fixing for linux...

git-svn-id: svn://10.0.0.236/branches/jar_restructuring_branch@79698 18797224-902f-48f8-a5cc-f745e15eee43

mozilla/LEGAL

@@ -0,0 +1,43 @@
+Please be apprised of the following Legal Notices:
+
+A) The U.S. District Court for the Eastern District of Virginia has
+ruled that the Netscape Navigator code does not infringe Wang's U.S.
+Patent No. 4,751,669 ("the '669 Patent") because: 1) HTML is not
+Videotex as defined by the '669 patent; 2) web servers are not central
+suppliers; and 3) Navigator does not "connect," as defined by the '669
+Patent, to web servers on the Internet. Wang may appeal this decision to
+the Federal Circuit. Wang contended that its Patent disclosing a
+"Videotext" system, is infringed by the following functionality in the
+Netscape Navigator code: 1) the animated logo and status line indicators
+--See Claims 1,8 and 9; 2)  the "File Save As" function --See Claims
+23-27; 3) Bookmarks and Rename Bookmarks in the Properties window --See
+Claims 20-22; 4) storing HTML, GIF, and JPEG files and adding filename
+extensions --See Claim 38
+
+B)   Intermind owns pending U.S. patent applications on communications
+systems which employ metadata ("channel objects") to define a control
+structure for information transfer.  The Netscape code does not infringe
+as released; however, modifications which utilize channel objects as
+described by Intermind should be considered carefully. The following is
+a statement from Intermind:  "Intermind's claims fundamentally involve
+the use of a control structure to automate communications. ...The
+essence of Intermind's top claim is that two devices sender and
+receiver have persistent storage, communicate over a network,
+and exchange a control structure including metadata which describes: 1)
+what information is to be updated, 2) when to update this information,
+and 3) how to transfer the updated information. In addition, at  least
+the receiving device must be able to process the metadata in order to
+perform the update determination and transfer. Any digital
+communications system which incorporates all of these elements will be
+covered by Intermind's patents."  See Intermind.com.
+
+C) Stac, Inc., and its licensing agent Hi/fn, own several patents which
+disclose data compression methods implementing an LZS compression
+algorithm, including U.S. Patent Nos.  4,701,745 and 5,016, 009 ("the
+Stac Patents").  The Netscape Communicator code  does not perform
+compression. If you modify the Netscape source code to perform
+compression, please take notice of the Stac Patents.
+
+D) Netscape Communications Corporation ("Netscape") does not guarantee
+that any source code or executable code available from the mozilla.org
+domain is Year 2000 compliant.

mozilla/LICENSE

@@ -0,0 +1,567 @@
+                          MOZILLA PUBLIC LICENSE
+                                Version 1.1
+
+                              ---------------
+
+1. Definitions.
+
+     1.0.1. "Commercial Use" means distribution or otherwise making the
+     Covered Code available to a third party.
+
+     1.1. "Contributor" means each entity that creates or contributes to
+     the creation of Modifications.
+
+     1.2. "Contributor Version" means the combination of the Original
+     Code, prior Modifications used by a Contributor, and the Modifications
+     made by that particular Contributor.
+
+     1.3. "Covered Code" means the Original Code or Modifications or the
+     combination of the Original Code and Modifications, in each case
+     including portions thereof.
+
+     1.4. "Electronic Distribution Mechanism" means a mechanism generally
+     accepted in the software development community for the electronic
+     transfer of data.
+
+     1.5. "Executable" means Covered Code in any form other than Source
+     Code.
+
+     1.6. "Initial Developer" means the individual or entity identified
+     as the Initial Developer in the Source Code notice required by Exhibit
+     A.
+
+     1.7. "Larger Work" means a work which combines Covered Code or
+     portions thereof with code not governed by the terms of this License.
+
+     1.8. "License" means this document.
+
+     1.8.1. "Licensable" means having the right to grant, to the maximum
+     extent possible, whether at the time of the initial grant or
+     subsequently acquired, any and all of the rights conveyed herein.
+
+     1.9. "Modifications" means any addition to or deletion from the
+     substance or structure of either the Original Code or any previous
+     Modifications. When Covered Code is released as a series of files, a
+     Modification is:
+          A. Any addition to or deletion from the contents of a file
+          containing Original Code or previous Modifications.
+
+          B. Any new file that contains any part of the Original Code or
+          previous Modifications.
+
+     1.10. "Original Code" means Source Code of computer software code
+     which is described in the Source Code notice required by Exhibit A as
+     Original Code, and which, at the time of its release under this
+     License is not already Covered Code governed by this License.
+
+     1.10.1. "Patent Claims" means any patent claim(s), now owned or
+     hereafter acquired, including without limitation,  method, process,
+     and apparatus claims, in any patent Licensable by grantor.
+
+     1.11. "Source Code" means the preferred form of the Covered Code for
+     making modifications to it, including all modules it contains, plus
+     any associated interface definition files, scripts used to control
+     compilation and installation of an Executable, or source code
+     differential comparisons against either the Original Code or another
+     well known, available Covered Code of the Contributor's choice. The
+     Source Code can be in a compressed or archival form, provided the
+     appropriate decompression or de-archiving software is widely available
+     for no charge.
+
+     1.12. "You" (or "Your")  means an individual or a legal entity
+     exercising rights under, and complying with all of the terms of, this
+     License or a future version of this License issued under Section 6.1.
+     For legal entities, "You" includes any entity which controls, is
+     controlled by, or is under common control with You. For purposes of
+     this definition, "control" means (a) the power, direct or indirect,
+     to cause the direction or management of such entity, whether by
+     contract or otherwise, or (b) ownership of more than fifty percent
+     (50%) of the outstanding shares or beneficial ownership of such
+     entity.
+
+2. Source Code License.
+
+     2.1. The Initial Developer Grant.
+     The Initial Developer hereby grants You a world-wide, royalty-free,
+     non-exclusive license, subject to third party intellectual property
+     claims:
+          (a)  under intellectual property rights (other than patent or
+          trademark) Licensable by Initial Developer to use, reproduce,
+          modify, display, perform, sublicense and distribute the Original
+          Code (or portions thereof) with or without Modifications, and/or
+          as part of a Larger Work; and
+
+          (b) under Patents Claims infringed by the making, using or
+          selling of Original Code, to make, have made, use, practice,
+          sell, and offer for sale, and/or otherwise dispose of the
+          Original Code (or portions thereof).
+
+          (c) the licenses granted in this Section 2.1(a) and (b) are
+          effective on the date Initial Developer first distributes
+          Original Code under the terms of this License.
+
+          (d) Notwithstanding Section 2.1(b) above, no patent license is
+          granted: 1) for code that You delete from the Original Code; 2)
+          separate from the Original Code;  or 3) for infringements caused
+          by: i) the modification of the Original Code or ii) the
+          combination of the Original Code with other software or devices.
+
+     2.2. Contributor Grant.
+     Subject to third party intellectual property claims, each Contributor
+     hereby grants You a world-wide, royalty-free, non-exclusive license
+
+          (a)  under intellectual property rights (other than patent or
+          trademark) Licensable by Contributor, to use, reproduce, modify,
+          display, perform, sublicense and distribute the Modifications
+          created by such Contributor (or portions thereof) either on an
+          unmodified basis, with other Modifications, as Covered Code
+          and/or as part of a Larger Work; and
+
+          (b) under Patent Claims infringed by the making, using, or
+          selling of  Modifications made by that Contributor either alone
+          and/or in combination with its Contributor Version (or portions
+          of such combination), to make, use, sell, offer for sale, have
+          made, and/or otherwise dispose of: 1) Modifications made by that
+          Contributor (or portions thereof); and 2) the combination of
+          Modifications made by that Contributor with its Contributor
+          Version (or portions of such combination).
+
+          (c) the licenses granted in Sections 2.2(a) and 2.2(b) are
+          effective on the date Contributor first makes Commercial Use of
+          the Covered Code.
+
+          (d)    Notwithstanding Section 2.2(b) above, no patent license is
+          granted: 1) for any code that Contributor has deleted from the
+          Contributor Version; 2)  separate from the Contributor Version;
+          3)  for infringements caused by: i) third party modifications of
+          Contributor Version or ii)  the combination of Modifications made
+          by that Contributor with other software  (except as part of the
+          Contributor Version) or other devices; or 4) under Patent Claims
+          infringed by Covered Code in the absence of Modifications made by
+          that Contributor.
+
+3. Distribution Obligations.
+
+     3.1. Application of License.
+     The Modifications which You create or to which You contribute are
+     governed by the terms of this License, including without limitation
+     Section 2.2. The Source Code version of Covered Code may be
+     distributed only under the terms of this License or a future version
+     of this License released under Section 6.1, and You must include a
+     copy of this License with every copy of the Source Code You
+     distribute. You may not offer or impose any terms on any Source Code
+     version that alters or restricts the applicable version of this
+     License or the recipients' rights hereunder. However, You may include
+     an additional document offering the additional rights described in
+     Section 3.5.
+
+     3.2. Availability of Source Code.
+     Any Modification which You create or to which You contribute must be
+     made available in Source Code form under the terms of this License
+     either on the same media as an Executable version or via an accepted
+     Electronic Distribution Mechanism to anyone to whom you made an
+     Executable version available; and if made available via Electronic
+     Distribution Mechanism, must remain available for at least twelve (12)
+     months after the date it initially became available, or at least six
+     (6) months after a subsequent version of that particular Modification
+     has been made available to such recipients. You are responsible for
+     ensuring that the Source Code version remains available even if the
+     Electronic Distribution Mechanism is maintained by a third party.
+
+     3.3. Description of Modifications.
+     You must cause all Covered Code to which You contribute to contain a
+     file documenting the changes You made to create that Covered Code and
+     the date of any change. You must include a prominent statement that
+     the Modification is derived, directly or indirectly, from Original
+     Code provided by the Initial Developer and including the name of the
+     Initial Developer in (a) the Source Code, and (b) in any notice in an
+     Executable version or related documentation in which You describe the
+     origin or ownership of the Covered Code.
+
+     3.4. Intellectual Property Matters
+          (a) Third Party Claims.
+          If Contributor has knowledge that a license under a third party's
+          intellectual property rights is required to exercise the rights
+          granted by such Contributor under Sections 2.1 or 2.2,
+          Contributor must include a text file with the Source Code
+          distribution titled "LEGAL" which describes the claim and the
+          party making the claim in sufficient detail that a recipient will
+          know whom to contact. If Contributor obtains such knowledge after
+          the Modification is made available as described in Section 3.2,
+          Contributor shall promptly modify the LEGAL file in all copies
+          Contributor makes available thereafter and shall take other steps
+          (such as notifying appropriate mailing lists or newsgroups)
+          reasonably calculated to inform those who received the Covered
+          Code that new knowledge has been obtained.
+
+          (b) Contributor APIs.
+          If Contributor's Modifications include an application programming
+          interface and Contributor has knowledge of patent licenses which
+          are reasonably necessary to implement that API, Contributor must
+          also include this information in the LEGAL file.
+
+               (c)    Representations.
+          Contributor represents that, except as disclosed pursuant to
+          Section 3.4(a) above, Contributor believes that Contributor's
+          Modifications are Contributor's original creation(s) and/or
+          Contributor has sufficient rights to grant the rights conveyed by
+          this License.
+
+     3.5. Required Notices.
+     You must duplicate the notice in Exhibit A in each file of the Source
+     Code.  If it is not possible to put such notice in a particular Source
+     Code file due to its structure, then You must include such notice in a
+     location (such as a relevant directory) where a user would be likely
+     to look for such a notice.  If You created one or more Modification(s)
+     You may add your name as a Contributor to the notice described in
+     Exhibit A.  You must also duplicate this License in any documentation
+     for the Source Code where You describe recipients' rights or ownership
+     rights relating to Covered Code.  You may choose to offer, and to
+     charge a fee for, warranty, support, indemnity or liability
+     obligations to one or more recipients of Covered Code. However, You
+     may do so only on Your own behalf, and not on behalf of the Initial
+     Developer or any Contributor. You must make it absolutely clear than
+     any such warranty, support, indemnity or liability obligation is
+     offered by You alone, and You hereby agree to indemnify the Initial
+     Developer and every Contributor for any liability incurred by the
+     Initial Developer or such Contributor as a result of warranty,
+     support, indemnity or liability terms You offer.
+
+     3.6. Distribution of Executable Versions.
+     You may distribute Covered Code in Executable form only if the
+     requirements of Section 3.1-3.5 have been met for that Covered Code,
+     and if You include a notice stating that the Source Code version of
+     the Covered Code is available under the terms of this License,
+     including a description of how and where You have fulfilled the
+     obligations of Section 3.2. The notice must be conspicuously included
+     in any notice in an Executable version, related documentation or
+     collateral in which You describe recipients' rights relating to the
+     Covered Code. You may distribute the Executable version of Covered
+     Code or ownership rights under a license of Your choice, which may
+     contain terms different from this License, provided that You are in
+     compliance with the terms of this License and that the license for the
+     Executable version does not attempt to limit or alter the recipient's
+     rights in the Source Code version from the rights set forth in this
+     License. If You distribute the Executable version under a different
+     license You must make it absolutely clear that any terms which differ
+     from this License are offered by You alone, not by the Initial
+     Developer or any Contributor. You hereby agree to indemnify the
+     Initial Developer and every Contributor for any liability incurred by
+     the Initial Developer or such Contributor as a result of any such
+     terms You offer.
+
+     3.7. Larger Works.
+     You may create a Larger Work by combining Covered Code with other code
+     not governed by the terms of this License and distribute the Larger
+     Work as a single product. In such a case, You must make sure the
+     requirements of this License are fulfilled for the Covered Code.
+
+4. Inability to Comply Due to Statute or Regulation.
+
+     If it is impossible for You to comply with any of the terms of this
+     License with respect to some or all of the Covered Code due to
+     statute, judicial order, or regulation then You must: (a) comply with
+     the terms of this License to the maximum extent possible; and (b)
+     describe the limitations and the code they affect. Such description
+     must be included in the LEGAL file described in Section 3.4 and must
+     be included with all distributions of the Source Code. Except to the
+     extent prohibited by statute or regulation, such description must be
+     sufficiently detailed for a recipient of ordinary skill to be able to
+     understand it.
+
+5. Application of this License.
+
+     This License applies to code to which the Initial Developer has
+     attached the notice in Exhibit A and to related Covered Code.
+
+6. Versions of the License.
+
+     6.1. New Versions.
+     Netscape Communications Corporation ("Netscape") may publish revised
+     and/or new versions of the License from time to time. Each version
+     will be given a distinguishing version number.
+
+     6.2. Effect of New Versions.
+     Once Covered Code has been published under a particular version of the
+     License, You may always continue to use it under the terms of that
+     version. You may also choose to use such Covered Code under the terms
+     of any subsequent version of the License published by Netscape. No one
+     other than Netscape has the right to modify the terms applicable to
+     Covered Code created under this License.
+
+     6.3. Derivative Works.
+     If You create or use a modified version of this License (which you may
+     only do in order to apply it to code which is not already Covered Code
+     governed by this License), You must (a) rename Your license so that
+     the phrases "Mozilla", "MOZILLAPL", "MOZPL", "Netscape",
+     "MPL", "NPL" or any confusingly similar phrase do not appear in your
+     license (except to note that your license differs from this License)
+     and (b) otherwise make it clear that Your version of the license
+     contains terms which differ from the Mozilla Public License and
+     Netscape Public License. (Filling in the name of the Initial
+     Developer, Original Code or Contributor in the notice described in
+     Exhibit A shall not of themselves be deemed to be modifications of
+     this License.)
+
+7. DISCLAIMER OF WARRANTY.
+
+     COVERED CODE IS PROVIDED UNDER THIS LICENSE ON AN "AS IS" BASIS,
+     WITHOUT WARRANTY OF ANY KIND, EITHER EXPRESSED OR IMPLIED, INCLUDING,
+     WITHOUT LIMITATION, WARRANTIES THAT THE COVERED CODE IS FREE OF
+     DEFECTS, MERCHANTABLE, FIT FOR A PARTICULAR PURPOSE OR NON-INFRINGING.
+     THE ENTIRE RISK AS TO THE QUALITY AND PERFORMANCE OF THE COVERED CODE
+     IS WITH YOU. SHOULD ANY COVERED CODE PROVE DEFECTIVE IN ANY RESPECT,
+     YOU (NOT THE INITIAL DEVELOPER OR ANY OTHER CONTRIBUTOR) ASSUME THE
+     COST OF ANY NECESSARY SERVICING, REPAIR OR CORRECTION. THIS DISCLAIMER
+     OF WARRANTY CONSTITUTES AN ESSENTIAL PART OF THIS LICENSE. NO USE OF
+     ANY COVERED CODE IS AUTHORIZED HEREUNDER EXCEPT UNDER THIS DISCLAIMER.
+
+8. TERMINATION.
+
+     8.1.  This License and the rights granted hereunder will terminate
+     automatically if You fail to comply with terms herein and fail to cure
+     such breach within 30 days of becoming aware of the breach. All
+     sublicenses to the Covered Code which are properly granted shall
+     survive any termination of this License. Provisions which, by their
+     nature, must remain in effect beyond the termination of this License
+     shall survive.
+
+     8.2.  If You initiate litigation by asserting a patent infringement
+     claim (excluding declatory judgment actions) against Initial Developer
+     or a Contributor (the Initial Developer or Contributor against whom
+     You file such action is referred to as "Participant")  alleging that:
+
+     (a)  such Participant's Contributor Version directly or indirectly
+     infringes any patent, then any and all rights granted by such
+     Participant to You under Sections 2.1 and/or 2.2 of this License
+     shall, upon 60 days notice from Participant terminate prospectively,
+     unless if within 60 days after receipt of notice You either: (i)
+     agree in writing to pay Participant a mutually agreeable reasonable
+     royalty for Your past and future use of Modifications made by such
+     Participant, or (ii) withdraw Your litigation claim with respect to
+     the Contributor Version against such Participant.  If within 60 days
+     of notice, a reasonable royalty and payment arrangement are not
+     mutually agreed upon in writing by the parties or the litigation claim
+     is not withdrawn, the rights granted by Participant to You under
+     Sections 2.1 and/or 2.2 automatically terminate at the expiration of
+     the 60 day notice period specified above.
+
+     (b)  any software, hardware, or device, other than such Participant's
+     Contributor Version, directly or indirectly infringes any patent, then
+     any rights granted to You by such Participant under Sections 2.1(b)
+     and 2.2(b) are revoked effective as of the date You first made, used,
+     sold, distributed, or had made, Modifications made by that
+     Participant.
+
+     8.3.  If You assert a patent infringement claim against Participant
+     alleging that such Participant's Contributor Version directly or
+     indirectly infringes any patent where such claim is resolved (such as
+     by license or settlement) prior to the initiation of patent
+     infringement litigation, then the reasonable value of the licenses
+     granted by such Participant under Sections 2.1 or 2.2 shall be taken
+     into account in determining the amount or value of any payment or
+     license.
+
+     8.4.  In the event of termination under Sections 8.1 or 8.2 above,
+     all end user license agreements (excluding distributors and resellers)
+     which have been validly granted by You or any distributor hereunder
+     prior to termination shall survive termination.
+
+9. LIMITATION OF LIABILITY.
+
+     UNDER NO CIRCUMSTANCES AND UNDER NO LEGAL THEORY, WHETHER TORT
+     (INCLUDING NEGLIGENCE), CONTRACT, OR OTHERWISE, SHALL YOU, THE INITIAL
+     DEVELOPER, ANY OTHER CONTRIBUTOR, OR ANY DISTRIBUTOR OF COVERED CODE,
+     OR ANY SUPPLIER OF ANY OF SUCH PARTIES, BE LIABLE TO ANY PERSON FOR
+     ANY INDIRECT, SPECIAL, INCIDENTAL, OR CONSEQUENTIAL DAMAGES OF ANY
+     CHARACTER INCLUDING, WITHOUT LIMITATION, DAMAGES FOR LOSS OF GOODWILL,
+     WORK STOPPAGE, COMPUTER FAILURE OR MALFUNCTION, OR ANY AND ALL OTHER
+     COMMERCIAL DAMAGES OR LOSSES, EVEN IF SUCH PARTY SHALL HAVE BEEN
+     INFORMED OF THE POSSIBILITY OF SUCH DAMAGES. THIS LIMITATION OF
+     LIABILITY SHALL NOT APPLY TO LIABILITY FOR DEATH OR PERSONAL INJURY
+     RESULTING FROM SUCH PARTY'S NEGLIGENCE TO THE EXTENT APPLICABLE LAW
+     PROHIBITS SUCH LIMITATION. SOME JURISDICTIONS DO NOT ALLOW THE
+     EXCLUSION OR LIMITATION OF INCIDENTAL OR CONSEQUENTIAL DAMAGES, SO
+     THIS EXCLUSION AND LIMITATION MAY NOT APPLY TO YOU.
+
+10. U.S. GOVERNMENT END USERS.
+
+     The Covered Code is a "commercial item," as that term is defined in
+     48 C.F.R. 2.101 (Oct. 1995), consisting of "commercial computer
+     software" and "commercial computer software documentation," as such
+     terms are used in 48 C.F.R. 12.212 (Sept. 1995). Consistent with 48
+     C.F.R. 12.212 and 48 C.F.R. 227.7202-1 through 227.7202-4 (June 1995),
+     all U.S. Government End Users acquire Covered Code with only those
+     rights set forth herein.
+
+11. MISCELLANEOUS.
+
+     This License represents the complete agreement concerning subject
+     matter hereof. If any provision of this License is held to be
+     unenforceable, such provision shall be reformed only to the extent
+     necessary to make it enforceable. This License shall be governed by
+     California law provisions (except to the extent applicable law, if
+     any, provides otherwise), excluding its conflict-of-law provisions.
+     With respect to disputes in which at least one party is a citizen of,
+     or an entity chartered or registered to do business in the United
+     States of America, any litigation relating to this License shall be
+     subject to the jurisdiction of the Federal Courts of the Northern
+     District of California, with venue lying in Santa Clara County,
+     California, with the losing party responsible for costs, including
+     without limitation, court costs and reasonable attorneys' fees and
+     expenses. The application of the United Nations Convention on
+     Contracts for the International Sale of Goods is expressly excluded.
+     Any law or regulation which provides that the language of a contract
+     shall be construed against the drafter shall not apply to this
+     License.
+
+12. RESPONSIBILITY FOR CLAIMS.
+
+     As between Initial Developer and the Contributors, each party is
+     responsible for claims and damages arising, directly or indirectly,
+     out of its utilization of rights under this License and You agree to
+     work with Initial Developer and Contributors to distribute such
+     responsibility on an equitable basis. Nothing herein is intended or
+     shall be deemed to constitute any admission of liability.
+
+13. MULTIPLE-LICENSED CODE.
+
+     Initial Developer may designate portions of the Covered Code as
+     "Multiple-Licensed".  "Multiple-Licensed" means that the Initial
+     Developer permits you to utilize portions of the Covered Code under
+     Your choice of the NPL or the alternative licenses, if any, specified
+     by the Initial Developer in the file described in Exhibit A.
+
+EXHIBIT A -Mozilla Public License.
+
+     ``The contents of this file are subject to the Mozilla Public License
+     Version 1.1 (the "License"); you may not use this file except in
+     compliance with the License. You may obtain a copy of the License at
+     http://www.mozilla.org/MPL/
+
+     Software distributed under the License is distributed on an "AS IS"
+     basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See the
+     License for the specific language governing rights and limitations
+     under the License.
+
+     The Original Code is ______________________________________.
+
+     The Initial Developer of the Original Code is ________________________.
+     Portions created by ______________________ are Copyright (C) ______
+     _______________________. All Rights Reserved.
+
+     Contributor(s): ______________________________________.
+
+     Alternatively, the contents of this file may be used under the terms
+     of the _____ license (the  "[___] License"), in which case the
+     provisions of [______] License are applicable instead of those
+     above.  If you wish to allow use of your version of this file only
+     under the terms of the [____] License and not to allow others to use
+     your version of this file under the MPL, indicate your decision by
+     deleting  the provisions above and replace  them with the notice and
+     other provisions required by the [___] License.  If you do not delete
+     the provisions above, a recipient may use your version of this file
+     under either the MPL or the [___] License."
+
+     [NOTE: The text of this Exhibit A may differ slightly from the text of
+     the notices in the Source Code files of the Original Code. You should
+     use the text of this Exhibit A rather than the text found in the
+     Original Code Source Code for Your Modifications.]
+
+     ----------------------------------------------------------------------
+
+     AMENDMENTS
+
+     The Netscape Public License Version 1.1 ("NPL") consists of the
+     Mozilla Public License Version 1.1 with the following Amendments,
+     including Exhibit A-Netscape Public License.  Files identified with
+     "Exhibit A-Netscape Public License" are governed by the Netscape
+     Public License Version 1.1.
+
+     Additional Terms applicable to the Netscape Public License.
+          I. Effect.
+          These additional terms described in this Netscape Public
+          License -- Amendments shall apply to the Mozilla Communicator
+          client code and to all Covered Code under this License.
+
+          II. "Netscape's Branded Code" means Covered Code that Netscape
+          distributes and/or permits others to distribute under one or more
+          trademark(s) which are controlled by Netscape but which are not
+          licensed for use under this License.
+
+          III. Netscape and logo.
+          This License does not grant any rights to use the trademarks
+          "Netscape", the "Netscape N and horizon" logo or the "Netscape
+          lighthouse" logo, "Netcenter", "Gecko", "Java" or "JavaScript",
+          "Smart Browsing" even if such marks are included in the Original
+          Code or Modifications.
+
+          IV. Inability to Comply Due to Contractual Obligation.
+          Prior to licensing the Original Code under this License, Netscape
+          has licensed third party code for use in Netscape's Branded Code.
+          To the extent that Netscape is limited contractually from making
+          such third party code available under this License, Netscape may
+          choose to reintegrate such code into Covered Code without being
+          required to distribute such code in Source Code form, even if
+          such code would otherwise be considered "Modifications" under
+          this License.
+
+          V. Use of Modifications and Covered Code by Initial Developer.
+               V.1. In General.
+               The obligations of Section 3 apply to Netscape, except to
+               the extent specified in this Amendment, Section V.2 and V.3.
+
+               V.2. Other Products.
+               Netscape may include Covered Code in products other than the
+               Netscape's Branded Code which are released by Netscape
+               during the two (2) years following the release date of the
+               Original Code, without such additional products becoming
+               subject to the terms of this License, and may license such
+               additional products on different terms from those contained
+               in this License.
+
+               V.3. Alternative Licensing.
+               Netscape may license the Source Code of Netscape's Branded
+               Code, including Modifications incorporated therein, without
+               such Netscape Branded Code becoming subject to the terms of
+               this License, and may license such Netscape Branded Code on
+               different terms from those contained in this License.
+
+          VI. Litigation.
+          Notwithstanding the limitations of Section 11 above, the
+          provisions regarding litigation in Section 11(a), (b) and (c) of
+          the License shall apply to all disputes relating to this License.
+
+     EXHIBIT A-Netscape Public License.
+
+          "The contents of this file are subject to the Netscape Public
+          License Version 1.1 (the "License"); you may not use this file
+          except in compliance with the License. You may obtain a copy of
+          the License at http://www.mozilla.org/NPL/
+
+          Software distributed under the License is distributed on an "AS
+          IS" basis, WITHOUT WARRANTY OF ANY KIND, either express or
+          implied. See the License for the specific language governing
+          rights and limitations under the License.
+
+          The Original Code is Mozilla Communicator client code, released
+          March 31, 1998.
+
+          The Initial Developer of the Original Code is Netscape
+          Communications Corporation. Portions created by Netscape are
+          Copyright (C) 1998-1999 Netscape Communications Corporation. All
+          Rights Reserved.
+
+          Contributor(s): ______________________________________.
+
+          Alternatively, the contents of this file may be used under the
+          terms of the _____ license (the "[___] License"), in which case
+          the provisions of [______] License are applicable  instead of
+          those above.  If you wish to allow use of your version of this
+          file only under the terms of the [____] License and not to allow
+          others to use your version of this file under the NPL, indicate
+          your decision by deleting  the provisions above and replace  them
+          with the notice and other provisions required by the [___]
+          License.  If you do not delete the provisions above, a recipient
+          may use your version of this file under either the NPL or the
+          [___] License."

mozilla/Makefile.in

@@ -0,0 +1,165 @@
+#
+# The contents of this file are subject to the Netscape Public
+# License Version 1.1 (the "License"); you may not use this file
+# except in compliance with the License. You may obtain a copy of
+# the License at http://www.mozilla.org/NPL/
+#
+# Software distributed under the License is distributed on an "AS
+# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express or
+# implied. See the License for the specific language governing
+# rights and limitations under the License.
+#
+# The Original Code is mozilla.org code.
+#
+# The Initial Developer of the Original Code is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation. All
+# Rights Reserved.
+#
+# Contributor(s): 
+#
+
+DEPTH		= .
+topsrcdir	= @top_srcdir@
+srcdir		= @srcdir@
+VPATH		= @srcdir@
+
+include $(DEPTH)/config/autoconf.mk
+
+include $(topsrcdir)/build/unix/modules.mk
+
+ifneq ($(BUILD_MODULES),all)
+
+DIRS		= $(BUILD_MODULE_DIRS)
+
+ifdef USE_ELF_DYNSTR_GC
+DIRS		+= tools/elf-dynstr-gc
+endif
+
+else
+
+DIRS		= config build
+
+ifdef USE_ELF_DYNSTR_GC
+DIRS		+= tools/elf-dynstr-gc
+endif
+
+ifdef MOZ_L10N
+DIRS        += l10n
+endif
+
+ifdef MOZ_JAVA_SUPPLEMENT
+DIRS += 			\
+  java/util			\
+  java/webclient		\
+  $(NULL)
+endif
+
+# boehm needs to be built before XPCOM
+ifdef GC_LEAK_DETECTOR
+DIRS += gc/boehm
+endif
+
+DIRS	+= $(NSPRPUB_DIR)
+
+DIRS		+= dbm modules/libreg js xpcom js/src/xpconnect
+
+ifdef MOZ_OJI
+DIRS		+= js/src/liveconnect
+endif
+
+ifndef MOZ_NATIVE_ZLIB
+DIRS		+= modules/zlib
+endif
+
+ifndef MOZ_NATIVE_JPEG
+DIRS		+= jpeg
+endif
+
+ifdef MOZ_ENABLE_GTK
+DIRS           += widget/src/gtksuperwin widget/src/gtkxtbin
+endif
+
+# Linux and Solaris installer needs standalone libjar, hence standalone zlib
+ifneq (,$(filter Linux SunOS,$(OS_ARCH)))
+DIRS		+= modules/zlib/standalone
+endif
+
+DIRS		+= \
+		widget/timer \
+		include \
+		modules/libutil \
+		netwerk \
+		modules/appfilelocprovider \
+		security \
+		uriloader \
+		intl \
+		modules/libpref \
+		modules/libimg \
+		modules/oji \
+		modules/libjar \
+		caps \
+		expat \
+		htmlparser \
+		gfx \
+		modules/plugin \
+		dom \
+		view \
+		widget \
+		layout \
+		db \
+		rdf \
+		docshell \
+		webshell \
+		embedding \
+		editor \
+		sun-java \
+		profile \
+		themes \
+		$(NULL)
+
+# This must preceed xpfe
+ifdef MOZ_JPROF
+DIRS        += tools/jprof
+endif
+
+ifdef MOZ_BUILD_XPFE
+DIRS		+= xpfe
+endif
+
+DIRS		+= xpinstall
+
+ifdef MOZ_EXTENSIONS
+DIRS		+= extensions
+endif
+
+ifdef MOZ_MAIL_NEWS
+DIRS		+= mailnews
+endif
+
+ifdef MOZ_LEAKY
+DIRS        += tools/leaky
+endif
+
+ifdef ENABLE_TESTS
+DIRS		+= xpcom/tests
+endif
+
+ifdef MOZ_LDAP_XPCOM
+DIRS	+=	directory/c-sdk/ldap directory/xpcom
+endif
+
+DIRS	+= l10n
+
+endif # BUILD_MODULES == all
+
+STATIC_MAKEFILES := $(NSPRPUB_DIR)
+
+GARBAGE_DIRS += dist
+DIST_GARBAGE = config.cache config.log config.status config-defs.h \
+   dependencies.beos config/autoconf.mk config/myrules.mk config/myconfig.mk \
+   $(shell cat unallmakefiles) unallmakefiles \
+   $(topsrcdir)/.mozconfig.mk $(topsrcdir)/.mozconfig.out 
+
+include $(topsrcdir)/config/rules.mk
+

mozilla/README/mozilla/README.build

@@ -0,0 +1,4 @@
+For mozilla-the-client build instructions, please read:
+http://www.mozilla.org/build
+
+

mozilla/aclocal.m4

@@ -0,0 +1,12 @@
+dnl
+dnl Local autoconf macros used with mozilla
+dnl The contents of this file are under the Public Domain.
+dnl 
+
+builtin(include, build/autoconf/glib.m4)dnl
+builtin(include, build/autoconf/gtk.m4)dnl
+builtin(include, build/autoconf/libIDL.m4)dnl
+dnl
+define(MOZ_TOPSRCDIR,.)dnl MOZ_TOPSRCDIR is used in altoptions.m4
+builtin(include, build/autoconf/altoptions.m4)dnl
+

