Bug fix #31255, copied from tip.

git-svn-id: svn://10.0.0.236/branches/JS_150_RC2@76290 18797224-902f-48f8-a5cc-f745e15eee43

mozilla/build/mac/IDE_Options.h

@@ -1,132 +0,0 @@
-/* -*- Mode: C; tab-width: 4; indent-tabs-mode: nil; c-basic-offset: 2 -*- */
-/* ***** BEGIN LICENSE BLOCK *****
- * Version: NPL 1.1/GPL 2.0/LGPL 2.1
- *
- * The contents of this file are subject to the Netscape Public License
- * Version 1.1 (the "License"); you may not use this file except in
- * compliance with the License. You may obtain a copy of the License at
- * http://www.mozilla.org/NPL/
- *
- * Software distributed under the License is distributed on an "AS IS" basis,
- * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
- * for the specific language governing rights and limitations under the
- * License.
- *
- * The Original Code is mozilla.org code.
- *
- * The Initial Developer of the Original Code is 
- * Netscape Communications Corporation.
- * Portions created by the Initial Developer are Copyright (C) 1998
- * the Initial Developer. All Rights Reserved.
- *
- * Contributor(s):
- *
- *
- * Alternatively, the contents of this file may be used under the terms of
- * either the GNU General Public License Version 2 or later (the "GPL"), or
- * the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
- * in which case the provisions of the GPL or the LGPL are applicable instead
- * of those above. If you wish to allow use of your version of this file only
- * under the terms of either the GPL or the LGPL, and not to allow others to
- * use your version of this file under the terms of the NPL, indicate your
- * decision by deleting the provisions above and replace them with the notice
- * and other provisions required by the GPL or the LGPL. If you do not delete
- * the provisions above, a recipient may use your version of this file under
- * the terms of any one of the NPL, the GPL or the LGPL.
- *
- * ***** END LICENSE BLOCK ***** */
-/*
-
-	This file overrides all option settings in the IDE.  It is an attempt to allow all builds
-	to have the same options.
-
-	Note: We can't use ConditionalMacros.h in this file because it will conflict with 
-	the PowerPlant precompiled headers.
-
-*/
-
-	/* warning pragmas */
-#pragma warn_hidevirtual 		on
-#pragma warn_emptydecl 			on
-#pragma warn_unusedvar 			on
-#pragma warn_extracomma 		on
-#pragma warn_illpragma 			on
-#pragma warn_possunwant 		on
-#pragma warn_unusedarg 			off		/* turned off to reduce warnings */
-
-#pragma check_header_flags 		on
-
-	/* Language features that must be the same across libraries... */
-#pragma enumsalwaysint			on
-#pragma unsigned_char			off
-#pragma exceptions				on
-#pragma bool 					on
-#pragma wchar_type              on
-#pragma RTTI                    on
-
-
-	/* Save as much space as possible with strings... */
-#pragma pool_strings				on
-#pragma dont_reuse_strings			off
-
-#pragma options align=native
-#pragma sym 						on				/* Takes no memory.  OK in non-debug. */
-
-
-
-#ifdef powerc /* ...generating PowerPC */
-	#pragma toc_data 				on
-	#pragma fp_contract 			on
-	#pragma readonly_strings 		on
-
-	#ifdef DEBUG
-		#pragma profile 		off							/* Turn this on to profile the application. */
-																				/* Look for more details about profiling in nsMacMessagePump.cpp.  */
-		#pragma traceback 			on
-		#pragma global_optimizer 	off
-		#pragma scheduling 			off
-		#pragma peephole 			off
-		#pragma optimize_for_size 	off
-	#else
-		
-		#if TARGET_CARBON
-			#pragma traceback		on					/* should always be ON for Carbon builds */
-		#else
-			#pragma traceback		off					/* leave on until the final release, so MacsBug logs are interpretable */
-		#endif
-		
-		#pragma global_optimizer 	on
-		#pragma optimization_level 	4
-		#pragma scheduling 			603
-		#pragma peephole 			on
-		#pragma optimize_for_size	on
-
-    #pragma opt_strength_reduction on
-    #pragma opt_propagation on
-    #pragma opt_loop_invariants on
-    #pragma opt_lifetimes on
-    #pragma opt_dead_code on
-    #pragma opt_dead_assignments on
-    #pragma opt_common_subs on
-	#endif
-
-#else /* ...generating 68k */
-	#pragma code68020 			on
-	#pragma code68881 			off
-
-		/* Far everything... */
-	#pragma far_code
-	#pragma far_data 			on
-	#pragma far_strings 		on
-	#pragma far_vtables 		on
-
-	#pragma fourbyteints		on	/* 4-byte ints */
-	#pragma IEEEdoubles			on	/* 8-byte doubles (as required by Java and NSPR) */
-
-	#ifdef DEBUG
-		#pragma macsbug 		on
-		#pragma oldstyle_symbols off
-	#else
-		#pragma macsbug 		off
-	#endif
-#endif

mozilla/build/mac/NSCrossProductDefines.h

@@ -1,59 +0,0 @@
-/* -*- Mode: C; tab-width: 4; indent-tabs-mode: nil; c-basic-offset: 2 -*- */
-/* ***** BEGIN LICENSE BLOCK *****
- * Version: NPL 1.1/GPL 2.0/LGPL 2.1
- *
- * The contents of this file are subject to the Netscape Public License
- * Version 1.1 (the "License"); you may not use this file except in
- * compliance with the License. You may obtain a copy of the License at
- * http://www.mozilla.org/NPL/
- *
- * Software distributed under the License is distributed on an "AS IS" basis,
- * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
- * for the specific language governing rights and limitations under the
- * License.
- *
- * The Original Code is mozilla.org code.
- *
- * The Initial Developer of the Original Code is 
- * Netscape Communications Corporation.
- * Portions created by the Initial Developer are Copyright (C) 1998
- * the Initial Developer. All Rights Reserved.
- *
- * Contributor(s):
- *
- *
- * Alternatively, the contents of this file may be used under the terms of
- * either the GNU General Public License Version 2 or later (the "GPL"), or
- * the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
- * in which case the provisions of the GPL or the LGPL are applicable instead
- * of those above. If you wish to allow use of your version of this file only
- * under the terms of either the GPL or the LGPL, and not to allow others to
- * use your version of this file under the terms of the NPL, indicate your
- * decision by deleting the provisions above and replace them with the notice
- * and other provisions required by the GPL or the LGPL. If you do not delete
- * the provisions above, a recipient may use your version of this file under
- * the terms of any one of the NPL, the GPL or the LGPL.
- *
- * ***** END LICENSE BLOCK ***** */
-
-#error "DonÕt use me!"
-
-#define OLDROUTINELOCATIONS 0
-#define XP_MAC 1
-#define NSPR20 1
-#define _NO_FAST_STRING_INLINES_ 1
-#define HAVE_BOOLEAN 1
-#define NETSCAPE 1
-#define OTUNIXERRORS 1		/* We want OpenTransport error codes */
-
-#define OJI 1
-
-/*
-	This compiles in heap dumping utilities and other good stuff
- for developers -- maybe we only want it in for a special SDK
- nspr/java runtime(?):
-*/
-#define DEVELOPER_DEBUG 1
-
-#define	MAX(_a,_b)	((_a) < (_b) ? (_b) : (_a))
-#define	MIN(_a,_b)	((_a) < (_b) ? (_a) : (_b))

mozilla/build/mac/build_scripts/BuildMozilla.pl

@@ -1,80 +0,0 @@
-#!perl
-
-#
-# The contents of this file are subject to the Netscape Public
-# License Version 1.1 (the "License"); you may not use this file
-# except in compliance with the License. You may obtain a copy of
-# the License at http://www.mozilla.org/NPL/
-#
-# Software distributed under the License is distributed on an "AS
-# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express or
-# implied. See the License for the specific language governing
-# rights and limitations under the License.
-#
-# The Original Code is mozilla.org code.
-#
-# The Initial Developer of the Original Code is Netscape
-# Communications Corporation.  Portions created by Netscape are
-# Copyright (C) 1998 Netscape Communications Corporation. All
-# Rights Reserved.
-#
-# Contributor(s): 
-#   Simon Fraser <sfraser@netscape.com>
-#
-
-require 5.004;
-
-use strict;
-
-use Cwd;
-use Moz::BuildUtils;
-use Moz::BuildCore;
-
-#-------------------------------------------------------------
-# Where have the build options gone?
-# 
-# The various build flags have been centralized into one place. 
-# The master list of options is in MozBuildFlags.txt. However, 
-# you should never need to edit that file, or this one.
-# 
-# To customize what gets built, or where to start the build, 
-# edit the $prefs_file_name file in
-# System Folder:Preferences:Mozilla build prefs:
-# Documentation is provided in that file.
-#-------------------------------------------------------------
-
-my($prefs_file_name) = "Mozilla opt build prefs";
-my($config_header_file_name) = ":mozilla:config:mac:DefinesOptions.h";
-
-#-------------------------------------------------------------
-# hashes to hold build options
-#-------------------------------------------------------------
-my(%build);
-my(%options);
-my(%filepaths);
-my(%optiondefines);
-
-# Hash of input files for this build. Eventually, there will be
-# input files for manifests, and projects too.
-my(%inputfiles) = (
-  "buildflags",     "MozillaBuildFlags.txt",
-  "checkoutdata",   "MozillaCheckoutList.txt",
-  "buildprogress",  "¥ Mozilla opt progress",
-  "buildmodule",    "MozillaBuildList.pm",
-  "checkouttime",   "Mozilla last checkout"
-);
-#-------------------------------------------------------------
-# end build hashes
-#-------------------------------------------------------------
-
-# set the build root directory, which is the the dir above mozilla
-SetupBuildRootDir(":mozilla:build:mac:build_scripts");
-
-# Set up all the flags on $main::, like DEBUG, CARBON etc.
-# Override the defaults using the preferences files.
-SetupDefaultBuildOptions(0, ":mozilla:dist:viewer:", $config_header_file_name);
-
-my($do_checkout)    = 0;
-my($do_build)       = 1;
-
-RunBuild($do_checkout, $do_build, \%inputfiles, $prefs_file_name);

mozilla/build/mac/build_scripts/BuildMozillaDebug.pl

@@ -1,80 +0,0 @@
-#!perl
-
-#
-# The contents of this file are subject to the Netscape Public
-# License Version 1.1 (the "License"); you may not use this file
-# except in compliance with the License. You may obtain a copy of
-# the License at http://www.mozilla.org/NPL/
-#
-# Software distributed under the License is distributed on an "AS
-# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express or
-# implied. See the License for the specific language governing
-# rights and limitations under the License.
-#
-# The Original Code is mozilla.org code.
-#
-# The Initial Developer of the Original Code is Netscape
-# Communications Corporation.  Portions created by Netscape are
-# Copyright (C) 1998 Netscape Communications Corporation. All
-# Rights Reserved.
-#
-# Contributor(s): 
-#   Simon Fraser <sfraser@netscape.com>
-#
-
-require 5.004;
-
-use strict;
-
-use Cwd;
-use Moz::BuildUtils;
-use Moz::BuildCore;
-
-#-------------------------------------------------------------
-# Where have the build options gone?
-# 
-# The various build flags have been centralized into one place. 
-# The master list of options is in MozBuildFlags.txt. However, 
-# you should never need to edit that file, or this one.
-# 
-# To customize what gets built, or where to start the build, 
-# edit the $prefs_file_name file in
-# System Folder:Preferences:Mozilla build prefs:
-# Documentation is provided in that file.
-#-------------------------------------------------------------
-
-my($prefs_file_name) = "Mozilla debug build prefs";
-my($config_header_file_name) = ":mozilla:config:mac:DefinesOptionsDebug.h";
-
-#-------------------------------------------------------------
-# hashes to hold build options
-#-------------------------------------------------------------
-my(%build);
-my(%options);
-my(%filepaths);
-my(%optiondefines);
-
-# Hash of input files for this build. Eventually, there will be
-# input files for manifests, and projects too.
-my(%inputfiles) = (
-  "buildflags",     "MozillaBuildFlags.txt",
-  "checkoutdata",   "MozillaCheckoutList.txt",
-  "buildprogress",  "¥ Mozilla debug progress",
-  "buildmodule",    "MozillaBuildList.pm",
-  "checkouttime",   "Mozilla last checkout"
-);
-#-------------------------------------------------------------
-# end build hashes
-#-------------------------------------------------------------
-
-# set the build root directory, which is the the dir above mozilla
-SetupBuildRootDir(":mozilla:build:mac:build_scripts");
-
-# Set up all the flags on $main::, like DEBUG, CARBON etc.
-# Override the defaults using the preferences files.
-SetupDefaultBuildOptions(1, ":mozilla:dist:viewer_debug:", $config_header_file_name);
-
-my($do_pull)        = 0;    # overridden by flags and prefs
-my($do_build)       = 1;
-
-RunBuild($do_pull, $do_build, \%inputfiles, $prefs_file_name);

mozilla/build/mac/build_scripts/Moz/BuildCore.pm

@@ -1,595 +0,0 @@
-#!perl -w
-package Moz::BuildCore;
-
-require 5.004;
-require Exporter;
-
-use strict;
-use vars qw( @ISA @EXPORT );
-
-# perl includes
-use Cwd;
-use POSIX;
-use Time::Local;
-use File::Basename;
-use LWP::Simple;
-
-# homegrown
-use Moz::Moz;
-use Moz::Jar;
-use Moz::BuildFlags;
-use Moz::BuildUtils;
-use Moz::CodeWarriorLib;
-
-# use MozillaBuildList;   # eventually, this should go away, and be replaced by data input
-
-
-@ISA        = qw(Exporter);
-@EXPORT     = qw(
-                    RunBuild
-                );
-
-
-#//--------------------------------------------------------------------------------------------------
-#// DoPrebuildCheck
-#//
-#// Check the build tools etc before running the build.
-#//--------------------------------------------------------------------------------------------------
-sub DoPrebuildCheck()
-{
-    SanityCheckBuildOptions();
-
-    # launch codewarrior and persist its location. Have to call this before first
-    # call to getCodeWarriorPath().
-    my($ide_path_file) = $main::filepaths{"idepath"};
-    $ide_path_file = full_path_to($ide_path_file);
-    LaunchCodeWarrior($ide_path_file);
-}
-
-#//--------------------------------------------------------------------------------------------------
-#// SanityCheckBuildOptions
-#//--------------------------------------------------------------------------------------------------
-sub SanityCheckBuildOptions()
-{
-    my($bad_options) = 0;
-
-    # Jar options
-    if (!$main::options{chrome_jars} && !$main::options{chrome_files})
-    {
-        print "Warning: Both \$options{chrome_jars} and \$options{chrome_files} are off. You won't get any chrome.\n";
-        $bad_options = 1;
-    }
-
-    if (!$main::options{chrome_jars} && $main::options{use_jars})
-    {
-        print "Warning: \$options{chrome_jars} is off but \$options{use_jars} is on. Your build won't run (expects jars, got files).\n";
-        $bad_options = 1;
-    }
-
-    if (!$main::options{chrome_files} && !$main::options{use_jars})
-    {
-        print "Warning: \$options{chrome_jars} is off but \$options{chrome_files} is on. Your build won't run (expects files, got jars).\n";
-        $bad_options = 1;
-    }
-
-    if ($main::options{ldap_experimental} && !$main::options{ldap})
-    {
-        print "Warning: \$options{ldap_experimental} is on but \$options{ldap} is off. LDAP experimental features will not be built.\n";
-        $bad_options = 1;
-    }
-
-    if ($main::options{wsp} && !$main::options{xmlextras})
-    {
-        print "Warning: \$options{wsp} is on but \$options{xmlextras} is off. wsp will not be built.\n";
-        $bad_options = 1;
-    }
-
-    if ($bad_options) {
-        print "Build will start in 5 seconds. Press command-. to stop\n";
-        
-        DelayFor(5);
-    }
-}
-
-#//--------------------------------------------------------------------------------------------------
-#// GenBuildSystemInfo
-#//--------------------------------------------------------------------------------------------------
-
-sub GenBuildSystemInfo()
-{
-    # always rebuild the configuration program.
-    BuildProjectClean(":mozilla:build:mac:tools:BuildSystemInfo:BuildSystemInfo.mcp", "BuildSystemInfo");
-
-    # delete the configuration file.
-    unlink(":mozilla:build:mac:BuildSystemInfo.pm");
-    
-    # run the program.
-    system(":mozilla:build:mac:BuildSystemInfo");
-
-    # wait for the file to be created.
-    while (!(-e ":mozilla:build:mac:BuildSystemInfo.pm")) { WaitNextEvent(); }
-    
-    # wait for BuildSystemInfo to finish, so that we see correct results.
-    while (IsProcessRunning("BuildSystemInfo")) { WaitNextEvent(); }
-
-    # now, evaluate the contents of the file.
-    open(F, ":mozilla:build:mac:BuildSystemInfo.pm");
-    while (<F>) { eval; }
-    close(F);
-}
-
-#//--------------------------------------------------------------------------------------------------
-#// Make library aliases
-#//--------------------------------------------------------------------------------------------------
-
-sub MakeLibAliases()
-{
-    my($dist_dir) = GetBinDirectory();
-
-    #// ProfilerLib
-    if ($main::PROFILE)
-    {
-        my($profilerlibpath) = Moz::CodeWarriorLib::getCodeWarriorPath("MacOS Support:Profiler:Profiler Common:ProfilerLib");
-        MakeAlias("$profilerlibpath", "$dist_dir"."Essential Files:");
-    }
-}
-
-#//--------------------------------------------------------------------------------------------------
-#// ConfigureBuildSystem
-#//
-#// defines some build-system configuration variables.
-#//--------------------------------------------------------------------------------------------------
-sub ConfigureBuildSystem()
-{
-    #// In the future, we may want to do configurations based on the actual build system itself.
-    #// GenBuildSystemInfo();
-        
-    #// For now, if we discover a newer header file than existed in Universal Interfaces 3.2,
-    #// we'll assume that 3.3 or later is in use.
-    my($universal_interfaces) = Moz::CodeWarriorLib::getCodeWarriorPath("MacOS Support:Universal:Interfaces:CIncludes:");
-    if (-e ($universal_interfaces . "ControlDefinitions.h")) {
-        $main::UNIVERSAL_INTERFACES_VERSION = 0x0330;
-    }
-
-    #// Rename IC SDK folder in the Mac OS Support folder
-    my($ic_sdk_folder) = Moz::CodeWarriorLib::getCodeWarriorPath("MacOS Support:ICProgKit2.0.2");
-    if( -e $ic_sdk_folder)
-    {
-        my($new_ic_folder_name) = Moz::CodeWarriorLib::getCodeWarriorPath("MacOS Support:(ICProgKit2.0.2)");
-        rename ($ic_sdk_folder, $new_ic_folder_name);
-        # note that CodeWarrior doesn't descend into folders with () the name
-        print "Mozilla no longer needs the Internet Config SDK to build:\n  Renaming the 'ICProgKit2.0.2' folder to '(ICProgKit2.0.2)'\n";
-    }
-
-    printf("UNIVERSAL_INTERFACES_VERSION = 0x%04X\n", $main::UNIVERSAL_INTERFACES_VERSION);
-
-    # alias required CodeWarrior libs into the Essential Files folder (only the Profiler lib now)
-    MakeLibAliases();
-}
-
-
-#//--------------------------------------------------------------------------------------------------
-#// CheckOutModule. Takes variable number of args; first two are required
-#//--------------------------------------------------------------------------------------------------
-sub CheckOutModule($$$$)
-{
-    my($session, $module, $revision, $date) = @_;
-
-    my($result) = $session->checkout($module, $revision, $date);
-    
-    # result of 1 is success
-    if ($result) { return; }
-    
-    my($checkout_err) = $session->getLastError();
-    if ($checkout_err == 708) {
-        die "Error: Checkout was cancelled.\n";
-    } elsif ($checkout_err == 911) {
-        die "Error: CVS session settings are incorrect. Check your password, and the CVS root settings.\n";
-    } elsif ($checkout_err == 703) {
-        die "Error: CVS checkout failed. Unknown module, unknown tag, bad username, or other CVS error.\n";
-    } elsif ($checkout_err == 711) {
-        print "Checkout of '$module' failed.\n";
-    }
-}
-
-#//--------------------------------------------------------------------------------------------------
-#// getScriptFolder
-#//--------------------------------------------------------------------------------------------------
-sub getScriptFolder()
-{
-    return dirname($0);
-}
-
-
-#//--------------------------------------------------------------------------------------------------
-#// getScriptFolder
-#//--------------------------------------------------------------------------------------------------
-sub get_url_contents($)
-{
-    my($url) = @_;
-
-    my($url_contents) = LWP::Simple::get($url);
-    $url_contents =~ s/\r\n/\n/g;     # normalize linebreaks
-    $url_contents =~ s/\r/\n/g;       # normalize linebreaks
-    return $url_contents;
-}
-
-#//--------------------------------------------------------------------------------------------------
-#// get_files_from_content
-#//--------------------------------------------------------------------------------------------------
-sub uniq
-{
-    my $lastval;
-    grep(($_ ne $lastval, $lastval = $_)[$[], @_);
-}
-
-
-#//--------------------------------------------------------------------------------------------------
-#// get_files_from_content
-#//--------------------------------------------------------------------------------------------------
-sub get_files_from_content($)
-{
-    my($content) = @_;
-  
-    my(@jscalls) = grep (/return js_file_menu[^{]*/, split(/\n/, $content));
-    my $i;
-  
-    for ($i = 0; $i < @jscalls ; $i++)
-    {
-        $jscalls[$i] =~ s/.*\(|\).*//g;
-        my(@callparams) = split(/,/, $jscalls[$i]);
-        my ($repos, $dir, $file, $rev) = grep(s/['\s]//g, @callparams);
-        $jscalls[$i] = "$dir/$file";
-    }
-
-  &uniq(sort(@jscalls));
-}
-
-#//--------------------------------------------------------------------------------------------------
-#// getLastUpdateTime
-#// 
-#// Get the last time we updated. Return 0 on failure
-#//--------------------------------------------------------------------------------------------------
-sub getLastUpdateTime($)
-{
-    my($timestamp_file) = @_;
- 
-    my($time_string);
-    
-    local(*TIMESTAMP_FILE);  
-    unless (open(TIMESTAMP_FILE, "< $timestamp_file")) { return 0; }
-
-    while (<TIMESTAMP_FILE>)
-    {
-        my($line) = $_;
-        chomp($line);
-
-        # ignore comments and empty lines
-        if ($line =~ /^\#/ || $line =~ /^\s*$/) {
-            next;
-        }
-        
-        $time_string = $line;
-    }
-
-    # get the epoch seconds
-    my($last_update_secs) = $time_string;
-    $last_update_secs =~ s/\s#.+$//;
-    
-    print "FAST_UPDATE found that you last updated at ".localtime($last_update_secs)."\n";
-    
-    # how long ago was this, in hours?
-    my($gm_now) = time();
-    my($update_hours) = 1 + ceil(($gm_now - $last_update_secs) / (60 * 60));
-    
-    return $update_hours;
-}
-
-
-#//--------------------------------------------------------------------------------------------------
-#// saveCheckoutTimestamp
-#// 
-#// Create a file on disk containing the current time. Param is time(), which is an Epoch seconds
-#// (and therefore in GMT).
-#// 
-#//--------------------------------------------------------------------------------------------------
-sub saveCheckoutTimestamp($$)
-{
-    my($gm_secs, $timestamp_file) = @_;
-        
-    local(*TIMESTAMP_FILE);
-    open(TIMESTAMP_FILE, ">$timestamp_file") || die "Failed to open $timestamp_file\n";
-    print(TIMESTAMP_FILE "# time of last checkout or update, in GMT. Used by FAST_UPDATE\n");
-    print(TIMESTAMP_FILE "$gm_secs \# around ".localtime()." local time\n");
-    close(TIMESTAMP_FILE);
-
-}
-
-#//--------------------------------------------------------------------------------------------------
-#// FastUpdate
-#// 
-#// Use Bonsai url data to update only those dirs which have new files
-#// 
-#//--------------------------------------------------------------------------------------------------
-sub FastUpdate($$)
-{
-    my($modules, $timestamp_file) = @_;          # list of modules to check out
-
-    my($num_hours) = getLastUpdateTime($timestamp_file);
-    if ($num_hours == 0 || $num_hours > 170) {
-        print "Can't fast_update; last update was too long ago, or never. Doing normal checkout.\n";
-        return 0;
-    }
-
-    print "Doing fast update, pulling files changed in the last $num_hours hours\n";
-
-    my($cvsfile) = AskAndPersistFile($main::filepaths{"sessionpath"});
-    my($session) = Moz::MacCVS->new( $cvsfile );
-    unless (defined($session)) { die "Error: Checkout aborted. Cannot create session file: $session" }
-
-    # activate MacCVS
-    ActivateApplication('Mcvs');
-    
-    my($checkout_start_time) = time();
-
-    #print "Time now is $checkout_start_time ($checkout_start_time + 0)\n";
-    
-    my($this_co);
-    foreach $this_co (@$modules)
-    {
-        my($module, $revision, $date) = ($this_co->[0], $this_co->[1], $this_co->[2]);        
-        
-        # assume that things pulled by date wont change
-        if ($date ne "") {
-            print "$module is pulled by date, so ignoring in FastUpdate.\n";
-            next;
-        }
-
-        my($search_type) = "hours";
-        my($min_date) = "";
-        my($max_date) = "";
-        my($url) = "http://bonsai.mozilla.org/cvsquery.cgi?treeid=default&module=${module}&branch=${revision}&branchtype=match&dir=&file=&filetype=match&who=&whotype=match&sortby=Date&hours=${num_hours}&date=${search_type}&mindate=${min_date}&maxdate=${max_date}&cvsroot=%2Fcvsroot";
-
-        if ($revision eq "") {
-            print "Getting list of checkins to $module from Bonsai...\n";
-        } else {
-            print "Getting list of checkins to $module on branch $revision from Bonsai...\n";
-        }
-        my(@files) = &get_files_from_content(&get_url_contents($url));
-
-        if ($#files > 0)
-        {
-           my(@cvs_co_list);
-        
-           my($co_file);
-           foreach $co_file (@files)
-           {
-               print "Updating $co_file\n";
-               push(@cvs_co_list, $co_file);
-           }
-
-            my($result) = $session->update($revision, \@cvs_co_list);
-            # result of 1 is success
-            if (!$result) { die "Error: Fast update failed\n"; }
-        } else {
-            print "No files in this module changed\n";        
-        }
-    }
-    
-    saveCheckoutTimestamp($checkout_start_time, $timestamp_file);
-    return 1;
-}
-
-
-#//--------------------------------------------------------------------------------------------------
-#// Checkout
-#//--------------------------------------------------------------------------------------------------
-sub CheckoutModules($$$)
-{
-    my($modules, $pull_date, $timestamp_file) = @_;          # list of modules to check out
-
-    my($start_time) = TimeStart();
-
-#    assertRightDirectory();
-    my($cvsfile) = AskAndPersistFile($main::filepaths{"sessionpath"});
-    my($session) = Moz::MacCVS->new( $cvsfile );
-    unless (defined($session)) { die "Error: Checkout aborted. Cannot create session file: $session" }
-
-    my($checkout_start_time) = time();
-    
-    # activate MacCVS
-    ActivateApplication('Mcvs');
-
-    my($this_co);
-    foreach $this_co (@$modules)
-    {
-        my($module, $revision, $date) = ($this_co->[0], $this_co->[1], $this_co->[2]);
-        if ($date eq "") {
-            $date = $pull_date;
-        }
-        CheckOutModule($session, $module, $revision, $date);
-        # print "Checking out $module with ref $revision, date $date\n";
-    }
-
-    saveCheckoutTimestamp($checkout_start_time, $timestamp_file);
-    TimeEnd($start_time, "Checkout");
-}
-
-#//--------------------------------------------------------------------------------------------------
-#// ReadCheckoutModulesFile
-#//--------------------------------------------------------------------------------------------------
-sub ReadCheckoutModulesFile($$)
-{
-    my($modules_file, $co_list) = @_;
-
-    my($checkout_file) = getScriptFolder().":".$modules_file;
-    local(*CHECKOUT_FILE);  
-    open(CHECKOUT_FILE, "< $checkout_file") || die "Error: failed to open checkout list $checkout_file\n";
-    while (<CHECKOUT_FILE>)
-    {
-        my($line) = $_;
-        chomp($line);
-    
-        # ignore comments and empty lines
-        if ($line =~ /^\#/ || $line =~ /^\s*$/) {
-            next;
-        }
-    
-        my(@cvs_co) = ["", "", ""];
-        
-        my($module, $revision, $date) = (0, 1, 2);
-        
-        if ($line =~ /\s*([^#,\s]+)\s*\,\s*([^#,\s]+)\s*\,\s*([^#]+)/)
-        {
-            @cvs_co[$module] = $1;
-            @cvs_co[$revision] = $2;
-            @cvs_co[$date] = $3;
-        }
-        elsif ($line =~ /\s*([^#,\s]+)\s*\,\s*([^#,\s]+)\s*(#.+)?/)
-        {
-            @cvs_co[$module] = $1;
-            @cvs_co[$revision] = $2;
-        }
-        elsif ($line =~ /\s*([^#,\s]+)\s*\,\s*,\s*([^#,]+)/)       
-        {
-            @cvs_co[$module] = $1;
-            @cvs_co[$date] = $2;
-        }
-        elsif ($line =~ /\s*([^#,\s]+)/)
-        {
-            @cvs_co[$module] = $1;
-        }
-        else
-        {
-            die "Error: unrecognized line '$line' in $modules_file\n";
-        }
-        
-        # strip surrounding space from date
-        @cvs_co[$date] =~ s/^\s*|\s*$//g;
-        
-        # print "Going to check out '@cvs_co[$module]', '@cvs_co[$revision]', '@cvs_co[$date]'\n";
-        push(@$co_list, \@cvs_co);
-    }
-
-    close(CHECKOUT_FILE);
-}
-
-#//--------------------------------------------------------------------------------------------------
-#// PullFromCVS
-#//--------------------------------------------------------------------------------------------------
-sub PullFromCVS($$)
-{
-    unless ( $main::build{pull} ) { return; }
-    
-    my($modules_file, $timestamp_file) = @_;
-
-    StartBuildModule("pull");
-    
-    my(@cvs_co_list);
-    ReadCheckoutModulesFile($modules_file, \@cvs_co_list);
-
-    if ($main::FAST_UPDATE && $main::options{pull_by_date})
-    {
-        die "Error: you can't use FAST_UPDATE if you are pulling by date.\n";
-    }
-
-    my($did_fast_update) = $main::FAST_UPDATE && FastUpdate(\@cvs_co_list, $timestamp_file);
-    if (!$did_fast_update)
-    {
-        my($pull_date) = "";
-        if ($main::options{pull_by_date})
-        {
-            # acceptable CVS date formats are (in local time):
-            # ISO8601 (e.g. "1972-09-24 20:05") and Internet (e.g. "24 Sep 1972 20:05").
-            # Perl's localtime() string format also seems to work.
-            $pull_date = localtime().""; # force string interp.
-            print "Pulling by date $pull_date\n";
-        }
-
-        CheckoutModules(\@cvs_co_list, $pull_date, $timestamp_file);
-    }
-
-    EndBuildModule("pull");
-}
-
-
-#//--------------------------------------------------------------------------------------------------
-#// RunBuild
-#//--------------------------------------------------------------------------------------------------
-sub RunBuild($$$$)
-{
-    my($do_pull, $do_build, $input_files, $build_prefs) = @_;
-
-    InitBuildProgress($input_files->{"buildprogress"});
-    
-    # if we are pulling, we probably want to do a full build, so clear the build progress
-    if ($do_pull) {
-        ClearBuildProgress();    
-    }
-    
-    # read local prefs, and the build progress file, and set flags to say what to build
-    SetupBuildParams(\%main::build,
-                     \%main::options,
-                     \%main::optiondefines,
-                     \%main::filepaths,
-                     $input_files->{"buildflags"},
-                     $build_prefs);
-    
-    # If we were told to pull, make sure we do, overriding prefs etc.
-    if ($do_pull)
-    {
-        $main::build{"pull"} = 1;
-    }
-    
-    # transfer this flag
-    $CodeWarriorLib::CLOSE_PROJECTS_FIRST = $main::CLOSE_PROJECTS_FIRST;
-    
-    # setup the build log
-    SetupBuildLog($main::filepaths{"buildlogfilepath"}, $main::USE_TIMESTAMPED_LOGS);
-    StopForErrors();
-    
-    if ($main::LOG_TO_FILE) {
-        RedirectOutputToFile($main::filepaths{"scriptlogfilepath"});
-    }
-        
-    # run a pre-build check to see that the tools etc are in order
-    DoPrebuildCheck();
-    
-    # do the pull
-    PullFromCVS($input_files->{"checkoutdata"}, $input_files->{"checkouttime"});
-    
-    unless ($do_build) { return; }
-
-    my($build_start) = TimeStart();
-
-    # check the build environment
-    ConfigureBuildSystem();
-
-    # here we load and call methods in the build module indirectly.
-    # we have to use indirection because the build module can be named
-    # differently for different builds.
-    chdir(dirname($0));     # change to the script dir
-    my($build_module) = $input_files->{"buildmodule"};
-    # load the build module
-    require $build_module;
-    {   # scope for no strict 'refs'
-        no strict 'refs';
-        
-        my($package_name) = $build_module;
-        $package_name =~ s/\.pm$//;
-        
-        chdir($main::MOZ_SRC);
-        &{$package_name."::BuildDist"}();
-        
-        chdir($main::MOZ_SRC);
-        &{$package_name."::BuildProjects"}();
-    }
-    
-    # the build finished, so clear the build progress state
-    ClearBuildProgress();
-    
-    TimeEnd($build_start, "Build");
-    print "Build complete\n";
-}
-
-1;

