communications Corporation. Portions created by Netscape are
|
||||
* Copyright (C) 1998 Netscape Communications Corporation. All Rights
|
||||
* Reserved.
|
||||
*/
|
||||
|
||||
#include "nsIEnumerator.h"
|
||||
|
||||
////////////////////////////////////////////////////////////////////////////////
|
||||
// Intersection Enumerators
|
||||
////////////////////////////////////////////////////////////////////////////////
|
||||
|
||||
class nsConjoiningEnumerator : public nsIBidirectionalEnumerator
|
||||
{
|
||||
public:
|
||||
NS_DECL_ISUPPORTS
|
||||
|
||||
// nsIEnumerator methods:
|
||||
NS_DECL_NSIENUMERATOR
|
||||
|
||||
// nsIBidirectionalEnumerator methods:
|
||||
NS_DECL_NSIBIDIRECTIONALENUMERATOR
|
||||
|
||||
// nsConjoiningEnumerator methods:
|
||||
nsConjoiningEnumerator(nsIEnumerator* first, nsIEnumerator* second);
|
||||
virtual ~nsConjoiningEnumerator(void);
|
||||
|
||||
protected:
|
||||
nsIEnumerator* mFirst;
|
||||
nsIEnumerator* mSecond;
|
||||
nsIEnumerator* mCurrent;
|
||||
};
|
||||
|
||||
nsConjoiningEnumerator::nsConjoiningEnumerator(nsIEnumerator* first, nsIEnumerator* second)
|
||||
: mFirst(first), mSecond(second), mCurrent(first)
|
||||
{
|
||||
NS_ADDREF(mFirst);
|
||||
NS_ADDREF(mSecond);
|
||||
}
|
||||
|
||||
nsConjoiningEnumerator::~nsConjoiningEnumerator(void)
|
||||
{
|
||||
NS_RELEASE(mFirst);
|
||||
NS_RELEASE(mSecond);
|
||||
}
|
||||
|
||||
NS_IMPL_ISUPPORTS2(nsConjoiningEnumerator, nsIBidirectionalEnumerator, nsIEnumerator)
|
||||
|
||||
NS_IMETHODIMP
|
||||
nsConjoiningEnumerator::First(void)
|
||||
{
|
||||
mCurrent = mFirst;
|
||||
return mCurrent->First();
|
||||
}
|
||||
|
||||
NS_IMETHODIMP
|
||||
nsConjoiningEnumerator::Next(void)
|
||||
{
|
||||
nsresult rv = mCurrent->Next();
|
||||
if (NS_FAILED(rv) && mCurrent == mFirst) {
|
||||
mCurrent = mSecond;
|
||||
rv = mCurrent->First();
|
||||
}
|
||||
return rv;
|
||||
}
|
||||
|
||||
NS_IMETHODIMP
|
||||
nsConjoiningEnumerator::CurrentItem(nsISupports **aItem)
|
||||
{
|
||||
return mCurrent->CurrentItem(aItem);
|
||||
}
|
||||
|
||||
NS_IMETHODIMP
|
||||
nsConjoiningEnumerator::IsDone(void)
|
||||
{
|
||||
return (mCurrent == mFirst && mCurrent->IsDone() == NS_OK)
|
||||
|| (mCurrent == mSecond && mCurrent->IsDone() == NS_OK)
|
||||
? NS_OK : NS_COMFALSE;
|
||||
}
|
||||
|
||||
////////////////////////////////////////////////////////////////////////////////
|
||||
|
||||
NS_IMETHODIMP
|
||||
nsConjoiningEnumerator::Last(void)
|
||||
{
|
||||
nsresult rv;
|
||||
nsIBidirectionalEnumerator* be;
|
||||
rv = mSecond->QueryInterface(nsIBidirectionalEnumerator::GetIID(), (void**)&be);
|
||||
if (NS_FAILED(rv)) return rv;
|
||||
mCurrent = mSecond;
|
||||
rv = be->Last();
|
||||
NS_RELEASE(be);
|
||||
return rv;
|
||||
}
|
||||
|
||||
NS_IMETHODIMP
|
||||
nsConjoiningEnumerator::Prev(void)
|
||||
{
|
||||
nsresult rv;
|
||||
nsIBidirectionalEnumerator* be;
|
||||
rv = mCurrent->QueryInterface(nsIBidirectionalEnumerator::GetIID(), (void**)&be);
|
||||
if (NS_FAILED(rv)) return rv;
|
||||
rv = be->Prev();
|
||||
NS_RELEASE(be);
|
||||
if (NS_FAILED(rv) && mCurrent == mSecond) {
|
||||
rv = mFirst->QueryInterface(nsIBidirectionalEnumerator::GetIID(), (void**)&be);
|
||||
if (NS_FAILED(rv)) return rv;
|
||||
mCurrent = mFirst;
|
||||
rv = be->Last();
|
||||
NS_RELEASE(be);
|
||||
}
|
||||
return rv;
|
||||
}
|
||||
|
||||
////////////////////////////////////////////////////////////////////////////////
|
||||
|
||||
extern "C" NS_COM nsresult
|
||||
NS_NewConjoiningEnumerator(nsIEnumerator* first, nsIEnumerator* second,
|
||||
nsIBidirectionalEnumerator* *aInstancePtrResult)
|
||||
{
|
||||
if (aInstancePtrResult == 0)
|
||||
return NS_ERROR_NULL_POINTER;
|
||||
nsConjoiningEnumerator* e = new nsConjoiningEnumerator(first, second);
|
||||
if (e == 0)
|
||||
return NS_ERROR_OUT_OF_MEMORY;
|
||||
NS_ADDREF(e);
|
||||
*aInstancePtrResult = e;
|
||||
return NS_OK;
|
||||
}
|
||||
|
||||
////////////////////////////////////////////////////////////////////////////////
|
||||
|
||||
static nsresult
|
||||
nsEnumeratorContains(nsIEnumerator* e, nsISupports* item)
|
||||
{
|
||||
nsresult rv;
|
||||
for (e->First(); e->IsDone() != NS_OK; e->Next()) {
|
||||
nsISupports* other;
|
||||
rv = e->CurrentItem(&other);
|
||||
if (NS_FAILED(rv)) return rv;
|
||||
if (item == other) {
|
||||
NS_RELEASE(other);
|
||||
return NS_OK; // true -- exists in enumerator
|
||||
}
|
||||
NS_RELEASE(other);
|
||||
}
|
||||
return NS_COMFALSE; // false -- doesn't exist
|
||||
}
|
||||
|
||||
////////////////////////////////////////////////////////////////////////////////
|
||||
// Intersection Enumerators
|
||||
////////////////////////////////////////////////////////////////////////////////
|
||||
|
||||
class nsIntersectionEnumerator : public nsIEnumerator
|
||||
{
|
||||
public:
|
||||
NS_DECL_ISUPPORTS
|
||||
|
||||
// nsIEnumerator methods:
|
||||
NS_DECL_NSIENUMERATOR
|
||||
|
||||
// nsIntersectionEnumerator methods:
|
||||
nsIntersectionEnumerator(nsIEnumerator* first, nsIEnumerator* second);
|
||||
virtual ~nsIntersectionEnumerator(void);
|
||||
|
||||
protected:
|
||||
nsIEnumerator* mFirst;
|
||||
nsIEnumerator* mSecond;
|
||||
};
|
||||
|
||||
nsIntersectionEnumerator::nsIntersectionEnumerator(nsIEnumerator* first, nsIEnumerator* second)
|
||||
: mFirst(first), mSecond(second)
|
||||
{
|
||||
NS_ADDREF(mFirst);
|
||||
NS_ADDREF(mSecond);
|
||||
}
|
||||
|
||||
nsIntersectionEnumerator::~nsIntersectionEnumerator(void)
|
||||
{
|
||||
NS_RELEASE(mFirst);
|
||||
NS_RELEASE(mSecond);
|
||||
}
|
||||
|
||||
NS_IMPL_ISUPPORTS1(nsIntersectionEnumerator, nsIEnumerator)
|
||||
|
||||
NS_IMETHODIMP
|
||||
nsIntersectionEnumerator::First(void)
|
||||
{
|
||||
nsresult rv = mFirst->First();
|
||||
if (NS_FAILED(rv)) return rv;
|
||||
return Next();
|
||||
}
|
||||
|
||||
NS_IMETHODIMP
|
||||
nsIntersectionEnumerator::Next(void)
|
||||
{
|
||||
nsresult rv;
|
||||
|
||||
// find the first item that exists in both
|
||||
for (; mFirst->IsDone() != NS_OK; mFirst->Next()) {
|
||||
nsISupports* item;
|
||||
rv = mFirst->CurrentItem(&item);
|
||||
if (NS_FAILED(rv)) return rv;
|
||||
|
||||
// see if it also exists in mSecond
|
||||
rv = nsEnumeratorContains(mSecond, item);
|
||||
if (NS_FAILED(rv)) return rv;
|
||||
|
||||
NS_RELEASE(item);
|
||||
if (rv == NS_OK) {
|
||||
// found in both, so return leaving it as the current item of mFirst
|
||||
return NS_OK;
|
||||
}
|
||||
}
|
||||
|
||||
return NS_ERROR_FAILURE;
|
||||
}
|
||||
|
||||
NS_IMETHODIMP
|
||||
nsIntersectionEnumerator::CurrentItem(nsISupports **aItem)
|
||||
{
|
||||
return mFirst->CurrentItem(aItem);
|
||||
}
|
||||
|
||||
NS_IMETHODIMP
|
||||
nsIntersectionEnumerator::IsDone(void)
|
||||
{
|
||||
return mFirst->IsDone();
|
||||
}
|
||||
|
||||
////////////////////////////////////////////////////////////////////////////////
|
||||
|
||||
extern "C" NS_COM nsresult
|
||||
NS_NewIntersectionEnumerator(nsIEnumerator* first, nsIEnumerator* second,
|
||||
nsIEnumerator* *aInstancePtrResult)
|
||||
{
|
||||
if (aInstancePtrResult == 0)
|
||||
return NS_ERROR_NULL_POINTER;
|
||||
nsIntersectionEnumerator* e = new nsIntersectionEnumerator(first, second);
|
||||
if (e == 0)
|
||||
return NS_ERROR_OUT_OF_MEMORY;
|
||||
NS_ADDREF(e);
|
||||
*aInstancePtrResult = e;
|
||||
return NS_OK;
|
||||
}
|
||||
|
||||
////////////////////////////////////////////////////////////////////////////////
|
||||
// Union Enumerators
|
||||
////////////////////////////////////////////////////////////////////////////////
|
||||
|
||||
class nsUnionEnumerator : public nsIEnumerator
|
||||
{
|
||||
public:
|
||||
NS_DECL_ISUPPORTS
|
||||
|
||||
// nsIEnumerator methods:
|
||||
NS_DECL_NSIENUMERATOR
|
||||
|
||||
// nsUnionEnumerator methods:
|
||||
nsUnionEnumerator(nsIEnumerator* first, nsIEnumerator* second);
|
||||
virtual ~nsUnionEnumerator(void);
|
||||
|
||||
protected:
|
||||
nsIEnumerator* mFirst;
|
||||
nsIEnumerator* mSecond;
|
||||
};
|
||||
|
||||
nsUnionEnumerator::nsUnionEnumerator(nsIEnumerator* first, nsIEnumerator* second)
|
||||
: mFirst(first), mSecond(second)
|
||||
{
|
||||
NS_ADDREF(mFirst);
|
||||
NS_ADDREF(mSecond);
|
||||
}
|
||||
|
||||
nsUnionEnumerator::~nsUnionEnumerator(void)
|
||||
{
|
||||
NS_RELEASE(mFirst);
|
||||
NS_RELEASE(mSecond);
|
||||
}
|
||||
|
||||
NS_IMPL_ISUPPORTS1(nsUnionEnumerator, nsIEnumerator)
|
||||
|
||||
NS_IMETHODIMP
|
||||
nsUnionEnumerator::First(void)
|
||||
{
|
||||
nsresult rv = mFirst->First();
|
||||
if (NS_FAILED(rv)) return rv;
|
||||
return Next();
|
||||
}
|
||||
|
||||
NS_IMETHODIMP
|
||||
nsUnionEnumerator::Next(void)
|
||||
{
|
||||
nsresult rv;
|
||||
|
||||
// find the first item that exists in both
|
||||
for (; mFirst->IsDone() != NS_OK; mFirst->Next()) {
|
||||
nsISupports* item;
|
||||
rv = mFirst->CurrentItem(&item);
|
||||
if (NS_FAILED(rv)) return rv;
|
||||
|
||||
// see if it also exists in mSecond
|
||||