mozilla/allmakefiles.sh

@@ -0,0 +1,998 @@
+#! /bin/sh
+#
+# The contents of this file are subject to the Netscape Public
+# License Version 1.1 (the "License"); you may not use this file
+# except in compliance with the License. You may obtain a copy of
+# the License at http://www.mozilla.org/NPL/
+#
+# Software distributed under the License is distributed on an "AS
+# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express or
+# implied. See the License for the specific language governing
+# rights and limitations under the License.
+#
+# The Original Code is mozilla.org code.
+#
+# The Initial Developer of the Original Code is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1999 Netscape Communications Corporation. All
+# Rights Reserved.
+#
+# Contributor(s): 
+#
+
+# allmakefiles.sh - List of all makefiles. 
+#   Appends the list of makefiles to the variable, MAKEFILES.
+#   There is no need to rerun autoconf after adding makefiles.
+#   You only need to run configure.
+#
+#   Please keep the modules in this file in sync with those in
+#   mozilla/build/unix/modules.mk
+#
+
+MAKEFILES=""
+
+# add_makefiles - Shell function to add makefiles to MAKEFILES
+add_makefiles() {
+    MAKEFILES="$MAKEFILES $*"
+}
+
+if [ "$srcdir" = "" ]; then
+    srcdir=.
+fi
+
+#
+# Common makefiles used by everyone
+#
+add_makefiles "
+Makefile
+build/Makefile
+build/unix/Makefile
+build/unix/mozilla-config
+build/unix/nspr_my_config.mk
+build/unix/nspr_my_overrides.mk
+config/Makefile
+config/autoconf.mk
+config/mkdepend/Makefile
+config/mkdetect/Makefile
+include/Makefile
+tools/elf-dynstr-gc/Makefile
+"
+
+MAKEFILES_db="
+db/Makefile
+db/mdb/Makefile
+db/mdb/public/Makefile
+db/mork/Makefile
+db/mork/build/Makefile
+db/mork/src/Makefile
+"
+
+MAKEFILES_dbm="
+dbm/Makefile
+dbm/include/Makefile
+dbm/src/Makefile
+dbm/tests/Makefile
+"
+
+MAKEFILES_dom="
+dom/Makefile
+dom/public/Makefile
+dom/public/base/Makefile
+dom/public/coreDom/Makefile
+dom/public/coreEvents/Makefile
+dom/public/css/Makefile
+dom/public/events/Makefile
+dom/public/range/Makefile
+dom/public/html/Makefile
+dom/public/idl/Makefile
+dom/public/idl/base/Makefile
+dom/public/idl/coreDom/Makefile
+dom/public/idl/css/Makefile
+dom/public/idl/events/Makefile
+dom/public/idl/html/Makefile
+dom/public/idl/range/Makefile
+dom/src/Makefile
+dom/src/base/Makefile
+dom/src/build/Makefile
+dom/src/coreDOM/Makefile
+dom/src/css/Makefile
+dom/src/events/Makefile
+dom/src/range/Makefile
+dom/src/html/Makefile
+dom/src/jsurl/Makefile
+dom/tools/Makefile
+"
+
+MAKEFILES_editor="
+editor/Makefile
+editor/base/Makefile
+editor/public/Makefile
+editor/idl/Makefile
+editor/txmgr/Makefile
+editor/txmgr/idl/Makefile
+editor/txmgr/public/Makefile
+editor/txmgr/src/Makefile
+editor/txmgr/tests/Makefile
+editor/txtsvc/Makefile
+editor/txtsvc/public/Makefile
+editor/txtsvc/src/Makefile
+editor/ui/Makefile
+editor/ui/composer/Makefile
+editor/ui/composer/content/Makefile
+editor/ui/composer/content/images/Makefile
+editor/ui/composer/locale/Makefile
+editor/ui/composer/locale/en-US/Makefile
+editor/ui/dialogs/Makefile
+editor/ui/dialogs/content/Makefile
+editor/ui/dialogs/locale/Makefile
+editor/ui/dialogs/locale/en-US/Makefile
+"
+
+MAKEFILES_expat="
+expat/Makefile
+expat/xmlparse/Makefile
+expat/xmltok/Makefile
+"
+
+MAKEFILES_extensions="
+extensions/Makefile
+"
+
+MAKEFILES_gfx="
+gfx/Makefile
+gfx/idl/Makefile
+gfx/public/Makefile
+gfx/src/Makefile
+gfx/src/beos/Makefile
+gfx/src/gtk/Makefile
+gfx/src/ps/Makefile
+gfx/src/motif/Makefile
+gfx/src/photon/Makefile
+gfx/src/rhapsody/Makefile
+gfx/src/mac/Makefile
+gfx/src/qt/Makefile
+gfx/src/xlib/Makefile
+gfx/src/os2/Makefile
+gfx/src/xlibrgb/Makefile
+gfx/tests/Makefile
+"
+
+MAKEFILES_htmlparser="
+htmlparser/Makefile
+htmlparser/robot/Makefile
+htmlparser/robot/test/Makefile
+htmlparser/src/Makefile
+htmlparser/tests/Makefile
+htmlparser/tests/grabpage/Makefile
+htmlparser/tests/logparse/Makefile
+htmlparser/tests/outsinks/Makefile
+"
+
+MAKEFILES_intl="
+intl/Makefile
+intl/chardet/Makefile
+intl/chardet/public/Makefile
+intl/chardet/src/Makefile
+intl/uconv/Makefile
+intl/uconv/idl/Makefile
+intl/uconv/public/Makefile
+intl/uconv/src/Makefile
+intl/uconv/tests/Makefile
+intl/uconv/ucvja/Makefile
+intl/uconv/ucvlatin/Makefile
+intl/uconv/ucvcn/Makefile
+intl/uconv/ucvtw/Makefile
+intl/uconv/ucvtw2/Makefile
+intl/uconv/ucvko/Makefile
+intl/uconv/ucvibm/Makefile
+intl/locale/Makefile
+intl/locale/public/Makefile
+intl/locale/idl/Makefile
+intl/locale/src/Makefile
+intl/locale/src/unix/Makefile
+intl/locale/src/os2/Makefile
+intl/locale/tests/Makefile
+intl/lwbrk/Makefile
+intl/lwbrk/src/Makefile
+intl/lwbrk/public/Makefile
+intl/lwbrk/tests/Makefile
+intl/unicharutil/Makefile
+intl/unicharutil/idl/Makefile
+intl/unicharutil/src/Makefile
+intl/unicharutil/public/Makefile
+intl/unicharutil/tables/Makefile
+intl/unicharutil/tests/Makefile
+intl/unicharutil/tools/Makefile
+intl/strres/Makefile
+intl/strres/public/Makefile
+intl/strres/src/Makefile
+intl/strres/tests/Makefile
+"
+
+MAKEFILES_js="
+js/Makefile
+js/src/Makefile
+js/src/fdlibm/Makefile
+"
+
+MAKEFILES_liveconnect="
+js/src/liveconnect/Makefile
+js/src/liveconnect/classes/Makefile
+"
+
+MAKEFILES_xpconnect="
+js/src/xpconnect/Makefile
+js/src/xpconnect/public/Makefile
+js/src/xpconnect/idl/Makefile
+js/src/xpconnect/shell/Makefile
+js/src/xpconnect/src/Makefile
+js/src/xpconnect/loader/Makefile
+js/src/xpconnect/tests/Makefile
+js/src/xpconnect/tests/components/Makefile
+js/src/xpconnect/tests/idl/Makefile
+js/src/xpconnect/shell/Makefile
+js/src/xpconnect/tools/Makefile
+js/src/xpconnect/tools/idl/Makefile
+js/src/xpconnect/tools/idl/Makefile
+"
+
+MAKEFILES_layout="
+layout/Makefile
+layout/base/Makefile
+layout/base/public/Makefile
+layout/base/src/Makefile
+layout/base/tests/Makefile
+layout/build/Makefile
+layout/events/Makefile
+layout/events/public/Makefile
+layout/events/src/Makefile
+layout/html/Makefile
+layout/html/base/Makefile
+layout/html/base/src/Makefile
+layout/html/content/Makefile
+layout/html/content/public/Makefile
+layout/html/content/src/Makefile
+layout/html/document/Makefile
+layout/html/document/public/Makefile
+layout/html/document/src/Makefile
+layout/html/forms/Makefile
+layout/html/forms/public/Makefile
+layout/html/forms/src/Makefile
+layout/html/style/Makefile
+layout/html/style/public/Makefile
+layout/html/style/src/Makefile
+layout/html/table/Makefile
+layout/html/table/public/Makefile
+layout/html/table/src/Makefile
+layout/html/tests/Makefile
+layout/tools/Makefile
+layout/xml/Makefile
+layout/xml/content/Makefile
+layout/xml/content/public/Makefile
+layout/xml/content/src/Makefile
+layout/xml/document/Makefile
+layout/xml/document/public/Makefile
+layout/xml/document/src/Makefile
+layout/xul/Makefile
+layout/xul/base/Makefile
+layout/xul/base/public/Makefile
+layout/xul/base/src/Makefile
+layout/xul/content/Makefile
+layout/xul/content/src/Makefile
+layout/xbl/Makefile
+layout/xbl/public/Makefile
+layout/xbl/src/Makefile
+"
+
+MAKEFILES_libimg="
+modules/libimg/Makefile
+modules/libimg/public/Makefile
+modules/libimg/public_com/Makefile
+modules/libimg/src/Makefile
+modules/libimg/gifcom/Makefile
+modules/libimg/jpgcom/Makefile
+modules/libimg/pngcom/Makefile  
+"
+
+MAKEFILES_libjar="
+modules/libjar/Makefile
+"
+
+MAKEFILES_libreg="
+modules/libreg/Makefile
+modules/libreg/include/Makefile
+modules/libreg/src/Makefile
+"
+
+MAKEFILES_libpref="
+modules/libpref/Makefile
+modules/libpref/public/Makefile
+modules/libpref/src/Makefile
+"
+
+MAKEFILES_libutil="
+modules/libutil/Makefile
+modules/libutil/public/Makefile
+modules/libutil/src/Makefile
+"
+
+MAKEFILES_oji="
+modules/oji/Makefile
+modules/oji/public/Makefile
+modules/oji/src/Makefile
+"
+
+MAKEFILES_plugin="
+modules/plugin/Makefile
+modules/plugin/nglsrc/Makefile
+modules/plugin/public/Makefile
+modules/plugin/src/Makefile
+modules/plugin/test/Makefile
+modules/plugin/SanePlugin/Makefile
+"
+
+MAKEFILES_netwerk="
+netwerk/Makefile
+netwerk/base/Makefile
+netwerk/base/public/Makefile
+netwerk/base/src/Makefile
+netwerk/build/Makefile
+netwerk/cache/build/Makefile
+netwerk/cache/filecache/Makefile
+netwerk/cache/Makefile
+netwerk/cache/memcache/Makefile
+netwerk/cache/mgr/Makefile
+netwerk/cache/public/Makefile
+netwerk/dns/Makefile
+netwerk/dns/public/Makefile
+netwerk/dns/src/Makefile
+netwerk/protocol/Makefile
+netwerk/protocol/about/Makefile
+netwerk/protocol/about/public/Makefile
+netwerk/protocol/about/src/Makefile
+netwerk/protocol/data/Makefile
+netwerk/protocol/data/public/Makefile
+netwerk/protocol/data/src/Makefile
+netwerk/protocol/datetime/src/Makefile
+netwerk/protocol/datetime/Makefile
+netwerk/protocol/file/Makefile
+netwerk/protocol/file/public/Makefile
+netwerk/protocol/file/src/Makefile
+netwerk/protocol/finger/Makefile
+netwerk/protocol/finger/src/Makefile
+netwerk/protocol/ftp/Makefile
+netwerk/protocol/ftp/public/Makefile
+netwerk/protocol/ftp/src/Makefile
+netwerk/protocol/http/Makefile
+netwerk/protocol/http/public/Makefile
+netwerk/protocol/http/src/Makefile
+netwerk/protocol/jar/Makefile
+netwerk/protocol/jar/public/Makefile
+netwerk/protocol/jar/src/Makefile
+netwerk/protocol/keyword/Makefile
+netwerk/protocol/keyword/src/Makefile
+netwerk/protocol/res/Makefile
+netwerk/protocol/res/public/Makefile
+netwerk/protocol/res/src/Makefile
+netwerk/mime/Makefile
+netwerk/mime/public/Makefile
+netwerk/mime/src/Makefile
+netwerk/socket/Makefile
+netwerk/socket/base/Makefile
+netwerk/streamconv/Makefile
+netwerk/streamconv/converters/Makefile
+netwerk/streamconv/public/Makefile
+netwerk/streamconv/src/Makefile
+netwerk/streamconv/test/Makefile
+netwerk/test/Makefile
+netwerk/testserver/Makefile
+"
+
+MAKEFILES_uriloader="
+uriloader/Makefile
+uriloader/base/Makefile
+uriloader/build/Makefile
+uriloader/extprotocol/Makefile
+uriloader/extprotocol/base/Makefile
+uriloader/extprotocol/unix/Makefile
+uriloader/exthandler/Makefile
+"
+
+MAKEFILES_profile="
+profile/Makefile
+profile/src/Makefile
+profile/public/Makefile
+profile/resources/Makefile
+profile/resources/content/Makefile
+profile/resources/locale/Makefile
+profile/resources/locale/en-US/Makefile
+profile/pref-migrator/Makefile
+profile/pref-migrator/public/Makefile
+profile/pref-migrator/src/Makefile
+profile/pref-migrator/resources/Makefile
+profile/pref-migrator/resources/content/Makefile
+profile/pref-migrator/resources/locale/Makefile
+profile/pref-migrator/resources/locale/en-US/Makefile
+profile/defaults/Makefile
+"
+
+MAKEFILES_rdf="
+rdf/Makefile
+rdf/base/Makefile
+rdf/base/idl/Makefile
+rdf/base/public/Makefile
+rdf/base/src/Makefile
+rdf/chrome/Makefile
+rdf/chrome/build/Makefile
+rdf/chrome/public/Makefile
+rdf/chrome/src/Makefile
+rdf/util/Makefile
+rdf/util/public/Makefile
+rdf/util/src/Makefile
+rdf/resources/Makefile
+rdf/build/Makefile
+rdf/content/Makefile
+rdf/content/public/Makefile
+rdf/content/public/idl/Makefile
+rdf/content/src/Makefile
+rdf/datasource/Makefile
+rdf/datasource/public/Makefile
+rdf/datasource/src/Makefile
+rdf/tests/Makefile
+rdf/tests/domds/Makefile
+rdf/tests/domds/resources/Makefile
+rdf/tests/localfile/Makefile
+rdf/tests/rdfsink/Makefile
+rdf/tests/rdfcat/Makefile
+rdf/tests/rdfpoll/Makefile
+"
+
+MAKEFILES_sun_java="
+sun-java/Makefile
+sun-java/stubs/Makefile
+sun-java/stubs/include/Makefile
+sun-java/stubs/jri/Makefile
+sun-java/stubs/src/Makefile
+"
+
+MAKEFILES_caps="
+caps/Makefile
+caps/idl/Makefile
+caps/include/Makefile
+caps/src/Makefile
+"
+
+MAKEFILES_view="
+view/Makefile
+view/public/Makefile
+view/src/Makefile
+"
+
+MAKEFILES_docshell="
+docshell/Makefile
+docshell/base/Makefile
+docshell/build/Makefile
+"
+
+MAKEFILES_webshell="
+webshell/Makefile
+webshell/public/Makefile
+webshell/src/Makefile
+webshell/tests/Makefile
+webshell/tests/viewer/Makefile
+webshell/tests/viewer/public/Makefile
+webshell/tests/viewer/unix/Makefile
+webshell/tests/viewer/unix/gtk/Makefile
+webshell/tests/viewer/unix/motif/Makefile
+webshell/tests/viewer/unix/qt/Makefile
+webshell/tests/viewer/unix/xlib/Makefile
+webshell/embed/Makefile
+"
+
+MAKEFILES_widget="
+widget/Makefile
+widget/public/Makefile
+widget/src/Makefile
+widget/src/beos/Makefile
+widget/src/build/Makefile
+widget/src/gtk/Makefile
+widget/src/gtksuperwin/Makefile
+widget/src/gtkxtbin/Makefile
+widget/src/motif/Makefile
+widget/src/motif/app_context/Makefile
+widget/src/photon/Makefile
+widget/src/rhapsody/Makefile
+widget/src/mac/Makefile
+widget/src/xlib/Makefile
+widget/src/os2/Makefile
+widget/src/os2/res/Makefile
+widget/src/os2/tests/Makefile
+widget/src/qt/Makefile
+widget/src/xlib/window_service/Makefile
+widget/src/xpwidgets/Makefile
+widget/src/support/Makefile
+widget/tests/Makefile
+widget/tests/scribble/Makefile
+widget/tests/widget/Makefile
+widget/timer/Makefile
+widget/timer/public/Makefile
+widget/timer/src/Makefile
+widget/timer/src/beos/Makefile
+widget/timer/src/rhapsody/Makefile
+widget/timer/src/unix/Makefile
+widget/timer/src/unix/gtk/Makefile
+widget/timer/src/unix/motif/Makefile
+widget/timer/src/unix/photon/Makefile
+widget/timer/src/unix/xlib/Makefile
+widget/timer/src/unix/qt/Makefile
+"
+
+MAKEFILES_xpcom="
+xpcom/Makefile
+xpcom/base/Makefile
+xpcom/build/Makefile
+xpcom/components/Makefile
+xpcom/ds/Makefile
+xpcom/io/Makefile
+xpcom/typelib/Makefile
+xpcom/reflect/Makefile
+xpcom/typelib/xpt/Makefile
+xpcom/typelib/xpt/public/Makefile
+xpcom/typelib/xpt/src/Makefile
+xpcom/typelib/xpt/tests/Makefile
+xpcom/typelib/xpt/tools/Makefile
+xpcom/typelib/xpidl/Makefile
+xpcom/reflect/xptcall/Makefile
+xpcom/reflect/xptcall/public/Makefile
+xpcom/reflect/xptcall/src/Makefile
+xpcom/reflect/xptcall/src/md/Makefile
+xpcom/reflect/xptcall/src/md/os2/Makefile
+xpcom/reflect/xptcall/src/md/test/Makefile
+xpcom/reflect/xptcall/src/md/unix/Makefile
+xpcom/reflect/xptcall/tests/Makefile
+xpcom/reflect/xptinfo/Makefile
+xpcom/reflect/xptinfo/public/Makefile
+xpcom/reflect/xptinfo/src/Makefile
+xpcom/reflect/xptinfo/tests/Makefile
+xpcom/proxy/Makefile
+xpcom/proxy/public/Makefile
+xpcom/proxy/src/Makefile
+xpcom/proxy/tests/Makefile
+xpcom/sample/Makefile
+xpcom/tests/Makefile
+xpcom/tests/dynamic/Makefile
+xpcom/tests/services/Makefile
+xpcom/threads/Makefile
+xpcom/tools/Makefile
+xpcom/tools/registry/Makefile
+"
+
+MAKEFILES_xpinstall="
+xpinstall/Makefile
+xpinstall/packager/Makefile
+xpinstall/public/Makefile
+xpinstall/res/Makefile
+xpinstall/res/content/Makefile
+xpinstall/res/locale/Makefile
+xpinstall/res/locale/en-US/Makefile
+xpinstall/src/Makefile
+xpinstall/stub/Makefile
+xpinstall/wizard/unix/src2/Makefile
+"
+
+MAKEFILES_xpfe="
+xpfe/Makefile
+xpfe/browser/Makefile
+xpfe/browser/public/Makefile
+xpfe/browser/src/Makefile
+xpfe/browser/samples/Makefile
+xpfe/browser/samples/sampleimages/Makefile
+xpfe/components/Makefile
+xpfe/components/public/Makefile
+xpfe/components/sample/Makefile
+xpfe/components/sample/public/Makefile
+xpfe/components/sample/src/Makefile
+xpfe/components/sample/resources/Makefile
+xpfe/components/shistory/Makefile
+xpfe/components/shistory/public/Makefile
+xpfe/components/shistory/src/Makefile
+xpfe/components/bookmarks/Makefile
+xpfe/components/bookmarks/public/Makefile
+xpfe/components/bookmarks/src/Makefile
+xpfe/components/bookmarks/resources/Makefile
+xpfe/components/directory/Makefile
+xpfe/components/timebomb/Makefile
+xpfe/components/timebomb/tools/Makefile
+xpfe/components/timebomb/resources/Makefile
+xpfe/components/timebomb/resources/content/Makefile
+xpfe/components/timebomb/resources/locale/Makefile
+xpfe/components/timebomb/resources/locale/en-US/Makefile
+xpfe/components/regviewer/Makefile
+xpfe/components/find/Makefile
+xpfe/components/find/public/Makefile
+xpfe/components/find/src/Makefile
+xpfe/components/find/resources/Makefile
+xpfe/components/filepicker/src/Makefile
+xpfe/components/filepicker/res/content/Makefile
+xpfe/components/filepicker/res/locale/Makefile
+xpfe/components/filepicker/res/locale/en-US/Makefile
+xpfe/components/filepicker/res/Makefile
+xpfe/components/filepicker/Makefile
+xpfe/components/history/Makefile
+xpfe/components/history/src/Makefile
+xpfe/components/history/public/Makefile
+xpfe/components/history/resources/Makefile
+xpfe/components/prefwindow/Makefile
+xpfe/components/prefwindow/resources/Makefile
+xpfe/components/prefwindow/resources/content/Makefile
+xpfe/components/prefwindow/resources/content/unix/Makefile
+xpfe/components/prefwindow/resources/locale/Makefile
+xpfe/components/prefwindow/resources/locale/en-US/Makefile
+xpfe/components/prefwindow/resources/locale/en-US/unix/Makefile
+xpfe/components/related/Makefile
+xpfe/components/related/src/Makefile
+xpfe/components/related/public/Makefile
+xpfe/components/related/resources/Makefile
+xpfe/components/search/Makefile
+xpfe/components/search/datasets/Makefile
+xpfe/components/search/resources/Makefile
+xpfe/components/search/public/Makefile
+xpfe/components/search/src/Makefile
+xpfe/components/sidebar/Makefile
+xpfe/components/sidebar/public/Makefile
+xpfe/components/sidebar/resources/Makefile
+xpfe/components/sidebar/src/Makefile
+xpfe/components/xfer/Makefile
+xpfe/components/xfer/public/Makefile
+xpfe/components/xfer/src/Makefile
+xpfe/components/xfer/resources/Makefile
+xpfe/components/ucth/Makefile
+xpfe/components/ucth/public/Makefile
+xpfe/components/ucth/src/Makefile
+xpfe/components/ucth/resources/Makefile
+xpfe/components/remote/Makefile
+xpfe/components/remote/public/Makefile
+xpfe/components/remote/src/Makefile
+xpfe/components/autocomplete/Makefile
+xpfe/components/autocomplete/public/Makefile
+xpfe/components/autocomplete/resources/Makefile
+xpfe/components/autocomplete/resources/content/Makefile
+xpfe/components/autocomplete/src/Makefile
+xpfe/components/console/Makefile
+xpfe/components/console/resources/Makefile
+xpfe/components/console/resources/content/Makefile
+xpfe/components/console/resources/locale/Makefile
+xpfe/components/console/resources/locale/en-US/Makefile
+xpfe/appshell/Makefile
+xpfe/appshell/src/Makefile
+xpfe/appshell/public/Makefile
+xpfe/bootstrap/Makefile
+xpfe/browser/Makefile
+xpfe/browser/src/Makefile
+xpfe/browser/resources/Makefile
+xpfe/browser/resources/content/Makefile
+xpfe/browser/resources/content/unix/Makefile
+xpfe/browser/resources/locale/Makefile
+xpfe/browser/resources/locale/en-US/Makefile
+xpfe/browser/resources/locale/en-US/unix/Makefile
+xpfe/appfilelocprovider/Makefile
+xpfe/appfilelocprovider/public/Makefile
+xpfe/appfilelocprovider/src/Makefile
+xpfe/global/Makefile
+xpfe/global/resources/Makefile
+xpfe/global/resources/content/Makefile
+xpfe/global/resources/content/os2/Makefile
+xpfe/global/resources/content/unix/Makefile
+xpfe/global/resources/locale/Makefile
+xpfe/global/resources/locale/en-US/Makefile
+xpfe/global/resources/locale/en-US/os2/Makefile
+xpfe/global/resources/locale/en-US/unix/Makefile
+xpfe/communicator/Makefile
+xpfe/communicator/resources/Makefile
+xpfe/communicator/resources/locale/Makefile
+xpfe/communicator/resources/locale/en-US/Makefile
+xpfe/communicator/resources/content/Makefile
+"
+
+MAKEFILES_embedding="
+embedding/Makefile
+embedding/browser/Makefile
+embedding/browser/build/Makefile
+embedding/browser/webBrowser/Makefile
+embedding/browser/gtk/Makefile
+embedding/browser/gtk/src/Makefile
+embedding/browser/gtk/tests/Makefile
+embedding/browser/photon/Makefile
+embedding/browser/photon/src/Makefile
+embedding/browser/photon/tests/Makefile
+embedding/config/Makefile
+embedding/tests/gtkEmbed/Makefile
+"
+
+MAKEFILES_security="
+security/Makefile
+security/base/Makefile
+security/base/public/Makefile
+security/base/res/Makefile
+security/base/res/content/Makefile
+security/base/res/locale/Makefile
+security/base/res/locale/en-US/Makefile
+security/psm/Makefile
+security/psm/lib/Makefile
+security/psm/lib/client/Makefile
+security/psm/lib/protocol/Makefile
+"
+
+MAKEFILES_transformiix="
+extensions/transformiix/source/base/Makefile
+extensions/transformiix/source/main/Makefile
+extensions/transformiix/source/net/Makefile
+extensions/transformiix/source/xml/dom/standalone/Makefile
+extensions/transformiix/source/xml/dom/Makefile
+extensions/transformiix/source/xml/dom/mozImpl/Makefile
+extensions/transformiix/source/xml/parser/Makefile
+extensions/transformiix/source/xml/printer/Makefile
+extensions/transformiix/source/xml/util/Makefile
+extensions/transformiix/source/xml/Makefile
+extensions/transformiix/source/xpath/Makefile
+extensions/transformiix/source/xslt/functions/Makefile
+extensions/transformiix/source/xslt/util/Makefile
+extensions/transformiix/source/xslt/Makefile
+extensions/transformiix/source/Makefile
+extensions/transformiix/Makefile
+"
+
+if [ "$MOZ_MAIL_NEWS" ]; then
+    MAKEFILES_mailnews=`cat ${srcdir}/mailnews/makefiles`
+fi
+
+if [ ! "$SYSTEM_JPEG" ]; then
+    MAKEFILES_jpeg="jpeg/Makefile"
+fi
+
+if [ ! "$SYSTEM_ZLIB" ]; then
+    MAKEFILES_zlib="
+	modules/zlib/Makefile
+	modules/zlib/src/Makefile
+"
+fi
+
+if [ ! "$SYSTEM_PNG" ]; then
+    MAKEFILES_libimg="$MAKEFILES_libimg modules/libimg/png/Makefile"
+fi
+
+
+#
+#  java/
+#
+if [ "$MOZ_JAVA_SUPPLEMENT" ]; then
+    MAKEFILES_java_supplement=`cat ${srcdir}/java/makefiles`
+fi
+
+#
+# l10n/
+#
+MAKEFILES_langpacks=`cat ${srcdir}/l10n/makefiles.all`
+
+if [ "$MOZ_L10N" ]; then
+    MAKEFILES_l10n="l10n/Makefile"
+
+    if [ "$MOZ_L10N_LANG" ]; then
+	MAKEFILES_l10n_lang="
+		l10n/lang/Makefile
+		l10n/lang/addressbook/Makefile
+		l10n/lang/bookmarks/Makefile
+		l10n/lang/directory/Makefile
+		l10n/lang/editor/Makefile
+		l10n/lang/global/Makefile
+		l10n/lang/history/Makefile
+		l10n/lang/messenger/Makefile
+		l10n/lang/messengercompose/Makefile
+		l10n/lang/navigator/Makefile
+		l10n/lang/pref/Makefile
+		l10n/lang/related/Makefile
+		l10n/lang/sidebar/Makefile
+		l10n/lang/addressbook/locale/Makefile
+		l10n/lang/bookmarks/locale/Makefile
+		l10n/lang/directory/locale/Makefile
+		l10n/lang/editor/locale/Makefile
+		l10n/lang/global/locale/Makefile
+		l10n/lang/history/locale/Makefile
+		l10n/lang/messenger/locale/Makefile
+		l10n/lang/messengercompose/locale/Makefile
+		l10n/lang/navigator/locale/Makefile
+		l10n/lang/pref/locale/Makefile
+		l10n/lang/related/locale/Makefile
+		l10n/lang/sidebar/locale/Makefile
+"
+	fi
+fi
+
+# tools/jprof
+if [ "$MOZ_JPROF" ]; then
+    MAKEFILES_jprof="tools/jprof/Makefile"
+fi
+
+# tools/leaky
+if [ "$MOZ_LEAKY" ]; then
+    MAKEFILES_leaky="tools/leaky/Makefile"
+fi
+
+# layout/mathml
+if [ "$MOZ_MATHML" ]; then
+    MAKEFILES_layout="$MAKEFILES_layout
+	layout/mathml/Makefile
+	layout/mathml/base/Makefile
+	layout/mathml/base/src/Makefile
+	layout/mathml/content/Makefile
+	layout/mathml/content/src/Makefile
+"
+fi
+
+# layout/svg
+if [ "$MOZ_SVG" ]; then
+    MAKEFILES_layout="$MAKEFILES_layout
+	layout/svg/Makefile
+	layout/svg/base/Makefile
+	layout/svg/base/public/Makefile
+	layout/svg/base/src/Makefile
+	layout/svg/content/Makefile
+	layout/svg/content/src/Makefile
+"
+fi
+
+# directory/xpcom
+if [ "$MOZ_LDAP_XPCOM" ]; then
+    MAKEFILES_ldap="
+	directory/xpcom/Makefile
+	directory/xpcom/base/Makefile
+	directory/xpcom/base/public/Makefile
+	directory/xpcom/base/src/Makefile
+"
+fi
+
+# libimg/mng
+if [ "$MOZ_MNG" ]; then
+    MAKEFILES_libimg="$MAKEFILES_libimg
+	modules/libimg/mng/Makefile
+	modules/libimg/mngcom/Makefile
+"
+fi
+
+for extension in $MOZ_EXTENSIONS; do
+    case "$extension" in
+        cookie ) MAKEFILES_extensions="$MAKEFILES_extensions
+	    extensions/cookie/Makefile
+	    extensions/cookie/tests/Makefile
+            " ;;
+        psm-glue ) MAKEFILES_extensions="$MAKEFILES_extensions
+	    extensions/psm-glue/public/Makefile
+	    extensions/psm-glue/Makefile
+	    extensions/psm-glue/src/Makefile
+            " ;;
+        irc ) MAKEFILES_extensions="$MAKEFILES_extensions
+	    extensions/irc/Makefile
+	    extensions/irc/xul/Makefile
+	    extensions/irc/xul/content/Makefile
+	    extensions/irc/xul/locale/Makefile
+	    extensions/irc/xul/locale/en-US/Makefile
+            " ;;
+	transformiix ) MAKEFILES_extensions="$MAKEFILES_extensions
+	    $MAKEFILES_transformiix"
+	    ;;
+        wallet ) MAKEFILES_extensions="$MAKEFILES_extensions
+	    extensions/wallet/Makefile
+	    extensions/wallet/public/Makefile
+	    extensions/wallet/src/Makefile
+	    extensions/wallet/editor/Makefile
+	    extensions/wallet/cookieviewer/Makefile
+	    extensions/wallet/signonviewer/Makefile
+	    extensions/wallet/walletpreview/Makefile
+	    extensions/wallet/build/Makefile
+            " ;;
+        xmlextras ) MAKEFILES_extensions="$MAKEFILES_extensions
+	    extensions/xmlextras/Makefile
+	    extensions/xmlextras/base/Makefile
+	    extensions/xmlextras/base/src/Makefile
+	    extensions/xmlextras/base/public/Makefile
+	    extensions/xmlextras/build/Makefile
+	    extensions/xmlextras/build/src/Makefile
+	    extensions/xmlextras/soap/public/Makefile
+            " ;;
+        xmlterm ) MAKEFILES_extensions="$MAKEFILES_extensions
+	    extensions/xmlterm/Makefile
+	    extensions/xmlterm/base/Makefile
+	    extensions/xmlterm/geckoterm/Makefile
+	    extensions/xmlterm/linetest/Makefile
+	    extensions/xmlterm/scripts/Makefile
+	    extensions/xmlterm/tests/Makefile
+	    extensions/xmlterm/ui/Makefile
+            " ;;
+        xml-rpc ) MAKEFILES_extensions="$MAKEFILES_extensions
+	    extensions/xml-rpc/Makefile
+	    extensions/xml-rpc/idl/Makefile
+	    extensions/xml-rpc/src/Makefile
+            " ;;
+    esac
+done
+
+
+#
+# Translate from BUILD_MODULES into the proper makefiles list
+#
+if [ "$BUILD_MODULES" = "all" ]; then
+
+MAKEFILES_themes=`cat ${srcdir}/themes/makefiles`
+
+add_makefiles "
+$MAKEFILES_caps
+$MAKEFILES_db
+$MAKEFILES_dbm
+$MAKEFILES_docshell
+$MAKEFILES_dom
+$MAKEFILES_editor
+$MAKEFILES_embedding
+$MAKEFILES_expat
+$MAKEFILES_extensions
+$MAKEFILES_gfx
+$MAKEFILES_htmlparser
+$MAKEFILES_intl
+$MAKEFILES_java_supplement
+$MAKEFILES_ldap
+$MAKEFILES_leaky
+$MAKEFILES_jpeg
+$MAKEFILES_jprof
+$MAKEFILES_js
+$MAKEFILES_l10n
+$MAKEFILES_l10n_lang
+$MAKEFILES_langpacks
+$MAKEFILES_layout
+$MAKEFILES_libreg
+$MAKEFILES_libimg
+$MAKEFILES_libjar
+$MAKEFILES_libpref
+$MAKEFILES_libutil
+$MAKEFILES_liveconnect
+$MAKEFILES_mailnews
+$MAKEFILES_oji
+$MAKEFILES_plugin
+$MAKEFILES_netwerk
+$MAKEFILES_profile
+$MAKEFILES_rdf
+$MAKEFILES_security
+$MAKEFILES_sun_java
+$MAKEFILES_themes
+$MAKEFILES_uriloader
+$MAKEFILES_view
+$MAKEFILES_webshell
+$MAKEFILES_widget
+$MAKEFILES_xpcom
+$MAKEFILES_xpconnect
+$MAKEFILES_xpinstall
+$MAKEFILES_xpfe
+$MAKEFILES_zlib
+"
+
+else
+
+# Standalone modules go here
+    for mod in $BUILD_MODULES; do
+	case $mod in
+	    dbm) add_makefiles "$MAKEFILES_dbm"
+		;;
+	    js) add_makefiles "$MAKEFILES_js"
+		;;
+	    necko) add_makefiles "
+                 $MAKEFILES_netwerk $MAKEFILES_xpcom $MAKEFILES_libreg"
+		;;
+	    transformiix) add_makefiles "$MAKEFILES_transformiix"
+		;;
+	    xpcom) add_makefiles "$MAKEFILES_xpcom $MAKEFILES_libreg"
+		;;
+	    xpconnect) add_makefiles "
+		$MAKEFILES_xpconnect $MAKEFILES_js $MAKEFILES_xpcom
+		$MAKEFILES_libreg"
+		;;
+        esac
+    done
+fi

mozilla/build/Makefile.in

@@ -0,0 +1,36 @@
+#
+# The contents of this file are subject to the Netscape Public
+# License Version 1.1 (the "License"); you may not use this file
+# except in compliance with the License. You may obtain a copy of
+# the License at http://www.mozilla.org/NPL/
+#
+# Software distributed under the License is distributed on an "AS
+# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express or
+# implied. See the License for the specific language governing
+# rights and limitations under the License.
+#
+# The Original Code is Mozilla Communicator client code, 
+# released March 31, 1998. 
+#
+# The Initial Developer of the Original Code is Netscape Communications 
+# Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation. All
+# Rights Reserved.
+#
+# Contributor(s): 
+#
+
+DEPTH		= ..
+topsrcdir	= @top_srcdir@
+srcdir		= @srcdir@
+VPATH		= @srcdir@
+
+include $(DEPTH)/config/autoconf.mk
+
+DIRS		= unix
+
+include $(topsrcdir)/config/rules.mk
+
+# Install bloaturls.txt file for tinderbox Bloaty test.
+install:: $(srcdir)/bloaturls.txt
+	$(INSTALL) $< $(DIST)/bin

mozilla/build/autoconf/acoutput-fast.pl

@@ -0,0 +1,179 @@
+#! /usr/bin/env perl
+#
+# The contents of this file are subject to the Netscape Public
+# License Version 1.1 (the "License"); you may not use this file
+# except in compliance with the License. You may obtain a copy of
+# the License at http://www.mozilla.org/NPL/
+#
+# Software distributed under the License is distributed on an "AS
+# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express or
+# implied. See the License for the specific language governing
+# rights and limitations under the License.
+#
+# The Original Code is mozilla.org code.
+#
+# The Initial Developer of the Original Code is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1999 Netscape Communications Corporation. All
+# Rights Reserved.
+#
+# Contributor(s): 
+#
+
+# acoutput-fast.pl - Quickly create makefiles that are in a common format.
+#
+# Most of the makefiles in mozilla only refer to two configure variables:
+#     @srcdir@
+#     @top_srcdir@
+# However, configure does not know any better and it runs sed on each file
+# with over 150 replacement rules (slow as molasses).
+#
+# This script takes a list of makefiles as input. For example,
+#   
+#     echo $MAKEFILES | acoutput-fast.pl
+#
+# The script creates each Makefile that only references @srcdir@ and
+# @top_srcdir@. For other files, it lists them in a shell command that is
+# printed to stdout:
+#
+#     CONFIG_FILES="unhandled_files..."; export CONFIG_FILES
+#
+# This command can be used to have config.status create the unhandled
+# files. For example,
+#
+#     eval "echo $MAKEFILES | acoutput-fast.pl"
+#     AC_OUTPUT($MAKEFILES)
+#
+# Send comments, improvements, bugs to Steve Lamm (slamm@netscape.com).
+
+#use File::Basename;
+sub dirname {
+  my $dir = $_[0];
+  return '.' if not $dir =~ m%/%;
+  $dir =~ s%/[^/][^/]*$%%;
+  return $dir;
+}
+
+# Create one directory. Assumes it doesn't already exist.
+# Will create parent(s) if needed.
+sub create_directory {
+  my $dir = $_[0];
+  my $parent = dirname($dir);
+  create_directory($parent) if not -d $parent;
+  mkdir "$dir",0777;
+}
+
+# Create all the directories at once.
+#   This can be much faster than calling mkdir() for each one.
+sub create_directories {
+  my @makefiles = @_;
+  my @dirs = ();
+  my $ac_file;
+  foreach $ac_file (@makefiles) {
+    push @dirs, dirname($ac_file);
+  }
+  # Call mkdir with the directories sorted by subdir count (how many /'s)
+  if (@dirs) {
+    my $mkdir_command = "mkdir -p ". join(' ', @dirs);
+    if (system($mkdir_command)  != 0) {
+      print STDERR "Creating dirs all at once failed; trying one at atime\n";
+      foreach $dir (@dirs) {
+        if (not -d $dir) {
+          print STDERR "Creating directory $dir\n";
+          create_directory($dir);
+        }
+      }
+    }
+  }
+}
+
+if ($ARGV[0] =~ /^--srcdir=/) {
+  $ac_given_srcdir = (split /=/, shift @ARGV)[1];
+} else {
+  $ac_given_srcdir = $0;
+  $ac_given_srcdir =~ s|/?build/autoconf/.*$||;
+  $ac_given_srcdir = '.' if $ac_given_srcdir eq '';
+}
+
+# Read list of makefiles from the stdin or,
+#   from files listed on the command-line.
+#
+@makefiles=();
+push @makefiles, split while (<>);
+
+# Create all the directories at once.
+#   This can be much faster than calling mkdir() for each one.
+create_directories(@makefiles);
+
+# Output the makefiles.
+#
+@unhandled=();
+foreach $ac_file (@makefiles) {
+  if (not $ac_file =~ /Makefile$/ or $ac_file =~ /:/) {
+    push @unhandled, $ac_file;
+    next;
+  }
+  $ac_file_in = "$ac_given_srcdir/$ac_file.in";
+  $ac_dir = dirname($ac_file);
+  if ($ac_dir eq '.') {
+    $ac_dir_suffix = '';
+    $ac_dots = '';
+  } else {
+    $ac_dir_suffix = "/$ac_dir";
+    $ac_dir_suffix =~ s%^/\./%/%;
+    $ac_dots = $ac_dir_suffix;
+    $ac_dots =~ s%/[^/]*%../%g;
+  }
+  if ($ac_given_srcdir eq '.') {
+    $srcdir = '.';
+    if ($ac_dots eq '') {
+      $top_srcdir = '.'
+    } else {
+      $top_srcdir = $ac_dots;
+      $top_srcdir =~ s%/$%%;
+    }
+  } elsif ($ac_given_srcdir =~ m%^/%) {
+    $srcdir     = "$ac_given_srcdir$ac_dir_suffix";
+    $top_srcdir = "$ac_given_srcdir";
+  } else {
+    $srcdir     = "$ac_dots$ac_given_srcdir$ac_dir_suffix";
+    $top_srcdir = "$ac_dots$ac_given_srcdir";
+  }
+
+  if (-e $ac_file) {
+    next if -M _ < -M $ac_file_in;
+    print STDERR "updating $ac_file\n";
+  } else {
+    print STDERR "creating $ac_file\n";
+  }
+
+  open (INFILE, "<$ac_file_in")
+    or ( warn "can't read $ac_file_in: No such file or directory\n" and next);
+  open (OUTFILE, ">$ac_file")
+    or ( warn "Unable to create $ac_file\n" and next);
+
+  while (<INFILE>) {
+    #if (/\@[_a-zA-Z]*\@.*\@[_a-zA-Z]*\@/) {
+    #  warn "Two defines on a line:$ac_file:$.:$_";
+    #  push @unhandled, $ac_file;
+    #  last;
+    #}
+
+    s/\@srcdir\@/$srcdir/g;
+    s/\@top_srcdir\@/$top_srcdir/g;
+
+    if (/\@[_a-zA-Z]*\@/) {
+      warn "Unknown variable:$ac_file:$.:$_";
+      push @unhandled, $ac_file;
+      last;
+    }
+    print OUTFILE;
+  }
+  close INFILE;
+  close OUTFILE;
+}
+
+# Print the shell command to be evaluated by configure.
+#
+print "CONFIG_FILES=\"".join(' ', @unhandled)."\"; export CONFIG_FILES\n";
+

mozilla/build/autoconf/altoptions.m4

@@ -0,0 +1,107 @@
+dnl The contents of this file are subject to the Netscape Public
+dnl License Version 1.1 (the "License"); you may not use this file
+dnl except in compliance with the License. You may obtain a copy of
+dnl the License at http://www.mozilla.org/NPL/
+dnl
+dnl Software distributed under the License is distributed on an "AS
+dnl IS" basis, WITHOUT WARRANTY OF ANY KIND, either express or
+dnl implied. See the License for the specific language governing
+dnl rights and limitations under the License.
+dnl
+dnl The Original Code is mozilla.org code.
+dnl
+dnl The Initial Developer of the Original Code is Netscape
+dnl Communications Corporation.  Portions created by Netscape are
+dnl Copyright (C) 1999 Netscape Communications Corporation. All
+dnl Rights Reserved.
+dnl
+dnl Contributor(s): 
+dnl
+
+dnl altoptions.m4 - An alternative way of specifying command-line options.
+dnl    These macros are needed to support a menu-based configurator.
+dnl    This file also includes the macro, AM_READ_MYCONFIG, for reading
+dnl    the 'myconfig.m4' file.
+
+dnl Send comments, improvements, bugs to Steve Lamm (slamm@netscape.com).
+
+
+dnl MOZ_ARG_ENABLE_BOOL(           NAME, HELP, IF-YES [, IF-NO [, ELSE]])
+dnl MOZ_ARG_DISABLE_BOOL(          NAME, HELP, IF-NO [, IF-YES [, ELSE]])
+dnl MOZ_ARG_ENABLE_STRING(         NAME, HELP, IF-SET [, ELSE])
+dnl MOZ_ARG_ENABLE_BOOL_OR_STRING( NAME, HELP, IF-YES, IF-NO, IF-SET[, ELSE]]])
+dnl MOZ_ARG_WITH_BOOL(             NAME, HELP, IF-YES [, IF-NO [, ELSE])
+dnl MOZ_ARG_WITHOUT_BOOL(          NAME, HELP, IF-NO [, IF-YES [, ELSE])
+dnl MOZ_ARG_WITH_STRING(           NAME, HELP, IF-SET [, ELSE])
+dnl MOZ_ARG_HEADER(Comment)
+dnl MOZ_READ_MYCONFIG() - Read in 'myconfig.sh' file
+
+
+dnl MOZ_TWO_STRING_TEST(NAME, STR1, IF-STR1, STR2, IF-STR2 [, ELSE])
+AC_DEFUN(MOZ_TWO_STRING_TEST,
+[if test "$enableval" = "[$2]"; then
+    ifelse([$3], , :, [$3])
+  elif test "$enableval" = "[$4]"; then
+    ifelse([$5], , :, [$5])
+  else
+    ifelse([$6], ,
+      [AC_MSG_ERROR([Option, [$1], does not take an argument ($enableval).])],
+      [$6])
+  fi])
+
+dnl MOZ_ARG_ENABLE_BOOL(NAME, HELP, IF-YES [, IF-NO [, ELSE]])
+AC_DEFUN(MOZ_ARG_ENABLE_BOOL,
+[AC_ARG_ENABLE([$1], [$2], 
+ [MOZ_TWO_STRING_TEST([$1], yes, [$3], no, [$4])],
+ [$5])])
+
+dnl MOZ_ARG_DISABLE_BOOL(NAME, HELP, IF-NO [, IF-YES [, ELSE]])
+AC_DEFUN(MOZ_ARG_DISABLE_BOOL,
+[AC_ARG_ENABLE([$1], [$2],
+ [MOZ_TWO_STRING_TEST([$1], no, [$3], yes, [$4])],
+ [$5])])
+
+dnl MOZ_ARG_ENABLE_STRING(NAME, HELP, IF-SET [, ELSE])
+AC_DEFUN(MOZ_ARG_ENABLE_STRING,
+[AC_ARG_ENABLE([$1], [$2], [$3], [$4])])
+
+dnl MOZ_ARG_ENABLE_BOOL_OR_STRING(NAME, HELP, IF-YES, IF-NO, IF-SET[, ELSE]]])
+AC_DEFUN(MOZ_ARG_ENABLE_BOOL_OR_STRING,
+[ifelse([$5], , 
+ [errprint([Option, $1, needs an "IF-SET" argument.
+])
+  m4exit(1)],
+ [AC_ARG_ENABLE([$1], [$2],
+  [MOZ_TWO_STRING_TEST([$1], yes, [$3], no, [$4], [$5])],
+  [$6])])])
+
+dnl MOZ_ARG_WITH_BOOL(NAME, HELP, IF-YES [, IF-NO [, ELSE])
+AC_DEFUN(MOZ_ARG_WITH_BOOL,
+[AC_ARG_WITH([$1], [$2],
+ [MOZ_TWO_STRING_TEST([$1], yes, [$3], no, [$4])],
+ [$5])])
+
+dnl MOZ_ARG_WITHOUT_BOOL(NAME, HELP, IF-NO [, IF-YES [, ELSE])
+AC_DEFUN(MOZ_ARG_WITHOUT_BOOL,
+[AC_ARG_WITH([$1], [$2],
+ [MOZ_TWO_STRING_TEST([$1], no, [$3], yes, [$4])],
+ [$5])])
+
+dnl MOZ_ARG_WITH_STRING(NAME, HELP, IF-SET [, ELSE])
+AC_DEFUN(MOZ_ARG_WITH_STRING,
+[AC_ARG_WITH([$1], [$2], [$3], [$4])])
+
+dnl MOZ_ARG_HEADER(Comment)
+dnl This is used by webconfig to group options
+define(MOZ_ARG_HEADER, [# $1])
+
+dnl MOZ_READ_MYCONFIG() - Read in 'myconfig.sh' file
+AC_DEFUN(MOZ_READ_MOZCONFIG,
+[AC_REQUIRE([AC_INIT_BINSH])dnl
+# Read in '.mozconfig' script to set the initial options.
+# See the mozconfig2configure script for more details.
+_AUTOCONF_TOOLS_DIR=`dirname [$]0`/[$1]/build/autoconf
+. $_AUTOCONF_TOOLS_DIR/mozconfig2configure])
+
+dnl This gets inserted at the top of the configure script
+MOZ_READ_MOZCONFIG(MOZ_TOPSRCDIR)

mozilla/build/autoconf/clean-config.sh

@@ -0,0 +1,54 @@
+#!/bin/sh
+#
+# The contents of this file are subject to the Netscape Public
+# License Version 1.1 (the "License"); you may not use this file
+# except in compliance with the License. You may obtain a copy of
+# the License at http://www.mozilla.org/NPL/
+#
+# Software distributed under the License is distributed on an "AS
+# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express or
+# implied. See the License for the specific language governing
+# rights and limitations under the License.
+#
+# The Original Code is mozilla.org code.
+#
+# The Initial Developer of the Original Code is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation. All
+# Rights Reserved.
+#
+# Contributor(s): 
+#
+
+# clean-config.sh - Removes all files generated by mozilla configure.
+#    Only removes files from the topsrcdir. To clean up an objdir,
+#    simply remove the directory and start over.
+#
+# Usage:
+#    1. cd <topsrcdir>
+#    2. build/autoconf/clean-config.sh
+#
+# Send comments, improvements, bugs to slamm@netscape.com
+
+topsrcdir=`cd \`dirname $0\`/../..; pwd`
+
+if [ ! -f configure.in ]; then
+  echo "clean-config.sh only cleans the source tree. To run," 2>&1
+  echo "  cd $topsrcdir; build/autoconf/clean-config.sh" 2>&1
+  echo "  (To clean a separate objdir, simple remove the directory.)" 2>&1
+  exit 1
+fi
+
+if [ -f mailnews/makefiles ]; then
+  MOZ_MAIL_NEWS=1
+  export MOZ_MAIL_NEWS
+fi
+
+. allmakefiles.sh
+
+rm -fr $MAKEFILES \
+    config-defs.h \
+    config.cache \
+    config.log \
+    config.status \
+    $NULL