mozilla/build/mac/build_scripts/Moz/BuildFlags.pm

@@ -1,425 +0,0 @@
-#!perl -w
-package Moz::BuildFlags;
-
-require 5.004;
-require Exporter;
-
-# Package that attempts to read a file from the Preferences folder,
-# and get build settings out of it
-
-use strict;
-use Exporter;
-
-use Cwd;
-use File::Basename;
-
-use Moz::Moz;
-use Moz::Prefs;
-
-use vars qw(@ISA @EXPORT);
-
-@ISA      = qw(Exporter);
-@EXPORT   = qw(
-                SetupBuildParams
-                InitBuildProgress
-                WriteBuildProgress
-                ClearBuildProgress
-                ReadBuildProgress
-              );
-
-
-my(@build_flags);
-my(@options_flags);
-my(@filepath_flags);
-
-my(%arrays_list) = (
-  "build_flags",    \@build_flags,
-  "options_flags",  \@options_flags,
-  "filepath_flags", \@filepath_flags
-);
-
-my($progress_file) = "¥ÊBuild progress";
-
-#-------------------------------------------------------------------------------
-# appendArrayFlag
-# 
-# Set a flag in the array
-#-------------------------------------------------------------------------------
-sub appendArrayFlag(@)
-{
-  my($array_name) = shift;
-  my($setting) = shift;
-  my($value) = shift;
-  
-  my(@optional_values);
-  foreach (@_) {
-    push(@optional_values, $_);
-  }
-
-  my(@this_flag) = [$setting, $value, @optional_values];
-  my($flags_array) = $arrays_list{$array_name};
-  if ($flags_array)
-  {
-    push(@{$flags_array}, @this_flag) || die "Failed to append\n";
-  }
-  else
-  {
-    die "Error: unknown build flags array $array_name\n";
-  }
-}
-
-#-------------------------------------------------------------------------------
-# readFlagsFile
-# 
-# Read the file of build flags from disk. File path is relative to the
-# script directory.
-#-------------------------------------------------------------------------------
-sub readFlagsFile($)
-{
-  my($flags_file) = @_;
-
-  my($file_path) = $0;
-  $file_path =~ s/[^:]+$/$flags_file/;
-  
-  print "Reading build flags from '$file_path'\n";
-
-  local(*FLAGS_FILE);
-  open(FLAGS_FILE, "< $file_path") || die "Error: failed to open flags file $file_path\n";
-
-  my($cur_array) = "";
-  
-  while(<FLAGS_FILE>)
-  {
-      my($line) = $_;
-      chomp($line);
-      
-      # ignore comments and empty lines  
-      if ($line =~ /^\#/ || $line =~ /^\s*$/) {
-        next;
-      }
-
-      # 1-word line, probably array name
-      if ($line =~ /^([^#\s]+)\s*$/)
-      {
-        $cur_array = $1;
-        next;  
-      }
-      elsif ($line =~ /^([^#\s]+)\s+\"(.+)\"(\s+#.+)?$/)    # quoted option, possible comment
-      {
-        my($flag) = $1;
-        my($setting) = $2;
-        
-        appendArrayFlag($cur_array, $flag, $setting);
-      }
-      elsif ($line =~ /^([^#\s]+)((\s+[^#\s]+)+)(\s+#.+)?$/)  # multiple word line, possible comment
-      {
-        my($flag) = $1;
-        
-        appendArrayFlag($cur_array, $flag, split(' ', $2));
-      }
-      else
-      {
-        die "Error: unknown build flag at '$line'\n";
-      }
-  
-  }
-  
-  close(FLAGS_FILE);
-}
-
-
-
-#-------------------------------------------------------------------------------
-# flagsArrayToHash
-# 
-# Utility routine to migrate flag from a 2D array to a hash, where
-# item[n][0] is the hash entry name, and item[n][1] is the hash entry value.
-#-------------------------------------------------------------------------------
-
-sub flagsArrayToHash($$)
-{
-  my($src_array, $dest_hash) = @_;
-  
-  my($item);
-  foreach $item (@$src_array)
-  {
-    $dest_hash->{$item->[0]} = $item->[1];
-  }
-}
-
-#-----------------------------------------------
-# printHash
-#
-# Utility routine to print a hash
-#-----------------------------------------------
-sub printHash($)
-{
-  my($hash_ref) = @_;
- 
-  print "Printing hash:\n";
-  
-  my($key, $value);
-  
-  while (($key, $value) = each (%$hash_ref))
-  {
-    print "  $key $value\n";
-  }
-}
-
-
-#-----------------------------------------------
-# printBuildArray
-#
-# Utility routine to print a 2D array
-#-----------------------------------------------
-sub printBuildArray($)
-{
-  my($build_array) = @_;
-  
-  my($entry);
-  foreach $entry (@$build_array)
-  {  
-    print "$entry->[0] = $entry->[1]\n";
-  }
-
-}
-
-#-------------------------------------------------------------------------------
-# SetBuildFlags
-#-------------------------------------------------------------------------------
-sub SetBuildFlags($)
-{
-  my($build) = @_;
-
-  flagsArrayToHash(\@build_flags, $build);
-}
-
-#-------------------------------------------------------------------------------
-# SetBuildOptions
-#-------------------------------------------------------------------------------
-sub SetBuildOptions($)
-{
-  my($options) = @_;
-
-  flagsArrayToHash(\@options_flags, $options);
-}
-
-#-------------------------------------------------------------------------------
-# SetFilepathFlags
-#-------------------------------------------------------------------------------
-sub SetFilepathFlags($)
-{
-  my($filepath) = @_;
-
-  flagsArrayToHash(\@filepath_flags, $filepath);
-}
-
-#-------------------------------------------------------------------------------
-# SetOptionDefines
-#-------------------------------------------------------------------------------
-sub SetOptionDefines($)
-{
-  my($optiondefines) = @_;
-
-  foreach my $entry (@options_flags)
-  {
-    if (defined($entry->[2])) {
-      $optiondefines->{$entry->[0]}{$entry->[2]} = 1;
-    }
-  }
-}
-
-
-#-------------------------------------------------------------------------------
-# PropagateAllFlags
-#-------------------------------------------------------------------------------
-sub PropagateAllFlags($)
-{
-  my($build_array) = @_;
-  
-  # if "all" is set, set all the flags to 1
-  unless ($build_array->[0][0] eq "all") { die "Error: 'all' must come first in the flags array\n"; }
-  
-  if ($build_array->[0][1] == 1)
-  {
-    my($index);
-    foreach $index (@$build_array)
-    {
-      $index->[1] = 1;
-    }
-  }
-}
-
-
-#//--------------------------------------------------------------------------------------------------
-#// _getBuildProgressFile
-#//--------------------------------------------------------------------------------------------------
-sub _getBuildProgressFile()
-{
-  return $progress_file;
-}
-
-
-#//--------------------------------------------------------------------------------------------------
-#// setBuildProgressStart
-#// 
-#// This automagically sets $build{"all"} to 0
-#//--------------------------------------------------------------------------------------------------
-sub setBuildProgressStart($$)
-{
-  my($build_array, $name) = @_;
-
-  my($index);
-  foreach $index (@$build_array)
-  {
-    $index->[1] = 0;
-    if ($index->[0] eq $name) {
-      last;
-    }    
-  }
-
-  print "Building from module after $name, as specified by build progress\n";
-}
-
-#//--------------------------------------------------------------------------------------------------
-#// InitBuildProgress
-#//--------------------------------------------------------------------------------------------------
-sub InitBuildProgress($)
-{
-  my($prog_file) = @_;
-  if ($prog_file ne "") {
-    $progress_file = full_path_to($prog_file);
-    print "Writing build progress to $progress_file\n";
-  }
-}
-
-#//--------------------------------------------------------------------------------------------------
-#// WriteBuildProgress
-#//--------------------------------------------------------------------------------------------------
-sub WriteBuildProgress($)
-{
-  my($module_built) = @_;
-
-  my($progress_file) = _getBuildProgressFile();
-  
-  if ($progress_file ne "")
-  {
-    open(PROGRESS_FILE, ">>$progress_file") || die "Failed to open $progress_file\n";
-    print(PROGRESS_FILE "$module_built\n");
-    close(PROGRESS_FILE);
-  }
-}
-
-
-#//--------------------------------------------------------------------------------------------------
-#// ClearBuildProgress
-#//--------------------------------------------------------------------------------------------------
-sub ClearBuildProgress()
-{
-  my($progress_file) = _getBuildProgressFile();
-  if ($progress_file ne "") {
-    unlink $progress_file;
-  }
-}
-
-#//--------------------------------------------------------------------------------------------------
-#// WipeBuildProgress
-#//--------------------------------------------------------------------------------------------------
-sub WipeBuildProgress()
-{
-  print "Ignoring build progress\n";
-  ClearBuildProgress();
-  $progress_file = "";
-}
-
-#//--------------------------------------------------------------------------------------------------
-#// ReadBuildProgress
-#//--------------------------------------------------------------------------------------------------
-sub ReadBuildProgress($)
-{
-  my($build_array) = @_;
-  my($progress_file) = _getBuildProgressFile();
-
-  my($last_module);
-  
-  if (open(PROGRESS_FILE, "< $progress_file"))
-  {
-    print "Getting build progress from $progress_file\n";
-    
-    while (<PROGRESS_FILE>)
-    {
-      my($line) = $_;
-      chomp($line);
-      $last_module = $line;
-    }
-    
-    close(PROGRESS_FILE);
-  }
-  
-  if ($last_module)
-  {
-    setBuildProgressStart($build_array, $last_module);
-  }
-}
-
-#-------------------------------------------------------------------------------
-# clearOldBuildSettings
-#-------------------------------------------------------------------------------
-sub clearOldBuildSettings($$$$)
-{
-  my($build, $options, $optiondefines, $filepaths) = @_;
-
-  # empty the arrays in case we're being called twice
-  @build_flags = ();
-  @options_flags = ();
-  @filepath_flags = ();
-  
-  # and empty the hashes
-  %$build = ();
-  %$options = ();
-  %$optiondefines = ();
-  %$filepaths = ();
-}
-
-#-------------------------------------------------------------------------------
-# SetupBuildParams
-#-------------------------------------------------------------------------------
-sub SetupBuildParams($$$$$$)
-{
-  my($build, $options, $optiondefines, $filepaths, $flags_file, $prefs_file) = @_;
-  
-  # Empty the hashes and arrays, to wipe out any stale data.
-  # Needed because these structures persist across two build scripts
-  # called using 'do' from a parent script.
-  clearOldBuildSettings($build, $options, $optiondefines, $filepaths);
-  
-  # Read from the flags file, which sets up the various arrays
-  readFlagsFile($flags_file);
-  
-  # If 'all' is set in the build array, propagate that to all entries
-  PropagateAllFlags(\@build_flags);
-  
-  # read the user pref file, that can change values in the array
-  ReadMozUserPrefs($prefs_file, \@build_flags, \@options_flags, \@filepath_flags);
-
-  # If build progress exists, this clears flags in the array up to a certain point
-  if ($main::USE_BUILD_PROGRESS) {
-    ReadBuildProgress(\@build_flags);
-  } else {
-    WipeBuildProgress();
-  }
-  
-#  printBuildArray(\@build_flags);
-#  printBuildArray(\@options_flags);
-  
-  SetBuildFlags($build);
-  SetBuildOptions($options);
-  SetOptionDefines($optiondefines);
-  SetFilepathFlags($filepaths);
-  
-#  printHash($build);
-#  printHash($options);
-}
-
-
-1;

mozilla/build/mac/build_scripts/Moz/BuildUtils.pm

@@ -1,786 +0,0 @@
-
-package Moz::BuildUtils;
-
-require 5.004;
-require Exporter;
-
-# Package that contains build util functions specific to the Mozilla build
-# process.
-
-use strict;
-use Exporter;
-
-use Cwd;
-use File::Path;
-use File::Basename;
-
-use Mac::Events;
-use Mac::StandardFile;
-
-use Moz::Moz;
-use Moz::BuildFlags;
-use Moz::MacCVS;
-#use Moz::ProjectXML;  #optional; required for static build only
-
-use vars qw(@ISA @EXPORT);
-
-@ISA      = qw(Exporter);
-@EXPORT   = qw(
-                SetupDefaultBuildOptions
-                SetupBuildRootDir
-                StartBuildModule
-                EndBuildModule
-                GetBinDirectory
-                BuildOneProjectWithOutput
-                BuildOneProject
-                BuildProject
-                BuildProjectClean
-                BuildIDLProject
-                BuildFolderResourceAliases
-                AskAndPersistFile
-                DelayFor
-                TimeStart
-                TimeEnd
-                EmptyTree
-                SetupBuildLog
-                SetBuildNumber
-                SetTimeBomb
-                UpdateConfigHeader
-              );
-
-#//--------------------------------------------------------------------------------------------------
-#// SetupDefaultBuildOptions
-#//--------------------------------------------------------------------------------------------------
-sub SetupDefaultBuildOptions($$$)
-{
-    my($debug, $bin_dir, $config_header_file_name) = @_;
-
-    # Here we set up defaults for the various build flags.
-    # If you want to override any of these, it's best to do
-    # so via the relevant preferences file, which lives in
-    # System Folder:Preferences:Mozilla build prefs:{build prefs file}.
-    # For the name of the prefs file, see the .pl script that you
-    # run to start this build. The prefs files are created when
-    # you run the build, and contain some documentation.
-    
-    #-------------------------------------------------------------
-    # configuration variables that globally affect what is built
-    #-------------------------------------------------------------
-    $main::DEBUG                  = $debug;
-    $main::PROFILE                = 0;
-    $main::RUNTIME                = 0;    # turn on to just build runtime support and NSPR projects
-    $main::GC_LEAK_DETECTOR       = 0;    # turn on to use GC leak detection
-    $main::MOZILLA_OFFICIAL       = 0;    # generate build number
-    $main::LOG_TO_FILE            = 0;    # write perl output to a file
-    
-    #-------------------------------------------------------------
-    # configuration variables that affect the manner of building, 
-    # but possibly affecting the outcome.
-    #-------------------------------------------------------------    
-    $main::ALIAS_SYM_FILES        = $main::DEBUG;
-    $main::CLOBBER_LIBS           = 1;      # turn on to clobber existing libs and .xSYM files before
-                                            # building each project                         
-    # The following two options will delete all dist files (if you have $main::build{dist} turned on),
-    # but leave the directory structure intact.
-    $main::CLOBBER_DIST_ALL       = 1;    # turn on to clobber all aliases/files inside dist (headers/xsym/libs)
-    $main::CLOBBER_DIST_LIBS      = 0;    # turn on to clobber only aliases/files for libraries/sym files in dist
-    $main::CLOBBER_IDL_PROJECTS   = 0;    # turn on to clobber all IDL projects.
-    $main::CLOBBER_PROJECTS       = 0;    # turn on to remove object code from each project before building it
-    
-    $main::UNIVERSAL_INTERFACES_VERSION = 0x0320;
-    
-    #-------------------------------------------------------------
-    # configuration variables that are preferences for the build,
-    # style and do not affect what is built.
-    #-------------------------------------------------------------
-    $main::CLOSE_PROJECTS_FIRST   = 0;
-                                    # 1 = close then make (for development),
-                                    # 0 = make then close (for tinderbox).
-    $main::USE_TIMESTAMPED_LOGS   = 0;
-    $main::USE_BUILD_PROGRESS     = 1;    # track build progress for restartable builds
-    #-------------------------------------------------------------
-    # END OF CONFIG SWITCHES
-    #-------------------------------------------------------------
-    
-    $main::BIN_DIRECTORY = $bin_dir;
-    $main::DEFINESOPTIONS_FILE = $config_header_file_name;
-}
-
-
-#//--------------------------------------------------------------------------------------------------
-#// SetupBuildRootDir
-#//--------------------------------------------------------------------------------------------------
-sub SetupBuildRootDir($)
-{
-    my($rel_path_to_script) = @_;
-
-    my($cur_dir) = cwd();
-    $cur_dir =~ s/$rel_path_to_script$//;
-    chdir($cur_dir) || die "Error: failed to set build root directory to '$cur_dir'.\nYou probably need to put 'mozilla' one level down (in a folder).\n";
-    $main::MOZ_SRC = cwd();
-}
-
-
-#//--------------------------------------------------------------------------------------------------
-#// StartBuildModule
-#//--------------------------------------------------------------------------------------------------
-sub StartBuildModule($)
-{
-    my($module) = @_;
-
-    print("---- Start of $module ----\n");
-}
-
-
-#//--------------------------------------------------------------------------------------------------
-#// EndBuildModule
-#//--------------------------------------------------------------------------------------------------
-sub EndBuildModule($)
-{
-    my($module) = @_;
-    WriteBuildProgress($module);
-    print("---- End of $module ----\n");
-}
-
-#--------------------------------------------------------------------------------------------------
-# GetBinDirectory
-#--------------------------------------------------------------------------------------------------
-sub GetBinDirectory()
-{
-    if ($main::BIN_DIRECTORY eq "") { die "Dist directory not set\n"; }
-    return $main::BIN_DIRECTORY;
-}
-
-#--------------------------------------------------------------------------------------------------
-# AskAndPersistFile stores the information about the user pick inside
-# the file $session_storage
-#--------------------------------------------------------------------------------------------------
-sub AskAndPersistFile($)
-{
-    my ($sessionStorage) = @_;
-    my $cvsfile;
-
-    if (( -e $sessionStorage) &&
-        open( SESSIONFILE, $sessionStorage ))
-    {
-    # Read in the path if available
-        $cvsfile = <SESSIONFILE>;
-        chomp $cvsfile;
-        close SESSIONFILE;
-        if ( ! -e $cvsfile )
-        {
-            print STDERR "$cvsfile has disappeared\n";
-            undef $cvsfile;
-        }
-    }
-    unless (defined ($cvsfile))
-    {
-        # make sure that MacPerl is a front process
-        ActivateApplication('McPL');
-        MacPerl::Answer("Could not find your MacCVS session file. Please choose one", "OK");
-        
-        # prompt user for the file name, and store it
-        my $macFile = StandardGetFile( 0, "McvD");  
-        if ( $macFile->sfGood() )
-        {
-            $cvsfile = $macFile->sfFile();
-            # save the choice if we can
-            if ( open (SESSIONFILE, ">" . $sessionStorage))
-            {
-                printf SESSIONFILE $cvsfile, "\n";
-                close SESSIONFILE;
-            }
-            else
-            {
-                print STDERR "Could not open storage file $sessionStorage for saving $cvsfile\n";
-            }
-        }
-    }
-    return $cvsfile;
-}
-
-
-#--------------------------------------------------------------------------------------------------
-# BuildIDLProject
-#
-#--------------------------------------------------------------------------------------------------
-
-sub BuildIDLProject($$)
-{
-    my ($project_path, $module_name) = @_;
-
-    if ($main::CLOBBER_IDL_PROJECTS)
-    {
-        my (@suffix_list) = (".mcp", ".xml");
-        my ($project_name, $project_dir, $suffix) = fileparse($project_path, @suffix_list);
-        if ($suffix eq "") { die "Error: Project, $project_path must end in .xml or .mcp\n"; }
-
-        my($datafolder_path);
-        if ($suffix eq ".xml")
-        {
-            $datafolder_path = $project_dir . "_" . $project_name . " Data:";
-        }
-        else {
-            $datafolder_path = $project_dir . $project_name . " Data:";
-        }
-
-        print STDERR "Deleting IDL data folder: $datafolder_path\n";
-        EmptyTree($datafolder_path);
-    }
-
-    BuildOneProject($project_path,  "headers", 0, 0, 0);
-    BuildOneProject($project_path,  $module_name.".xpt", 1, 0, 1);
-}
-
-
-#--------------------------------------------------------------------------------------------------
-# CreateStaticLibTargets
-#
-#--------------------------------------------------------------------------------------------------
-sub CreateXMLStaticLibTargets($)
-{
-    my($xml_path) = @_;
-
-    my (@suffix_list) = (".xml");
-    my ($project_name, $project_dir, $suffix) = fileparse($xml_path, @suffix_list);
-    if ($suffix eq "") { die "XML munging: $xml_path must end in .xml\n"; }
-
-    #sniff the file to see if we need to fix up broken Pro5-exported XML
-    print "Parsing $xml_path\n";
-    
-    my $ide_version = Moz::ProjectXML::SniffProjectXMLIDEVersion($xml_path);
-    if ($ide_version eq "4.0")
-    {
-        my $new_file = $project_dir.$project_name."2.xml";
-        
-        print "Cleaning up Pro 5 xml to $new_file\n";
-        
-        Moz::ProjectXML::CleanupPro5XML($xml_path, $new_file);
-
-        unlink $xml_path;
-        rename ($new_file, $xml_path);
-    }
-    
-    my $doc = Moz::ProjectXML::ParseXMLDocument($xml_path);
-    my @target_list = Moz::ProjectXML::GetTargetsList($doc);
-    my $target;
-    
-    my %target_hash;    # for easy lookups below
-    foreach $target (@target_list) { $target_hash{$target} = 1; }
-    
-    foreach $target (@target_list)
-    {
-        if ($target =~ /(.+).shlb$/)        # if this is a shared lib target
-        {
-            my $target_base = $1;
-            my $static_target = $target_base.".o";
-            
-            # ensure that this does not exist already
-            if ($target_hash{$static_target}) {
-                print "Static target $static_target already exists in project. Not making\n";
-                next;
-            }
-            
-            print "Making static target '$static_target' from target '$target'\n";
-
-            Moz::ProjectXML::CloneTarget($doc, $target, $static_target);
-            Moz::ProjectXML::SetAsStaticLibraryTarget($doc, $static_target, $static_target);
-        }
-    }
-    
-    print "Writing XML file to $xml_path\n";
-    my $temp_path = $project_dir."_".$project_name.".xml";
-    Moz::ProjectXML::WriteXMLDocument($doc, $temp_path, $ide_version);
-    Moz::ProjectXML::DisposeXMLDocument($doc);
-    
-    if (-e $temp_path)
-    {
-        unlink $xml_path;
-        rename ($temp_path, $xml_path);
-    }
-    else
-    {
-        die "Error: Failed to add new targets to XML project\n";
-    }
-}
-
-#//--------------------------------------------------------------------------------------------------
-#// ProcessProjectXML
-#// 
-#// Helper routine to allow for XML pre-processing. This should read in the XML, process it,
-#// and replace the original file with the processed version.
-#//--------------------------------------------------------------------------------------------------
-sub ProcessProjectXML($)
-{
-    my($xml_path) = @_;
-  
-    # we need to manually load Moz::ProjectXML, becaues not everyone will have the
-    # required perl modules in their distro.
-    my($cur_dir) = cwd();
-    
-    chdir(dirname($0));     # change to the script dir
-    eval "require Moz::ProjectXML";
-    if ($@) { die "Error: could not do Project XML munging because you do not have the correct XML modules installed. Error is:\n################\n $@################"; }
-    
-    chdir($cur_dir);
-    
-    CreateXMLStaticLibTargets($xml_path);
-}
-
-#//--------------------------------------------------------------------------------------------------
-#// Build one project, and make the alias. Parameters are project path, target name, shared  library
-#// name, make shlb alias (boolean), make xSYM alias (boolean), and is component (boolean).
-#//--------------------------------------------------------------------------------------------------
-
-sub BuildOneProjectWithOutput($$$$$$)
-{
-    my ($project_path, $target_name, $output_name, $alias_lib, $alias_xSYM, $component) = @_;
-
-    unless ($project_path =~ m/^$main::BUILD_ROOT.+/) { return; }
-
-    my (@suffix_list) = (".mcp", ".xml");
-    my ($project_name, $project_dir, $suffix) = fileparse($project_path, @suffix_list);
-    if ($suffix eq "") { die "Error: Project, $project_path must end in .xml or .mcp\n"; }
-    
-    my($dist_dir) = GetBinDirectory();
-    
-    # Put libraries in "Essential Files" folder, Components in "Components" folder
-    my($output_dir)  = $component ? "Components:" : "Essential Files:";
-    my($output_path) = $dist_dir.$output_dir;
-
-    if ($main::options{static_build})
-    {      
-      if ($output_name =~ /\.o$/ || $output_name =~ /\.[Ll]ib$/)
-      {
-        $alias_xSYM = 0;
-        $alias_lib  = 1;
-        $output_path = $main::DEBUG ? ":mozilla:dist:static_libs_debug:" : ":mozilla:dist:static_libs:";
-      }
-    }
-
-    # if the flag is on to export projects to XML, export and munge them
-    if ($main::EXPORT_PROJECTS && !($project_path =~ /IDL\.mcp$/))
-    {
-        my $xml_out_path = $project_path;
-
-        $xml_out_path =~ s/\.mcp$/\.xml/;
-
-        # only do this if project is newer?
-        if (! -e $xml_out_path)
-        {
-          ExportProjectToXML(full_path_to($project_path), full_path_to($xml_out_path));
-          ProcessProjectXML($xml_out_path);
-        }
-    }
-        
-    # if the flag is set to use XML projects, default to XML if the file 
-    # is present.
-    if ($main::USE_XML_PROJECTS && !($project_path =~ /IDL\.mcp$/))
-    {
-      my $xml_project_path = $project_dir.$project_name.".xml";
-      if (-e $xml_project_path)
-      {
-        $project_path = $xml_project_path;
-        $suffix = ".xml";
-      }
-    }
-    
-    if ($suffix eq ".xml")
-    {
-        my($xml_path) = $project_path;
-        # Prepend an "_" onto the name of the generated project file so it doesn't conflict
-        $project_path = $project_dir . "_" . $project_name . ".mcp";
-        my($project_modtime) = (-e $project_path ? GetFileModDate($project_path) : 0);
-        my($xml_modtime) = (-e $xml_path ? GetFileModDate($xml_path) : 0);
-
-        if ($xml_modtime > $project_modtime)
-        {
-            print("Importing $project_path from $project_name.xml.\n");
-            unlink($project_path);
-            # Might want to delete the "xxx.mcp Data" dir ???
-            ImportXMLProject(full_path_to($xml_path), full_path_to($project_path));
-        }
-    }
-
-
-    if ($main::CLOBBER_LIBS)
-    {
-        unlink "$project_dir$output_name";              # it's OK if these fail
-        unlink "$project_dir$output_name.xSYM";
-    }
-    
-    DoBuildProject($project_path, $target_name, $main::CLOBBER_PROJECTS);
-    
-    $alias_lib  ? MakeAlias("$project_dir$output_name",      "$output_path") : 0;
-    $alias_xSYM ? MakeAlias("$project_dir$output_name.xSYM", "$output_path") : 0;
-}
-
-#//--------------------------------------------------------------------------------------------------
-#// For compatiblity with existing scripts, BuildOneProject now just calls
-#// BuildOneProjectWithOutput, with the output name and target name identical.
-#// Note that this routine assumes that the target name and the shared libary name
-#// are the same.
-#//--------------------------------------------------------------------------------------------------
-
-sub BuildOneProject($$$$$)
-{
-    my ($project_path, $target_name, $alias_lib, $alias_xSYM, $component) = @_;
-    
-	BuildOneProjectWithOutput($project_path, $target_name, $target_name,
-							  $alias_lib, $alias_xSYM, $component);
-}
-
-#//--------------------------------------------------------------------------------------------------
-#// For compatiblity with existing scripts, BuildProject now just calls
-#// BuildOneProjectWithOutput, with the output name and target name identical.
-#// Note that this routine assumes that the target name and the shared libary name
-#// are the same. No aliases of the output are made.
-#//--------------------------------------------------------------------------------------------------
-
-sub BuildProject($$)
-{
-    my ($project_path, $target_name) = @_;
-    
-	BuildOneProjectWithOutput($project_path, $target_name, $target_name, 0, 0, 0);
-}
-
-#//--------------------------------------------------------------------------------------------------
-#// Identical to BuildProject but clobbers the project before building it.
-#//--------------------------------------------------------------------------------------------------
-
-sub BuildProjectClean($$)
-{
-    my ($project_path, $target_name) = @_;
-    my ($save_clobber_flag) = $main::CLOBBER_PROJECTS;
-    $main::CLOBBER_PROJECTS = 1;
-	BuildOneProjectWithOutput($project_path, $target_name, $target_name, 0, 0, 0);
-	$main::CLOBBER_PROJECTS = $save_clobber_flag;
-}
-
-#//--------------------------------------------------------------------------------------------------
-#// Make resource aliases for one directory
-#//--------------------------------------------------------------------------------------------------
-
-sub BuildFolderResourceAliases($$)
-{
-    my($src_dir, $dest_dir) = @_;
-        
-    # get a list of all the resource files
-    opendir(SRCDIR, $src_dir) || die("can't open $src_dir");
-    my(@resource_files) = readdir(SRCDIR);
-    closedir(SRCDIR);
-    
-    # make aliases for each one into the dest directory
-    print("Placing aliases to all files from $src_dir in $dest_dir\n");
-    for ( @resource_files )
-    {
-        next if $_ eq "CVS";
-        #print("    Doing $_\n");
-        if (-l $src_dir.$_)
-        {
-            print("     $_ is an alias\n");
-            next;
-        }
-        my($file_name) = $src_dir . $_; 
-        MakeAlias($file_name, $dest_dir);
-    }
-}
-
-
-#//--------------------------------------------------------------------------------------------------
-#// DelayFor
-#//
-#// Delay for the given number of seconds, allowing the script to be cancelled
-#//--------------------------------------------------------------------------------------------------
-
-sub DelayFor($)
-{
-  my($delay_secs) = @_;
-  
-  STDOUT->autoflush(1);
-  
-  my($end_time) = time() + $delay_secs;
-    
-  my($last_time) = 0;
-  my($cur_time) = time();
-  
-  while ($cur_time < $end_time)
-  {
-    $cur_time = time();
-    if ($cur_time > $last_time)
-    {
-      print ".";
-      $last_time = $cur_time;
-    }
-    
-    WaitNextEvent();
-  }
-
-  print "\n";
-  STDOUT->autoflush(0);
-}
-
-
-#//--------------------------------------------------------------------------------------------------
-#// TimeStart
-#//--------------------------------------------------------------------------------------------------
-sub TimeStart()
-{
-    return time();
-}
-
-#//--------------------------------------------------------------------------------------------------
-#// TimeEnd
-#//--------------------------------------------------------------------------------------------------
-sub TimeEnd($$)
-{
-    use integer;
-    
-    my($start_time, $operation_name) = @_;
-    my($end_time) = time();
-    
-    my($tot_sec) = $end_time - $start_time;
-    
-    my($seconds) = $tot_sec;
-    
-    my($hours) = $seconds / (60 * 60);
-    $seconds -= $hours * (60 * 60);
-    
-    my($minutes) = $seconds / 60;
-    $seconds -= $minutes * 60;
-        
-    print "$operation_name took $hours hours $minutes minutes and $seconds seconds\n";
-}
-
-#//--------------------------------------------------------------------------------------------------
-#// Remove all files from a tree, leaving directories intact (except "CVS").
-#//--------------------------------------------------------------------------------------------------
-
-sub EmptyTree($)
-{
-    my ($root) = @_; 
-    #print "EmptyTree($root)\n";
-    opendir(DIR, $root);
-    my $sub;
-    foreach $sub (readdir(DIR))
-    {
-        my $fullpathname = $root.$sub; # -f, -d only work on full paths
-
-        # Don't call empty tree for the alias of a directory.
-        # -d returns true for the alias of a directory, false for a broken alias)
-
-        if (-d $fullpathname)
-        {
-            if (-l $fullpathname)   # delete aliases
-            {
-                unlink $fullpathname;
-                next;
-            }
-            EmptyTree($fullpathname.":");
-            if ($sub eq "CVS")
-            {
-                #print "rmdir $fullpathname\n";
-                rmdir $fullpathname;
-            }
-        }
-        else
-        {
-            unless (unlink $fullpathname) { die "Failed to delete $fullpathname\n"; }
-        }
-    }
-    closedir(DIR);
-}
-
-
-#//--------------------------------------------------------------------------------------------------
-#// Recurse through a directory hierarchy, looking for MANIFEST files.
-#// Currently unused.
-#//--------------------------------------------------------------------------------------------------
-
-sub ScanForManifestFiles($$$$)
-{
-    my($dir, $theme_root, $theme_name, $dist_dir) = @_;
-
-    opendir(DIR, $dir) or die "Cannot open dir $dir\n";
-    my @files = readdir(DIR);
-    closedir DIR;
-
-    my $file;
-
-    foreach $file (@files)
-    {    
-        my $filepath = $dir.":".$file;
-
-        if (-d $filepath)
-        {
-            # print "Looking for MANIFEST files in $filepath\n";        
-            ScanForManifestFiles($filepath, $theme_root, $theme_name, $dist_dir);
-        }
-        elsif ($file eq "MANIFEST")
-        {
-            # print "Doing manifest file $filepath\n";
-
-            # Get the dest path from the first line of the file
-
-            open(MANIFEST, $filepath) || die "Could not open file $file";
-            # Read in the path if available
-            my($dest_line) = <MANIFEST>;
-            chomp $dest_line;
-            close MANIFEST;
-
-            $dest_line =~ s|^#!dest[\t ]+|| || die "No destination line found in $filepath\n";
-
-            my($dest_path) = $dist_dir."chrome:skins:$theme_name:$dest_line";
-            # print " Destination is $dest_path\n";
-
-            InstallResources($filepath, "$dest_path", 0);
-        }
-    }
-}
-
-
-#-----------------------------------------------
-# SetupBuildLog
-#-----------------------------------------------
-sub SetupBuildLog($$)
-{
-    my($logfile_path, $timestamped_log) = @_;
-    
-    my($logdir) = "";
-    my($logfile) = $logfile_path;
-    
-    if ($logfile_path =~ /(.+?:)([^:]+)$/)       # ? for non-greedy match
-    {
-        $logdir = $1;
-        $logfile = $2;
-        
-        mkpath($logdir);
-    }
-    
-    if ($timestamped_log)
-    {
-        #Use time-stamped names so that you don't clobber your previous log file!
-        my $now = localtime();
-        while ($now =~ s@:@.@) {} # replace all colons by periods
-        OpenErrorLog("${logdir}${now}");
-    }
-    else
-    {
-        OpenErrorLog("${logdir}${logfile}");
-    }
-}
-
-#-----------------------------------------------
-# SetBuildNumber
-#-----------------------------------------------
-sub SetBuildNumber($$)
-{
-    my($build_num_file, $files_to_touch) = @_;
-
-    # Make sure we add the config dir to search, to pick up mozBDate.pm
-    # Need to do this dynamically, because this module can be used before
-    # mozilla/config has been checked out.
-    
-    my ($inc_path) = $0;        # $0 is the path to the parent script
-    $inc_path =~ s/:build:mac:build_scripts:.+$/:config/;
-    push(@INC, $inc_path);
-
-    require mozBDate;
-    
-    mozBDate::UpdateBuildNumber($build_num_file, $main::MOZILLA_OFFICIAL);
-   
-    my($file);
-    foreach $file (@$files_to_touch)
-    {
-        print "Writing build number to $file from ${file}.in\n";
-        mozBDate::SubstituteBuildNumber($file, $build_num_file, "${file}.in");
-    }
-}
-
-#-----------------------------------------------
-# SetTimeBomb
-#-----------------------------------------------
-sub SetTimeBomb($$)		
-{
-  my ($warn_days, $bomb_days) = @_;
-  
-  system("perl :mozilla:config:mac-set-timebomb.pl $warn_days $bomb_days");
-}
-
-#//--------------------------------------------------------------------------------------------------
-#// Regenerate a configuration header file if necessary
-#//--------------------------------------------------------------------------------------------------
-sub UpdateConfigHeader($)
-{
-    my($config_path) = @_;
-    
-    my($config, $oldconfig) = ("", "");
-    my($define, $definevalue, $defines);
-    my($k, $l,);
-
-    foreach $k (keys(%main::options))
-    {
-        if ($main::options{$k})
-        {
-            foreach $l (keys(%{$main::optiondefines{$k}}))
-            {
-                $my::defines{$l} = $main::optiondefines{$k}{$l};
-                print "Setting up my::defines{$l}\n";
-            }
-        }
-    }
-
-    my $config_headerfile = current_directory().$config_path;
-    if (-e $config_headerfile)
-    {
-        open(CONFIG_HEADER, "< $config_headerfile") || die "$config_headerfile: $!\n";
-        my($line);
-        while ($line = <CONFIG_HEADER>)
-        {
-            if ($line =~ m/#define\s+([^\s]*)\s+([^\s]*)\s*\n/)
-            {
-                $define = $1;
-                $definevalue = $2;
-                
-                #canonicalize so that whitespace changes are not significant
-                my $canon_value = "#define " . $define . " " . $definevalue . "\n";
-                $oldconfig .= $canon_value;
-                
-                if (exists ($my::defines{$define}) and ($my::defines{$define} == $definevalue))
-                {
-                    delete $my::defines{$define};
-                    $config .= $canon_value;
-                }
-            }
-        }
-        close(CONFIG_HEADER);
-    }
-
-    if (%my::defines)
-    {
-        foreach $k (keys(%my::defines))
-        {
-            $config .= "#define " . $k . " " . $my::defines{$k} . "\n";
-        }
-    }
-
-    my $file_name = basename($config_headerfile);
-    if (($config ne $oldconfig) || (!-e $config_headerfile))
-    {
-        printf("Writing new configuration header $file_name\n");
-        open(CONFIG_HEADER, "> $config_headerfile") || die "$config_headerfile: $!\n";
-        print(CONFIG_HEADER "/* This file is auto-generated based on build options. Do not edit. */\n");
-        print CONFIG_HEADER ($config);
-        close(CONFIG_HEADER);
-
-        MacPerl::SetFileInfo("CWIE", "TEXT", $config_headerfile);
-    }
-    else
-    {
-        printf("Configuration header $file_name is up-to-date\n");
-    }
-}
-
-
-1;
-