rv = nsEnumeratorContains(mSecond, item);
|
||||
if (NS_FAILED(rv)) return rv;
|
||||
|
||||
NS_RELEASE(item);
|
||||
if (rv != NS_OK) {
|
||||
// if it didn't exist in mSecond, return, making it the current item
|
||||
return NS_OK;
|
||||
}
|
||||
|
||||
// each time around, make sure that mSecond gets reset to the beginning
|
||||
// so that when mFirst is done, we'll be ready to enumerate mSecond
|
||||
rv = mSecond->First();
|
||||
if (NS_FAILED(rv)) return rv;
|
||||
}
|
||||
|
||||
return mSecond->Next();
|
||||
}
|
||||
|
||||
NS_IMETHODIMP
|
||||
nsUnionEnumerator::CurrentItem(nsISupports **aItem)
|
||||
{
|
||||
if (mFirst->IsDone() != NS_OK)
|
||||
return mFirst->CurrentItem(aItem);
|
||||
else
|
||||
return mSecond->CurrentItem(aItem);
|
||||
}
|
||||
|
||||
NS_IMETHODIMP
|
||||
nsUnionEnumerator::IsDone(void)
|
||||
{
|
||||
return (mFirst->IsDone() == NS_OK && mSecond->IsDone() == NS_OK)
|
||||
? NS_OK : NS_COMFALSE;
|
||||
}
|
||||
|
||||
////////////////////////////////////////////////////////////////////////////////
|
||||
|
||||
extern "C" NS_COM nsresult
|
||||
NS_NewUnionEnumerator(nsIEnumerator* first, nsIEnumerator* second,
|
||||
nsIEnumerator* *aInstancePtrResult)
|
||||
{
|
||||
if (aInstancePtrResult == 0)
|
||||
return NS_ERROR_NULL_POINTER;
|
||||
nsUnionEnumerator* e = new nsUnionEnumerator(first, second);
|
||||
if (e == 0)
|
||||
return NS_ERROR_OUT_OF_MEMORY;
|
||||
NS_ADDREF(e);
|
||||
*aInstancePtrResult = e;
|
||||
return NS_OK;
|
||||
}
|
||||
|
||||
////////////////////////////////////////////////////////////////////////////////
|
||||
122
mozilla/xpcom/ds/nsCppSharedAllocator.h
Normal file
122
mozilla/xpcom/ds/nsCppSharedAllocator.h
Normal file
@@ -0,0 +1,122 @@
|
||||
#ifndef nsCppSharedAllocator_h__
|
||||
#define nsCppSharedAllocator_h__
|
||||
|
||||
#include "nsIAllocator.h" // for |nsAllocator|
|
||||
#include "nscore.h" // for |NS_XXX_CAST|
|
||||
#include <new.h> // to allow placement |new|
|
||||
|
||||
|
||||
// under Metrowerks (Mac), we don't have autoconf yet
|
||||
#ifdef __MWERKS__
|
||||
#define HAVE_CPP_MEMBER_TEMPLATES
|
||||
#define HAVE_CPP_NUMERIC_LIMITS
|
||||
#endif
|
||||
|
||||
#ifdef HAVE_CPP_NUMERIC_LIMITS
|
||||
#include <limits>
|
||||
#else
|
||||
#include <limits.h>
|
||||
#endif
|
||||
|
||||
|
||||
template <class T>
|
||||
class nsCppSharedAllocator
|
||||
/*
|
||||
...allows Standard Library containers, et al, to use our global shared
|
||||
(XP)COM-aware allocator.
|
||||
*/
|
||||
{
|
||||
public:
|
||||
typedef T value_type;
|
||||
typedef size_t size_type;
|
||||
typedef ptrdiff_t difference_type;
|
||||
|
||||
typedef T* pointer;
|
||||
typedef const T* const_pointer;
|
||||
|
||||
typedef T& reference;
|
||||
typedef const T& const_reference;
|
||||
|
||||
|
||||
|
||||
nsCppSharedAllocator() { }
|
||||
|
||||
#ifdef HAVE_CPP_MEMBER_TEMPLATES
|
||||
template <class U>
|
||||
nsCppSharedAllocator( const nsCppSharedAllocator<U>& ) { }
|
||||
#endif
|
||||
|
||||
~nsCppSharedAllocator() { }
|
||||
|
||||
|
||||
pointer
|
||||
address( reference r ) const
|
||||
{
|
||||
return &r;
|
||||
}
|
||||
|
||||
const_pointer
|
||||
address( const_reference r ) const
|
||||
{
|
||||
return &r;
|
||||
}
|
||||
|
||||
pointer
|
||||
allocate( size_type n, const void* /*hint*/=0 )
|
||||
{
|
||||
return NS_REINTERPRET_CAST(pointer, nsAllocator::Alloc(NS_STATIC_CAST(PRUint32, n*sizeof(T))));
|
||||
}
|
||||
|
||||
void
|
||||
deallocate( pointer p, size_type /*n*/ )
|
||||
{
|
||||
nsAllocator::Free(p);
|
||||
}
|
||||
|
||||
void
|
||||
construct( pointer p, const T& val )
|
||||
{
|
||||
new (p) T(val);
|
||||
}
|
||||
|
||||
void
|
||||
destroy( pointer p )
|
||||
{
|
||||
p->~T();
|
||||
}
|
||||
|
||||
size_type
|
||||
max_size() const
|
||||
{
|
||||
#ifdef HAVE_CPP_NUMERIC_LIMITS
|
||||
return numeric_limits<size_type>::max() / sizeof(T);
|
||||
#else
|
||||
return ULONG_MAX / sizeof(T);
|
||||
#endif
|
||||
}
|
||||
|
||||
#ifdef HAVE_CPP_MEMBER_TEMPLATES
|
||||
template <class U>
|
||||
struct rebind
|
||||
{
|
||||
typedef nsCppSharedAllocator<U> other;
|
||||
};
|
||||
#endif
|
||||
};
|
||||
|
||||
|
||||
template <class T>
|
||||
PRBool
|
||||
operator==( const nsCppSharedAllocator<T>&, const nsCppSharedAllocator<T>& )
|
||||
{
|
||||
return PR_TRUE;
|
||||
}
|
||||
|
||||
template <class T>
|
||||
PRBool
|
||||
operator!=( const nsCppSharedAllocator<T>&, const nsCppSharedAllocator<T>& )
|
||||
{
|
||||
return PR_FALSE;
|
||||
}
|
||||
|
||||
#endif /* !defined(nsCppSharedAllocator_h__) */
|
||||
594
mozilla/xpcom/ds/nsDeque.cpp
Normal file
594
mozilla/xpcom/ds/nsDeque.cpp
Normal file
@@ -0,0 +1,594 @@
|
||||
/* -*- Mode: C++; tab-width: 2; indent-tabs-mode: nil; c-basic-offset: 2 -*- */
|
||||
/*
|
||||
* The contents of this file are subject to the Netscape Public License
|
||||
* Version 1.0 (the "NPL"); you may not use this file except in
|
||||
* compliance with the NPL. You may obtain a copy of the NPL at
|
||||
* http://www.mozilla.org/NPL/
|
||||
*
|
||||
* Software distributed under the NPL is distributed on an "AS IS" basis,
|
||||
* WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
|
||||
* for the specific language governing rights and limitations under the
|
||||
* NPL.
|
||||
*
|
||||
* The Initial Developer of this code under the NPL is Netscape
|
||||
* Communications Corporation. Portions created by Netscape are
|
||||
* Copyright (C) 1998 Netscape Communications Corporation. All Rights
|
||||
* Reserved.
|
||||
*/
|
||||
|
||||
|
||||
#include "nsDeque.h"
|
||||
#include "nsCRT.h"
|
||||
#include <stdio.h>
|
||||
|
||||
//#define _SELFTEST_DEQUE 1
|
||||
#undef _SELFTEST_DEQUE
|
||||
|
||||
/**
|
||||
* Standard constructor
|
||||
* @update gess4/18/98
|
||||
* @return new deque
|
||||
*/
|
||||
nsDeque::nsDeque(nsDequeFunctor* aDeallocator) {
|
||||
mDeallocator=aDeallocator;
|
||||
mOrigin=mSize=0;
|
||||
mData=mBuffer; // don't allocate space until you must
|
||||
mCapacity=sizeof(mBuffer)/sizeof(mBuffer[0]);
|
||||
nsCRT::zero(mData,mCapacity*sizeof(mBuffer[0]));
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
* Destructor
|
||||
* @update gess4/18/98
|
||||
*/
|
||||
nsDeque::~nsDeque() {
|
||||
|
||||
#if 0
|
||||
char buffer[30];
|
||||
printf("Capacity: %i\n",mCapacity);
|
||||
|
||||
static int mCaps[15] = {0,0,0,0,0,0,0,0,0,0,0,0,0,0,0};
|
||||
switch(mCapacity) {
|
||||
case 4: mCaps[0]++; break;
|
||||
case 8: mCaps[1]++; break;
|
||||
case 16: mCaps[2]++; break;
|
||||
case 32: mCaps[3]++; break;
|
||||
case 64: mCaps[4]++; break;
|
||||
case 128: mCaps[5]++; break;
|
||||
case 256: mCaps[6]++; break;
|
||||
case 512: mCaps[7]++; break;
|
||||
case 1024: mCaps[8]++; break;
|
||||
case 2048: mCaps[9]++; break;
|
||||
case 4096: mCaps[10]++; break;
|
||||
default:
|
||||
break;
|
||||
}
|
||||
#endif
|
||||
|
||||
Erase();
|
||||
if(mData && (mData!=mBuffer))
|
||||
delete [] mData;
|
||||
mData=0;
|
||||
if(mDeallocator) {
|
||||
delete mDeallocator;
|
||||
}
|
||||
mDeallocator=0;
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
*
|
||||
* @update gess4/18/98
|
||||
* @param
|
||||
* @return
|
||||
*/
|
||||
void nsDeque::SetDeallocator(nsDequeFunctor* aDeallocator){
|
||||
if(mDeallocator) {
|
||||
delete mDeallocator;
|
||||
}
|
||||
mDeallocator=aDeallocator;
|
||||
}
|
||||
|
||||
/**
|
||||
* Remove all items from container without destroying them.
|
||||
*
|
||||
* @update gess4/18/98
|
||||
* @param
|
||||
* @return
|
||||
*/
|
||||
nsDeque& nsDeque::Empty() {
|
||||
if((0<mCapacity) && (mData)) {
|
||||
nsCRT::zero(mData,mCapacity*sizeof(mData));
|
||||
}
|
||||
mSize=0;
|
||||
mOrigin=0;
|
||||
return *this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Remove and delete all items from container
|
||||
*
|
||||
* @update gess4/18/98
|
||||
* @return this
|
||||
*/
|
||||
nsDeque& nsDeque::Erase() {
|
||||
if(mDeallocator && mSize) {
|
||||
ForEach(*mDeallocator);
|
||||
}
|
||||
return Empty();
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
* This method adds an item to the end of the deque.
|
||||
* This operation has the potential to cause the
|
||||
* underlying buffer to resize.
|
||||
*
|
||||
* @update gess4/18/98
|
||||
* @param anItem: new item to be added to deque
|
||||
* @return nada
|
||||
*/
|
||||
nsDeque& nsDeque::GrowCapacity(void) {
|
||||
|
||||
PRInt32 theNewSize = mCapacity<<2;
|
||||
void** temp=new void*[theNewSize];
|
||||
|
||||
//Here's the interesting part: You can't just move the elements
|
||||
//directy (in situ) from the old buffer to the new one.
|
||||
//Since capacity has changed, the old origin doesn't make
|
||||
//sense anymore. It's better to resequence the elements now.
|
||||
|
||||
if(mData) {
|
||||
int tempi=0;
|
||||
int i=0;
|
||||
int j=0;
|
||||
for(i=mOrigin;i<mCapacity;i++) temp[tempi++]=mData[i]; //copy the leading elements...
|
||||
for(j=0;j<mOrigin;j++) temp[tempi++]=mData[j]; //copy the trailing elements...