mozilla/build/autoconf/glib.m4

@@ -0,0 +1,200 @@
+# Configure paths for GLIB
+# Owen Taylor     97-11-3
+
+dnl AM_PATH_GLIB([MINIMUM-VERSION, [ACTION-IF-FOUND [, ACTION-IF-NOT-FOUND [, MODULES]]]])
+dnl Test for GLIB, and define GLIB_CFLAGS and GLIB_LIBS, if "gmodule" or 
+dnl gthread is specified in MODULES, pass to glib-config
+dnl
+AC_DEFUN(AM_PATH_GLIB,
+[dnl 
+dnl Get the cflags and libraries from the glib-config script
+dnl
+AC_ARG_WITH(glib-prefix,[  --with-glib-prefix=PFX  Prefix where GLIB is installed (optional)],
+            glib_config_prefix="$withval", glib_config_prefix="")
+AC_ARG_WITH(glib-exec-prefix,[  --with-glib-exec-prefix=PFX
+                          Exec prefix where GLIB is installed (optional)],
+            glib_config_exec_prefix="$withval", glib_config_exec_prefix="")
+AC_ARG_ENABLE(glibtest, [  --disable-glibtest      Do not try to compile and run a test GLIB program],
+		    , enable_glibtest=yes)
+
+  if test x$glib_config_exec_prefix != x ; then
+     glib_config_args="$glib_config_args --exec-prefix=$glib_config_exec_prefix"
+     if test x${GLIB_CONFIG+set} != xset ; then
+        GLIB_CONFIG=$glib_config_exec_prefix/bin/glib-config
+     fi
+  fi
+  if test x$glib_config_prefix != x ; then
+     glib_config_args="$glib_config_args --prefix=$glib_config_prefix"
+     if test x${GLIB_CONFIG+set} != xset ; then
+        GLIB_CONFIG=$glib_config_prefix/bin/glib-config
+     fi
+  fi
+
+  for module in . $4
+  do
+      case "$module" in
+         gmodule) 
+             glib_config_args="$glib_config_args gmodule"
+         ;;
+         gthread) 
+             glib_config_args="$glib_config_args gthread"
+         ;;
+      esac
+  done
+
+  dnl Force a version check to keep upgraded versions from being overridden by the cached value.
+  unset ac_cv_path_GLIB_CONFIG
+
+  AC_PATH_PROG(GLIB_CONFIG, glib-config, no)
+  min_glib_version=ifelse([$1], ,0.99.7,$1)
+  AC_MSG_CHECKING(for GLIB - version >= $min_glib_version)
+  no_glib=""
+  if test "$GLIB_CONFIG" = "no" ; then
+    no_glib=yes
+  else
+    GLIB_CFLAGS=`$GLIB_CONFIG $glib_config_args --cflags`
+    GLIB_LIBS=`$GLIB_CONFIG $glib_config_args --libs`
+    glib_config_major_version=`$GLIB_CONFIG $glib_config_args --version | \
+           sed 's/\([[0-9]]*\).\([[0-9]]*\).\([[0-9]]*\)/\1/'`
+    glib_config_minor_version=`$GLIB_CONFIG $glib_config_args --version | \
+           sed 's/\([[0-9]]*\).\([[0-9]]*\).\([[0-9]]*\)/\2/'`
+    glib_config_micro_version=`$GLIB_CONFIG $glib_config_args --version | \
+           sed 's/\([[0-9]]*\).\([[0-9]]*\).\([[0-9]]*\)/\3/'`
+    if test "x$enable_glibtest" = "xyes" ; then
+      ac_save_CFLAGS="$CFLAGS"
+      ac_save_LIBS="$LIBS"
+      CFLAGS="$CFLAGS $GLIB_CFLAGS"
+      LIBS="$GLIB_LIBS $LIBS"
+dnl
+dnl Now check if the installed GLIB is sufficiently new. (Also sanity
+dnl checks the results of glib-config to some extent
+dnl
+      rm -f conf.glibtest
+      AC_TRY_RUN([
+#include <glib.h>
+#include <stdio.h>
+#include <stdlib.h>
+
+int 
+main ()
+{
+  int major, minor, micro;
+  char *tmp_version;
+
+  system ("touch conf.glibtest");
+
+  /* HP/UX 9 (%@#!) writes to sscanf strings */
+  tmp_version = g_strdup("$min_glib_version");
+  if (sscanf(tmp_version, "%d.%d.%d", &major, &minor, &micro) != 3) {
+     printf("%s, bad version string\n", "$min_glib_version");
+     exit(1);
+   }
+
+  if ((glib_major_version != $glib_config_major_version) ||
+      (glib_minor_version != $glib_config_minor_version) ||
+      (glib_micro_version != $glib_config_micro_version))
+    {
+      printf("\n*** 'glib-config --version' returned %d.%d.%d, but GLIB (%d.%d.%d)\n", 
+             $glib_config_major_version, $glib_config_minor_version, $glib_config_micro_version,
+             glib_major_version, glib_minor_version, glib_micro_version);
+      printf ("*** was found! If glib-config was correct, then it is best\n");
+      printf ("*** to remove the old version of GLIB. You may also be able to fix the error\n");
+      printf("*** by modifying your LD_LIBRARY_PATH enviroment variable, or by editing\n");
+      printf("*** /etc/ld.so.conf. Make sure you have run ldconfig if that is\n");
+      printf("*** required on your system.\n");
+      printf("*** If glib-config was wrong, set the environment variable GLIB_CONFIG\n");
+      printf("*** to point to the correct copy of glib-config, and remove the file config.cache\n");
+      printf("*** before re-running configure\n");
+    } 
+  else if ((glib_major_version != GLIB_MAJOR_VERSION) ||
+	   (glib_minor_version != GLIB_MINOR_VERSION) ||
+           (glib_micro_version != GLIB_MICRO_VERSION))
+    {
+      printf("*** GLIB header files (version %d.%d.%d) do not match\n",
+	     GLIB_MAJOR_VERSION, GLIB_MINOR_VERSION, GLIB_MICRO_VERSION);
+      printf("*** library (version %d.%d.%d)\n",
+	     glib_major_version, glib_minor_version, glib_micro_version);
+    }
+  else
+    {
+      if ((glib_major_version > major) ||
+        ((glib_major_version == major) && (glib_minor_version > minor)) ||
+        ((glib_major_version == major) && (glib_minor_version == minor) && (glib_micro_version >= micro)))
+      {
+        return 0;
+       }
+     else
+      {
+        printf("\n*** An old version of GLIB (%d.%d.%d) was found.\n",
+               glib_major_version, glib_minor_version, glib_micro_version);
+        printf("*** You need a version of GLIB newer than %d.%d.%d. The latest version of\n",
+	       major, minor, micro);
+        printf("*** GLIB is always available from ftp://ftp.gtk.org.\n");
+        printf("***\n");
+        printf("*** If you have already installed a sufficiently new version, this error\n");
+        printf("*** probably means that the wrong copy of the glib-config shell script is\n");
+        printf("*** being found. The easiest way to fix this is to remove the old version\n");
+        printf("*** of GLIB, but you can also set the GLIB_CONFIG environment to point to the\n");
+        printf("*** correct copy of glib-config. (In this case, you will have to\n");
+        printf("*** modify your LD_LIBRARY_PATH enviroment variable, or edit /etc/ld.so.conf\n");
+        printf("*** so that the correct libraries are found at run-time))\n");
+      }
+    }
+  return 1;
+}
+],, no_glib=yes,[echo $ac_n "cross compiling; assumed OK... $ac_c"])
+       CFLAGS="$ac_save_CFLAGS"
+       LIBS="$ac_save_LIBS"
+     fi
+  fi
+  if test "x$no_glib" = x ; then
+     AC_MSG_RESULT(yes)
+     ifelse([$2], , :, [$2])     
+  else
+     AC_MSG_RESULT(no)
+     if test "$GLIB_CONFIG" = "no" ; then
+       echo "*** The glib-config script installed by GLIB could not be found"
+       echo "*** If GLIB was installed in PREFIX, make sure PREFIX/bin is in"
+       echo "*** your path, or set the GLIB_CONFIG environment variable to the"
+       echo "*** full path to glib-config."
+     else
+       if test -f conf.glibtest ; then
+        :
+       else
+          echo "*** Could not run GLIB test program, checking why..."
+          CFLAGS="$CFLAGS $GLIB_CFLAGS"
+          LIBS="$LIBS $GLIB_LIBS"
+          AC_TRY_LINK([
+#include <glib.h>
+#include <stdio.h>
+],      [ return ((glib_major_version) || (glib_minor_version) || (glib_micro_version)); ],
+        [ echo "*** The test program compiled, but did not run. This usually means"
+          echo "*** that the run-time linker is not finding GLIB or finding the wrong"
+          echo "*** version of GLIB. If it is not finding GLIB, you'll need to set your"
+          echo "*** LD_LIBRARY_PATH environment variable, or edit /etc/ld.so.conf to point"
+          echo "*** to the installed location  Also, make sure you have run ldconfig if that"
+          echo "*** is required on your system"
+	  echo "***"
+          echo "*** If you have an old version installed, it is best to remove it, although"
+          echo "*** you may also be able to get things to work by modifying LD_LIBRARY_PATH"
+          echo "***"
+          echo "*** If you have a RedHat 5.0 system, you should remove the GTK package that"
+          echo "*** came with the system with the command"
+          echo "***"
+          echo "***    rpm --erase --nodeps gtk gtk-devel" ],
+        [ echo "*** The test program failed to compile or link. See the file config.log for the"
+          echo "*** exact error that occured. This usually means GLIB was incorrectly installed"
+          echo "*** or that you have moved GLIB since it was installed. In the latter case, you"
+          echo "*** may want to edit the glib-config script: $GLIB_CONFIG" ])
+          CFLAGS="$ac_save_CFLAGS"
+          LIBS="$ac_save_LIBS"
+       fi
+     fi
+     GLIB_CFLAGS=""
+     GLIB_LIBS=""
+     ifelse([$3], , :, [$3])
+  fi
+  AC_SUBST(GLIB_CFLAGS)
+  AC_SUBST(GLIB_LIBS)
+  rm -f conf.glibtest
+])

mozilla/build/autoconf/gtk.m4

@@ -0,0 +1,191 @@
+# Configure paths for GTK+
+# Owen Taylor     97-11-3
+# (copy of gtk.m4 (public domain))
+
+dnl AM_PATH_GTK([MINIMUM-VERSION, [ACTION-IF-FOUND [, ACTION-IF-NOT-FOUND]]])
+dnl Test for GTK, and define GTK_CFLAGS and GTK_LIBS
+dnl
+AC_DEFUN(AM_PATH_GTK,
+[dnl 
+dnl Get the cflags and libraries from the gtk-config script
+dnl
+AC_ARG_WITH(gtk-prefix,[  --with-gtk-prefix=PFX   Prefix where GTK is installed (optional)],
+            gtk_config_prefix="$withval", gtk_config_prefix="")
+AC_ARG_WITH(gtk-exec-prefix,[  --with-gtk-exec-prefix=PFX 
+                          Exec prefix where GTK is installed (optional)],
+            gtk_config_exec_prefix="$withval", gtk_config_exec_prefix="")
+AC_ARG_ENABLE(gtktest, [  --disable-gtktest       Do not try to compile and run a test GTK program],
+		    , enable_gtktest=yes)
+
+  if test x$gtk_config_exec_prefix != x ; then
+     gtk_config_args="$gtk_config_args --exec-prefix=$gtk_config_exec_prefix"
+     if test x${GTK_CONFIG+set} != xset ; then
+        GTK_CONFIG=$gtk_config_exec_prefix/bin/gtk-config
+     fi
+  fi
+  if test x$gtk_config_prefix != x ; then
+     gtk_config_args="$gtk_config_args --prefix=$gtk_config_prefix"
+     if test x${GTK_CONFIG+set} != xset ; then
+        GTK_CONFIG=$gtk_config_prefix/bin/gtk-config
+     fi
+  fi
+
+  dnl Force a version check to keep upgraded versions from being overridden by the cached value.
+  unset ac_cv_path_GTK_CONFIG
+
+  AC_PATH_PROG(GTK_CONFIG, gtk-config, no)
+  min_gtk_version=ifelse([$1], ,0.99.7,$1)
+  AC_MSG_CHECKING(for GTK - version >= $min_gtk_version)
+  no_gtk=""
+  if test "$GTK_CONFIG" = "no" ; then
+    no_gtk=yes
+  else
+    GTK_CFLAGS=`$GTK_CONFIG $gtk_config_args --cflags`
+    GTK_LIBS=`$GTK_CONFIG $gtk_config_args --libs`
+    gtk_config_major_version=`$GTK_CONFIG $gtk_config_args --version | \
+           sed 's/\([[0-9]]*\).\([[0-9]]*\).\([[0-9]]*\)/\1/'`
+    gtk_config_minor_version=`$GTK_CONFIG $gtk_config_args --version | \
+           sed 's/\([[0-9]]*\).\([[0-9]]*\).\([[0-9]]*\)/\2/'`
+    gtk_config_micro_version=`$GTK_CONFIG $gtk_config_args --version | \
+           sed 's/\([[0-9]]*\).\([[0-9]]*\).\([[0-9]]*\)/\3/'`
+    if test "x$enable_gtktest" = "xyes" ; then
+      ac_save_CFLAGS="$CFLAGS"
+      ac_save_LIBS="$LIBS"
+      CFLAGS="$CFLAGS $GTK_CFLAGS"
+      LIBS="$LIBS $GTK_LIBS"
+dnl
+dnl Now check if the installed GTK is sufficiently new. (Also sanity
+dnl checks the results of gtk-config to some extent
+dnl
+      rm -f conf.gtktest
+      AC_TRY_RUN([
+#include <gtk/gtk.h>
+#include <stdio.h>
+#include <stdlib.h>
+
+int 
+main ()
+{
+  int major, minor, micro;
+  char *tmp_version;
+
+  system ("touch conf.gtktest");
+
+  /* HP/UX 9 (%@#!) writes to sscanf strings */
+  tmp_version = g_strdup("$min_gtk_version");
+  if (sscanf(tmp_version, "%d.%d.%d", &major, &minor, &micro) != 3) {
+     printf("%s, bad version string\n", "$min_gtk_version");
+     exit(1);
+   }
+
+  if ((gtk_major_version != $gtk_config_major_version) ||
+      (gtk_minor_version != $gtk_config_minor_version) ||
+      (gtk_micro_version != $gtk_config_micro_version))
+    {
+      printf("\n*** 'gtk-config --version' returned %d.%d.%d, but GTK+ (%d.%d.%d)\n", 
+             $gtk_config_major_version, $gtk_config_minor_version, $gtk_config_micro_version,
+             gtk_major_version, gtk_minor_version, gtk_micro_version);
+      printf ("*** was found! If gtk-config was correct, then it is best\n");
+      printf ("*** to remove the old version of GTK+. You may also be able to fix the error\n");
+      printf("*** by modifying your LD_LIBRARY_PATH enviroment variable, or by editing\n");
+      printf("*** /etc/ld.so.conf. Make sure you have run ldconfig if that is\n");
+      printf("*** required on your system.\n");
+      printf("*** If gtk-config was wrong, set the environment variable GTK_CONFIG\n");
+      printf("*** to point to the correct copy of gtk-config, and remove the file config.cache\n");
+      printf("*** before re-running configure\n");
+    } 
+#if defined (GTK_MAJOR_VERSION) && defined (GTK_MINOR_VERSION) && defined (GTK_MICRO_VERSION)
+  else if ((gtk_major_version != GTK_MAJOR_VERSION) ||
+	   (gtk_minor_version != GTK_MINOR_VERSION) ||
+           (gtk_micro_version != GTK_MICRO_VERSION))
+    {
+      printf("*** GTK+ header files (version %d.%d.%d) do not match\n",
+	     GTK_MAJOR_VERSION, GTK_MINOR_VERSION, GTK_MICRO_VERSION);
+      printf("*** library (version %d.%d.%d)\n",
+	     gtk_major_version, gtk_minor_version, gtk_micro_version);
+    }
+#endif /* defined (GTK_MAJOR_VERSION) ... */
+  else
+    {
+      if ((gtk_major_version > major) ||
+        ((gtk_major_version == major) && (gtk_minor_version > minor)) ||
+        ((gtk_major_version == major) && (gtk_minor_version == minor) && (gtk_micro_version >= micro)))
+      {
+        return 0;
+       }
+     else
+      {
+        printf("\n*** An old version of GTK+ (%d.%d.%d) was found.\n",
+               gtk_major_version, gtk_minor_version, gtk_micro_version);
+        printf("*** You need a version of GTK+ newer than %d.%d.%d. The latest version of\n",
+	       major, minor, micro);
+        printf("*** GTK+ is always available from ftp://ftp.gtk.org.\n");
+        printf("***\n");
+        printf("*** If you have already installed a sufficiently new version, this error\n");
+        printf("*** probably means that the wrong copy of the gtk-config shell script is\n");
+        printf("*** being found. The easiest way to fix this is to remove the old version\n");
+        printf("*** of GTK+, but you can also set the GTK_CONFIG environment to point to the\n");
+        printf("*** correct copy of gtk-config. (In this case, you will have to\n");
+        printf("*** modify your LD_LIBRARY_PATH enviroment variable, or edit /etc/ld.so.conf\n");
+        printf("*** so that the correct libraries are found at run-time))\n");
+      }
+    }
+  return 1;
+}
+],, no_gtk=yes,[echo $ac_n "cross compiling; assumed OK... $ac_c"])
+       CFLAGS="$ac_save_CFLAGS"
+       LIBS="$ac_save_LIBS"
+     fi
+  fi
+  if test "x$no_gtk" = x ; then
+     AC_MSG_RESULT(yes)
+     ifelse([$2], , :, [$2])     
+  else
+     AC_MSG_RESULT(no)
+     if test "$GTK_CONFIG" = "no" ; then
+       echo "*** The gtk-config script installed by GTK could not be found."
+       echo "*** If GTK was installed in PREFIX, make sure PREFIX/bin is in"
+       echo "*** your path, or set the GTK_CONFIG environment variable to the"
+       echo "*** full path to gtk-config."
+       echo "*** GTK+ is available from ftp://ftp.gtk.org/pub/gtk"
+     else
+       if test -f conf.gtktest ; then
+        :
+       else
+          echo "*** Could not run GTK test program, checking why..."
+          CFLAGS="$CFLAGS $GTK_CFLAGS"
+          LIBS="$LIBS $GTK_LIBS"
+          AC_TRY_LINK([
+#include <gtk/gtk.h>
+#include <stdio.h>
+],      [ return ((gtk_major_version) || (gtk_minor_version) || (gtk_micro_version)); ],
+        [ echo "*** The test program compiled, but did not run. This usually means"
+          echo "*** that the run-time linker is not finding GTK or finding the wrong"
+          echo "*** version of GTK. If it is not finding GTK, you'll need to set your"
+          echo "*** LD_LIBRARY_PATH environment variable, or edit /etc/ld.so.conf to point"
+          echo "*** to the installed location  Also, make sure you have run ldconfig if that"
+          echo "*** is required on your system"
+	  echo "***"
+          echo "*** If you have an old version installed, it is best to remove it, although"
+          echo "*** you may also be able to get things to work by modifying LD_LIBRARY_PATH"
+          echo "***"
+          echo "*** If you have a RedHat 5.0 system, you should remove the GTK package that"
+          echo "*** came with the system with the command"
+          echo "***"
+          echo "***    rpm --erase --nodeps gtk gtk-devel" ],
+        [ echo "*** The test program failed to compile or link. See the file config.log for the"
+          echo "*** exact error that occured. This usually means GTK was incorrectly installed"
+          echo "*** or that you have moved GTK since it was installed. In the latter case, you"
+          echo "*** may want to edit the gtk-config script: $GTK_CONFIG" ])
+          CFLAGS="$ac_save_CFLAGS"
+          LIBS="$ac_save_LIBS"
+       fi
+     fi
+     GTK_CFLAGS=""
+     GTK_LIBS=""
+     ifelse([$3], , :, [$3])
+  fi
+  AC_SUBST(GTK_CFLAGS)
+  AC_SUBST(GTK_LIBS)
+  rm -f conf.gtktest
+])

mozilla/build/autoconf/install-sh

@@ -0,0 +1,119 @@
+#!/bin/sh
+
+#
+# install - install a program, script, or datafile
+# This comes from X11R5; it is not part of GNU.
+#
+# $XConsortium: install.sh,v 1.2 89/12/18 14:47:22 jim Exp $
+#
+# This script is compatible with the BSD install script, but was written
+# from scratch.
+#
+
+
+# set DOITPROG to echo to test this script
+
+# Don't use :- since 4.3BSD and earlier shells don't like it.
+doit="${DOITPROG-}"
+
+
+# put in absolute paths if you don't have them in your path; or use env. vars.
+
+mvprog="${MVPROG-mv}"
+cpprog="${CPPROG-cp}"
+chmodprog="${CHMODPROG-chmod}"
+chownprog="${CHOWNPROG-chown}"
+chgrpprog="${CHGRPPROG-chgrp}"
+stripprog="${STRIPPROG-strip}"
+rmprog="${RMPROG-rm}"
+
+instcmd="$mvprog"
+chmodcmd=""
+chowncmd=""
+chgrpcmd=""
+stripcmd=""
+rmcmd="$rmprog -f"
+mvcmd="$mvprog"
+src=""
+dst=""
+
+while [ x"$1" != x ]; do
+    case $1 in
+	-c) instcmd="$cpprog"
+	    shift
+	    continue;;
+
+	-m) chmodcmd="$chmodprog $2"
+	    shift
+	    shift
+	    continue;;
+
+	-o) chowncmd="$chownprog $2"
+	    shift
+	    shift
+	    continue;;
+
+	-g) chgrpcmd="$chgrpprog $2"
+	    shift
+	    shift
+	    continue;;
+
+	-s) stripcmd="$stripprog"
+	    shift
+	    continue;;
+
+	*)  if [ x"$src" = x ]
+	    then
+		src=$1
+	    else
+		dst=$1
+	    fi
+	    shift
+	    continue;;
+    esac
+done
+
+if [ x"$src" = x ]
+then
+	echo "install:  no input file specified"
+	exit 1
+fi
+
+if [ x"$dst" = x ]
+then
+	echo "install:  no destination specified"
+	exit 1
+fi
+
+
+# If destination is a directory, append the input filename; if your system
+# does not like double slashes in filenames, you may need to add some logic
+
+if [ -d $dst ]
+then
+	dst="$dst"/`basename $src`
+fi
+
+# Make a temp file name in the proper directory.
+
+dstdir=`dirname $dst`
+dsttmp=$dstdir/#inst.$$#
+
+# Move or copy the file name to the temp name
+
+$doit $instcmd $src $dsttmp
+
+# and set any options; do chmod last to preserve setuid bits
+
+if [ x"$chowncmd" != x ]; then $doit $chowncmd $dsttmp; fi
+if [ x"$chgrpcmd" != x ]; then $doit $chgrpcmd $dsttmp; fi
+if [ x"$stripcmd" != x ]; then $doit $stripcmd $dsttmp; fi
+if [ x"$chmodcmd" != x ]; then $doit $chmodcmd $dsttmp; fi
+
+# Now rename the file to the real destination.
+
+$doit $rmcmd $dst
+$doit $mvcmd $dsttmp $dst
+
+
+exit 0

mozilla/build/autoconf/libIDL.m4

@@ -0,0 +1,198 @@
+# Configure paths for LIBIDL
+
+dnl AM_PATH_LIBIDL([MINIMUM-VERSION, [ACTION-IF-FOUND [, ACTION-IF-NOT-FOUND [, MODULES]]]])
+dnl Test for LIBIDL, and define LIBIDL_CFLAGS and LIBIDL_LIBS
+dnl
+AC_DEFUN(AM_PATH_LIBIDL,
+[dnl 
+dnl Get the cflags and libraries from the libIDL-config script
+dnl
+AC_ARG_WITH(libIDL-prefix,[  --with-libIDL-prefix=PFX
+                          Prefix where libIDL is installed (optional)],
+            libIDL_config_prefix="$withval", libIDL_config_prefix="")
+AC_ARG_WITH(libIDL-exec-prefix,[  --with-libIDL-exec-prefix=PFX
+                          Exec prefix where libIDL is installed (optional)],
+            libIDL_config_exec_prefix="$withval", libIDL_config_exec_prefix="")
+AC_ARG_ENABLE(libIDLtest, [  --disable-libIDLtest    Do not try to compile and run a test libIDL program],
+		    , enable_libIDLtest=yes)
+
+  if test x$libIDL_config_exec_prefix != x ; then
+     libIDL_config_args="$libIDL_config_args --exec-prefix=$libIDL_config_exec_prefix"
+     if test x${LIBIDL_CONFIG+set} != xset ; then
+        LIBIDL_CONFIG=$libIDL_config_exec_prefix/bin/libIDL-config
+     fi
+  fi
+  if test x$libIDL_config_prefix != x ; then
+     libIDL_config_args="$libIDL_config_args --prefix=$libIDL_config_prefix"
+     if test x${LIBIDL_CONFIG+set} != xset ; then
+        LIBIDL_CONFIG=$libIDL_config_prefix/bin/libIDL-config
+     fi
+  fi
+
+  AM_PATH_GLIB(1.2.0)
+
+  dnl Force a version check to keep upgraded versions from being overridden by the cached value.
+  unset ac_cv_path_LIBIDL_CONFIG
+
+  AC_PATH_PROG(LIBIDL_CONFIG, libIDL-config, no)
+  min_libIDL_version=ifelse([$1], ,0.6.0,$1)
+  AC_MSG_CHECKING(for libIDL - version >= $min_libIDL_version)
+  no_libIDL=""
+  if test "$LIBIDL_CONFIG" = "no" ; then
+    no_libIDL=yes
+  else
+    LIBIDL_CFLAGS=`$LIBIDL_CONFIG $libIDL_config_args --cflags`
+    LIBIDL_LIBS=`$LIBIDL_CONFIG $libIDL_config_args --libs`
+    # hack to allow us to keep using libIDL 0.6.3-0.6.7. Anyone may remove
+    # this after we start requiring libIDL 0.6.8 or anything higher
+    LIBIDL_CFLAGS="$GLIB_CFLAGS $LIBIDL_CFLAGS"
+    LIBIDL_LIBS="$GLIB_LIBS $LIBIDL_LIBS"
+    libIDL_config_major_version=`$LIBIDL_CONFIG $libIDL_config_args --version | \
+           sed 's/\([[0-9]]*\).\([[0-9]]*\).\([[0-9]]*\)/\1/'`
+    libIDL_config_minor_version=`$LIBIDL_CONFIG $libIDL_config_args --version | \
+           sed 's/\([[0-9]]*\).\([[0-9]]*\).\([[0-9]]*\)/\2/'`
+    libIDL_config_micro_version=`$LIBIDL_CONFIG $libIDL_config_args --version | \
+           sed 's/\([[0-9]]*\).\([[0-9]]*\).\([[0-9]]*\)/\3/'`
+    if test "x$enable_libIDLtest" = "xyes" ; then
+      ac_save_CFLAGS="$CFLAGS"
+      ac_save_LIBS="$LIBS"
+      CFLAGS="$CFLAGS $LIBIDL_CFLAGS"
+      LIBS="$LIBIDL_LIBS $LIBS"
+dnl
+dnl Now check if the installed LIBIDL is sufficiently new.
+dnl
+      rm -f conf.libIDLtest
+      AC_TRY_RUN([
+#include <stdio.h>
+#include <stdlib.h>
+#include <libIDL/IDL.h>
+
+int 
+main ()
+{
+  int major, minor, micro;
+  int libIDL_major_version;
+  int libIDL_minor_version;
+  int libIDL_micro_version;
+  char *tmp_version;
+
+  system ("touch conf.libIDLtest");
+
+  /* HP/UX 9 (%@#!) writes to sscanf strings */
+  tmp_version = g_strdup ("$min_libIDL_version");
+  if (sscanf(tmp_version, "%d.%d.%d", &major, &minor, &micro) != 3) {
+     printf("%s, bad version string\n", "$min_libIDL_version");
+     exit(1);
+  }
+  tmp_version = g_strdup (IDL_get_libver_string ());
+  if (sscanf(tmp_version, "%d.%d.%d",
+	     &libIDL_major_version,
+	     &libIDL_minor_version,
+	     &libIDL_micro_version) != 3) {
+     printf("%s, bad version string\n", tmp_version);
+     exit(1);
+  }
+
+  if ((libIDL_major_version != $libIDL_config_major_version) ||
+      (libIDL_minor_version != $libIDL_config_minor_version) ||
+      (libIDL_micro_version != $libIDL_config_micro_version))
+    {
+      printf("\n*** 'libIDL-config --version' returned %d.%d.%d, but libIDL (%d.%d.%d)\n", 
+             $libIDL_config_major_version, $libIDL_config_minor_version, $libIDL_config_micro_version,
+             libIDL_major_version, libIDL_minor_version, libIDL_micro_version);
+      printf ("*** was found! If libIDL-config was correct, then it is best\n");
+      printf ("*** to remove the old version of LIBIDL. You may also be able to fix the error\n");
+      printf("*** by modifying your LD_LIBRARY_PATH enviroment variable, or by editing\n");
+      printf("*** /etc/ld.so.conf. Make sure you have run ldconfig if that is\n");
+      printf("*** required on your system.\n");
+      printf("*** If libIDL-config was wrong, set the environment variable LIBIDL_CONFIG\n");
+      printf("*** to point to the correct copy of libIDL-config, and remove the file config.cache\n");
+      printf("*** before re-running configure\n");
+    } 
+  else if ((libIDL_major_version != LIBIDL_MAJOR_VERSION) ||
+	   (libIDL_minor_version != LIBIDL_MINOR_VERSION) ||
+           (libIDL_micro_version != LIBIDL_MICRO_VERSION))
+    {
+      printf("\n*** libIDL header files (version %d.%d.%d) do not match\n",
+	     LIBIDL_MAJOR_VERSION, LIBIDL_MINOR_VERSION, LIBIDL_MICRO_VERSION);
+      printf("*** library (version %d.%d.%d)\n",
+	     libIDL_major_version, libIDL_minor_version, libIDL_micro_version);
+    }
+  else
+    {
+      if ((libIDL_major_version > major) ||
+        ((libIDL_major_version == major) && (libIDL_minor_version > minor)) ||
+        ((libIDL_major_version == major) && (libIDL_minor_version == minor) && (libIDL_micro_version >= micro)))
+      {
+        return 0;
+       }
+     else
+      {
+        printf("\n*** An old version of libIDL (%d.%d.%d) was found.\n",
+               libIDL_major_version, libIDL_minor_version, libIDL_micro_version);
+        printf("*** You need at least libIDL version %d.%d.%d.\n",
+               major, minor, micro);
+        printf("***\n");
+        printf("*** If you have already installed a sufficiently new version, this error\n");
+        printf("*** probably means that the wrong copy of the libIDL-config shell script is\n");
+        printf("*** being found. The easiest way to fix this is to remove the old version\n");
+        printf("*** of libIDL, but you can also set the LIBIDL_CONFIG environment to point to the\n");
+        printf("*** correct copy of libIDL-config. (In this case, you will have to\n");
+        printf("*** modify your LD_LIBRARY_PATH enviroment variable, or edit /etc/ld.so.conf\n");
+        printf("*** so that the correct libraries are found at run-time))\n");
+      }
+    }
+  return 1;
+}
+],, no_libIDL=yes,[echo $ac_n "cross compiling; assumed OK... $ac_c"])
+       CFLAGS="$ac_save_CFLAGS"
+       LIBS="$ac_save_LIBS"
+     fi
+  fi
+  if test "x$no_libIDL" = x ; then
+     AC_MSG_RESULT(yes)
+     ifelse([$2], , :, [$2])     
+  else
+     AC_MSG_RESULT(no)
+     if test "$LIBIDL_CONFIG" = "no" ; then
+       echo "*** The libIDL-config script installed by libIDL could not be found"
+       echo "*** If libIDL was installed in PREFIX, make sure PREFIX/bin is in"
+       echo "*** your path, or set the LIBIDL_CONFIG environment variable to the"
+       echo "*** full path to libIDL-config."
+     else
+       if test -f conf.libIDLtest ; then
+        :
+       else
+          echo "*** Could not run libIDL test program, checking why..."
+          CFLAGS="$CFLAGS $LIBIDL_CFLAGS"
+          LIBS="$LIBS $LIBIDL_LIBS"
+          AC_TRY_LINK([
+#include <stdio.h>
+#include <stdlib.h>
+#include <libIDL/IDL.h>
+],      [ return IDL_get_libver_string ? 1 : 0; ],
+        [ echo "*** The test program compiled, but did not run. This usually means"
+          echo "*** that the run-time linker is not finding libIDL or finding the wrong"
+          echo "*** version of LIBIDL. If it is not finding libIDL, you'll need to set your"
+          echo "*** LD_LIBRARY_PATH environment variable, or edit /etc/ld.so.conf to point"
+          echo "*** to the installed location  Also, make sure you have run ldconfig if that"
+          echo "*** is required on your system"
+	  echo "***"
+          echo "*** If you have an old version installed, it is best to remove it, although"
+          echo "*** you may also be able to get things to work by modifying LD_LIBRARY_PATH" ],
+        [ echo "*** The test program failed to compile or link. See the file config.log for the"
+          echo "*** exact error that occured. This usually means libIDL was incorrectly installed"
+          echo "*** or that you have moved libIDL since it was installed. In the latter case, you"
+          echo "*** may want to edit the libIDL-config script: $LIBIDL_CONFIG" ])
+          CFLAGS="$ac_save_CFLAGS"
+          LIBS="$ac_save_LIBS"
+       fi
+     fi
+     LIBIDL_CFLAGS=""
+     LIBIDL_LIBS=""
+     ifelse([$3], , :, [$3])
+  fi
+  AC_SUBST(LIBIDL_CFLAGS)
+  AC_SUBST(LIBIDL_LIBS)
+  rm -f conf.libIDLtest
+])

mozilla/build/autoconf/make-makefile

@@ -0,0 +1,279 @@
+#! /usr/bin/env perl
+# The contents of this file are subject to the Netscape Public
+# License Version 1.1 (the "License"); you may not use this file
+# except in compliance with the License. You may obtain a copy of
+# the License at http://www.mozilla.org/NPL/
+#
+# Software distributed under the License is distributed on an "AS
+# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express or
+# implied. See the License for the specific language governing
+# rights and limitations under the License.
+#
+# The Original Code is mozilla.org code.
+#
+# The Initial Developer of the Original Code is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1999 Netscape Communications Corporation. All
+# Rights Reserved.
+#
+# Contributor(s): 
+#
+
+# make-makefiles - Quickly create Makefiles for subdirectories.
+#      Also, creates any needed subdirectories.
+#
+# usage: make-makefiles [ -t <topsrcdir> -d <depth> ] [ <subdir> | <subdir>/Makefile ] ...
+
+# Send comments, improvements, bugs to Steve Lamm (slamm@netscape.com).
+
+#$debug = 1;
+
+# Determine various tree path variables
+#
+($topsrcdir, $depth, @makefiles) = parse_arguments(@ARGV);
+
+$object_fullpath = `pwd`;
+chdir $depth;
+$object_root = `pwd`;
+chomp $object_fullpath;
+chomp $object_root;
+
+# $source_subdir is the path from the object root to where
+#    'make-makefile' was called. For example, if make-makefile was
+#    called from "mozilla/gfx/src", then $source_subdir would be
+#    "gfx/src/".
+$source_subdir = "$object_fullpath/";
+$source_subdir =~ s|^$object_root/||;
+
+# Prefix makefiles with $source_subdir so that paths
+# will be relative to the top of the object tree.
+#
+for $makefile (@makefiles) {
+  $makefile = "$source_subdir$makefile";
+}
+
+create_directories(@makefiles);
+
+# Find the path to the source directory based on how 'make-makefile'
+#  was invoked. The path is either relative to the object directory
+#  or an absolute path.
+$given_srcdir = find_srcdir($topsrcdir, $depth);
+
+if ($debug) {
+  warn "object_fullpath = $object_fullpath\n";
+  warn "object_root     = $object_root\n";
+  warn "source_subdir   = $source_subdir\n";
+  warn "makefiles       = @makefiles\n";
+  warn "given_srcdir    = $given_srcdir\n";
+}
+
+@unhandled = update_makefiles($given_srcdir, @makefiles);
+
+run_config_status(@unhandled);
+
+# end of Main
+############################################################
+
+sub dirname {
+ return $_[0] =~ /(.*)\/.*/ ? "$1" : '.';
+}
+
+# find_depth: Pull the value of DEPTH out of a Makefile (or Makefile.in)
+sub find_depth {
+  my $depth = '';
+  open(MAKEFILE, "<$_[0]") || die "Unable to open $_[0]: $!\n";
+  while (<MAKEFILE>) {
+    next unless /^DEPTH\s*=\s*(\..*)/;
+    $depth = $1;
+    last;
+  }
+  close MAKEFILE;
+  return $depth;
+}
+
+sub parse_arguments {
+  my @args = @_;
+  my $depth = '';
+  my $topsrcdir = '';
+  my @makefiles = ();
+
+  while (1) {
+    if ($args[0] eq '-d') {
+      $depth = $args[1];
+      shift @args; 
+      shift @args; 
+    } elsif ($args[0] eq '-t') {
+      $topsrcdir = $args[1];
+      shift @args; 
+      shift @args; 
+    } else {
+      last;
+    }
+  }
+
+  if ($topsrcdir eq '') {
+    $topsrcdir = $0; # Figure out topsrcdir based on program name.
+    $topsrcdir =~ s|/?build/autoconf/.*$||;
+  }
+  if ($depth eq '') {
+    # Use $(DEPTH) in the Makefile or Makefile.in to determine the depth
+    if (-e "Makefile.in") {
+      $depth = find_depth("Makefile.in");
+    } elsif (-e "Makefile") {
+      $depth = find_depth("Makefile");
+    } elsif (-e "../Makefile") {
+      $depth = "../".find_depth("../Makefile");
+      $depth =~ s/\/\.$//;
+    } else {
+      warn "Unable to determine depth (e.g. ../..) to root of objdir tree.\n";
+      die  "No Makefile(.in) present. Try running with '-d <depth>'\n";
+    }
+  } 
+
+  # Build the list of makefiles to generate
+  #
+  @makefiles = ();
+  my $makefile;
+  foreach $makefile (@args) {
+    $makefile =~ s/\.in$//;
+    $makefile =~ s/\/$//;
+    $makefile =~ /Makefile$/ or $makefile .= "/Makefile";
+    push @makefiles, "$makefile";
+  }
+  @makefiles = "Makefile" unless @args;
+
+  return ($topsrcdir, $depth, @makefiles);
+}
+
+
+# Create all the directories at once.
+#   This can be much faster than calling mkdir() for each one.
+sub create_directories {
+  my @makefiles = @_;
+  my @dirs = ();
+  my $ac_file;
+  foreach $ac_file (@makefiles) {
+    push @dirs, dirname($ac_file);
+  }
+  # Call mkdir with the directories sorted by subdir count (how many /'s)
+  system "mkdir -p ". join(' ', @dirs) if @dirs;
+}
+
+# Find the top of the source directory
+# (Assuming that the executable is in $top_srcdir/build/autoconf)
+sub find_srcdir {
+  my ($ac_given_srcdir, $depth) = @_;
+
+  if ($debug) {
+    print "ac_given_srcdir = $ac_given_srcdir\n";
+    print "depth           = $depth\n";
+  }
+  if ($ac_given_srcdir =~ /^\./ and $depth ne '.') {
+    my $quoted_depth = quotemeta($depth);
+    $ac_given_srcdir =~ s|^$quoted_depth/?||;
+  }
+  if ($debug) {
+    print "ac_given_srcdir = $ac_given_srcdir\n";
+  }
+  $ac_given_srcdir = '.' if $ac_given_srcdir eq '';
+  return $ac_given_srcdir;
+}
+
+# Output the makefiles.
+#
+sub update_makefiles {
+  my ($ac_given_srcdir, @makefiles) = @_;
+  my @unhandled=();
+
+  my $ac_file;
+  foreach $ac_file (@makefiles) {
+    my $ac_file_in    = "$ac_given_srcdir/${ac_file}.in";
+    my $ac_dir        = dirname($ac_file);
+    my $ac_dots       = '';
+    my $ac_dir_suffix = '';
+    my $srcdir        = '.';
+    my $top_srcdir    = '.';
+
+    # Determine $srcdir and $top_srcdir
+    #
+    if ($ac_dir ne '.') {
+      $ac_dir_suffix = "/$ac_dir";
+      $ac_dir_suffix =~ s%^/\./%/%;
+      $ac_dots = $ac_dir_suffix;
+      $ac_dots =~ s%/[^/]*%../%g;
+    }
+    if ($ac_given_srcdir eq '.') {
+      if ($ac_dots ne '') {
+        $top_srcdir = $ac_dots;
+        $top_srcdir =~ s%/$%%;
+      }
+    } elsif ($ac_given_srcdir =~ m%^/%) {
+      $srcdir     = "$ac_given_srcdir$ac_dir_suffix";
+      $top_srcdir = "$ac_given_srcdir";
+    } else {
+      $srcdir     = "$ac_dots$ac_given_srcdir$ac_dir_suffix";
+      $top_srcdir = "$ac_dots$ac_given_srcdir";
+    }
+
+    if ($debug) {
+      print "ac_dir     = $ac_dir\n";
+      print "ac_file    = $ac_file\n";
+      print "ac_file_in = $ac_file_in\n";
+      print "srcdir     = $srcdir\n";
+      print "top_srcdir = $top_srcdir\n";
+      print "cwd        = " . `pwd` . "\n";
+    }
+
+    # Copy the file and make substitutions.
+    #    @srcdir@     -> value of $srcdir
+    #    @top_srcdir@ -> value of $top_srcdir
+    #
+    if (-e $ac_file) {
+      next if -M _ < -M $ac_file_in;  # Next if Makefile is up-to-date.
+      warn "updating $ac_file\n";
+    } else {
+      warn "creating $ac_file\n";
+    }
+
+    open INFILE, "<$ac_file_in" or do {
+      warn "$0: Cannot read $ac_file_in: No such file or directory\n";
+      next;
+    };
+    open OUTFILE, ">$ac_file" or do {
+      warn "$0: Unable to create $ac_file\n";
+      next;
+    };
+
+    while (<INFILE>) {
+      if (/\@[_a-zA-Z]*\@.*\@[_a-zA-Z]*\@/) {
+        #warn "Two defines on a line:$ac_file:$.:$_";
+        push @unhandled, $ac_file;
+        last;
+      }
+
+      s/\@srcdir\@/$srcdir/;
+      s/\@top_srcdir\@/$top_srcdir/;
+
+      if (/\@[_a-zA-Z]*\@/) {
+        #warn "Unknown variable:$ac_file:$.:$_";
+        push @unhandled, $ac_file;
+        last;
+      }
+      print OUTFILE;
+    }
+    close INFILE;
+    close OUTFILE;
+  }
+  return @unhandled;
+}
+
+sub run_config_status {
+  my @unhandled = @_;
+
+  # Run config.status with any unhandled files.
+  #
+  if (@unhandled) {
+    $ENV{CONFIG_FILES}= join ' ', @unhandled;
+    system "./config.status";
+  }
+}

mozilla/build/autoconf/match-dir.sh

@@ -0,0 +1,85 @@
+#!/bin/sh
+#
+# The contents of this file are subject to the Netscape Public
+# License Version 1.1 (the "License"); you may not use this file
+# except in compliance with the License. You may obtain a copy of
+# the License at http://www.mozilla.org/NPL/
+#
+# Software distributed under the License is distributed on an "AS
+# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express or
+# implied. See the License for the specific language governing
+# rights and limitations under the License.
+#
+# The Original Code is mozilla.org code.
+#
+# The Initial Developer of the Original Code is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation. All
+# Rights Reserved.
+#
+# Contributor(s): 
+#
+
+#
+# This script will match a dir with a set of dirs.
+#
+# Usage: match-dir.sh match [dir1 dir2 ... dirn]
+#
+# Send comments, improvements, bugs to ramiro@netscape.com
+# 
+
+if [ -f Makefile ]; then
+	MAKEFILE="Makefile"
+else
+	if [ -f Makefile.in ]; then
+		MAKEFILE="Makefile.in"
+	else
+		echo
+		echo "There ain't no 'Makefile' or 'Makefile.in' over here: $pwd, dude."
+		echo
+		exit 1
+	fi
+fi
+
+# Use DEPTH in the Makefile.in to determine the depth
+depth=`grep -w DEPTH ${MAKEFILE}  | grep "\.\." | awk -F"=" '{ print $2; }'`
+cwd=`pwd`
+
+# Determine the depth count
+n=`echo $depth | tr '/' ' ' | wc -w`
+
+cd $depth
+objdir=`pwd`
+
+path=`echo $cwd | sed "s|^${objdir}/||"`
+
+match=$path
+
+for i in $*
+do
+#	echo "Looking for $match in $i"
+
+	echo $i | grep -q -x $match
+
+	if [ $? -eq 0 ]
+	then
+		echo "1"
+
+		exit 0
+	fi
+
+#	echo "Looking for $i in $match"
+
+	echo $match | grep -q $i
+
+	if [ $? -eq 0 ]
+	then
+		echo "1"
+
+		exit 0
+	fi
+done
+
+echo "0"
+
+exit 0

mozilla/build/autoconf/mozconfig-find

@@ -0,0 +1,46 @@
+#! /bin/sh
+#
+# The contents of this file are subject to the Netscape Public
+# License Version 1.1 (the "License"); you may not use this file
+# except in compliance with the License. You may obtain a copy of
+# the License at http://www.mozilla.org/NPL/
+#
+# Software distributed under the License is distributed on an "AS
+# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express or
+# implied. See the License for the specific language governing
+# rights and limitations under the License.
+#
+# The Original Code is mozilla.org code.
+#
+# The Initial Developer of the Original Code is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1999 Netscape Communications Corporation. All
+# Rights Reserved.
+#
+# Contributor(s): Stephen Lamm <slamm@netscape.com>
+#
+
+# mozconfigfind - Loads options from .mozconfig onto configure's
+#    command-line. The .mozconfig file is searched for in the 
+#    order:
+#       if $MOZCONFIG is set, use that.
+#       Otherwise, use $TOPSRCDIR/.mozconfig
+#       Otherwise, use $HOME/.mozconfig
+#
+topsrcdir=$1
+
+for _config in $MOZCONFIG \
+               $MOZ_MYCONFIG \
+               $topsrcdir/.mozconfig \
+               $topsrcdir/mozconfig \
+               $topsrcdir/mozconfig.sh \
+               $topsrcdir/myconfig.sh \
+               $HOME/.mozconfig \
+               $HOME/.mozconfig.sh \
+               $HOME/.mozmyconfig.sh
+do
+  if test -f $_config; then
+    echo $_config;
+    exit 0
+  fi
+done