mozilla/build/mac/build_scripts/Moz/CodeWarriorLib.pm

@@ -1,660 +0,0 @@
-#!perl
-package Moz::CodeWarriorLib;
-
-=pod
-
-=head1 NAME
-
-CodeWarriorLib - supply interface to CodeWarrior
-
-=head1 SYNOPSIS
-
-	#!perl
-	use CodeWarriorLib;
-	CodeWarriorLib::activate();
-	$had_errors = CodeWarriorLib::build_project(
-		$project_path, $target_name, $recent_errors_file, $clean_build
-	);
-
-=head1 DESCRIPTION
-
-Replaces the AppleScript library I<CodeWarriorLib>.
-
-=over 4
-
-=cut
-
-use strict;
-
-use Cwd;
-use File::Basename;
-
-use Mac::Types;
-use Mac::Events;
-use Mac::AppleEvents;
-use Mac::AppleEvents::Simple;
-use Mac::Processes;
-use Mac::MoreFiles;
-use Mac::StandardFile;
-
-
-use vars qw($VERSION);
-$VERSION = '1.02';
-
-my($app)  = 'CWIE';
-my($scriptDir) = cwd();         # could use $0 for this
-my($ide_loc_file) = "";
-
-# 0 == don't switch CWIE to front app in do_event(), 1 == do switch
-# note: activate() still switches when called
-$Mac::AppleEvents::Simple::SWITCH = 0;
-# $Mac::AppleEvents::Simple::WARN = 1;
-
-# supply your own path to the source here
-#_test('PowerPudgeIV:mozilla:mozilla:');
-
-# If you want to understand the gobbldeygook that's used to build Apple Events,
-# you should start by reading the AEGizmos documentation.
-
-=pod
-
-=item _get_project($full_path)
-
-A private routine returning a reference to the open project with the given name,
-or else the empty string (when that project is not open)
-
-full_path is a string identifying the project to be built and is of the form, 
-e.g., "HD:ProjectFolder:MyProject.mcp".  It must be supplied.
-
-=cut
-
-sub _get_project ($) {
-	my(
-		$full_path, $candidate_projects
-	) = @_;
-	$candidate_projects = _doc_named(basename($full_path, '*'));
-	if ($candidate_projects) {
-		my($cps) = _get_dobj($candidate_projects);
-		my($num) = AECountItems($cps);
-		if ($num) {  # is a list
-			foreach (1 .. AECountItems($cps)) {
-				my($cp) = AEGetNthDesc($cps, $_);
-				if (lc $full_path eq lc _full_path($cp)) {
-					return($cp);
-				}
-			}
-		} else {     # is only one, not a list
-			if (lc $full_path eq lc _full_path($cps)) {
-				return($cps);
-			}
-		}
-	}
-	return;
-}
-
-=pod
-
-=item build_project
-
-Build a selected target of a project, saving any errors to a file, if supplied.
-	
-full_path is a string identifying the project to be built and is of the form, 
-e.g., "HD:ProjectFolder:MyProject.mcp".  It must be supplied.
-
-If target_name is the empty string, the current target of the selected project 
-will be built, else, target_name should be a string matching a target name in 
-the selected project.
-	
-If error_path is the empty string, errors will not be saved to a file,
-else, error_path should be the full path of a file to save error messages into.
-
-=cut
-
-$CodeWarriorLib::CLOSE_PROJECTS_FIRST = 0; # If true we close then make. If false, make then close.
-my $last_project_built = "";
-my $last_project_was_closed = 0;
-
-sub build_project ($;$$$) {
-	my(
-		$full_path, $target_name, $error_path,
-		$remove_object, $p, $project_was_closed, $had_errors
-	) = @_;
-	_close_errors_window();
-
-	if ($CodeWarriorLib::CLOSE_PROJECTS_FIRST && ($last_project_built ne $full_path))
-	{
-		# If we're in "close first" mode, we don't close if the current project
-		# is the same as the previous one.
-		if ($last_project_was_closed) {
-			$p = _get_project($last_project_built);
-			_close($p);
-		}
-		$last_project_built = $full_path;
-		$last_project_was_closed = 0; # now refers to the new project
-	}
-	$project_was_closed = 0;
-	while (1) {
-		$p = _get_project($full_path);
-		if (!$p) {
-			if ($project_was_closed) {
-				print "### Error - request for project document failed after opening\n";
-				die "### possibly CW Pro 4 bug: be sure to close your Find window\n";
-			}
-			$project_was_closed = 1;
-			$last_project_was_closed = 1;
-			_open_file($full_path);
-		} else {
-			last;
-		}
-	}
-
-	$had_errors = 0;
-	if ($target_name eq '') {
-		if ($remove_object) {_remove_object($p)}
-		_build($p);
-	} else {
-		if ($remove_object) {_remove_object($p, $target_name)}
-		_build($p, $target_name);
-	}
-
-	if ($error_path ne '') {
-		_save_errors_window($error_path);
-	}
-	$had_errors = _close_errors_window();
-
-	if (!$CodeWarriorLib::CLOSE_PROJECTS_FIRST)
-	{
-		if ($project_was_closed) {
-			$p = _get_project($full_path);
-			_close($p);
-		}
-	}
-
-	return($had_errors);
-}
-
-=pod
-
-=item appIsRunning()
-
-=cut
-sub _appIsRunning($)
-{
-	my ($appSignature) = @_;
-	my ($psi);
-	my ($found) = 0;
-	my ($appPSN);
-
-	foreach $psi (values(%Process))
-	{
-		if ($psi->processSignature() eq $appSignature)
-		{
-			$appPSN = $psi->processNumber();
-			$found = 1;
-            last;
-		}
-	}
-	
-	return $found;
-}
-
-=pod
-
-=item appIsFrontmost()
-
-=cut
-sub _appIsFrontmost($)
-{
-	my ($appSignature) = @_;
-	my ($psi);
-	my ($found) = 0;
-	my ($appPSN);
-
-	foreach $psi (values(%Process))
-	{
-		if ($psi->processSignature() eq $appSignature)
-		{
-			$appPSN = $psi->processNumber();
-			$found = 1;
-            last;
-		}
-	}
-	
-	return (GetFrontProcess() == $appPSN);
-}
-
-
-=pod
-
-=item activate()
-
-Launches CodeWarrior and brings it to the front.
-
-Once found, path will be saved in $idepath_file for future reference.
-Edit or delete this file to change the location of the IDE.  If app is
-moved, C<activate()> will prompt for a new location.
-
-First looks for an open CodeWarrior app.  Second, tries to open previously
-saved location in ':idepath.txt'.  Third, tries to find it and allow user
-to choose it with Navigation Services (if present).  Fourth, uses good old
-GUSI routines built-in to MacPerl for a Choose Directory dialog box.
-
-=cut
-
-sub activate ($) {
-
-    $ide_loc_file = $_[0];     # save in global
-        
-	my($filepath, $appath, $psi) = ($ide_loc_file);
-
-	foreach $psi (values(%Process)) {
-		if ($psi->processSignature() eq $app) {
-			$appath = $psi->processAppSpec();
-			_save_appath($filepath, $appath);
-			last;
-		}
-	}
-
-	if (!$appath || !-x $appath) {
-		$appath = _read_appath($filepath);
-	}
-	
-	if (!$appath || ! -x $appath)
-	{
-		# make sure that MacPerl is a front process
-		#ActivateApplication('McPL');
-		MacPerl::Answer("Please locate the CodeWarrior application.", "OK");
-		
-		# prompt user for the file name, and store it
-		my $macFile = StandardGetFile( 0, "APPL");
-		if ( $macFile->sfGood() )
-		{
-			$appath = $macFile->sfFile();
-		}
-		else
-		{
-			die "Operation canceled\n";
-		}
-	
-#		if (eval {require Mac::Navigation}) {
-#			my($options, $nav);
-#			Mac::Navigation->import();
-#			$options = NavGetDefaultDialogOptions();
-#			$options->message('Where is CodeWarrior IDE?');
-#			$options->windowTitle('Find CodeWarrior IDE');
-#			$nav = NavChooseObject($Application{$app}, $options);
-#			die "CodeWarrior IDE not found.\n" if (!$nav || !$nav->file(1));
-#			$appath = $nav->file(1);
-#		} else {
-#			local(*D);
-#			my $cwd = `pwd`;
-#			$appath = _get_folder(
-#                               'Where is the CW IDE folder?',
-#				dirname($Application{$app})
-#			);
-#			die "CodeWarrior IDE not found.\n" if !$appath;
-#			opendir(D, $appath) or die $!;
-#			chdir($appath);
-#			foreach my $file (sort readdir (D)) {
-#				my(@app) = MacPerl::GetFileInfo($file);
-#				if ($app[0] && $app[1] &&
-#					$app[1] eq 'APPL' && $app[0] eq $app
-#				) {
-#					$appath .= $file;
-#					last;
-#				}
-#			}
-#			chomp($cwd);
-#			chdir($cwd);
-#		}
-		_save_appath($filepath, $appath);
-	}
-
-	my($lp) = LaunchParam->new(
-		launchAppSpec => $appath,
-		launchControlFlags => launchContinue() + launchNoFileFlags()
-	);
-	
-	unless (LaunchApplication($lp)) {
-		unlink($filepath);
-		die $^E;
-	}
-	
-	# wait for CodeWarrior to show up in the list of processes
-	while (!_appIsRunning('CWIE'))
-	{
-		WaitNextEvent();
-	}
-
-	# wait for CodeWarrior to come to the front
-	while (!_appIsFrontmost('CWIE'))
-	{
-		WaitNextEvent();
-	}
-}
-
-=pod
-
-=item getCodeWarriorPath()
-
-Returns a file path relative to the CodeWarrior folder
-
-=cut
-
-sub getCodeWarriorPath($)
-{
-    my($subfolder)=@_;
-    
-    my($app_path) = _read_appath($ide_loc_file);
-    if ($app_path eq "") { die "Error: Failed to get CodeWarrior IDE path\n"; }
-    
-    my($codewarrior_root) = $app_path;
-    $codewarrior_root =~ s/[^:]*$//;
-    return ($codewarrior_root . $subfolder);
-}
-
-
-=pod
-
-=item getCodeWarriorIDEName()
-
-Returns the name of the CodeWarrior application
-
-=cut
-
-sub getCodeWarriorIDEName()
-{
-    my($subfolder)=@_;
-
-    my($app_path) = _read_appath($ide_loc_file);
-    if ($app_path eq "") { die "Error: Failed to get CodeWarrior IDE path\n"; }
-
-    my(@codewarrior_path) = split(/:/, $app_path);
-    return pop(@codewarrior_path);
-}
-
-
-=pod
-
-=item quit()
-
-Quits CodeWarrior.
-
-=cut
-
-sub quit() {
-
-	$last_project_built = "";
-	$last_project_was_closed = 0;
-
-	my($evt) = do_event(qw/aevt quit/, $app);
-}
-
-
-sub _build ($;$) {
-	my($evt);
-	if ($_[1]) {
-		my($prm) =
-			q"'----':obj {form:name, want:type(TRGT), seld:TEXT(@), from:" .
-			AEPrint($_[0]) . '}';
-		$evt = do_event(qw/CWIE MAKE/, $app, $prm, $_[1]);
-	} else {
-		my($prm) = q"'----':" . AEPrint($_[0]);
-		$evt = do_event(qw/CWIE MAKE/, $app, $prm);
-	}
-}
-
-sub _remove_object ($;$) {
-	my($evt);
-	if ($_[1]) {
-		my($prm) =
-			q"'----':obj {form:name, want:type(TRGT), seld:TEXT(@), from:" .
-			AEPrint($_[0]) . '}';
-		$evt = do_event(qw/CWIE RMOB/, $app, $prm, $_[1]);
-	} else {
-		my($prm) = q"'----':" . AEPrint($_[0]);
-		$evt = do_event(qw/CWIE RMOB/, $app, $prm);
-	}
-}
-
-sub _open_file ($) {
-	my($prm) =
-		q"'----':obj {form:name, want:type(alis), " .
-		q"seld:TEXT(@), from:'null'()}";
-
-	do_event(qw/aevt odoc/, $app, $prm, $_[0]);
-}
-
-sub import_project ($$) {
-	my($xml_file, $project_path) = @_;
-	
-	my($prm) = "kocl:type(PRJD), rtyp:TEXT(@), data:TEXT(@), &subj:'null'()";
-	
-	my($evt) = do_event(qw/core crel/, $app, $prm, $project_path, $xml_file);    
-	my($result) = _get_event_result($evt);
-	
-	if ($result eq "") {
-		_close(_get_project($project_path));
-	}
-	return $result;
-}
-
-sub export_project ($$) {
-	my($project_path, $xml_out_path) = @_;
-	my($p, $project_was_closed);
-	
-	$project_was_closed = 0;
-	while (1) {
-		$p = _get_project($project_path);
-		if (!$p) {
-			if ($project_was_closed) {
-				print "### Error - request for project document failed after opening\n";
-				die "### possibly CW bug: be sure to close your Find window\n";
-}
-			$project_was_closed = 1;
-			_open_file($project_path);
-		} else {
-			last;
-		}
-	}
-
-    # avoid problems with the Project Messages window
-    _close_named_window("Project Messages");
-    
-	my($prm) =
-		q"'----':obj {form:indx, want:type(PRJD), " .
-		q"seld:1, from:'null'()}, kfil:TEXT(@)";
-
-	my($evt) = do_event(qw/CWIE EXPT/, $app, $prm, $xml_out_path);    
-	
-	if ($project_was_closed) {
-		$p = _get_project($project_path);
-		_close($p);
-	}
-	
-	return _get_event_result($evt);
-}
-
-sub _doc_named ($) {
-	my($prm) =
-		q"'----':obj {form:test, want:type(docu), from:'null'(), " .
-		q"seld:cmpd{relo:'=   ', 'obj1':obj {form:prop, want:type" .
-		q"(prop), seld:type(pnam), from:'exmn'()}, 'obj2':TEXT(@)}}";
-
-	my($evt) = do_event(qw/core getd/, $app, $prm, $_[0]);
-	return($evt->{REPLY} eq 'aevt\ansr{}' ? undef : $evt);
-}
-
-sub _full_path ($) {
-	my($obj) = $_[0];
-	my($prm) =
-		q"'----':obj {form:prop, want:type(prop), seld:type(FILE), " .
-		q"from:" . AEPrint($_[0]) . q"}, rtyp:type(TEXT)";
-	my($evt) = do_event(qw/core getd/, $app, $prm);
-
-	return MacPerl::MakePath(
-		MacUnpack('fss ', (
-			AEGetParamDesc($evt->{REP}, keyDirectObject()))->data()->get()
-		)
-	);
-}
-
-sub _save_errors_window ($) {
-	my($prm) = 
-		q"'----':obj {form:name, want:type(alis), seld:TEXT(@), from:'null'()}";
-	do_event(qw/MMPR SvMs/, $app, $prm, $_[0]);
-}
-
-
-sub _close_errors_window () {
-    return _close_named_window('Errors & Warnings');
-}
-
-
-sub _close_named_window ($) {
-    my($window_name) = @_;
-    
-	my($prm) =
-		q"'----':obj {form:name, want:type(cwin), " .
-		q"seld:TEXT(@), from:'null'()}";
-
-	my($evt) = do_event(qw/core clos/, $app, $prm, $window_name);
-	return($evt->{REPLY} eq 'aevt\ansr{}' ? 1 : 0);
-}
-
-sub _close () {
-	my($prm) = q"'----':" . AEPrint($_[0]);
-	do_event(qw/core clos/, $app, $prm);
-}
-
-sub _get_dobj ($) {
-	return(AEGetParamDesc($_[0]->{REP}, keyDirectObject()));
-}
-
-sub _get_folder ($$) {
-    require 'GUSI.ph';
-    my($prompt, $default) = @_;
-    MacPerl::Choose(
-        GUSI::AF_FILE(), 0, $prompt, '',
-        GUSI::CHOOSE_DIR() + ($default ? &GUSI::CHOOSE_DEFAULT : 0),
-        $default
-    );
-}
-
-sub _get_event_result ($)
-{
-    my($evt) = @_;
-
-    my($result) = $evt->{ERROR};
-    
-    if ( $result eq "" && $evt->{ERRNO} != 0 )
-    {
-        $result = "unknown error (".$evt->{ERRNO}.")";
-    }
-    
-    return $result;
-}
-
-
-sub _save_appath ($$) {
-
-	my($cwd) = cwd();	# remember the current working dir
-	chdir($scriptDir);	# change dir to the script dir
-
-	local(*F);
-	open(F, '>' . $_[0]) or die $!;
-	print F $_[1];
-	close(F);
-		
-	chdir($cwd);		# restore the cwd
-}
-
-sub _read_appath ($) {
-
-	my($filepath) = @_;
-
-	my($cwd) = cwd();	# remember the current working dir
-	chdir($scriptDir);	# change dir to the script dir
-	
-	if (! -e $filepath) {
-		return "";
-	}
-
-	local(*F);
-	open(F, $filepath);
-	my($appath) = <F>;
-	close(F);
-		
-	chdir($cwd);		# restore the cwd
-	return($appath);
-}
-
-
-sub _test ($) {
-	activate($ide_loc_file);
-	my($path) = $_[0];
-	build_project(
-	  "${path}modules:xml:macbuild:XML.mcp", '',
-	  "${path}build:mac:Mozilla.BuildLog.part"
-	);
-}
-
-1;
-
-=pod
-
-=back
-
-=head1 HISTORY
-
-=over 4
-
-=item v1.02, September 23, 1998
-
-Made fixes in finding and saving location of CodeWarrior IDE.
-
-=item v1.01, June 1, 1998
-
-Made fixes to C<chdir()> in C<activate()>, made C<activate()> more robust 
-in finding CodeWarrior IDE, added global variable to NOT switch to IDE
-for each sent event, a few other fixes.
-
-=item v1.00, May 30, 1998
-
-First shot
-
-=back
-
-
-=head1 AUTHORS
-
-Chris Nandor F<E<lt>pudge@pobox.comE<gt>>, and the author of the
-original I<CodeWarriorLib>, Scott Collins F<E<lt>scc@netscape.comE<gt>>.
-
-=head1 SEE ALSO
-
-BuildProject L<Moz>.
-
-=head1 COPYRIGHT
-
-The contents of this file are subject to the Netscape Public
-License Version 1.1 (the "License"); you may not use this file
-except in compliance with the License. You may obtain a copy of
-the License at http://www.mozilla.org/NPL/
-
-Software distributed under the License is distributed on an "AS
-IS" basis, WITHOUT WARRANTY OF ANY KIND, either express or
-implied. See the License for the specific language governing
-rights and limitations under the License.
-
-The Original Code is Mozilla Communicator client code, released
-March 31, 1998.
-
-The Initial Developer of the Original Code is Netscape
-Communications Corporation. Portions created by Netscape are
-Copyright (C) 1998-1999 Netscape Communications Corporation. All
-Rights Reserved.
-
-Contributor(s): 
-
-=cut