|
||||
if(mData!=mBuffer)
|
||||
delete [] mData;
|
||||
}
|
||||
mCapacity=theNewSize;
|
||||
mOrigin=0; //now realign the origin...
|
||||
mData=temp;
|
||||
return *this;
|
||||
}
|
||||
|
||||
/**
|
||||
* This method adds an item to the end of the deque.
|
||||
* This operation has the potential to cause the
|
||||
* underlying buffer to resize.
|
||||
*
|
||||
* @update gess4/18/98
|
||||
* @param anItem: new item to be added to deque
|
||||
* @return nada
|
||||
*/
|
||||
nsDeque& nsDeque::Push(void* anItem) {
|
||||
if(mSize==mCapacity) {
|
||||
GrowCapacity();
|
||||
}
|
||||
int offset=mOrigin+mSize;
|
||||
if(offset<mCapacity)
|
||||
mData[offset]=anItem;
|
||||
else mData[offset-mCapacity]=anItem;
|
||||
mSize++;
|
||||
return *this;
|
||||
}
|
||||
|
||||
/**
|
||||
* This method adds an item to the front of the deque.
|
||||
* This operation has the potential to cause the
|
||||
* underlying buffer to resize.
|
||||
*
|
||||
* @update gess4/18/98
|
||||
* @param anItem: new item to be added to deque
|
||||
* @return nada
|
||||
*/
|
||||
nsDeque& nsDeque::PushFront(void* anItem) {
|
||||
if(mSize==mCapacity) {
|
||||
GrowCapacity();
|
||||
}
|
||||
if(0==mOrigin){ //case1: [xxx..]
|
||||
//mOrigin=mCapacity-1-mSize++;
|
||||
mOrigin=mCapacity-1;
|
||||
mData[mOrigin]=anItem;
|
||||
}
|
||||
else {// if(mCapacity==(mOrigin+mSize-1)){ //case2: [..xxx] and case3: [.xxx.]
|
||||
mData[--mOrigin]=anItem;
|
||||
}
|
||||
mSize++;
|
||||
return *this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Remove and return the last item in the container.
|
||||
*
|
||||
* @update gess4/18/98
|
||||
* @param none
|
||||
* @return ptr to last item in container
|
||||
*/
|
||||
void* nsDeque::Pop(void) {
|
||||
void* result=0;
|
||||
if(mSize>0) {
|
||||
int offset=mOrigin+mSize-1;
|
||||
if(offset>=mCapacity)
|
||||
offset-=mCapacity;
|
||||
result=mData[offset];
|
||||
mData[offset]=0;
|
||||
mSize--;
|
||||
if(0==mSize)
|
||||
mOrigin=0;
|
||||
}
|
||||
return result;
|
||||
}
|
||||
|
||||
/**
|
||||
* This method gets called you want to remove and return
|
||||
* the first member in the container.
|
||||
*
|
||||
* @update gess4/18/98
|
||||
* @param nada
|
||||
* @return last item in container
|
||||
*/
|
||||
void* nsDeque::PopFront() {
|
||||
void* result=0;
|
||||
if(mSize>0) {
|
||||
NS_ASSERTION(mOrigin<mCapacity,"Error: Bad origin");
|
||||
result=mData[mOrigin];
|
||||
mData[mOrigin++]=0; //zero it out for debugging purposes.
|
||||
mSize--;
|
||||
if(mCapacity==mOrigin) //you popped off the end, so cycle back around...
|
||||
mOrigin=0;
|
||||
if(0==mSize)
|
||||
mOrigin=0;
|
||||
}
|
||||
return result;
|
||||
}
|
||||
|
||||
/**
|
||||
* This method gets called you want to peek at the topmost
|
||||
* member without removing it.
|
||||
*
|
||||
* @update gess4/18/98
|
||||
* @param nada
|
||||
* @return last item in container
|
||||
*/
|
||||
void* nsDeque::Peek() {
|
||||
void* result=0;
|
||||
if(mSize>0) {
|
||||
result=mData[mOrigin];
|
||||
}
|
||||
return result;
|
||||
}
|
||||
|
||||
/**
|
||||
* Call this to retrieve the ith element from this container.
|
||||
* Keep in mind that accessing the underlying elements is
|
||||
* done in a relative fashion. Object 0 is not necessarily
|
||||
* the first element (the first element is at mOrigin).
|
||||
*
|
||||
* @update gess4/18/98
|
||||
* @param anIndex : 0 relative offset of item you want
|
||||
* @return void* or null
|
||||
*/
|
||||
void* nsDeque::ObjectAt(PRInt32 anIndex) const {
|
||||
void* result=0;
|
||||
|
||||
if((anIndex>=0) && (anIndex<mSize))
|
||||
{
|
||||
if(anIndex<(mCapacity-mOrigin)) {
|
||||
result=mData[mOrigin+anIndex];
|
||||
}
|
||||
else {
|
||||
result=mData[anIndex-(mCapacity-mOrigin)];
|
||||
}
|
||||
}
|
||||
return result;
|
||||
}
|
||||
|
||||
/**
|
||||
* Create and return an iterator pointing to
|
||||
* the beginning of the queue. Note that this
|
||||
* takes the circular buffer semantics into account.
|
||||
*
|
||||
* @update gess4/18/98
|
||||
* @return new deque iterator, init'ed to 1st item
|
||||
*/
|
||||
nsDequeIterator nsDeque::Begin(void) const{
|
||||
return nsDequeIterator(*this,0);
|
||||
}
|
||||
|
||||
/**
|
||||
* Create and return an iterator pointing to
|
||||
* the last of the queue. Note that this
|
||||
* takes the circular buffer semantics into account.
|
||||
*
|
||||
* @update gess4/18/98
|
||||
* @return new deque iterator, init'ed to last item
|
||||
*/
|
||||
nsDequeIterator nsDeque::End(void) const{
|
||||
return nsDequeIterator(*this,mSize);
|
||||
}
|
||||
|
||||
/**
|
||||
* Call this method when you wanto to iterate all the
|
||||
* members of the container, passing a functor along
|
||||
* to call your code.
|
||||
*
|
||||
* @update gess4/20/98
|
||||
* @param aFunctor object to call for each member
|
||||
* @return *this
|
||||
*/
|
||||
void nsDeque::ForEach(nsDequeFunctor& aFunctor) const{
|
||||
int i=0;
|
||||
for(i=0;i<mSize;i++){
|
||||
void* obj=ObjectAt(i);
|
||||
obj=aFunctor(obj);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Call this method when you wanto to iterate all the
|
||||
* members of the container, passing a functor along
|
||||
* to call your code. Iteration continues until your
|
||||
* functor returns a non-null.
|
||||
*
|
||||
* @update gess4/20/98
|
||||
* @param aFunctor object to call for each member
|
||||
* @return *this
|
||||
*/
|
||||
const void* nsDeque::FirstThat(nsDequeFunctor& aFunctor) const{
|
||||
int i=0;
|
||||
for(i=0;i<mSize;i++){
|
||||
void* obj=ObjectAt(i);
|
||||
obj=aFunctor(obj);
|
||||
if(obj)
|
||||
return obj;
|
||||
}
|
||||
return 0;
|
||||
}
|
||||
|
||||
|
||||
/******************************************************
|
||||
* Here comes the nsDequeIterator class...
|
||||
******************************************************/
|
||||
|
||||
/**
|
||||
* DequeIterator is an object that knows how to iterate (forward and backward)
|
||||
* a Deque. Normally, you don't need to do this, but there are some special
|
||||
* cases where it is pretty handy, so here you go.
|
||||
*
|
||||
* This is a standard dequeiterator constructor
|
||||
*
|
||||
* @update gess4/18/98
|
||||
* @param aQueue is the deque object to be iterated
|
||||
* @param anIndex is the starting position for your iteration
|
||||
*/
|
||||
nsDequeIterator::nsDequeIterator(const nsDeque& aQueue,int anIndex): mIndex(anIndex), mDeque(aQueue) {
|
||||
}
|
||||
|
||||
/**
|
||||
* Copy construct a new iterator beginning with given
|
||||
*
|
||||
* @update gess4/20/98
|
||||
* @param aCopy is another iterator to copy from
|
||||
* @return
|
||||
*/
|
||||
nsDequeIterator::nsDequeIterator(const nsDequeIterator& aCopy) : mIndex(aCopy.mIndex), mDeque(aCopy.mDeque) {
|
||||
}
|
||||
|
||||
/**
|
||||
* Moves iterator to first element in deque
|
||||
* @update gess4/18/98
|
||||
* @return this
|
||||
*/
|
||||
nsDequeIterator& nsDequeIterator::First(void){
|
||||
mIndex=0;
|
||||
return *this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Standard assignment operator for dequeiterator
|
||||
*
|
||||
* @update gess4/18/98
|
||||
* @param aCopy is an iterator to be copied from
|
||||
* @return *this
|
||||
*/
|
||||
nsDequeIterator& nsDequeIterator::operator=(const nsDequeIterator& aCopy) {
|
||||
//queue's are already equal.
|
||||
mIndex=aCopy.mIndex;
|
||||
return *this;
|
||||
}
|
||||
|
||||
/**
|
||||
* preform ! operation against to iterators to test for equivalence
|
||||
* (or lack thereof)!
|
||||
*
|
||||
* @update gess4/18/98
|
||||
* @param anIter is the object to be compared to
|
||||
* @return TRUE if NOT equal.
|
||||
*/
|
||||
PRBool nsDequeIterator::operator!=(nsDequeIterator& anIter) {
|
||||
return PRBool(!this->operator==(anIter));
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
* Compare 2 iterators for equivalence.
|
||||
*
|
||||
* @update gess4/18/98
|
||||
* @param anIter is the other iterator to be compared to
|
||||
* @return TRUE if EQUAL
|
||||
*/
|
||||
PRBool nsDequeIterator::operator<(nsDequeIterator& anIter) {
|
||||
return PRBool(((mIndex<anIter.mIndex) && (&mDeque==&anIter.mDeque)));
|
||||
}
|
||||
|
||||
/**
|
||||
* Compare 2 iterators for equivalence.
|
||||
*
|
||||
* @update gess4/18/98
|
||||
* @param anIter is the other iterator to be compared to
|
||||
* @return TRUE if EQUAL
|
||||
*/
|
||||
PRBool nsDequeIterator::operator==(nsDequeIterator& anIter) {
|
||||
return PRBool(((mIndex==anIter.mIndex) && (&mDeque==&anIter.mDeque)));
|
||||
}
|
||||
|
||||
/**
|
||||
* Compare 2 iterators for equivalence.
|
||||
*
|
||||
* @update gess4/18/98
|
||||
* @param anIter is the other iterator to be compared to
|
||||
* @return TRUE if EQUAL
|
||||
*/
|
||||
PRBool nsDequeIterator::operator>=(nsDequeIterator& anIter) {
|
||||
return PRBool(((mIndex>=anIter.mIndex) && (&mDeque==&anIter.mDeque)));
|
||||
}
|
||||
|
||||
/**
|
||||
* Pre-increment operator
|
||||
*
|
||||
* @update gess4/18/98
|
||||
* @return object at preincremented index
|
||||
*/
|
||||
void* nsDequeIterator::operator++() {
|
||||
return mDeque.ObjectAt(++mIndex);
|
||||
}
|
||||
|
||||
/**
|
||||
* Post-increment operator
|
||||
*
|
||||
* @update gess4/18/98
|
||||
* @param param is ignored
|
||||
* @return object at post-incremented index
|
||||
*/
|
||||
void* nsDequeIterator::operator++(int) {
|
||||
return mDeque.ObjectAt(mIndex++);
|
||||
}
|
||||
|
||||
/**
|
||||
* Pre-decrement operator
|
||||
*
|
||||
* @update gess4/18/98
|
||||
* @return object at pre-decremented index
|
||||
*/
|
||||
void* nsDequeIterator::operator--() {
|
||||
return mDeque.ObjectAt(--mIndex);
|
||||
}
|
||||
|
||||
/**
|
||||
* Post-decrement operator
|
||||
*
|
||||
* @update gess4/18/98
|
||||
* @param param is ignored
|
||||
* @return object at post-decremented index
|
||||
*/
|
||||
void* nsDequeIterator::operator--(int) {
|
||||
return mDeque.ObjectAt(mIndex--);
|
||||
}
|
||||
|
||||
/**
|
||||
* Dereference operator
|
||||
*
|
||||
* @update gess4/18/98
|
||||
* @return object at ith index
|
||||
*/
|
||||
void* nsDequeIterator::GetCurrent(void) {
|
||||
return mDeque.ObjectAt(mIndex);
|
||||
}
|
||||
|
||||
/**
|
||||
* Call this method when you wanto to iterate all the
|
||||
* members of the container, passing a functor along
|
||||
* to call your code.