mozilla/build/autoconf/mozconfig2client-mk

@@ -0,0 +1,94 @@
+#! /bin/sh
+#
+# The contents of this file are subject to the Netscape Public
+# License Version 1.1 (the "License"); you may not use this file
+# except in compliance with the License. You may obtain a copy of
+# the License at http://www.mozilla.org/NPL/
+#
+# Software distributed under the License is distributed on an "AS
+# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express or
+# implied. See the License for the specific language governing
+# rights and limitations under the License.
+#
+# The Original Code is mozilla.org code.
+#
+# The Initial Developer of the Original Code is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1999 Netscape Communications Corporation. All
+# Rights Reserved.
+#
+# Contributor(s): Stephen Lamm <slamm@netscape.com>
+#
+
+# mozconfig2client-mk - Translates .mozconfig into options for client.mk.
+#    Prints defines to stdout.
+#
+# See mozconfig2configure for more details
+
+print_header() {
+  _mozconfig=${MOZCONFIG:-$HOME/.mozconfig}
+  cat >> $tmp_file <<EOF
+# gmake
+# This file is automatically generated for client.mk.
+# Do not edit. Edit $_mozconfig instead.
+# To create a new .mozconfig file, you can visit,
+#   http://webtools.mozilla.org/build/config.cgi
+
+EOF
+}
+
+ac_add_options() {
+  echo "# $* is used by configure (not client.mk)" >> $tmp_file
+}
+
+mk_add_options() {
+  for _opt
+  do
+    # Escape shell characters, space, tab, dollar, quote, backslash,
+    # and substitute '@<word>@' with '$(<word>)'.
+    _opt=`echo "$_opt" | sed -e 's/\([\"\\]\)/\\\1/g; s/@\([^@]*\)@/\$(\1)/g;'`
+    echo $_opt;
+    opts="${opts:+$opts^}$_opt";
+  done >> $tmp_file
+}
+
+mk_echo_options() {
+  echo "Adding client.mk options from $MOZCONFIG:"
+  IFS=^
+  for _opt in $opts; do
+    echo "    $_opt"
+  done
+}
+
+# Main
+#--------------------------------------------------
+
+scriptdir=`dirname $0`
+topsrcdir=$1
+out_file=$2
+tmp_file="$out_file-tmp$$"
+opts=""
+
+trap "rm -f $tmp_file; exit 1" 1 2 15
+
+MOZCONFIG=`$scriptdir/mozconfig-find $topsrcdir`
+
+print_header > $tmp_file
+
+# If the path changes, configure should be rerun
+echo "# PATH=$PATH" >> $tmp_file
+
+if [ "$MOZCONFIG" ]
+then
+  . $MOZCONFIG
+fi
+
+if [ "$opts" ]; then
+  mk_echo_options
+fi
+
+if test -f $out_file && cmp -s $tmp_file $out_file; then
+  rm $tmp_file
+else
+  mv -f $tmp_file $out_file
+fi

mozilla/build/autoconf/mozconfig2configurator

@@ -0,0 +1,70 @@
+#! /bin/sh
+#
+# The contents of this file are subject to the Netscape Public
+# License Version 1.1 (the "License"); you may not use this file
+# except in compliance with the License. You may obtain a copy of
+# the License at http://www.mozilla.org/NPL/
+#
+# Software distributed under the License is distributed on an "AS
+# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express or
+# implied. See the License for the specific language governing
+# rights and limitations under the License.
+#
+# The Original Code is mozilla.org code.
+#
+# The Initial Developer of the Original Code is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1999 Netscape Communications Corporation. All
+# Rights Reserved.
+#
+# Contributor(s): Stephen Lamm (slamm@netscape.com)
+#
+
+# mozconfig2configurator - Translates .mozconfig into options for
+#    the online configurator,
+#
+#        http://webtools.mozilla.org/build/config.cgi
+#    
+#   This is called by the 'webconfig' target of mozilla/client.mk
+#
+
+ac_add_options() {
+  for _opt
+  do
+    # Escape special url characters
+    _opt=`echo $_opt | sed -e 's/%/%25/g;s/ /%20/g;s/&/%26/g;'`
+    case "$_opt" in
+      --*-*= ) url="$url$_opt&"     ;;
+      --*-* )  url="$url$_opt=yes&" ;;
+    esac
+  done
+}
+
+mk_add_options() {
+  for _opt
+  do
+    # Escape special url characters
+    # Escape special url characters
+    _opt=`echo $_opt | sed -e 's/%/%25/g;s/ /%20/g;s/&/%26/g;'`
+    url="$url$_opt&"
+  done
+}
+
+#
+# main
+#
+
+# find-mozconfig.sh 
+#   In params:   $MOZCONFIG $HOME ($MOZ_MYCONFIG)
+scriptdir=`dirname $0`
+MOZCONFIG=`$scriptdir/mozconfig-find $topsrcdir`
+
+if [ "$MOZCONFIG" ]
+then
+  url="http://webtools.mozilla.org/build/config.cgi?"
+  . $MOZCONFIG
+
+  # Drop the last character of $url
+  echo `expr "$url" : "\(.*\)."`
+fi
+

mozilla/build/autoconf/mozconfig2configure

@@ -0,0 +1,99 @@
+#! /bin/sh
+#
+# The contents of this file are subject to the Netscape Public
+# License Version 1.1 (the "License"); you may not use this file
+# except in compliance with the License. You may obtain a copy of
+# the License at http://www.mozilla.org/NPL/
+#
+# Software distributed under the License is distributed on an "AS
+# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express or
+# implied. See the License for the specific language governing
+# rights and limitations under the License.
+#
+# The Original Code is mozilla.org code.
+#
+# The Initial Developer of the Original Code is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1999 Netscape Communications Corporation. All
+# Rights Reserved.
+#
+# Contributor(s): Stephen Lamm <slamm@netscape.com>
+#
+
+# mozconfig2configure - Loads options from .mozconfig onto configure's
+#    command-line. See find-mozconfig.sh for how the config file is
+#    found
+#
+#    The options from .mozconfig are inserted into the command-line
+#    before the real command-line options. This way the real options
+#    will override any .mozconfig options.
+#
+# .mozconfig is a shell script. To add an option to configure's
+#    command-line use the pre-defined function, ac_add_options,
+#
+#       ac_add_options  <configure-option> [<configure-option> ... ]
+#
+#    For example,
+#
+#       ac_add_options --with-pthreads --enable-debug
+#
+# ac_add_options can be called multiple times in .mozconfig.
+#    Each call adds more options to configure's command-line.
+
+# Note: $_AUTOCONF_TOOLS_DIR must be defined in the script that includes this.
+
+ac_add_options() {
+  for _opt
+  do
+    # Escape shell characters, space, tab, dollar, quote, backslash.
+    _opt=`echo $_opt | sed -e 's/\([\ \	\$\"\\]\)/\\\\\1/g;s/@\([^@]*\)@/\$\1/g;'`
+    _opt=`echo $_opt | sed -e 's/@\([^@]*\)@/\$(\1)/g'`
+
+    # Avoid adding duplicates
+    case "$ac_options" in
+      *"$_opt"* ) ;;
+      * ) mozconfig_ac_options="$mozconfig_ac_options $_opt" ;;
+    esac
+  done
+}
+
+mk_add_options() {
+  # These options are for client.mk
+  # configure can safely ignore them.
+  :
+}
+
+ac_echo_options() {
+  echo "Adding configure options from $MOZCONFIG:"
+  eval "set -- $mozconfig_ac_options"
+  for _opt
+  do
+    echo "  $_opt"
+  done
+}
+
+# Main
+#--------------------------------------------------
+_topsrcdir=`dirname $0`
+ac_options=
+mozconfig_ac_options=
+
+# Save the real command-line options
+for _opt
+do
+  # Escape shell characters, space, tab, dollar, quote, backslash.
+  _opt=`echo $_opt | sed -e 's/\([\ \	\$\"\\]\)/\\\\\1/g;'`
+  ac_options="$ac_options \"$_opt\""
+done
+
+MOZCONFIG=`$_AUTOCONF_TOOLS_DIR/mozconfig-find $_topsrcdir`
+if [ "$MOZCONFIG" ]; then
+  . $MOZCONFIG
+fi
+
+if [ "$mozconfig_ac_options" ]; then
+  ac_echo_options 1>&2
+fi
+
+eval "set -- $mozconfig_ac_options $ac_options"
+

mozilla/build/autoconf/update-makefile.sh

@@ -0,0 +1,102 @@
+#!/bin/sh
+#
+# The contents of this file are subject to the Netscape Public
+# License Version 1.1 (the "License"); you may not use this file
+# except in compliance with the License. You may obtain a copy of
+# the License at http://www.mozilla.org/NPL/
+#
+# Software distributed under the License is distributed on an "AS
+# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express or
+# implied. See the License for the specific language governing
+# rights and limitations under the License.
+#
+# The Original Code is mozilla.org code.
+#
+# The Initial Developer of the Original Code is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation. All
+# Rights Reserved.
+#
+# Contributor(s): 
+#
+
+#
+# This script will generate a single Makefile from a Makefile.in using
+# the config.status script.
+#
+# The config.status script is generated the first time you run 
+# ./configure.
+#
+#
+# Usage: update-makefile.sh
+#
+# Send comments, improvements, bugs to ramiro@netscape.com
+# 
+
+update_makefile_usage() {
+  _progname=`expr //$0 : '.*/\(.*\)'`
+  cat <<END_USAGE 2>&1
+
+Usage: $_progname [-h -u] [<keyword>]
+     -d <dir>     Subdir to update
+     -h           Print usage
+END_USAGE
+}
+
+# Parse the command-line options
+#
+subdir=
+while getopts d:h OPT; do
+    case $OPT in
+       d) # Make sure "subdir" has exactly one ending slash
+          subdir=`echo $OPTARG | sed 's/\/$//;'`"/" ;;
+    \?|h) update_makefile_usage
+          exit 1
+          ;;
+    esac
+done
+
+
+# find_depth: Pull the value of DEPTH out of Makefile (or Makefile.in)
+find_depth() {
+  egrep '^DEPTH[ 	]*=[ 	]*\.' $1 | awk -F= '{ print $2; }'
+}
+
+# The Makefile to create
+target_makefile=`pwd`"/${subdir}Makefile"
+
+# Use $(DEPTH) in the Makefile or Makefile.in to determine the depth
+if [ -f Makefile.in ]
+then
+    depth=`find_depth Makefile.in`
+elif [ -f Makefile ]
+then
+    depth=`find_depth Makefile`
+elif [ -f ../Makefile ]
+then
+    depth="../"`find_depth Makefile`
+else
+    echo
+    echo "There ain't no 'Makefile' or 'Makefile.in' over here: $pwd"
+    echo
+    exit
+fi
+
+# 'cd' to the root of the tree to run "config.status" there
+cd $depth
+
+# Strip the tree root off the Makefile's path
+#
+root_path=`pwd`
+target_makefile=`expr $target_makefile : $root_path'/\(.*\)'`
+
+# Make sure config.status exists
+#
+if [ -f config.status ]
+then
+    CONFIG_FILES=$target_makefile ./config.status
+else
+    echo
+    echo "There ain't no 'config.status' over here: $pwd"
+    echo
+fi

mozilla/build/bloaturls.txt

@@ -0,0 +1,6 @@
+http://www.mozilla.org
+ftp://ftp.mozilla.org
+resource:///res/samples/test2.html
+resource:///res/samples/test8.html
+resource:///res/samples/test6.html
+resource:///res/samples/test8.html

mozilla/build/build_number

@@ -0,0 +1 @@
+0000000000

mozilla/build/file_migrate.pl

@@ -0,0 +1,292 @@
+#!perl -w
+
+# This script copies modified files from a source CVS tree to a destination
+# tree. Modified files are detected by comparing their modification dates
+# with the CVS Entries file.
+# 
+# Modified files are copied in their entirety to the destination tree
+# (no diffing is done). Files are only copied of the CVS version of the
+# file is the same in both trees. If the destination file is modified
+# already, it is backed up and replaced.
+# 
+# To use this on your tree/platform, do the following:
+# 
+# 1. Fix the !perl line, if necessary.
+# 2. Fix $dirsep to be the directory separator on your platform.
+# 3. Uncomment the appropriate $dst_linebreaks file specify what linebreaks
+#    you want for the copied files. This variable defines the *destination* linebreaks 
+#    that you want your changes to be converted to.
+#    For example, if you have a linux volume 
+#    mounted (via SAMBA perhaps) to your windows box where you've made changes to 
+#    source files, you'd want $dst_linebreaks to be set for unix. This ensures that 
+#    linebreaks are converted to the appropriate OS linebreak scheme for your *target* tree.
+# 4. Set $src_tree and $dest_tree to point to the directories you want
+#    to sync up. These don't have to point to the root of the tree,
+#    but should be equivalent directories in the two trees.
+#    
+# First version:
+#     Simon Fraser <sfraser@netscape.com>
+
+use File::stat;
+use Time::Local;
+
+# change for your platform ('\' == windows, ':' == mac, '/' == unix)
+$dirsep = "\\";
+
+# Set this to the native OS of the *destination* tree
+# $dst_linebreaks = pack("cc", 13);           # Mac
+#$dst_linebreaks = pack("cc", 13, 10);       # DOS
+$dst_linebreaks = pack("cc", 10);           # UNIX
+
+#change for your src and dest trees
+$src_tree =  "x:\\mozilla\\xpfe\\components";
+$dest_tree = "h:\\builds\\mozilla\\xpfe\\components";
+
+
+#//--------------------------------------------------------------------------------------------------
+#// _copyFile. Copy file from src to dest, converting linebreaks if necessary
+#//--------------------------------------------------------------------------------------------------
+sub _copyFile($;$;$;$)
+{
+    my($srcdir, $destdir, $file, $backup) = @_;
+
+    my($srcfile) = $srcdir.$dirsep.$file;
+    my($dstfile) = $destdir.$dirsep.$file;
+    
+    if ($backup)
+    {
+        my($counter) = 0;
+        
+        while (-f $dstfile."-".$counter)
+        {
+            $counter ++;
+        }
+        
+        rename($dstfile, $dstfile."-".$counter) or die "Failed to rename file\n";
+    }
+    
+    print "Copying $file over to dest\n";
+
+    my($newdest) = $dstfile."_temp";
+    
+    open(SRCFILE, "< $srcfile")     or die "Can't open source file $srcfile\n";
+    open(NEWDEST, "> $newdest")     or die "Can't open dest file $newdest\n";
+    
+    while (<SRCFILE>)
+    {
+        chomp($_);
+        print NEWDEST $_.$dst_linebreaks;
+    }
+    
+    close(SRCFILE);
+    close(NEWDEST);
+    
+    if (!$backup) {
+        unlink($dstfile)  or die "Failed to remove $dstfile\n";
+    }
+    rename($newdest, $dstfile)      or die "Failed to rename $newdest\n";
+}
+
+
+#//--------------------------------------------------------------------------------------------------
+#// _readCVSInfo. Suck in the CVS info from the Entries file
+#//--------------------------------------------------------------------------------------------------
+
+sub _readCVSInfo($)
+{
+    my($cvsDir) = @_;
+
+    my($entries_file_name) = $cvsDir.$dirsep."CVS".$dirsep."Entries";
+    
+    # print "Reading $entries_file_name\n";
+    open(ENTRIES, $entries_file_name) || die "Could not open file $entries_file_name";
+
+    my(%cvs_entries);
+    
+    # Read in the path if available    
+    while (defined ($line = <ENTRIES>))
+    {
+        chomp($line);
+        
+        #parse out the line. Format is:
+        #   files:    /filename/version/date/options/tag
+        #   dirs:     D/dirname////
+        #   dir?      D
+        # because we might be reading an entries file from another platform, with
+        # different linebreaks, be anal about cleaning up $line.
+                
+        if ($line =~ /^?\/(.+)\/(.+)\/(.+)\/(.*)\/(.*)?$/)
+        {
+            my($filename) = $1;
+            my($version) = $2;
+            my($date) = $3;
+            my($options) = $4;
+            my($tag) = $5;
+            
+            my(%cvs_file) = (
+                "version"   => $version,
+                "date"      => $date,
+                "options"   => $options,
+                "tag"       => $tag
+            );
+                        
+            # print $filename." ".$version." ".$date." ".$options." ".$tag."\n";
+            $cvs_entries{$filename} = \%cvs_file;
+        }
+    }
+   
+    close ENTRIES;
+
+    return %cvs_entries;
+}
+
+
+#//--------------------------------------------------------------------------------------------------
+#// _fileIsModified. compare mod date with CVS entries to see if a file is modified
+#//--------------------------------------------------------------------------------------------------
+sub _fileIsModified($;$;$)
+{
+    my($entries, $dir, $file) = @_;
+
+    my($abs_file) = $dir.$dirsep.$file;
+
+    if (exists($entries->{$file}))
+    {
+        my($date) = $entries->{$file}->{"date"};
+        
+        # stat the file to get its date
+        my($file_data) = stat($abs_file) || die "Could not stat $file\n";
+        my($mod_string) = scalar(gmtime($file_data->mtime));
+
+       return ($mod_string ne $date);
+    }
+    else
+    {
+        return 0;    
+    }
+}
+
+
+#//--------------------------------------------------------------------------------------------------
+#// _processFile. args: entries hash, dir, filename
+#//--------------------------------------------------------------------------------------------------
+
+sub _processFile($;$;$;$;$)
+{
+    my($src_entries, $dest_entries, $srcdir, $destdir, $file) = @_;
+
+    my($abs_file) = $srcdir.$dirsep.$file;
+            
+    if (exists($src_entries->{$file}))
+    {
+        my($file_entry) = $src_entries->{$file};
+        my($version) = $file_entry->{"version"};
+        
+        if (_fileIsModified($src_entries, $srcdir, $file))
+        {
+            my($rel_file) = $abs_file;
+            $rel_file =~ s/^$src_tree//;
+            
+            # print "¥ÊFile $rel_file is modified\n";
+            
+            # check CVS version in dest
+            my($dest_entry) = $dest_entries->{$file};
+            if ($dest_entry)
+            {
+                my($dest_version) = $dest_entry->{"version"};
+                my($versions_match) = ($version == $dest_version);
+                my($dest_modified) = _fileIsModified($dest_entries, $destdir, $file);
+                                
+                if ($versions_match)
+                {
+                    # ok, we can copy the file over now, backing up dest if it is modified
+                    _copyFile($srcdir, $destdir, $file, $dest_modified);
+                }
+                else
+                {
+                    print "File $rel_file is version $version in the src tree, but $dest_version in dest. This file will not be copied.\n";
+                }
+            }
+            else
+            {
+                print "No CVS entry found in destination tree for $rel_file\n";
+            }
+        }
+    }
+    else
+    {
+        print "No entry for file $file\n";
+    }
+}
+
+
+#//--------------------------------------------------------------------------------------------------
+#// _traverseDir. Traverse one dir, recurse for each found dir.
+#//--------------------------------------------------------------------------------------------------
+
+sub _traverseDir($;$)
+{
+    my($srcdir, $destdir) = @_;
+
+    opendir(DIR, $srcdir) or die "Cannot open dir $srcdir\n";
+    my @files = readdir(DIR);
+    closedir DIR;
+    
+    # suck in the CVS info for this dir, if there is a CVS dir
+    unless (-e $srcdir.$dirsep."CVS".$dirsep."Entries" && -e $destdir.$dirsep."CVS".$dirsep."Entries") {
+        print "$srcdir is not a CVS directory in both source and dest\n";
+        return;
+    }
+    
+    print " Doing $srcdir\n";
+    
+    my(%src_entries)  = _readCVSInfo($srcdir);
+    my(%dest_entries) = _readCVSInfo($destdir);
+
+    my $file;    
+    foreach $file (@files)
+    {        
+        my $filepath = $srcdir.$dirsep.$file;
+                
+        if (-d $filepath)
+        {
+            if ($file ne "CVS")     # ignore 'CVS' dirs
+            {
+                # print "Going into $filepath\n";            
+                _traverseDir($filepath, $destdir.$dirsep.$file);
+            }
+        }
+        else
+        {
+            # process this file
+            _processFile(\%src_entries, \%dest_entries, $srcdir, $destdir, $file);
+        }
+    }
+}
+
+#//--------------------------------------------------------------------------------------------------
+#// MigrateChanges
+#//--------------------------------------------------------------------------------------------------
+sub MigrateChanges($;$)
+{
+    my($srcdir, $destdir) = @_;
+
+    # Check that src and dest exist
+    if (! -d $srcdir) {
+        die "Source directory $srcdir does not exist\n";
+    }
+
+    if (! -d $destdir) {
+        die "Dest directory $destdir does not exist\n";
+    }
+
+    print "---------------------------------------------------------\n";
+    print "Migrating changes from\n  $srcdir\nto\n  $destdir\n";
+    print "---------------------------------------------------------\n";
+    _traverseDir($srcdir, $destdir);
+    print "---------------------------------------------------------\n";
+}
+
+
+MigrateChanges($src_tree, $dest_tree);
+

mozilla/build/genrc.sh

@@ -0,0 +1,29 @@
+#!/bin/sh
+#
+# The contents of this file are subject to the Netscape Public
+# License Version 1.1 (the "License"); you may not use this file
+# except in compliance with the License. You may obtain a copy of
+# the License at http://www.mozilla.org/NPL/
+#
+# Software distributed under the License is distributed on an "AS
+# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express or
+# implied. See the License for the specific language governing
+# rights and limitations under the License.
+#
+# The Original Code is mozilla.org code.
+#
+# The Initial Developer of the Original Code is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation. All
+# Rights Reserved.
+#
+# Contributor(s): 
+#
+
+DATATYPE="$1"
+INFILE="$2"
+
+echo "${DATATYPE} RCDATA"
+sed 's/"/""/g' ${INFILE} | awk 'BEGIN { printf("BEGIN\n") } { printf("\"%s\\r\\n\",\n", $0) } END { printf("\"\\0\"\nEND\n") }'
+
+exit 0

mozilla/build/hcc

@@ -0,0 +1,95 @@
+#!/bin/sh
+#
+# The contents of this file are subject to the Netscape Public
+# License Version 1.1 (the "License"); you may not use this file
+# except in compliance with the License. You may obtain a copy of
+# the License at http://www.mozilla.org/NPL/
+#
+# Software distributed under the License is distributed on an "AS
+# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express or
+# implied. See the License for the specific language governing
+# rights and limitations under the License.
+#
+# The Original Code is mozilla.org code.
+#
+# The Initial Developer of the Original Code is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation. All
+# Rights Reserved.
+#
+# Contributor(s): 
+#
+
+#
+# Fix brain-damaged compilers that don't understand -o and -c together
+#
+CC=`echo $1 | sed -e "s|'||g" -e 's|"||g'`
+shift
+DASH_C=0
+DASH_O=0
+DUMMY="XxxXxxX"
+GET_OBJECT=0
+OBJ="${DUMMY}"
+OBJECT="${DUMMY}"
+
+for i in $*
+do
+	[ "${CHECK_O}" = yes ]  && {
+	case $i in
+		./*/*.o)	OBJECT="$i"
+			OPTS="${OPTS} -o"
+   			DASH_O=1
+			;;
+		./*.o)	OBJECT="`basename $i`"
+			i=""
+   			DASH_O=1
+			;;
+		*.o)	if [ $i = `basename $i` ]
+			then
+				OBJECT="$i"
+				i=""
+			else
+				OPTS="${OPTS} -o"
+			fi
+   			DASH_O=1
+			;;
+		*)	OPTS="${OPTS} -o $i"
+   			DASH_O=1
+			i=""
+			;;
+	esac
+	CHECK_O=no
+	}
+   case $i in
+   -c)     DASH_C=1
+	OPTS="${OPTS} -c"
+		;;
+   -o)     CHECK_O=yes
+		;;
+   *.c)    C_SRC=$i
+	OPTS="${OPTS} $i"
+# cc always creates the .o from the .c name
+	OBJ=`basename $C_SRC .c`.o
+		;;
+   *.s)    S_SRC=$i
+	OPTS="${OPTS} $i"
+# or the .o from the .s name
+	OBJ=`basename $S_SRC .s`.o
+		;;
+   *.o)    OBJECT=$i
+	OPTS="${OPTS} $i"
+		;;
+   *) 	OPTS="${OPTS} $i"
+		;;
+   esac
+done
+
+${CC} ${OPTS} || exit $?
+
+# if there was no -c and -o we're done
+[ $DASH_C = 1 -a $DASH_O = 1 ] || exit 0
+
+# if $OBJ and $OBJECT are the same we're done
+[ $OBJ = $OBJECT ] && exit 0
+
+[ -f $OBJ ] && mv -f $OBJ $OBJECT

mozilla/build/hcpp

@@ -0,0 +1,139 @@
+#!/bin/sh
+#
+# The contents of this file are subject to the Netscape Public
+# License Version 1.1 (the "License"); you may not use this file
+# except in compliance with the License. You may obtain a copy of
+# the License at http://www.mozilla.org/NPL/
+#
+# Software distributed under the License is distributed on an "AS
+# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express or
+# implied. See the License for the specific language governing
+# rights and limitations under the License.
+#
+# The Original Code is mozilla.org code.
+#
+# The Initial Developer of the Original Code is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation. All
+# Rights Reserved.
+#
+# Contributor(s): 
+#
+
+#
+# Wrapper for brain-damaged compilers that don't understand -o and -c together.
+#
+CXX=`echo $1 | sed -e "s|'||g" -e 's|"||g'`
+shift
+DUMMY="XxxXxxX"
+DASH_C=0
+DASH_O=0
+GET_OBJECT=0
+C_SRC="${DUMMY}"
+CC_SRC="${DUMMY}"
+CPP_SRC="${DUMMY}"
+S_SRC="${DUMMY}"
+OBJECT="${DUMMY}"
+NEW_i="${DUMMY}"
+PLATFORM=`uname -s`
+
+for i in $*
+do
+	[ ${GET_OBJECT} -eq 1 ]  && {
+	case $i in
+		./*/*.o)	OBJECT="$i"
+			OPTS="${OPTS} -o"
+   			DASH_O=1
+			;;
+		./*.o)	OBJECT="`basename $i`"
+			i=""
+   			DASH_O=1
+			;;
+		*.o)	if [ $i = `basename $i` ]
+			then
+				i=""
+			else
+				OPTS="${OPTS} -o"
+   				DASH_O=1
+			fi
+			;;
+		*)	OPTS="${OPTS} -o $i"
+   			DASH_O=1
+			i=""
+			;;
+	esac
+	GET_OBJECT=0
+	}
+	case $i in
+		-c)
+			DASH_C=1
+			OPTS="${OPTS} -c"
+			;;
+		-o)
+			GET_OBJECT=1
+			;;
+		*.c)
+			C_SRC="$i"
+			OPTS="${OPTS} $i"
+# cc always creates the .o from the .c name
+			OBJ=`basename ${C_SRC} .c`.o
+			;;
+		+.*)
+			OPTS="${OPTS} $i"
+			;;
+		*.cpp)
+			CPP_SRC="$i"
+			if [ "${PLATFORM}" = "SCO_SV" ]; then
+				OPTS="${OPTS} +.cpp $i"
+			elif [ "${PLATFORM}" = "IRIX" ]; then
+				NEW_i=`basename ${CPP_SRC} .cpp`.C
+				rm -f ${NEW_i}
+				cp $i ${NEW_i}
+				OPTS="${OPTS} ${NEW_i}"
+			else
+				OPTS="${OPTS} $i"
+			fi
+# cc always creates the .o from the .cpp name
+			OBJ=`basename ${CPP_SRC} .cpp`.o
+			;;
+		*.cc)
+			CC_SRC="$i"
+			OPTS="${OPTS} $i"
+# cc always creates the .o from the .cc name
+			OBJ=`basename ${CC_SRC} .cc`.o
+			;;
+		*.s)
+			S_SRC="$i"
+			OPTS="${OPTS} $i"
+# cc always creates the .o from the .s name
+			OBJ=`basename ${S_SRC} .s`.o
+			;;
+   		*.o)    OBJECT=$i
+			OPTS="${OPTS} $i"
+			;;
+   		*) 	OPTS="${OPTS} $i"
+			;;
+	esac
+done
+
+${CXX} ${OPTS} || exit $?
+rm -f ${NEW_i}
+
+# Really only needed for NSPR now.
+if [ "${PLATFORM}" = "IRIX" -a "$OBJ" != "$OBJECT" ]; then
+	OBJ=$OBJECT
+fi
+
+# LAME!!!
+if [ -f -O ]; then
+	mv -f -- -O ${OBJECT}
+fi
+
+# if there was no -c and -o we're done
+[ ${DASH_C} -eq 1 -a ${DASH_O} -eq 1 ] || exit 0
+
+# if $OBJ and $OBJECT are the same we're done
+[ $OBJ = $OBJECT ] && exit 0
+
+[ -f $OBJ ] && mv -f $OBJ $OBJECT
+

mozilla/build/mac/BuildNGLayout.pl

@@ -0,0 +1,197 @@
+#!perl
+
+#
+# The contents of this file are subject to the Netscape Public
+# License Version 1.1 (the "License"); you may not use this file
+# except in compliance with the License. You may obtain a copy of
+# the License at http://www.mozilla.org/NPL/
+#
+# Software distributed under the License is distributed on an "AS
+# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express or
+# implied. See the License for the specific language governing
+# rights and limitations under the License.
+#
+# The Original Code is mozilla.org code.
+#
+# The Initial Developer of the Original Code is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation. All
+# Rights Reserved.
+#
+# Contributor(s): 
+#
+
+#
+# build script (optimized)
+#
+use Mac::Processes;
+use NGLayoutBuildList;
+use Cwd;
+use Moz;
+
+#-----------------------------------------------
+# configuration variables that globally affect what is built
+#-----------------------------------------------
+$DEBUG					= 0;
+$CARBON					= 0;	# turn on to build with TARGET_CARBON
+$PROFILE				= 0;
+$GC_LEAK_DETECTOR		= 0;	# turn on to use GC leak detection
+$INCLUDE_CLASSIC_SKIN 	= 1; 
+
+$pull{all} 				= 0;
+$pull{moz}				= 0;
+$pull{runtime} 			= 0;
+
+$build{all}             = 1;	# turn off to do individual builds, or to do "most"
+$build{most}            = 0;	# turn off to do individual builds
+$build{dist}            = 0;
+$build{dist_runtime}    = 0;	# implied by $build{dist}
+$build{xpidl}           = 0;
+$build{idl}             = 0;
+$build{stubs}           = 0;
+$build{runtime}         = 0;
+$build{common}          = 0;
+$build{imglib}          = 0;
+$build{necko}           = 0;
+$build{security}        = 0;
+$build{browserutils}    = 0;
+$build{intl}            = 0;
+$build{nglayout}        = 0;
+$build{editor}          = 0;
+$build{viewer}          = 0;
+$build{xpapp}           = 0;
+$build{extensions}      = 1;
+$build{plugins}         = 0;
+$build{mailnews}        = 0;
+$build{apprunner}       = 0;
+$build{resources}       = 1;
+
+$build{xptlink}		    = 0;
+
+$options{transformiix}	= 0;
+$options{mathml}		= 0;
+$options{svg}			= 0;
+$options{mng}			= 1;
+$options{ldap}			= 0;
+$options{xmlextras}		= 0;
+
+$options{jar_manifests} = 1;        # use jar.mn files for resources, not MANIFESTs
+$options{jars}    		= 1;        # build jar files
+$options{chrome_files}  = 0;        # install files in chrome as well as making jar files.
+
+# Don't change these (where should they go?)
+$optiondefines{mathml}{MOZ_MATHML}		= 1;
+$optiondefines{svg}{MOZ_SVG}			= 1;
+
+#-----------------------------------------------
+# configuration variables that affect the manner
+# of building, but possibly affecting
+# the outcome.
+#-----------------------------------------------
+$ALIAS_SYM_FILES		= $DEBUG;
+$CLOBBER_LIBS			= 1;	# turn on to clobber existing libs and .xSYM files before
+								# building each project							
+# The following two options will delete all dist files (if you have $build{dist} turned on),
+# but leave the directory structure intact.
+$CLOBBER_DIST_ALL 		= 1;	# turn on to clobber all aliases/files inside dist (headers/xsym/libs)
+$CLOBBER_DIST_LIBS 		= 0;	# turn on to clobber only aliases/files for libraries/sym files in dist
+$CLOBBER_IDL_PROJECTS	= 0;	# turn on to clobber all IDL projects.
+
+#-----------------------------------------------
+# configuration variables that are preferences for the build style,
+# and do not affect what is built.
+#-----------------------------------------------
+$CodeWarriorLib::CLOSE_PROJECTS_FIRST
+						= 0;
+								# 1 = close then make (for development),
+								# 0 = make then close (for tinderbox).
+$USE_TIMESTAMPED_LOGS 	= 0;
+#-----------------------------------------------
+# END OF CONFIG SWITCHES
+#-----------------------------------------------
+
+if ($pull{all})
+{
+	foreach $k (keys(%pull))
+	{
+		$pull{$k} = 1;
+	}
+}
+if ($build{all})
+{
+	foreach $k (keys(%build))
+	{
+		$build{$k} = 1;
+	}
+}
+if ($build{most})
+{
+### Just uncomment/comment to get the ones you want (if "most" is selected).
+#   $build{dist}            = 0;
+#   $build{dist_runtime}    = 0;	# Implied by $build{dist}
+#   $build{xpidl}           = 0;
+#   $build{idl}             = 0;
+#   $build{stubs}           = 0;
+#   $build{runtime}         = 1;
+#   $build{common}          = 1;
+#   $build{imglib}          = 1;
+#   $build{necko}           = 1;
+#   $build{security}        = 1;
+#   $build{browserutils}    = 1;
+#   $build{intl}            = 1;
+#   $build{nglayout}        = 1;
+#   $build{editor}          = 1;
+#   $build{viewer}          = 1;
+#   $build{xpapp}           = 1;
+#   $build{extensions}      = 1;
+#   $build{plugins}         = 1;
+#   $build{mailnews}        = 1;
+#   $build{apprunner}       = 1;
+#   $build{resources}       = 0;
+}
+
+# do the work
+# you should not have to edit anything below
+
+chdir("::::");
+$MOZ_SRC = cwd();
+
+if ($USE_TIMESTAMPED_LOGS)
+{
+	#Use time-stamped names so that you don't clobber your previous log file!
+	my $now = localtime();
+	while ($now =~ s@:@.@) {} # replace all colons by periods
+	my $logdir = ":Build Logs:";
+	if (!stat($logdir))
+	{
+	        print "Creating directory $logdir\n";
+	        mkdir $logdir, 0777 || die "Couldn't create directory $logdir";
+	}
+	OpenErrorLog("$logdir$now");
+}
+else
+{
+	OpenErrorLog("NGLayoutBuildLog");		# Release build requires that name
+	#OpenErrorLog("Mozilla.BuildLog");		# Tinderbox requires that name
+}
+
+Moz::StopForErrors();
+#Moz::DontStopForErrors();
+
+ConfigureBuildSystem();
+
+Checkout();
+
+my(@gen_files) = (
+    ":mozilla:xpfe:appshell:public:nsBuildID.h",
+    ":mozilla:xpfe:browser:resources:locale:en-US:navigator.dtd"
+);
+SetBuildNumber(":mozilla:config:build_number", ":mozilla:config:aboutime.pl", \@gen_files);
+
+chdir($MOZ_SRC);
+BuildDist();
+
+chdir($MOZ_SRC);
+BuildProjects();
+
+print "Build complete\n";

mozilla/build/mac/BuildNGLayoutDebug.pl

@@ -0,0 +1,189 @@
+#!perl
+
+#
+# The contents of this file are subject to the Netscape Public
+# License Version 1.1 (the "License"); you may not use this file
+# except in compliance with the License. You may obtain a copy of
+# the License at http://www.mozilla.org/NPL/
+#
+# Software distributed under the License is distributed on an "AS
+# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express or
+# implied. See the License for the specific language governing
+# rights and limitations under the License.
+#
+# The Original Code is mozilla.org code.
+#
+# The Initial Developer of the Original Code is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation. All
+# Rights Reserved.
+#
+# Contributor(s): 
+#
+
+#
+# build script (debug)
+#
+use Mac::Processes;
+use NGLayoutBuildList;
+use Cwd;
+use Moz;
+
+$DEBUG					= 1;
+$CARBON					= 0;	# Turn on to build with TARGET_CARBON
+$PROFILE				= 0;
+$GC_LEAK_DETECTOR		= 0;	# turn on to use GC leak detection
+$INCLUDE_CLASSIC_SKIN = 1;
+
+$pull{all} 				= 0;
+$pull{moz}				= 0;
+$pull{runtime} 			= 0;
+
+$build{all} 			= 1;	# Turn off to do individual builds, or to do "most"
+$build{most} 			= 0;	# Turn off to do individual builds
+$build{dist} 			= 0;
+$build{dist_runtime}	= 0;	# Implied by $build{dist}
+$build{xpidl}			= 0;
+$build{idl}             = 0;
+$build{stubs} 			= 0;
+$build{runtime}			= 0;
+$build{common} 			= 0;
+$build{imglib} 			= 0;
+$build{necko} 			= 0;
+$build{security}        = 0;
+$build{browserutils} 	= 0;
+$build{intl} 			= 0;
+$build{nglayout} 		= 0;
+$build{editor} 			= 0;
+$build{viewer} 			= 0;
+$build{xpapp} 			= 0;
+$build{extensions} 		= 1;
+$build{plugins}			= 0;
+$build{mailnews} 		= 0;
+$build{apprunner}		= 0;
+$build{resources} 		= 1;
+
+$build{xptlink}		    = 0;
+
+$options{transformiix}	= 0;
+$options{mathml}		= 0;
+$options{svg}			= 0;
+$options{mng}			= 1;
+$options{ldap}			= 0;
+$options{xmlextras}		= 0;
+
+$options{jar_manifests} = 1;        # use jar.mn files for resources, not MANIFESTs
+$options{jars}    		= 1;        # build jar files
+$options{chrome_files}  = 0;        # install files in chrome as well as making jar files.
+
+
+# Don't change these (where should they go?)
+$optiondefines{mathml}{MOZ_MATHML}		= 1;
+$optiondefines{svg}{MOZ_SVG}			= 1;
+
+#-----------------------------------------------
+# configuration variables that affect the manner
+# of building, but possibly affecting
+# the outcome.
+#-----------------------------------------------
+$ALIAS_SYM_FILES		= $DEBUG;
+$CLOBBER_LIBS			= 1;	# turn on to clobber existing libs and .xSYM files before
+								# building each project							
+# The following two options will delete all dist files (if you have $build{dist} turned on),
+# but leave the directory structure intact.
+$CLOBBER_DIST_ALL 		= 1;	# turn on to clobber all aliases/files inside dist (headers/xsym/libs)
+$CLOBBER_DIST_LIBS 		= 0;	# turn on to clobber only aliases/files for libraries/sym files in dist
+$CLOBBER_IDL_PROJECTS	= 0;	# turn on to clobber all IDL projects.
+
+#-----------------------------------------------
+# configuration variables that are preferences for the build style,
+# and do not affect what is built.
+#-----------------------------------------------
+$CodeWarriorLib::CLOSE_PROJECTS_FIRST
+						= 1;
+								# 1 = close then make (for development),
+								# 0 = make then close (for tinderbox).
+$USE_TIMESTAMPED_LOGS 	= 1;
+#-----------------------------------------------
+# END OF CONFIG SWITCHES
+#-----------------------------------------------
+
+if ($pull{all})
+{
+	foreach $k (keys(%pull))
+	{
+		$pull{$k} = 1;
+	}
+}
+if ($build{all})
+{
+	foreach $k (keys(%build))
+	{
+		$build{$k} = 1;
+	}
+}
+if ($build{most})
+{
+### Just uncomment/comment to get the ones you want (if "most" is selected).
+#	$build{dist}		= 1;
+#	$build{dist_runtime}= 1;
+    $build{xpidl}		= 1; # build idl compiler
+	$build{idl}         = 1;
+	$build{stubs}		= 1;
+	$build{runtime}		= 1;
+	$build{common}		= 1;
+	$build{imglib} 		= 1;
+	$build{necko} 		= 1;
+    $build{security}    = 1;
+	$build{browserutils} = 1;
+	$build{intl}		= 1; 
+	$build{nglayout}	= 1;
+	$build{editor}		= 1;
+	$build{viewer}		= 1;
+	$build{xpapp}		= 1;
+	$build{extensions} 	= 1;
+	$build{plugins}		= 1;
+	$build{mailnews}	= 1;
+	$build{apprunner} 	= 1;
+	$build{resources}	= 1;
+}
+
+# do the work
+# you should not have to edit anything below
+
+chdir("::::");
+$MOZ_SRC = cwd();
+
+if ($USE_TIMESTAMPED_LOGS)
+{
+	#Use time-stamped names so that you don't clobber your previous log file!
+	my $now = localtime();
+	while ($now =~ s@:@.@) {} # replace all colons by periods
+	my $logdir = ":Build Logs:";
+	if (!stat($logdir))
+	{
+	        print "Creating directory $logdir\n";
+	        mkdir $logdir, 0777 || die "Couldn't create directory $logdir";
+	}
+	OpenErrorLog("$logdir$now");
+}
+else
+{
+	OpenErrorLog("NGLayoutBuildLog");		# Release build
+	#OpenErrorLog("Mozilla.BuildLog");		# Tinderbox requires that name
+}
+
+Moz::StopForErrors();
+#Moz::DontStopForErrors();
+
+ConfigureBuildSystem();
+
+Checkout();
+
+chdir($MOZ_SRC);
+BuildDist();
+
+chdir($MOZ_SRC);
+BuildProjects();
+
+print "Build complete\n";