mozilla/build/mac/build_scripts/Moz/Jar.pm

@@ -1,576 +0,0 @@
-#!perl -w
-package Moz::Jar;
-
-#
-# Module for creating jar files, either using a jar manifest, or
-# simply jarring up folders on disk.
-#
-
-require 5.004;
-require Exporter;
-
-use strict;
-use Archive::Zip;
-use File::Path;
-
-use Mac::Files;
-
-use Moz::Moz;
-
-use vars qw( @ISA @EXPORT );
-
-@ISA        = qw(Exporter);
-@EXPORT     = qw(
-                    CreateJarFileFromDirectory
-                    CreateJarFromManifest
-                    WriteOutJarFiles
-                    SanityCheckJarOptions
-                );
-
-
-#-------------------------------------------------------------------------------
-# Add the contents of a directory to the zip file
-#
-#-------------------------------------------------------------------------------
-sub _addDirToJar($$$$)
-{
-    my($dir, $jar_root, $zip, $compress) = @_;
-
-    opendir(DIR, $dir) or die "Error: Cannot open dir $dir\n";
-    my @files = readdir(DIR);
-    closedir DIR;
-    
-    my $unix_jar_root = $jar_root;
-    $unix_jar_root =~ s|:|/|g;       # colon to slash conversion
-    
-    my $file;
-    
-    foreach $file (@files)
-    {        
-        my $filepath = $dir.":".$file;
-        
-        if (-d $filepath)
-        {
-            print "Adding files to jar from $filepath\n";            
-            _addDirToJar($filepath, $jar_root, $zip, $compress);
-        }
-        else
-        {
-            my $member = Archive::Zip::Member->newFromFile($filepath);
-            die "Error: Failed to create zip file member $filepath\n" unless $member;
-            
-            my $unixName = $filepath;
-            $unixName =~ s|:|/|g;               # colon to slash conversion
-            $unixName =~ s|^$unix_jar_root||;   # relativise
-            
-            $member->fileName($unixName);
-            
-            # print "Adding $file as $unixName\n";
-            
-            if ($compress) {
-                $member->desiredCompressionMethod(Archive::Zip::COMPRESSION_DEFLATED);            
-            } else {
-                $member->desiredCompressionMethod(Archive::Zip::COMPRESSION_STORED);
-            }
-            
-            $zip->addMember($member);
-        }
-    }
-}
-
-#-------------------------------------------------------------------------------
-# Add the contents of a directory to the zip file
-#
-#-------------------------------------------------------------------------------
-
-sub CreateJarFileFromDirectory($$$)
-{
-    my($srcdir, $jarpath, $compress) = @_;
-
-    my $zip = Archive::Zip->new();
-
-    _addDirToJar($srcdir, $srcdir, $zip, $compress);
-
-    print "Saving zip file...\n";
-    my $status = $zip->writeToFileNamed($jarpath);
-    if ($status == 0) {
-        print "Zipping completed successfully\n";
-    } else {
-        print "Error saving zip file\n";
-    }
-    
-    # set the file type/creator to something reasonable
-    MacPerl::SetFileInfo("ZIP ", "ZIP ", $jarpath);
-}
-
-
-#-------------------------------------------------------------------------------
-# printZipContents
-# 
-#-------------------------------------------------------------------------------
-sub printZipContents($)
-{
-    my($zip) = @_;
-
-    my(@members) = $zip->memberNames();
-    
-    print "Zip contains:\n";
-    
-    my($member);
-    foreach $member (@members)
-    {
-        print "  $member\n";
-    }
-}
-
-
-#-------------------------------------------------------------------------------
-# safeSaveJarFile
-# 
-# Archive::Zip has a problem where you cannot save a zip file on top of
-# an existing zip file that it has open, because it holds references
-# into that zip. So we have to save to a temp file, then do a swap.
-# 
-# Note that the zip will become invalid after this operation.
-# If you want to do further operations on it, you'll have to reread it.
-#-------------------------------------------------------------------------------
-sub safeSaveJarFile($$)
-{
-    my($zip, $full_dest_path) = @_;
-    
-    my($temp_file_name) = $full_dest_path."_temp";
-
-    ($zip->writeToFileNamed($temp_file_name) == Archive::Zip::AZ_OK) || die "Error: died writing jar to temp file $temp_file_name\n";
-    
-    unlink $full_dest_path;
-    
-    (rename $temp_file_name, $full_dest_path) || die "Error: Failed to rename $temp_file_name\n";
-    
-    MacPerl::SetFileInfo("ZIP ", "ZIP ", $full_dest_path);
-}
-
-
-#-------------------------------------------------------------------------------
-# addToJarFile
-# 
-# Add a file to a jar file
-#
-# Parameters:
-#   1. Jar ID. Unix path of jar file inside chrome.
-#   2. Abs path to jar.mn file (i.e. source)    (mac breaks)
-#   3. File source, relative to jar.mn path     (mac breaks)
-#   4. Abs path to the resulting .jar file      (mac breaks)
-#   5. Relative file path within the jar        (unix breaks)
-#   6. Reference to hash of jar files
-#
-#-------------------------------------------------------------------------------
-
-sub addToJarFile($$$$$$$)
-{
-    my($jar_id, $jar_man_dir, $file_src, $jar_path, $file_jar_path, $override, $jars) = @_;
-
-    # print "addToJarFile with:\n  $jar_man_dir\n  $file_src\n  $jar_path\n  $file_jar_path\n";
-
-    unless ($jar_path =~ m/(.+:)([^:]+)$/) { die "Error: Bad jar path $jar_path\n"; }
-    
-    my($target_dir) = $1;
-    my($jar_name) = $2;
-
-    $target_dir =~ s/[^:]+$//;
-    
-    # print "¥ $target_dir $jar_name\n";
-
-    # find the source file
-    my($src) = $jar_man_dir.":".$file_src;
-    if ((!-e $src) && ($file_src =~ m/.+:([^:]+)$/))    # src does not exist. Fall back to looking for src in jar.mn dir
-    {
-        $file_src = $1;
-        $src = $jar_man_dir.":".$file_src;
-        
-        if (!-e $src) {
-            die "Error: Can't find chrome file $src\n";
-        }
-    }
-    
-    if ($main::options{chrome_jars})
-    {
-        my($zip) = $jars->{$jar_id};
-        unless ($zip) { die "Error: Can't find Zip entry for $jar_id\n"; }
-        
-        # print "Adding $file_src to jar file $jar_path at $file_jar_path\n";
-        my($member) = Archive::Zip::Member->newFromFile($src);
-        unless ($member) { die "Error: Failed to create zip file member $src\n"; }
-
-        $member->fileName($file_jar_path);    
-    
-        my($compress) = 1;
-        if ($compress) {
-            $member->desiredCompressionMethod(Archive::Zip::COMPRESSION_DEFLATED);            
-            $member->desiredCompressionLevel(Archive::Zip::COMPRESSION_LEVEL_DEFAULT);   # defaults to 6
-        } else {
-            $member->desiredCompressionMethod(Archive::Zip::COMPRESSION_STORED);
-        }
-
-        my($old_member) = $zip->memberNamed($file_jar_path);
-        
-        if ($override)
-        {
-            if ($old_member)
-            {
-                # print "Overriding $file_jar_path in jar file $jar_id\n";
-                # need to compare mod dates or use the + here
-                $zip->removeMember($old_member);
-            }
-        
-            $zip->addMember($member);
-        }
-        else
-        {
-            if ($old_member)
-            {
-                #compare dates here
-                my($member_moddate) = $old_member->lastModTime();
-                my($file_moddate) = GetFileModDate($src);
-            
-                if ($file_moddate > $member_moddate)
-                {
-                    print "Updating older file $file_jar_path in $jar_id\n";
-                    $zip->removeMember($old_member);
-                    $zip->addMember($member);
-                }
-                else
-                {
-                    print "File $file_jar_path in $jar_id is more recent. Not updating.\n";
-                }
-            }
-            else
-            {
-                $zip->addMember($member);
-            }
-        }
-    }
-    
-    if ($main::options{chrome_files})  # we install raw files too
-    {
-        my($rel_path) = $file_jar_path;
-        $rel_path =~ s|/|:|g;       # slash to colons
-        
-        my($dir_name) = $jar_name;
-        $dir_name =~ s/\.jar$//;
-        
-        my($dst) = $target_dir.$dir_name.":".$rel_path;
-                
-        # print "Aliassing $src\n to\n$dst\n";        
-        if ($override)
-        {
-            unlink $dst;
-        MakeAlias($src, $dst);      # don't check errors, otherwise we fail on replacement
-    }
-        else
-        {
-            if (-e $dst)
-            {
-                #compare dates here
-                my($dst_moddate) = GetFileModDate($dst);
-                my($file_moddate) = GetFileModDate($src);
-            
-                if ($file_moddate > $dst_moddate)
-                {
-                    print "Updating older file $rel_path in $dir_name\n";
-                    unlink $dst;
-                    MakeAlias($src, $dst);
-                }
-                else
-                {
-                    print "File $file_jar_path in $jar_id is more recent. Not updating.\n";
-                }
-            
-            }
-            else
-            {
-                MakeAlias($src, $dst);
-            }
-        }
-        
-    }
-}
-
-
-#-------------------------------------------------------------------------------
-# setupJarFile
-# 
-# setup a zip for writing
-#-------------------------------------------------------------------------------
-
-sub setupJarFile($$$)
-{
-    my($jar_id, $dest_path, $jar_hash) = @_;
-
-    # print "Creating jar file $jar_id at $jar_path\n";
-    
-    my($jar_file) = $jar_id;
-    $jar_file =~ s|/|:|g;           # slash to colons
-    my($full_jar_path) = full_path_to($dest_path.":".$jar_file);
-
-    if ($main::options{chrome_jars})
-    {
-        my($zip) = $jar_hash->{$jar_id};
-        if (!$zip)      # if we haven't made it already, do so
-        {
-	        my($zip) = Archive::Zip->new();
-	        $jar_hash->{$jar_id} = $zip;
-
-            # does the jar file exist already? If so, read it in
-            if (-e $full_jar_path)
-            {
-                print "Reading in jar file $jar_id\n";
-                if ($zip->read($full_jar_path) != Archive::Zip::AZ_OK) { die "Error: Failed to re-read $full_jar_path\n"; }
-                
-                # printZipContents($zip);
-            }
-
-        }
-    }
-    else
-    {
-        # installing files.
-        # nothing to do. MakeAlias creates dirs as needed.
-
-	    # add this jar to the list
-	    $jar_hash->{$jar_id} = 1;
-    }
-}
-
-
-#-------------------------------------------------------------------------------
-# closeJarFile
-# 
-# We're done with this jar file _for this jar.mn_. We may add more entries
-# to it later, so keep it open in the hash.
-#-------------------------------------------------------------------------------
-sub closeJarFile($$)
-{
-    my($jar_path, $jar_hash) = @_;
-
-    # print "Closing jar file $jar_path\n";
-
-    if ($main::options{chrome_jars})
-    {
-    
-    }
-    else
-    {
-        # installing files.
-        # nothing to do
-    }
-}
-
-
-#-------------------------------------------------------------------------------
-# WriteOutJarFiles
-# 
-# Now we dump out the jars
-#-------------------------------------------------------------------------------
-sub WriteOutJarFiles($$)
-{
-    my($chrome_dir, $jars) = @_;
-
-    unless ($main::options{chrome_jars}) { return; }
-    
-    my($full_chrome_path) = full_path_to($chrome_dir);
-
-    my($key);
-    foreach $key (keys %$jars)
-    {
-        my($zip) = $jars->{$key};
-        
-        my($rel_path) = $key;
-        $rel_path =~ s/\//:/g;
-        
-        my($output_path) = $full_chrome_path.":".$rel_path;
-        
-        print "Writing zip file $key to $output_path\n";
-
-        # ensure the target dirs exist
-        my($path) = $output_path;
-        $path =~ s/[^:]+$//;
-        mkpath($path);
-        
-        # unlink $output_path;        # remove any existing jar
-        safeSaveJarFile($zip, $output_path);
-        # $zip is invalid after this operation, so nuke it here
-        $jars->{$key} = 0;
-    }
-}
-
-
-#-------------------------------------------------------------------------------
-# registerChromePackage
-# 
-# Enter a chrome package into the installed-chrome.txt file
-#-------------------------------------------------------------------------------
-sub registerChromePackage($$$$$$)
-{
-    my($jar_file, $file_path, $chrome_dir, $jar_hash, $chrome_type, $pkg_name) = @_;
-
-    my($manifest_subdir) = $jar_file;
-    $manifest_subdir =~ s/:/\//g;
-    
-    if (index($manifest_subdir, "-unix") == -1 && index($manifest_subdir, "-win") == -1) {
-
-    my($chrome_entry);
-    
-    if ($main::options{use_jars}) {
-        $chrome_entry = "$chrome_type,install,url,jar:resource:/chrome/$manifest_subdir!/$chrome_type/$pkg_name";
-    } else {
-        $manifest_subdir =~ s/\.jar$//;
-        $chrome_entry = "$chrome_type,install,url,resource:/chrome/$manifest_subdir/$chrome_type/$pkg_name";
-    }
-
-    # print "Entering $chrome_entry in installed-chrome.txt\n";
-    
-    # ensure chrome_dir exists
-    mkpath($chrome_dir);
-    
-    my($inst_chrome) = ${chrome_dir}.":installed-chrome.txt";
-    
-    if (open(CHROMEFILE, "<$inst_chrome")) {
-        while (<CHROMEFILE>) {
-            chomp;
-            if ($_ eq $chrome_entry) {
-                # $chrome_entry already appears in installed-chrome.txt file
-                # just update the mod date
-                my $now = time;
-                utime($now, $now, $inst_chrome) || die "Error: Couldn't touch $inst_chrome";
-                print "+++ updating chrome $inst_chrome\n+++\t\t$chrome_entry\n";
-                close(CHROMEFILE) || die "Error: can't close $inst_chrome: $!";
-                return 0;
-            }
-        }
-        close(CHROMEFILE) || die "Error: can't close $inst_chrome: $!";
-    }
-    open(CHROMEFILE, ">>${inst_chrome}") || die "Error: Failed to open $inst_chrome\n";
-    print(CHROMEFILE "${chrome_entry}\n");
-    close(CHROMEFILE) || die "Error: Failed to close $inst_chrome\n";
-    print "+++ adding chrome $inst_chrome\n+++\t\t$chrome_entry\n";
-  }
-}
-
-#-------------------------------------------------------------------------------
-# Create or add to a jar file from a jar.mn file.
-# Both arguments are relative to the mozilla root dir.
-#
-#
-#-------------------------------------------------------------------------------
-sub CreateJarFromManifest($$$)
-{
-    my($jar_man_path, $dest_path, $jars) = @_;
-    
-    if ($main::options{chrome_jars}) {
-        print "Jarring from $jar_man_path\n";
-    }
-    if ($main::options{chrome_files}) {
-        print "Installing files from $jar_man_path\n";
-    }
-
-    $jar_man_path = full_path_to($jar_man_path);
-    $dest_path = full_path_to($dest_path);
-
-    # if the jars hash is empty, nuke installed-chrome.txt
-    if (! scalar(%$jars))
-    {
-        print "Nuking installed-chrome.txt\n";
-	    my($installed_chrome) = $dest_path.":installed-chrome.txt";
-	    # unlink $installed_chrome;
-    }
-    
-    my $jar_man_dir = "";
-    my $jar_man_file = "";
-    
-    if ($jar_man_path =~ /(.+):([^:]+)$/)
-    {
-        $jar_man_dir = $1;      # no trailing :
-        $jar_man_file = $2;
-    }
-
-    # Keep a hash of jar files, keyed on relative jar path (e.g. "packages/core.jar")
-    # Entries are open Archive::Zips (if zipping), and installed-chrome entries.
-    
-    my($jar_id) = "";       # Current foo/bar.jar from jar.mn file
-    my($jar_file) = "";     # relative path to jar file (from $dest_path), with mac separators
-    my($full_jar_path);
-    
-    open(FILE, "<$jar_man_path") || die "Error: could not open \"$jar_man_path\": $!";
-    while (<FILE>)
-    {
-        my($line) = $_;
-        chomp($line);
-        
-        # print "$line\n";
-        
-        if ($line =~ /^\s*\#.*$/) {     # skip comments
-            next;
-        }
-        
-        if ($line =~/^([\w\d.\-\_\\\/]+)\:\s*$/)                                  # line start jar file entries
-        {
-            $jar_id = $1;
-            $jar_file = $jar_id;
-            $jar_file =~ s|/|:|g;           # slash to colons
-            $full_jar_path = $dest_path.":".$jar_file;
-                        
-            setupJarFile($jar_id, $dest_path, $jars);
-
-        }
-        elsif ($line =~ /^(\+?)\s+([\w\d.\-\_\\\/]+)\s*(\([\w\d.\-\_\\\/]+\))?$\s*/)     # jar file entry
-        {
-            my($override) = ($1 eq "+");
-            my($file_dest) = $2;
-            my($file_src) = $3;
- 
-            if ($file_src) {  
-                $file_src = substr($file_src, 1, -1);      #strip the ()
-            } else {
-                $file_src = $file_dest;
-            }
-            
-            $file_src =~ s|/|:|g;
-            
-            if ($jar_file ne "")    # if jar is open, add to jar
-            {
-                if ($file_dest =~ /([\w\d.\-\_]+)\/([\w\d.\-\_\\\/]+)contents.rdf/)
-                {
-                    my $chrome_type = $1;
-                    my $pkg_name = $2;
-                    registerChromePackage($jar_file, $file_dest, $dest_path, $jars, $chrome_type, $pkg_name);
-                }
-                
-                addToJarFile($jar_id, $jar_man_dir, $file_src, $full_jar_path, $file_dest, $override, $jars);
-            }
-            else
-            {
-                die "Error: bad jar.mn format at $line\n";
-            }
-        }
-        elsif ($line =~ /^\s*$/ )                                               # blank line
-        {
-            if ($jar_file ne "")    #if a jar file is open, close it
-            {
-                closeJarFile($full_jar_path, $jars);
-                
-                $jar_file = "";
-                $full_jar_path = "";
-            }
-        }
-    }
-    
-    close(FILE);
-
-    if ($jar_file ne "")    #if a jar file is open, close it
-    {
-        closeJarFile($full_jar_path, $jars);
-    }
-
-}
-
-1;

mozilla/build/mac/build_scripts/Moz/MacCVS.pm

@@ -1,228 +0,0 @@
-#!perl -w
-package Moz::MacCVS;
-
-# package Mac::Apps::MacCVS; this should really be the name of the package
-# but due to our directory hierarchy in mozilla, I am not doing it
-
-require 5.004;
-require Exporter;
-
-use strict;
-use Exporter;
-
-use vars qw($VERSION @ISA @EXPORT);
-
-use Cwd;
-
-use File::Basename;
-
-use Mac::StandardFile;
-use Mac::AppleEvents;
-use Mac::AppleEvents::Simple;
-
-@ISA        = qw(Exporter);
-@EXPORT     = qw(new describe checkout update);
-$VERSION = "1.00";
-
-# If you want to understand the gobbldeygook that's used to build Apple Events,
-# you should start by reading the AEGizmos documentation.
-
-
-# Architecture:
-# cvs session object:
-# name - session name
-# session_file - session file
-# 
-# 
-
-my($last_error) = 0;
-my($gAppSig)    = 'Mcvs';   # MacCVS Pro
-
-#
-# utility routines
-#
-
-
-sub _checkForEventError($)
-{
-  my($evt) = @_;
-
-  if ($evt->{ERRNO} != 0)
-  {
-    print STDERR "Error. Script returned '$evt->{ERROR} (error $evt->{ERRNO})\n";
-    $last_error = $evt->{ERRNO};
-    return 0;
-  }
-  
-  return 1; # success
-}
-
-
-#
-# Session object methods
-#
-
-sub new
-{
-  my ( $proto, $session_file) = @_;
-  my $class = ref($proto) || $proto;
-  my $self = {};
-
-  if ( defined($session_file) && ( -e $session_file) )
-  {
-    $self->{"name"} = basename( $session_file );
-    $self->{"session_file"} = $session_file;
-    bless $self, $class;
-    return $self;
-  }
-  else
-  {
-    print STDERR "MacCVS->new cvs file < $session_file > does not exist\n";
-    return;
-  }
-}
-
-# makes sure that the session is open
-# assertSessionOpen()
-# returns 1 on success
-sub assertSessionOpen()
-{
-  my ($self) = shift;
-
-  $last_error = 0;
-
-  my($prm) =
-    q"'----':obj {form:name, want:type(alis), seld:TEXT(@), from:'null'()}";
-
-  my($evt) = do_event(qw/aevt odoc/, $gAppSig, $prm, $self->{session_file});
-  return _checkForEventError($evt);
-}
-
-# prints the cvs object, used mostly for debugging
-sub describe
-{
-  my($self) = shift;
-  $last_error = 0;
-  print "MacCVS:: name: ", $self->{name}, " session file: ", $self->{session_file}, "\n";
-}
-
-# checkout( self, module, revision, date)
-# MacCVS checkout command
-# returns 1 on success.
-sub checkout()
-{
-  my($self, $module, $revision, $date ) = @_;
-  unless( defined ($module) ) { $module = ""; } # get rid of the pesky undefined warnings
-  unless( defined ($revision) ) { $revision = ""; }
-  unless( defined ($date) ) { $date = ""; }
-
-  $last_error = 0;
-    
-  $self->assertSessionOpen() || die "Error: failed to open MacCVS session file at $self->{session_file}\n";
-  
-  my($revstring) = ($revision ne "") ? $revision : "(none)";
-  my($datestring) = ($date ne "") ? $date : "(none)";
-  
-  print "Checking out $module with revision $revstring, date $datestring\n";
-
-  my($prm) =
-    q"'----':obj {form:name, want:type(docu), seld:TEXT(@), from:'null'()}, ".
-    q"modl:'TEXT'(@), tagr:'TEXT'(@), tagd:'TEXT'(@) ";
-  
-  my($evt) = do_event(qw/MCvs cout/, $gAppSig, $prm, $self->{name}, $module, $revision, $date);
-  return _checkForEventError($evt);
-}
-
-
-# update( self, branch tag, list of paths)
-# MacCVS udate command
-# returns 1 on success.
-# NOTE: MacCVS Pro does not correctly support this stuff yet (as of version 2.7d5).
-sub update()
-{
-  my($self, $branch, $paths ) = @_;
-
-  $last_error = 0;
-    
-  $self->assertSessionOpen() || die "Error: failed to open MacCVS session file at $self->{session_file}\n";
-
-  if ($branch eq "HEAD") {
-    $branch = "";
-  }
-  
-  my($paths_list) = "";
-  
-  my($path);
-  foreach $path (@$paths)
-  {
-    if ($paths_list ne "") {
-      $paths_list = $paths_list.", ";
-    }
-    
-    $paths_list = $paths_list."Ò".$path."Ó";
-  }
-    
-  my($prm) =
-    q"'----':obj {form:name, want:type(docu), seld:TEXT(@), from:'null'()}, ".
-    q"tagr:'TEXT'(@), tFls:[";
-
-  $prm = $prm.$paths_list."]";
-    
-  my($evt) = do_event(qw/MCvs updt/, $gAppSig, $prm, $self->{name}, $branch);
-  return _checkForEventError($evt);
-};
-
-
-sub getLastError()
-{
-  return $last_error;
-}
-
-1;
-=pod
-
-=head1 NAME
-
-MacCVS - Interface to MacCVS
-
-=head1 SYNOPSIS
-
-  use MacCVS;
-  $session = MacCVS->new( <session_file_path>) || die "cannot create session";
-  $session->checkout([module] [revision] [date]) || die "Could not check out";
-    
-=head1 DESCRIPTION
-
-This is a MacCVS interface for talking to MacCVS Pro client.
-MacCVSSession is the class used to manipulate the session
-
-=item new
-  MacCVS->new( <cvs session file path>);
-  
-  Creates a new session. Returns undef on failure.
-
-=item checkout( <module> [revision] [date] )
-
-  cvs checkout command. Revision and date are optional
-  returns 0 on failure
-  
-=cut
-
-=head1 SEE ALSO
-
-=over
-
-=item MacCVS Home Page
-
-http://www.maccvs.org/
-
-=back 
-
-=head1 AUTHORS
-
-Aleks Totic atotic@netscape.com
-Simon Fraser sfraser@netscape.com
-
-=cut
-
-__END__

mozilla/build/mac/build_scripts/Moz/Moz.pm

@@ -1,603 +0,0 @@
-=head1 NAME
-
-B<Moz> - routines for automating CodeWarrior builds, and some extra-curricular
-activities related to building Mozilla
-
-=head1 SYNOPSIS
-
-    use Moz;
-
-    OpenErrorLog(":::BuildLog");
-    StopForErrors();
-
-		$Moz::QUIET = 1;
-		InstallFromManifest(":projects:MANIFEST", $dist_dir);
-
-    BuildProjectClean(":projects:SomeProject.mcp", "SomeTarget");
-    MakeAlias(":projects:SomeProject.shlb", $dist_dir);
-
-    DontStopForErrors();
-
-    BuildProject(":projects:SomeOtherProject.mcp", "SomeTarget");
-
-=head1 DESCRIPTION
-
-B<Moz> comprises the routines needed to slap CodeWarrior around, force it
-to build a sequence of projects, report the results, and a few other things.
-This module should only contain functions that are generic to any build,
-not just the Mozilla build.
-
-=cut
-
-
-package			Moz::Moz;
-require			Exporter;
-
-use Cwd;
-
-use File::Copy;
-use File::Path;
-use File::Basename;
-
-use Mac::Types;
-use Mac::Events;
-use Mac::Processes;
-
-use ExtUtils::Manifest 'maniread';
-
-use Moz::CodeWarriorLib;
-
-@ISA				= qw(Exporter);
-
-@EXPORT			= qw( LaunchCodeWarrior
-                  GetCodeWarriorRelativePath
-                  current_directory
-                  full_path_to
-                  DoBuildProject
-                  ImportXMLProject
-                  ExportProjectToXML
-                  OpenErrorLog
-                  MakeAlias
-                  GetFileModDate
-                  StopForErrors
-                  DontStopForErrors
-                  InstallFromManifest
-                  InstallResources
-                  RedirectOutputToFile
-                  Delay
-                  ActivateApplication
-                  IsProcessRunning);
-
-@EXPORT_OK	= qw(CloseErrorLog QUIET);
-
-
-sub current_directory()
-	{
-		my $current_directory = cwd();
-		chop($current_directory) if ( $current_directory =~ m/:$/ );
-		return $current_directory;
-	}
-
-sub full_path_to($)
-	{
-		my ($path) = @_;
-		if ( $path =~ m/^[^:]+$/ )
-			{
-				$path = ":" . $path;
-			}
-
-		if ( $path =~ m/^:/ )
-			{
-				$path = current_directory() . $path;
-			}
-
-		return $path;
-	}
-
-$logging								= 0;
-$recent_errors_file			= "";
-$stop_on_1st_error			= 1;
-$QUIET									= 0;
-
-
-
-=head2 Logging all the errors and warnings - C<OpenErrorLog($log_file)>, C<CloseErrorLog()>
-
-The warnings and errors generated in the course of building projects can be logged to a file.
-Tinderbox uses this facility to show why a remote build failed.
-
-Logging is off by default.
-  Start logging at any point in your build process with C<OpenErrorLog($log_file)>.
-  Stop with C<CloseErrorLog()>.
-  You never need to close the log explicitly, unless you want to just log a couple of projects in the middle of a big list.
-  C<CloseErrorLog()> is not exported by default. 
-
-=cut
-
-sub CloseErrorLog()
-	{
-		if ( $logging )
-			{
-				close(ERROR_LOG);
-				$logging = 0;
-				StopForErrors() if $stop_on_1st_error;
-			}
-	}
-
-
-
-sub OpenErrorLog($)
-	{
-		my ($log_file) = @_;
-
-		CloseErrorLog();
-		if ( $log_file )
-			{
-				$log_file = full_path_to($log_file);
- 
-				open(ERROR_LOG, ">$log_file") || die "Error: Can't open $log_file\n";
-				MacPerl::SetFileInfo("CWIE", "TEXT", $log_file);
-
-				$log_file =~ m/.+:(.+)/;
-				$recent_errors_file = full_path_to("$1.part");
-				$logging = 1;
-			}
-	}
-
-
-=head2 Stopping before it's too late - C<StopForErrors()>, C<DontStopForErrors()>
-
-When building a long list of projects, you decide whether to continue building subsequent projects when one fails.
-  By default, your build script will C<die> after the first project that generates an error while building.
-  Change this behavior with C<DontStopForErrors()>.
-  Re-enable it with C<StopForErrors()>.
-
-=cut
-
-sub StopForErrors()
-	{
-		$stop_on_1st_error = 1;
-		
-			# Can't stop for errors unless we notice them.
-			# Can't notice them unless we are logging.
-			# If the user didn't explicitly request logging, log to a temporary file.
-
-		if ( ! $recent_errors_file )
-			{
-				OpenErrorLog("${TMPDIR}BuildResults");
-			}
-	}
-
-sub DontStopForErrors()
-	{
-		$stop_on_1st_error = 0;		
-	}
-
-sub log_message($)
-	{
-		if ( $logging )
-			{
-				my ($message) = @_;
-				print ERROR_LOG $message;
-			}
-	}
-
-sub log_message_with_time($)
-	{
-		if ( $logging )
-			{
-				my ($message) = @_;
-				my $time_stamp = localtime();
-				log_message("$message ($time_stamp)\n");
-			}
-	}
-
-sub log_recent_errors($)
-	{
-		my ($project_name) = @_;
-		my $found_errors = 0;
-	
-		if ( $logging )
-			{
-				open(RECENT_ERRORS, "<$recent_errors_file");
-
-				while( <RECENT_ERRORS> )
-					{
-						if ( /^Error/ || /^CouldnÕt find project file/ || /^Link Error/ )
-							{
-#								if (!$found_errors)
-#									print $_;
-								$found_errors = 1;
-							}
-						print ERROR_LOG $_;
-					}
-
-				close(RECENT_ERRORS);
-				unlink("$recent_errors_file");
-			}
-		
-		if ( $stop_on_1st_error && $found_errors )
-			{
-				print ERROR_LOG "### Build failed.\n";
-				die "### Errors encountered building \"$project_name\".\n";
-			}
-	}
-	
-sub DoBuildProject($$$)
-	{
-		my ($project_path, $target_name, $clean_build) = @_;
-		$project_path = full_path_to($project_path);
-
-#		$project_path =~ m/.+:(.+)/;
-#		my $project_name = $1;
-
-		log_message_with_time("### Building \"$project_path\"");
-
-			# Check that the given project exists
-		if (! -e $project_path)
-			{
-				print ERROR_LOG "### Build failed.\n";
-				die "### Can't find project file \"$project_path\".\n";
-			}
-		
-		print "Building \"$project_path\[$target_name\]\"\n";
-		
-		$had_errors = Moz::CodeWarriorLib::build_project(
-			$project_path, $target_name, $recent_errors_file, $clean_build
-		);
-		WaitNextEvent();
-
-#		$had_errors =
-#MacPerl::DoAppleScript(<<END_OF_APPLESCRIPT);
-#	tell (load script file "$CodeWarriorLib") to BuildProject("$project_path", "$project_name", "$target_name", "$recent_errors_file", $clean_build)
-#END_OF_APPLESCRIPT
-
-			# Append any errors to the globally accumulated log file
-#		if ( $had_errors ) # Removed this test, because we want warnings, too.  -- jrm
-			{
-				log_recent_errors($project_path);
-			}
-	}
-
-
-sub ImportXMLProject($$)
-{
-    my ($xml_path, $project_path) = @_;
-
-#    my ($codewarrior_ide_name) = Moz::CodeWarriorLib::getCodeWarriorIDEName();
-#    my $ascript = <<EOS;
-#      tell application "$codewarrior_ide_name"
-#        make new (project document) as ("$project_path") with data ("$xml_path")
-#      end tell
-#EOS
-#    print $ascript."\n";
-#    my($result) = MacPerl::DoAppleScript($ascript);
-#    unless ($result) { die "Error: ImportXMLProject AppleScript failed $^E $result\n";  }
-#    
-
-    my($import_error) = Moz::CodeWarriorLib::import_project($xml_path, $project_path);
-    if ($import_error ne "") {
-      die "Error: ImportXMLProject failed with error $import_error\n";
-    }
-}
-
-sub ExportProjectToXML($$)
-{
-    my ($project_path, $xml_path) = @_;
-
-    my (@suffix_list) = (".mcp");
-    my ($project_name, $project_dir, $suffix) = fileparse($project_path, @suffix_list);
-    if ($suffix eq "") { die "Project: $project_path doesn't look like a project file.\n"; }
-    
-    if (-e $xml_path) {
-        print "$xml_path exists - not exporting $project_path\n";
-    }
-    else {
-        print "Exporting $project_path to $xml_path\n";
-        my($export_error) = Moz::CodeWarriorLib::export_project($project_path, $xml_path);
-        if ($export_error ne "") {
-            die "Error: export_project failed with error '$export_error'\n";
-        }
-        
-        if (! -e $xml_path) {
-          die "Error: XML export to $xml_path failed\n";
-        }
-    }
-}
-
-
-=head2 Miscellaneous
-
-C<MakeAlias($old_file, $new_file)> functions like C<symlink()>, except with better argument defaulting and more explicit error messages.
-
-=cut
-
-sub MakeAlias($$)
-	{
-		my ($old_file, $new_file) = @_;
-
-			# if the directory to hold $new_file doesn't exist, create it
-		if ( ($new_file =~ m/(.+:)/) && !-d $1 )
-			{
-				mkpath($1);
-			}
-
-			# if a leaf name wasn't specified for $new_file, use the leaf from $old_file
-		if ( ($new_file =~ m/:$/) && ($old_file =~ m/.+:(.+)/) )
-			{
-				$new_file .= $1;
-			}
-
-		my $message = "Can't create a Finder alias (at \"$new_file\")\n for \"$old_file\"; because ";
-
-		die "Error: $message \"$old_file\" doesn't exist.\n" unless -e $old_file;
-		die "Error: $message I won't replace an existing (non-alias) file with an alias.\n" if ( -e $new_file && ! -l $new_file );
-
-			# now: $old_file exists; $new_file doesn't (or else, is an alias already)
-
-		if ( -l $new_file )
-			{
-					# ...then see if it already points to $old_file
-				my $current_target	= full_path_to(readlink($new_file));
-				my $new_target			= full_path_to($old_file);
-
-				return if ( $current_target eq $new_target );
-					# if the desired alias already exists and points to the right thing, then we're done
-				
-				unlink $new_file;
-			}
-		
-		symlink($old_file, $new_file) || die "Error: $message symlink returned an unexpected error.\n";
-	}
-	
-	
-=pod
-
-C<InstallFromManifest()>
-
-=cut
-
-sub InstallFromManifest($;$$)
-	{
-		my ($manifest_file, $dest_dir, $flat) = @_;
-		
-		$flat = 0 unless defined($flat); # if $flat, all rel. paths in MANIFEST get aliased to the root of $dest_dir
-
-		$dest_dir ||= ":";
-
-		$manifest_file =~ m/(.+):/;
-		my $source_dir =  $1;
-
-		chop($dest_dir) if $dest_dir =~ m/:$/;
-
-		#Mac::Events->import();
-		WaitNextEvent();
-		if ($flat)
-		{
-			print "Doing manifest on \"$manifest_file\" FLAT\n" unless $QUIET;
-		}
-		else
-		{
-			print "Doing manifest on \"$manifest_file\"\n" unless $QUIET;
-		}
-		
-		my $read = maniread(full_path_to($manifest_file));
-		foreach $file (keys %$read)
-			{
-				next unless $file;
-
-				$subdir = ":";
-				if (!$flat && ($file =~ /:.+:/ ))
-					{
-						$subdir = $&;
-					}
-
-				$file = ":$file" unless $file =~ m/^:/;
-				MakeAlias("$source_dir$file", "$dest_dir$subdir");
-			}
-	}
-
-
-=pod
-
-C<InstallResources()>
-
-=cut
-
-# parameters are path to MANIFEST file, destination dir, true (to make copies) or false (to make aliases)
-sub InstallResources($;$;$)
-	{
-		my ($manifest_file, $dest_dir, $copy_files) = @_;
-
-		$dest_dir ||= ":";
-		mkpath($dest_dir) if !-d $dest_dir;
-
-		$manifest_file =~ m/(.+):/;
-		my $source_dir =  $1;
-
-		chop($dest_dir) if $dest_dir =~ m/:$/;
-
-		WaitNextEvent();
-		print "Installing resources from \"$manifest_file\"\n" unless $QUIET;
-		
-		my $read = maniread(full_path_to($manifest_file));
-		foreach $file (keys %$read)
-			{
-				next unless $file;
-				
-				if ($copy_files)
-					{
-						copy("$source_dir:$file", "$dest_dir:$file");
-					}
-				else
-					{
-						MakeAlias("$source_dir:$file", "$dest_dir:$file");
-					}
-			}
-	}
-
-
-#//--------------------------------------------------------------------------------------------------
-#// Delay
-#//--------------------------------------------------------------------------------------------------
-sub Delay($)		
-{
-  my ($delay_seconds) = @_;
-
-  $now = time;
-  
-  $exit_time = $now + $delay_seconds;
-
-  while ($exit_time > $now) {
-     $now = time;
-  }
-	
-}
-
-#//--------------------------------------------------------------------------------------------------
-#// GetFileModDate
-#//--------------------------------------------------------------------------------------------------
-sub GetFileModDate($)
-{
-    my($filePath)=@_;
-    my($dev,$ino,$mode,$nlink,$uid,$gid,$rdev,$size,
-        $atime,$mtime,$ctime,$blksize,$blocks) = stat($filePath);
-    return $mtime;
-}
-
-
-#//--------------------------------------------------------------------------------------------------
-#// LaunchCodeWarrior
-#//--------------------------------------------------------------------------------------------------
-sub LaunchCodeWarrior($)
-{
-  my($idepath_file) = @_;   # full path to IDE location file
-  my($cur_dir) = cwd();
-  
-  # this both launches and writes the IDE path file
-  Moz::CodeWarriorLib::activate($idepath_file);
-  
-  chdir($cur_dir);
-}
-
-#//--------------------------------------------------------------------------------------------------
-#// GetCodeWarriorRelativePath
-#//--------------------------------------------------------------------------------------------------
-sub GetCodeWarriorRelativePath($)
-{
-  my($rel_path) = @_;
-  return Moz::CodeWarriorLib::getCodeWarriorPath($rel_path);
-}
-
-
-#//--------------------------------------------------------------------------------------------------
-#// RedirectOutputToFile
-#//--------------------------------------------------------------------------------------------------
-sub RedirectOutputToFile($)
-{
-    my($log_file) = @_;
-    
-    # ensure that folders in the path exist
-    my($logdir) = "";
-    my($logfile) = $log_file;
-    
-    if ($log_file =~ /(.+?:)([^:]+)$/)       # ? for non-greedy match
-    {
-        $logdir = $1;
-        $logfile = $2;
-        
-        mkpath($logdir);
-    }
-
-    print "Output is now being redirected to the file '$log_file'\n";
-    
-    open(STDOUT, "> $log_file") || die "Can't redirect stdout";
-    open(STDERR, ">&STDOUT") || die "Can't dup stdout";
-    select(STDERR); $| = 1;     # make unbuffered
-    select(STDOUT); $| = 1;     # make unbuffered
-    
-    MacPerl::SetFileInfo("CWIE", "TEXT", $log_file);
-}
-
-#//--------------------------------------------------------------------------------------------------
-#// ActivateApplication
-#//--------------------------------------------------------------------------------------------------
-
-sub ActivateApplication($)
-{
-	my ($appSignature) = @_;
-	my ($psi, $found);
-	my ($appPSN);
-	
-	$found = 0;
-		
-	foreach $psi (values(%Process))
-	{
-		if ($psi->processSignature() eq $appSignature)
-		{
-			$appPSN = $psi->processNumber();
-			$found = 1;
-            last;
-		}
-	}
-
-	if ($found == 0 || SameProcess($appPSN, GetFrontProcess()))
-	{
-		return;
-	}
-
-	SetFrontProcess($appPSN);
-
-	while (GetFrontProcess() != $appPSN)
-	{
-		WaitNextEvent();
-	}
-}
-
-#//--------------------------------------------------------------------------------------------------
-#// IsProcessRunning
-#//--------------------------------------------------------------------------------------------------
-
-sub IsProcessRunning($)
-{
-    my($processName, $psn, $psi) = @_;
-    while ( ($psn, $psi) = each(%Process) ) {
-     if ($psi->processName eq $processName) { return 1; }
-    }
-    return 0;
-}
-
-
-1;
-
-=head1 AUTHORS
-
-Scott Collins <scc@netscape.com>, Simon Fraser <sfraser@netscape.com>, Chris Yeh <cyeh@netscape.com>
-
-=head1 SEE ALSO
-
-BuildMozillaDebug.pl (et al), BuildList.pm, CodeWarriorLib (an AppleScript library)
-
-=head1 COPYRIGHT
-
-The contents of this file are subject to the Netscape Public
-License Version 1.1 (the "License"); you may not use this file
-except in compliance with the License. You may obtain a copy of
-the License at http://www.mozilla.org/NPL/
-
-Software distributed under the License is distributed on an "AS
-IS" basis, WITHOUT WARRANTY OF ANY KIND, either express or
-implied. See the License for the specific language governing
-rights and limitations under the License.
-
-The Original Code is Mozilla Communicator client code, released
-March 31, 1998.
-
-The Initial Developer of the Original Code is Netscape
-Communications Corporation. Portions created by Netscape are
-Copyright (C) 1998-1999 Netscape Communications Corporation. All
-Rights Reserved.
-
-Contributor(s): 
-
-=cut