|
||||
*
|
||||
* @update gess4/20/98
|
||||
* @param aFunctor object to call for each member
|
||||
* @return *this
|
||||
*/
|
||||
void nsDequeIterator::ForEach(nsDequeFunctor& aFunctor) const{
|
||||
mDeque.ForEach(aFunctor);
|
||||
}
|
||||
|
||||
/**
|
||||
* Call this method when you wanto to iterate all the
|
||||
* members of the container, passing a functor along
|
||||
* to call your code.
|
||||
*
|
||||
* @update gess4/20/98
|
||||
* @param aFunctor object to call for each member
|
||||
* @return *this
|
||||
*/
|
||||
const void* nsDequeIterator::FirstThat(nsDequeFunctor& aFunctor) const{
|
||||
return mDeque.FirstThat(aFunctor);
|
||||
}
|
||||
|
||||
#ifdef _SELFTEST_DEQUE
|
||||
/**************************************************************
|
||||
Now define the token deallocator class...
|
||||
**************************************************************/
|
||||
class _SelfTestDeallocator: public nsDequeFunctor{
|
||||
public:
|
||||
_SelfTestDeallocator::_SelfTestDeallocator() {
|
||||
nsDeque::SelfTest();
|
||||
}
|
||||
virtual void* operator()(void* anObject) {
|
||||
return 0;
|
||||
}
|
||||
};
|
||||
static _SelfTestDeallocator gDeallocator;
|
||||
#endif
|
||||
|
||||
/**
|
||||
* conduct automated self test for this class
|
||||
*
|
||||
* @update gess4/18/98
|
||||
* @param
|
||||
* @return
|
||||
*/
|
||||
void nsDeque::SelfTest(void) {
|
||||
#ifdef _SELFTEST_DEQUE
|
||||
|
||||
{
|
||||
nsDeque theDeque(gDeallocator); //construct a simple one...
|
||||
|
||||
int ints[200];
|
||||
int count=sizeof(ints)/sizeof(int);
|
||||
int i=0;
|
||||
|
||||
for(i=0;i<count;i++){ //initialize'em
|
||||
ints[i]=10*(1+i);
|
||||
}
|
||||
|
||||
for(i=0;i<70;i++){
|
||||
theDeque.Push(&ints[i]);
|
||||
}
|
||||
|
||||
for(i=0;i<56;i++){
|
||||
int* temp=(int*)theDeque.Pop();
|
||||
}
|
||||
|
||||
for(i=0;i<55;i++){
|
||||
theDeque.Push(&ints[i]);
|
||||
}
|
||||
|
||||
for(i=0;i<35;i++){
|
||||
int* temp=(int*)theDeque.Pop();
|
||||
}
|
||||
|
||||
for(i=0;i<35;i++){
|
||||
theDeque.Push(&ints[i]);
|
||||
}
|
||||
|
||||
for(i=0;i<38;i++){
|
||||
int* temp=(int*)theDeque.Pop();
|
||||
}
|
||||
|
||||
}
|
||||
|
||||
int x;
|
||||
x=10;
|
||||
#endif
|
||||
}
|
||||
|
||||
410
mozilla/xpcom/ds/nsDeque.h
Normal file
410
mozilla/xpcom/ds/nsDeque.h
Normal file
@@ -0,0 +1,410 @@
|
||||
/* -*- Mode: C++; tab-width: 2; indent-tabs-mode: nil; c-basic-offset: 2 -*- */
|
||||
/*
|
||||
* The contents of this file are subject to the Netscape Public License
|
||||
* Version 1.0 (the "NPL"); you may not use this file except in
|
||||
* compliance with the NPL. You may obtain a copy of the NPL at
|
||||
* http://www.mozilla.org/NPL/
|
||||
*
|
||||
* Software distributed under the NPL is distributed on an "AS IS" basis,
|
||||
* WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
|
||||
* for the specific language governing rights and limitations under the
|
||||
* NPL.
|
||||
*
|
||||
* The Initial Developer of this code under the NPL is Netscape
|
||||
* Communications Corporation. Portions created by Netscape are
|
||||
* Copyright (C) 1998 Netscape Communications Corporation. All Rights
|
||||
* Reserved.
|
||||
*/
|
||||
|
||||
/**
|
||||
* MODULE NOTES:
|
||||
* @update gess 4/15/98 (tax day)
|
||||
*
|
||||
* The Deque is a very small, very efficient container object
|
||||
* than can hold elements of type void*, offering the following features:
|
||||
* It's interface supports pushing and poping of children.
|
||||
* It can iterate (via an interator class) it's children.
|
||||
* When full, it can efficently resize dynamically.
|
||||
*
|
||||
*
|
||||
* NOTE: The only bit of trickery here is that this deque is
|
||||
* built upon a ring-buffer. Like all ring buffers, the first
|
||||
* element may not be at index[0]. The mOrigin member determines
|
||||
* where the first child is. This point is quietly hidden from
|
||||
* customers of this class.
|
||||
*
|
||||
*/
|
||||
|
||||
|
||||
#ifndef _NSDEQUE
|
||||
#define _NSDEQUE
|
||||
|
||||
#include "nscore.h"
|
||||
|
||||
/**
|
||||
* The nsDequefunctor class is used when you want to create
|
||||
* callbacks between the deque and your generic code.
|
||||
* Use these objects in a call to ForEach();
|
||||
*
|
||||
* @update gess4/20/98
|
||||
*/
|
||||
class NS_COM nsDequeFunctor{
|
||||
public:
|
||||
virtual void* operator()(void* anObject)=0;
|
||||
};
|
||||
|
||||
|
||||
/******************************************************
|
||||
* Here comes the nsDeque class itself...
|
||||
******************************************************/
|
||||
|
||||
/**
|
||||
* The deque (double-ended queue) class is a common container type,
|
||||
* whose behavior mimics a line in your favorite checkout stand.
|
||||
* Classic CS describes the common behavior of a queue as FIFO.
|
||||
* A Deque allows items to be added and removed from either end of
|
||||
* the queue.
|
||||
*
|
||||
* @update gess4/20/98
|
||||
*/
|
||||
|
||||
class NS_COM nsDeque {
|
||||
friend class nsDequeIterator;
|
||||
public:
|
||||
nsDeque(nsDequeFunctor* aDeallocator);
|
||||
~nsDeque();
|
||||
|
||||
/**
|
||||
* Returns the number of elements currently stored in
|
||||
* this deque.
|
||||
*
|
||||
* @update gess4/18/98
|
||||
* @param
|
||||
* @return int contains element count
|
||||
*/
|
||||
inline PRInt32 GetSize() const { return mSize;}
|
||||
|
||||
/**
|
||||
* Pushes new member onto the end of the deque
|
||||
*
|
||||
* @update gess4/18/98
|
||||
* @param ptr to object to store
|
||||
* @return *this
|
||||
*/
|
||||
nsDeque& Push(void* anItem);
|
||||
|
||||
/**
|
||||
* Pushes new member onto the front of the deque
|
||||
*
|
||||
* @update gess4/18/98
|
||||
* @param ptr to object to store
|
||||
* @return *this
|
||||
*/
|
||||
nsDeque& PushFront(void* anItem);
|
||||
|
||||
/**
|
||||
* Remove and return the first item in the container.
|
||||
*
|
||||
* @update gess4/18/98
|
||||
* @param none
|
||||
* @return ptr to first item in container
|
||||
*/
|
||||
void* Pop(void);
|
||||
|
||||
/**
|
||||
* Remove and return the first item in the container.
|
||||
*
|
||||
* @update gess4/18/98
|
||||
* @param none
|
||||
* @return ptr to first item in container
|
||||
*/
|
||||
void* PopFront(void);
|
||||
|
||||
|
||||
/**
|
||||
* Return topmost item without removing it.
|
||||
*
|
||||
* @update gess4/18/98
|
||||
* @param none
|
||||
* @return ptr to first item in container
|
||||
*/
|
||||
void* Peek(void);
|
||||
|
||||
/**
|
||||
* method used to retrieve ptr to
|
||||
* ith member in container. DOesn't remove
|
||||
* that item.
|
||||
*
|
||||
* @update gess4/18/98
|
||||
* @param index of desired item
|
||||
* @return ptr to ith element in list
|
||||
*/
|
||||
void* ObjectAt(int anIndex) const;
|
||||
|
||||
/**
|
||||
* Remove all items from container without destroying them
|
||||
*
|
||||
* @update gess4/18/98
|
||||
* @param
|
||||
* @return
|
||||
*/
|
||||
nsDeque& Empty();
|
||||
|
||||
/**
|
||||
* Remove and delete all items from container
|
||||
*
|
||||
* @update gess4/18/98
|
||||
* @param
|
||||
* @return
|
||||
*/
|
||||
nsDeque& Erase();
|
||||
|
||||
|
||||
/**
|
||||
* Creates a new iterator, init'ed to start of container
|
||||
*
|
||||
* @update gess4/18/98
|
||||
* @return new dequeIterator
|
||||
*/
|
||||
nsDequeIterator Begin() const;
|
||||
|
||||
/**
|
||||
* Creates a new iterator, init'ed to end of container
|
||||
*
|
||||
* @update gess4/18/98
|
||||
* @return new dequeIterator
|
||||
*/
|
||||
nsDequeIterator End() const;
|
||||
|
||||
|
||||
/**
|
||||
* Call this method when you wanto to iterate all the
|
||||
* members of the container, passing a functor along
|
||||
* to call your code.
|
||||
*
|
||||
* @update gess4/20/98
|
||||
* @param aFunctor object to call for each member
|
||||
* @return *this
|
||||
*/
|
||||
void ForEach(nsDequeFunctor& aFunctor) const;
|
||||
|
||||
/**
|
||||
* Call this method when you wanto to iterate all the
|
||||
* members of the container, passing a functor along
|
||||
* to call your code. This process will interupt if
|
||||
* your function returns a null to this iterator.
|
||||
*
|
||||
* @update gess4/20/98
|
||||
* @param aFunctor object to call for each member
|
||||
* @return *this
|
||||
*/
|
||||
const void* FirstThat(nsDequeFunctor& aFunctor) const;
|
||||
|
||||
void SetDeallocator(nsDequeFunctor* aDeallocator);
|
||||
|
||||
/**
|
||||
* Perform automated selftest on the deque
|
||||
*
|
||||
* @update gess4/18/98
|
||||
* @param
|
||||
* @return
|
||||
*/
|
||||
static void SelfTest();
|
||||
|
||||
protected:
|
||||
|
||||
PRInt32 mSize;
|
||||
PRInt32 mCapacity;
|
||||
PRInt32 mOrigin;
|
||||
nsDequeFunctor* mDeallocator;
|
||||
void* mBuffer[8];
|
||||
void** mData;
|
||||
|
||||
|
||||
private:
|
||||
|
||||
|
||||
/**
|
||||
* Simple default constructor (PRIVATE)
|
||||
*
|
||||
* @update gess4/18/98
|
||||
* @param
|
||||
* @return
|
||||
*/
|
||||
nsDeque();
|
||||
|
||||
/**
|
||||
* Copy constructor (PRIVATE)
|
||||
*
|
||||
* @update gess4/18/98
|
||||
* @param
|
||||
* @return
|
||||
*/
|
||||
nsDeque(const nsDeque& other);
|
||||
|
||||
/**
|
||||
* Deque assignment operator (PRIVATE)
|
||||
*
|
||||
* @update gess4/18/98
|
||||
* @param another deque
|
||||
* @return *this
|
||||
*/
|
||||
nsDeque& operator=(const nsDeque& anOther);
|
||||
|
||||
nsDeque& GrowCapacity(void);
|
||||
|
||||
};
|
||||
|
||||
/******************************************************
|
||||
* Here comes the nsDequeIterator class...
|
||||
******************************************************/
|
||||
|
||||
class NS_COM nsDequeIterator {
|
||||
public:
|
||||
|
||||
/**
|
||||
* DequeIterator is an object that knows how to iterate (forward and backward)
|
||||
* a Deque. Normally, you don't need to do this, but there are some special
|
||||
* cases where it is pretty handy, so here you go.