mozilla/build/mac/CodeWarriorLib.pm

@@ -0,0 +1,470 @@
+#!perl
+package CodeWarriorLib;
+
+=pod
+
+=head1 NAME
+
+CodeWarriorLib - supply interface to CodeWarrior
+
+=head1 SYNOPSIS
+
+	#!perl
+	use CodeWarriorLib;
+	CodeWarriorLib::activate();
+	$had_errors = CodeWarriorLib::build_project(
+		$project_path, $target_name, $recent_errors_file, $clean_build
+	);
+
+=head1 DESCRIPTION
+
+Replaces the AppleScript library I<CodeWarriorLib>.
+
+=over 4
+
+=cut
+
+use strict;
+use Cwd;
+use Mac::Types;
+use Mac::AppleEvents;
+use Mac::AppleEvents::Simple;
+use Mac::Processes;
+use Mac::MoreFiles;
+use Mac::StandardFile;
+use File::Basename;
+
+use vars qw($VERSION);
+$VERSION = '1.02';
+
+my($app)  = 'CWIE';
+my($scriptDir) = cwd();
+
+# 0 == don't switch CWIE to front app in do_event(), 1 == do switch
+# note: activate() still switches when called
+$Mac::AppleEvents::Simple::SWITCH = 0;
+
+# supply your own path to the source here
+#_test('PowerPudgeIV:mozilla:mozilla:');
+
+
+=pod
+
+=item _get_project($full_path)
+
+A private routine returning a reference to the open project with the given name,
+or else the empty string (when that project is not open)
+
+full_path is a string identifying the project to be built and is of the form, 
+e.g., "HD:ProjectFolder:MyProject.mcp".  It must be supplied.
+
+=cut
+
+sub _get_project ($) {
+	my(
+		$full_path, $candidate_projects
+	) = @_;
+	$candidate_projects = _doc_named(basename($full_path, '*'));
+	if ($candidate_projects) {
+		my($cps) = _get_dobj($candidate_projects);
+		my($num) = AECountItems($cps);
+		if ($num) {  # is a list
+			foreach (1 .. AECountItems($cps)) {
+				my($cp) = AEGetNthDesc($cps, $_);
+				if (lc $full_path eq lc _full_path($cp)) {
+					return($cp);
+				}
+			}
+		} else {     # is only one, not a list
+			if (lc $full_path eq lc _full_path($cps)) {
+				return($cps);
+			}
+		}
+	}
+	return;
+}
+
+=pod
+
+=item build_project
+
+Build a selected target of a project, saving any errors to a file, if supplied.
+	
+full_path is a string identifying the project to be built and is of the form, 
+e.g., "HD:ProjectFolder:MyProject.mcp".  It must be supplied.
+
+If target_name is the empty string, the current target of the selected project 
+will be built, else, target_name should be a string matching a target name in 
+the selected project.
+	
+If error_path is the empty string, errors will not be saved to a file,
+else, error_path should be the full path of a file to save error messages into.
+
+=cut
+
+$CodeWarriorLib::CLOSE_PROJECTS_FIRST = 0; # If true we close then make. If false, make then close.
+my $last_project_built = "";
+my $last_project_was_closed = 0;
+
+sub build_project ($;$$$) {
+	my(
+		$full_path, $target_name, $error_path,
+		$remove_object, $p, $project_was_closed, $had_errors
+	) = @_;
+	_close_errors_window();
+
+	if ($CodeWarriorLib::CLOSE_PROJECTS_FIRST && ($last_project_built ne $full_path))
+	{
+		# If we're in "close first" mode, we don't close if the current project
+		# is the same as the previous one.
+		if ($last_project_was_closed) {
+			$p = _get_project($last_project_built);
+			_close($p);
+		}
+		$last_project_built = $full_path;
+		$last_project_was_closed = 0; # now refers to the new project
+	}
+	$project_was_closed = 0;
+	while (1) {
+		$p = _get_project($full_path);
+		if (!$p) {
+			if ($project_was_closed) {
+				print "### Error - request for project document failed after opening\n";
+				die "### possibly CW Pro 4 bug: be sure to close your Find window\n";
+			}
+			$project_was_closed = 1;
+			$last_project_was_closed = 1;
+			_open_file($full_path);
+		} else {
+			last;
+		}
+	}
+
+	$had_errors = 0;
+	if ($target_name eq '') {
+		if ($remove_object) {_remove_object($p)}
+		_build($p);
+	} else {
+		if ($remove_object) {_remove_object($p, $target_name)}
+		_build($p, $target_name);
+	}
+
+	if ($error_path ne '') {
+		_save_errors_window($error_path);
+	}
+	$had_errors = _close_errors_window();
+
+	if (!$CodeWarriorLib::CLOSE_PROJECTS_FIRST)
+	{
+		if ($project_was_closed) {
+			$p = _get_project($full_path);
+			_close($p);
+		}
+	}
+
+	return($had_errors);
+}
+
+=pod
+
+=item activate()
+
+Launches CodeWarrior and brings it to the front.
+
+Once found, path will be saved in ':idepath.txt' for future reference.
+Edit or delete this file to change the location of the IDE.  If app is
+moved, C<activate()> will prompt for a new location.
+
+First looks for an open CodeWarrior app.  Second, tries to open previously
+saved location in ':idepath.txt'.  Third, tries to find it and allow user
+to choose it with Navigation Services (if present).  Fourth, uses good old
+GUSI routines built-in to MacPerl for a Choose Directory dialog box.
+
+=cut
+
+sub activate () {
+	local(*F);
+	my($filepath, $appath, $psi) = (':idepath.txt');
+
+	foreach $psi (values(%Process)) {
+		if ($psi->processSignature() eq $app) {
+			$appath = $psi->processAppSpec();
+			_save_appath($filepath, $appath);
+			last;
+		}
+	}
+
+	if (!$appath || !-x $appath) {
+		$appath = _read_appath($filepath);
+	}
+	
+	if (!$appath || ! -x $appath)
+	{
+		# make sure that MacPerl is a front process
+		#ActivateApplication('McPL');
+		MacPerl::Answer("Please locate the CodeWarrior application.", "OK");
+		
+		# prompt user for the file name, and store it
+		my $macFile = StandardGetFile( 0, "APPL");
+		if ( $macFile->sfGood() )
+		{
+			$appath = $macFile->sfFile();
+		}
+		else
+		{
+			die "Operation canceled\n";
+		}
+	
+#		if (eval {require Mac::Navigation}) {
+#			my($options, $nav);
+#			Mac::Navigation->import();
+#			$options = NavGetDefaultDialogOptions();
+#			$options->message('Where is CodeWarrior IDE?');
+#			$options->windowTitle('Find CodeWarrior IDE');
+#			$nav = NavChooseObject($Application{$app}, $options);
+#			die "CodeWarrior IDE not found.\n" if (!$nav || !$nav->file(1));
+#			$appath = $nav->file(1);
+#		} else {
+#			local(*D);
+#			my $cwd = `pwd`;
+#			$appath = _get_folder(
+#                               'Where is the CW IDE folder?',
+#				dirname($Application{$app})
+#			);
+#			die "CodeWarrior IDE not found.\n" if !$appath;
+#			opendir(D, $appath) or die $!;
+#			chdir($appath);
+#			foreach my $file (sort readdir (D)) {
+#				my(@app) = MacPerl::GetFileInfo($file);
+#				if ($app[0] && $app[1] &&
+#					$app[1] eq 'APPL' && $app[0] eq $app
+#				) {
+#					$appath .= $file;
+#					last;
+#				}
+#			}
+#			chomp($cwd);
+#			chdir($cwd);
+#		}
+		_save_appath($filepath, $appath);
+	}
+
+	my($lp) = LaunchParam->new(
+		launchAppSpec => $appath,
+		launchControlFlags => launchContinue() + launchNoFileFlags()
+	);
+        unless (LaunchApplication($lp)) {
+                unlink($filepath);
+                die $^E;
+        }
+}
+
+=pod
+
+=item quit()
+
+Quits CodeWarrior.
+
+=cut
+
+sub quit() {
+
+	$last_project_built = "";
+	$last_project_was_closed = 0;
+
+	my($evt) = do_event(qw/aevt quit/, $app);
+}
+
+
+sub _build ($;$) {
+	my($evt);
+	if ($_[1]) {
+		my($prm) =
+			q"'----':obj {form:name, want:type(TRGT), seld:TEXT(@), from:" .
+			AEPrint($_[0]) . '}';
+		$evt = do_event(qw/CWIE MAKE/, $app, $prm, $_[1]);
+	} else {
+		my($prm) = q"'----':" . AEPrint($_[0]);
+		$evt = do_event(qw/CWIE MAKE/, $app, $prm);
+	}
+}
+
+sub _remove_object ($;$) {
+	my($evt);
+	if ($_[1]) {
+		my($prm) =
+			q"'----':obj {form:name, want:type(TRGT), seld:TEXT(@), from:" .
+			AEPrint($_[0]) . '}';
+		$evt = do_event(qw/CWIE RMOB/, $app, $prm, $_[1]);
+	} else {
+		my($prm) = q"'----':" . AEPrint($_[0]);
+		$evt = do_event(qw/CWIE RMOB/, $app, $prm);
+	}
+}
+
+sub _open_file ($) {
+	my($prm) =
+		q"'----':obj {form:name, want:type(alis), " .
+		q"seld:TEXT(@), from:'null'()}";
+
+	do_event(qw/aevt odoc/, $app, $prm, $_[0]);
+}
+
+sub _doc_named ($) {
+	my($prm) =
+		q"'----':obj {form:test, want:type(docu), from:'null'(), " .
+		q"seld:cmpd{relo:'=   ', 'obj1':obj {form:prop, want:type" .
+		q"(prop), seld:type(pnam), from:'exmn'()}, 'obj2':TEXT(@)}}";
+
+	my($evt) = do_event(qw/core getd/, $app, $prm, $_[0]);
+	return($evt->{REPLY} eq 'aevt\ansr{}' ? undef : $evt);
+}
+
+sub _full_path ($) {
+	my($obj) = $_[0];
+	my($prm) =
+		q"'----':obj {form:prop, want:type(prop), seld:type(FILE), " .
+		q"from:" . AEPrint($_[0]) . q"}, rtyp:type(TEXT)";
+	my($evt) = do_event(qw/core getd/, $app, $prm);
+
+	return MacPerl::MakePath(
+		MacUnpack('fss ', (
+			AEGetParamDesc($evt->{REP}, keyDirectObject()))->data()->get()
+		)
+	);
+}
+
+sub _save_errors_window ($) {
+	my($prm) = 
+		q"'----':obj {form:name, want:type(alis), seld:TEXT(@), from:'null'()}";
+	do_event(qw/MMPR SvMs/, $app, $prm, $_[0]);
+}
+
+
+sub _close_errors_window () {
+	my($prm) =
+		q"'----':obj {form:name, want:type(cwin), " .
+		q"seld:TEXT(@), from:'null'()}";
+
+	my($evt) = do_event(qw/core clos/, $app, $prm, 'Errors & Warnings');
+	return($evt->{REPLY} eq 'aevt\ansr{}' ? 1 : 0);
+}
+
+sub _close () {
+	my($prm) = q"'----':" . AEPrint($_[0]);
+	do_event(qw/core clos/, $app, $prm);
+}
+
+sub _get_dobj ($) {
+	return(AEGetParamDesc($_[0]->{REP}, keyDirectObject()));
+}
+
+sub _get_folder ($$) {
+    require 'GUSI.ph';
+    my($prompt, $default) = @_;
+    MacPerl::Choose(
+        GUSI::AF_FILE(), 0, $prompt, '',
+        GUSI::CHOOSE_DIR() + ($default ? &GUSI::CHOOSE_DEFAULT : 0),
+        $default
+    );
+}
+
+sub _save_appath ($$) {
+
+	my($cwd) = cwd();	# remember the current working dir
+	chdir($scriptDir);	# change dir to the script dir
+
+	open(F, '>' . $_[0]) or die $!;
+	print F $_[1];
+	close(F);
+		
+	chdir($cwd);		# restore the cwd
+}
+
+sub _read_appath ($) {
+
+	my($filepath) = @_;
+
+	my($cwd) = cwd();	# remember the current working dir
+	chdir($scriptDir);	# change dir to the script dir
+	
+	if (! -e $filepath) {
+		return "";
+	}
+	open(F, $filepath);
+	my($appath) = <F>;
+	close(F);
+		
+	chdir($cwd);		# restore the cwd
+	return($appath);
+}
+
+
+sub _test ($) {
+	activate();
+	my($path) = $_[0];
+	build_project(
+	  "${path}modules:xml:macbuild:XML.mcp", '',
+	  "${path}build:mac:Mozilla.BuildLog.part"
+	);
+}
+
+1;
+
+=pod
+
+=back
+
+=head1 HISTORY
+
+=over 4
+
+=item v1.02, September 23, 1998
+
+Made fixes in finding and saving location of CodeWarrior IDE.
+
+=item v1.01, June 1, 1998
+
+Made fixes to C<chdir()> in C<activate()>, made C<activate()> more robust 
+in finding CodeWarrior IDE, added global variable to NOT switch to IDE
+for each sent event, a few other fixes.
+
+=item v1.00, May 30, 1998
+
+First shot
+
+=back
+
+
+=head1 AUTHORS
+
+Chris Nandor F<E<lt>pudge@pobox.comE<gt>>, and the author of the
+original I<CodeWarriorLib>, Scott Collins F<E<lt>scc@netscape.comE<gt>>.
+
+=head1 SEE ALSO
+
+BuildProject L<Moz>.
+
+=head1 COPYRIGHT
+
+The contents of this file are subject to the Netscape Public
+License Version 1.1 (the "License"); you may not use this file
+except in compliance with the License. You may obtain a copy of
+the License at http://www.mozilla.org/NPL/
+
+Software distributed under the License is distributed on an "AS
+IS" basis, WITHOUT WARRANTY OF ANY KIND, either express or
+implied. See the License for the specific language governing
+rights and limitations under the License.
+
+The Original Code is Mozilla Communicator client code, released
+March 31, 1998.
+
+The Initial Developer of the Original Code is Netscape
+Communications Corporation. Portions created by Netscape are
+Copyright (C) 1998-1999 Netscape Communications Corporation. All
+Rights Reserved.
+
+Contributor(s): 
+
+=cut

mozilla/build/mac/GenToc.script

@@ -0,0 +1,264 @@
+(*
+ *
+ * The contents of this file are subject to the Netscape Public
+ * License Version 1.1 (the "License"); you may not use this file
+ * except in compliance with the License. You may obtain a copy of
+ * the License at http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the License is distributed on an "AS
+ * IS" basis, WITHOUT WARRANTY OF ANY KIND, either express or
+ * implied. See the License for the specific language governing
+ * rights and limitations under the License.
+ *
+ * The Original Code is mozilla.org code.
+ *
+ * The Initial Developer of the Original Code is Netscape
+ * Communications Corporation.  Portions created by Netscape are
+ * Copyright (C) 1998 Netscape Communications Corporation. All
+ * Rights Reserved.
+ *
+ * Contributor(s): 
+ *)
+
+(*
+	GenToc - Generates a .toc file from the current contents of a project.
+
+	by Patrick C. Beard <beard@netscape.com>
+ *)
+
+on swapDelimiters(newDelimiters)
+	set oldDelimiters to get AppleScript's text item delimiters
+	set AppleScript's text item delimiters to newDelimiters
+	return oldDelimiters
+end swapDelimiters
+
+on setDelimiters(newDelimiters)
+	set AppleScript's text item delimiters to newDelimiters
+end setDelimiters
+
+on setExtension(fileName, newExtension)
+	set oldDelimiters to swapDelimiters(".")
+	set newFileName to (text item 1 of fileName) & newExtension
+	setDelimiters(oldDelimiters)
+	return newFileName
+end setExtension
+
+on folderFromPath(filePath)
+	set folderPath to ((filePath's text items 1 thru ((count of filePath's text items) - 1)) as string) & ":"
+	return folderPath
+end folderFromPath
+
+on fileFromPath(filePath)
+	return last text item of filePath
+end fileFromPath
+
+on openProject(aProjectFile)
+	tell application "CodeWarrior IDE 3.3"
+		open aProjectFile
+	end tell
+end openProject
+
+on selectProject(aProjectFile)
+	set projectName to fileFromPath(aProjectFile as text)
+	tell application "CodeWarrior IDE 3.3"
+		if (name of window 1 is not projectName) then
+			select window projectName
+		end if
+	end tell
+end selectProject
+
+on getTargets()
+	set targetList to {}
+	set nameList to {}
+	tell application "CodeWarrior IDE 3.3"
+		set currentProject to project document 1
+		repeat with targetIndex from 1 to (count of targets of currentProject)
+			set currentTarget to (target targetIndex of currentProject)
+			set targetList to targetList & {currentTarget}
+			set nameList to nameList & {name of currentTarget}
+		end repeat
+		return {target:targetList, names:nameList}
+	end tell
+end getTargets
+
+(* uses "sort" scripting addition to sort a list of strings. *)
+on sortList(aList)
+	if (aList ­ {}) then
+		return sort aList
+	else
+		return {}
+	end if
+end sortList
+
+(* uses "info for" scripting addition, to return the file type of a path. *)
+on getFileType(aFilePath)
+	return file type of (info for alias aFilePath)
+end getFileType
+
+(* returns all "TEXT" files of the named target. *)
+on getTargetFiles(targetKey)
+	set targetFiles to {}
+	tell application "CodeWarrior IDE 3.3"
+		set currentProject to project document 1
+		set currentTarget to (target targetKey of currentProject)
+		try
+			-- workaround for CW IDE 3.X bug, loop until error encountered.
+			set fileIndex to 1
+			repeat until false
+				set targetFile to (target file fileIndex of currentTarget)
+				-- only consider text files, since other platforms won't be managing binaries.
+				-- also, only consider if target file is directly linked.
+				if (linked of targetFile) then
+					set targetFilePath to (Access Paths of targetFile)
+					tell me
+						if (getFileType(targetFilePath) = "TEXT") then
+							set targetFiles to targetFiles & {targetFilePath}
+						end if
+					end tell
+				end if
+				set fileIndex to (fileIndex + 1)
+			end repeat
+		on error msg
+			-- display dialog msg & " file count = " & fileIndex
+		end try
+	end tell
+	return sortList(targetFiles)
+end getTargetFiles
+
+on addTargetFile(targetFile, targetName)
+	tell application "CodeWarrior IDE 3.3"
+		add (project document 1) new target file with data {targetFile} to targets {targetName}
+	end tell
+end addTargetFile
+
+on setCurrentTarget(currentTargetName)
+	tell application "CodeWarrior IDE 3.3"
+		Set Current Target currentTargetName
+	end tell
+end setCurrentTarget
+
+on removeTargetFile(targetFile)
+	tell application "CodeWarrior IDE 3.3"
+		Remove Files {targetFile}
+	end tell
+end removeTargetFile
+
+on quote(aString)
+	return "'" & aString & "'"
+end quote
+
+on listContains(aList, anItem)
+	repeat with listItem in aList
+		if (listItem contains anItem) then
+			return true
+		end if
+	end repeat
+	return false
+end listContains
+
+on showList(listToShow)
+	choose from list listToShow with prompt "List:" with empty selection allowed
+end showList
+
+on replace(aString, oldChar, newChar)
+	set newString to ""
+	repeat with aChar in (every character of aString)
+		if (contents of aChar = oldChar) then
+			set newString to newString & newChar
+		else
+			set newString to newString & aChar
+		end if
+	end repeat
+	return newString
+end replace
+
+on substring(aString, anOffset)
+	set aSubString to ""
+	repeat with charIndex from anOffset to (count aString)
+		set aSubString to aSubString & (character charIndex of aString)
+	end repeat
+	return aSubString
+end substring
+
+on setFileInfo(aFile, aCreator, aType)
+	tell application "Finder"
+		set creator type of aFile to aCreator
+		set file type of aFile to aType
+	end tell
+end setFileInfo
+
+on closeFile(fileRef)
+	try
+		-- make sure it's not currently open.
+		close access fileRef
+	on error
+		-- ignore error closing.
+	end try
+end closeFile
+
+on mroFile(aFile)
+	try
+		-- make sure it's modifiable.
+		mro aFile
+	on error
+		-- ignore error MROing.
+	end try
+end mroFile
+
+on run
+	-- so we can easily strip off file names from paths.
+	set oldDelimiters to swapDelimiters(":")
+	
+	set theProjectFile to (choose file with prompt "Choose a CW Project file." of type {"MMPr"})
+	set theManifestFile to (new file with prompt "Create MANIFEST where?" default name setExtension(fileFromPath(theProjectFile as text), ".toc"))
+	
+	set manifestRef to false
+	
+	try
+		-- make sure the file is closed & is modifiable.
+		closeFile(theManifestFile)
+		mroFile(theManifestFile)
+		
+		-- open the new MANIFEST file.
+		set manifestRef to (open for access theManifestFile with write permission)
+		set eof manifestRef to 0
+		
+		-- give it CodeWarrior look and feel.
+		setFileInfo(theManifestFile, "CWIE", "TEXT")
+		
+		openProject(theProjectFile)
+		selectProject(theProjectFile)
+		
+		set targetsList to getTargets()
+		set targetNames to names of targetsList
+		set targetCount to count items of targetNames
+		
+		set mozillaTreePathOffset to (offset of "mozilla" in (theManifestFile as text))
+		
+		-- dump all targets into the new MANIFEST file.
+		repeat with targetName in targetNames
+			write ("# target: " & targetName & return) to manifestRef
+			setCurrentTarget(targetName)
+			set targetFiles to getTargetFiles(contents of targetName)
+			repeat with targetFile in targetFiles
+				-- only store the path name relative to the source tree itself.
+				set targetFilePath to substring(contents of targetFile, mozillaTreePathOffset)
+				write (replace(targetFilePath, ":", "/") & return) to manifestRef
+			end repeat
+		end repeat
+	on error msg
+		display dialog msg
+	end try
+	if (manifestRef is not false) then
+		closeFile(manifestRef)
+	end if
+	
+	-- shut the project down, and display the result.
+	tell application "CodeWarrior IDE 3.3"
+		activate
+		Close Project
+		open theManifestFile
+	end tell
+	
+	setDelimiters(oldDelimiters)
+end run

mozilla/build/mac/IDE_Options.h

@@ -0,0 +1,110 @@
+/* -*- Mode: C; tab-width: 4; indent-tabs-mode: nil; c-basic-offset: 2 -*-
+ *
+ * The contents of this file are subject to the Netscape Public
+ * License Version 1.1 (the "License"); you may not use this file
+ * except in compliance with the License. You may obtain a copy of
+ * the License at http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the License is distributed on an "AS
+ * IS" basis, WITHOUT WARRANTY OF ANY KIND, either express or
+ * implied. See the License for the specific language governing
+ * rights and limitations under the License.
+ *
+ * The Original Code is mozilla.org code.
+ *
+ * The Initial Developer of the Original Code is Netscape
+ * Communications Corporation.  Portions created by Netscape are
+ * Copyright (C) 1998 Netscape Communications Corporation. All
+ * Rights Reserved.
+ *
+ * Contributor(s): 
+ */
+/*
+
+	This file overrides all option settings in the IDE.  It is an attempt to allow all builds
+	to have the same options.
+
+	Note: We can't use ConditionalMacros.h in this file because it will conflict with 
+	the PowerPlant precompiled headers.
+
+*/
+
+	/* warning pragmas */
+#pragma warn_hidevirtual 		on
+#pragma warn_emptydecl 			on
+#pragma warn_unusedvar 			on
+#pragma warn_extracomma 		on
+#pragma warn_illpragma 			on
+#pragma warn_possunwant 		on
+#pragma warn_unusedarg 			off		/* turned off to reduce warnings */
+
+#pragma check_header_flags 		on
+
+	/* Language features that must be the same across libraries... */
+#pragma enumsalwaysint			on
+#pragma unsigned_char			off
+#pragma exceptions				on
+#pragma bool 					on
+#pragma wchar_type              on
+#pragma RTTI                    on
+
+
+	/* Save as much space as possible with strings... */
+#pragma pool_strings				on
+#pragma dont_reuse_strings			off
+
+#pragma options align=native
+#pragma sym 						on				/* Takes no memory.  OK in non-debug. */
+
+
+
+#ifdef powerc /* ...generating PowerPC */
+	#pragma toc_data 				on
+	#pragma fp_contract 			on
+	#pragma readonly_strings 		on
+
+	#ifdef DEBUG
+		#pragma profile 		off							/* Turn this on to profile the application. */
+																				/* Look for more details about profiling in nsMacMessagePump.cpp.  */
+		#pragma traceback 			on
+		#pragma global_optimizer 	off
+		#pragma scheduling 			off
+		#pragma peephole 			off
+		#pragma optimize_for_size 	off
+	#else
+		#pragma traceback 			on					/* leave on until the final release, so MacsBug logs are interpretable */
+		#pragma global_optimizer 	on
+		#pragma optimization_level 	4
+		#pragma scheduling 			603
+		#pragma peephole 			on
+		#pragma optimize_for_size	on
+
+    #pragma opt_strength_reduction on
+    #pragma opt_propagation on
+    #pragma opt_loop_invariants on
+    #pragma opt_lifetimes on
+    #pragma opt_dead_code on
+    #pragma opt_dead_assignments on
+    #pragma opt_common_subs on
+	#endif
+
+#else /* ...generating 68k */
+	#pragma code68020 			on
+	#pragma code68881 			off
+
+		/* Far everything... */
+	#pragma far_code
+	#pragma far_data 			on
+	#pragma far_strings 		on
+	#pragma far_vtables 		on
+
+	#pragma fourbyteints		on	/* 4-byte ints */
+	#pragma IEEEdoubles			on	/* 8-byte doubles (as required by Java and NSPR) */
+
+	#ifdef DEBUG
+		#pragma macsbug 		on
+		#pragma oldstyle_symbols off
+	#else
+		#pragma macsbug 		off
+	#endif
+#endif

mozilla/build/mac/MANIFEST

@@ -0,0 +1,5 @@
+#
+# This is a list of local files which get copied to the mozilla:dist directory
+#
+
+IDE_Options.h

mozilla/build/mac/MANIFESTO.pm

@@ -0,0 +1,222 @@
+#!perl -w
+package	MANIFESTO;
+
+require 5.004;
+require	Exporter;
+
+#use strict;
+
+use vars qw($VERSION @ISA @EXPORT $MANIFESTOLib);
+use Mac::StandardFile;
+use Moz;
+use Cwd;
+use Exporter;
+use File::Basename;
+
+@ISA				= qw(Exporter);
+@EXPORT			= qw(ReconcileProject);
+$VERSION = "1.00";
+
+=head1 NAME
+
+MANIFESTO - drives the Mac Project Reconciliation tool.
+
+=head1 SYNOPSIS
+
+You want to use this script. It will make your life easier.
+
+=head1 COPYRIGHT
+
+The contents of this file are subject to the Netscape Public
+License Version 1.1 (the "License"); you may not use this file
+except in compliance with the License. You may obtain a copy of
+the License at http://www.mozilla.org/NPL/
+
+Software distributed under the License is distributed on an "AS
+IS" basis, WITHOUT WARRANTY OF ANY KIND, either express or
+implied. See the License for the specific language governing
+rights and limitations under the License.
+
+The Original Code is Mozilla Communicator client code, released
+March 31, 1998.
+
+The Initial Developer of the Original Code is Netscape
+Communications Corporation. Portions created by Netscape are
+Copyright (C) 1998-1999 Netscape Communications Corporation. All
+Rights Reserved.
+
+Contributor(s): 
+
+=cut
+
+# 
+# globals
+# $MANIFESTOLib - location of MANIFESTO applescript library
+#
+
+#
+# utility routines
+#
+
+sub current_directory()
+{
+	my $current_directory = cwd();
+	chop($current_directory) if ( $current_directory =~ m/:$/ );
+	return $current_directory;
+}
+
+# Uses the "compile script" extension to compile a script.
+sub compile_script($;$) {
+	my($scriptPath, $outputPath) = @_;
+	
+	#// generate a script to compile a script file.
+	my $script = <<END_OF_APPLESCRIPT;
+	store script (compile script (alias "$scriptPath")) in (file "$outputPath") replacing yes
+END_OF_APPLESCRIPT
+
+	#// run the script.
+	MacPerl::DoAppleScript($script);
+}
+
+# _useMANIFESTOLib()
+# returns 1 on success
+# Search the include path for the file called MANIFESTOLib
+sub _useMANIFESTOLib() 
+{
+	unless ( defined($MANIFESTOLib) )
+	{
+		my($scriptName) = "MANIFESTOLib.script";
+		my($libName) = "MANIFESTOLib";
+		# try the directory we were run from
+		my($scriptPath) = dirname($0) . ":" . $scriptName;
+		my($libPath) = dirname($0) . ":" . $libName;
+		# make sure that the compiled script is up to date with the textual script.
+		unless (-e $libPath && getModificationDate($libPath) >= getModificationDate($scriptPath)) {
+			print "# Recompiling MANIFESTOLib.script.\n";
+			compile_script($scriptPath, $libPath);
+		}
+		if ( -e $libPath) {
+			$MANIFESTOLib = $libPath;
+		} else {
+			# now search the include directories
+			foreach (@INC)
+			{
+				unless ( m/^Dev:Pseudo/ )	# This is some bizarre MacPerl special-case directory
+				{
+					$libPath = $_ . $libName;
+					if (-e $libPath)
+					{
+						$MANIFESTOLib = $libPath;
+						last;
+					}
+				}
+			}
+		}
+		if (! (-e $MANIFESTOLib)) {
+			print STDERR "MANIFESTOLib lib could not be found! $MANIFESTOLib";
+			return 0;
+		}
+	}
+	return 1;
+}
+
+sub getModificationDate($) {
+	my($filePath)=@_;
+	my($dev,$ino,$mode,$nlink,$uid,$gid,$rdev,$size,
+		$atime,$mtime,$ctime,$blksize,$blocks) = stat($filePath);
+	return $mtime;
+}
+
+sub setExtension($;$;$) {
+	my($filePath, $oldExtension, $newExtension)=@_;
+	my($name, $dir, $type) = fileparse($filePath, $oldExtension);
+	return "$dir$name$newExtension";
+}
+
+#
+# ReconcileProject(projectPath, manifestoPath)
+#
+# Uses MANIFESTOLib AppleScript to reconcile the contents (toc?) of a
+# CodeWarrior project with an external MANIFEST file.
+#
+
+sub ReconcileProject($;$) {
+	#// turn this feature on by removing the following line.
+	return 1;
+
+	my($projectPath, $manifestoPath) = @_;
+	my($sourceTree) = current_directory();
+	my($logPath) = setExtension($manifestoPath, ".toc", ".log");
+
+	print STDERR "# Reconciling Project: $projectPath with $manifestoPath\n";
+	
+	#// compare the modification dates of the .toc and .log files. If .log is newer, do nothing.
+	if (-e $logPath && getModificationDate($logPath) >= getModificationDate($manifestoPath)) {
+		print "# Project is up to date.\n";
+		return 1;
+	}
+
+	_useMANIFESTOLib() || die "Could not load MANIFESTOLib\n";
+	
+	my $script = <<END_OF_APPLESCRIPT;
+	tell (load script file "$MANIFESTOLib") to ReconcileProject("$sourceTree:", "$sourceTree$projectPath", "$sourceTree$manifestoPath")
+END_OF_APPLESCRIPT
+
+	#// run the script, and store the results in a file called "$manifestoPath.log"
+	my $asresult = substr(MacPerl::DoAppleScript($script), 1, -1);	#// chops off leading, trailing quotes.
+
+	#// print out to STDOUT to show progress.
+	print $asresult;
+
+	#// store the results in "$manifestoPath.log", which will act as a cache for later checks.
+	open(OUTPUT, ">$logPath") || die "can't open log file $logPath.";
+	print OUTPUT $asresult;
+	close(OUTPUT);
+
+	return 1;
+}
+
+1;
+=pod
+
+=head1 NAME
+
+MANIFESTO - Scripts to process source .toc files.
+
+=head1 SYNOPSIS
+
+	use MANIFESTO;
+	ReconcileProject(<path to Mac project file>, <path to table of contents file>) || die "cannot reconcile project";
+		
+=head1 DESCRIPTION
+
+This is a PERL interface for talking to MANIFESTOLib AppleScripts.
+
+=item ReconcileProject
+	ReconcileProject(<path to Mac project file>, <path to table of contents file>);
+	
+	Reconciles the contents of a project with an external .toc file.
+
+=cut
+
+=head1 SEE ALSO
+
+=over
+
+=item MacCVS Home Page
+
+http://www.maccvs.org/
+
+=back 
+
+=head1 AUTHORS
+
+Patrick Beard beard@netscape.com
+
+based on work by
+
+Aleks Totic atotic@netscape.com
+
+=cut
+
+__END__

mozilla/build/mac/MANIFESTOLib.script

@@ -0,0 +1,376 @@
+(*
+ *
+ * The contents of this file are subject to the Netscape Public
+ * License Version 1.1 (the "License"); you may not use this file
+ * except in compliance with the License. You may obtain a copy of
+ * the License at http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the License is distributed on an "AS
+ * IS" basis, WITHOUT WARRANTY OF ANY KIND, either express or
+ * implied. See the License for the specific language governing
+ * rights and limitations under the License.
+ *
+ * The Original Code is mozilla.org code.
+ *
+ * The Initial Developer of the Original Code is Netscape
+ * Communications Corporation.  Portions created by Netscape are
+ * Copyright (C) 1998 Netscape Communications Corporation. All
+ * Rights Reserved.
+ *
+ * Contributor(s): 
+ *)
+
+(*
+	MANIFESTOLib - Reconciles a CW Project file with an external table of contents file.
+
+	Uses merge sort, one pass per target.
+	
+	by Patrick C. Beard <beard@netscape.com>
+ *)
+
+(* Global Configuration Properties *)
+
+property pShowReport : true
+-- property pSourceTree : "Homeward:Work:Raptor:src:"
+property pSourceTree : "Morbeus:Projects:Raptor:src:"
+
+on swapDelimiters(newDelimiters)
+	set oldDelimiters to get AppleScript's text item delimiters
+	set AppleScript's text item delimiters to newDelimiters
+	return oldDelimiters
+end swapDelimiters
+
+on setDelimiters(newDelimiters)
+	set AppleScript's text item delimiters to newDelimiters
+end setDelimiters
+
+-- replaces oldChar with newChar in a string.
+on replace(aString, oldChar, newChar)
+	set newString to ""
+	repeat with aChar in (every character of aString)
+		if (contents of aChar = oldChar) then
+			set newString to newString & newChar
+		else
+			set newString to newString & aChar
+		end if
+	end repeat
+	return newString
+end replace
+
+(* uses "sort" scripting addition to sort a list of strings. *)
+on sortList(aList)
+	if (aList ­ {}) then
+		return sort aList
+	else
+		return {}
+	end if
+end sortList
+
+-- reads .toc file into a list.
+on readManifestFile(sourceTree, manifestFile)
+	set oldDelimiters to swapDelimiters(return)
+	set fileRef to false
+	set fileLines to {}
+	try
+		set fileRef to (open for access manifestFile without write permission)
+		-- read entire file into memory, use text items to delimit lines.
+		set fileContents to (read fileRef)
+		repeat with lineRef in (every text item of fileContents)
+			-- ignore lines that start with "#" or are empty.
+			set fileLine to (contents of lineRef)
+			if (fileLine ­ "") and not (fileLine starts with "#") then
+				set fileLines to fileLines & (sourceTree & replace(fileLine, "/", ":"))
+			end if
+		end repeat
+	on error
+		-- ignore errors.
+	end try
+	if (fileRef is not false) then close access fileRef
+	setDelimiters(oldDelimiters)
+	return sortList(fileLines)
+end readManifestFile
+
+(* both of the following depend on ":" as the delimiter character. *)
+
+on folderFromPath(filePath)
+	return ((filePath's text items 1 thru ((count of filePath's text items) - 1)) as string) & ":"
+end folderFromPath
+
+on fileFromPath(filePath)
+	return last text item of filePath
+end fileFromPath
+
+(* CW Pro IDE Interface Handlers. *)
+
+on openProject(aProjectFile)
+	tell application "CodeWarrior IDE 3.3"
+		-- activate
+		open aProjectFile
+	end tell
+end openProject
+
+(* forces the named project file to be the front window. *)
+on selectProject(aProjectFile)
+	set projectName to fileFromPath(aProjectFile as text)
+	tell application "CodeWarrior IDE 3.3"
+		if (name of window 1 is not projectName) then
+			select window projectName
+		end if
+	end tell
+end selectProject
+
+on closeProject(aProjectFile)
+	tell application "CodeWarrior IDE 3.3"
+		Close Project
+	end tell
+end closeProject
+
+on getTargets()
+	set targetList to {}
+	set nameList to {}
+	tell application "CodeWarrior IDE 3.3"
+		set currentProject to project document 1
+		repeat with targetIndex from 1 to (count of targets of currentProject)
+			set currentTarget to (target targetIndex of currentProject)
+			set targetList to targetList & {currentTarget}
+			set nameList to nameList & {name of currentTarget}
+		end repeat
+		return {target:targetList, names:nameList}
+	end tell
+end getTargets
+
+(* uses "info for" scripting addition, to return the file type of a path. *)
+on getFileType(aFilePath)
+	return file type of (info for alias aFilePath)
+end getFileType
+
+(* returns all "TEXT" files of the named target. *)
+on getTargetFiles(targetKey)
+	set targetFiles to {}
+	tell application "CodeWarrior IDE 3.3"
+		set currentProject to project document 1
+		set currentTarget to (target targetKey of currentProject)
+		try
+			-- workaround for CW IDE 3.X bug, loop until error encountered.
+			set fileIndex to 1
+			repeat until false
+				set targetFile to (target file fileIndex of currentTarget)
+				-- only consider text files, since other platforms won't be managing binaries.
+				-- also, only consider if target file is directly linked.
+				if (linked of targetFile) then
+					set targetFilePath to (Access Paths of targetFile)
+					tell me
+						if (getFileType(targetFilePath) = "TEXT") then
+							set targetFiles to targetFiles & {targetFilePath}
+						end if
+					end tell
+				end if
+				set fileIndex to (fileIndex + 1)
+			end repeat
+		on error msg
+			-- display dialog msg & " file count = " & fileIndex
+		end try
+	end tell
+	return sortList(targetFiles)
+end getTargetFiles
+
+on addTargetFile(targetFile, targetList)
+	tell application "CodeWarrior IDE 3.3"
+		add (project document 1) new target file with data {targetFile} to targets targetList
+	end tell
+end addTargetFile
+
+global gCurrentTarget
+
+on setCurrentTarget(currentTargetName)
+	if (gCurrentTarget ­ currentTargetName) then
+		set gCurrentTarget to currentTargetName
+		tell application "CodeWarrior IDE 3.3"
+			Set Current Target currentTargetName
+		end tell
+	end if
+end setCurrentTarget
+
+on removeTargetFile(targetFile)
+	tell application "CodeWarrior IDE 3.3"
+		Remove Files {targetFile}
+	end tell
+end removeTargetFile
+
+on quote(aString)
+	return "'" & aString & "'"
+end quote
+
+on listContains(aList, anItem)
+	repeat with listItem in aList
+		if (contents of listItem = anItem) then
+			return true
+		end if
+	end repeat
+	return false
+end listContains
+
+on showList(aList)
+	choose from list aList with prompt "List:" with empty selection allowed
+end showList
+
+global gProjectModified
+
+on ModifyReadOnly(aProjectFile)
+	if (not gProjectModified) then
+		set gProjectModified to true
+		-- so CodeWarrior will notice, must close the file before MROing it.
+		closeProject(aProjectFile)
+		mro aProjectFile
+		openProject(aProjectFile)
+		selectProject(aProjectFile)
+	end if
+end ModifyReadOnly
+
+on makeStream(itemList)
+	return {streamList:itemList, streamCount:count itemList, streamIndex:0}
+end makeStream
+
+(* true is used as the end of stream value. *)
+property pEOS : true
+
+on advanceStream(stream)
+	set itemCount to (streamCount of stream)
+	set itemIndex to (streamIndex of stream)
+	if (itemIndex < itemCount) then
+		set itemIndex to (itemIndex + 1)
+		set (streamIndex of stream) to itemIndex
+		return (item itemIndex of streamList of stream)
+	else
+		return pEOS
+	end if
+end advanceStream
+
+-- returns true if str2 is INFINITELY great, or str1 is less than str2.
+on precedes(str1, str2)
+	return (str2 = pEOS) or ((str1 ­ pEOS) and (str1 < str2))
+end precedes
+
+on get_current_application()
+	return last text item of ((path to current application) as text)
+end get_current_application
+
+on get_frontmost_application()
+	return last text item of ((path to frontmost application) as text)
+end get_frontmost_application
+
+on activate_application(applicationName)
+	tell application "Finder"
+		set applicationProcess to (application process applicationName)
+		set frontmost of applicationProcess to true
+	end tell
+end activate_application
+
+on ReconcileProject(sourceTree, projectPath, manifestoPath)
+	-- so we can easily strip off file names from paths.
+	set oldDelimiters to swapDelimiters(":")
+	
+	-- initialize globals.
+	set gCurrentTarget to ""
+	set gProjectModified to false
+	
+	-- convert paths to aliases.
+	set projectFile to alias projectPath
+	set manifestFile to alias manifestoPath
+	
+	-- read the MANIFESTO file into a list of paths.
+	set manifestContents to readManifestFile(sourceTree, manifestFile)
+	-- return manifestContents
+	
+	-- now, start processing the file items, ensuring that the project contains all items.
+	openProject(projectFile)
+	selectProject(projectFile)
+	set targetsList to getTargets()
+	set targetNames to names of targetsList
+	
+	if (pShowReport) then
+		set theReport to ""
+		set addedFiles to ""
+		set removedFiles to ""
+	end if
+	
+	-- push current application to front for speed.
+	-- set frontmostApplication to get_frontmost_application()
+	-- set currentApplication to get_current_application()
+	-- activate_application(currentApplication)
+	
+	-- reconcile all targets with the MANIFEST file.
+	-- this loop should be recoded in PERL for speed.
+	-- IDEA: with sorted lists, can scan both lists, like a merge sort, and make one pass per target.
+	repeat with targetNameRef in targetNames
+		-- switch targets because getTargetFiles now checks to see if file is linked in current target.
+		set targetName to (contents of targetNameRef)
+		set targetFiles to getTargetFiles(targetName)
+		-- hopefully, this list test is fast.
+		if (targetFiles ­ manifestContents) then
+			-- return {count targetFiles, count manifestContents, targetFiles, manifestContents}
+			-- make sure the project file is modifiable.
+			ModifyReadOnly(projectFile)
+			setCurrentTarget(targetName)
+			set targetStream to makeStream(targetFiles)
+			set targetItem to advanceStream(targetStream)
+			set manifestStream to makeStream(manifestContents)
+			set manifestItem to advanceStream(manifestStream)
+			repeat until (manifestItem is pEOS) and (targetItem is pEOS)
+				-- display dialog "m: " & manifestItem & ", t: " & targetFileItem
+				if (manifestItem = targetItem) then
+					-- items match, advance both.
+					set manifestItem to advanceStream(manifestStream)
+					set targetItem to advanceStream(targetStream)
+				else
+					-- return {manifestItem, targetItem}
+					if (precedes(manifestItem, targetItem)) then
+						-- we have an item in manifest, not in project, so we have to add it to the targets.
+						-- display dialog "adding " & manifestItem
+						addTargetFile(manifestItem, targetNames)
+						if pShowReport then
+							set addedFiles to addedFiles & ("# " & (last text item of manifestItem) & return)
+						end if
+						set manifestItem to advanceStream(manifestStream)
+					else
+						-- we have an item not in manifest, but in project, so it must be removed from this target.
+						-- display dialog "removing " & targetItem
+						removeTargetFile(targetItem)
+						if pShowReport then
+							set removedFiles to removedFiles & ("# " & targetName & " - " & (last text item of targetItem) & return)
+						end if
+						set targetItem to advanceStream(targetStream)
+					end if
+				end if
+			end repeat
+		end if
+	end repeat
+	
+	-- activate_application(frontmostApplication)
+	
+	-- commit the project changes, and  optionally display a report.
+	tell application "CodeWarrior IDE 3.3"
+		-- leave project open for compilation phase?
+		Close Project
+		if pShowReport then
+			if addedFiles is not "" then set theReport to ("# Added files: " & return & addedFiles)
+			if removedFiles is not "" then set theReport to theReport & ("# Removed files: " & return & removedFiles)
+			if (theReport is "") then set theReport to (" # Project is up to date." & return)
+			-- display dialog theReport buttons {"OK"} default button "OK"
+		end if
+	end tell
+	
+	-- restore AppleScript's delimiters.
+	setDelimiters(oldDelimiters)
+	
+	-- return 0 to indicate no error.
+	return theReport
+end ReconcileProject
+
+on run
+	-- when run interactively,
+	-- ask user which project/MANIFEST files to use.
+	set projectPath to (choose file with prompt "Choose a CW Project file." of type {"MMPr"}) as text
+	set manifestPath to (choose file with prompt "Choose a TOC file to process." of type {"TEXT"}) as text
+	ReconcileProject(pSourceTree, projectPath, manifestPath)
+end run