mozilla/build/mac/build_scripts/Moz/Prefs.pm

@@ -1,272 +0,0 @@
-
-package Moz::Prefs;
-
-require 5.004;
-require Exporter;
-
-# Package that attempts to read a file from the Preferences folder,
-# and get build settings out of it
-
-use strict;
-
-use Exporter;
-use File::Path;
-
-use Mac::Files;
-
-use vars qw(@ISA @EXPORT);
-
-@ISA		  = qw(Exporter);
-@EXPORT 	= qw(ReadMozUserPrefs);
-
-
-#-------------------------------------------------------------------------------
-#
-# GetPrefsFolder
-#
-#-------------------------------------------------------------------------------
-
-sub GetPrefsFolder()
-{
-  my($prefs_folder) = FindFolder(kOnSystemDisk, kPreferencesFolderType, 1);
-  return $prefs_folder.":Mozilla build prefs";
-}
-
-
-#-------------------------------------------------------------------------------
-#
-# SetArrayValue
-#
-#-------------------------------------------------------------------------------
-sub SetArrayValue($$$)
-{
-  my($array_ref, $index1, $index2) = @_;
-
-  my($index);
-  foreach $index (@$array_ref)
-  {
-    if ($index->[0] eq $index1)
-    {
-      $index->[1] = $index2;
-      return 1;
-    }
-  }
-  
-  return 0;
-}
-
-
-#-------------------------------------------------------------------------------
-#
-# WriteDefaultPrefsFile
-#
-#-------------------------------------------------------------------------------
-
-sub WriteDefaultPrefsFile($)
-{
-  my($file_path) = @_;
-
-  my($file_contents);
-  $file_contents = <<'EOS';
-% You can use this file to customize the Mozilla build system.
-% The following kinds of lines are allowable:
-%   Comment lines, which start with a '%' in the first column
-%   Lines which modify the default build settings. For the list of flags,
-%   see MozBuildFlags.pm. Examples are:
-%
-%    build       pull            0                    % don't pull
-%    options     mng             1                    % turn mng on
-%   
-%   Line containing the special 'buildfrom' flag, which specifies
-%   where to start the build. Example:
-%   
-%    buildfrom   nglayout                % where to start the build
-%
-%   Lines which specify the location of the files used to store paths
-%   to the CodeWarrior IDE, and the MacCVS Pro session file. Note quoting
-%   of paths containing whitespace. Examples:
-%
-%    filepath   idepath         ::codewarrior.txt
-%    filepath   sessionpath     ":Some folder:MacCVS session path.txt"
-%
-%   Lines which modify the build settings like %main::DEBUG.
-%   Any lines which do not match either of the above are assumed
-%   to set variables on $main::. Examples:
-%   
-%    MOZILLA_OFFICIAL    1
-%
-EOS
-
-  $file_contents =~ s/%/#/g;
-   
-  local(*PREFS_FILE);
-
-  open(PREFS_FILE, "> $file_path") || die "Could not write default prefs file\n";
-  print PREFS_FILE ($file_contents);
-  close(PREFS_FILE);
-
-  MacPerl::SetFileInfo("McPL", "TEXT", $file_path);
-}
-
-
-#-------------------------------------------------------------------------------
-#
-# HandlePrefSet
-#
-#-------------------------------------------------------------------------------
-sub HandlePrefSet($$$$)
-{
-  my($flags, $name, $value, $desc) = @_;
-
-  if (SetArrayValue($flags, $name, $value)) {
-    print "Prefs set $desc flag '$name' to '$value'\n";
-  } else {
-    die "$desc setting '$name' is not a valid option\n";
-  }
-
-}
-
-
-#-------------------------------------------------------------------------------
-#
-# HandleBuildFromPref
-#
-#-------------------------------------------------------------------------------
-sub HandleBuildFromPref($$)
-{
-  my($build_array, $name) = @_;
-
-  my($setting) = 0;
-  my($index);
-  foreach $index (@$build_array)
-  {
-    if ($index->[0] eq $name) {
-      $setting = 1;
-    }
-    
-    $index->[1] = $setting;    
-  }
-
-  if ($setting == 1) {
-    print "Building from $name onwards, as specified by prefs\n";
-  } else {
-    printf "Failed to find buildfrom setting '$name'\n";
-  }
-}
-
-
-#-------------------------------------------------------------------------------
-#
-# ReadPrefsFile
-#
-#-------------------------------------------------------------------------------
-
-sub ReadPrefsFile($$$$$)
-{
-  my($file_path, $build_flags, $options_flags, $filepath_flags, $create_if_missing) = @_;
-  
-  local(*PREFS_FILE);
-  
-  if (open(PREFS_FILE, "< $file_path"))
-  {
-    print "Reading build prefs from '$file_path'\n";
-  
-    while (<PREFS_FILE>)
-    {
-      my($line) = $_;
-      chomp($line);
-      
-      if ($line =~ /^\#/ || $line =~ /^\s*$/) {    # ignore comments and empty lines
-        next;
-      }
-            
-      if (($line =~ /^\s*([^#\s]+)\s+([^#\s]+)\s+\"(.+)\"(\s+#.+)?/) ||
-          ($line =~ /^\s*([^#\s]+)\s+([^#\s]+)\s+\'(.+)\'(\s+#.+)?/) ||
-          ($line =~ /^\s*([^#\s]+)\s+([^#\s]+)\s+([^#\s]+)(\s+#.+)?/))
-      {
-        my($array_name) = $1;      
-        my($option_name) = $2;
-        my($option_value) = $3;      
-      
-        # print "Read '$array_name' '$option_name' '$option_value'\n";
-        
-        if ($array_name eq "build")
-        {
-          HandlePrefSet($build_flags, $option_name, $option_value, "Build");
-        }
-        elsif ($array_name eq "options")
-        {
-          HandlePrefSet($options_flags, $option_name, $option_value, "Options");
-        }
-        elsif ($array_name eq "filepath" && $option_name && $option_value)
-        {
-          HandlePrefSet($filepath_flags, $option_name, $option_value, "Filepath");
-        }
-        else
-        {
-          print "Unknown pref option at $line\n";
-        }
-      }
-      elsif ($line =~ /^\s*buildfrom\s+([^#\s]+)(\s+#.+)?/)
-      {
-        my($build_start) = $1;
-        HandleBuildFromPref($build_flags, $build_start);
-      }
-      elsif ($line =~ /^\s*([^#\s]+)\s+([^#\s]+)(\s+#.+)?/)
-      {
-        my($build_var) = $1;
-        my($var_setting) = $2;
-        
-        print "Setting \$main::$build_var to $var_setting\n";
-        eval "\$main::$build_var = \"$var_setting\"";
-      }
-      else
-      {
-        print "Unrecognized input line at $line\n";
-      }
-      
-    }
-    
-    close(PREFS_FILE);  
-  }
-  elsif ($create_if_missing)
-  {
-    print "No prefs file found at $file_path; using defaults\n";
-    
-    my($folder_path) = $file_path;
-    $folder_path =~ s/[^:]+$//;
-    mkpath($folder_path);
-    WriteDefaultPrefsFile($file_path);
-  }
-}
-
-
-#-------------------------------------------------------------------------------
-#
-# ReadMozUserPrefs
-#
-#-------------------------------------------------------------------------------
-
-sub ReadMozUserPrefs($$$$)
-{
-  my($prefs_file_name, $build_flags, $options_flags, $filepath_flags) = @_;
-  
-  if ($prefs_file_name eq "") { return; }
-  
-  # if local prefs exist, just use those. Othewise, look in the prefs folder
-  if (-e $prefs_file_name)
-  {
-    # read local prefs
-    ReadPrefsFile($prefs_file_name, $build_flags, $options_flags, $filepath_flags, 0);
-  }
-  else
-  {
-    # first read prefs folder prefs
-    my($prefs_path) = GetPrefsFolder();
-    $prefs_path .= ":$prefs_file_name";
-
-    ReadPrefsFile($prefs_path, $build_flags, $options_flags, $filepath_flags, 1);
-  }
-}
-
-1;

mozilla/build/mac/build_scripts/Moz/ProjectXML.pm

@@ -1,932 +0,0 @@
-#!/usr/bin/perl
-
-#
-# The contents of this file are subject to the Netscape Public
-# License Version 1.1 (the "License"); you may not use this file
-# except in compliance with the License. You may obtain a copy of
-# the License at http://www.mozilla.org/NPL/
-#
-# Software distributed under the License is distributed on an "AS
-# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express or
-# implied. See the License for the specific language governing
-# rights and limitations under the License.
-#
-# The Original Code is mozilla.org code.
-#
-# The Initial Developer of the Original Code is Netscape
-# Communications Corporation.  Portions created by Netscape are
-# Copyright (C) 1998 Netscape Communications Corporation. All
-# Rights Reserved.
-#
-# Contributor(s): 
-#   Simon Fraser <sfraser@netscape.com>
-#
-
-package Moz::ProjectXML;
-
-require 5.004;
-require Exporter;
-
-use strict;
-use Exporter;
-
-use Cwd;
-use XML::DOM;
-
-use vars qw(@ISA @EXPORT);
-
-@ISA      = qw(Exporter);
-@EXPORT   = qw(
-                ParseXMLDocument
-                DisposeXMLDocument
-                WriteXMLDocument
-                CleanupPro5XML
-                GetTargetsList
-                CloneTarget
-                SetAsSharedLibraryTarget
-                SetAsStaticLibraryTarget
-                AddTarget
-                RemoveTarget
-                GetTargetSetting
-                SetTargetSetting
-                getChildElementTextContents
-              );
-
-
-#--------------------------------------------------------------------------------------------------
-# A module for reading, manipulating, and writing XML-format CodeWarrior project files.
-# 
-# Sample usage:
-# 
-# use ProjectXML;
-# 
-# my $doc = ProjectXML::ParseXMLDocument("Test.mcp.xml");
-# ProjectXML::CloneTarget($doc, "Test.shlb", "Test.lib");
-# ProjectXML::SetAsStaticLibraryTarget($doc, "Test.lib", "TestOutput.lib");
-# ProjectXML::WriteXMLDocument($doc, "Test_out.xml");
-# ProjectXML::DisposeXMLDocument($doc);
-# 
-#--------------------------------------------------------------------------------------------------
-
-
-#//--------------------------------------------------------------------------------------------------
-#// ParseXMLDocument
-#// Note that the caller must call DisposeXMLDocument on the returned doc
-#//--------------------------------------------------------------------------------------------------
-sub ParseXMLDocument($)
-{
-  my($doc_path) = @_;
-
-  my $parser = new XML::DOM::Parser(ErrorContext => 2);
-  my $doc = $parser->parsefile($doc_path);
-
-  return $doc;
-}
-
-#//--------------------------------------------------------------------------------------------------
-#// DisposeXMLDocument
-#// Needed to avoid memory leaks - cleanup circular references for garbage collection
-#//--------------------------------------------------------------------------------------------------
-sub DisposeXMLDocument($)
-{
-  my($doc) = @_;
-  
-  $doc->dispose();
-}
-
-
-#//--------------------------------------------------------------------------------------------------
-#// WriteXMLDocument
-#//--------------------------------------------------------------------------------------------------
-
-sub _pro5_tag_compression($$)
-{
-   return 1;    # Pro 5 is broken and can't import XML with <foo/> style tags
-}
-
-sub _pro6plus_tag_compression($$)
-{
-   return 0;    # Pro 6 can deal with empty XML tags like <foo/>
-}
-
-sub WriteXMLDocument($$$)
-{
-  my($doc, $file_path, $ide_version) = @_;
-
-  if ($ide_version eq "4.0")
-  {
-    XML::DOM::setTagCompression(\&_pro5_tag_compression);
-  }
-  else
-  {
-    XML::DOM::setTagCompression(\&_pro6plus_tag_compression);
-  }
-
-  $doc->printToFile($file_path);
-}
-
-
-#//--------------------------------------------------------------------------------------------------
-#// CleanupPro5XML
-#// XML Projects exported by Pro 5 contain garbage data under the MWMerge_MacOS_skipResources
-#// setting. This routine cleans this up, saving the result to a new file
-#//--------------------------------------------------------------------------------------------------
-sub CleanupPro5XML($$)
-{
-  my($xml_path, $out_path) = @_;
-  
-  local(*XML_FILE);
-  open(XML_FILE, "< $xml_path") || die "Error: failed to open file $xml_path\n";
-  
-  local(*CLEANED_FILE);
-  open(CLEANED_FILE, "> $out_path") || die "Error: failed to open file $out_path for writing\n";
-  
-  my $in_skip_resources_settings = 0;
-  
-  while(<XML_FILE>)
-  {
-      my($line) = $_;
-
-      if ($line =~ /^<\?codewarrior/)    # is processing inst line
-      {
-        my $test_line = $line;
-        chomp($test_line);
-  
-        my $out_line = $test_line;
-        if ($test_line =~ /^<\?codewarrior\s+exportversion=\"(.+)\"\s+ideversion=\"(.+)\"\s*\?>$/)
-        {
-          my $export_version = $1;
-          my $ide_version    = $2;
-
-          $ide_version = "4.0_mozilla";   # pseudo IDE version so we know we touched it
-          $out_line = "<?codewarrior exportversion=\"".$export_version."\" ideversion=\"".$ide_version."\"?>";
-        }
-
-        print CLEANED_FILE "$out_line\n";
-        next;
-      }
-      
-      if ($line =~ /MWMerge_MacOS_skipResources/)
-      {
-        $in_skip_resources_settings = 1;
-        print CLEANED_FILE "$line";
-      }
-      elsif($in_skip_resources_settings && $line =~ /<!-- Settings for/)
-      {
-        # leaving bad settings lines. Write closing tag
-        print CLEANED_FILE "                    <!-- Corrupted setting entries removed by script -->\n";
-        print CLEANED_FILE "                </SETTING>\n\n";
-        
-        print CLEANED_FILE "$line";
-
-        $in_skip_resources_settings = 0;
-      }
-      elsif (!$in_skip_resources_settings)
-      {      
-        print CLEANED_FILE "$line";
-      }
-  }
-  
-  close(XML_FILE);
-  close(CLEANED_FILE);
-
-}
-
-#--------------------------------------------------------------------------------------------------
-# SniffProjectXMLIDEVersion
-#
-#--------------------------------------------------------------------------------------------------
-sub SniffProjectXMLIDEVersion($)
-{
-  my($xml_path) = @_;
-  
-  my $found_version = "";
-  
-  local(*XML_FILE);
-  open(XML_FILE, "< $xml_path") || die "Error: failed to open file $xml_path\n";
-  
-  while(<XML_FILE>)
-  {
-      my($line) = $_;
-      chomp($line);
-      
-      if ($line =~ /^<\?codewarrior/)    # is processing inst line
-      {
-        unless ($line =~ /^<\?codewarrior\s+exportversion=\"(.+)\"\s+ideversion=\"(.+)\"\s*\?>$/)
-        {
-          die "Error: Failed to find ideversion in $xml_path in line $line\n";
-        }
-        
-        my $export_version = $1;
-        my $ide_version    = $2;
-
-        $found_version = $ide_version;         
-        last;
-      }
-  }
-  
-  close(XML_FILE);
-
-  return $found_version;
-}
-
-#//--------------------------------------------------------------------------------------------------
-#// GetTargetsList
-#// Returns an array of target names
-#//--------------------------------------------------------------------------------------------------
-sub GetTargetsList($)
-{
-  my($doc) = @_;
-
-  my $nodes = $doc->getElementsByTagName("TARGET");
-  my $n = $nodes->getLength;
-  
-  my @target_names;
-  
-  for (my $i = 0; $i < $n; $i++)
-  {
-    my ($node) = $nodes->item($i);   
-   
-    my($target_name) = getChildElementTextContents($node, "NAME");
-    push(@target_names, $target_name);
-  }
-
-  return @target_names;
-}
-
-
-#//--------------------------------------------------------------------------------------------------
-#// CloneTarget
-#// Clone the named target, renaming it to 'new_name'
-#//--------------------------------------------------------------------------------------------------
-sub CloneTarget($$$)
-{
-  my($doc, $target_name, $new_name) = @_;
-
-  my $target_node   = getTargetNode($doc, $target_name);
-
-  # clone here
-  my $target_clone  = $target_node->cloneNode(1);   # deep clone
-  
-  # -- munge target settings --
-
-  # set the target name field
-  setChildElementTextContents($doc, $target_clone, "NAME", $new_name);
-  
-  # set the targetname pref
-  setTargetNodeSetting($doc, $target_clone, "Targetname", $new_name);
-
-  # -- insert new target subtree --
-  
-  my $target_list   = $target_node->getParentNode();
-  $target_list->appendChild($target_clone);
-  
-  # -- now add to targetorder --
-  my (@target_order_nodes) = getChildOfDocument($doc, "TARGETORDER");
-  
-  my $target_order = @target_order_nodes[0];
-  
-  my $new_order     = $doc->createElement("ORDEREDTARGET");
-  my $order_name    = $doc->createElement("NAME");
-  
-  $new_order->appendChild($order_name);
-
-  setChildElementTextContents($doc, $new_order, "NAME", $new_name);
-  $target_order->appendChild($new_order);
-}
-
-
-#//--------------------------------------------------------------------------------------------------
-#// SetAsSharedLibraryTarget
-#// 
-#//--------------------------------------------------------------------------------------------------
-sub SetAsSharedLibraryTarget($$$)
-{
-  my($doc, $target_name, $output_name) = @_;
-
-  my $target_node = getTargetNode($doc, $target_name);
-
-  setTargetNodeSetting($doc, $target_node, "MWProject_PPC_type", "SharedLibrary");
-  setTargetNodeSetting($doc, $target_node, "MWProject_PPC_filetype", "1936223330"); #'shlb'
-  setTargetNodeSetting($doc, $target_node, "MWProject_PPC_outfile", $output_name);
-}
-
-
-#//--------------------------------------------------------------------------------------------------
-#// AddFileToTarget
-#// 
-#// Add a file to the specified target(s).
-#// 
-#//--------------------------------------------------------------------------------------------------
-sub AddFileToTarget($$$)
-{
-  my($doc, $target_list, $file_name) = @_;
-
-  # the file must be added in 3 places:
-  # 1. in <TARGET><FILELIST><FILE> (with linkage flags if necessary)
-  # 2. in <TARGET><LINKORDER><FILEREF>
-  # 3. in <GROUPLIST><GROUP><FILEREF>
-  die "Write me\n";
-}
-
-#//--------------------------------------------------------------------------------------------------
-#// RemoveFileFromTarget
-#// 
-#// Remove a file from the specified target, removing it from the entire project
-#// if no other targets reference it.
-#// 
-#//--------------------------------------------------------------------------------------------------
-sub RemoveFileFromTarget($$$)
-{
-  my($doc, $target_node, $file_name) = @_;
-  
-  # the file must be removed in 3 places:
-  # 1. in <TARGET><FILELIST><FILE>
-  # 2. in <TARGET><LINKORDER><FILEREF>
-  # 3. in <GROUPLIST><GROUP><FILEREF>
-  
-  # first, remove from <FILELIST>
-  my $filelist_node = getFirstChildElement($target_node, "FILELIST");
-  unless ($filelist_node) { die "Error: failed to find FILELIST node\n"; }
-  
-  my $file_node = getChildNodeByGrandchildContents($doc, $filelist_node, "FILE", "PATH", $file_name);
-  unless ($file_node) { return; }
-
-  $filelist_node->removeChild($file_node);
-  
-  # next, remove from <LINKORDER>
-  my $linkorder_node = getFirstChildElement($target_node, "LINKORDER");
-  unless ($linkorder_node) { die "Error: failed to find LINKORDER node\n"; }
-  
-  my $fileref_node = getChildNodeByGrandchildContents($doc, $linkorder_node, "FILEREF", "PATH", $file_name);
-  unless ($fileref_node) { die "Error: link order node for file $file_name not found\n"; }
-
-  $linkorder_node->removeChild($fileref_node);
-  
-  # last, remove from <GROUPLIST>
-  # <GROUPLIST> is cross-target, so we have to be careful here.
-  my $grouplist_node = getChildOfDocument($doc, "GROUPLIST");
-  unless ($grouplist_node) { die "Error: failed to find GROUPLIST node\n"; }
-
-  # if the file isn't in any other targets, remove it from the groups
-  if (!GetFileInUse($doc, $file_name))
-  {
-    print "File $file_name is in no other targest. Removing from project\n";
-
-    my @group_nodes;
-    getChildElementsOfType($doc, $grouplist_node, "GROUP", \@group_nodes);
-    my $group_node;
-    foreach $group_node (@group_nodes)
-    {
-      my @fileref_nodes;
-      getChildElementsOfType($doc, $group_node, "FILEREF", \@fileref_nodes);
-  
-      my $fileref_node;
-      foreach $fileref_node (@fileref_nodes)
-      {
-        my $path_name = getChildElementTextContents($fileref_node, "PATH");
-        if ($path_name eq $file_name)
-        {
-          print "Removing $file_name from project group list\n";
-          $group_node->removeChild($fileref_node);
-          last;
-        }
-      }
-      
-      # can a file appear in more than one group?
-    }
-  }
-}
-
-#//--------------------------------------------------------------------------------------------------
-#// SetAsStaticLibraryTarget
-#// 
-#//--------------------------------------------------------------------------------------------------
-sub SetAsStaticLibraryTarget($$$)
-{
-  my($doc, $target_name, $output_name) = @_;
-
-  my $target_node = getTargetNode($doc, $target_name);
-
-  setTargetNodeSetting($doc, $target_node, "MWProject_PPC_type", "Library");
-  setTargetNodeSetting($doc, $target_node, "MWProject_PPC_filetype", "1061109567"); #'????'
-  setTargetNodeSetting($doc, $target_node, "MWProject_PPC_outfile", $output_name);
-
-  # static targets don't need any library linkage, so we can remove linkage
-  # with all .shlb and .Lib files.
-  
-  my(@obsolete_files) = ("NSStdLibStubs", "InterfacesStubs", "InterfaceLib", "InternetConfigLib");
-
-  print " Removing libraries etc. from target\n";
-
-  # get all files in target
-  my @target_files = GetTargetFilesList($doc, $target_name);
-  my $target_file;
-  foreach $target_file (@target_files)
-  {
-    if ($target_file =~ /(\.shlb|\.lib|\.Lib|\.o|\.exp)$/)
-    {
-      RemoveFileFromTarget($doc, $target_node, $target_file);
-    }
-  }
-  
-  print " Removing stub libraries from target\n";
-  
-  # then remove files with known names
-  my $obs_file;
-  foreach $obs_file (@obsolete_files)
-  {
-    RemoveFileFromTarget($doc, $target_node, $obs_file);
-  }
-
-}
-
-
-#//--------------------------------------------------------------------------------------------------
-#// AddTarget
-#// 
-#//--------------------------------------------------------------------------------------------------
-sub AddTarget($$)
-{
-  my($doc, $target_name) = @_;
-
-  die "Write me\n";
-}
-
-#//--------------------------------------------------------------------------------------------------
-#// RemoveTarget
-#// 
-#//--------------------------------------------------------------------------------------------------
-sub RemoveTarget($$)
-{
-  my($doc, $target_name) = @_;
-
-  die "Write me\n";
-}
-
-
-#//--------------------------------------------------------------------------------------------------
-#// GetTargetSetting
-#// Get the value for the specified setting in the specified target
-#//--------------------------------------------------------------------------------------------------
-sub GetTargetSetting($$$)
-{
-  my($doc, $target_name, $setting_name) = @_;
-
-  my $target_node   = getTargetNode($doc, $target_name);
-  return getTargetNodeSetting($target_node, "VALUE");
-}
-
-
-#//--------------------------------------------------------------------------------------------------
-#// SetTargetSetting
-#// Set the value for the specified setting in the specified target
-#//--------------------------------------------------------------------------------------------------
-sub SetTargetSetting($$$$)
-{
-  my($doc, $target_name, $setting_name, $new_value) = @_;
-
-  my $target_node   = getTargetNode($doc, $target_name);
-  setTargetNodeSetting($doc, $target_node, "VALUE", $new_value);
-}
-
-
-#//--------------------------------------------------------------------------------------------------
-#// GetTargetFilesList
-#// Return an array of the files in the target (in filelist order)
-#//--------------------------------------------------------------------------------------------------
-sub GetTargetFilesList($$)
-{
-  my($doc, $target_name) = @_;
-
-  my $target_node = getTargetNode($doc, $target_name);
-
-  my @files_list;
-    
-  my $filelist_node = getFirstChildElement($target_node, "FILELIST");
-  unless ($filelist_node) { die "Error: failed to find FILELIST node\n"; }
-
-  my @file_nodes;
-  getChildElementsOfType($doc, $filelist_node, "FILE", \@file_nodes);
-  
-  my $node;
-  foreach $node (@file_nodes)
-  {
-    my $file_name = getChildElementTextContents($node, "PATH");
-    push(@files_list, $file_name);
-  }
-  
-  return @files_list;
-}
-
-
-#//--------------------------------------------------------------------------------------------------
-#// FileIsInTarget
-#// 
-#//--------------------------------------------------------------------------------------------------
-sub FileIsInTarget($$$)
-{
-  my($doc, $file_name, $target_name) = @_;
-
-  my $target_node = getTargetNode($doc, $target_name);
-  unless ($target_node) { die "Error: no target found called $target_name\n"; }
-
-  my $file_node = GetTargetFileNode($doc, $target_node, $file_name);
-  if ($file_node) {
-    return 1;
-  }
-  
-  return 0;
-}
-
-
-#//--------------------------------------------------------------------------------------------------
-#// GetFileTargetsList
-#// Return an array of the targets that a file is in (expensive)
-#//--------------------------------------------------------------------------------------------------
-sub GetFileTargetsList($$)
-{
-  my ($doc, $file_name) = @_;
-
-  my @target_list;
-
-  my @targets = GetTargetsList($doc);
-  my $target;
-  
-  foreach $target (@targets)
-  {
-    if (FileIsInTarget($doc, $file_name, $target))
-    {
-      push(@target_list, $target);
-    }
-  }
-  
-  return @target_list;
-}
-
-
-#//--------------------------------------------------------------------------------------------------
-#// GetTargetFileNode
-#// 
-#//--------------------------------------------------------------------------------------------------
-sub GetTargetFileNode($$$)
-{
-  my($doc, $target_node, $file_name) = @_;
-
-  my $filelist_node = getFirstChildElement($target_node, "FILELIST");
-  unless ($filelist_node) { die "Error: failed to find FILELIST node\n"; }
-  
-  my $file_node = getChildNodeByGrandchildContents($doc, $filelist_node, "FILE", "PATH", $file_name);
-
-  return $file_node;
-}
-
-
-#//--------------------------------------------------------------------------------------------------
-#// GetFileInUse
-#// Return true if the file is used by any target
-#//--------------------------------------------------------------------------------------------------
-sub GetFileInUse($$)
-{
-  my($doc, $file_name) = @_;
-
-  my $targetlist_node = getChildOfDocument($doc, "TARGETLIST");
-
-  my $target_node = $targetlist_node->getFirstChild();
- 
-  while ($target_node)
-  {
-    if ($target_node->getNodeTypeName eq "ELEMENT_NODE" &&
-        $target_node->getTagName() eq "TARGET")
-    {
-      # if this is a target node
-      my $file_node = GetTargetFileNode($doc, $target_node, $file_name);
-      if ($file_node) {
-        return 1;   # found it
-      }      
-    }
-
-    $target_node = $target_node->getNextSibling();
-  }
-  
-  # not found
-  return 0;
-}
-
-#//--------------------------------------------------------------------------------------------------
-#// getChildOfDocument
-#//--------------------------------------------------------------------------------------------------
-sub getChildOfDocument($$)
-{
-  my($doc, $child_type) = @_;
-
-  return getFirstChildElement($doc->getDocumentElement(), $child_type);
-}
-
-
-#//--------------------------------------------------------------------------------------------------
-#// getFirstChildElement
-#//--------------------------------------------------------------------------------------------------
-sub getFirstChildElement($$)
-{
-  my($node, $element_name) = @_;
-
-  my $found_node;
-  
-  unless ($node) { die "getFirstChildElement called with empty node\n"; }
-  
-  #look for the first "element_name" child
-
-  my $child_node = $node->getFirstChild();
- 
-  while ($child_node)
-  {
-    if ($child_node->getNodeTypeName eq "ELEMENT_NODE" &&
-        $child_node->getTagName() eq $element_name)
-    {
-      $found_node = $child_node;
-      last;
-    }
-
-    $child_node = $child_node->getNextSibling();
-  }
-   
-  return $found_node;
-}
-
-
-#//--------------------------------------------------------------------------------------------------
-#// getChildElementsOfType
-#// 
-#// Return an array of refs to child nodes of the given type
-#//--------------------------------------------------------------------------------------------------
-sub getChildElementsOfType($$$$)
-{
-  my($doc, $node, $child_type, $array_ref) = @_;
-
-  my $child_node = $node->getFirstChild();
- 
-  while ($child_node)
-  {
-    if ($child_node->getNodeTypeName eq "ELEMENT_NODE" &&
-        $child_node->getTagName() eq $child_type)
-    {
-      push(@$array_ref, $child_node);
-    }
-
-    $child_node = $child_node->getNextSibling();
-  }
-
-}
-
-#//--------------------------------------------------------------------------------------------------
-#// getChildElementTextContents
-#//--------------------------------------------------------------------------------------------------
-#
-# Given <FOOPY><NERD>Hi!</NERD></FOOPY>, where $node is <FOOPY>,
-# returns "Hi!". If > 1 <NERD> node, returns the contents of the first.
-#
-sub getChildElementTextContents($$)
-{
-  my($node, $tag_name) = @_;
-
-  my $first_element = getFirstChildElement($node, $tag_name);  
-  my $text_node     = $first_element->getFirstChild();
-  
-  my $text_contents = "";
-  
-  # concat adjacent text nodes
-  while ($text_node)
-  {
-    if ($text_node->getNodeTypeName() ne "TEXT_NODE")
-    {
-      last;
-    }
-
-    $text_contents = $text_contents.$text_node->getData();
-    $text_node = $text_node->getNextSibling();
-  }
-
-  return $text_contents;
-}
-
-#//--------------------------------------------------------------------------------------------------
-#// setChildElementTextContents
-#//--------------------------------------------------------------------------------------------------
-sub setChildElementTextContents($$$$)
-{
-  my($doc, $node, $tag_name, $contents_text) = @_;
-  
-  my $first_element = getFirstChildElement($node, $tag_name);  
-  my $new_text_node = $doc->createTextNode($contents_text);
-  
-  # replace all child elements with a text element
-  removeAllChildren($first_element);
-  
-  $first_element->appendChild($new_text_node);
-}
-
-
-#//--------------------------------------------------------------------------------------------------
-#// getChildNodeByContents
-#// 
-#// Consider <foo><bar><baz>Foopy</baz></bar><bar><baz>Loopy</baz></bar></foo>
-#// This function, when called with getChildNodeByContents($foonode, "bar", "baz", "Loopy")
-#// returns the second <bar> node.
-#//--------------------------------------------------------------------------------------------------
-sub getChildNodeByGrandchildContents($$$$$)
-{
-  my($doc, $node, $child_type, $gc_type, $gc_contents) = @_;    # gc = grandchild
-
-  my $found_node;
-  my $child_node = $node->getFirstChild();
-  while ($child_node)
-  {
-    if ($child_node->getNodeTypeName eq "ELEMENT_NODE" &&
-        $child_node->getTagName() eq $child_type)
-    {
-      # check for a child of this node of type 
-      my $child_contents = getChildElementTextContents($child_node, $gc_type);
-
-      if ($child_contents eq $gc_contents)
-      {
-        $found_node = $child_node;
-        last;
-      }
-    }
-
-    $child_node = $child_node->getNextSibling();
-  }
-
-  return $found_node;
-}
-
-
-#//--------------------------------------------------------------------------------------------------
-#// getTargetNode
-#//--------------------------------------------------------------------------------------------------
-sub getTargetNode($$)
-{
-  my($doc, $target_name) = @_;
-
-  my $targetlist_node = getChildOfDocument($doc, "TARGETLIST");
-  return getChildNodeByGrandchildContents($doc, $targetlist_node, "TARGET", "NAME", $target_name);
-}
-
-
-#//--------------------------------------------------------------------------------------------------
-#// getTargetNamedSettingNode
-#//--------------------------------------------------------------------------------------------------
-sub getTargetNamedSettingNode($$)
-{
-  my($target_node, $setting_name) = @_;
-
-  my $setting_node;
-
-  my $settinglist_node = getFirstChildElement($target_node, "SETTINGLIST");
-  my $child_node = $settinglist_node->getFirstChild();
- 
-  while ($child_node)
-  {
-    if ($child_node->getNodeTypeName ne "ELEMENT_NODE")
-    {
-      $child_node = $child_node->getNextSibling();
-      next;
-    }
-    
-    if ($child_node->getTagName() eq "SETTING")
-    {
-      my $set_name = getChildElementTextContents($child_node, "NAME");
-
-      if ($set_name eq $setting_name)
-      {
-        $setting_node = $child_node;
-        last;
-      }
-    }
-
-    $child_node = $child_node->getNextSibling();
-  }
-
-  return $setting_node;
-}
-
-
-#//--------------------------------------------------------------------------------------------------
-#// getTargetNodeSetting
-#//--------------------------------------------------------------------------------------------------
-sub getTargetNodeSetting($$)
-{
-  my($target_node, $setting_name) = @_;
-  
-  my $setting_node  = getTargetNamedSettingNode($target_node, $setting_name);
-  return getChildElementTextContents($setting_node, "VALUE");
-}
-
-
-#//--------------------------------------------------------------------------------------------------
-#// setTargetNodeSetting
-#//--------------------------------------------------------------------------------------------------
-sub setTargetNodeSetting($$$$)
-{
-  my($doc, $target_node, $setting_name, $new_value) = @_;
-
-  my $setting_node  = getTargetNamedSettingNode($target_node, $setting_name);
-
-  setChildElementTextContents($doc, $setting_node, "VALUE", $new_value);
-}
-
-
-#//--------------------------------------------------------------------------------------------------
-#// elementInArray
-#//--------------------------------------------------------------------------------------------------
-sub elementInArray($$)
-{
-  my($element, $array) = @_;
-  my $test;
-  foreach $test (@$array)
-  {
-    if ($test eq $element) {
-      return 1;
-    }
-  }
-  return 0;
-}
-
-
-#//--------------------------------------------------------------------------------------------------
-#// removeAllChildren
-#//--------------------------------------------------------------------------------------------------
-sub removeAllChildren($)
-{
-  my($node) = @_;
-  
-  my $child_node = $node->getFirstChild();
-  
-  while ($child_node)
-  {
-    $node->removeChild($child_node);
-    $child_node = $node->getFirstChild();
-  }
-}
-
-
-#//--------------------------------------------------------------------------------------------------
-#// dumpNodeData
-#//--------------------------------------------------------------------------------------------------
-sub dumpNodeData($)
-{
-  my($node) = @_;
-  
-  unless ($node) { die "Null node passed to dumpNodeData\n"; }
-  
-  print "Dumping node $node\n";
-  
-  my($node_type) = $node->getNodeTypeName();
-  
-  if ($node_type eq "ELEMENT_NODE")
-  {
-    my($node_name) = $node->getTagName();
-    print "Element $node_name\n";
-  }
-  elsif ($node_type eq "TEXT_NODE")
-  {
-    my($node_data) = $node->getData;
-    # my(@node_vals) = unpack("C*", $node_data);
-    print "Text '$node_data'\n";    # may contain LF chars
-  }
-  else
-  {
-    print "Node $node_type\n";
-  }
-
-}
-
-#//--------------------------------------------------------------------------------------------------
-#// dumpNodeTree
-#//--------------------------------------------------------------------------------------------------
-sub dumpNodeTree($)
-{
-  my($node) = @_;
-  
-  my($child_node) = $node->getFirstChild();
-  
-  unless ($child_node) { return; }
-
-  # recurse
-  dumpNodeData($child_node);
-  
-  # then go through child nodes
-  while ($child_node)
-  {
-    dumpNodeTree($child_node);
-  
-    $child_node = $child_node->getNextSibling();
-  }
-}
-
-
-
-
-1;
-