|
||||
*
|
||||
* @update gess4/18/98
|
||||
* @param aQueue is the deque object to be iterated
|
||||
* @param anIndex is the starting position for your iteration
|
||||
*/
|
||||
nsDequeIterator(const nsDeque& aQueue,int anIndex=0);
|
||||
|
||||
/**
|
||||
* DequeIterator is an object that knows how to iterate (forward and backward)
|
||||
* a Deque. Normally, you don't need to do this, but there are some special
|
||||
* cases where it is pretty handy, so here you go.
|
||||
*
|
||||
* @update gess4/18/98
|
||||
* @param aQueue is the deque object to be iterated
|
||||
* @param anIndex is the starting position for your iteration
|
||||
*/
|
||||
nsDequeIterator(const nsDequeIterator& aCopy);
|
||||
|
||||
/**
|
||||
* Moves iterator to first element in deque
|
||||
* @update gess4/18/98
|
||||
* @return this
|
||||
*/
|
||||
nsDequeIterator& First(void);
|
||||
|
||||
/**
|
||||
* Standard assignment operator for deque
|
||||
* @update gess4/18/98
|
||||
* @param
|
||||
* @return
|
||||
*/
|
||||
nsDequeIterator& operator=(const nsDequeIterator& aCopy);
|
||||
|
||||
/**
|
||||
* preform ! operation against to iterators to test for equivalence
|
||||
* (or lack thereof)!
|
||||
*
|
||||
* @update gess4/18/98
|
||||
* @param anIter is the object to be compared to
|
||||
* @return TRUE if NOT equal.
|
||||
*/
|
||||
PRBool operator!=(nsDequeIterator& anIter);
|
||||
|
||||
/**
|
||||
* Compare 2 iterators for equivalence.
|
||||
*
|
||||
* @update gess4/18/98
|
||||
* @param anIter is the other iterator to be compared to
|
||||
* @return TRUE if EQUAL
|
||||
*/
|
||||
PRBool operator<(nsDequeIterator& anIter);
|
||||
|
||||
/**
|
||||
* Compare 2 iterators for equivalence.
|
||||
*
|
||||
* @update gess4/18/98
|
||||
* @param anIter is the other iterator to be compared to
|
||||
* @return TRUE if EQUAL
|
||||
*/
|
||||
PRBool operator==(nsDequeIterator& anIter);
|
||||
|
||||
/**
|
||||
* Compare 2 iterators for equivalence.
|
||||
*
|
||||
* @update gess4/18/98
|
||||
* @param anIter is the other iterator to be compared to
|
||||
* @return TRUE if EQUAL
|
||||
*/
|
||||
PRBool operator>=(nsDequeIterator& anIter);
|
||||
|
||||
/**
|
||||
* Pre-increment operator
|
||||
*
|
||||
* @update gess4/18/98
|
||||
* @return object at preincremented index
|
||||
*/
|
||||
void* operator++();
|
||||
|
||||
/**
|
||||
* Post-increment operator
|
||||
*
|
||||
* @update gess4/18/98
|
||||
* @param param is ignored
|
||||
* @return object at post-incremented index
|
||||
*/
|
||||
void* operator++(int);
|
||||
|
||||
/**
|
||||
* Pre-decrement operator
|
||||
*
|
||||
* @update gess4/18/98
|
||||
* @return object at pre-decremented index
|
||||
*/
|
||||
void* operator--();
|
||||
|
||||
/**
|
||||
* Post-decrement operator
|
||||
*
|
||||
* @update gess4/18/98
|
||||
* @param param is ignored
|
||||
* @return object at post-decremented index
|
||||
*/
|
||||
void* operator--(int);
|
||||
|
||||
/**
|
||||
* Retrieve the ptr to the iterators notion of current node
|
||||
*
|
||||
* @update gess4/18/98
|
||||
* @return object at ith index
|
||||
*/
|
||||
void* GetCurrent(void);
|
||||
|
||||
/**
|
||||
* Call this method when you wanto to iterate all the
|
||||
* members of the container, passing a functor along
|
||||
* to call your code.
|
||||
*
|
||||
* @update gess4/20/98
|
||||
* @param aFunctor object to call for each member
|
||||
* @return *this
|
||||
*/
|
||||
void ForEach(nsDequeFunctor& aFunctor) const;
|
||||
|
||||
/**
|
||||
* Call this method when you wanto to iterate all the
|
||||
* members of the container, passing a functor along
|
||||
* to call your code.
|
||||
*
|
||||
* @update gess4/20/98
|
||||
* @param aFunctor object to call for each member
|
||||
* @return *this
|
||||
*/
|
||||
const void* FirstThat(nsDequeFunctor& aFunctor) const;
|
||||
|
||||
protected:
|
||||
|
||||
PRInt32 mIndex;
|
||||
const nsDeque& mDeque;
|
||||
};
|
||||
|
||||
|
||||
#endif
|
||||
75
mozilla/xpcom/ds/nsEmptyEnumerator.cpp
Normal file
75
mozilla/xpcom/ds/nsEmptyEnumerator.cpp
Normal file
@@ -0,0 +1,75 @@
|
||||
/* -*- Mode: C++; tab-width: 4; indent-tabs-mode: nil; c-basic-offset: 4 -*-
|
||||
*
|
||||
* The contents of this file are subject to the Netscape Public License
|
||||
* Version 1.0 (the "NPL"); you may not use this file except in
|
||||
* compliance with the NPL. You may obtain a copy of the NPL at
|
||||
* http://www.mozilla.org/NPL/
|
||||
*
|
||||
* Software distributed under the NPL is distributed on an "AS IS" basis,
|
||||
* WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
|
||||
* for the specific language governing rights and limitations under the
|
||||
* NPL.
|
||||
*
|
||||
* The Initial Developer of this code under the NPL is Netscape
|
||||
* Communications Corporation. Portions created by Netscape are
|
||||
* Copyright (C) 1998 Netscape Communications Corporation. All Rights
|
||||
* Reserved.
|
||||
*/
|
||||
|
||||
/*
|
||||
|
||||
An empty enumerator.
|
||||
|
||||
*/
|
||||
|
||||
#include "nsIEnumerator.h"
|
||||
|
||||
////////////////////////////////////////////////////////////////////////
|
||||
|
||||
class EmptyEnumeratorImpl : public nsISimpleEnumerator
|
||||
{
|
||||
public:
|
||||
EmptyEnumeratorImpl(void) {};
|
||||
virtual ~EmptyEnumeratorImpl(void) {};
|
||||
|
||||
// nsISupports interface
|
||||
NS_IMETHOD_(nsrefcnt) AddRef(void) {
|
||||
return 2;
|
||||
}
|
||||
|
||||
NS_IMETHOD_(nsrefcnt) Release(void) {
|
||||
return 1;
|
||||
}
|
||||
|
||||
NS_IMETHOD QueryInterface(REFNSIID iid, void** result) {
|
||||
if (! result)
|
||||
return NS_ERROR_NULL_POINTER;
|
||||
|
||||
if (iid.Equals(nsISimpleEnumerator::GetIID()) ||
|
||||
iid.Equals(NS_GET_IID(nsISupports))) {
|
||||
*result = (nsISimpleEnumerator*) this;
|
||||
NS_ADDREF(this);
|
||||
return NS_OK;
|
||||
}
|
||||
return NS_NOINTERFACE;
|
||||
}
|
||||
|
||||
// nsISimpleEnumerator
|
||||
NS_IMETHOD HasMoreElements(PRBool* aResult) {
|
||||
*aResult = PR_FALSE;
|
||||
return NS_OK;
|
||||
}
|
||||
|
||||
NS_IMETHOD GetNext(nsISupports** aResult) {
|
||||
return NS_ERROR_UNEXPECTED;
|
||||
}
|
||||
};
|
||||
|
||||
extern "C" NS_COM nsresult
|
||||
NS_NewEmptyEnumerator(nsISimpleEnumerator** aResult)
|
||||
{
|
||||
static EmptyEnumeratorImpl gEmptyEnumerator;
|
||||
*aResult = &gEmptyEnumerator;
|
||||
return NS_OK;
|
||||
}
|
||||
|
||||
228
mozilla/xpcom/ds/nsEnumeratorUtils.cpp
Normal file
228
mozilla/xpcom/ds/nsEnumeratorUtils.cpp
Normal file
@@ -0,0 +1,228 @@
|
||||
/* -*- Mode: C++; tab-width: 4; indent-tabs-mode: nil; c-basic-offset: 4 -*-
|
||||
*
|
||||
* The contents of this file are subject to the Netscape Public License
|
||||
* Version 1.0 (the "NPL"); you may not use this file except in
|
||||
* compliance with the NPL. You may obtain a copy of the NPL at
|
||||
* http://www.mozilla.org/NPL/
|
||||
*
|
||||
* Software distributed under the NPL is distributed on an "AS IS" basis,
|
||||
* WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
|
||||
* for the specific language governing rights and limitations under the
|
||||
* NPL.
|
||||
*
|
||||
* The Initial Developer of this code under the NPL is Netscape
|
||||
* Communications Corporation. Portions created by Netscape are
|
||||
* Copyright (C) 1998 Netscape Communications Corporation. All Rights
|
||||
* Reserved.