mozilla/build/mac/MacCVS.pm

@@ -0,0 +1,204 @@
+#!perl -w
+package	MacCVS;
+
+# package	Mac::Apps::MacCVS; this should really be the name of the package
+# but due to our directory hierarchy in mozilla, I am not doing it
+
+require 5.004;
+require	Exporter;
+
+use strict;
+
+use vars qw($VERSION @ISA @EXPORT $MacCVSLib);
+use Mac::StandardFile;
+use Moz;
+use Cwd;
+use Exporter;
+use File::Basename;
+
+@ISA				= qw(Exporter);
+@EXPORT			= qw( new print checkout);
+$VERSION = "1.00";
+
+# Architecture:
+# cvs session object:
+# name - session name
+# session_file - session file
+# 
+# globals
+# $MacCVSLib - location of MacCVS applescript library
+#
+# 
+
+#
+# utility routines
+#
+
+# just like Mac::DoAppleScript, 1 is success, 0 is failure
+sub _myDoAppleScript($)	
+{
+	my($script) = @_;
+	my $asresult = MacPerl::DoAppleScript($script);
+	if ($asresult eq "0")
+	{
+		return 1;
+	}
+	else
+	{
+		print STDERR "AppleScript error: $asresult\n";
+		print STDERR "AppleScript was: \n $script \n";
+		return 0;
+	}
+}
+
+# _useMacCVSLib
+# returns 1 on success
+# Search the include path for the file called MacCVSLib
+sub _useMacCVSLib() 
+{
+	unless ( defined($MacCVSLib) )
+	{
+		my($libname) = "MacCVSLib";
+# try the directory we were run from
+		my($c) = dirname($0) . ":" . $libname;
+		if ( -e $c)
+		{
+			$MacCVSLib = $c;
+		}
+		else
+		{
+	# now search the include directories
+			foreach (@INC)
+			{
+				unless ( m/^Dev:Pseudo/ )	# This is some bizarre MacPerl special-case directory
+				{
+					$c = $_ . $libname;
+					if (-e $c)
+					{
+						$MacCVSLib = $c;
+						last;
+					}
+				}
+			}
+		}
+		if (! (-e $MacCVSLib))
+		{
+			print STDERR "MacCVS lib could not be found! $MacCVSLib";
+			return 0;
+		}
+	}
+	return 1;
+}
+
+
+#
+# Session object methods
+#
+
+sub new		{
+	my ( $proto, $session_file) = @_;
+	my $class = ref($proto) || $proto;
+	my $self = {};
+
+	if ( defined($session_file) && ( -e $session_file) )
+	{
+		$self->{"name"} = basename( $session_file );
+		$self->{"session_file"} = $session_file;
+		bless $self, $class;
+		return $self;
+	}
+	else
+	{
+		print STDERR "MacCVS->new cvs file < $session_file > does not exist\n";
+		return;
+	}
+}
+
+# makes sure that the session is open
+# assertSessionOpen()
+# returns 1 on failure
+sub assertSessionOpen()	{
+	my ($self) = shift;
+	_useMacCVSLib() || die "Could not load MacCVSLib\n";
+	my $script = <<END_OF_APPLESCRIPT;
+	tell (load script file "$MacCVSLib") to OpenSession("$self->{session_file}")
+END_OF_APPLESCRIPT
+	return _myDoAppleScript($script);
+}
+
+# prints the cvs object, used mostly for debugging
+sub print {
+	my($self) = shift;
+	print "MacCVS:: name: ", $self->{name}, " session file: ", $self->{session_file}, "\n";
+}
+
+# checkout( self, module, revision, date)
+# MacCVS checkout command
+# returns 1 on failure
+sub checkout
+{
+	my($self, $module, $revision, $date ) = @_;
+	unless( defined ($module) ) { $module = ""; }	# get rid of the pesky undefined warnings
+	unless( defined ($revision) ) { $revision = ""; }
+	unless( defined ($date) ) { $date = ""; }
+
+	$self->assertSessionOpen() || return 1;
+	
+	my($revstring) = ($revision ne "") ? $revision : "(none)";
+	my($datestring) = ($date ne "") ? $date : "(none)";
+	
+	print "Checking out $module with revision $revstring, date $datestring\n";
+	
+	my $script = <<END_OF_APPLESCRIPT;
+	tell (load script file "$MacCVSLib") to Checkout given sessionName:"$self->{name}", module:"$module", revision:"$revision", date:"$date"
+END_OF_APPLESCRIPT
+	return _myDoAppleScript($script);
+}
+
+1;
+=pod
+
+=head1 NAME
+
+MacCVS - Interface to MacCVS
+
+=head1 SYNOPSIS
+
+	use MacCVS;
+	$session = MacCVS->new( <session_file_path>) || die "cannot create session";
+	$session->checkout([module] [revision] [date]) || die "Could not check out";
+		
+=head1 DESCRIPTION
+
+This is a MacCVS interface for talking to MacCVS Pro client.
+MacCVSSession is the class used to manipulate the session
+
+=item new
+	MacCVS->new( <cvs session file path>);
+	
+	Creates a new session. Returns undef on failure.
+
+=item checkout( <module> [revision] [date] )
+
+	cvs checkout command. Revision and date are optional
+	returns 0 on failure
+	
+=cut
+
+=head1 SEE ALSO
+
+=over
+
+=item MacCVS Home Page
+
+http://www.maccvs.org/
+
+=back 
+
+=head1 AUTHORS
+
+Aleks Totic atotic@netscape.com
+
+=cut
+
+__END__

mozilla/build/mac/MakeJarsMac.pm

@@ -0,0 +1,146 @@
+#!perl -w
+# make-jars [-d <destPath>] < <manifest.jr>
+
+package	MozJar;
+
+require 5.004;
+
+use strict;
+use Cwd;
+use Archive::Zip qw( :ERROR_CODES :CONSTANTS );
+use Moz;
+
+use vars qw( @ISA @EXPORT );
+
+@ISA		= qw(Exporter);
+@EXPORT     = qw(ProcessJarManifest);
+
+sub _addToJar($$$$$)
+{
+      my($thing, $srcPath, $jarManDir, $zip, $compress) = @_;
+      #print "_addToJar($thing, $srcPath, $jarManDir, $zip, $compress)\n";
+      
+      my $existingMember = $zip->memberNamed($thing);
+      if ($existingMember) {
+          my $modtime = $existingMember->lastModTime();
+          print "already have $thing at $modtime\n";  # XXX need to check mod time here!
+          return 0;
+      }
+      
+      my $filepath = "$jarManDir:$srcPath";
+      $filepath =~ s|/|:|g;
+      
+      if (!-e $filepath) {
+          $srcPath =~ /([\w\d.:\-\\\/]+)[:\\\/]([\w\d.\-]+)/;
+          $filepath = "$jarManDir:$2";
+          if (!-e $filepath) {
+              die "$filepath does not exist\n";
+          }
+      }
+      
+      my $member = Archive::Zip::Member->newFromFile($filepath);
+      die "Failed to create zip file member $filepath\n" unless $member;
+
+      $member->fileName($thing);
+
+      print "Adding $filepath as $thing\n";
+
+      if ($compress) {
+          $member->desiredCompressionMethod(Archive::Zip::COMPRESSION_DEFLATED);            
+      } else {
+          $member->desiredCompressionMethod(Archive::Zip::COMPRESSION_STORED);
+      }
+
+      $zip->addMember($member);
+}
+
+sub JarIt($$)
+{
+    my ($jarfile, $zip) = @_;
+    #print "+++ jarring $jarfile\n";
+    #flush();
+    #system "zip -u $jarfile $args\n";
+    my $jarTempFile = $jarfile . ".temp";
+    $zip->writeToFileNamed($jarTempFile) == AZ_OK
+      || die "zip writeToFileNamed $jarTempFile failed";
+
+    # set the file type/creator to something reasonable
+    MacPerl::SetFileInfo("ZIP ", "ZIP ", $jarTempFile);
+    rename($jarTempFile, $jarfile);
+    print "+++ finished jarring $jarfile\n";
+}
+
+sub ProcessJarManifest($$)
+{
+    my ($jarManPath, $destPath) = @_;
+    
+    $jarManPath = Moz::full_path_to($jarManPath);
+    $destPath = Moz::full_path_to($destPath);
+    #print "ProcessJarManifest($jarManPath, $destPath)\n";
+
+    print "+++ jarring $jarManPath\n";
+    
+	my $jarManDir = "";
+	my $jarManFile = "";
+	if ($jarManPath =~ /([\w\d.:\-\\\/]+)[:\\\/]([\w\d.\-]+)/) {
+        $jarManDir = $1;
+        $jarManFile = $2;
+    }
+    else {
+    	die "bad jar.mn specification";
+    }
+
+    open(FILE, "<$jarManPath") || die "could not open $jarManPath: $!";
+	while (<FILE>) {
+	    chomp;
+	  start: 
+	    if (/^([\w\d.\-\\\/]+)\:\s*$/) {
+	        my $jarfile = "$destPath/$1";
+	        $jarfile =~ s|/|:|g;
+	        #my $args = "";
+
+            my $zip = Archive::Zip->new();
+            #print "new jar $jarfile\n";
+	        if (-e $jarfile) {
+	        	#print "=====> $jarfile exists\n";
+	        	my $ok = $zip->read($jarfile);
+	        	if ($ok != AZ_OK) {
+	        	    die "zip read $jarfile failed: $ok";
+	        	}
+	        }
+
+	        while (<FILE>) {
+	            if (/^\s+([\w\d.\-\\\/]+)\s*(\([\w\d.\-\\\/]+\))?$\s*/) {
+					my $dest = $1;
+					my $srcPath = $2;
+                	if ( $srcPath ) {  
+                	    $srcPath = substr($srcPath,1,-1);
+                	}
+                	else {
+                		$srcPath = ":" . $dest;
+                	}
+                	$srcPath =~ s|/|:|g;
+
+	                _addToJar($dest, $srcPath, $jarManDir, $zip, 1);
+	            } elsif (/^\s*$/) {
+	                # end with blank line
+	                last;
+	            } else {
+	                JarIt($jarfile, $zip);
+	                goto start;
+	            }
+	        }
+	        JarIt($jarfile, $zip);
+
+	    } elsif (/^\s*\#.*$/) {
+	        # skip comments
+	    } elsif (/^\s*$/) {
+	        # skip blank lines
+	    } else {
+	        close;
+	        die "bad jar rule head at: $_";
+	    }
+	}
+    close(FILE);
+}
+

mozilla/build/mac/Moz.pm

@@ -0,0 +1,572 @@
+=head1 NAME
+
+B<Moz> - routines for automating CodeWarrior builds, and some extra-curricular activities related to building Mozilla
+
+=head1 SYNOPSIS
+
+    use Moz;
+
+    OpenErrorLog(":::BuildLog");
+    StopForErrors();
+
+		$Moz::QUIET = 1;
+		InstallFromManifest(":projects:MANIFEST", $dist_dir);
+
+    BuildProjectClean(":projects:SomeProject.mcp", "SomeTarget");
+    MakeAlias(":projects:SomeProject.shlb", $dist_dir);
+
+    DontStopForErrors();
+
+    BuildProject(":projects:SomeOtherProject.mcp", "SomeTarget");
+
+=head1 DESCRIPTION
+
+B<Moz> comprises the routines needed to slap CodeWarrior around, force it to build a sequence of projects, report the results, and a few other things.
+
+=cut
+
+
+
+
+package			Moz;
+require			Exporter;
+
+use Mac::Types;
+use Mac::Events;
+use Mac::Processes;
+use File::Copy;
+
+@ISA				= qw(Exporter);
+@EXPORT			= qw(BuildProject LaunchCodeWarrior BuildProjectClean GetFileModDate OpenErrorLog MakeAlias StopForErrors DontStopForErrors InstallFromManifest InstallResources SetBuildNumber SetAgentString SetTimeBomb Delay ActivateApplication);
+@EXPORT_OK	= qw(CloseErrorLog UseCodeWarriorLib QUIET);
+
+	use Cwd;
+	use File::Path;
+	use ExtUtils::Manifest 'maniread';
+
+	use CodeWarriorLib;
+
+sub current_directory()
+	{
+		my $current_directory = cwd();
+		chop($current_directory) if ( $current_directory =~ m/:$/ );
+		return $current_directory;
+	}
+
+sub full_path_to($)
+	{
+		my ($path) = @_;
+		if ( $path =~ m/^[^:]+$/ )
+			{
+				$path = ":" . $path;
+			}
+
+		if ( $path =~ m/^:/ )
+			{
+				$path = current_directory() . $path;
+			}
+
+		return $path;
+	}
+
+=head2 Setup
+
+Pretty much, everything is taken care of for you.
+  However, B<Moz> does use a little compiled AppleScript library (the file CodeWarriorLib) for some of its communcication with CodeWarrior.
+  If this library isn't in the same directory as "Moz.pm", then you need to tell B<Moz> where to find it.
+  Call C<UseCodeWarriorLib($path_to_CodeWarriorLib)>.
+  This routine is not exported by default, nor are you likely to need it.
+
+=cut
+
+sub UseCodeWarriorLib($)
+	{
+#		($CodeWarriorLib) = @_;
+#		$CodeWarriorLib = full_path_to($CodeWarriorLib);
+	}
+
+sub LaunchCodeWarrior()
+{
+  CodeWarriorLib::activate();
+}
+
+
+sub activate_CodeWarrior()
+	{
+#MacPerl::DoAppleScript(<<END_OF_APPLESCRIPT);
+#	tell (load script file "$CodeWarriorLib") to ActivateCodeWarrior()
+#END_OF_APPLESCRIPT
+	}
+
+
+$logging								= 0;
+$recent_errors_file			= "";
+$stop_on_1st_error			= 1;
+$QUIET									= 0;
+
+
+
+=head2 Logging all the errors and warnings - C<OpenErrorLog($log_file)>, C<CloseErrorLog()>
+
+The warnings and errors generated in the course of building projects can be logged to a file.
+Tinderbox uses this facility to show why a remote build failed.
+
+Logging is off by default.
+  Start logging at any point in your build process with C<OpenErrorLog($log_file)>.
+  Stop with C<CloseErrorLog()>.
+  You never need to close the log explicitly, unless you want to just log a couple of projects in the middle of a big list.
+  C<CloseErrorLog()> is not exported by default. 
+
+=cut
+
+sub CloseErrorLog()
+	{
+		if ( $logging )
+			{
+				close(ERROR_LOG);
+				$logging = 0;
+				StopForErrors() if $stop_on_1st_error;
+			}
+	}
+
+
+
+sub OpenErrorLog($)
+	{
+		my ($log_file) = @_;
+
+		CloseErrorLog();
+		if ( $log_file )
+			{
+				$log_file = full_path_to($log_file);
+ 
+				open(ERROR_LOG, ">$log_file") || die "Can't open logfile, check the file path.\n";
+				MacPerl::SetFileInfo("CWIE", "TEXT", $log_file);
+
+				$log_file =~ m/.+:(.+)/;
+				$recent_errors_file = full_path_to("$1.part");
+				$logging = 1;
+			}
+	}
+
+
+=head2 Stopping before it's too late - C<StopForErrors()>, C<DontStopForErrors()>
+
+When building a long list of projects, you decide whether to continue building subsequent projects when one fails.
+  By default, your build script will C<die> after the first project that generates an error while building.
+  Change this behavior with C<DontStopForErrors()>.
+  Re-enable it with C<StopForErrors()>.
+
+=cut
+
+sub StopForErrors()
+	{
+		$stop_on_1st_error = 1;
+		
+			# Can't stop for errors unless we notice them.
+			# Can't notice them unless we are logging.
+			# If the user didn't explicitly request logging, log to a temporary file.
+
+		if ( ! $recent_errors_file )
+			{
+				OpenErrorLog("${TMPDIR}BuildResults");
+			}
+	}
+
+sub DontStopForErrors()
+	{
+		$stop_on_1st_error = 0;		
+	}
+
+sub log_message($)
+	{
+		if ( $logging )
+			{
+				my ($message) = @_;
+				print ERROR_LOG $message;
+			}
+	}
+
+sub log_message_with_time($)
+	{
+		if ( $logging )
+			{
+				my ($message) = @_;
+				my $time_stamp = localtime();
+				log_message("$message ($time_stamp)\n");
+			}
+	}
+
+sub log_recent_errors($)
+	{
+		my ($project_name) = @_;
+		my $found_errors = 0;
+	
+		if ( $logging )
+			{
+				open(RECENT_ERRORS, "<$recent_errors_file");
+
+				while( <RECENT_ERRORS> )
+					{
+						if ( /^Error/ || /^CouldnÕt find project file/ || /^Link Error/ )
+							{
+#								if (!$found_errors)
+#									print $_;
+								$found_errors = 1;
+							}
+						print ERROR_LOG $_;
+					}
+
+				close(RECENT_ERRORS);
+				unlink("$recent_errors_file");
+			}
+		
+		if ( $stop_on_1st_error && $found_errors )
+			{
+				print ERROR_LOG "### Build failed.\n";
+				die "### Errors encountered building \"$project_name\".\n";
+			}
+	}
+
+sub build_project($$$)
+	{
+		my ($project_path, $target_name, $clean_build) = @_;
+		$project_path = full_path_to($project_path);
+
+#		$project_path =~ m/.+:(.+)/;
+#		my $project_name = $1;
+
+		log_message_with_time("### Building \"$project_path\"");
+
+			# Check that the given project exists
+		if (! -e $project_path)
+			{
+				print ERROR_LOG "### Build failed.\n";
+				die "### Can't find project file \"$project_path\".\n";
+			}
+		
+		print "Building \"$project_path\[$target_name\]\"\n";
+		
+		$had_errors = CodeWarriorLib::build_project(
+			$project_path, $target_name, $recent_errors_file, $clean_build
+		);
+		WaitNextEvent();
+
+#		$had_errors =
+#MacPerl::DoAppleScript(<<END_OF_APPLESCRIPT);
+#	tell (load script file "$CodeWarriorLib") to BuildProject("$project_path", "$project_name", "$target_name", "$recent_errors_file", $clean_build)
+#END_OF_APPLESCRIPT
+
+			# Append any errors to the globally accumulated log file
+#		if ( $had_errors ) # Removed this test, because we want warnings, too.  -- jrm
+			{
+				log_recent_errors($project_path);
+			}
+	}
+
+=head2 Getting CodeWarrior to build projects - C<BuildProject($project, $opt_target)>, C<BuildProjectClean($project, $opt_target)>
+
+C<BuildProject()> and C<BuildProjectClean()> are identical, except that the latter first removes object code.
+  In both, CodeWarrior opens the project if it wasn't already open; builds the given (or else current) target; and finally closes
+ the project, if it wasn't already open.
+
+=cut
+
+sub BuildProject($;$)
+	{
+		my ($project_path, $target_name) = @_;
+		build_project($project_path, $target_name, 0);
+	}
+
+sub BuildProjectClean($;$)
+	{
+		my ($project_path, $target_name) = @_;
+		build_project($project_path, $target_name, 1);
+	}
+
+
+=head2 Miscellaneous
+
+C<MakeAlias($old_file, $new_file)> functions like C<symlink()>, except with better argument defaulting and more explicit error messages.
+
+=cut
+
+sub MakeAlias($$)
+	{
+		my ($old_file, $new_file) = @_;
+
+			# if the directory to hold $new_file doesn't exist, create it
+		if ( ($new_file =~ m/(.+:)/) && !-d $1 )
+			{
+				mkpath($1);
+			}
+
+			# if a leaf name wasn't specified for $new_file, use the leaf from $old_file
+		if ( ($new_file =~ m/:$/) && ($old_file =~ m/.+:(.+)/) )
+			{
+				$new_file .= $1;
+			}
+
+		my $message = "Can't create a Finder alias (at \"$new_file\")\n for \"$old_file\"; because ";
+
+		die "$message \"$old_file\" doesn't exist.\n" unless -e $old_file;
+		die "$message I won't replace an existing (non-alias) file with an alias.\n" if ( -e $new_file && ! -l $new_file );
+
+			# now: $old_file exists; $new_file doesn't (or else, is an alias already)
+
+		if ( -l $new_file )
+			{
+					# ...then see if it already points to $old_file
+				my $current_target	= full_path_to(readlink($new_file));
+				my $new_target			= full_path_to($old_file);
+
+				return if ( $current_target eq $new_target );
+					# if the desired alias already exists and points to the right thing, then we're done
+				
+				unlink $new_file;
+			}
+		
+		symlink($old_file, $new_file) || die "$message symlink returned an unexpected error.\n";
+	}
+	
+	
+=pod
+
+C<InstallFromManifest()>
+
+=cut
+
+sub InstallFromManifest($;$$)
+	{
+		my ($manifest_file, $dest_dir, $flat) = @_;
+		
+		$flat = 0 unless defined($flat); # if $flat, all rel. paths in MANIFEST get aliased to the root of $dest_dir
+
+		$dest_dir ||= ":";
+
+		$manifest_file =~ m/(.+):/;
+		my $source_dir =  $1;
+
+		chop($dest_dir) if $dest_dir =~ m/:$/;
+
+		#Mac::Events->import();
+		WaitNextEvent();
+		if ($flat)
+		{
+			print "Doing manifest on \"$manifest_file\" FLAT\n" unless $QUIET;
+		}
+		else
+		{
+			print "Doing manifest on \"$manifest_file\"\n" unless $QUIET;
+		}
+		
+		my $read = maniread(full_path_to($manifest_file));
+		foreach $file (keys %$read)
+			{
+				next unless $file;
+
+				$subdir = ":";
+				if (!$flat && ($file =~ /:.+:/ ))
+					{
+						$subdir = $&;
+					}
+
+				$file = ":$file" unless $file =~ m/^:/;
+				MakeAlias("$source_dir$file", "$dest_dir$subdir");
+			}
+	}
+
+
+=pod
+
+C<InstallResources()>
+
+=cut
+
+# parameters are path to MANIFEST file, destination dir, true (to make copies) or false (to make aliases)
+sub InstallResources($;$;$)
+	{
+		my ($manifest_file, $dest_dir, $copy_files) = @_;
+
+		$dest_dir ||= ":";
+		mkpath($dest_dir) if !-d $dest_dir;
+
+		$manifest_file =~ m/(.+):/;
+		my $source_dir =  $1;
+
+		chop($dest_dir) if $dest_dir =~ m/:$/;
+
+		WaitNextEvent();
+		print "Installing resources from \"$manifest_file\"\n" unless $QUIET;
+		
+		my $read = maniread(full_path_to($manifest_file));
+		foreach $file (keys %$read)
+			{
+				next unless $file;
+				
+				if ($copy_files)
+					{
+						copy("$source_dir:$file", "$dest_dir:$file");
+					}
+				else
+					{
+						MakeAlias("$source_dir:$file", "$dest_dir:$file");
+					}
+			}
+	}
+
+ 
+sub SetBuildNumber($$$)
+{
+    my($build_num_file, $build_gen_script, $files_to_touch) = @_;
+    
+    open (OUTPUT, ">$build_num_file") || die "could not open buildnumber";
+
+    open (BDATE, "perl :mozilla:config:bdate.pl|");
+   
+    while (<BDATE>) {
+      print OUTPUT $_;
+    }
+
+    close (BDATE);
+    close (OUTPUT);
+
+    my($file);
+    foreach $file (@$files_to_touch)
+    {
+        print "Writing build number to $file\n";
+        system ("perl $build_gen_script $file $build_num_file");    
+    }
+}
+
+sub SetAgentString
+{
+	
+	open (BDATE, ":mozilla:config:build_number") || die "could not open buildnumber";
+	   
+	while (<BDATE>) {
+		$build_number = $_;
+	}
+	
+	close (BDATE);
+	
+	open (ORIGFILE, ":mozilla:cmd:macfe:restext:custom.r") || die "no original file";
+	open (OUTPUT, ">:mozilla:cmd:macfe:restext:agent.r") || die "no output file";
+	
+	chop($build_number);
+	
+	while (<ORIGFILE>) {
+	
+		$tempstring = $_;
+		if ($tempstring =~	"\#define		VERSION_MAJOR_STR") {
+			$tempstring = "\#define		VERSION_MAJOR_STR	\"5.0a1-" . $build_number . " Development\"\n";
+		}
+		print OUTPUT $tempstring;
+	}
+	
+	close (ORIGFILE);
+	close (OUTPUT);
+	
+	unlink (":mozilla:cmd:macfe:restext:custom.r");
+	rename (":mozilla:cmd:macfe:restext:agent.r", ":mozilla:cmd:macfe:restext:custom.r");
+}
+
+sub SetTimeBomb($$)
+		
+{
+  my ($warn_days, $bomb_days) = @_;
+  
+  system("perl :mozilla:config:mac-set-timebomb.pl $warn_days $bomb_days");
+	
+}
+
+sub Delay($)
+		
+{
+  my ($delay_seconds) = @_;
+
+  $now = time;
+  
+  $exit_time = $now + $delay_seconds;
+
+  while ($exit_time > $now) {
+     $now = time;
+  }
+	
+}
+
+
+sub GetFileModDate($)
+{
+    my($filePath)=@_;
+    my($dev,$ino,$mode,$nlink,$uid,$gid,$rdev,$size,
+        $atime,$mtime,$ctime,$blksize,$blocks) = stat($filePath);
+    return $mtime;
+}
+
+
+sub ActivateApplication($)
+{
+	my ($appSignature) = @_;
+	my ($psi, $found);
+	my ($appPSN);
+	
+	$found = 0;
+	
+	foreach $psi (values(%Process))
+	{
+		if ($psi->processSignature() eq $appSignature)
+		{
+			$appPSN = $psi->processNumber();
+			$found = 1;
+      last;
+		}
+	}
+
+	if ($found == 0)
+	{
+		return;
+	}
+		
+	SetFrontProcess($appPSN);
+
+	while (GetFrontProcess() != $appPSN)
+	{
+		WaitNextEvent();
+	}
+
+}
+
+1;
+
+=head1 AUTHORS
+
+Scott Collins <scc@netscape.com>, Simon Fraser <sfraser@netscape.com>, Chris Yeh <cyeh@netscape.com>
+
+=head1 SEE ALSO
+
+BuildMozillaDebug.pl (et al), BuildList.pm, CodeWarriorLib (an AppleScript library)
+
+=head1 COPYRIGHT
+
+The contents of this file are subject to the Netscape Public
+License Version 1.1 (the "License"); you may not use this file
+except in compliance with the License. You may obtain a copy of
+the License at http://www.mozilla.org/NPL/
+
+Software distributed under the License is distributed on an "AS
+IS" basis, WITHOUT WARRANTY OF ANY KIND, either express or
+implied. See the License for the specific language governing
+rights and limitations under the License.
+
+The Original Code is Mozilla Communicator client code, released
+March 31, 1998.
+
+The Initial Developer of the Original Code is Netscape
+Communications Corporation. Portions created by Netscape are
+Copyright (C) 1998-1999 Netscape Communications Corporation. All
+Rights Reserved.
+
+Contributor(s): 
+
+=cut

mozilla/build/mac/MozBuildFlags.pm

@@ -0,0 +1,172 @@
+
+package MozBuildFlags;
+
+require 5.004;
+require Exporter;
+
+# Package that attempts to read a file from the Preferences folder,
+# and get build settings out of it
+
+use strict;
+use Exporter;
+
+use MozPrefs;
+
+use vars qw(@ISA @EXPORT);
+
+@ISA      = qw(Exporter);
+@EXPORT   = qw(SetupBuildParams);
+
+
+#-------------------------------------------------------------------------------
+# These 3 arrays are the 'master lists' to control what gets built.
+# We use arrays here, instead of just intializing the hashes directly,
+# so that we can start the build at a given stage using a stored key.
+# 
+# Ordering in these arrays is important; it has to reflect the order in
+# which the build occurs.
+#-------------------------------------------------------------------------------
+
+my(@pull_flags) =
+(
+  ["moz",          1],    # pull everything needed for mozilla
+  ["runtime",      0]     # used to just build runtime libs, up to NSPR
+);
+
+my(@build_flags) =
+(
+  ["all",           1],
+  ["dist",          0],
+  ["dist_runtime",  0],
+  ["xpidl",         0],
+  ["idl",           0],
+  ["stubs",         0],
+  ["runtime",       0],
+  ["common",        0],
+  ["imglib",        0],
+  ["necko",         0],
+  ["security",      0],
+  ["browserutils",  0],
+  ["intl",          0],
+  ["nglayout",      0],
+  ["editor",        0],
+  ["viewer",        0],
+  ["xpapp",         0],
+  ["extensions",    0],
+  ["plugins",       0],
+  ["mailnews",      0],
+  ["apprunner",     0],
+  ["resources",     0],
+  ["jars",          0]
+);
+
+my(@options_flags) = 
+(
+  ["transformiix",  0],
+  ["mathml",        0],
+  ["svg",           0],
+  ["mng",           1],
+  ["ldap",          0],
+  ["xmlextras",     0],
+  ["mailextras",    1],     # mail importers
+  ["xptlink",       0]      # xpt linker codewarrior plugin
+);
+
+
+#-------------------------------------------------------------------------------
+# End of build flags
+#-------------------------------------------------------------------------------
+
+
+
+
+
+#-------------------------------------------------------------------------------
+# flagsArrayToHash
+# 
+# Utility routine to migrate flag from a 2D array to a hash, where
+# item[n][0] is the hash entry name, and item[n][1] is the hash entry value.
+#-------------------------------------------------------------------------------
+
+sub flagsArrayToHash($$)
+{
+  my($src_array, $dest_hash) = @_;
+  
+  my($item);
+  foreach $item (@$src_array)
+  {
+    $dest_hash->{$item->[0]} = $item->[1];
+  }
+}
+
+#-----------------------------------------------
+# printHash
+#
+# Utility routine to print a hash
+#-----------------------------------------------
+sub printHash($)
+{
+	my($hash_ref) = @_;
+ 
+  my($key, $value);
+  
+  while (($key, $value) = each %$hash_ref)
+  {
+    print "$key $value\n";
+  }
+}
+
+
+#-------------------------------------------------------------------------------
+# SetPullFlags
+#-------------------------------------------------------------------------------
+sub SetPullFlags($)
+{
+  my($pull) = @_;
+  
+  flagsArrayToHash(\@pull_flags, $pull);
+}
+
+#-------------------------------------------------------------------------------
+# SetBuildFlags
+#-------------------------------------------------------------------------------
+sub SetBuildFlags($)
+{
+  my($build) = @_;
+
+  flagsArrayToHash(\@build_flags, $build);
+}
+
+#-------------------------------------------------------------------------------
+# SetBuildOptions
+#-------------------------------------------------------------------------------
+sub SetBuildOptions($)
+{
+  my($options) = @_;
+
+  flagsArrayToHash(\@options_flags, $options);
+}
+
+#-------------------------------------------------------------------------------
+# SetupBuildParams
+#-------------------------------------------------------------------------------
+sub SetupBuildParams($$$)
+{
+  my($pull, $build, $options) = @_;
+    
+	SetPullFlags($pull);
+	SetBuildFlags($build);
+	SetBuildOptions($options);
+
+  print "Build before:\n";
+  printHash($build);
+
+  # read the user pref file, that can change values in the array
+  ReadMozUserPrefs("Mozilla build prefs", $pull, $build, $options);
+	
+  print "Build after:\n";
+  printHash($build);
+}
+
+
+1;

mozilla/build/mac/MozJar.pm

@@ -0,0 +1,536 @@
+#!perl -w
+package MozJar;
+
+#
+# Module for creating jar files, either using a jar manifest, or
+# simply jarring up folders on disk.
+#
+
+require 5.004;
+require Exporter;
+
+use strict;
+use Archive::Zip;
+use File::Path;
+
+use Mac::Files;
+
+use Moz;
+
+use vars qw( @ISA @EXPORT );
+
+@ISA        = qw(Exporter);
+@EXPORT     = qw(CreateJarFileFromDirectory WriteOutJarFiles);
+
+
+#-------------------------------------------------------------------------------
+# Add the contents of a directory to the zip file
+#
+#-------------------------------------------------------------------------------
+sub _addDirToJar($$$$)
+{
+    my($dir, $jar_root, $zip, $compress) = @_;
+
+    opendir(DIR, $dir) or die "Cannot open dir $dir\n";
+    my @files = readdir(DIR);
+    closedir DIR;
+    
+    my $unix_jar_root = $jar_root;
+    $unix_jar_root =~ s|:|/|g;       # colon to slash conversion
+    
+    my $file;
+    
+    foreach $file (@files)
+    {        
+        my $filepath = $dir.":".$file;
+        
+        if (-d $filepath)
+        {
+            print "Adding files to jar from $filepath\n";            
+            _addDirToJar($filepath, $jar_root, $zip, $compress);
+        }
+        else
+        {
+            my $member = Archive::Zip::Member->newFromFile($filepath);
+            die "Failed to create zip file member $filepath\n" unless $member;
+            
+            my $unixName = $filepath;
+            $unixName =~ s|:|/|g;               # colon to slash conversion
+            $unixName =~ s|^$unix_jar_root||;   # relativise
+            
+            $member->fileName($unixName);
+            
+            # print "Adding $file as $unixName\n";
+            
+            if ($compress) {
+                $member->desiredCompressionMethod(Archive::Zip::COMPRESSION_DEFLATED);            
+            } else {
+                $member->desiredCompressionMethod(Archive::Zip::COMPRESSION_STORED);
+            }
+            
+            $zip->addMember($member);
+        }
+    }
+}
+
+#-------------------------------------------------------------------------------
+# Add the contents of a directory to the zip file
+#
+#-------------------------------------------------------------------------------
+
+sub CreateJarFileFromDirectory($$$)
+{
+    my($srcdir, $jarpath, $compress) = @_;
+
+    my $zip = Archive::Zip->new();
+
+    _addDirToJar($srcdir, $srcdir, $zip, $compress);
+
+    print "Saving zip file...\n";
+    my $status = $zip->writeToFileNamed($jarpath);
+    if ($status == 0) {
+        print "Zipping completed successfully\n";
+    } else {
+        print "Error saving zip file\n";
+    }
+    
+    # set the file type/creator to something reasonable
+    MacPerl::SetFileInfo("ZIP ", "ZIP ", $jarpath);
+}
+
+#-------------------------------------------------------------------------------
+# printZipContents
+# 
+#-------------------------------------------------------------------------------
+sub printZipContents($)
+{
+    my($zip) = @_;
+
+    my(@members) = $zip->memberNames();
+    
+    print "Zip contains:\n";
+    
+    my($member);
+    foreach $member (@members)
+    {
+        print "  $member\n";
+    }
+}
+
+
+#-------------------------------------------------------------------------------
+# safeSaveJarFile
+# 
+# Archive::Zip has a problem where you cannot save a zip file on top of
+# an existing zip file that it has open, because it holds references
+# into that zip. So we have to save to a temp file, then do a swap.
+# 
+# Note that the zip will become invalid after this operation.
+# If you want to do further operations on it, you'll have to reread it.
+#-------------------------------------------------------------------------------
+sub safeSaveJarFile($$)
+{
+    my($zip, $full_dest_path) = @_;
+    
+    my($temp_file_name) = $full_dest_path."_temp";
+
+    ($zip->writeToFileNamed($temp_file_name) == Archive::Zip::AZ_OK) || die "Error writing jar to temp file $temp_file_name\n";
+    
+    unlink $full_dest_path;
+    
+    (rename $temp_file_name, $full_dest_path) || die "Failed to rename $temp_file_name\n";
+    
+    MacPerl::SetFileInfo("ZIP ", "ZIP ", $full_dest_path);
+}
+
+
+#-------------------------------------------------------------------------------
+# addToJarFile
+# 
+# Add a file to a jar file
+#
+# Parameters:
+#   1. Jar ID. Unix path of jar file inside chrome.
+#   2. Abs path to jar.mn file (i.e. source)    (mac breaks)
+#   3. File source, relative to jar.mn path     (mac breaks)
+#   4. Abs path to the resulting .jar file      (mac breaks)
+#   5. Relative file path within the jar        (unix breaks)
+#   6. Reference to hash of jar files
+#
+#-------------------------------------------------------------------------------
+
+sub addToJarFile($$$$$$$)
+{
+    my($jar_id, $jar_man_dir, $file_src, $jar_path, $file_jar_path, $override, $jars) = @_;
+
+    # print "addToJarFile with:\n  $jar_man_dir\n  $file_src\n  $jar_path\n  $file_jar_path\n";
+
+    unless ($jar_path =~ m/(.+:)([^:]+)$/) { die "Bad jar path $jar_path\n"; }
+    
+    my($target_dir) = $1;
+    my($jar_name) = $2;
+
+    $target_dir =~ s/[^:]+$//;
+    
+    # print "¥ $target_dir $jar_name\n";
+
+    # find the source file
+    my($src) = $jar_man_dir.":".$file_src;
+    if ((!-e $src) && ($file_src =~ m/.+:([^:]+)$/))    # src does not exist. Fall back to looking for src in jar.mn dir
+    {
+        $file_src = $1;
+        $src = $jar_man_dir.":".$file_src;
+        
+        if (!-e $src) {
+            die "Can't find chrome file $src\n";
+        }
+    }
+    
+    if ($main::options{jars})
+    {
+        my($zip) = $jars->{$jar_id};
+        unless ($zip) { die "Can't find Zip entry for $jar_id\n"; }
+        
+        # print "Adding $file_src to jar file $jar_path at $file_jar_path\n";
+        my($member) = Archive::Zip::Member->newFromFile($src);
+        unless ($member) { die "Failed to create zip file member $src\n"; }
+
+        $member->fileName($file_jar_path);    
+    
+        my($compress) = 1;
+        if ($compress) {
+            $member->desiredCompressionMethod(Archive::Zip::COMPRESSION_DEFLATED);
+            $member->desiredCompressionLevel(Archive::Zip::COMPRESSION_LEVEL_DEFAULT);   # defaults to 6
+        } else {
+            $member->desiredCompressionMethod(Archive::Zip::COMPRESSION_STORED);
+        }
+
+        my($old_member) = $zip->memberNamed($file_jar_path);
+        
+        if ($override)
+        {
+            if ($old_member)
+            {
+                # print "Overriding $file_jar_path in jar file $jar_id\n";
+                # need to compare mod dates or use the + here
+                $zip->removeMember($old_member);
+            }
+        
+            $zip->addMember($member);
+        }
+        else
+        {
+            if ($old_member)
+            {
+                #compare dates here
+                my($member_moddate) = $old_member->lastModTime();
+                my($file_moddate) = GetFileModDate($src);
+            
+                if ($file_moddate > $member_moddate)
+                {
+                    print "Updating older file $file_jar_path in $jar_id\n";
+                    $zip->removeMember($old_member);
+                    $zip->addMember($member);
+                }
+                else
+                {
+                    print "File $file_jar_path in $jar_id is more recent. Not updating.\n";
+                }
+            }
+            else
+            {
+                $zip->addMember($member);
+            }
+        }
+    }
+    
+    if ($main::options{chrome_files})  # we install raw files too
+    {
+        my($rel_path) = $file_jar_path;
+        $rel_path =~ s|/|:|g;       # slash to colons
+        
+        my($dir_name) = $jar_name;
+        $dir_name =~ s/\.jar$//;
+        
+        my($dst) = $target_dir.$dir_name.":".$rel_path;
+                
+        # print "Aliassing $src\n to\n$dst\n";        
+        MakeAlias($src, $dst);      # don't check errors, otherwise we fail on replacement
+    }
+}
+
+
+#-------------------------------------------------------------------------------
+# setupJarFile
+# 
+# setup a zip for writing
+#-------------------------------------------------------------------------------
+
+sub setupJarFile($$$)
+{
+    my($jar_id, $dest_path, $jar_hash) = @_;
+
+    # print "Creating jar file $jar_id at $jar_path\n";
+    
+    my($jar_file) = $jar_id;
+    $jar_file =~ s|/|:|g;           # slash to colons
+    my($full_jar_path) = Moz::full_path_to($dest_path.":".$jar_file);
+
+    if ($main::options{jars})
+    {
+        my($zip) = $jar_hash->{$jar_id};
+        if (!$zip)      # if we haven't made it already, do so
+        {
+            my($zip) = Archive::Zip->new();
+            $jar_hash->{$jar_id} = $zip;
+
+            # does the jar file exist already? If so, read it in
+            if (-e $full_jar_path)
+            {
+                print "Reading in jar file $jar_id\n";
+                if ($zip->read($full_jar_path) != Archive::Zip::AZ_OK) { die "Failed to re-read $full_jar_path\n"; }
+                
+                # printZipContents($zip);
+            }
+
+        }
+    }
+    else
+    {
+        # installing files.
+        # nothing to do. MakeAlias creates dirs as needed.
+
+        # add this jar to the list
+        $jar_hash->{$jar_id} = 1;
+    }
+}
+
+
+#-------------------------------------------------------------------------------
+# closeJarFile
+# 
+# We're done with this jar file _for this jar.mn_. We may add more entries
+# to it later, so keep it open in the hash.
+#-------------------------------------------------------------------------------
+sub closeJarFile($$)
+{
+    my($jar_path, $jar_hash) = @_;
+
+    # print "Closing jar file $jar_path\n";
+
+    if ($main::options{jars})
+    {
+    
+    }
+    else
+    {
+        # installing files.
+        # nothing to do
+    }
+}
+
+
+#-------------------------------------------------------------------------------
+# WriteOutJarFiles
+# 
+# Now we dump out the jars
+#-------------------------------------------------------------------------------
+sub WriteOutJarFiles($$)
+{
+    my($chrome_dir, $jars) = @_;
+
+    unless ($main::options{jars}) { return; }
+    
+    my($full_chrome_path) = Moz::full_path_to($chrome_dir);
+
+    my($key);
+    foreach $key (keys %$jars)
+    {
+        my($zip) = $jars->{$key};
+        
+        my($rel_path) = $key;
+        $rel_path =~ s/\//:/g;
+        
+        my($output_path) = $full_chrome_path.":".$rel_path;
+        
+        print "Writing zip file $key to $output_path\n";
+
+        # ensure the target dirs exist
+        my($path) = $output_path;
+        $path =~ s/[^:]+$//;
+        mkpath($path);
+        
+        # unlink $output_path;        # remove any existing jar
+        safeSaveJarFile($zip, $output_path);
+        # $zip is invalid after this operation, so nuke it here
+        $jars->{$key} = 0;
+    }
+}
+
+
+#-------------------------------------------------------------------------------
+# registerChromePackage
+# 
+# Enter a chrome package into the installed-chrome.txt file
+#-------------------------------------------------------------------------------
+sub registerChromePackage($$$$$$)
+{
+    my($jar_file, $file_path, $chrome_dir, $jar_hash, $chrome_type, $pkg_name) = @_;
+
+    my($manifest_subdir) = $jar_file;
+    $manifest_subdir =~ s/:/\//g;
+    
+    my($chrome_entry);
+    
+    if ($main::options{jars}) {
+        $chrome_entry = "$chrome_type,install,url,jar:resource:/chrome/$manifest_subdir!/$chrome_type/$pkg_name";
+    } else {
+        $manifest_subdir =~ s/\.jar$/\//;
+        $chrome_entry = "$chrome_type,install,url,resource:/chrome/$manifest_subdir/$chrome_type/$pkg_name";
+    }
+
+    # print "Entering $chrome_entry in installed-chrome.txt\n";
+
+    # ensure chrome_dir exists
+    mkpath($chrome_dir);
+    
+    my($inst_chrome) = ${chrome_dir}.":installed-chrome.txt";
+    
+    if (open(CHROMEFILE, "<$inst_chrome")) {
+        while (<CHROMEFILE>) {
+            chomp;
+            if ($_ eq $chrome_entry) {
+                # $chrome_entry already appears in installed-chrome.txt file
+                # just update the mod date
+                my $now = time;
+                utime($now, $now, $inst_chrome) || die "couldn't touch $inst_chrome";
+                print "+++ updating chrome $inst_chrome\n+++\t\t$chrome_entry\n";
+                close(CHROMEFILE) || die "error: can't close $inst_chrome: $!";
+                return 0;
+            }
+        }
+        close(CHROMEFILE) || die "error: can't close $inst_chrome: $!";
+    }
+    open(CHROMEFILE, ">>${inst_chrome}") || die "Failed to open $inst_chrome\n";
+    print(CHROMEFILE "${chrome_entry}\n");
+    close(CHROMEFILE) || die "Failed to close $inst_chrome\n";
+    print "+++ adding chrome $inst_chrome\n+++\t\t$chrome_entry\n";
+}
+
+#-------------------------------------------------------------------------------
+# Create or add to a jar file from a jar.mn file.
+# Both arguments are relative to the mozilla root dir.
+#
+#
+#-------------------------------------------------------------------------------
+sub CreateJarFromManifest($$$)
+{
+    my($jar_man_path, $dest_path, $jars) = @_;
+    
+    if ($main::options{jars}) {
+        print "Jarring from $jar_man_path\n";
+    } else {
+        print "Installing files from $jar_man_path\n";
+    }
+
+    $jar_man_path = Moz::full_path_to($jar_man_path);
+    $dest_path = Moz::full_path_to($dest_path);
+
+    # if the jars hash is empty, nuke installed-chrome.txt
+    if (! scalar(%$jars))
+    {
+        print "Nuking installed-chrome.txt\n";
+        my($installed_chrome) = $dest_path.":installed-chrome.txt";
+        # unlink $installed_chrome;
+    }
+    
+    my $jar_man_dir = "";
+    my $jar_man_file = "";
+    
+    if ($jar_man_path =~ /(.+):([^:]+)$/)
+    {
+        $jar_man_dir = $1;      # no trailing :
+        $jar_man_file = $2;
+    }
+
+    # Keep a hash of jar files, keyed on relative jar path (e.g. "packages/core.jar")
+    # Entries are open Archive::Zips (if zipping), and installed-chrome entries.
+    
+    my($jar_id) = "";       # Current foo/bar.jar from jar.mn file
+    my($jar_file) = "";     # relative path to jar file (from $dest_path), with mac separators
+    my($full_jar_path);
+    
+    open(FILE, "<$jar_man_path") || die "could not open \"$jar_man_path\": $!";
+    while (<FILE>)
+    {
+        my($line) = $_;
+        chomp($line);
+        
+        # print "$line\n";
+        
+        if ($line =~ /^\s*\#.*$/) {     # skip comments
+            next;
+        }
+        
+        if ($line =~/^([\w\d.\-\_\\\/]+)\:\s*$/)                                  # line start jar file entries
+        {
+            $jar_id = $1;
+            $jar_file = $jar_id;
+            $jar_file =~ s|/|:|g;           # slash to colons
+            $full_jar_path = $dest_path.":".$jar_file;
+                        
+            setupJarFile($jar_id, $dest_path, $jars);
+
+        }
+        elsif ($line =~ /^(\+?)\s+([\w\d.\-\_\\\/]+)\s*(\([\w\d.\-\_\\\/]+\))?$\s*/)     # jar file entry
+        {
+            my($override) = ($1 eq "+");
+            my($file_dest) = $2;
+            my($file_src) = $3;
+             
+            if ($file_src) {  
+                $file_src = substr($file_src, 1, -1);      #strip the ()
+            } else {
+                $file_src = $file_dest;
+            }
+            
+            $file_src =~ s|/|:|g;
+            
+            if ($jar_file ne "")    # if jar is open, add to jar
+            {
+                if ($file_dest =~ /([\w\d.\-\_]+)\/([\w\d.\-\_\\\/]+)contents.rdf/)
+                {
+                    my $chrome_type = $1;
+                    my $pkg_name = $2;
+                    registerChromePackage($jar_file, $file_dest, $dest_path, $jars, $chrome_type, $pkg_name);
+                }
+                
+                addToJarFile($jar_id, $jar_man_dir, $file_src, $full_jar_path, $file_dest, $override, $jars);
+            }
+            else
+            {
+                die "bad jar.mn format at $line\n";
+            }
+        }
+        elsif ($line =~ /^\s*$/ )                                               # blank line
+        {
+           if ($jar_file ne "")    #if a jar file is open, close it
+            {
+                closeJarFile($full_jar_path, $jars);
+                
+                $jar_file = "";
+                $full_jar_path = "";
+            }
+        }
+    }
+
+    close(FILE);
+
+    if ($jar_file ne "")    #if a jar file is open, close it
+    {
+        closeJarFile($full_jar_path, $jars);
+    }
+
+}
+
+1;