mozilla/build/mac/build_scripts/MozillaBuildFlags.txt

@@ -1,90 +0,0 @@
-#-------------------------------------------------------------------------------
-# These 3 lists are the 'master lists' to control what gets built.
-# 
-# Ordering in these arrays is important; it has to reflect the order in
-# which the build occurs.
-#
-# Setting containing spaces must be quoted with double quotes.
-#-------------------------------------------------------------------------------
-
-build_flags
-all             1
-pull            0
-dist            0
-config          0
-xpidl           0
-idl             0
-stubs           0
-runtime         0
-common          0
-imglib          0
-libimg2         0
-necko           0
-security        0
-browserutils    0
-intl            0
-nglayout        0
-accessiblity    0
-editor          0
-embedding       0
-viewer          0
-xpapp           0
-extensions      0
-plugins         0
-mailnews        0
-apprunner       0
-resources       0
-
-options_flags
-pull_by_date    0
-chrome_jars     1
-chrome_files    0
-use_jars        1
-transformiix    1
-mathml          0      MOZ_MATHML
-svg             0      MOZ_SVG
-# svg requires libart, which is an lgpl library. You need to pull it 
-# explicitly.
-libart_lgpl     0
-mng             1
-ldap            1      MOZ_LDAP_XPCOM
-ldap_experimental 0    MOZ_LDAP_XPCOM_EXPERIMENTAL
-xmlextras       1
-wsp             0      MOZ_WSP
-inspector       1
-mailextras      1
-xptlink         0
-psm             0      MOZ_PSM
-embedding_test  1
-embedding_chrome 0
-embedding_xulprefs 0
-embedding_xulsecurity 0
-carbon          0      TARGET_CARBON
-useimg2         1      USE_IMG2
-lowmem          0      MOZ_MAC_LOWMEM
-accessible      1      ACCESSIBILITY
-bidi            1      IBMBIDI
-p3p             0
-jsd             1
-venkman         1
-moz_logging     1      MOZ_LOGGING
-chatzilla       1
-content_packs   1
-xml_rpc         1
-cview           1
-help            1
-timeline        0      MOZ_TIMELINE
-static_build    0      MOZ_STATIC_COMPONENT_LIBS
-string_debug    0      DEBUG_STRING
-string_stats    0      DEBUG_STRING_STATS
-xpctools        0      XPC_TOOLS_SUPPORT
-smime           1
-mdn             1
-print_preview   1      NS_PRINT_PREVIEW
-moz_xul         1      MOZ_XUL
-
-filepath_flags
-idepath             ":CodeWarrior IDE Path.txt"
-sessionpath         ":Mozilla session path.txt"
-buildlogfilepath    ":Build Logs:Mozilla build log.txt"   # this is a path
-scriptlogfilepath   ":Build Logs:Mozilla script log.txt"

mozilla/build/mac/build_scripts/MozillaCheckoutList.txt

@@ -1,22 +0,0 @@
-# List of modules to check out. Format is
-#   module, (tag), (date)
-# where tag and date are optional (non-trailing commas are required)
-#
-# Examples:
-#   mozilla/nsprpub, NSPRPUB_CLIENT_TAG
-#   mozilla/gc, , 10/25/2000 12:00:00
-#
-
-mozilla/nsprpub,        	NETSCAPE_7_02_RELEASE
-mozilla/security/nss,   	NETSCAPE_7_02_RELEASE
-mozilla/security/manager,	NETSCAPE_7_02_RELEASE
-mozilla/accessible,			NETSCAPE_7_02_RELEASE
-mozilla/directory/c-sdk,	NETSCAPE_7_02_RELEASE
-mozilla/lib/mac/Instrumentation, 	NETSCAPE_7_02_RELEASE
-mozilla/gfx2, 				NETSCAPE_7_02_RELEASE
-mozilla/modules/libpr0n,	NETSCAPE_7_02_RELEASE
-SeaMonkeyAll, 				NETSCAPE_7_02_RELEASE
-
-## You need this if you want to be able to use SVG
-## Note that this library is under the LGPL, not the MPL
-#mozilla/other-licenses/libart_lgpl

mozilla/build/mac/build_scripts/PullMozilla.pl

@@ -1,79 +0,0 @@
-#!perl
-
-#
-# The contents of this file are subject to the Netscape Public
-# License Version 1.1 (the "License"); you may not use this file
-# except in compliance with the License. You may obtain a copy of
-# the License at http://www.mozilla.org/NPL/
-#
-# Software distributed under the License is distributed on an "AS
-# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express or
-# implied. See the License for the specific language governing
-# rights and limitations under the License.
-#
-# The Original Code is mozilla.org code.
-#
-# The Initial Developer of the Original Code is Netscape
-# Communications Corporation.  Portions created by Netscape are
-# Copyright (C) 1998 Netscape Communications Corporation. All
-# Rights Reserved.
-#
-# Contributor(s): 
-#   Simon Fraser <sfraser@netscape.com>
-#
-
-require 5.004;
-
-use strict;
-
-use Cwd;
-use Moz::BuildUtils;
-use Moz::BuildCore;
-
-#-------------------------------------------------------------
-# Where have the build options gone?
-# 
-# The various build flags have been centralized into one place. 
-# The master list of options is in MozBuildFlags.txt. However, 
-# you should never need to edit that file, or this one.
-# 
-# To customize what gets built, or where to start the build, 
-# edit the $prefs_file_name file in
-# System Folder:Preferences:Mozilla build prefs:
-# Documentation is provided in that file.
-#-------------------------------------------------------------
-
-my($prefs_file_name) = "Mozilla pull prefs";
-
-#-------------------------------------------------------------
-# hashes to hold build options
-#-------------------------------------------------------------
-my(%build);
-my(%options);
-my(%filepaths);
-my(%optiondefines);
-
-# Hash of input files for this build. Eventually, there will be
-# input files for manifests, and projects too.
-my(%inputfiles) = (
-  "buildflags",     "MozillaBuildFlags.txt",
-  "checkoutdata",   "MozillaCheckoutList.txt",
-  "buildprogress",  "",
-  "buildmodule",    "MozillaBuildList.pm",
-  "checkouttime",   "Mozilla last checkout"
-);
-#-------------------------------------------------------------
-# end build hashes
-#-------------------------------------------------------------
-
-# set the build root directory, which is the the dir above mozilla
-SetupBuildRootDir(":mozilla:build:mac:build_scripts");
-
-# Set up all the flags on $main::, like DEBUG, CARBON etc.
-# Override the defaults using the preferences files.
-SetupDefaultBuildOptions(0, ":mozilla:dist:viewer:", "");
-
-my($do_checkout)    = 1;
-my($do_build)       = 0;
-
-RunBuild($do_checkout, $do_build, \%inputfiles, $prefs_file_name);

mozilla/build/mac/test/README

@@ -1,4 +0,0 @@
-This directory is merely here to test the project editor server. It will go away after
-it is validated. For more information, see http://camelot.
-
-Testing watchers.

mozilla/build/mac/test/test1.cpp

@@ -1 +0,0 @@
-// test1.cpp

mozilla/build/mac/test/test2.cpp

@@ -1 +0,0 @@
-// test2.cpp

mozilla/build/mac/test/test3.cpp

@@ -1 +0,0 @@
-// test2.cpp

mozilla/build/mac/test/test5.cpp

@@ -1,4 +0,0 @@
-// test2.cpp
-
-as
-dfasdf

mozilla/build/mac/tools/BuildSystemInfo/BuildSystemInfo.cpp

@@ -1,12 +0,0 @@
-#include <stdio.h>
-
-#include <ConditionalMacros.h>
-
-int main(int argc, char* argv[])
-{
-    FILE* file = fopen("BuildSystemInfo.pm", "w");
-    if (file != NULL) {
-        fprintf(file, "$UNIVERSAL_INTERFACES_VERSION=0x%04X;\n", UNIVERSAL_INTERFACES_VERSION);
-        fclose(file);
-    }
-}

mozilla/client.mk

@@ -1,650 +0,0 @@
-# The contents of this file are subject to the Netscape Public
-# License Version 1.1 (the "License"); you may not use this file
-# except in compliance with the License. You may obtain a copy of
-# the License at http://www.mozilla.org/NPL/
-#
-# Software distributed under the License is distributed on an "AS
-# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express or
-# implied. See the License for the specific language governing
-# rights and limitations under the License.
-#
-# The Original Code is mozilla.org code.
-#
-# The Initial Developer of the Original Code is Netscape
-# Communications Corporation.  Portions created by Netscape are
-# Copyright (C) 1998 Netscape Communications Corporation. All
-# Rights Reserved.
-#
-# Contributor(s): Stephen Lamm
-
-# Build the Mozilla client.
-#
-# This needs CVSROOT set to work, e.g.,
-#   setenv CVSROOT :pserver:anonymous@cvs-mirror.mozilla.org:/cvsroot
-# or
-#   setenv CVSROOT :pserver:username%somedomain.org@cvs.mozilla.org:/cvsroot
-# 
-# To checkout and build a tree,
-#    1. cvs co mozilla/client.mk
-#    2. cd mozilla
-#    3. gmake -f client.mk
-#
-# Other targets (gmake -f client.mk [targets...]),
-#    checkout
-#    build
-#    clean (realclean is now the same as clean)
-#    distclean
-#
-# See http://www.mozilla.org/build/unix.html for more information.
-#
-# Options:
-#   MOZ_OBJDIR           - Destination object directory
-#   MOZ_CO_DATE          - Date tag to use for checkout (default: none)
-#   MOZ_CO_MODULE        - Module to checkout (default: SeaMonkeyAll)
-#   MOZ_CVS_FLAGS        - Flags to pass cvs (default: -q -z3)
-#   MOZ_CO_FLAGS         - Flags to pass after 'cvs co' (default: -P)
-#   MOZ_MAKE_FLAGS       - Flags to pass to $(MAKE)
-#   MOZ_CO_BRANCH        - Branch tag (Deprecated. Use MOZ_CO_TAG below.)
-#
-
-#######################################################################
-# Checkout Tags
-#
-# For branches, uncomment the MOZ_CO_TAG line with the proper tag,
-# and commit this file on that tag.
-MOZ_CO_TAG = NETSCAPE_7_02_RELEASE
-NSPR_CO_TAG = NETSCAPE_7_02_RELEASE
-PSM_CO_TAG = NETSCAPE_7_02_RELEASE
-NSS_CO_TAG = NETSCAPE_7_02_RELEASE
-LDAPCSDK_CO_TAG = NETSCAPE_7_02_RELEASE
-ACCESSIBLE_CO_TAG = NETSCAPE_7_02_RELEASE
-GFX2_CO_TAG = NETSCAPE_7_02_RELEASE
-IMGLIB2_CO_TAG = NETSCAPE_7_02_RELEASE
-BUILD_MODULES = all
-
-#######################################################################
-# Defines
-#
-CVS = cvs
-
-CWD := $(shell pwd)
-
-ifeq "$(CWD)" "/"
-CWD   := /.
-endif
-
-ifneq (, $(wildcard client.mk))
-# Ran from mozilla directory
-ROOTDIR   := $(shell dirname $(CWD))
-TOPSRCDIR := $(CWD)
-else
-# Ran from mozilla/.. directory (?)
-ROOTDIR   := $(CWD)
-TOPSRCDIR := $(CWD)/mozilla
-endif
-
-# on os2, TOPSRCDIR may have two forward slashes in a row, which doesn't
-#  work;  replace first instance with one forward slash
-TOPSRCDIR := $(shell echo "$(TOPSRCDIR)" | sed -e 's%//%/%')
-
-ifndef TOPSRCDIR_MOZ
-TOPSRCDIR_MOZ=$(TOPSRCDIR)
-endif
-
-# if ROOTDIR equals only drive letter (i.e. "C:"), set to "/"
-DIRNAME := $(shell echo "$(ROOTDIR)" | sed -e 's/^.://')
-ifeq ($(DIRNAME),)
-ROOTDIR := /.
-endif
-
-AUTOCONF := autoconf
-MKDIR := mkdir
-SH := /bin/sh
-ifndef MAKE
-MAKE := gmake
-endif
-
-CONFIG_GUESS_SCRIPT := $(wildcard $(TOPSRCDIR)/build/autoconf/config.guess)
-ifdef CONFIG_GUESS_SCRIPT
-  CONFIG_GUESS = $(shell $(CONFIG_GUESS_SCRIPT))
-else
-  _IS_FIRST_CHECKOUT := 1
-endif
-
-####################################
-# CVS
-
-# Add the CVS root to CVS_FLAGS if needed
-CVS_ROOT_IN_TREE := $(shell cat $(TOPSRCDIR)/CVS/Root 2>/dev/null)
-ifneq ($(CVS_ROOT_IN_TREE),)
-ifneq ($(CVS_ROOT_IN_TREE),$(CVSROOT))
-  CVS_FLAGS := -d $(CVS_ROOT_IN_TREE)
-endif
-endif
-
-CVSCO = $(strip $(CVS) $(CVS_FLAGS) co $(CVS_CO_FLAGS))
-CVSCO_LOGFILE := $(ROOTDIR)/cvsco.log
-CVSCO_LOGFILE := $(shell echo $(CVSCO_LOGFILE) | sed s%//%/%)
-
-ifdef MOZ_CO_TAG
-  CVS_CO_FLAGS := -r $(MOZ_CO_TAG)
-endif
-
-####################################
-# Load mozconfig Options
-
-# See build pages, http://www.mozilla.org/build/unix.html, 
-# for how to set up mozconfig.
-MOZCONFIG_LOADER := mozilla/build/autoconf/mozconfig2client-mk
-MOZCONFIG_FINDER := mozilla/build/autoconf/mozconfig-find 
-MOZCONFIG_MODULES := mozilla/build/unix/modules.mk
-run_for_side_effects := \
-  $(shell cd $(ROOTDIR); \
-     if test "$(_IS_FIRST_CHECKOUT)"; then \
-        $(CVSCO) $(MOZCONFIG_FINDER) $(MOZCONFIG_LOADER) $(MOZCONFIG_MODULES); \
-     else true; \
-     fi; \
-     $(MOZCONFIG_LOADER) $(TOPSRCDIR) mozilla/.mozconfig.mk > mozilla/.mozconfig.out)
-include $(TOPSRCDIR)/.mozconfig.mk
-include $(TOPSRCDIR)/build/unix/modules.mk
-
-####################################
-# Options that may come from mozconfig
-
-# Change CVS flags if anonymous root is requested
-ifdef MOZ_CO_USE_MIRROR
-  CVS_FLAGS := -d :pserver:anonymous@cvs-mirror.mozilla.org:/cvsroot
-endif
-
-# MOZ_CVS_FLAGS - Basic CVS flags
-ifeq "$(origin MOZ_CVS_FLAGS)" "undefined"
-  CVS_FLAGS := $(CVS_FLAGS) -q -z 3 
-else
-  CVS_FLAGS := $(MOZ_CVS_FLAGS)
-endif
-
-# This option is deprecated. The best way to have client.mk pull a tag
-# is to set MOZ_CO_TAG (see above) and commit that change on the tag.
-ifdef MOZ_CO_BRANCH
-  $(warning Use MOZ_CO_TAG instead of MOZ_CO_BRANCH)
-  CVS_CO_FLAGS := -r $(MOZ_CO_BRANCH)
-endif
-
-# MOZ_CO_FLAGS - Anything that we should use on all checkouts
-ifeq "$(origin MOZ_CO_FLAGS)" "undefined"
-  CVS_CO_FLAGS := $(CVS_CO_FLAGS) -P
-else
-  CVS_CO_FLAGS := $(CVS_CO_FLAGS) $(MOZ_CO_FLAGS)
-endif
-
-ifdef MOZ_CO_DATE
-  CVS_CO_DATE_FLAGS := -D "$(MOZ_CO_DATE)"
-endif
-
-ifdef MOZ_OBJDIR
-  OBJDIR := $(MOZ_OBJDIR)
-  MOZ_MAKE := $(MAKE) $(MOZ_MAKE_FLAGS) -C $(OBJDIR)
-else
-  OBJDIR := $(TOPSRCDIR)
-  MOZ_MAKE := $(MAKE) $(MOZ_MAKE_FLAGS)
-endif
-
-####################################
-# CVS defines for PSM
-#
-PSM_CO_MODULE= mozilla/security/manager
-PSM_CO_FLAGS := -P -A
-ifdef MOZ_CO_FLAGS
-  PSM_CO_FLAGS := $(MOZ_CO_FLAGS)
-endif
-ifdef PSM_CO_TAG
-  PSM_CO_FLAGS := $(PSM_CO_FLAGS) -r $(PSM_CO_TAG)
-endif
-CVSCO_PSM = $(CVS) $(CVS_FLAGS) co $(PSM_CO_FLAGS) $(CVS_CO_DATE_FLAGS) $(PSM_CO_MODULE)
-
-####################################
-# CVS defines for NSS
-#
-NSS_CO_MODULE = mozilla/security/nss \
-		mozilla/security/coreconf \
-		$(NULL)
-
-NSS_CO_FLAGS := -P
-ifdef MOZ_CO_FLAGS
-  NSS_CO_FLAGS := $(MOZ_CO_FLAGS)
-endif
-ifdef NSS_CO_TAG
-   NSS_CO_FLAGS := $(NSS_CO_FLAGS) -r $(NSS_CO_TAG)
-endif
-# Cannot pull static tags by date
-ifeq ($(NSS_CO_TAG),NSS_CLIENT_TAG)
-CVSCO_NSS = $(CVS) $(CVS_FLAGS) co $(NSS_CO_FLAGS) $(NSS_CO_MODULE)
-else
-CVSCO_NSS = $(CVS) $(CVS_FLAGS) co $(NSS_CO_FLAGS) $(CVS_CO_DATE_FLAGS) $(NSS_CO_MODULE)
-endif
-
-####################################
-# CVS defines for NSPR
-#
-NSPR_CO_MODULE = mozilla/nsprpub
-NSPR_CO_FLAGS := -P
-ifdef MOZ_CO_FLAGS
-  NSPR_CO_FLAGS := $(MOZ_CO_FLAGS)
-endif
-ifdef NSPR_CO_TAG
-  NSPR_CO_FLAGS := $(NSPR_CO_FLAGS) -r $(NSPR_CO_TAG)
-endif
-# Cannot pull static tags by date
-ifeq ($(NSPR_CO_TAG),NSPRPUB_CLIENT_TAG)
-CVSCO_NSPR = $(CVS) $(CVS_FLAGS) co $(NSPR_CO_FLAGS) $(NSPR_CO_MODULE)
-else
-CVSCO_NSPR = $(CVS) $(CVS_FLAGS) co $(NSPR_CO_FLAGS) $(CVS_CO_DATE_FLAGS) $(NSPR_CO_MODULE)
-endif
-
-####################################
-# CVS defines for the C LDAP SDK
-#
-LDAPCSDK_CO_MODULE = mozilla/directory/c-sdk
-LDAPCSDK_CO_FLAGS := -P
-ifdef MOZ_CO_FLAGS
-  LDAPCSDK_CO_FLAGS := $(MOZ_CO_FLAGS)
-endif
-ifdef LDAPCSDK_CO_TAG
-  LDAPCSDK_CO_FLAGS := $(LDAPCSDK_CO_FLAGS) -r $(LDAPCSDK_CO_TAG)
-endif
-CVSCO_LDAPCSDK = $(CVS) $(CVS_FLAGS) co $(LDAPCSDK_CO_FLAGS) $(CVS_CO_DATE_FLAGS) $(LDAPCSDK_CO_MODULE)
-
-####################################
-# CVS defines for the C LDAP SDK
-#
-ACCESSIBLE_CO_MODULE = mozilla/accessible
-ACCESSIBLE_CO_FLAGS := -P
-ifdef MOZ_CO_FLAGS
-  ACCESSIBLE_CO_FLAGS := $(MOZ_CO_FLAGS)
-endif
-ifdef ACCESSIBLE_CO_TAG
-  ACCESSIBLE_CO_FLAGS := $(ACCESSIBLE_CO_FLAGS) -r $(ACCESSIBLE_CO_TAG)
-endif
-CVSCO_ACCESSIBLE = $(CVS) $(CVS_FLAGS) co $(ACCESSIBLE_CO_FLAGS) $(CVS_CO_DATE_FLAGS) $(ACCESSIBLE_CO_MODULE)
-
-####################################
-# CVS defines for gfx2
-#
-GFX2_CO_MODULE = mozilla/gfx2
-GFX2_CO_FLAGS := -P
-ifdef MOZ_CO_FLAGS
-  GFX2_CO_FLAGS := $(MOZ_CO_FLAGS)
-endif
-ifdef GFX2_CO_TAG
-  GFX2_CO_FLAGS := $(GFX2_CO_FLAGS) -r $(GFX2_CO_TAG)
-endif
-CVSCO_GFX2 = $(CVS) $(CVS_FLAGS) co $(GFX2_CO_FLAGS) $(CVS_CO_DATE_FLAGS) $(GFX2_CO_MODULE)
-
-####################################
-# CVS defines for new image library
-#
-IMGLIB2_CO_MODULE = mozilla/modules/libpr0n
-IMGLIB2_CO_FLAGS := -P
-ifdef MOZ_CO_FLAGS
-  IMGLIB2_CO_FLAGS := $(MOZ_CO_FLAGS)
-endif
-ifdef IMGLIB2_CO_TAG
-  IMGLIB2_CO_FLAGS := $(IMGLIB2_CO_FLAGS) -r $(IMGLIB2_CO_TAG)
-endif
-CVSCO_IMGLIB2 = $(CVS) $(CVS_FLAGS) co $(IMGLIB2_CO_FLAGS) $(CVS_CO_DATE_FLAGS) $(IMGLIB2_CO_MODULE)
-
-####################################
-# CVS defines for standalone modules
-#
-ifneq ($(BUILD_MODULES),all)
-  MOZ_CO_MODULE := $(filter-out $(NSPRPUB_DIR) security directory/c-sdk, $(BUILD_MODULE_CVS))
-  MOZ_CO_MODULE += allmakefiles.sh client.mk aclocal.m4 configure configure.in
-  MOZ_CO_MODULE += Makefile.in
-  MOZ_CO_MODULE := $(addprefix mozilla/, $(MOZ_CO_MODULE))
-
-  NOSUBDIRS_MODULE := $(addprefix mozilla/, $(BUILD_MODULE_CVS_NS))
-ifneq ($(NOSUBDIRS_MODULE),)
-  CVSCO_NOSUBDIRS := $(CVSCO) -l $(CVS_CO_DATE_FLAGS) $(NOSUBDIRS_MODULE)
-endif
-
-ifeq (,$(filter $(NSPRPUB_DIR), $(BUILD_MODULE_CVS)))
-  CVSCO_NSPR :=
-endif
-ifeq (,$(filter security security/manager, $(BUILD_MODULE_CVS)))
-  CVSCO_PSM :=
-  CVSCO_NSS :=
-endif
-ifeq (,$(filter directory/c-sdk, $(BUILD_MODULE_CVS)))
-  CVSCO_LDAPCSDK :=
-endif
-ifeq (,$(filter accessible, $(BUILD_MODULE_CVS)))
-  CVSCO_ACCESSIBLE :=
-endif
-ifeq (,$(filter gfx2, $(BUILD_MODULE_CVS)))
-  CVSCO_GFX2 :=
-endif
-ifeq (,$(filter modules/libpr0n, $(BUILD_MODULE_CVS)))
-  CVSCO_IMGLIB2 :=
-endif
-endif
-
-####################################
-# CVS defines for SeaMonkey
-#
-ifeq ($(MOZ_CO_MODULE),)
-  MOZ_CO_MODULE := SeaMonkeyAll
-endif
-CVSCO_SEAMONKEY := $(CVSCO) $(CVS_CO_DATE_FLAGS) $(MOZ_CO_MODULE)
-
-####################################
-# CVS defined for libart (pulled and built if MOZ_INTERNAL_LIBART_LGPL is set)
-#
-CVSCO_LIBART := $(CVSCO) $(CVS_CO_DATE_FLAGS) mozilla/other-licenses/libart_lgpl
-
-ifdef MOZ_INTERNAL_LIBART_LGPL
-FASTUPDATE_LIBART := fast_update $(CVSCO_LIBART)
-CHECKOUT_LIBART := cvs_co $(CVSCO_LIBART)
-else
-CHECKOUT_LIBART := true
-FASTUPDATE_LIBART := true
-endif
-
-####################################
-# CVS defines for Calendar (pulled and built if MOZ_CALENDAR is set)
-#
-CVSCO_CALENDAR := $(CVSCO) $(CVS_CO_DATE_FLAGS) mozilla/calendar
-
-ifdef MOZ_CALENDAR
-FASTUPDATE_CALENDAR := fast_update $(CVSCO_CALENDAR)
-CHECKOUT_CALENDAR := cvs_co $(CVSCO_CALENDAR)
-else
-CHECKOUT_CALENDAR := true
-FASTUPDATE_CALENDAR := true
-endif
-
-
-# because some cygwin tools can't handle native dos-drive paths & vice-versa
-# force configure to use a relative path for --srcdir
-# need a better check for win32
-# and we need to get OBJDIR earlier
-ifdef MOZ_TOOLS
-_tmpobjdir := $(shell cygpath -u $(OBJDIR))
-_abs2rel := $(shell cygpath -w $(TOPSRCDIR)/build/unix/abs2rel.pl | sed -e 's|\\|/|g')
-_OBJ2SRCPATH := $(shell $(_abs2rel) $(TOPSRCDIR) $(_tmpobjdir))
-endif 
-
-#######################################################################
-# Rules
-# 
-
-# Print out any options loaded from mozconfig.
-all build checkout clean depend distclean export libs install realclean::
-	@if test -f .mozconfig.out; then \
-	  cat .mozconfig.out; \
-	  rm -f .mozconfig.out; \
-	else true; \
-	fi
-
-ifdef _IS_FIRST_CHECKOUT
-all:: checkout build
-else
-all:: checkout alldep
-endif
-
-# Windows equivalents
-pull_all: checkout
-build_all: build
-build_all_dep: alldep
-build_all_depend: alldep
-clobber clobber_all: clean
-pull_and_build_all: checkout alldep
-
-# Do everything from scratch
-everything: checkout clean build
-
-####################################
-# CVS checkout
-#
-checkout::
-#	@: Backup the last checkout log.
-	@if test -f $(CVSCO_LOGFILE) ; then \
-	  mv $(CVSCO_LOGFILE) $(CVSCO_LOGFILE).old; \
-	else true; \
-	fi
-ifdef RUN_AUTOCONF_LOCALLY
-	@echo "Removing local configures" ; \
-	cd $(ROOTDIR) && \
-	$(RM) -f mozilla/configure mozilla/nsprpub/configure \
-		mozilla/directory/c-sdk/configure
-endif
-	@echo "checkout start: "`date` | tee $(CVSCO_LOGFILE)
-	@echo '$(CVSCO) mozilla/client.mk mozilla/build/unix/modules.mk'; \
-        cd $(ROOTDIR) && \
-	$(CVSCO) mozilla/client.mk mozilla/build/unix/modules.mk
-	@cd $(ROOTDIR) && $(MAKE) -f mozilla/client.mk real_checkout
-
-real_checkout:
-#	@: Start the checkout. Split the output to the tty and a log file. \
-#	 : If it fails, touch an error file because "tee" hides the error.
-	@failed=.cvs-failed.tmp; rm -f $$failed*; \
-	cvs_co() { echo "$$@" ; \
-	  ("$$@" || touch $$failed) 2>&1 | tee -a $(CVSCO_LOGFILE) && \
-	  if test -f $$failed; then false; else true; fi; }; \
-	cvs_co $(CVSCO_NSPR) && \
-	cvs_co $(CVSCO_NSS) && \
-	cvs_co $(CVSCO_PSM) && \
-        cvs_co $(CVSCO_LDAPCSDK) && \
-        cvs_co $(CVSCO_ACCESSIBLE) && \
-        cvs_co $(CVSCO_GFX2) && \
-        cvs_co $(CVSCO_IMGLIB2) && \
-	$(CHECKOUT_CALENDAR) && \
-	$(CHECKOUT_LIBART) && \
-	cvs_co $(CVSCO_SEAMONKEY) && \
-	cvs_co $(CVSCO_NOSUBDIRS)
-	@echo "checkout finish: "`date` | tee -a $(CVSCO_LOGFILE)
-#	@: Check the log for conflicts. ;
-	@conflicts=`egrep "^C " $(CVSCO_LOGFILE)` ;\
-	if test "$$conflicts" ; then \
-	  echo "$(MAKE): *** Conflicts during checkout." ;\
-	  echo "$$conflicts" ;\
-	  echo "$(MAKE): Refer to $(CVSCO_LOGFILE) for full log." ;\
-	  false; \
-	else true; \
-	fi
-ifdef RUN_AUTOCONF_LOCALLY
-	@echo Generating configures using $(AUTOCONF) ; \
-	cd $(TOPSRCDIR) && $(AUTOCONF) && \
-	cd $(TOPSRCDIR)/nsprpub && $(AUTOCONF) && \
-	cd $(TOPSRCDIR)/directory/c-sdk && $(AUTOCONF)
-endif
-
-fast-update:
-#	@: Backup the last checkout log.
-	@if test -f $(CVSCO_LOGFILE) ; then \
-	  mv $(CVSCO_LOGFILE) $(CVSCO_LOGFILE).old; \
-	else true; \
-	fi
-ifdef RUN_AUTOCONF_LOCALLY
-	@echo "Removing local configures" ; \
-	cd $(ROOTDIR) && \
-	$(RM) -f mozilla/configure mozilla/nsprpub/configure \
-		mozilla/directory/c-sdk/configure
-endif
-	@echo "checkout start: "`date` | tee $(CVSCO_LOGFILE)
-	@echo '$(CVSCO) mozilla/client.mk mozilla/build/unix/modules.mk'; \
-        cd $(ROOTDIR) && \
-	$(CVSCO) mozilla/client.mk mozilla/build/unix/modules.mk
-	@cd $(TOPSRCDIR) && \
-	$(MAKE) -f client.mk real_fast-update
-
-real_fast-update:
-#	@: Start the update. Split the output to the tty and a log file. \
-#	 : If it fails, touch an error file because "tee" hides the error.
-	@failed=.fast_update-failed.tmp; rm -f $$failed*; \
-	fast_update() { (config/cvsco-fast-update.pl $$@ || touch $$failed) 2>&1 | tee -a $(CVSCO_LOGFILE) && \
-	  if test -f $$failed; then false; else true; fi; }; \
-	cvs_co() { echo "$$@" ; \
-	  ("$$@" || touch $$failed) 2>&1 | tee -a $(CVSCO_LOGFILE) && \
-	  if test -f $$failed; then false; else true; fi; }; \
-	fast_update $(CVSCO_NSPR) && \
-	cd $(ROOTDIR) && \
-	failed=mozilla/.fast_update-failed.tmp && \
-	cvs_co $(CVSCO_NSS) && \
-	failed=.fast_update-failed.tmp && \
-	cd mozilla && \
-	fast_update $(CVSCO_PSM) && \
-	fast_update $(CVSCO_LDAPCSDK) && \
-	fast_update $(CVSCO_ACCESSIBLE) && \
-	fast_update $(CVSCO_GFX2) && \
-	fast_update $(CVSCO_IMGLIB2) && \
-	$(FASTUPDATE_CALENDAR) && \
-	$(FASTUPDATE_LIBART) && \
-	fast_update $(CVSCO_SEAMONKEY) && \
-	fast_update $(CVSCO_NOSUBDIRS)
-	@echo "fast_update finish: "`date` | tee -a $(CVSCO_LOGFILE)
-#	@: Check the log for conflicts. ;
-	@conflicts=`egrep "^C " $(CVSCO_LOGFILE)` ;\
-	if test "$$conflicts" ; then \
-	  echo "$(MAKE): *** Conflicts during fast-update." ;\
-	  echo "$$conflicts" ;\
-	  echo "$(MAKE): Refer to $(CVSCO_LOGFILE) for full log." ;\
-	  false; \
-	else true; \
-	fi
-ifdef RUN_AUTOCONF_LOCALLY
-	@echo Generating configures using $(AUTOCONF) ; \
-	cd $(TOPSRCDIR) && $(AUTOCONF) && \
-	cd $(TOPSRCDIR)/nsprpub && $(AUTOCONF) && \
-	cd $(TOPSRCDIR)/directory/c-sdk && $(AUTOCONF)
-endif
-
-####################################
-# Web configure
-
-WEBCONFIG_FILE  := $(HOME)/.mozconfig
-
-MOZCONFIG2CONFIGURATOR := build/autoconf/mozconfig2configurator
-webconfig:
-	@cd $(TOPSRCDIR); \
-	url=`$(MOZCONFIG2CONFIGURATOR) $(TOPSRCDIR)`; \
-	echo Running mozilla with the following url: ;\
-	echo ;\
-	echo $$url ;\
-	mozilla -remote "openURL($$url)" || \
-	netscape -remote "openURL($$url)" || \
-	mozilla $$url || \
-	netscape $$url ;\
-	echo ;\
-	echo   1. Fill out the form on the browser. ;\
-	echo   2. Save the results to $(WEBCONFIG_FILE)
-
-#####################################################
-# First Checkout
-
-ifdef _IS_FIRST_CHECKOUT
-# First time, do build target in a new process to pick up new files.
-build::
-	$(MAKE) -f $(TOPSRCDIR)/client.mk build
-else
-
-#####################################################
-# After First Checkout
-
-
-####################################
-# Configure
-
-CONFIG_STATUS := $(wildcard $(OBJDIR)/config.status)
-CONFIG_CACHE  := $(wildcard $(OBJDIR)/config.cache)
-
-ifdef RUN_AUTOCONF_LOCALLY
-EXTRA_CONFIG_DEPS := \
-	$(TOPSRCDIR)/aclocal.m4 \
-	$(wildcard $(TOPSRCDIR)/build/autoconf/*.m4) \
-	$(NULL)
-
-$(TOPSRCDIR)/configure: $(TOPSRCDIR)/configure.in $(EXTRA_CONFIG_DEPS)
-	@echo Generating $@ using autoconf
-	cd $(TOPSRCDIR); $(AUTOCONF)
-endif
-
-CONFIG_STATUS_DEPS_L10N := $(wildcard $(TOPSRCDIR)/l10n/makefiles.all)
-
-CONFIG_STATUS_DEPS := \
-	$(TOPSRCDIR)/configure \
-	$(TOPSRCDIR)/allmakefiles.sh \
-	$(TOPSRCDIR)/.mozconfig.mk \
-	$(wildcard $(TOPSRCDIR)/nsprpub/configure) \
-	$(wildcard $(TOPSRCDIR)/directory/c-sdk/configure) \
-	$(wildcard $(TOPSRCDIR)/mailnews/makefiles) \
-	$(CONFIG_STATUS_DEPS_L10N) \
-	$(wildcard $(TOPSRCDIR)/themes/makefiles) \
-	$(NULL)
-
-# configure uses the program name to determine @srcdir@. Calling it without
-#   $(TOPSRCDIR) will set @srcdir@ to "."; otherwise, it is set to the full
-#   path of $(TOPSRCDIR).
-ifeq ($(TOPSRCDIR),$(OBJDIR))
-  CONFIGURE := ./configure
-else
-  CONFIGURE := $(TOPSRCDIR)/configure
-endif
-
-ifdef _OBJ2SRCPATH
-CONFIGURE_ARGS := --srcdir=$(_OBJ2SRCPATH) $(CONFIGURE_ARGS)
-endif
-
-$(OBJDIR)/Makefile $(OBJDIR)/config.status: $(CONFIG_STATUS_DEPS)
-	@if test ! -d $(OBJDIR); then $(MKDIR) $(OBJDIR); else true; fi
-	@echo cd $(OBJDIR);
-	@echo $(CONFIGURE) $(CONFIGURE_ARGS)
-	@cd $(OBJDIR) && $(CONFIGURE_ENV_ARGS) $(CONFIGURE) $(CONFIGURE_ARGS) \
-	  || ( echo "*** Fix above errors and then restart with\
-               \"$(MAKE) -f client.mk build\"" && exit 1 )
-	@touch $(OBJDIR)/Makefile
-
-ifdef CONFIG_STATUS
-$(OBJDIR)/config/autoconf.mk: $(TOPSRCDIR)/config/autoconf.mk.in
-	cd $(OBJDIR); \
-	  CONFIG_FILES=config/autoconf.mk ./config.status
-endif
-
-
-####################################
-# Depend
-
-depend:: $(OBJDIR)/Makefile $(OBJDIR)/config.status
-	$(MOZ_MAKE) export && $(MOZ_MAKE) depend
-
-####################################
-# Build it
-
-build::  $(OBJDIR)/Makefile $(OBJDIR)/config.status
-	$(MOZ_MAKE)
-
-####################################
-# Other targets
-
-# Pass these target onto the real build system
-install export libs clean realclean distclean alldep:: $(OBJDIR)/Makefile $(OBJDIR)/config.status
-	$(MOZ_MAKE) $@
-
-cleansrcdir:
-	@cd $(TOPSRCDIR); \
-        if [ -f webshell/embed/gtk/Makefile ]; then \
-          $(MAKE) -C webshell/embed/gtk distclean; \
-        fi; \
-	if [ -f Makefile ]; then \
-	  $(MAKE) distclean ; \
-	else \
-	  echo "Removing object files from srcdir..."; \
-	  rm -fr `find . -type d \( -name .deps -print -o -name CVS \
-	          -o -exec test ! -d {}/CVS \; \) -prune \
-	          -o \( -name '*.[ao]' -o -name '*.so' \) -type f -print`; \
-	   build/autoconf/clean-config.sh; \
-	fi;
-
-# (! IS_FIRST_CHECKOUT)
-endif
-
-.PHONY: checkout real_checkout depend build export libs alldep install clean realclean distclean cleansrcdir pull_all build_all clobber clobber_all pull_and_build_all everything