|
||||
*/
|
||||
|
||||
#include "nsEnumeratorUtils.h"
|
||||
|
||||
|
||||
nsArrayEnumerator::nsArrayEnumerator(nsISupportsArray* aValueArray)
|
||||
: mValueArray(aValueArray),
|
||||
mIndex(0)
|
||||
{
|
||||
NS_INIT_REFCNT();
|
||||
NS_IF_ADDREF(mValueArray);
|
||||
}
|
||||
|
||||
nsArrayEnumerator::~nsArrayEnumerator(void)
|
||||
{
|
||||
NS_IF_RELEASE(mValueArray);
|
||||
}
|
||||
|
||||
NS_IMPL_ISUPPORTS1(nsArrayEnumerator, nsISimpleEnumerator)
|
||||
|
||||
NS_IMETHODIMP
|
||||
nsArrayEnumerator::HasMoreElements(PRBool* aResult)
|
||||
{
|
||||
NS_PRECONDITION(aResult != 0, "null ptr");
|
||||
if (! aResult)
|
||||
return NS_ERROR_NULL_POINTER;
|
||||
|
||||
PRUint32 cnt;
|
||||
nsresult rv = mValueArray->Count(&cnt);
|
||||
if (NS_FAILED(rv)) return rv;
|
||||
*aResult = (mIndex < (PRInt32) cnt);
|
||||
return NS_OK;
|
||||
}
|
||||
|
||||
NS_IMETHODIMP
|
||||
nsArrayEnumerator::GetNext(nsISupports** aResult)
|
||||
{
|
||||
NS_PRECONDITION(aResult != 0, "null ptr");
|
||||
if (! aResult)
|
||||
return NS_ERROR_NULL_POINTER;
|
||||
|
||||
PRUint32 cnt;
|
||||
nsresult rv = mValueArray->Count(&cnt);
|
||||
if (NS_FAILED(rv)) return rv;
|
||||
if (mIndex >= (PRInt32) cnt)
|
||||
return NS_ERROR_UNEXPECTED;
|
||||
|
||||
*aResult = mValueArray->ElementAt(mIndex++);
|
||||
return NS_OK;
|
||||
}
|
||||
|
||||
extern "C" NS_COM nsresult
|
||||
NS_NewArrayEnumerator(nsISimpleEnumerator* *result,
|
||||
nsISupportsArray* array)
|
||||
{
|
||||
nsArrayEnumerator* enumer = new nsArrayEnumerator(array);
|
||||
if (enumer == nsnull)
|
||||
return NS_ERROR_OUT_OF_MEMORY;
|
||||
NS_ADDREF(enumer);
|
||||
*result = enumer;
|
||||
return NS_OK;
|
||||
}
|
||||
|
||||
////////////////////////////////////////////////////////////////////////////////
|
||||
|
||||
nsSingletonEnumerator::nsSingletonEnumerator(nsISupports* aValue)
|
||||
: mValue(aValue)
|
||||
{
|
||||
NS_INIT_REFCNT();
|
||||
NS_IF_ADDREF(mValue);
|
||||
mConsumed = (mValue ? PR_FALSE : PR_TRUE);
|
||||
}
|
||||
|
||||
nsSingletonEnumerator::~nsSingletonEnumerator()
|
||||
{
|
||||
NS_IF_RELEASE(mValue);
|
||||
}
|
||||
|
||||
NS_IMPL_ISUPPORTS1(nsSingletonEnumerator, nsISimpleEnumerator)
|
||||
|
||||
NS_IMETHODIMP
|
||||
nsSingletonEnumerator::HasMoreElements(PRBool* aResult)
|
||||
{
|
||||
NS_PRECONDITION(aResult != 0, "null ptr");
|
||||
if (! aResult)
|
||||
return NS_ERROR_NULL_POINTER;
|
||||
|
||||
*aResult = !mConsumed;
|
||||
return NS_OK;
|
||||
}
|
||||
|
||||
|
||||
NS_IMETHODIMP
|
||||
nsSingletonEnumerator::GetNext(nsISupports** aResult)
|
||||
{
|
||||
NS_PRECONDITION(aResult != 0, "null ptr");
|
||||
if (! aResult)
|
||||
return NS_ERROR_NULL_POINTER;
|
||||
|
||||
if (mConsumed)
|
||||
return NS_ERROR_UNEXPECTED;
|
||||
|
||||
mConsumed = PR_TRUE;
|
||||
|
||||
NS_ADDREF(mValue);
|
||||
*aResult = mValue;
|
||||
return NS_OK;
|
||||
}
|
||||
|
||||
extern "C" NS_COM nsresult
|
||||
NS_NewSingletonEnumerator(nsISimpleEnumerator* *result,
|
||||
nsISupports* singleton)
|
||||
{
|
||||
nsSingletonEnumerator* enumer = new nsSingletonEnumerator(singleton);
|
||||
if (enumer == nsnull)
|
||||
return NS_ERROR_OUT_OF_MEMORY;
|
||||
NS_ADDREF(enumer);
|
||||
*result = enumer;
|
||||
return NS_OK;
|
||||
}
|
||||
|
||||
////////////////////////////////////////////////////////////////////////
|
||||
|
||||
|
||||
nsAdapterEnumerator::nsAdapterEnumerator(nsIEnumerator* aEnum)
|
||||
: mEnum(aEnum), mCurrent(0), mStarted(PR_FALSE)
|
||||
{
|
||||
NS_INIT_REFCNT();
|
||||
NS_ADDREF(mEnum);
|
||||
}
|
||||
|
||||
|
||||
nsAdapterEnumerator::~nsAdapterEnumerator()
|
||||
{
|
||||
NS_RELEASE(mEnum);
|
||||
NS_IF_RELEASE(mCurrent);
|
||||
}
|
||||
|
||||
|
||||
NS_IMPL_ISUPPORTS1(nsAdapterEnumerator, nsISimpleEnumerator)
|
||||
|
||||
NS_IMETHODIMP
|
||||
nsAdapterEnumerator::HasMoreElements(PRBool* aResult)
|
||||
{
|
||||
nsresult rv;
|
||||
|
||||
if (mCurrent) {
|
||||
*aResult = PR_TRUE;
|
||||
return NS_OK;
|
||||
}
|
||||
|
||||
if (! mStarted) {
|
||||
mStarted = PR_TRUE;
|
||||
rv = mEnum->First();
|
||||
if (rv == NS_OK) {
|
||||
mEnum->CurrentItem(&mCurrent);
|
||||
*aResult = PR_TRUE;
|
||||
}
|
||||
else {
|
||||
*aResult = PR_FALSE;
|
||||
}
|
||||
}
|
||||
else {
|
||||
*aResult = PR_FALSE;
|
||||
|
||||
rv = mEnum->IsDone();
|
||||
if (rv != NS_OK) {
|
||||
// We're not done. Advance to the next one.
|
||||
rv = mEnum->Next();
|
||||
if (rv == NS_OK) {
|
||||
mEnum->CurrentItem(&mCurrent);
|
||||
*aResult = PR_TRUE;
|
||||
}
|
||||
}
|
||||
}
|
||||
return NS_OK;
|
||||
}
|
||||
|
||||
|
||||
NS_IMETHODIMP
|
||||
nsAdapterEnumerator::GetNext(nsISupports** aResult)
|
||||
{
|
||||
nsresult rv;
|
||||
|
||||
PRBool hasMore;
|
||||
rv = HasMoreElements(&hasMore);
|
||||
if (NS_FAILED(rv)) return rv;
|
||||
|
||||
if (! hasMore)
|
||||
return NS_ERROR_UNEXPECTED;
|
||||
|
||||
// No need to addref, we "transfer" the ownership to the caller.
|
||||
*aResult = mCurrent;
|
||||
mCurrent = 0;
|
||||
return NS_OK;
|
||||
}
|
||||
|
||||
extern "C" NS_COM nsresult
|
||||
NS_NewAdapterEnumerator(nsISimpleEnumerator* *result,
|
||||
nsIEnumerator* enumerator)
|
||||
{
|
||||
nsAdapterEnumerator* enumer = new nsAdapterEnumerator(enumerator);
|
||||
if (enumer == nsnull)
|
||||
return NS_ERROR_OUT_OF_MEMORY;
|
||||
NS_ADDREF(enumer);
|
||||
*result = enumer;
|
||||
return NS_OK;
|
||||
}
|
||||
|
||||
////////////////////////////////////////////////////////////////////////////////
|
||||
|
||||
|
||||
97
mozilla/xpcom/ds/nsEnumeratorUtils.h
Normal file
97
mozilla/xpcom/ds/nsEnumeratorUtils.h
Normal file
@@ -0,0 +1,97 @@
|
||||
/* -*- Mode: C++; tab-width: 4; indent-tabs-mode: nil; c-basic-offset: 4 -*-
|
||||
*
|
||||
* The contents of this file are subject to the Netscape Public License
|
||||
* Version 1.0 (the "NPL"); you may not use this file except in
|
||||
* compliance with the NPL. You may obtain a copy of the NPL at
|
||||
* http://www.mozilla.org/NPL/
|
||||
*
|
||||
* Software distributed under the NPL is distributed on an "AS IS" basis,
|
||||
* WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
|
||||
* for the specific language governing rights and limitations under the
|
||||
* NPL.
|
||||
*
|
||||
* The Initial Developer of this code under the NPL is Netscape
|
||||
* Communications Corporation. Portions created by Netscape are
|
||||
* Copyright (C) 1998 Netscape Communications Corporation. All Rights
|
||||
* Reserved.
|
||||
*/
|
||||
|
||||
#ifndef nsEnumeratorUtils_h__
|
||||
#define nsEnumeratorUtils_h__
|
||||
|
||||
#include "nsIEnumerator.h"
|
||||
#include "nsISupportsArray.h"
|
||||
|
||||
class NS_COM nsArrayEnumerator : public nsISimpleEnumerator
|
||||
{
|
||||
public:
|
||||
// nsISupports interface
|
||||
NS_DECL_ISUPPORTS
|
||||
|
||||
// nsISimpleEnumerator interface
|
||||
NS_IMETHOD HasMoreElements(PRBool* aResult);
|
||||
NS_IMETHOD GetNext(nsISupports** aResult);
|
||||
|
||||
// nsRDFArrayEnumerator methods
|
||||
nsArrayEnumerator(nsISupportsArray* aValueArray);
|
||||
virtual ~nsArrayEnumerator(void);
|
||||
|
||||
protected:
|
||||
nsISupportsArray* mValueArray;
|
||||
PRInt32 mIndex;
|
||||
};
|
||||
|
||||
extern "C" NS_COM nsresult
|
||||
NS_NewArrayEnumerator(nsISimpleEnumerator* *result,
|
||||
nsISupportsArray* array);
|
||||
|
||||
////////////////////////////////////////////////////////////////////////////////
|
||||
|
||||
class NS_COM nsSingletonEnumerator : public nsISimpleEnumerator
|
||||
{
|
||||
public:
|
||||
NS_DECL_ISUPPORTS
|
||||
|
||||
// nsISimpleEnumerator methods
|
||||
NS_IMETHOD HasMoreElements(PRBool* aResult);
|
||||
NS_IMETHOD GetNext(nsISupports** aResult);
|
||||
|
||||
nsSingletonEnumerator(nsISupports* aValue);
|
||||
virtual ~nsSingletonEnumerator();
|
||||
|
||||
protected:
|
||||
nsISupports* mValue;
|
||||
PRBool mConsumed;
|
||||
};
|
||||
|
||||
extern "C" NS_COM nsresult
|
||||
NS_NewSingletonEnumerator(nsISimpleEnumerator* *result,
|
||||
nsISupports* singleton);
|
||||
|
||||
////////////////////////////////////////////////////////////////////////////////
|
||||
|
||||
class NS_COM nsAdapterEnumerator : public nsISimpleEnumerator
|
||||
{
|
||||
public:
|
||||
NS_DECL_ISUPPORTS
|
||||
|
||||
// nsISimpleEnumerator methods
|
||||
NS_IMETHOD HasMoreElements(PRBool* aResult);
|
||||
NS_IMETHOD GetNext(nsISupports** aResult);
|
||||
|
||||
nsAdapterEnumerator(nsIEnumerator* aEnum);
|
||||
virtual ~nsAdapterEnumerator();
|
||||
|
||||
protected:
|
||||
nsIEnumerator* mEnum;
|
||||
nsISupports* mCurrent;
|
||||
PRBool mStarted;
|
||||
};
|
||||
|
||||
extern "C" NS_COM nsresult
|
||||
NS_NewAdapterEnumerator(nsISimpleEnumerator* *result,
|
||||
nsIEnumerator* enumerator);
|
||||
|
||||
////////////////////////////////////////////////////////////////////////
|
||||
|
||||
#endif /* nsEnumeratorUtils_h__ */
|
||||
67
mozilla/xpcom/ds/nsIArena.h
Normal file
67
mozilla/xpcom/ds/nsIArena.h
Normal file
@@ -0,0 +1,67 @@
|
||||
/* -*- Mode: C++; tab-width: 2; indent-tabs-mode: nil; c-basic-offset: 2 -*-
|
||||
*
|
||||
* The contents of this file are subject to the Netscape Public License
|
||||
* Version 1.0 (the "NPL"); you may not use this file except in
|
||||
* compliance with the NPL. You may obtain a copy of the NPL at
|
||||
* http://www.mozilla.org/NPL/
|
||||
*
|
||||
* Software distributed under the NPL is distributed on an "AS IS" basis,
|
||||
* WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
|
||||
* for the specific language governing rights and limitations under the
|
||||
* NPL.
|
||||
*
|
||||
* The Initial Developer of this code under the NPL is Netscape
|
||||
* Communications Corporation. Portions created by Netscape are
|
||||
* Copyright (C) 1998 Netscape Communications Corporation. All Rights
|
||||
* Reserved.
|
||||
*/
|
||||
#ifndef nsIArena_h___
|
||||
#define nsIArena_h___
|
||||
|
||||
#include "nscore.h"
|
||||
#include "nsISupports.h"
|
||||
|
||||
#define NS_MIN_ARENA_BLOCK_SIZE 64
|
||||
#define NS_DEFAULT_ARENA_BLOCK_SIZE 4096
|
||||
|
||||
/// Interface IID for nsIArena
|
||||
#define NS_IARENA_IID \
|
||||
{ 0xa24fdad0, 0x93b4, 0x11d1, \
|
||||
{0x89, 0x5b, 0x00, 0x60, 0x08, 0x91, 0x1b, 0x81} }
|
||||
#define NS_ARENA_PROGID "component://netscape/arena"
|
||||
#define NS_ARENA_CLASSNAME "Arena"
|
||||
|
||||
/** Interface to a memory arena abstraction. Arena's use large blocks
|
||||
* of memory to allocate smaller objects. Arena's provide no free
|
||||
* operator; instead, all of the objects in the arena are deallocated
|
||||
* by deallocating the arena (e.g. when it's reference count goes to
|
||||
* zero)
|
||||
*/
|
||||
class nsIArena : public nsISupports {
|
||||
public:
|
||||
static const nsIID& GetIID() { static nsIID iid = NS_IARENA_IID; return iid; }
|
||||
|
||||
NS_IMETHOD Init(PRUint32 arenaBlockSize) = 0;
|
||||
|
||||
NS_IMETHOD_(void*) Alloc(PRUint32 size) = 0;
|
||||
};
|
||||
|
||||
/**
|
||||
* Create a new arena using the desired block size for allocating the
|
||||
* underlying memory blocks. The underlying memory blocks are allocated
|
||||
* using the PR heap.