mozilla/build/mac/MozPrefs.pm

@@ -0,0 +1,146 @@
+
+package MozPrefs;
+
+require 5.004;
+require Exporter;
+
+# Package that attempts to read a file from the Preferences folder,
+# and get build settings out of it
+
+use strict;
+
+use Exporter;
+use Mac::Files;
+
+use vars qw(@ISA @EXPORT);
+
+@ISA		  = qw(Exporter);
+@EXPORT 	= qw(ReadMozUserPrefs);
+
+
+
+#-------------------------------------------------------------------------------
+#
+# GetPrefsFolder
+#
+#-------------------------------------------------------------------------------
+
+sub GetPrefsFolder()
+{
+  my($prefs_folder) = FindFolder(kOnSystemDisk, kPreferencesFolderType, 1);
+  return $prefs_folder;
+}
+
+
+#-------------------------------------------------------------------------------
+#
+# WriteDefaultPrefsFile
+#
+#-------------------------------------------------------------------------------
+
+sub WriteDefaultPrefsFile($)
+{
+  my($file_path) = @_;
+
+  my($file_contents);
+  $file_contents = <<'EOS';
+% You can use this file to customize the Mozilla build system.
+% The following kinds of lines are allowable:
+%   Comment lines, which start with a '%' in the first column
+%   Lines with modify the default build settings. Examples are:
+%
+%    pull        runtime         1       % just pull runtime
+%    options     mng             1       % turn mng on
+%    build       jars            0       % don't build jar files
+%
+% Note that by default, the scripts have $build{"all"} and $pull{"all"}
+% turned on, which overrides other settings. To do partial builds, turn
+% these off thus:
+%    build       all             0
+%
+EOS
+
+  $file_contents =~ s/%/#/g;
+   
+  open(PREFS_FILE, "> $file_path") || die "Could not write default prefs file\n";
+  print PREFS_FILE ($file_contents);
+  close(PREFS_FILE);
+
+  MacPerl::SetFileInfo("McPL", "TEXT", $file_path);
+}
+
+
+#-------------------------------------------------------------------------------
+#
+# ReadPrefsFile
+#
+#-------------------------------------------------------------------------------
+
+sub ReadPrefsFile($$$$)
+{
+  my($file_path, $pull_hash, $build_hash, $options_hash) = @_;
+  
+  if (open(PREFS_FILE, "< $file_path"))
+  {
+    print "Reading build prefs from $file_path\n";
+  
+    while (<PREFS_FILE>)
+    {
+      my($line) = $_;
+            
+      if ($line =~ /$\#/) {    # ignore comments
+        next;
+      }
+      
+      if ($line =~ /$\s*(\w+)\s+(\w+)\s+(\w+)\s*/)
+      {
+        my($array_name) = $1;      
+        my($option_name) = $2;
+        my($option_value) = $3;      
+      
+        if ($array_name eq "pull")
+        {
+          $pull_hash->{$option_name} = $option_value;
+        }
+        elsif ($array_name eq "build")
+        {
+          $build_hash->{$option_name} = $option_value;
+        }
+        elsif ($array_name eq "options")
+        {
+          $options_hash->{$option_name} = $option_value;
+        }
+        else
+        {
+          print "Unknown pref option at $line\n";
+        }
+      }    
+    }
+    
+    close(PREFS_FILE);  
+  }
+  else
+  {
+    print "No prefs file found at $file_path; using defaults\n";
+    WriteDefaultPrefsFile($file_path);
+  }
+}
+
+
+#-------------------------------------------------------------------------------
+#
+# ReadMozUserPrefs
+#
+#-------------------------------------------------------------------------------
+
+sub ReadMozUserPrefs($$$$)
+{
+  my($prefs_file_name, $pull_hash, $build_hash, $options_hash) = @_;
+  
+  my($prefs_path) = GetPrefsFolder();
+  $prefs_path .= ":$prefs_file_name";
+
+  ReadPrefsFile($prefs_path, $pull_hash, $build_hash, $options_hash);
+}
+
+1;

mozilla/build/mac/NSCrossProductDefines.h

@@ -0,0 +1,43 @@
+/* -*- Mode: C; tab-width: 4; indent-tabs-mode: nil; c-basic-offset: 2 -*-
+ *
+ * The contents of this file are subject to the Netscape Public
+ * License Version 1.1 (the "License"); you may not use this file
+ * except in compliance with the License. You may obtain a copy of
+ * the License at http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the License is distributed on an "AS
+ * IS" basis, WITHOUT WARRANTY OF ANY KIND, either express or
+ * implied. See the License for the specific language governing
+ * rights and limitations under the License.
+ *
+ * The Original Code is mozilla.org code.
+ *
+ * The Initial Developer of the Original Code is Netscape
+ * Communications Corporation.  Portions created by Netscape are
+ * Copyright (C) 1998 Netscape Communications Corporation. All
+ * Rights Reserved.
+ *
+ * Contributor(s): 
+ */
+
+#error "DonÕt use me!"
+
+#define OLDROUTINELOCATIONS 0
+#define XP_MAC 1
+#define NSPR20 1
+#define _NO_FAST_STRING_INLINES_ 1
+#define HAVE_BOOLEAN 1
+#define NETSCAPE 1
+#define OTUNIXERRORS 1		/* We want OpenTransport error codes */
+
+#define OJI 1
+
+/*
+	This compiles in heap dumping utilities and other good stuff
+ for developers -- maybe we only want it in for a special SDK
+ nspr/java runtime(?):
+*/
+#define DEVELOPER_DEBUG 1
+
+#define	MAX(_a,_b)	((_a) < (_b) ? (_b) : (_a))
+#define	MIN(_a,_b)	((_a) < (_b) ? (_a) : (_b))

mozilla/build/mac/PullNGlayout.pl

@@ -0,0 +1,54 @@
+#!perl
+
+#
+# The contents of this file are subject to the Netscape Public
+# License Version 1.1 (the "License"); you may not use this file
+# except in compliance with the License. You may obtain a copy of
+# the License at http://www.mozilla.org/NPL/
+#
+# Software distributed under the License is distributed on an "AS
+# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express or
+# implied. See the License for the specific language governing
+# rights and limitations under the License.
+#
+# The Original Code is mozilla.org code.
+#
+# The Initial Developer of the Original Code is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation. All
+# Rights Reserved.
+#
+# Contributor(s): 
+#
+
+#
+# nglayout pull script 
+#
+use Mac::Processes;
+use NGLayoutBuildList;
+use Cwd;
+use Moz;
+
+# configuration variables
+$pull{all} = 1;
+$pull{moz} = 0;
+$pull{runtime} = 0;
+
+if ($pull{all})
+{
+	foreach $k (keys(%pull))
+	{
+		$pull{$k} = 1;
+	}
+}
+
+# you should not have to edit anything bellow
+
+chdir("::::");
+
+Moz::StopForErrors();
+#Moz::DontStopForErrors();
+
+OpenErrorLog("NGLayoutPullLog");
+
+Checkout();

mozilla/build/mac/test/README

@@ -0,0 +1,4 @@
+This directory is merely here to test the project editor server. It will go away after
+it is validated. For more information, see http://camelot.
+
+Testing watchers.

mozilla/build/mac/test/test1.cpp

@@ -0,0 +1 @@
+// test1.cpp

mozilla/build/mac/test/test2.cpp

@@ -0,0 +1 @@
+// test2.cpp

mozilla/build/mac/test/test3.cpp

@@ -0,0 +1 @@
+// test2.cpp

mozilla/build/mac/tools/BuildSystemInfo/BuildSystemInfo.cpp

@@ -0,0 +1,12 @@
+#include <stdio.h>
+
+#include <ConditionalMacros.h>
+
+int main(int argc, char* argv[])
+{
+    FILE* file = fopen("BuildSystemInfo.pm", "w");
+    if (file != NULL) {
+        fprintf(file, "$UNIVERSAL_INTERFACES_VERSION=0x%04X;\n", UNIVERSAL_INTERFACES_VERSION);
+        fclose(file);
+    }
+}

mozilla/build/package/debian/TODO

@@ -0,0 +1,5 @@
+- Currently, we do a fairly conservative (--disable a lot) build; find
+  out what works already.
+
+- More libraries could be put in separate packages, like mailnews and
+  editor are.

mozilla/build/package/debian/changelog

@@ -0,0 +1,279 @@
+mozilla (19990716.M8-3) unstable; urgency=low
+
+  * Updated with build rules for the new mozilla-provided CVS directory.
+  * Register as MIME-handler (Close Bug# 42206)
+
+ -- Brent A. Fulgham <bfulgham@debian.org>  Tue, 3 Aug 1999 09:15:17 -0700
+
+mozilla (19990716.M8-2) unstable; urgency=low
+
+  * Added fix for m68k in hashtable function (Res. Bug# 41267)
+  * More robust /usr/bin/mozilla (Res. Bug# 41912)
+  * Remove suggestion for obsolete x11amp (Res. Bug# 41181)
+
+ -- Brent A. Fulgham <bfulgham@debian.org>  Tue, 27 Jul 1999 09:15:17 -0700
+
+mozilla (19990716.M8-1) unstable; urgency=low
+
+  * This is SeaMonkey Milestone 8.
+
+ -- Brent A. Fulgham <bfulgham@debian.org>  Thu, 22 Jul 1999 21:20:10 -0700
+
+mozilla (19990624.M7-1) unstable; urgency=low
+
+  * This is SeaMonkey Milestone 7 !
+  * Removed the so-called upstream changelog (fixes #39307 #39496 #40368).
+
+  * Retried building without the static libraries. It actually worked,
+    after two Makefile.ins backports from M8 :)
+
+ -- Josip Rodin <jrodin@jagor.srce.hr>  Sat,  3 Jul 1999 14:09:18 +0200
+
+mozilla (19990529.M6-1) unstable; urgency=low
+
+  * This is SeaMonkey Milestone 6 !
+
+ -- Josip Rodin <jrodin@jagor.srce.hr>  Mon, 31 May 1999 20:46:16 +0200
+
+mozilla (19990527-1) unstable; urgency=low
+
+  * Another try, the previous one didn't build, stopped in xpidl/build/
+  * Fresh tarball from the FTP site.
+  * I'll give up with NO_STATIC_LIB for now, let's just make something.
+  * First attempt on the editor exclusion (in mozilla-editor package).
+
+ -- Josip Rodin <jrodin@jagor.srce.hr>  Fri, 28 May 1999 16:08:56 +0200
+
+mozilla (19990526-1) unstable; urgency=low
+
+  * New one, this time with .orig.tar.gz cleaned up.
+
+ -- Josip Rodin <jrodin@jagor.srce.hr>  Thu, 27 May 1999 19:31:13 +0200
+
+mozilla (19990524-1) unstable; urgency=low
+
+  * Another new tree, probably the last before M6 releases. Maybe it'll
+    even build, who knows? ;)
+
+ -- Josip Rodin <jrodin@jagor.srce.hr>  Tue, 25 May 1999 16:11:57 +0200
+
+mozilla (19990521-1) unstable; urgency=low
+
+  * Another try, more testing of --disable-static and some changes to 
+    the rules file. Applied some more recent patches from CVS.
+  * Build NSPR with pthreads support.
+  * Building on pandora (fast!), but it'll depend on glibc2.1 :(
+
+ -- Josip Rodin <jrodin@jagor.srce.hr>  Sun, 23 May 1999 14:10:53 +0200
+
+mozilla (19990518-1) unstable; urgency=low
+
+  * Bypassed the dangling symlinks with a "-" :(
+  * Added some Conflicts/Replaces to libnspr to prevent clashes with the
+    previous (unreleased) versions of it, 20 and 21.
+  * Brent decided to split out mailnews from the main package, so it's
+    now in mozilla-mailnews package. Quite a lot of changes to the rules
+    and control file. Added appropriate Provides: because of that, so
+    that's one less TODO item.
+
+ -- Josip Rodin <jrodin@jagor.srce.hr>  Wed, 19 May 1999 04:10:07 -0700
+
+mozilla (19990515-1) unstable; urgency=low
+
+  * Another try. Incorporated some changes as seen in M4's spec file
+    that was used to build the RPM.
+  * Fixed debian/control NSPR entries.
+
+ -- Josip Rodin <jrodin@jagor.srce.hr>  Sun, 16 May 1999 05:30:39 -0700
+
+mozilla (19990513-1) unstable; urgency=low
+
+  * Try, try again.
+
+ -- Brent A. Fulgham <bfulgham@debian.org>  Thu, 13 May 1999 09:50:20 -0700
+
+mozilla (19990510-1) unstable; urgency=low
+
+  * A possibly working build from the FTP site, since M5 didn't manage
+    to build :(
+  * NSPR renamed to libnspr3{-dev}, as one of the upstream people advised.
+
+ -- Josip Rodin <jrodin@jagor.srce.hr>  Thu, 13 May 1999 05:08:24 -0700
+
+mozilla (19990505.M5-1) unstable; urgency=low
+
+  * This is SeaMonkey Milestone 5 !
+  * The previous M4 builds didn't work out. This was released on my
+    birthday, so it could even work ;)
+
+ -- Josip Rodin <jrodin@jagor.srce.hr>  Mon, 10 May 1999 00:27:47 -0700
+
+mozilla (19990415.M4-2) unstable; urgency=low
+
+  * Let's try once again - the previous build was kinda fscked up...
+
+ -- Josip Rodin <jrodin@jagor.srce.hr>  Sun,  9 May 1999 15:08:39 -0700
+
+mozilla (19990415.M4-1) unstable; urgency=low
+
+  * This is SeaMonkey Milestone 4 !
+  * Massive changes to debian/rules, now it actually works :o)
+    + builds in a subdirectory (yipee!)
+    + removes unneeded Makefiles
+    + installs a proper copyright file
+  * NSPR renamed to libnspr21{-dev}, thought I'm not sure it is the
+    real version... we still have to hardcode the dependency :(
+
+ -- Josip Rodin <jrodin@jagor.srce.hr>  Tue,  4 May 1999 01:41:22 -0700
+
+mozilla (19990410-1) unstable; urgency=low
+
+  * Let's try this snapshot from FTP... I modified the debian/rules file
+    a bit.
+
+ -- Josip Rodin <jrodin@jagor.srce.hr>  Sat, 10 Apr 1999 19:17:59 -0700
+
+mozilla (19990402-1) unstable; urgency=low
+
+  * New CVS pull.  First attempt at mail and editor support.
+
+ -- Brent A. Fulgham <bfulgham@debian.org>  Fri, 2 Apr 1999 09:15:22 -0800
+
+mozilla (19990331-1) unstable; urgency=low
+
+  * New build, using automated script to grab the latest stable
+    branch from CVS.
+
+ -- Brent A. Fulgham <bfulgham@debian.org>  Wed, 31 Mar 1999 14:58:40 -0800
+
+mozilla (19990326-1) unstable; urgency=low
+
+  * Updated to fix library so-name and shlibdepends problem.
+  * Current CVS pull
+  * Double-double check that debugging is turned off.
+
+ -- Brent A. Fulgham <bfulgham@debian.org>  Fri, 26 Mar 1999 09:31:45 -0800
+
+mozilla (19990325-1) unstable; urgency=low
+
+  * Updated for fix to (hopefully) stop segfault problem.
+
+ -- Brent A. Fulgham <bfulgham@debian.org>  Thu, 25 Mar 1999 12:58:18 -0800
+
+mozilla (19990323-1) unstable; urgency=low
+
+  * This is a test release using CVS snapshots
+  * Continuing to use Ray's debian/ dir (thanks again!).
+  * Change moz-wrapper to use "apprunner" instead of the viewer (viewer is just 
+    a test application.
+  * Whoo-hoo -- it's running!
+
+ -- Brent A. Fulgham <bfulgham@debian.org>  Tue, 23 Mar 1999 14:25:07 -0800
+
+mozilla (19990317-1) unstable; urgency=low
+
+  * This is a test release done just to get things moving.
+  * Built on va from a snapshot, using Ray's debian/ dir (thanks!).
+
+ -- Josip Rodin <jrodin@jagor.srce.hr>  Sun, 21 Mar 1999 15:37:16 -0800
+
+mozilla (19981211-0.1) unstable; urgency=low
+
+  * UNRELEASED
+  * UNFINISHED. TODO:
+    * Check we're not compiling -DDEVELOPER_DEBUG.
+    * Ensure nsprpub/config/UNIX.mk doesn't get a hardwired x86 reference.
+    * Remove the ?widgets/src/gdk/depend.mk? as part of clean.
+    * Remove the autogenerated files of htmlparser/src.
+    * ~/.mozilla -> ~/.netscape fixes bug #?????.
+  * Non-maintainer upload.
+  * New upstream tarball:
+    * Includes glibc2.1 patches.
+    * Configuration dir is now ~/.mozilla rather than ~/.netscape.
+    * Default widget set has switched from Motif to Gtk. The Gtk version
+      needed is newer than the one in frozen, so this for unstable only.
+  * Moved libnspr into packages of its own (as non-mozilla software like
+    Japhar uses it) and made mozilla depend on the runtime library package.
+  * Removed YAFHintel (thanks to John Goerzen for reminding me).
+  * [nsprpub/config/rules.mk] Use standard naming of shared library files
+    and SONAMEs.
+  * Make sure mozilla gets linked against the system libjpeg, libpng,
+    libz and libxmltok1 (Fixes #30306).
+
+ -- J.H.M. Dassen (Ray) <jdassen@wi.LeidenUniv.nl>  Sun, 10 Jan 1999 20:02:19 +0100
+
+mozilla (19981008-0.1) frozen unstable; urgency=low
+
+  * Non-maintainer upload.
+  * New upstream tarball. 
+  * Adapted build process to it (nspr doesn't use autoconf and needs to be
+    built before the regular autoconf build).
+  * Built with fixed libc6 (and other fixed libs), so it works again.
+  * Updated Standards-Version.
+  * [config/Linux.mk] Added EXTRA_DSO_LDOPTS = -lc to add dependency
+    information to the shared libraries generated.
+  * [nsprlib/config/Linux.mk] Added OS_LIBS = -lc to add dependency
+    information to the shared libraries generated.
+
+ -- J.H.M. Dassen (Ray) <jdassen@wi.LeidenUniv.nl>  Sat, 28 Nov 1998 18:29:06 +0100
+
+mozilla (19980904-1) unstable; urgency=low
+
+  * Non-maintainer upload: this package has been orphaned.
+  * Used latest snapshot tarball; as no real mozilla releases have been made 
+    so far, we use the snapshot date for the version number.
+  * Previous versions were accidentally built as "Debian only" source.
+  * Updated Standards-Version.
+  * Adapted to current mozilla source organisation and build process.
+  * LessTif version, so mozilla can go in main.
+  * Improved package relationships:
+    * Added Provides: www-browser .
+    * Added Recommends: mime-support .
+    * Added Suggest dependency for postscript-viewer, pdf-viewer, images
+      formats viewers, video formats viewers and audio formats players.
+  * Added mozilla(1) -> unknown(7) manpage symlink.
+
+ -- J.H.M. Dassen (Ray) <jdassen@wi.LeidenUniv.nl>  Thu, 10 Sep 1998 21:58:26 +0200
+
+mozilla (5.0b1-2) unstable; urgency=low
+
+  * Made mozilla-smotif and mozilla-dmotif conflict with and replace each
+    other; both now provide mozilla, so that we can cope with a lesstif
+    version when there is one.
+  * Put packages in contrib and added a README.contrib-only file to explain
+    why.
+  * Tweaked ns/cmd/xfe/Makefile to force a build of the dynamic Motif version.
+    My previous change to this had made both versions dynamically linked to
+    Motif.  With no change at all, both versions were statically linked.
+
+ -- Oliver Elphick <Oliver.Elphick@lfix.co.uk>  Wed,  8 Apr 1998 13:17:10 +0100
+
+mozilla (5.0b1-1) unstable; urgency=low
+
+  * Linked with Motif 2.1 and libc6
+  * Modified ns/cmd/xfe/Makefile to force it to build a version dynamically
+    linked to Motif.
+  * Created -smotif and -dmotif packages.
+  * New Maintainer
+
+ -- Oliver Elphick <Oliver.Elphick@lfix.co.uk>  Tue,  7 Apr 1998 11:25:16 +0100
+
+mozilla (5.0b1-0.0) unstable; urgency=low
+
+  * First release.
+  * I don't intend to maintain this package becuase:
+    1. I don't have a libc6 motif (this is built with a libc5 motif, though
+       the package only depends on libc6 and it works ok). Ideally, the
+       maintainer should have libc6 motif.
+    2. I don't have enough disk space, cpu time, bandwidth, or free time to
+       maintain it.
+    So this is just a quickie to get the package out. Somebody else should
+    take it from here.
+  * Applied some minor fixes to make it work. In particular, cmd/xfe/foo.c
+    is a nasty hack to define a symbol that my motif libs needed.
+
+ -- Joey Hess <joeyh@master.debian.org>  Tue, 31 Mar 1998 16:43:55 -0800
+
+Local variables:
+mode: debian-changelog
+End:

mozilla/build/package/debian/control

@@ -0,0 +1,101 @@
+Source: mozilla
+Section: net
+Priority: optional
+Maintainer: Debian Mozilla maintainers <mozilla@packages.debian.org>
+Standards-Version: 2.5.1
+
+Package: mozilla
+Architecture: any
+Depends: ${shlibs:Depends}, libnspr3
+Recommends: mime-support
+Suggests: postscript-viewer, pdf-viewer, eeyes | imagemagick | netpbm | xli | xloadimage | xv, xanim | ucbmpeg-play, freeamp | amp | splay | maplay | mpg123 | xmms
+Conflicts: mozilla-dmotif, mozilla-smotif
+Replaces: mozilla-dmotif, mozilla-smotif
+Provides: www-browser
+Description: An Open Source WWW browser for X and GTK+
+ Mozilla is a sophisticated graphical World-Wide-Web browser, with large
+ number of various browser features like support for HTML 4.0, CSS 2,
+ JavaScript and Java. Of course, besides the network option, it can also
+ be used as a standalone HTML viewer.
+ .
+ Mozilla is based on part of the codebase of the well known "netscape"
+ ("communicator" or "navigator") browser. It was opened up to the Open
+ Source (TM) community by Netscape Communications under a new NPL licence.
+ .
+ See the website http://www.mozilla.org/ for more information on the
+ development of mozilla.
+
+Package: mozilla-mailnews
+Architecture: any
+Depends: mozilla (= ${Source-Version}), libnspr3
+Recommends: mime-support
+Suggests: mail-transport-agent
+Provides: mail-reader, imap-client, news-reader
+Description: An Open Source WWW browser for X and GTK+, mail and news files
+ Mozilla is a sophisticated graphical World-Wide-Web browser, with large
+ number of various browser features like support for HTML 4.0, CSS 2,
+ JavaScript and Java. Of course, besides the network option, it can also
+ be used as a standalone HTML viewer.
+ .
+ Mozilla is based on part of the codebase of the well known "netscape"
+ ("communicator" or "navigator") browser. It was opened up to the Open
+ Source (TM) community by Netscape Communications under a new NPL licence.
+ .
+ See the website http://www.mozilla.org/ for more information on the
+ development of mozilla.
+
+Package: mozilla-editor
+Architecture: any
+Depends: mozilla (= ${Source-Version}), libnspr3
+Suggests: httpd
+Description: An Open Source WWW browser for X and GTK+, editor files
+ Mozilla is a sophisticated graphical World-Wide-Web browser, with large
+ number of various browser features like support for HTML 4.0, CSS 2,
+ JavaScript and Java. Of course, besides the network option, it can also
+ be used as a standalone HTML viewer.
+ .
+ Mozilla is based on part of the codebase of the well known "netscape"
+ ("communicator" or "navigator") browser. It was opened up to the Open
+ Source (TM) community by Netscape Communications under a new NPL licence.
+ .
+ See the website http://www.mozilla.org/ for more information on the
+ development of mozilla.
+
+Package: libnspr3
+Section: libs
+Architecture: any
+Depends: ${shlibs:Depends}
+Conflicts: libnspr20, libnspr21
+Replaces: libnspr20, libnspr21
+Description: Netscape Portable Runtime library
+ This library provides platform independent non-GUI operating system
+ facilities including:
+  * threads,
+  * thread synchronisation,
+  * normal file I/O and network I/O,
+  * interval timing and calender time,
+  * basic memory management (malloc and free),
+  * shared library linking.
+ .
+ See http://www.mozilla.org/docs/refList/refNSPR/ for more information.
+
+Package: libnspr3-dev
+Section: libs
+Architecture: any
+Depends: libc6-dev, xlib6g-dev, libnspr3 (= ${Source-Version})
+Conflicts: libnspr20-dev, libnspr21-dev
+Replaces: libnspr20-dev, libnspr21-dev
+Description: Netscape Portable Runtime library - development files
+ NSPR provides platform independence for non-GUI operating system
+ facilities including:
+  * threads,
+  * thread synchronisation,
+  * normal file I/O and network I/O,
+  * interval timing and calender time,
+  * basic memory management (malloc and free),
+  * shared library linking.
+ .
+ See http://www.mozilla.org/docs/refList/refNSPR/ for more information.
+ .
+ You need this package to get includes and static libraries for building
+ programs linked to NSPR.

mozilla/build/package/debian/copyright.short

@@ -0,0 +1,13 @@
+This package was originally put together by Joey Hess <joeyh@debian.org>.
+People who contributed were: Oliver Elphick, J.H.M. Dassen (Ray),
+Josip Rodin, Brent Fulgham.
+
+Today, package is maintained by the maintenance team which consists
+of Josip Rodin and Brent Fulgham, at <mozilla@packages.debian.org>.
+
+Original source can be found at:
+	ftp://ftp.mozilla.org/pub/mozilla/releases/
+	ftp://ftp.mozilla.org/pub/mozilla/nightly/
+
+The following copyright (from ../LICENCE) applies to this package:
+

mozilla/build/package/debian/files

@@ -0,0 +1,5 @@
+mozilla_19990716.M8-3_i386.deb net optional
+mozilla-mailnews_19990716.M8-3_i386.deb net optional
+mozilla-editor_19990716.M8-3_i386.deb net optional
+libnspr3_19990716.M8-3_i386.deb libs optional
+libnspr3-dev_19990716.M8-3_i386.deb libs optional

mozilla/build/package/debian/libnspr3-dev.dirs

@@ -0,0 +1,4 @@
+usr/lib
+usr/include/nspr
+usr/doc
+

mozilla/build/package/debian/libnspr3.dirs

@@ -0,0 +1,2 @@
+usr/lib
+usr/doc

mozilla/build/package/debian/libnspr3.postinst

@@ -0,0 +1,6 @@
+#! /bin/sh
+set -e
+
+if [ "$1" = "configure" ]; then
+  ldconfig
+fi

mozilla/build/package/debian/libnspr3.shlibs

@@ -0,0 +1,3 @@
+libnspr3	libnspr3
+libplc3		libnspr3
+libplds3	libnspr3

mozilla/build/package/debian/libnspr3.substvars

@@ -0,0 +1 @@
+shlibs:Depends=libc6 (>= 2.1)

mozilla/build/package/debian/menu

@@ -0,0 +1,2 @@
+?package(mozilla):needs="x11" section="Apps/Net" \
+	title="Mozilla Navigator" command="mozilla"

mozilla/build/package/debian/mozilla-editor.dirs

@@ -0,0 +1,4 @@
+usr/lib/mozilla
+usr/lib/mozilla/components
+usr/lib/mozilla/chrome/editor
+usr/doc

mozilla/build/package/debian/mozilla-editor.files

@@ -0,0 +1,2 @@
+usr/lib/mozilla/components/libeditor.so
+usr/lib/mozilla/chrome/editor

mozilla/build/package/debian/mozilla-editor.substvars

@@ -0,0 +1 @@
+shlibs:Depends=libc6 (>= 2.1), libstdc++2.9-glibc2.1

mozilla/build/package/debian/mozilla-mailnews.dirs

@@ -0,0 +1,9 @@
+usr/lib/mozilla
+usr/lib/mozilla/chrome
+usr/lib/mozilla/chrome/addressbook
+usr/lib/mozilla/chrome/messenger
+usr/lib/mozilla/chrome/messengercompose
+usr/lib/mozilla/components
+usr/lib/mozilla/res
+usr/lib/mozilla/res/mailnews
+usr/doc

mozilla/build/package/debian/mozilla-mailnews.files

@@ -0,0 +1,15 @@
+usr/lib/mozilla/libmsgbaseutil.so
+usr/lib/mozilla/chrome/addressbook
+usr/lib/mozilla/chrome/messenger
+usr/lib/mozilla/chrome/messengercompose
+usr/lib/mozilla/components/addrbook.xpt
+usr/lib/mozilla/components/libaddrbook.so
+usr/lib/mozilla/components/liblocalmail.so
+usr/lib/mozilla/components/libmailnews.so
+usr/lib/mozilla/components/libmime*.so
+usr/lib/mozilla/components/libmork.so
+usr/lib/mozilla/components/libmsg*.so
+usr/lib/mozilla/components/libvcard.so
+usr/lib/mozilla/components/mailnews.xpt
+usr/lib/mozilla/components/msg*.xpt
+usr/lib/mozilla/res/mailnews

mozilla/build/package/debian/mozilla-mailnews.substvars

@@ -0,0 +1 @@
+shlibs:Depends=libc6 (>= 2.1), libstdc++2.9-glibc2.1

mozilla/build/package/debian/mozilla.dirs

@@ -0,0 +1,6 @@
+usr/bin
+usr/lib/mozilla
+usr/lib/mozilla/chrome
+usr/lib/mozilla/components
+usr/lib/mozilla/res
+usr/doc/mozilla

mozilla/build/package/debian/mozilla.mime

@@ -0,0 +1,2 @@
+text/html; /usr/bin/mozilla %s; description=HTML Text; nametemplate=%s.html; priority=3
+

mozilla/build/package/debian/postinst.debhelper

@@ -0,0 +1,6 @@
+# Automatically added by dh_installmime
+if [ -x /usr/sbin/update-mime ]; then update-mime; fi
+# End automatically added section
+# Automatically added by dh_installmenu
+if test -x /usr/bin/update-menus ; then update-menus ; fi
+# End automatically added section

mozilla/build/package/debian/postrm.debhelper

@@ -0,0 +1,6 @@
+# Automatically added by dh_installmime
+if [ -x /usr/sbin/update-mime ]; then update-mime; fi
+# End automatically added section
+# Automatically added by dh_installmenu
+if test -x /usr/bin/update-menus ; then update-menus ; fi
+# End automatically added section

mozilla/build/package/debian/rules

@@ -0,0 +1,117 @@
+#!/usr/bin/make -f
+# Derived from debhelper/dh_make example.
+
+#export DH_VERBOSE=1
+
+# Set by configure (plus USE_AUTOCONF=1), but useful for NSPR
+export MOZILLA_CLIENT=1
+export BUILD_OPT=1
+export NO_STATIC_LIB=1
+# untested upstream - export USE_IPV6=$(shell cpp debian/testipv6 | sh -)
+export USE_PTHREADS=1
+
+nspr = libnspr3
+nsprdev = libnspr3-dev
+mailnews = mozilla-mailnews
+editor = mozilla-editor
+TOP=..
+
+build: build-stamp
+build-stamp:
+	dh_testdir
+
+	test -d build-nspr || mkdir build-nspr
+	test -s build-nspr/lib/$(nspr).so || $(MAKE) -C nsprpub DIST=`pwd`/build-nspr 
+
+	test -d obj-`./build/autoconf/config.guess` || mkdir obj-`./build/autoconf/config.guess`
+	cd obj-`./build/autoconf/config.guess` && \
+	LD_LIBRARY_PATH=`cd ..;pwd`/build-nspr/lib \
+        $(TOP)/configure --verbose --prefix=/usr \
+	   --disable-debug --disable-profile --disable-crypto \
+	   --disable-netcast --disable-java --disable-oji --disable-static \
+	   --disable-tests --disable-smart-mail --enable-mailnews \
+	   --enable-editor --enable-ldap --enable-optimize --with-pthreads \
+	   --with-jpeg=/usr/include --with-png=/usr/include \
+	   --with-zlib=/usr/include --with-nspr=`cd $(TOP);pwd`/build-nspr
+	cd obj-`./build/autoconf/config.guess` && LD_LIBRARY_PATH=`cd $(TOP);pwd`/build-nspr/lib $(MAKE)
+
+	touch build-stamp
+
+clean:
+	dh_testdir
+	dh_testroot
+	rm -f build-stamp install-stamp
+
+	-cd nsprpub ; $(MAKE) realclean
+	rm -rf build-nspr obj-`./build/autoconf/config.guess`
+#	find . -type f -name Makefile ! -path '*nsprpub*' | xargs -r rm
+
+	dh_clean
+
+install: install-stamp
+install-stamp: build-stamp
+	dh_testdir
+	dh_testroot
+	dh_clean -k
+	dh_installdirs -a
+
+	cp -pR build-nspr/lib/*.so* `pwd`/debian/$(nspr)/usr/lib
+	cd `pwd`/debian/$(nspr)/usr/lib ; /sbin/ldconfig -n .
+#	cd `pwd`/debian/$(nspr)/usr/lib ; for i in * ; do ln -s $$i $$i.0 ; done
+
+	cp -pR build-nspr/include/* `pwd`/debian/$(nsprdev)/usr/include/nspr
+	cp -pR build-nspr/lib/*.a `pwd`/debian/$(nsprdev)/usr/lib
+
+	# this may fail, but who cares
+	-cp -pR obj-`./build/autoconf/config.guess`/dist/bin/* `pwd`/debian/tmp/usr/lib/mozilla
+	install -m 755 `pwd`/debian/runner `pwd`/debian/tmp/usr/bin/mozilla
+
+#	# Okay, lets move a bunch of mail-news stuff to its own place
+	# Note:  We have to cd and set sourcedir because the debian directory
+	# now lives in mozilla/build/package and dh_movefiles won't work
+	# across the symlink.
+	cd `pwd`/build/package; \
+ 	    dh_movefiles --sourcedir=debian/tmp -a
+
+	touch install-stamp
+
+binary-indep: build
+# We have nothing to do by default, no architecture-independent files here.
+
+binary-arch: build install
+	dh_testdir -a
+	dh_testroot -a
+	cd debian/ ; cat copyright.short > copyright
+	cat LICENSE >> debian/copyright
+	dh_installdocs -pmozilla LEGAL
+	dh_installdocs -p$(nspr)
+	dh_installmime -pmozilla
+	rm debian/copyright
+#	dh_installexamples `find -name '*.ad'`
+	dh_installmenu -pmozilla
+# Running this is a baaad idea.
+#	dh_installmanpages
+	dh_undocumented -pmozilla mozilla.1
+	dh_installchangelogs -pmozilla
+	dh_installchangelogs -p$(nspr)
+	cd `pwd`/debian/$(nsprdev)/usr/doc ; ln -s /usr/doc/$(nspr) ./$(nsprdev)
+	cd `pwd`/debian/$(mailnews)/usr/doc ; ln -s /usr/doc/mozilla ./$(mailnews)
+	cd `pwd`/debian/$(editor)/usr/doc ; ln -s /usr/doc/mozilla ./$(editor)
+	dh_strip -a
+	dh_compress -a
+	dh_fixperms -a
+	dh_installdeb -a
+	cd debian ; cat $(nspr).shlibs > shlibs.local
+	env LD_LIBRARY_PATH=`pwd`/debian/$(nspr)/usr/lib:`pwd`/debian/tmp/usr/lib/mozilla \
+	  dh_shlibdeps -pmozilla -plibnspr3 -p$(mailnews) -p$(editor)
+	rm -f debian/shlibs.local
+	dh_gencontrol -a
+	dh_md5sums -a
+	dh_builddeb -a
+
+source diff:                                                                  
+	@echo >&2 'source and diff are obsolete - use dpkg-source -b'; false
+
+binary: binary-indep binary-arch
+
+.PHONY: build clean binary-indep binary-arch binary # quicktest make

mozilla/build/package/debian/runner

@@ -0,0 +1,20 @@
+#!/bin/sh
+# A simple script to start mozilla.
+
+MOZILLA_DIR=/usr/lib/mozilla
+
+# Check for a $HOME/.mozilla directory.  If it doesn't exist, create a GOOD one
+if [ ! -d $HOME/.mozilla ]
+then
+    cd $HOME
+    mkdir .mozilla
+    for file in $MOZILLA_DIR/*; do
+        if [ `basename $file` != component.reg ]; then
+            ln -s $file $HOME/.mozilla
+	fi
+    done
+fi
+
+export LD_LIBRARY_PATH=$MOZILLA_DIR   MOZILLA_FIVE_HOME=$HOME/.mozilla
+
+exec $MOZILLA_DIR/apprunner "$@"

mozilla/build/package/debian/substvars

@@ -0,0 +1 @@
+shlibs:Depends=libc6 (>= 2.1), libglib1.2 (>= 1.2.0), libgtk1.2 (>= 1.2.3-2), libjpeg62, libpng2, libstdc++2.9-glibc2.1, orbit (>= 0.4.3-1), xlib6g (>= 3.3.3.1-1), zlib1g (>= 1:1.1.3)

mozilla/build/package/debian/testipv6

@@ -0,0 +1,8 @@
+#include <features.h>
+#if defined(__GLIBC__) && (__GLIBC__ >= 2) && (__GLIBC__ + __GLIBC_MINOR__ >= 3)
+  /* For IPv6 support, glibc2.1 or newer is required */
+  echo 1
+#else
+  /* Sorry, no IPv6 support */
+  echo 0
+#endif