mozilla/js/src/MANIFEST

@@ -0,0 +1,48 @@
+# This file is required for the Mac client mozilla build.
+# This is a list of local files which get copied to the mozilla:dist directory
+#
+
+js.msg
+jsapi.h
+jsarena.h
+jspubtd.h
+jsarray.h
+jsatom.h
+jsbool.h
+jsclist.h
+jscntxt.h
+jscompat.h
+jsconfig.h
+jscpucfg.h
+jsdate.h
+jsdbgapi.h
+jsdhash.h
+jsdtoa.h
+jsemit.h
+jsfun.h
+jsgc.h
+jshash.h
+jsinterp.h
+jslock.h
+jslong.h
+jsmath.h
+jsnum.h
+jsobj.h
+jsopcode.tbl
+jsopcode.h
+jsosdep.h
+jsotypes.h
+jsparse.h
+jsprf.h
+jsprvtd.h
+jspubtd.h
+jsregexp.h
+jsscan.h
+jsscope.h
+jsscript.h
+jsstr.h
+jstypes.h
+jsutil.h
+jsxdrapi.h
+
+

mozilla/js/src/Makefile.in

@@ -0,0 +1,337 @@
+#
+# The contents of this file are subject to the Netscape Public
+# License Version 1.1 (the "License"); you may not use this file
+# except in compliance with the License. You may obtain a copy of
+# the License at http://www.mozilla.org/NPL/
+#
+# Software distributed under the License is distributed on an "AS
+# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+# implied. See the License for the specific language governing
+# rights and limitations under the License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation. All
+# Rights Reserved.
+#
+# Contributor(s): 
+#
+# Alternatively, the contents of this file may be used under the
+# terms of the GNU Public License (the "GPL"), in which case the
+# provisions of the GPL are applicable instead of those above.
+# If you wish to allow use of your version of this file only
+# under the terms of the GPL and not to allow others to use your
+# version of this file under the NPL, indicate your decision by
+# deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL.  If you do not delete
+# the provisions above, a recipient may use your version of this
+# file under either the NPL or the GPL.
+#
+
+DEPTH		= ../..
+topsrcdir	= @top_srcdir@
+srcdir		= @srcdir@
+VPATH		= @srcdir@
+
+include $(DEPTH)/config/autoconf.mk
+
+MODULE		= js
+LIBRARY_NAME	= mozjs
+
+DIRS		= fdlibm
+
+CSRCS		= \
+		jsapi.c \
+		jsarena.c \
+		jsarray.c \
+		jsatom.c \
+		jsbool.c \
+		jscntxt.c \
+		jsdate.c \
+		jsdbgapi.c \
+		jsdhash.c \
+		jsdtoa.c \
+		jsemit.c \
+		jsexn.c \
+		jsfun.c \
+		jsgc.c \
+		jshash.c \
+		jsinterp.c \
+		jslock.c \
+		jslog2.c \
+		jslong.c \
+		jsmath.c \
+		jsnum.c \
+		jsobj.c \
+		jsopcode.c \
+		jsparse.c \
+		jsprf.c \
+		jsregexp.c \
+		jsscan.c \
+		jsscope.c \
+		jsscript.c \
+		jsstr.c \
+		jsutil.c \
+		jsxdrapi.c \
+		prmjtime.c \
+		$(NULL)
+
+EXPORTS		= \
+		js.msg \
+		jsapi.h \
+		jsarray.h \
+		jsarena.h \
+		jsatom.h \
+		jsbit.h \
+		jsbool.h \
+		jsclist.h \
+		jscntxt.h \
+		jscompat.h \
+		jsconfig.h \
+		jsdate.h \
+		jsdbgapi.h \
+		jsdhash.h \
+		jsemit.h \
+		jsfun.h \
+		jsgc.h \
+		jshash.h \
+		jsinterp.h \
+		jslock.h \
+		jslong.h \
+		jsmath.h \
+		jsnum.h \
+		jsobj.h \
+		jsopcode.tbl \
+		jsopcode.h \
+		jsosdep.h \
+		jsotypes.h \
+		jsparse.h \
+		jsprf.h \
+		jsprvtd.h \
+		jspubtd.h \
+		jsregexp.h \
+		jsscan.h \
+		jsscope.h \
+		jsscript.h \
+		jsstr.h \
+		jstypes.h \
+		jsutil.h \
+		jsxdrapi.h \
+		jsstddef.h \
+		$(NULL)
+
+EXPORTS		:= $(addprefix $(srcdir)/, $(EXPORTS))
+
+FDLIBM_LIBRARY	= fdlibm/libfdm.$(LIB_SUFFIX)
+JSMATH_PRELINK	= jsmathtemp.o
+JS_SAFE_ARENA	= 1
+
+DASH_R		= -r
+
+include $(topsrcdir)/config/config.mk
+
+ifeq ($(OS_ARCH),OS2)
+ifneq ($(MOZ_WIDGET_TOOLKIT),os2)
+ifndef XCFLAGS
+OS2_IMPLIB	= 1
+LIBRARY		= js$(MOZ_BITS)$(VERSION_NUMBER).$(LIB_SUFFIX)
+DEF_FILE	= jsos2$(VERSION_NUMBER).def
+EXTRA_LIBS	= $(NSPR_LIBS) $(LIBNSJAVA)
+else
+EXTRA_LIBS	= $(NSPR_LIBS) $(LIBNSJAVA) libjs.lib
+endif
+OS_CFLAGS	+= -tm-
+endif
+endif
+
+EXTRA_DSO_LDOPTS += $(MOZ_COMPONENT_NSPR_LIBS)
+
+# When using gcc the assembly is inlined in the C-file (see jslock.c)
+ifdef NS_USE_NATIVE
+ASFILES		= $(notdir $(wildcard $(srcdir)/*_$(OS_ARCH).s))
+endif
+
+ifeq ($(MOZ_WIDGET_TOOLKIT),os2)
+DEF_OBJS = jsapi.o jsarena.o jsdbgapi.o jsdhash.o jsdtoa.o jsgc.o jshash.o \
+	jsinterp.o jslog2.o jslong.o jsprf.o jsutil.o jsxdrapi.o prmjtime.o
+#ADD_TO_DEF_FILE = cat < $(srcdir)/extradefs.os2 >>$(DEF_FILE)
+endif
+
+ifndef BUILD_OPT
+MOCHAFILE	= 1
+endif
+
+ifndef NSBUILDROOT
+JSJAVA_STUBHEADERS = \
+		-I$(topsrcdir)/sun-java/include/_gen \
+		-I$(topsrcdir)/sun-java/netscape/javascript/_jri \
+		-I$(topsrcdir)/sun-java/netscape/security/_jri
+else
+JSJAVA_STUBHEADERS = -I$(JRI_GEN_DIR) -I$(JDK_GEN_DIR)
+endif
+
+JSJAVA_CFLAGS	= \
+		-I$(topsrcdir)/sun-java/md-include \
+		-I$(topsrcdir)/sun-java/include \
+		$(JSJAVA_STUBHEADERS)
+
+include $(topsrcdir)/config/rules.mk
+
+DEFINES		+= -DEXPORT_JS_API 
+
+INCLUDES	+= -I$(srcdir)
+
+GARBAGE		+= $(JSMATH_PRELINK) jscpucfg.o jsautocfg.h jsautocfg.tmp jscpucfg
+
+TARGETS		+= jscpucfg$(BIN_SUFFIX)
+
+ifdef JS_SAFE_ARENA
+DEFINES		+= -DJS_USE_SAFE_ARENA
+endif
+
+ifdef JS_THREADSAFE
+DEFINES		+= -DJS_THREADSAFE
+endif
+
+ifdef JS_NO_THIN_LOCKS
+DEFINES		+= -DJS_USE_ONLY_NSPR_LOCKS
+endif
+
+ifdef JS_VERSION
+DEFINES		+= -DJS_VERSION=$(JS_VERSION)
+endif
+
+ifneq ($(findstring -L,$(NSPR_LIBS)),)
+NSPR_STATIC_PATH = $(subst -L,,$(findstring -L,$(NSPR_LIBS)))
+else
+NSPR_STATIC_PATH = $(DIST)/lib
+endif
+
+LDFLAGS		+= $(pathsubst -l%,$(NSPR_STATIC_PATH)/%.a,$(NSPR_LIBS))
+
+# BeOS and HP-UX do not require the extra linking of "-lm"
+ifeq (,$(filter BeOS HP-UX,$(OS_ARCH)))
+LDFLAGS		+= -lm
+endif
+
+ifeq ($(OS_ARCH),FreeBSD)
+LDFLAGS		+= -pthread
+endif
+ifeq ($(OS_ARCH),IRIX)
+ifneq ($(basename $(OS_RELEASE)),5)
+LDFLAGS		+= -n32
+DASH_R		+= -n32
+endif
+endif
+ifeq ($(OS_ARCH),Linux)
+LDFLAGS		+= -ldl
+endif
+ifeq ($(OS_ARCH),OSF1)
+LDFLAGS		+= -lc_r
+endif
+ifeq ($(OS_ARCH),SunOS)
+ifeq ($(CPU_ARCH),sparc)
+
+ifndef JS_NO_ULTRA
+ULTRA_OPTIONS	:= -xarch=v8plus,-DULTRA_SPARC
+ULTRA_OPTIONSCC	:= -DULTRA_SPARC
+else
+ULTRA_OPTIONS	:= -xarch=v8
+ULTRA_OPTIONSCC	:=
+endif
+
+ifeq ($(shell uname -m),sun4u)
+ASFLAGS		+= -Wa,$(ULTRA_OPTIONS),-P,-L,-D_ASM,-D__STDC__=0 $(ULTRA_OPTIONSCC)
+else
+ASFLAGS		+= -Wa,-xarch=v8,-P,-L,-D_ASM,-D__STDC__=0
+endif
+
+endif
+ifeq ($(OS_RELEASE),4.1)
+LDFLAGS		+= -ldl -lnsl
+else
+LDFLAGS		+= -lposix4 -ldl -lnsl -lsocket
+endif
+endif
+
+ifeq ($(OS_ARCH),QNX)
+ifneq ($(OS_TARGET),NTO)
+# Don't use wildcard here, because we only want this resolved at link time.
+OBJS		+= fdlibm/*.o
+endif
+endif
+
+# OS/2 linkers expect to create executables or dlls, not object files
+# so we pull in what's needed from fdlibm when creating the js dll
+ifneq ($(MOZ_WIDGET_TOOLKIT),os2)
+# special rule for jsmath.o since we want to incrementally link
+# against fdlibm to pull in only what is needed
+jsmath.o: $(FDLIBM_LIBRARY) $(JSMATH_PRELINK)
+ifeq ($(OS_ARCH),QNX)
+ifneq ($(OS_TARGET),NTO)
+	@cp $(JSMATH_PRELINK) $@
+else
+	$(LD) $(DASH_R) -o $@ $(JSMATH_PRELINK) $(FDLIBM_LIBRARY)
+endif
+else
+	$(LD) $(DASH_R) -o $@ $(JSMATH_PRELINK) $(FDLIBM_LIBRARY)
+endif
+
+$(JSMATH_PRELINK): jsmath.c
+ifeq ($(OS_ARCH),WINNT)
+	$(CC) -Fo$@ -c $(CFLAGS) $<
+else
+	$(CC) -o $@ -c $(COMPILE_CFLAGS) $<
+endif
+endif
+
+# An AIX Optimization bug causes PR_dtoa() & JS_dtoa to produce wrong result.
+# This suppresses optimization for this single compilation unit.
+ifeq ($(OS_ARCH),AIX)
+jsdtoa.o: jsdtoa.c
+	$(CC) -o $@ -c $(filter-out -O, $(COMPILE_CFLAGS)) $<
+endif
+
+$(FDLIBM_LIBRARY):
+	@$(CONTINUE_ON_ERROR) \
+	$(MAKE) -C $(@D) $(@F); \
+	$(EXIT_ON_ERROR)
+
+jsopcode.h jsopcode.c: jsopcode.tbl
+
+jsautocfg.h: jscpucfg$(BIN_SUFFIX)
+	@rm -f $@ jsautocfg.tmp
+	./jscpucfg > jsautocfg.tmp
+	mv jsautocfg.tmp $@
+
+# jscpucfg is a strange target
+# Needs to be built with the host compiler but needs to include
+# the mdcpucfg for the target so it needs the appropriate target defines
+ifdef HOST_NSPR_MDCPUCFG
+HOST_CC := $(HOST_CC) -DMDCPUCFG=$(TARGET_NSPR_MDCPUCFG)
+endif
+
+ifeq ($(OS_ARCH),QNX)
+ifneq ($(OS_TARGET),NTO)
+# QNX's compiler apparently can't build a binary directly from a source file.
+jscpucfg.o: jscpucfg.c
+	$(HOST_CC) $(HOST_CFLAGS) -c $(DEFINES) $(NSPR_CFLAGS) -o $@ $<
+
+jscpucfg: jscpucfg.o
+	$(HOST_CC) $(HOST_CFLAGS) $(DEFINES) -o $@ $<
+endif
+else
+jscpucfg$(BIN_SUFFIX): jscpucfg.c
+ifeq ($(MOZ_OS2_TOOLS),VACPP)
+	$(HOST_CC) $(HOST_CFLAGS) $(DEFINES) $(NSPR_CFLAGS) /Fe$@ $<
+else
+	$(HOST_CC) $(HOST_CFLAGS) $(DEFINES) $(NSPR_CFLAGS) -o $@ $<
+endif
+endif
+
+export:: jsautocfg.h
+	$(INSTALL) -m 444 $< $(PUBLIC)
+

mozilla/js/src/Makefile.ref

@@ -0,0 +1,344 @@
+#
+# The contents of this file are subject to the Netscape Public
+# License Version 1.1 (the "License"); you may not use this file
+# except in compliance with the License. You may obtain a copy of
+# the License at http://www.mozilla.org/NPL/
+#
+# Software distributed under the License is distributed on an "AS
+# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+# implied. See the License for the specific language governing
+# rights and limitations under the License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation. All
+# Rights Reserved.
+#
+# Contributor(s): 
+#	Michael Ang <mang@subcarrier.org>
+#	
+#
+# Alternatively, the contents of this file may be used under the
+# terms of the GNU Public License (the "GPL"), in which case the
+# provisions of the GPL are applicable instead of those above.
+# If you wish to allow use of your version of this file only
+# under the terms of the GPL and not to allow others to use your
+# version of this file under the NPL, indicate your decision by
+# deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL.  If you do not delete
+# the provisions above, a recipient may use your version of this
+# file under either the NPL or the GPL.
+
+#
+# JSRef GNUmake makefile.
+#
+
+DEPTH = .
+
+include config.mk
+
+#NS_USE_NATIVE = 1
+
+ifdef USE_MSVC
+OTHER_LIBS += fdlibm/$(OBJDIR)/fdlibm.lib
+else
+OTHER_LIBS += -Lfdlibm/$(OBJDIR) -lfdm
+endif
+
+ifdef JS_THREADSAFE
+DEFINES += -DJS_THREADSAFE
+INCLUDES += -I../../dist/$(OBJDIR)/include
+ifdef USE_MSVC
+OTHER_LIBS += ../../dist/$(OBJDIR)/lib/libnspr3.lib
+else
+OTHER_LIBS += -L../../dist/$(OBJDIR)/lib -lnspr3
+endif
+endif
+
+ifdef JS_NO_THIN_LOCKS
+DEFINES += -DJS_USE_ONLY_NSPR_LOCKS
+endif
+
+ifdef JS_HAS_FILE_OBJECT
+DEFINES += -DJS_HAS_FILE_OBJECT
+endif
+
+#
+# XCFLAGS may be set in the environment or on the gmake command line
+#
+CFLAGS          += $(OPTIMIZER) $(OS_CFLAGS) $(DEFINES) $(INCLUDES) $(XCFLAGS)
+
+LDFLAGS		= $(XLDFLAGS)
+
+ifndef NO_LIBM
+LDFLAGS += -lm
+endif
+
+#
+# Ask perl what flags it was built with, so we can build js with similar flags
+# and link properly.  Viva gmake.
+#
+ifdef JS_PERLCONNECT
+DEFINES += -DPERLCONNECT -D_GNU_SOURCE
+
+PERLCFLAGS := $(shell perl -MExtUtils::Embed -e ccopts)
+PERLLDFLAGS := $(shell perl -MExtUtils::Embed -e ldopts)
+
+# perl erroneously reports compiler flag -rdynamic (interpreted by ld
+# as -r) when it really meant -export-dynamic.
+PERLLDFLAGS := $(subst -rdynamic,-export-dynamic,$(PERLLDFLAGS))
+
+CFLAGS += $(PERLCFLAGS)
+LDFLAGS += $(PERLLDFLAGS)
+endif
+
+#
+#	Server-related changes :
+#
+ifdef NES40 
+DEFINES += -DNES40 
+endif 
+
+#
+# Line editing support.
+# Define JS_READLINE or JS_EDITLINE to enable line editing in the
+# js command-line interpreter.
+#
+ifdef JS_READLINE
+# For those platforms with the readline library installed.
+DEFINES += -DEDITLINE
+PROG_LIBS += -lreadline
+else
+ifdef JS_EDITLINE
+# Use the editline library, built locally.
+PREDIRS += editline
+DEFINES += -DEDITLINE
+PROG_LIBS += -Leditline/$(OBJDIR) -ledit
+endif
+endif
+
+# For purify
+PURE_CFLAGS     = -DXP_UNIX $(OPTIMIZER) $(PURE_OS_CFLAGS) $(DEFINES) \
+                  $(INCLUDES) $(XCFLAGS)
+
+#
+# JS file lists
+#
+JS_HFILES =		\
+	jsarray.h	\
+	jsatom.h	\
+	jsbool.h	\
+	jsconfig.h	\
+	jscntxt.h	\
+	jsdate.h	\
+	jsemit.h	\
+	jsexn.h		\
+	jsfun.h		\
+	jsgc.h		\
+	jsinterp.h	\
+	jslibmath.h	\
+	jslock.h	\
+	jsmath.h	\
+	jsnum.h		\
+	jsobj.h		\
+	jsopcode.h      \
+	jsparse.h	\
+	jsarena.h	\
+	jsclist.h	\
+	jsdtoa.h	\
+	jshash.h	\
+	jslong.h	\
+	jsosdep.h	\
+	jstypes.h	\
+	jsprvtd.h	\
+	jspubtd.h	\
+	jsregexp.h	\
+	jsscan.h	\
+	jsscope.h	\
+	jsscript.h	\
+	jsstr.h		\
+	jsxdrapi.h	\
+	$(NULL)
+
+API_HFILES =		\
+	jsapi.h		\
+	jsdbgapi.h	\
+	$(NULL)
+
+OTHER_HFILES =		\
+	jsbit.h		\
+	jscompat.h	\
+	jscpucfg.h	\
+	jsotypes.h	\
+	jsstddef.h	\
+	prmjtime.h	\
+	resource.h	\
+	jsopcode.tbl	\
+	js.msg		\
+	jsshell.msg	\
+	$(NULL)
+
+ifndef PREBUILT_CPUCFG
+OTHER_HFILES += $(OBJDIR)/jsautocfg.h
+endif
+
+HFILES = $(JS_HFILES) $(API_HFILES) $(OTHER_HFILES)
+
+JS_CFILES =		\
+	jsapi.c		\
+	jsarena.c	\
+	jsarray.c	\
+	jsatom.c	\
+	jsbool.c	\
+	jscntxt.c	\
+	jsdate.c	\
+	jsdbgapi.c	\
+	jsdtoa.c	\
+	jsemit.c	\
+	jsexn.c		\
+	jsfun.c		\
+	jsgc.c		\
+	jshash.c	\
+	jsinterp.c	\
+	jslock.c	\
+	jslog2.c	\
+	jslong.c	\
+	jsmath.c	\
+	jsnum.c		\
+	jsobj.c		\
+	jsopcode.c      \
+	jsparse.c	\
+	jsprf.c		\
+	jsregexp.c	\
+	jsscan.c	\
+	jsscope.c	\
+	jsscript.c	\
+	jsstr.c		\
+	jsutil.c        \
+	jsxdrapi.c	\
+	prmjtime.c	\
+	$(NULL)
+
+PREDIRS   += fdlibm
+ifdef USE_MSVC
+FDLIBM_LIBRARY = fdlibm/$(OBJDIR)/fdlibm.lib
+else
+FDLIBM_LIBRARY = fdlibm/$(OBJDIR)/libfdm.a
+endif
+JSMATH_PRELINK	= $(OBJDIR)/jsmathtemp.o
+# Flag for incremental linking
+DASH_R		= -r
+
+ifeq ($(OS_ARCH),QNX)
+ifneq ($(OS_TARGET),NTO)
+# Don't use wildcard here, because we only want this resolved at link time.
+OBJS		+= fdlibm/*.o
+endif
+endif
+
+ifdef JS_LIVECONNECT
+DIRS      += liveconnect
+endif
+
+ifdef JS_PERLCONNECT
+JS_CFILES += perlconnect/jsperl.c
+endif
+
+ifdef JS_HAS_FILE_OBJECT
+JS_CFILES += jsfile.c
+JS_HFILES += jsfile.h
+endif
+
+LIB_CFILES  = $(JS_CFILES)
+LIB_ASFILES := $(wildcard *_$(OS_ARCH).s)
+PROG_CFILES = js.c
+
+ifdef USE_MSVC
+LIBRARY = $(OBJDIR)/js32.lib
+SHARED_LIBRARY = $(OBJDIR)/js32.dll
+PROGRAM = $(OBJDIR)/js.exe
+else
+LIBRARY = $(OBJDIR)/libjs.a
+SHARED_LIBRARY = $(OBJDIR)/libjs.$(SO_SUFFIX)
+PROGRAM = $(OBJDIR)/js
+endif
+
+include rules.mk
+
+MOZ_DEPTH = ../..
+include jsconfig.mk
+
+nsinstall-target:
+	cd ../../config; $(MAKE) OBJDIR=$(OBJDIR) OBJDIR_NAME=$(OBJDIR)
+ifdef USE_MSVC
+$(PROGRAM): $(PROG_OBJS) $(LIBRARY) $(FDLIBM_LIBRARY)
+	link.exe -out:"$@" $(EXE_LINK_FLAGS) $^
+else
+$(PROGRAM): $(PROG_OBJS) $(LIBRARY) $(FDLIBM_LIBRARY)
+	$(CC) -o $@ $(CFLAGS) $(PROG_OBJS) $(LIBRARY) $(LDFLAGS) $(OTHER_LIBS) \
+	    $(PROG_LIBS)
+endif
+
+$(PROGRAM).pure: $(PROG_OBJS) $(LIBRARY)
+	purify $(PUREFLAGS) \
+	    $(CC) -o $@ $(PURE_OS_CFLAGS) $(PROG_OBJS) $(LIBRARY) $(LDFLAGS) \
+		$(OTHER_LIBS) $(PROG_LIBS)
+
+ifndef PREBUILT_CPUCFG
+$(HFILES) $(CFILES): $(OBJDIR)/jsautocfg.h
+
+$(OBJDIR)/jsautocfg.h: $(OBJDIR)/jscpucfg
+	rm -f $@
+	$(OBJDIR)/jscpucfg > $@
+
+$(OBJDIR)/jscpucfg: $(OBJDIR)/jscpucfg.o
+	$(CC) -o $@ $(OBJDIR)/jscpucfg.o
+
+# Look in OBJDIR to find jsautocfg.h
+INCLUDES   += -I$(OBJDIR)
+
+# Add to TARGETS for clobber rule
+TARGETS += $(OBJDIR)/jsautocfg.h $(OBJDIR)/jscpucfg $(OBJDIR)/jscpucfg.o
+endif
+
+
+# special rule for jsmath.o since we want to incrementally link
+# against fdlibm to pull in only what is needed
+$(OBJDIR)/jsmath.o: $(FDLIBM_LIBRARY) $(JSMATH_PRELINK)
+ifeq ($(OS_ARCH),QNX)
+ifneq ($(OS_TARGET),NTO)
+	@cp $(JSMATH_PRELINK) $@
+else	
+	$(LD) $(DASH_R) -o $@ $(JSMATH_PRELINK) $(FDLIBM_LIBRARY)
+endif
+else
+ifdef USE_MSVC
+	@echo Warning: to use $(LIBRARY) must also link against $(FDLIBM_LIBRARY)
+	@cp $(JSMATH_PRELINK) $@
+endif
+	$(LD) $(DASH_R) -o $@ $(JSMATH_PRELINK) $(FDLIBM_LIBRARY)
+endif
+
+$(JSMATH_PRELINK): jsmath.c
+ifneq (,$(filter OS2 WINNT,$(OS_ARCH)))
+	$(CC) -Fo$@ -c $(CFLAGS) $<
+else
+	$(CC) -o $@ -c $(CFLAGS) $<
+endif
+
+#
+# Hardwire dependencies on jsopcode.tbl
+#
+jsopcode.h jsopcode.c: jsopcode.tbl
+
+-include $(DEPENDENCIES)
+
+TARNAME = jsref.tar
+TARFILES = files `cat files`
+
+SUFFIXES: .i
+%.i: %.c
+	$(CC) -C -E $(CFLAGS) $< > $*.i