|
||||
*/
|
||||
extern NS_COM nsresult NS_NewHeapArena(nsIArena** aInstancePtrResult,
|
||||
PRUint32 aArenaBlockSize = 0);
|
||||
|
||||
#define NS_ARENA_CID \
|
||||
{ /* 9832ec80-0d6b-11d3-9331-00104ba0fd40 */ \
|
||||
0x9832ec80, \
|
||||
0x0d6b, \
|
||||
0x11d3, \
|
||||
{0x93, 0x31, 0x00, 0x10, 0x4b, 0xa0, 0xfd, 0x40} \
|
||||
}
|
||||
|
||||
#endif /* nsIArena_h___ */
|
||||
|
||||
|
||||
82
mozilla/xpcom/ds/nsIAtom.idl
Normal file
82
mozilla/xpcom/ds/nsIAtom.idl
Normal file
@@ -0,0 +1,82 @@
|
||||
/* -*- Mode: C++; tab-width: 2; indent-tabs-mode: nil; c-basic-offset: 2 -*- */
|
||||
/*
|
||||
* The contents of this file are subject to the Netscape Public License
|
||||
* Version 1.0 (the "License"); you may not use this file except in
|
||||
* compliance with the License. You may obtain a copy of the License at
|
||||
* http://www.mozilla.org/NPL/
|
||||
*
|
||||
* Software distributed under the License is distributed on an "AS IS" basis,
|
||||
* WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
|
||||
* for the specific language governing rights and limitations under the
|
||||
* License.
|
||||
*
|
||||
* The Original Code is Mozilla Communicator client code,
|
||||
* released March 31, 1998.
|
||||
*
|
||||
* The Initial Developer of the Original Code is Netscape Communications
|
||||
* Corporation. Portions created by Netscape are
|
||||
* Copyright (C) 1998-1999 Netscape Communications Corporation. All Rights
|
||||
* Reserved.
|
||||
*
|
||||
* Contributors:
|
||||
*
|
||||
*/
|
||||
#include "nsISupports.idl"
|
||||
|
||||
interface nsISizeOfHandler;
|
||||
|
||||
|
||||
[ref] native nsStringRef(nsString);
|
||||
%{ C++
|
||||
class nsString;
|
||||
%}
|
||||
|
||||
|
||||
[uuid(3d1b15b0-93b4-11d1-895b-006008911b81)]
|
||||
interface nsIAtom : nsISupports
|
||||
{
|
||||
/**
|
||||
* Translate the unicode string into the stringbuf.
|
||||
*/
|
||||
void ToString(in nsStringRef aString);
|
||||
|
||||
/**
|
||||
* Return a pointer to a zero terminated unicode string.
|
||||
*/
|
||||
void GetUnicode([shared, retval] out wstring aResult);
|
||||
|
||||
/**
|
||||
* Get the size, in bytes, of the atom.
|
||||
*/
|
||||
PRUint32 SizeOf(in nsISizeOfHandler aHandler);
|
||||
};
|
||||
|
||||
|
||||
%{C++
|
||||
|
||||
/**
|
||||
* Find an atom that matches the given iso-latin1 C string. The
|
||||
* C string is translated into it's unicode equivalent.
|
||||
*/
|
||||
extern NS_COM nsIAtom* NS_NewAtom(const char* isolatin1);
|
||||
|
||||
/**
|
||||
* Find an atom that matches the given unicode string. The string is assumed
|
||||
* to be zero terminated.
|
||||
*/
|
||||
extern NS_COM nsIAtom* NS_NewAtom(const PRUnichar* unicode);
|
||||
|
||||
/**
|
||||
* Find an atom that matches the given string.
|
||||
*/
|
||||
extern NS_COM nsIAtom* NS_NewAtom(const nsString& aString);
|
||||
|
||||
/**
|
||||
* Return a count of the total number of atoms currently
|
||||
* alive in the system.
|
||||
*/
|
||||
extern NS_COM nsrefcnt NS_GetNumberOfAtoms(void);
|
||||
|
||||
extern NS_COM void NS_PurgeAtomTable(void);
|
||||
|
||||
%}
|
||||
312
mozilla/xpcom/ds/nsIBuffer.h
Normal file
312
mozilla/xpcom/ds/nsIBuffer.h
Normal file
@@ -0,0 +1,312 @@
|
||||
/* -*- Mode: C++; tab-width: 4; indent-tabs-mode: nil; c-basic-offset: 4 -*-
|
||||
*
|
||||
* The contents of this file are subject to the Netscape Public License
|
||||
* Version 1.0 (the "NPL"); you may not use this file except in
|
||||
* compliance with the NPL. You may obtain a copy of the NPL at
|
||||
* http://www.mozilla.org/NPL/
|
||||
*
|
||||
* Software distributed under the NPL is distributed on an "AS IS" basis,
|
||||
* WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
|
||||
* for the specific language governing rights and limitations under the
|
||||
* NPL.
|
||||
*
|
||||
* The Initial Developer of this code under the NPL is Netscape
|
||||
* Communications Corporation. Portions created by Netscape are
|
||||
* Copyright (C) 1998 Netscape Communications Corporation. All Rights
|
||||
* Reserved.
|
||||
*/
|
||||
|
||||
#ifndef nsIBuffer_h___
|
||||
#define nsIBuffer_h___
|
||||
|
||||
/**
|
||||
* nsIBuffer is something that we use to implement pipes (buffered
|
||||
* input/output stream pairs). It might be useful to you for other
|
||||
* purposes, but if not, oh well.
|
||||
*
|
||||
* One of the important things to understand about pipes is how
|
||||
* they work with respect to EOF and result values. The following
|
||||
* table describes:
|
||||
*
|
||||
* | empty & not EOF | full | reader closed | writer closed |
|
||||
* -------------------------------------------------------------------------------------------------------------
|
||||
* buffer Read | readCount == 0 | readCount == N | N/A | readCount == N, return NS_OK -or- |
|
||||
* operations | return WOULD_BLOCK | return NS_OK | | readCount == 0, return EOF |
|
||||
* -------------------------------------------------------------------------------------------------------------
|
||||
* buffer Write | writeCount == N | writeCount == 0 | N/A | assertion! |
|
||||
* operations | return NS_OK | return WOULD_BLOCK | | |
|
||||
* -------------------------------------------------------------------------------------------------------------
|
||||
* input stream | readCount == 0 | readCount == N | assertion! | readCount == N, return NS_OK -or- |
|
||||
* Read ops | return WOULD_BLOCK | return NS_OK | | readCount == 0, return EOF |
|
||||
* -------------------------------------------------------------------------------------------------------------
|
||||
* output stream | writeCount == N | writeCount == 0 | return | assertion! |
|
||||
* Write ops | return NS_OK | return WOULD_BLOCK | STREAM_CLOSED | |
|
||||
* -------------------------------------------------------------------------------------------------------------
|
||||
*/
|
||||
|
||||
#include "nsISupports.h"
|
||||
#include "nscore.h"
|
||||
|
||||
class nsIInputStream;
|
||||
class nsIAllocator;
|
||||
class nsIBufferInputStream;
|
||||
class nsIBufferOutputStream;
|
||||
class nsIBufferObserver;
|
||||
|
||||
#define NS_IBUFFER_IID \
|
||||
{ /* 1eebb300-fb8b-11d2-9324-00104ba0fd40 */ \
|
||||
0x1eebb300, \
|
||||
0xfb8b, \
|
||||
0x11d2, \
|
||||
{0x93, 0x24, 0x00, 0x10, 0x4b, 0xa0, 0xfd, 0x40} \
|
||||
}
|
||||
|
||||
#define NS_BUFFER_CID \
|
||||
{ /* 5dbe4de0-fbab-11d2-9324-00104ba0fd40 */ \
|
||||
0x5dbe4de0, \
|
||||
0xfbab, \
|
||||
0x11d2, \
|
||||
{0x93, 0x24, 0x00, 0x10, 0x4b, 0xa0, 0xfd, 0x40} \
|
||||
}
|
||||
|
||||
#define NS_BUFFER_PROGID "component://netscape/buffer"
|
||||
#define NS_BUFFER_CLASSNAME "Buffer"
|
||||
|
||||
/**
|
||||
* The signature for the reader function passed to WriteSegment. This
|
||||
* specifies where the data should come from that gets written into the buffer.
|
||||
* Implementers should return the following:
|
||||
* @return NS_OK and readCount - if successfully read something
|
||||
* @return NS_BASE_STREAM_EOF - if no more to read
|
||||
* @return NS_BASE_STREAM_WOULD_BLOCK - if there is currently no data (in
|
||||
* a non-blocking mode)
|
||||
* @return <other-error> - on failure
|
||||
*/
|
||||
typedef NS_CALLBACK(nsReadSegmentFun)(void* closure,
|
||||
char* toRawSegment,
|
||||
PRUint32 fromOffset,
|
||||
PRUint32 count,
|
||||
PRUint32 *readCount);
|
||||
|
||||
/**
|
||||
* The signature of the writer function passed to ReadSegments. This
|
||||
* specifies where the data should go that gets read from the buffer.
|
||||
* Implementers should return the following:
|
||||
* @return NS_OK and writeCount - if successfully wrote something
|
||||
* @return NS_BASE_STREAM_CLOSED - if no more can be written
|
||||
* @return NS_BASE_STREAM_WOULD_BLOCK - if there is currently space to write (in
|
||||
* a non-blocking mode)
|
||||
* @return <other-error> - on failure
|
||||
*/
|
||||
typedef NS_CALLBACK(nsWriteSegmentFun)(void* closure,
|
||||
const char* fromRawSegment,
|
||||
PRUint32 toOffset,
|
||||
PRUint32 count,
|
||||
PRUint32 *writeCount);
|
||||
|
||||
class nsIBuffer : public nsISupports {
|
||||
public:
|
||||
NS_DEFINE_STATIC_IID_ACCESSOR(NS_IBUFFER_IID);
|
||||
|
||||
/**
|
||||
* The segment overhead is the amount of space chopped out of each
|
||||
* segment for implementation purposes. The remainder of the segment
|
||||
* is available for data, e.g.:
|
||||
* segmentDataSize = growBySize - SEGMENT_OVERHEAD;
|
||||
*/
|
||||
enum { SEGMENT_OVERHEAD = 8 };
|
||||
|
||||
/**
|
||||
* Initializes a buffer. The segment size (including overhead) will
|
||||
* start from and increment by the growBySize, until reaching maxSize.
|
||||
* The size of the data that can fit in a segment will be the growBySize
|
||||
* minus SEGMENT_OVERHEAD bytes.
|
||||
*/
|
||||
NS_IMETHOD Init(PRUint32 growBySize, PRUint32 maxSize,
|
||||
nsIBufferObserver* observer, nsIAllocator* allocator) = 0;
|
||||
|
||||
////////////////////////////////////////////////////////////////////////////
|
||||
// Methods for Readers
|
||||
|
||||
/**
|
||||
* Reads from the read cursor into a char buffer up to a specified length.
|
||||
*/
|
||||
NS_IMETHOD Read(char* toBuf, PRUint32 bufLen, PRUint32 *readCount) = 0;
|
||||
|
||||
/**
|
||||
* This read method allows you to pass a callback function that gets called
|
||||
* repeatedly for each buffer segment until the entire amount is read.
|
||||
* This avoids the need to copy data to/from and intermediate buffer.
|
||||
*/
|
||||
NS_IMETHOD ReadSegments(nsWriteSegmentFun writer, void* closure, PRUint32 count,
|
||||
PRUint32 *readCount) = 0;
|
||||
|
||||
/**
|
||||
* Returns the raw char buffer segment and its length available for reading.
|
||||
* @param segmentLogicalOffset - The offset from the current read cursor for
|
||||
* the segment to be returned. If this is beyond the available written area,
|
||||
* NULL is returned for the resultSegment.
|
||||
* @param resultSegment - The resulting read segment.
|
||||
* @param resultSegmentLength - The resulting read segment length.