mozilla/build/package/rpm/generate-package-info.sh

@@ -0,0 +1,252 @@
+#!/bin/sh
+#
+# The contents of this file are subject to the Netscape Public
+# License Version 1.1 (the "License"); you may not use this file
+# except in compliance with the License. You may obtain a copy of
+# the License at http://www.mozilla.org/NPL/
+#
+# Software distributed under the License is distributed on an "AS
+# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express or
+# implied. See the License for the specific language governing
+# rights and limitations under the License.
+#
+# The Original Code is mozilla.org code.
+#
+# The Initial Developer of the Original Code is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation. All
+# Rights Reserved.
+#
+# Contributor(s): 
+#
+#
+
+# The way this thing works:
+#
+# + A packages file is parsed.  This file contains something 
+#   that looks like this (note that spaces are illegal):
+#
+#   +----------------------------------------------
+#   |nspr:nsprpub
+#   |core:build,db,xpcom,intl,js,modules/libutil,modules/security/freenav,modules/libpref,modules/libimg,modules/libjar,caps
+#   |network:netwerk
+#   |layout:htmlparser,gfx,dom,view,widget/timer,widget,layout,webshell,editor,modules/plugin
+#   |xpinstall:xpinstall
+#   |profile:profile
+#   |xptoolkit:xpfe,rdf
+#   |cookie:extensions/cookie
+#   |wallet:extensions/wallet
+#   |mailnews:mailnews
+#   +----------------------------------------------
+#
+# + For each package, a list of modules corresponding to that
+#   package is parsed.  Each modules corresponds to a 
+#   directory somewhere in a mozilla build tree - usually
+#   the toplevel ones (ie, layout, nsprpub, xpcom) but not
+#   always (ie, extensions/wallet)
+#
+# + For each module, print-module-filelist.sh is invoked.
+#   The output of that is parsed and converted from the 
+#   crazy mozilla install hierarchy to something that
+#   makes sense on a linux box.
+#
+#   For example:  
+#
+#     bin/components/libraptorhtml.so
+#   
+#   becomes
+#
+#     %{prefix}/lib/mozilla/components/libraptorhtml.so
+#
+# + Also, this script determines which files belong in 
+#   a devel package.  For example, "include/*" and "idl/*"
+
+name=generate-package-info.sh
+
+if [ $# -lt 4 ]
+then
+	echo
+	echo "Usage: $name package-list module-list-dir outdir mozdir"
+	echo
+	exit 1
+fi
+
+package_list=$1
+module_list_dir=$2
+outdir=$3
+mozdir=$4
+
+if [ ! -f $package_list ]
+then
+	echo
+	echo "$name: Cant access package file $package_list."
+	echo
+	exit 1
+fi
+
+if [ ! -d $module_list_dir ]
+then
+	echo
+	echo "$name: Cant access module list dir $package_list."
+	echo
+	exit 1
+fi
+
+if [ ! -d $outdir ]
+then
+	echo
+	echo "$name: Cant access outdir $outdir."
+	echo
+	exit 1
+fi
+
+if [ ! -d $mozdir ]
+then
+	echo
+	echo "$name: Cant access mozdir $mozdir."
+	echo
+	exit 1
+fi
+
+rm -rf $outdir/*
+
+packages=`cat $package_list | grep -v -e "^#.*$" | grep -v -e "^[ \t]*$"`
+
+for p in $packages
+do
+	package=`echo $p | awk -F":" '{ print $1; }'`
+
+	modules=`echo $p | awk -F":" '{ print $2; }' | tr "," " "`
+	
+	file_list=$outdir/mozilla-$package-file-list.txt
+	file_list_devel=$outdir/mozilla-$package-devel-file-list.txt
+
+	tmp_raw=/tmp/raw-list.$$.tmp
+
+	tmp_file_list=/tmp/file-list.$$.tmp
+	tmp_file_list_devel=/tmp/file-list-devel.$$.tmp
+
+	tmp_dir_list=/tmp/dir-list.$$.tmp
+	tmp_dir_list_devel=/tmp/dir-list-devel.$$.tmp
+
+#	echo "package=$package"
+#	echo "modules=$modules"
+#	echo "file_list=$file_list"
+#	echo "file_list_devel=$file_list_devel"
+#	echo "#################"
+
+	rm -f $tmp_raw $file_list $file_list_devel
+	rm -f $tmp_file_list $tmp_file_list_devel 
+	rm -f $tmp_dir_list $tmp_dir_list_devel
+
+	touch $tmp_raw $file_list $file_list_devel
+	touch $tmp_file_list $tmp_file_list_devel
+	touch $tmp_dir_list $tmp_dir_list_devel
+
+	print_cmd=$mozdir/build/package/rpm/print-module-filelist.sh
+
+	here=`pwd`
+
+	# Write the raw file list
+	for m in $modules
+	do
+		cd $mozdir/$m
+		$print_cmd  >> $tmp_raw
+	done
+
+	cd $here
+
+	# Munge the raw list into the file list
+	for i in `cat $tmp_raw`
+	do
+		prefix=`echo $i | awk -F"/" '{ print $1; }'`
+
+		case "$prefix"
+		in
+			# dirs
+			DIR:*)
+				dir=`echo $i | cut -b5-`
+
+				case "$dir" 
+				in
+					include*)
+						echo $dir >> $tmp_dir_list_devel
+					;;
+
+					*)
+						prefix2=`echo $dir | awk -F"/" '{ print $2; }'`
+
+						case "$prefix2"
+						in
+							# Cut out the "bin/" from these
+								res|chrome|defaults)
+									echo $dir | cut -b5- >> $tmp_dir_list
+								;;
+						esac
+					;;
+				esac
+			;;
+
+			##
+			## XXX: This one needs to be smarter and catch more devel only
+			## stuff.  For example, the gecko viewer and all its resources
+			## should go in the devel package.  This would in turn make the
+			## regular package smaller.
+			##
+
+			# include, idl, lib
+			include|idl|lib)
+				echo $i >> $tmp_file_list_devel
+			;;
+
+			# bin the evil
+			bin)
+				prefix2=`echo $i | awk -F"/" '{ print $2; }'`
+
+				case "$prefix2"
+				in
+					# Cut out the "bin/" from these
+					components|res|chrome|defaults|netscape.cfg)
+						echo $i | cut -b5- >> $tmp_file_list
+					;;
+
+					# whatever else in "bin/"
+					*)
+						# Move special files in "bin/" around
+						base=`basename $i`
+
+						case "$base"
+						in
+						# Mozilla brillantly puts .so files in "bin/" bleh
+						*.so)
+							echo "lib/$base" >> $tmp_file_list
+							;;
+
+						*)
+							echo $i >> $tmp_file_list
+						;;
+						esac
+					;;
+				esac
+			;;
+
+			# whatever else
+			*)
+				echo $i >> $tmp_file_list
+			;;
+		esac
+
+	done
+
+	# Spit out sorted file lists
+	cat $tmp_dir_list | sort | uniq | awk '{ printf("%%dir %%{prefix}/lib/mozilla/%s\n" , $0); }' >> $file_list
+
+	cat $tmp_file_list | sort | uniq | awk '{ printf("%%{prefix}/lib/mozilla/%s\n" , $0); }' >> $file_list
+
+	cat $tmp_dir_list_devel | sort | uniq | awk '{ printf("%%dir %%{prefix}/lib/mozilla/%s\n" , $0); }' >> $file_list_devel
+
+	cat $tmp_file_list_devel | sort | uniq | awk '{ printf("%%{prefix}/lib/mozilla/%s\n" , $0); }' >> $file_list_devel
+
+	# Cleanup
+	rm -f $tmp_raw $tmp_file_list $tmp_file_list_devel $tmp_dir_list $tmp_dir_list_devel
+done

mozilla/build/package/rpm/make-rpm.sh

@@ -0,0 +1,125 @@
+#!/bin/sh
+
+# A hack to make mozilla rpms in place.
+here=`pwd`
+
+if [ ! -d ./mozilla ]
+then
+    printf "\n\nDude, you have to be on the root of the mozilla cvs tree.\n\n"
+    exit 1
+fi
+
+rpm_place=$here/rpm_on_demand_dir
+
+rm -rf $rpm_place
+
+mkdir -p $rpm_place
+
+mkdir -p $rpm_place/tarball
+mkdir -p $rpm_place/home
+mkdir -p $rpm_place/topdir
+mkdir -p $rpm_place/topdir/BUILD
+mkdir -p $rpm_place/topdir/RPMS
+mkdir -p $rpm_place/topdir/RPMS/i386
+mkdir -p $rpm_place/topdir/RPMS/noarch
+mkdir -p $rpm_place/topdir/SOURCES
+mkdir -p $rpm_place/topdir/SPECS
+mkdir -p $rpm_place/topdir/SRPMS
+
+_top_dir=$rpm_place/topdir
+
+_spec_dir=$_top_dir/SPECS
+
+_sources_dir=$_top_dir/SOURCES
+
+_rpms_dir=$_top_dir/RPMS
+
+_home=$rpm_place/home
+
+_rpm_macros=$_home/.rpmmacros
+
+_tarball_dir=$rpm_place/tarball
+
+#_spec_file=$here/build/package/rpm/mozilla.spec
+
+##
+## Setup a phony topdir for the phony rpm macros file
+##
+echo "%_topdir $_top_dir" >> $_rpm_macros
+
+##
+## Make a tarball of the beast
+##
+cd $_tarball_dir
+cvs co mozilla/client.mk
+make -f mozilla/client.mk pull_all
+
+tar vzcf mozilla-source.tar.gz mozilla
+
+#XXXX YANK
+#cp /tmp/mozilla-source.tar.gz .
+#XXXX YANK
+
+tarball=`/bin/ls -1 mozilla*.tar.gz | head -1`
+
+if [ ! -f $tarball ]
+then
+	printf "\n\nDude, failed to make mozilla tarball.\n\n"
+	exit 1
+fi
+
+# Put the tarball in the SOURCES dir
+mv -f $tarball $_sources_dir
+
+printf "\n\nMozilla tarball = %s\n\n" $_sources_dir/$tarball
+
+# Find the spec file from the rpm 
+spec_in_rpm=`tar tzvf $_sources_dir/$tarball |grep -w "mozilla\.spec$" | awk '{ print $6; }'`
+
+printf "\n\nspec_in_rpm=%s\n\n" $spec_in_rpm
+
+# Extract the spec file from the tarball
+spec_in_rpm_dir=`echo $spec_in_rpm | awk -F"/" '{ print $1; }'`
+
+printf "\n\nspec_in_rpm_dir=%s\n\n" $spec_in_rpm_dir
+
+tar zvxf $_sources_dir/$tarball $spec_in_rpm
+
+#_spec_file=`/bin/ls -1 $spec_in_rpm_dir | grep "\.spec$" | head -1`
+
+#printf "\n\n_spec_file=%s\n\n" $_spec_file
+
+if [ ! -f $spec_in_rpm ]
+then
+	printf "\n\nFailed to extract spec file from tarball.\n\n"
+	exit 1
+fi
+
+# Put the spec file in SPECS
+#cp $spec_in_rpm $_spec_dir
+
+#XXXX YANK
+cp /tmp/mozilla.spec $_spec_dir
+#XXXX YANK
+
+HOME=$_home rpm -ba $_spec_dir/mozilla.spec # > /dev/null 2>&1
+
+if [ $? -eq 0 ]
+then
+	mkdir -p $rpm_place/RPMS
+
+	cp $_rpms_dir/i386/*.rpm $rpm_place/RPMS/
+
+	last=`/bin/ls -lt1 $rpm_place/RPMS|head -1`
+
+	echo "New RPM written to RPMS/$last"
+else
+	echo "Failed to build the rpm.  Check the spec file."
+fi
+
+echo
+
+cd $rpm_place
+
+# Cleanup
+rm -rf $rpm_place/topdir $rpm_place/home

mozilla/build/package/rpm/mozilla

@@ -0,0 +1,133 @@
+#!/bin/sh
+#
+# The contents of this file are subject to the Netscape Public
+# License Version 1.1 (the "License"); you may not use this file
+# except in compliance with the License. You may obtain a copy of
+# the License at http://www.mozilla.org/NPL/
+#
+# Software distributed under the License is distributed on an "AS
+# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express or
+# implied. See the License for the specific language governing
+# rights and limitations under the License.
+#
+# The Original Code is mozilla.org code.
+#
+# The Initial Developer of the Original Code is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation. All
+# Rights Reserved.
+#
+# Contributor(s): 
+#
+
+## 
+## Usage:
+##
+## $ mozilla
+##
+## This script is meant to run a mozilla program from the mozilla
+## rpm installation.
+##
+## The script will setup all the environment voodoo needed to make
+## mozilla work.
+
+##
+## Standard shell script disclaimer blurb thing:
+##
+## This script is a hcak.  Its brute force.  Its horrible.  
+## It doesnt use Artificial Intelligence.  It doesnt use Virtual Reality.
+## Its not perl.  Its not python.  It probably wont work unchanged on
+## the "other" thousands of unices.  But it worksforme.
+##
+## If you have an improvement, patch, idea, whatever, on how to make this
+## script better, post it here:
+##
+## news://news.mozilla.org/netscape.public.mozilla.patches
+## news://news.mozilla.org/netscape.public.mozilla.unix
+##
+## 
+
+##
+## Potential improvements:
+##
+## + Run ldd on the program and report missing dlls
+## + All the "other" unices/packages
+##
+
+cmdname=`basename $0`
+
+##
+## location of the apprunner binary.
+##
+MOZ_APPRUNNER_NAME="/usr/lib/mozilla/bin/apprunner"
+
+##
+## Variables
+##
+MOZ_DIST_BIN=""
+MOZ_PROGRAM=""
+
+##
+## Functions
+##
+moz_bail()
+{
+	message=$1
+
+	echo
+	echo "$cmdname: $message"
+	echo
+
+	exit 1
+}
+
+moz_test_binary()
+{
+	binary=$1
+
+	if [ -f "$binary" ]
+	then
+		if [ -x "$binary" ]
+		then
+			return 1
+		fi
+	fi
+
+	return 0
+}
+
+moz_test_binary $MOZ_APPRUNNER_NAME
+
+if [ $? -eq 1 ]
+then
+	MOZ_PROGRAM=$MOZ_APPRUNNER_NAME
+fi
+
+##
+## Make sure the program is executable
+##
+if [ ! -x $MOZ_PROGRAM ]
+then
+	moz_bail "Cannot execute $MOZ_PROGRAM."
+fi
+
+##
+## Set MOZILLA_FIVE_HOME
+##
+MOZILLA_FIVE_HOME="/usr/lib/mozilla"
+
+export MOZILLA_FIVE_HOME
+
+##
+## Set LD_LIBRARY_PATH
+##
+if [ "$LD_LIBRARY_PATH" ]
+then
+  LD_LIBRARY_PATH=/usr/lib/mozilla/lib:$LD_LIBRARY_PATH
+else
+  LD_LIBRARY_PATH=/usr/lib/mozilla/lib
+fi
+
+export LD_LIBRARY_PATH
+
+exec $MOZ_PROGRAM ${1+"$@"}

mozilla/build/package/rpm/mozilla-package-list.txt

@@ -0,0 +1,10 @@
+nspr:nsprpub
+core:build,db,xpcom,intl,js,modules/libutil,modules/security/freenav,modules/libpref,modules/libimg,modules/libjar,caps
+network:netwerk
+layout:htmlparser,gfx,dom,view,widget/timer,widget,layout,webshell,editor,modules/plugin
+xpinstall:xpinstall
+profile:profile
+xptoolkit:xpfe,rdf
+cookie:extensions/cookie
+wallet:extensions/wallet
+mailnews:mailnews

mozilla/build/package/rpm/mozilla-viewer

@@ -0,0 +1,115 @@
+#!/bin/sh
+#
+# The contents of this file are subject to the Netscape Public
+# License Version 1.1 (the "License"); you may not use this file
+# except in compliance with the License. You may obtain a copy of
+# the License at http://www.mozilla.org/NPL/
+#
+# Software distributed under the License is distributed on an "AS
+# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express or
+# implied. See the License for the specific language governing
+# rights and limitations under the License.
+#
+# The Original Code is mozilla.org code.
+#
+# The Initial Developer of the Original Code is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation. All
+# Rights Reserved.
+#
+# Contributor(s): 
+#
+
+## 
+## Usage:
+##
+## $ mozilla
+##
+## This script is meant to run a mozilla program from the mozilla
+## rpm installation.
+##
+## The script will setup all the environment voodoo needed to make
+## mozilla work.
+
+##
+## Standard shell script disclaimer blurb thing:
+##
+## This script is a hcak.  Its brute force.  Its horrible.  
+## It doesnt use Artificial Intelligence.  It doesnt use Virtual Reality.
+## Its not perl.  Its not python.  It probably wont work unchanged on
+## the "other" thousands of unices.  But it worksforme.
+##
+## If you have an improvement, patch, idea, whatever, on how to make this
+## script better, post it here:
+##
+## news://news.mozilla.org/netscape.public.mozilla.patches
+## news://news.mozilla.org/netscape.public.mozilla.unix
+##
+## 
+
+##
+## Potential improvements:
+##
+## + Run ldd on the program and report missing dlls
+## + All the "other" unices/packages
+##
+
+cmdname=`basename $0`
+
+##
+## location of the viewer binary.
+##
+MOZ_VIEWER_NAME="/usr/lib/mozilla/bin/viewer"
+
+##
+## Variables
+##
+MOZ_PROGRAM=""
+
+##
+## Functions
+##
+moz_bail()
+{
+	message=$1
+
+	echo
+	echo "$cmdname: $message"
+	echo
+
+	exit 1
+}
+
+moz_test_binary()
+{
+	binary=$1
+
+	if [ -f "$binary" ]
+	then
+		if [ -x "$binary" ]
+		then
+			return 1
+		fi
+	fi
+
+	return 0
+}
+
+
+MOZ_PROGRAM=$MOZ_APPRUNNER_NAME
+
+moz_test_binary $MOZ_PROGRAM
+
+if [ $? -eq 0 ]
+then
+	moz_bail "Cannot execute $MOZ_PROGRAM."
+fi
+
+##
+## Set MOZILLA_FIVE_HOME
+##
+MOZILLA_FIVE_HOME="/usr/lib/mozilla"
+
+export MOZILLA_FIVE_HOME
+
+exec $MOZ_PROGRAM ${1+"$@"}

mozilla/build/package/rpm/mozilla.spec

@@ -0,0 +1,410 @@
+Summary:		Mozilla and stuff
+Name:			mozilla
+Version:		666
+Release:		0
+Serial:			0
+Copyright:		NPL/MPL
+Group:			Mozilla
+Source0:		ftp://ftp.mozilla.org/pub/mozilla/nightly/latest/mozilla-source.tar.gz
+#Source0:		ftp://ftp.mozilla.org/pub/mozilla/nightly/latest/mozilla-binary.tar.gz
+Buildroot:		/var/tmp/mozilla-root
+Prefix:			/usr
+Requires:		gtk+ >= 1.2.4
+
+#
+# TODO: lots of stuff
+#
+# + Add nice summary and description entries
+#
+# + Make sure the requires entries make sense
+#
+# + Add more packages for other mozilla extensions (for instance: irc)
+#
+# + Remove and/or combine the current packages that make more sense
+#
+# + mozilla-xpcom package ?
+#
+# + should nspr be its own package ?
+#
+# + it is probably a good idea to have a mozilla-browser package
+#   instead of mozilla-xptoolkit
+#
+# + the mozilla-xpinstall package obviously doesnt make sense - 
+#   its there for show
+#
+# + a lot of stuff is dumped into the default package that 
+#   should really be in the devel package.  For example the
+#   gecko viewer and all its tests.
+#
+#   For the code that determines what goes where, see:
+# 
+#   mozilla/build/package/rpm/print-module-filelist.sh
+#   mozilla/build/package/rpm/generate-package-info.sh
+#
+
+#Exclusivearch:		i386
+
+%description
+Mozilla is the king of all beasts - big badass Beasts.
+
+%package nspr
+Summary:	mozilla-nspr
+Group:		Mozilla
+
+%description nspr
+mozilla-nspr
+
+%package nspr-devel
+Requires:	mozilla-nspr
+Summary:	mozilla-nspr-devel
+Group:		Mozilla
+
+%description nspr-devel
+mozilla-nspr devel
+
+%package core
+Summary:	mozilla-core
+Group:		Mozilla
+Requires:	mozilla-nspr
+
+%description core
+mozilla-core
+
+%package core-devel
+Requires:	mozilla-core
+Summary:	mozilla-core-devel
+Group:		Mozilla
+Requires:	mozilla-nspr-devel
+
+%description core-devel
+mozilla-core devel
+
+%package network
+Summary:	mozilla-network
+Group:		Mozilla
+Requires:	mozilla-core
+
+%description network
+mozilla-network
+
+%package network-devel
+Requires:	mozilla-network
+Summary:	mozilla-network-devel
+Group:		Mozilla
+Requires:	mozilla-core-devel
+
+%description network-devel
+mozilla-network devel
+
+%package layout
+Summary:	mozilla-layout
+Group:		Mozilla
+Requires:	mozilla-network
+
+%description layout
+mozilla-layout
+
+%package layout-devel
+Requires:	mozilla-layout
+Summary:	mozilla-layout-devel
+Group:		Mozilla
+Requires:	mozilla-network-devel
+
+%description layout-devel
+mozilla-layout devel
+
+%package xpinstall
+Summary:	mozilla-xpinstall
+Group:		Mozilla
+Requires:	mozilla-layout
+
+%description xpinstall
+mozilla-xpinstall
+
+%package xpinstall-devel
+Requires:	mozilla-xpinstall
+Summary:	mozilla-xpinstall-devel
+Group:		Mozilla
+Requires:	mozilla-layout-devel
+
+%description xpinstall-devel
+mozilla-xpinstall devel
+
+%package profile
+Summary:	mozilla-profile
+Group:		Mozilla
+Requires:	mozilla-layout
+
+%description profile
+mozilla-profile
+
+%package profile-devel
+Requires:	mozilla-profile
+Summary:	mozilla-profile-devel
+Group:		Mozilla
+Requires:	mozilla-layout-devel
+
+%description profile-devel
+mozilla-profile devel
+
+%package xptoolkit
+Summary:	mozilla-xptoolkit
+Group:		Mozilla
+Requires:	mozilla-layout
+
+%description xptoolkit
+mozilla-xptoolkit
+
+%package xptoolkit-devel
+Requires:	mozilla-xptoolkit
+Summary:	mozilla-xptoolkit-devel
+Group:		Mozilla
+Requires:	mozilla-layout-devel
+
+%description xptoolkit-devel
+mozilla-xptoolkit devel
+
+%package cookie
+Summary:	mozilla-cookie
+Group:		Mozilla
+Requires:	mozilla-layout
+
+%description cookie
+mozilla-cookie
+
+%package cookie-devel
+Requires:	mozilla-cookie
+Summary:	mozilla-cookie-devel
+Group:		Mozilla
+Requires:	mozilla-layout-devel
+
+%description cookie-devel
+mozilla-cookie devel
+
+%package wallet
+Summary:	mozilla-wallet
+Group:		Mozilla
+Requires:	mozilla-layout
+
+%description wallet
+mozilla-wallet
+
+%package wallet-devel
+Requires:	mozilla-wallet
+Summary:	mozilla-wallet-devel
+Group:		Mozilla
+Requires:	mozilla-layout-devel
+
+%description wallet-devel
+mozilla-wallet devel
+
+%package mailnews
+Summary:	mozilla-mailnews
+Group:		Mozilla
+Requires:	mozilla-layout
+
+%description mailnews
+mozilla-mailnews
+
+%package mailnews-devel
+Requires:	mozilla-mailnews
+Summary:	mozilla-mailnews-devel
+Group:		Mozilla
+Requires:	mozilla-layout-devel
+
+%description mailnews-devel
+mozilla-mailnews devel
+
+
+%prep
+%setup -n mozilla
+
+%install
+rm -rf $RPM_BUILD_ROOT
+
+################################
+#
+# Remember where we are
+#
+################################
+here=`pwd`
+
+################################
+#
+# configure
+#
+################################
+
+if [ 1 ]
+then
+###
+###
+###
+rm -f $here/blank
+
+touch $here/blank
+
+MOZCONFIG=blank
+
+export MOZCONFIG
+
+./configure --disable-tests --with-xlib=no --with-motif=no --enable-strip-libs --disable-debug --enable-optimize --disable-gtk-mozilla
+
+make
+
+fi
+################################
+
+mkdir -p $RPM_BUILD_ROOT/%{prefix}/lib/mozilla
+mkdir -p $RPM_BUILD_ROOT/%{prefix}/lib/mozilla/plugins
+
+################################
+#
+# Generate the package lists
+#
+################################
+here=`pwd`
+
+mkdir -p $here/file-lists
+
+cd build/package/rpm
+
+./generate-package-info.sh mozilla-package-list.txt . $here/file-lists $here
+
+cd $here
+################################
+
+################################
+#
+# Copy the stuff in dist/* to the rpm stage place
+#
+################################
+cp -r dist/* $RPM_BUILD_ROOT/%{prefix}/lib/mozilla/
+
+cd $RPM_BUILD_ROOT/%{prefix}/lib/mozilla/
+
+/bin/mv -f bin/*.so lib
+/bin/mv -f bin/chrome .
+/bin/mv -f bin/components .
+/bin/mv -f bin/defaults .
+/bin/mv -f bin/netscape.cfg .
+/bin/mv -f bin/res .
+
+strip lib/*.so
+strip components/*.so
+
+cd $here
+
+install -m 755 build/package/rpm/mozilla $RPM_BUILD_ROOT/%{prefix}/lib/mozilla/bin
+################################
+
+##
+## This function gets called on the %post stage to make sure any
+## new components that are installed in the system get 
+## registered to component.reg
+##
+%define call_regxpcom here=`pwd` ; cd %{prefix}/lib/mozilla ; LD_LIBRARY_PATH=`pwd`/lib ./bin/regxpcom ; cd $here
+
+%clean
+rm -rf $RPM_BUILD_ROOT
+
+%files -f file-lists/mozilla-nspr-file-list.txt nspr
+%defattr(-,root,root)
+
+%files -f file-lists/mozilla-nspr-devel-file-list.txt nspr-devel
+%defattr(-,root,root)
+
+%files -f file-lists/mozilla-core-file-list.txt core
+%defattr(-,root,root)
+%dir %{prefix}/lib/mozilla
+%dir %{prefix}/lib/mozilla/bin
+%dir %{prefix}/lib/mozilla/chrome
+%dir %{prefix}/lib/mozilla/components
+%dir %{prefix}/lib/mozilla/defaults
+%dir %{prefix}/lib/mozilla/defaults/pref
+%dir %{prefix}/lib/mozilla/lib
+%dir %{prefix}/lib/mozilla/plugins
+%dir %{prefix}/lib/mozilla/res
+
+%files -f file-lists/mozilla-core-devel-file-list.txt core-devel
+%defattr(-,root,root)
+
+%post core
+%{call_regxpcom}
+
+%files -f file-lists/mozilla-network-file-list.txt network
+%defattr(-,root,root)
+
+%files -f file-lists/mozilla-network-devel-file-list.txt network-devel
+%defattr(-,root,root)
+
+%post network
+%{call_regxpcom}
+
+%files -f file-lists/mozilla-layout-file-list.txt layout
+%defattr(-,root,root)
+
+%files -f file-lists/mozilla-layout-devel-file-list.txt layout-devel
+%defattr(-,root,root)
+
+%post layout
+%{call_regxpcom}
+
+%files -f file-lists/mozilla-xpinstall-file-list.txt xpinstall
+%defattr(-,root,root)
+
+%files -f file-lists/mozilla-xpinstall-devel-file-list.txt xpinstall-devel
+%defattr(-,root,root)
+
+%post xpinstall
+%{call_regxpcom}
+
+%files -f file-lists/mozilla-profile-file-list.txt profile
+%defattr(-,root,root)
+
+%files -f file-lists/mozilla-profile-devel-file-list.txt profile-devel
+%defattr(-,root,root)
+
+%post profile
+%{call_regxpcom}
+
+%files -f file-lists/mozilla-xptoolkit-file-list.txt xptoolkit
+%defattr(-,root,root)
+
+%files -f file-lists/mozilla-xptoolkit-devel-file-list.txt xptoolkit-devel
+%defattr(-,root,root)
+
+%post xptoolkit
+%{call_regxpcom}
+
+%files -f file-lists/mozilla-cookie-file-list.txt cookie
+%defattr(-,root,root)
+
+%files -f file-lists/mozilla-cookie-devel-file-list.txt cookie-devel
+%defattr(-,root,root)
+
+%post cookie
+%{call_regxpcom}
+
+%files -f file-lists/mozilla-wallet-file-list.txt wallet
+%defattr(-,root,root)
+
+%files -f file-lists/mozilla-wallet-devel-file-list.txt wallet-devel
+%defattr(-,root,root)
+
+%post wallet
+%{call_regxpcom}
+
+%files -f file-lists/mozilla-mailnews-file-list.txt mailnews
+%defattr(-,root,root)
+
+%files -f file-lists/mozilla-mailnews-devel-file-list.txt mailnews-devel
+%defattr(-,root,root)
+
+%post mailnews
+%{call_regxpcom}
+
+%changelog
+* Wed Oct 20 1999 Ramiro Estrugo <ramiro@fateware.com>
+- First rev.
+

mozilla/build/package/rpm/print-module-filelist.sh

@@ -0,0 +1,156 @@
+#!/bin/sh
+#
+# The contents of this file are subject to the Netscape Public
+# License Version 1.1 (the "License"); you may not use this file
+# except in compliance with the License. You may obtain a copy of
+# the License at http://www.mozilla.org/NPL/
+#
+# Software distributed under the License is distributed on an "AS
+# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express or
+# implied. See the License for the specific language governing
+# rights and limitations under the License.
+#
+# The Original Code is mozilla.org code.
+#
+# The Initial Developer of the Original Code is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation. All
+# Rights Reserved.
+#
+# Contributor(s): 
+#
+#
+
+
+# The way this thing works:
+#
+# + a phony $(DIST) is created: /tmp/foo
+#
+# + The module is instaled there so that it can be isolated and
+#   catalogued.
+#
+# + A bunch of case statements determine what gets ignored
+#   and what is otherwise echoed as a file or dir member for
+#   the module
+#
+# + Most of this hacks are a result of the totally messed
+#   way in which mozilla pretentsto do "make install"
+
+here=`pwd`
+
+dist=/tmp/dist-$$.tmp
+
+raw_file_list=/tmp/raw-file-list-$$.txt
+file_list=/tmp/file-list-$$.txt
+
+raw_dir_list=/tmp/raw-dir-list-$$.txt
+dir_list=/tmp/dir-list-$$.txt
+
+rm -rf $dist $raw_file_list $file_list $raw_dir_list $dir_list
+
+# Need to mkdir include or else "make export" in mozilla gets confused
+mkdir -p $dist
+mkdir -p $dist/include
+
+make -s DIST=$dist XPDIST=$dist PUBLIC=$dist/include EXTRA_DEPS= >/dev/null 2>&1
+
+cd $dist
+
+find -type l | cut -b3- > $raw_file_list
+find -type d | cut -b3- | grep -v -e "^[ \t]*$" > $raw_dir_list
+
+touch $file_list
+
+for i in `cat $raw_file_list`
+do
+	skip="false"
+
+	dir=`echo $i | awk -F"/" '{ print $1; }'`
+
+	# "lib" voodoo
+	if [ "$dir" = "lib" ]
+	then
+		rest=`echo $i | cut -b5-`
+
+		bin_dup="bin/$rest"
+
+		# Dont output files in "lib/" that are duplicated in "bin/"
+		if [ -f "$bin_dup" ]
+		then
+			skip="true"
+		fi
+
+		# Test for files that need to be skipped
+		file=`basename $i`
+
+		case "$file"
+		in
+			# Dont skip util .a files
+			*util_s.a)
+				:
+			;;
+
+			# Dont skip nspr .a files
+			libnspr*.a|libplc*|libplds*)
+				:
+			;;
+
+			# Skip all .a files
+			*.a)
+				skip="true"
+			;;
+
+			# Skip .so files
+			*.so)
+				skip="true"
+			;;
+		esac
+	fi
+
+	if [ "$skip" != "true" ]
+	then
+		echo $i >> $file_list
+#	else
+#		echo "skipping $i"
+	fi
+done
+
+touch $dir_list
+
+for i in `cat $raw_dir_list`
+do
+	skip="false"
+
+	# Skip directories that are shared across all of mozilla's components
+	case $i in
+		# level 1
+		include|idl|lib|bin)
+			skip="true"
+		;;
+
+		# level 2
+		lib/components|bin/components|bin/chrome|bin/res|bin/defaults|bin/plugins)
+			skip="true"
+		;;
+
+		# level 3
+		bin/defaults/pref)
+			skip="true"
+		;;
+	esac
+
+	if [ "$skip" != "true" ]
+	then
+		echo DIR:$i >> $dir_list
+#	else
+#		echo "skipping $i"
+	fi
+done
+
+cat $file_list
+cat $dir_list
+
+rm -rf $dist $raw_file_list $file_list $raw_dir_list $dir_list
+
+cd $here
+

mozilla/build/package/rpm/print-module-name.sh

@@ -0,0 +1,26 @@
+#!/bin/sh
+#
+# The contents of this file are subject to the Netscape Public
+# License Version 1.1 (the "License"); you may not use this file
+# except in compliance with the License. You may obtain a copy of
+# the License at http://www.mozilla.org/NPL/
+#
+# Software distributed under the License is distributed on an "AS
+# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express or
+# implied. See the License for the specific language governing
+# rights and limitations under the License.
+#
+# The Original Code is mozilla.org code.
+#
+# The Initial Developer of the Original Code is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation. All
+# Rights Reserved.
+#
+# Contributor(s): 
+#
+#
+
+module=`make -s echo-depth-path | cut -b9-`
+
+echo $module

mozilla/build/unix/Makefile.in

@@ -0,0 +1,37 @@
+#
+# The contents of this file are subject to the Netscape Public
+# License Version 1.1 (the "License"); you may not use this file
+# except in compliance with the License. You may obtain a copy of
+# the License at http://www.mozilla.org/NPL/
+#
+# Software distributed under the License is distributed on an "AS
+# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express or
+# implied. See the License for the specific language governing
+# rights and limitations under the License.
+#
+# The Original Code is Mozilla Communicator client code, 
+# released March 31, 1998. 
+#
+# The Initial Developer of the Original Code is Netscape Communications 
+# Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation. All
+# Rights Reserved.
+#
+# Contributor(s): 
+#
+
+DEPTH		= ../..
+topsrcdir	= @top_srcdir@
+srcdir		= @srcdir@
+VPATH		= @srcdir@
+
+include $(DEPTH)/config/autoconf.mk
+
+include $(topsrcdir)/config/rules.mk
+
+export:: 
+	chmod 755 mozilla-config
+	$(INSTALL) -m 755 mozilla-config $(DIST)/bin
+
+install:: $(srcdir)/run-mozilla.sh
+	$(INSTALL) $< $(DIST)/bin

mozilla/build/unix/gnu-ld-scripts/components-version-script

@@ -0,0 +1,8 @@
+EXPORTED {
+   global:
+		NSGetFactory;
+		NSGetModule;
+		NSRegisterSelf;
+		NSUnregisterSelf;
+   local: *;
+};

mozilla/build/unix/mddepend.pl

@@ -0,0 +1,115 @@
+#!/usr/bin/env perl
+
+# The contents of this file are subject to the Netscape Public
+# License Version 1.1 (the "License"); you may not use this file
+# except in compliance with the License. You may obtain a copy of
+# the License at http://www.mozilla.org/NPL/
+#
+# Software distributed under the License is distributed on an "AS
+# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express or
+# implied. See the License for the specific language governing
+# rights and limitations under the License.
+#
+# The Original Code is this file as it was released upon March 8, 1999.
+#
+# The Initial Developer of the Original Code is Netscape Communications
+# Corporation. Portions created by Netscape are
+# Copyright (C) 1999 Netscape Communications Corporation. All
+# Rights Reserved.
+#
+# Contributor(s): 
+
+# mddepend.pl - Reads in dependencies generated my -MD flag. Prints list
+#   of objects that need to be rebuilt. These can then be added to the
+#   PHONY target. Using this script copes with the problem of header
+#   files that have been removed from the build.
+#    
+# Usage:
+#   mddepend.pl <output_file> <dependency_files...>
+#
+# Send comments, improvements, bugs to Steve Lamm (slamm@netscape.com).
+
+#$debug = 1;
+
+$outfile = shift @ARGV;
+
+@alldeps=();
+# Parse dependency files
+while ($line = <>) {
+  chomp $line;
+  ($obj,$rest) = split /\s*:\s+/, $line, 2;
+  next if $obj eq '';
+
+  if ($line =~ /\\$/) {
+    chop $rest;
+    $hasSlash = 1;
+  } else {
+    $hasSlash = 0;
+  }
+  $deps = [ $obj, split /\s+/, $rest ];
+
+  while ($hasSlash and $line = <>) {
+    chomp $line;
+    if ($line =~ /\\$/) {
+      chop $line;
+    } else {
+      $hasSlash = 0;
+    }
+    $line =~ s/^\s+//;
+    push @{$deps}, split /\s+/, $line;
+  }
+  warn "add @{$deps}\n" if $debug;
+  push @alldeps, $deps;
+}
+
+# Test dependencies
+foreach $deps (@alldeps) {
+  $obj = shift @{$deps};
+
+  $mtime = (stat $obj)[9] or next;
+
+  foreach $dep_file (@{$deps}) {
+    if (not defined($dep_mtime = $modtimes{$dep_file})) {
+      $dep_mtime = (stat $dep_file)[9];
+      $modtimes{$dep_file} = $dep_mtime;
+    }
+    if ($dep_mtime ne '' and $dep_mtime > $mtime) {
+      print "$obj($mtime) older than $dep_file($dep_mtime)\n" if $debug;
+      push @objs, $obj;
+      # Object will be marked for rebuild. No need to check other dependencies.
+      last;
+    }
+  }
+}
+
+# Output objects to rebuild (if needed).
+if (@objs) {
+  $new_output = "@objs: FORCE\n";
+
+  # Read in the current dependencies file.
+  open(OLD, "<$outfile")
+    and $old_output = <OLD>;
+  close(OLD);
+
+  # Only write out the dependencies if they are different.
+  if ($new_output ne $old_output) {
+    open(OUT, ">$outfile") and print OUT "$new_output";
+    print "Updating dependencies file, $outfile\n";
+    if ($debug) {
+      print "new: $new_output\n";
+      print "was: $old_output\n" if $old_output ne '';
+    }
+  }
+} elsif (-s $outfile) {
+  # Remove the old dependencies because all objects are up to date.
+  print "Removing old dependencies file, $outfile\n";
+
+  if ($debug) {
+    open(OLD, "<$outfile")
+      and $old_output = <OLD>;
+    close(OLD);
+    print "was: $old_output\n";
+  }
+
+  unlink $outfile;
+}

mozilla/build/unix/modules.mk

@@ -0,0 +1,69 @@
+#
+# The contents of this file are subject to the Mozilla Public
+# License Version 1.1 (the "License"); you may not use this file
+# except in compliance with the License. You may obtain a copy of
+# the License at http://www.mozilla.org/MPL/
+#
+# Software distributed under the License is distributed on an "AS
+# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express or
+# implied. See the License for the specific language governing
+# rights and limitations under the License.
+#
+# The Original Code is build/unix/modules.mk from the Mozilla source tree.
+#
+# The Initial Developer of the Original Code is Christopher
+# Seawood. Portions created by Christopher Seawood are
+# Copyright (C) 2000 Christopher Seawood. All Rights Reserved.
+#
+#
+
+BUILD_MODULE_DIRS := config build include
+_BUILD_MODS = 
+NSPRPUB_DIR =
+
+# client.mk does not have topsrcdir set
+ifndef topsrcdir
+topsrcdir=$(TOPSRCDIR)
+endif
+
+ifndef MOZ_NATIVE_NSPR
+# Do not regenerate Makefile for NSPR
+ifdef USE_NSPR_AUTOCONF
+NSPRPUB_DIR		= nsprpub
+else
+NSPRPUB_DIR		= $(topsrcdir)/nsprpub
+endif
+endif
+
+ifneq ($(BUILD_MODULES),all)
+
+ifdef CROSS_COMPILE
+BUILD_MODULE_DIRS_js		= $(NSPRPUB_DIR)
+endif
+
+BUILD_MODULE_DIRS_dbm 		= $(NSPRPUB_DIR) dbm
+BUILD_MODULE_DIRS_js		+= js
+BUILD_MODULE_DIRS_necko		= $(BUILD_MODULE_DIRS_xpcom) netwerk
+BUILD_MODULE_DIRS_transformiix	= extensions/transformiix
+BUILD_MODULE_DIRS_xpcom		= $(NSPRPUB_DIR) modules/libreg xpcom
+BUILD_MODULE_DIRS_xpconnect	= $(BUILD_MODULE_DIRS_xpcom) $(BUILD_MODULE_DIRS_js) js/src/xpconnect
+
+
+BUILD_MODULE_DIRS += $(foreach mod,$(BUILD_MODULES), $(BUILD_MODULE_DIRS_$(mod)))
+
+# Remove dups from the list to speed up the build
+#
+ifdef PERL
+BUILD_MODULE_DIRS := $(shell $(PERL) -e 'undef @out; \
+    foreach $$d (@ARGV) { \
+	push @out, $$d if (!grep(/$$d/, @out)); \
+    }; \
+    print "@out\n"; ' $(BUILD_MODULE_DIRS))
+else
+# Since PERL isn't defined, client.mk must've called us so order doesn't matter
+BUILD_MODULE_DIRS := $(sort $(BUILD_MODULE_DIRS))
+endif
+
+endif # BUILD_MODULES
+
+

mozilla/build/unix/mozilla-config.in

@@ -0,0 +1,80 @@
+#!/bin/sh
+
+prefix=@prefix@
+exec_prefix=@exec_prefix@
+exec_prefix_set=no
+
+usage()
+{
+	cat <<EOF
+Usage: mozilla-config [OPTIONS] [LIBRARIES]
+Options:
+	[--prefix[=DIR]]
+	[--exec-prefix[=DIR]]
+	[--version]
+	[--libs]
+	[--cflags]
+EOF
+	exit $1
+}
+
+if test $# -eq 0; then
+	usage 1 1>&2
+fi
+
+while test $# -gt 0; do
+  case "$1" in
+  -*=*) optarg=`echo "$1" | sed 's/[-_a-zA-Z0-9]*=//'` ;;
+  *) optarg= ;;
+  esac
+
+  case $1 in
+    --prefix=*)
+      prefix=$optarg
+      if test $exec_prefix_set = no ; then
+        exec_prefix=$optarg
+      fi
+      ;;
+    --prefix)
+      echo_prefix=yes
+      ;;
+    --exec-prefix=*)
+      exec_prefix=$optarg
+      exec_prefix_set=yes
+      ;;
+    --exec-prefix)
+      echo_exec_prefix=yes
+      ;;
+    --version)
+      echo -1
+      exit 0
+      ;;
+    --cflags)
+      if test "@includedir@" != /usr/include ; then
+        includes="-I@includedir@"
+      fi
+      echo_cflags=yes
+      ;;
+    --libs)
+      echo_libs=yes
+      ;;
+    *)
+      usage 1 1>&2
+      ;;
+  esac
+  shift
+done
+
+if test "$echo_prefix" = "yes"; then
+	echo $prefix
+fi
+if test "$echo_exec_prefix" = "yes"; then
+	echo $exec_prefix
+fi
+if test "$echo_cflags" = "yes"; then
+	cflags="@DEFS@"
+	echo $includes $cflags
+fi
+if test "$echo_libs" = "yes"; then
+	echo -L@libdir@ -lxpcom
+fi

mozilla/build/unix/nspr_my_config.mk.in

@@ -0,0 +1,8 @@
+USE_PTHREADS=@MOZ_NSPRENV_USE_PTHREADS@
+BUILD_OPT=@MOZ_NSPRENV_BUILD_OPT@
+NS_USE_GCC=@MOZ_NSPRENV_NS_USE_GCC@
+NO_MDUPDATE=@MOZ_NSPRENV_NO_MDUPDATE@
+NS_USE_NATIVE=@MOZ_NSPRENV_NS_USE_NATIVE@
+MOZILLA_CLIENT=@MOZ_NSPRENV_MOZILLA_CLIENT@
+CLASSIC_NSPR=@MOZ_NSPRENV_CLASSIC_NSPR@
+GC_LEAK_DETECTOR=@MOZ_NSPRENV_GC_LEAK_DETECTOR@

mozilla/build/unix/nspr_my_overrides.mk.in

@@ -0,0 +1,7 @@
+DIST=@MOZ_NSPRENV_DIST@
+MOZ_NSPRENV_OVERRIDE_MAKE=@MOZ_NSPRENV_OVERRIDE_MAKE@
+
+ifdef MOZ_NSPRENV_OVERRIDE_MAKE
+MAKE=$(MOZ_NSPRENV_OVERRIDE_MAKE)
+endif
+