|
||||
*
|
||||
* @return NS_OK - if a read segment is successfully returned, or if
|
||||
* the requested offset is at or beyond the write cursor (in which case
|
||||
* the resultSegment will be nsnull and the resultSegmentLen will be 0)
|
||||
* @return NS_BASE_STREAM_WOULD_BLOCK - if the buffer size becomes 0
|
||||
* @return any error set by SetCondition if the requested offset is at
|
||||
* or beyond the write cursor (in which case the resultSegment will be
|
||||
* nsnull and the resultSegmentLen will be 0). Note that NS_OK will be
|
||||
* returned if SetCondition has not been called.
|
||||
* @return any error returned by OnEmpty
|
||||
*/
|
||||
NS_IMETHOD GetReadSegment(PRUint32 segmentLogicalOffset,
|
||||
const char* *resultSegment,
|
||||
PRUint32 *resultSegmentLen) = 0;
|
||||
|
||||
/**
|
||||
* Returns the amount of data currently in the buffer available for reading.
|
||||
*/
|
||||
NS_IMETHOD GetReadableAmount(PRUint32 *amount) = 0;
|
||||
|
||||
/**
|
||||
* Searches for a string in the buffer. Since the buffer has a notion
|
||||
* of EOF, it is possible that the string may at some time be in the
|
||||
* buffer, but is is not currently found up to some offset. Consequently,
|
||||
* both the found and not found cases return an offset:
|
||||
* if found, return offset where it was found
|
||||
* if not found, return offset of the first byte not searched
|
||||
* In the case the buffer is at EOF and the string is not found, the first
|
||||
* byte not searched will correspond to the length of the buffer.
|
||||
*/
|
||||
NS_IMETHOD Search(const char* forString, PRBool ignoreCase,
|
||||
PRBool *found, PRUint32 *offsetSearchedTo) = 0;
|
||||
|
||||
/**
|
||||
* Sets that the reader has closed their end of the stream.
|
||||
*/
|
||||
NS_IMETHOD ReaderClosed(void) = 0;
|
||||
|
||||
/**
|
||||
* Tests whether EOF marker is set. Note that this does not necessarily mean that
|
||||
* all the data in the buffer has yet been consumed.
|
||||
*/
|
||||
NS_IMETHOD GetCondition(nsresult *result) = 0;
|
||||
|
||||
////////////////////////////////////////////////////////////////////////////
|
||||
// Methods for Writers
|
||||
|
||||
/**
|
||||
* Writes from a char buffer up to a specified length.
|
||||
* @param writeCount - The amount that could be written. If the buffer becomes full,
|
||||
* this could be less then the specified bufLen.
|
||||
*/
|
||||
NS_IMETHOD Write(const char* fromBuf, PRUint32 bufLen, PRUint32 *writeCount) = 0;
|
||||
|
||||
/**
|
||||
* Writes from an input stream up to a specified count of bytes.
|
||||
* @param writeCount - The amount that could be written. If the buffer becomes full,
|
||||
* this could be less then the specified count.
|
||||
*/
|
||||
NS_IMETHOD WriteFrom(nsIInputStream* fromStream, PRUint32 count, PRUint32 *writeCount) = 0;
|
||||
|
||||
/**
|
||||
* This write method allows you to pass a callback function that gets called
|
||||
* repeatedly for each buffer segment until the entire amount is written.
|
||||
* This avoids the need to copy data to/from and intermediate buffer.
|
||||
*/
|
||||
NS_IMETHOD WriteSegments(nsReadSegmentFun reader, void* closure, PRUint32 count,
|
||||
PRUint32 *writeCount) = 0;
|
||||
|
||||
/**
|
||||
* Returns the raw char buffer segment and its length available for writing.
|
||||
* @param resultSegment - The resulting write segment.
|
||||
* @param resultSegmentLength - The resulting write segment length.
|
||||
*
|
||||
* @return NS_OK - if there is a segment available to write to
|
||||
* @return NS_BASE_STREAM_CLOSED - if ReaderClosed has been called
|
||||
* @return NS_BASE_STREAM_WOULD_BLOCK - if the max buffer size is exceeded
|
||||
* @return NS_ERROR_OUT_OF_MEMORY - if a new segment could not be allocated
|
||||
* @return any error returned by OnFull
|
||||
*/
|
||||
NS_IMETHOD GetWriteSegment(char* *resultSegment,
|
||||
PRUint32 *resultSegmentLen) = 0;
|
||||
|
||||
/**
|
||||
* Returns the amount of space currently in the buffer available for writing.
|
||||
*/
|
||||
NS_IMETHOD GetWritableAmount(PRUint32 *amount) = 0;
|
||||
|
||||
/**
|
||||
* Returns whether the reader has closed their end of the stream.
|
||||
*/
|
||||
NS_IMETHOD GetReaderClosed(PRBool *result) = 0;
|
||||
|
||||
/**
|
||||
* Sets an EOF marker (typcially done by the writer) so that a reader can be informed
|
||||
* when all the data in the buffer is consumed. After the EOF marker has been
|
||||
* set, all subsequent calls to the above write methods will return NS_BASE_STREAM_EOF.
|
||||
*/
|
||||
NS_IMETHOD SetCondition(nsresult condition) = 0;
|
||||
};
|
||||
|
||||
////////////////////////////////////////////////////////////////////////////////
|
||||
|
||||
#define NS_IBUFFEROBSERVER_IID \
|
||||
{ /* 0c18bef0-22a8-11d3-9349-00104ba0fd40 */ \
|
||||
0x0c18bef0, \
|
||||
0x22a8, \
|
||||
0x11d3, \
|
||||
{0x93, 0x49, 0x00, 0x10, 0x4b, 0xa0, 0xfd, 0x40} \
|
||||
}
|
||||
|
||||
/**
|
||||
* A buffer observer is used to detect when the buffer becomes completely full
|
||||
* or completely empty.
|
||||
*/
|
||||
class nsIBufferObserver : public nsISupports {
|
||||
public:
|
||||
NS_DEFINE_STATIC_IID_ACCESSOR(NS_IBUFFEROBSERVER_IID);
|
||||
|
||||
NS_IMETHOD OnFull(nsIBuffer* buffer) = 0;
|
||||
|
||||
NS_IMETHOD OnWrite(nsIBuffer*, PRUint32 amount) = 0;
|
||||
|
||||
NS_IMETHOD OnEmpty(nsIBuffer* buffer) = 0;
|
||||
};
|
||||
|
||||
////////////////////////////////////////////////////////////////////////////////
|
||||
|
||||
/**
|
||||
* Creates a new buffer.
|
||||
* @param observer - may be null
|
||||
*/
|
||||
extern NS_COM nsresult
|
||||
NS_NewBuffer(nsIBuffer* *result,
|
||||
PRUint32 growBySize, PRUint32 maxSize,
|
||||
nsIBufferObserver* observer);
|
||||
|
||||
/**
|
||||
* Creates a new buffer, allocating segments from virtual memory pages.
|
||||
*/
|
||||
extern NS_COM nsresult
|
||||
NS_NewPageBuffer(nsIBuffer* *result,
|
||||
PRUint32 growBySize, PRUint32 maxSize,
|
||||
nsIBufferObserver* observer);
|
||||
|
||||
extern NS_COM nsresult
|
||||
NS_NewBufferInputStream(nsIBufferInputStream* *result,
|
||||
nsIBuffer* buffer, PRBool blocking = PR_FALSE);
|
||||
|
||||
extern NS_COM nsresult
|
||||
NS_NewBufferOutputStream(nsIBufferOutputStream* *result,
|
||||
nsIBuffer* buffer, PRBool blocking = PR_FALSE);
|
||||
|
||||
extern NS_COM nsresult
|
||||
NS_NewPipe(nsIBufferInputStream* *inStrResult,
|
||||
nsIBufferOutputStream* *outStrResult,
|
||||
PRUint32 growBySize, PRUint32 maxSize,
|
||||
PRBool blocking, nsIBufferObserver* observer);
|
||||
|
||||
////////////////////////////////////////////////////////////////////////////////
|
||||
|
||||
#endif // nsIBuffer_h___
|
||||
76
mozilla/xpcom/ds/nsIByteBuffer.h
Normal file
76
mozilla/xpcom/ds/nsIByteBuffer.h
Normal file
@@ -0,0 +1,76 @@
|
||||
/* -*- Mode: C++; tab-width: 2; indent-tabs-mode: nil; c-basic-offset: 2 -*-
|
||||
*
|
||||
* The contents of this file are subject to the Netscape Public License
|
||||
* Version 1.0 (the "NPL"); you may not use this file except in
|
||||
* compliance with the NPL. You may obtain a copy of the NPL at
|
||||
* http://www.mozilla.org/NPL/
|
||||
*
|
||||
* Software distributed under the NPL is distributed on an "AS IS" basis,
|
||||
* WITHOUT WARRANTY OF ANY KIND, either express or implied. See the NPL
|
||||
* for the specific language governing rights and limitations under the
|
||||
* NPL.
|
||||
*
|
||||
* The Initial Developer of this code under the NPL is Netscape
|
||||
* Communications Corporation. Portions created by Netscape are
|
||||
* Copyright (C) 1998 Netscape Communications Corporation. All Rights
|
||||
* Reserved.
|
||||
*/
|
||||
|
||||
#ifndef nsIByteBuffer_h___
|
||||
#define nsIByteBuffer_h___
|
||||
|
||||
#include "nscore.h"
|
||||
#include "nsISupports.h"
|
||||
|
||||
class nsIInputStream;
|
||||
|
||||
#define NS_IBYTE_BUFFER_IID \
|
||||
{ 0xe4a6e4b0, 0x93b4, 0x11d1, \
|
||||
{0x89, 0x5b, 0x00, 0x60, 0x08, 0x91, 0x1b, 0x81} }
|
||||
#define NS_IBYTEBUFFER_IID \
|
||||
{ 0xe4a6e4b0, 0x93b4, 0x11d1, \
|
||||
{0x89, 0x5b, 0x00, 0x60, 0x08, 0x91, 0x1b, 0x81} }
|
||||
#define NS_BYTEBUFFER_PROGID "component://netscape/byte-buffer"
|
||||
#define NS_BYTEBUFFER_CLASSNAME "Byte Buffer"
|
||||
|
||||
/** Interface to a buffer that holds bytes */
|
||||
class nsIByteBuffer : public nsISupports {
|
||||
public:
|
||||
static const nsIID& GetIID() { static nsIID iid = NS_IBYTEBUFFER_IID; return iid; }
|
||||
|
||||
NS_IMETHOD Init(PRUint32 aBufferSize) = 0;
|
||||
|
||||
/** @return length of buffer, i.e. how many bytes are currently in it. */
|
||||
NS_IMETHOD_(PRUint32) GetLength(void) const = 0;
|
||||
|
||||
/** @return number of bytes allocated in the buffer */
|
||||
NS_IMETHOD_(PRUint32) GetBufferSize(void) const = 0;
|
||||
|
||||
/** @return the buffer */
|
||||
NS_IMETHOD_(char*) GetBuffer(void) const = 0;
|
||||
|
||||
/** Grow buffer to aNewSize bytes. */
|
||||
NS_IMETHOD_(PRBool) Grow(PRUint32 aNewSize) = 0;
|
||||
|
||||
/** Fill the buffer with data from aStream. Don't grow the buffer, only
|
||||
* read until length of buffer equals buffer size. */
|
||||
NS_IMETHOD_(PRInt32) Fill(nsresult* aErrorCode, nsIInputStream* aStream,
|
||||
PRUint32 aKeep) = 0;
|
||||
};
|
||||
|
||||
#define NS_BYTEBUFFER_CID \
|
||||
{ /* a49d5280-0d6b-11d3-9331-00104ba0fd40 */ \
|
||||
0xa49d5280, \
|
||||
0x0d6b, \
|
||||
0x11d3, \
|
||||
{0x93, 0x31, 0x00, 0x10, 0x4b, 0xa0, 0xfd, 0x40} \
|
||||
}
|
||||
|
||||
/** Create a new byte buffer using the given buffer size. */
|
||||
extern NS_COM nsresult
|
||||
NS_NewByteBuffer(nsIByteBuffer** aInstancePtrResult,
|
||||
nsISupports* aOuter,
|
||||
PRUint32 aBufferSize = 0);
|
||||
|
||||
#endif /* nsIByteBuffer_h___ */
|
||||
|
||||
Some files were not shown because too many files have changed in this diff Show More
Reference in New Issue
Block a user