mozilla/js/src/README.html

@@ -0,0 +1,804 @@
+<!-- 
+   - The contents of this file are subject to the Netscape Public
+   - License Version 1.1 (the "License"); you may not use this file
+   - except in compliance with the License. You may obtain a copy of
+   - the License at http://www.mozilla.org/NPL/
+   - 
+   - Software distributed under the License is distributed on an "AS
+   - IS" basis, WITHOUT WARRANTY OF ANY KIND, either express or
+   - implied. See the License for the specific language governing
+   - rights and limitations under the License.
+   - 
+   - The Original Code is Mozilla Communicator client code, released
+   - March 31, 1998.
+   - 
+   - The Initial Developer of the Original Code is Netscape
+   - Communications Corporation. Portions created by Netscape are
+   - Copyright (C) 1998-1999 Netscape Communications Corporation. All
+   - Rights Reserved.
+   - 
+   - Contributor(s):
+   - 
+   - Alternatively, the contents of this file may be used under the
+   - terms of the GNU Public License (the "GPL"), in which case the
+   - provisions of the GPL are applicable instead of those above.
+   - If you wish to allow use of your version of this file only
+   - under the terms of the GPL and not to allow others to use your
+   - version of this file under the NPL, indicate your decision by
+   - deleting the provisions above and replace them with the notice
+   - and other provisions required by the GPL.  If you do not delete
+   - the provisions above, a recipient may use your version of this
+   - file under either the NPL or the GPL.
+  -->
+<!doctype html public "-//w3c//dtd html 4.0 transitional//en">
+<html>
+<head>
+   <meta http-equiv="Content-Type" content="text/html; charset=iso-8859-1">
+   <meta name="GENERATOR" content="Mozilla/4.5 [en] (WinNT; I) [Netscape]">
+   <title>JavaScript Reference Implementation (JSRef) README</title>
+</head>
+<body>
+
+<h2>
+Table of Contents</h2>
+
+<ul>
+<li>
+<a href="#Introduction">Introduction</a></li>
+
+<li>
+<a href="#Build">Build conventions (standalone JS engine and shell)</a></li>
+
+<li>
+<a href="#Debugging">Debugging notes</a></li>
+
+<li>
+<a href="#Conventions">Naming and coding conventions</a></li>
+
+<li>
+<a href="#JSAPI">Using the JS API</a></li>
+
+<li>
+<a href="#Design">Design walk-through</a></li>
+
+<li>
+<a href="#Resources">Additional Resources (links, API docs, and newsgroups)</a></li>
+
+</ul>
+
+<h2>
+<a NAME="Introduction"></a>Introduction</h2>
+This is the README file for the&nbsp;<span CLASS=LXRSHORTDESC>JavaScript
+Reference (JSRef) implementation.</span> It consists of build conventions
+and instructions, source code conventions, a design walk-through, and a
+brief file-by-file description of the source.
+<p><span CLASS=LXRLONGDESC>JSRef builds a library or DLL containing the
+JavaScript runtime (compiler, interpreter, decompiler, garbage collector,
+atom manager, standard classes). It then compiles a small "shell" program
+and links that with the library to make an interpreter that can be used
+interactively and with test .js files to run scripts.&nbsp; The code has
+no dependencies on the Navigator code.</span>
+<p><i>Quick start tip</i>: skip to "Using the JS API" below, build the
+js shell, and play with the object named "it" (start by setting 'it.noisy
+= true').
+<h2>
+<a NAME="Build"></a>Build conventions (standalone JS engine and shell)</h2>
+These build directions refer only to building the standalone JavaScript
+engine and shell.&nbsp; To build within the browser, refer to the <a href="http://www.mozilla.org/docs/">build
+directions</a> on the mozilla.org website.
+<p>By default, all platforms build a version of the JS engine that is <i>not</i>
+threadsafe.&nbsp; If you require thread-safety, you must also populate
+the <tt>mozilla/dist</tt> directory with <a href="http://www.mozilla.org/docs/tplist/catCode/nsprdesc.htm">NSPR</a>
+headers and libraries.&nbsp; (NSPR implements a portable threading library,
+among other things.&nbsp; The source is downloadable via <a href="http://www.mozilla.org/cvs.html">CVS</a>
+from <tt><a href="http://lxr.mozilla.org/mozilla/source/nsprpub">mozilla/nsprpub</a></tt>.)&nbsp;
+Next, you must define <tt>JS_THREADSAFE</tt> when building the JS engine,
+either on the command-line (gmake/nmake) or in a universal header file.
+<h3>
+Windows</h3>
+
+<ul>
+<li>
+Use MSVC 4.2 or 5.0.</li>
+
+<li>
+For building from the IDE use <tt>js/src/js.mdp</tt>.&nbsp; (<tt>js.mdp</tt>
+is an MSVC4.2 project file, but if you load it into MSVC5, it will be converted
+to the newer project file format.)&nbsp; <font color="#CC0000">NOTE: makefile.win
+is an nmake file used only for building the JS-engine in the Mozilla browser.&nbsp;
+Don't attempt to use it to build the standalone JS-engine.</font></li>
+
+<li>
+If you prefer to build from the command-line, use '<tt>nmake -f js.mak</tt>'</li>
+
+<li>
+Executable shell <tt>js.exe</tt> and runtime library <tt>js32.dll</tt>
+are created in either <tt>js/src/Debug</tt> or <tt>js/src/Release</tt>.</li>
+</ul>
+
+<h3>
+Macintosh</h3>
+
+<ul>
+<li>
+Use CodeWarrior 3.x</li>
+
+<li>
+Load the project file <tt>js:src:macbuild:JSRef.mcp </tt>and select "Make"
+from the menu.</li>
+</ul>
+
+<h3>
+Unix</h3>
+
+<ul>
+<li>
+Use '<tt>gmake -f Makefile.ref</tt>' to build. To compile optimized code,
+pass <tt>BUILD_OPT=1</tt> on the gmake command line or preset it in the
+environment or <tt>Makefile.ref</tt>.&nbsp; <font color="#CC0000">NOTE:
+Do not attempt to use Makefile to build the standalone JavaScript engine.&nbsp;
+This file is used only for building the JS-engine in the Mozilla browser.</font></li>
+
+<li>
+<font color="#000000">Each platform on which JS is built must have a <tt>*.mk</tt>
+configuration file in the <tt>js/src/config</tt> directory.&nbsp; The configuration
+file specifies the compiler/linker to be used and allows for customization
+of command-line options.&nbsp; To date, the build system has been tested
+on Solaris, AIX, HP/UX, OSF, IRIX, x86 Linux and Windows NT.</font></li>
+
+<li>
+<font color="#000000">Most platforms will work with either the vendor compiler
+</font>or
+<a href="ftp://prep.ai.mit.edu/pub/gnu">gcc</a>.&nbsp;
+(Except that HP builds only work using the native compiler.&nbsp; gcc won't
+link correctly with shared libraries on that platform.&nbsp; If someone
+knows a way to fix this, <a href="mailto:wynholds@netscape.com">let us
+know</a>.)</li>
+
+<li>
+<font color="#000000">If you define <tt>JS_LIVECONNECT</tt>, gmake will
+descend into the liveconnect directory and build 
+<a href="http://lxr.mozilla.org/mozilla/source/js/src/liveconnect/README.html">LiveConnect</a>
+after building the JS engine.</font></li>
+
+<li>
+To build a binary drop (a zip'ed up file of headers, libraries, binaries),
+check out <tt>mozilla/config</tt> and <tt>mozilla/nsprpub/config</tt>.&nbsp;
+Use '<tt>gmake -f Makefile.ref nsinstall-target all export ship</tt>'</li>
+</ul>
+
+<h2>
+<a NAME="Debugging"></a>Debugging notes</h2>
+
+<ul>
+<li>
+To turn on GC instrumentation, define <tt>JS_GCMETER</tt>.</li>
+
+<li>
+To turn on the arena package's instrumentation, define <tt>JS_ARENAMETER</tt>.</li>
+
+<li>
+To turn on the hash table package's metering, define <tt>JS_HASHMETER</tt>.</li>
+</ul>
+
+<h2>
+<a NAME="Conventions"></a>Naming and coding conventions</h2>
+
+<ul>
+<li>
+Public function names begin with <tt>JS_</tt> followed by capitalized "intercaps",
+e.g. <tt>JS_NewObject</tt>.</li>
+
+<li>
+Extern but library-private function names use a <tt>js_</tt> prefix and
+mixed case, e.g. <tt>js_LookupSymbol</tt>.</li>
+
+<li>
+Most static function names have unprefixed, mixed-case names: <tt>GetChar</tt>.</li>
+
+<li>
+But static native methods of JS objects have lowercase, underscore-separated
+or intercaps names, e.g., <tt>str_indexOf</tt>.</li>
+
+<li>
+And library-private and static data use underscores, not intercaps (but
+library-private data do use a <tt>js_</tt> prefix).</li>
+
+<li>
+Scalar type names are lowercase and js-prefixed: <tt>jsdouble</tt>.</li>
+
+<li>
+Aggregate type names are JS-prefixed and mixed-case: <tt>JSObject.</tt></li>
+
+<li>
+Macros are generally <tt>ALL_CAPS </tt>and underscored, to call out potential
+side effects, multiple uses of a formal argument, etc. - Four spaces of
+indentation per statement nesting level.</li>
+
+<li>
+Tabs are taken to be eight spaces, and an Emacs magic comment at the top
+of each file tries to help. If you're using MSVC or similar, you'll want
+to set tab width to 8, or convert these files to be space-filled.</li>
+
+<li>
+DLL entry points have their return type expanded within a <tt>JS_PUBLIC_API()</tt>
+macro call, to get the right Windows secret type qualifiers in the right
+places for both 16- and 32-bit builds.</li>
+
+<li>
+Callback functions that might be called from a DLL are similarly macroized
+with <tt>JS_STATIC_DLL_CALLBACK</tt> (if the function otherwise would be
+static to hide its name) or <tt>JS_DLL_CALLBACK</tt> (this macro takes
+no type argument; it should be used after the return type and before the
+function name).</li>
+</ul>
+
+<h2>
+<a NAME="JSAPI"></a>Using the JS API</h2>
+
+<h4>
+Starting up</h4>
+
+<pre><tt>&nbsp;&nbsp;&nbsp; /*
+&nbsp;&nbsp;&nbsp;&nbsp; * Tune this to avoid wasting space for shallow stacks, while saving on
+&nbsp;&nbsp;&nbsp;&nbsp; * malloc overhead/fragmentation for deep or highly-variable stacks.
+&nbsp;&nbsp;&nbsp;&nbsp; */
+&nbsp;&nbsp;&nbsp; #define STACK_CHUNK_SIZE&nbsp;&nbsp;&nbsp; 8192
+
+&nbsp;&nbsp;&nbsp; JSRuntime *rt;
+&nbsp;&nbsp;&nbsp; JSContext *cx;
+
+&nbsp;&nbsp;&nbsp; /* You need a runtime and one or more contexts to do anything with JS. */
+&nbsp;&nbsp;&nbsp; rt = JS_Init(1000000L);
+&nbsp;&nbsp;&nbsp; if (!rt)
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; fail("can't create JavaScript runtime");
+&nbsp;&nbsp;&nbsp; cx = JS_NewContext(rt, STACK_CHUNK_SIZE);
+&nbsp;&nbsp;&nbsp; if (!cx)
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; fail("can't create JavaScript context");
+
+&nbsp;&nbsp;&nbsp; /*
+&nbsp;&nbsp;&nbsp;&nbsp; * The context definitely wants a global object, in order to have standard
+&nbsp;&nbsp;&nbsp;&nbsp; * classes and functions like Date and parseInt.&nbsp; See below for details on
+&nbsp;&nbsp;&nbsp;&nbsp; * JS_NewObject.
+&nbsp;&nbsp;&nbsp;&nbsp; */
+&nbsp;&nbsp;&nbsp; JSObject *globalObj;
+
+&nbsp;&nbsp;&nbsp; globalObj = JS_NewObject(cx, &amp;my_global_class, 0, 0);
+&nbsp;&nbsp;&nbsp; JS_InitStandardClasses(cx, globalObj);</tt></pre>
+
+<h4>
+Defining objects and properties</h4>
+
+<pre><tt>&nbsp;&nbsp;&nbsp; /* Statically initialize a class to make "one-off" objects. */
+&nbsp;&nbsp;&nbsp; JSClass my_class = {
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; "MyClass",
+
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; /* All of these can be replaced with the corresponding JS_*Stub
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; function pointers. */
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; my_addProperty, my_delProperty, my_getProperty, my_setProperty,
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; my_enumerate,&nbsp;&nbsp; my_resolve,&nbsp;&nbsp;&nbsp;&nbsp; my_convert,&nbsp;&nbsp;&nbsp;&nbsp; my_finalize
+&nbsp;&nbsp;&nbsp; };
+
+&nbsp;&nbsp;&nbsp; JSObject *obj;
+
+&nbsp;&nbsp;&nbsp; /*
+&nbsp;&nbsp;&nbsp;&nbsp; * Define an object named in the global scope that can be enumerated by
+&nbsp;&nbsp;&nbsp;&nbsp; * for/in loops.&nbsp; The parent object is passed as the second argument, as
+&nbsp;&nbsp;&nbsp;&nbsp; * with all other API calls that take an object/name pair.&nbsp; The prototype
+&nbsp;&nbsp;&nbsp;&nbsp; * passed in is null, so the default object prototype will be used.
+&nbsp;&nbsp;&nbsp;&nbsp; */
+&nbsp;&nbsp;&nbsp; obj = JS_DefineObject(cx, globalObj, "myObject", &amp;my_class, 0,
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; JSPROP_ENUMERATE);
+
+&nbsp;&nbsp;&nbsp; /*
+&nbsp;&nbsp;&nbsp;&nbsp; * Define a bunch of properties with a JSPropertySpec array statically
+&nbsp;&nbsp;&nbsp;&nbsp; * initialized and terminated with a null-name entry.&nbsp; Besides its name,
+&nbsp;&nbsp;&nbsp;&nbsp; * each property has a "tiny" identifier (MY_COLOR, e.g.) that can be used
+&nbsp;&nbsp;&nbsp;&nbsp; * in switch statements (in a common my_getProperty function, for example).
+&nbsp;&nbsp;&nbsp;&nbsp; */
+&nbsp;&nbsp;&nbsp; enum my_tinyid {
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; MY_COLOR, MY_HEIGHT, MY_WIDTH, MY_FUNNY, MY_ARRAY, MY_RDONLY
+&nbsp;&nbsp;&nbsp; };
+
+&nbsp;&nbsp;&nbsp; static JSPropertySpec my_props[] = {
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; {"color",&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; MY_COLOR,&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; JSPROP_ENUMERATE},
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; {"height",&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; MY_HEIGHT,&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; JSPROP_ENUMERATE},
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; {"width",&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; MY_WIDTH,&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; JSPROP_ENUMERATE},
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; {"funny",&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; MY_FUNNY,&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; JSPROP_ENUMERATE},
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; {"array",&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; MY_ARRAY,&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; JSPROP_ENUMERATE},
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; {"rdonly",&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; MY_RDONLY,&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; JSPROP_READONLY},
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; {0}
+&nbsp;&nbsp;&nbsp; };
+
+&nbsp;&nbsp;&nbsp; JS_DefineProperties(cx, obj, my_props);
+
+&nbsp;&nbsp;&nbsp; /*
+&nbsp;&nbsp;&nbsp;&nbsp; * Given the above definitions and call to JS_DefineProperties, obj will
+&nbsp;&nbsp;&nbsp;&nbsp; * need this sort of "getter" method in its class (my_class, above).&nbsp; See
+&nbsp;&nbsp;&nbsp;&nbsp; * the example for the "It" class in js.c.
+&nbsp;&nbsp;&nbsp;&nbsp; */
+&nbsp;&nbsp;&nbsp; static JSBool
+&nbsp;&nbsp;&nbsp; my_getProperty(JSContext *cx, JSObject *obj, jsval id, jsval *vp)
+&nbsp;&nbsp;&nbsp; {
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; if (JSVAL_IS_INT(id)) {
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; switch (JSVAL_TO_INT(id)) {
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; case MY_COLOR:&nbsp; *vp = . . .; break;
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; case MY_HEIGHT: *vp = . . .; break;
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; case MY_WIDTH:&nbsp; *vp = . . .; break;
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; case MY_FUNNY:&nbsp; *vp = . . .; break;
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; case MY_ARRAY:&nbsp; *vp = . . .; break;
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; case MY_RDONLY: *vp = . . .; break;
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; }
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; }
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; return JS_TRUE;
+&nbsp;&nbsp;&nbsp; }</tt></pre>
+
+<h4>
+Defining functions</h4>
+
+<pre><tt>&nbsp;&nbsp;&nbsp; /* Define a bunch of native functions first: */
+&nbsp;&nbsp;&nbsp; static JSBool
+&nbsp;&nbsp;&nbsp; my_abs(JSContext *cx, JSObject *obj, uintN argc, jsval *argv, jsval *rval)
+&nbsp;&nbsp;&nbsp; {
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; jsdouble x, z;
+
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; if (!JS_ValueToNumber(cx, argv[0], &amp;x))
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; return JS_FALSE;
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; z = (x &lt; 0) ? -x : x;
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; return JS_NewDoubleValue(cx, z, rval);
+&nbsp;&nbsp;&nbsp; }
+
+&nbsp;&nbsp;&nbsp; . . .
+
+&nbsp;&nbsp;&nbsp; /*
+&nbsp;&nbsp;&nbsp;&nbsp; * Use a JSFunctionSpec array terminated with a null name to define a
+&nbsp;&nbsp;&nbsp;&nbsp; * bunch of native functions.
+&nbsp;&nbsp;&nbsp;&nbsp; */
+&nbsp;&nbsp;&nbsp; static JSFunctionSpec my_functions[] = {
+&nbsp;&nbsp;&nbsp; /*&nbsp;&nbsp;&nbsp; name&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; native&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; nargs&nbsp;&nbsp;&nbsp; */
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; {"abs",&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; my_abs,&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; 1},
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; {"acos",&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; my_acos,&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; 1},
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; {"asin",&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; my_asin,&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; 1},
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; . . .
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; {0}
+&nbsp;&nbsp;&nbsp; };
+
+&nbsp;&nbsp;&nbsp; /*
+&nbsp;&nbsp;&nbsp;&nbsp; * Pass a particular object to define methods for it alone.&nbsp; If you pass
+&nbsp;&nbsp;&nbsp;&nbsp; * a prototype object, the methods will apply to all instances past and
+&nbsp;&nbsp;&nbsp;&nbsp; * future of the prototype's class (see below for classes).
+&nbsp;&nbsp;&nbsp;&nbsp; */
+&nbsp;&nbsp;&nbsp; JS_DefineFunctions(cx, globalObj, my_functions);</tt></pre>
+
+<h4>
+Defining classes</h4>
+
+<pre><tt>&nbsp;&nbsp;&nbsp; /*
+&nbsp;&nbsp;&nbsp;&nbsp; * This pulls together the above API elements by defining a constructor
+&nbsp;&nbsp;&nbsp;&nbsp; * function, a prototype object, and properties of the prototype and of
+&nbsp;&nbsp;&nbsp;&nbsp; * the constructor, all with one API call.
+&nbsp;&nbsp;&nbsp;&nbsp; *
+&nbsp;&nbsp;&nbsp;&nbsp; * Initialize a class by defining its constructor function, prototype, and
+&nbsp;&nbsp;&nbsp;&nbsp; * per-instance and per-class properties.&nbsp; The latter are called "static"
+&nbsp;&nbsp;&nbsp;&nbsp; * below by analogy to Java.&nbsp; They are defined in the constructor object's
+&nbsp;&nbsp;&nbsp;&nbsp; * scope, so that 'MyClass.myStaticProp' works along with 'new MyClass()'.
+&nbsp;&nbsp;&nbsp;&nbsp; *
+&nbsp;&nbsp;&nbsp;&nbsp; * JS_InitClass takes a lot of arguments, but you can pass null for any of
+&nbsp;&nbsp;&nbsp;&nbsp; * the last four if there are no such properties or methods.
+&nbsp;&nbsp;&nbsp;&nbsp; *
+&nbsp;&nbsp;&nbsp;&nbsp; * Note that you do not need to call JS_InitClass to make a new instance of
+&nbsp;&nbsp;&nbsp;&nbsp; * that class -- otherwise there would be a chicken-and-egg problem making
+&nbsp;&nbsp;&nbsp;&nbsp; * the global object -- but you should call JS_InitClass if you require a
+&nbsp;&nbsp;&nbsp;&nbsp; * constructor function for script authors to call via new, and/or a class
+&nbsp;&nbsp;&nbsp;&nbsp; * prototype object ('MyClass.prototype') for authors to extend with new
+&nbsp;&nbsp;&nbsp;&nbsp; * properties at run-time.
+&nbsp;&nbsp;&nbsp;&nbsp; */
+&nbsp;&nbsp;&nbsp; protoObj = JS_InitClass(cx, globalObj, NULL, &amp;my_class,
+
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; /* native constructor function and min arg count */
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; MyClass, 0,
+
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; /* prototype object properties and methods -- these
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; will be "inherited" by all instances through
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; delegation up the instance's prototype link. */
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; my_props, my_methods,
+
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; /* class constructor properties and methods */
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; my_static_props, my_static_methods);</tt></pre>
+
+<h4>
+Running scripts</h4>
+
+<pre><tt>&nbsp;&nbsp;&nbsp; /* These should indicate source location for diagnostics. */
+&nbsp;&nbsp;&nbsp; char *filename;
+&nbsp;&nbsp;&nbsp; uintN lineno;
+
+&nbsp;&nbsp;&nbsp; /*
+&nbsp;&nbsp;&nbsp;&nbsp; * The return value comes back here -- if it could be a GC thing, you must
+&nbsp;&nbsp;&nbsp;&nbsp; * add it to the GC's "root set" with JS_AddRoot(cx, &amp;thing) where thing
+&nbsp;&nbsp;&nbsp;&nbsp; * is a JSString *, JSObject *, or jsdouble *, and remove the root before
+&nbsp;&nbsp;&nbsp;&nbsp; * rval goes out of scope, or when rval is no longer needed.
+&nbsp;&nbsp;&nbsp;&nbsp; */
+&nbsp;&nbsp;&nbsp; jsval rval;
+&nbsp;&nbsp;&nbsp; JSBool ok;
+
+&nbsp;&nbsp;&nbsp; /*
+&nbsp;&nbsp;&nbsp;&nbsp; * Some example source in a C string.&nbsp; Larger, non-null-terminated buffers
+&nbsp;&nbsp;&nbsp;&nbsp; * can be used, if you pass the buffer length to JS_EvaluateScript.
+&nbsp;&nbsp;&nbsp;&nbsp; */
+&nbsp;&nbsp;&nbsp; char *source = "x * f(y)";
+
+&nbsp;&nbsp;&nbsp; ok = JS_EvaluateScript(cx, globalObj, source, strlen(source),
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; filename, lineno, &amp;rval);
+
+&nbsp;&nbsp;&nbsp; if (ok) {
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; /* Should get a number back from the example source. */
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; jsdouble d;
+
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; ok = JS_ValueToNumber(cx, rval, &amp;d);
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; . . .
+&nbsp;&nbsp;&nbsp; }</tt></pre>
+
+<h4>
+Calling functions</h4>
+
+<pre><tt>&nbsp;&nbsp;&nbsp; /* Call a global function named "foo" that takes no arguments. */
+&nbsp;&nbsp;&nbsp; ok = JS_CallFunctionName(cx, globalObj, "foo", 0, 0, &amp;rval);
+
+&nbsp;&nbsp;&nbsp; jsval argv[2];
+
+&nbsp;&nbsp;&nbsp; /* Call a function in obj's scope named "method", passing two arguments. */
+&nbsp;&nbsp;&nbsp; argv[0] = . . .;
+&nbsp;&nbsp;&nbsp; argv[1] = . . .;
+&nbsp;&nbsp;&nbsp; ok = JS_CallFunctionName(cx, obj, "method", 2, argv, &amp;rval);</tt></pre>
+
+<h4>
+Shutting down</h4>
+
+<pre><tt>&nbsp;&nbsp;&nbsp; /* For each context you've created: */
+&nbsp;&nbsp;&nbsp; JS_DestroyContext(cx);
+
+&nbsp;&nbsp;&nbsp; /* And finally: */
+&nbsp;&nbsp;&nbsp; JS_Finish(rt);</tt></pre>
+
+<h4>
+Debugging API</h4>
+See the<tt> trap, untrap, watch, unwatch, line2pc</tt>, and <tt>pc2line</tt>
+commands in <tt>js.c</tt>. Also the (scant) comments in <i>jsdbgapi.h</i>.
+<h2>
+<a NAME="Design"></a>Design walk-through</h2>
+This section must be brief for now -- it could easily turn into a book.
+<h4>
+JS "JavaScript Proper"</h4>
+JS modules declare and implement the JavaScript compiler, interpreter,
+decompiler, GC and atom manager, and standard classes.
+<p>JavaScript uses untyped bytecode and runtime type tagging of data values.
+The <tt>jsval</tt> type is a signed machine word that contains either a
+signed integer value (if the low bit is set), or a type-tagged pointer
+or boolean value (if the low bit is clear). Tagged pointers all refer to
+8-byte-aligned things in the GC heap.
+<p>Objects consist of a possibly shared structural description, called
+the map or scope; and unshared property values in a vector, called the
+slots. Object properties are associated with nonnegative integers stored
+in <tt>jsval</tt>'s, or with atoms (unique string descriptors) if named
+by an identifier or a non-integral index expression.
+<p>Scripts contain bytecode, source annotations, and a pool of string,
+number, and identifier literals. Functions are objects that extend scripts
+or native functions with formal parameters, a literal syntax, and a distinct
+primitive type ("function").
+<p>The compiler consists of a recursive-descent parser and a random-logic
+rather than table-driven lexical scanner. Semantic and lexical feedback
+are used to disambiguate hard cases such as missing semicolons, assignable
+expressions ("lvalues" in C parlance), etc. The parser generates bytecode
+as it parses, using fixup lists for downward branches and code buffering
+and rewriting for exceptional cases such as for loops. It attempts no error
+recovery. The interpreter executes the bytecode of top-level scripts, and
+calls itself indirectly to interpret function bodies (which are also scripts).
+All state associated with an interpreter instance is passed through formal
+parameters to the interpreter entry point; most implicit state is collected
+in a type named JSContext. Therefore, all API and almost all other functions
+in JSRef take a JSContext pointer as their first argument.
+<p>The decompiler translates postfix bytecode into infix source by consulting
+a separate byte-sized code, called source notes, to disambiguate bytecodes
+that result from more than one grammatical production.
+<p>The GC is a mark-and-sweep, non-conservative (perfect) collector. It
+can allocate only fixed-sized things -- the current size is two machine
+words. It is used to hold JS object and string descriptors (but not property
+lists or string bytes), and double-precision floating point numbers. It
+runs automatically only when maxbytes (as passed to <tt>JS_Init()</tt>)
+bytes of GC things have been allocated and another thing-allocation request
+is made. JS API users should call <tt>JS_GC()</tt> or <tt>JS_MaybeGC()</tt>
+between script executions or from the branch callback, as often as necessary.
+<p>An important point about the GC's "perfection": you must add roots for
+new objects created by your native methods if you store references to them
+into a non-JS structure in the malloc heap or in static data. Also, if
+you make a new object in a native method, but do not store it through the
+<tt>rval</tt>
+result parameter (see math_abs in the "Using the JS API" section above)
+so that it is in a known root, the object is guaranteed to survive only
+until another new object is created. Either lock the first new object when
+making two in a row, or store it in a root you've added, or store it via
+rval.
+<p>The atom manager consists of a hash table associating strings uniquely
+with scanner/parser information such as keyword type, index in script or
+function literal pool, etc. Atoms play three roles in JSRef: as literals
+referred to by unaligned 16-bit immediate bytecode operands, as unique
+string descriptors for efficient property name hashing, and as members
+of the root GC set for perfect GC. This design therefore requires atoms
+to be manually reference counted, from script literal pools (<tt>JSAtomMap</tt>)
+and object symbol (<tt>JSSymbol</tt>) entry keys.
+<p>Native objects and methods for arrays, booleans, dates, functions, numbers,
+and strings are implemented using the JS API and certain internal interfaces
+used as "fast paths".
+<p>In general, errors are signaled by false or unoverloaded-null return
+values, and are reported using <tt>JS_ReportError()</tt> or one of its
+variants by the lowest level in order to provide the most detail. Client
+code can substitute its own error reporting function and suppress errors,
+or reflect them into Java or some other runtime system as exceptions, GUI
+dialogs, etc..
+<h2>
+File walk-through (BADLY OUT OF DATE!)</h2>
+
+<h4>
+jsapi.c, jsapi.h</h4>
+The public API to be used by almost all client code.&nbsp; If your client
+code can't make do with <tt>jsapi.h</tt>, and must reach into a friend
+or private js* file, please let us know so we can extend <tt>jsapi.h</tt>
+to include what you need in a fashion that we can support over the long
+run.
+<h4>
+jspubtd.h, jsprvtd.h</h4>
+These files exist to group struct and scalar typedefs so they can be used
+everywhere without dragging in struct definitions from N different files.
+The <tt>jspubtd.h</tt> file contains public typedefs, and is included by
+<tt>jsapi.h</tt>.
+The <tt>jsprvtd.h</tt> file contains private typedefs and is included by
+various .h files that need type names, but not type sizes or declarations.
+<h4>
+jsdbgapi.c, jsdbgapi.h</h4>
+The Debugging API, still very much under development. Provided so far:
+<ul>
+<li>
+Traps, with which breakpoints, single-stepping, step over, step out, and
+so on can be implemented. The debugger will have to consult jsopcode.def
+on its own to figure out where to plant trap instructions to implement
+functions like step out, but a future jsdbgapi.h will provide convenience
+interfaces to do these things. At most one trap per bytecode can be set.
+When a script (<tt>JSScript</tt>) is destroyed, all traps set in its bytecode
+are cleared.</li>
+
+<li>
+Watchpoints, for intercepting set operations on properties and running
+a debugger-supplied function that receives the old value and a pointer
+to the new one, which it can use to modify the new value being set.</li>
+
+<li>
+Line number to PC and back mapping functions. The line-to-PC direction
+"rounds" toward the next bytecode generated from a line greater than or
+equal to the input line, and may return the PC of a for-loop update part,
+if given the line number of the loop body's closing brace. Any line after
+the last one in a script or function maps to a PC one byte beyond the last
+bytecode in the script. An example, from perfect.js:</li>
+
+<pre><tt>14&nbsp;&nbsp; function perfect(n)
+15&nbsp;&nbsp; {
+16&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; print("The perfect numbers up to " +&nbsp; n + " are:");
+17
+18&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; // We build sumOfDivisors[i] to hold a string expression for
+19&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; // the sum of the divisors of i, excluding i itself.
+20&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; var sumOfDivisors = new ExprArray(n+1,1);
+21&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; for (var divisor = 2; divisor &lt;= n; divisor++) {
+22&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; for (var j = divisor + divisor; j &lt;= n; j += divisor) {
+23&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; sumOfDivisors[j] += " + " + divisor;
+24&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; }
+25&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; // At this point everything up to 'divisor' has its sumOfDivisors
+26&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; // expression calculated, so we can determine whether it's perfect
+27&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; // already by evaluating.
+28&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; if (eval(sumOfDivisors[divisor]) == divisor) {
+29&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; print("" + divisor + " = " + sumOfDivisors[divisor]);
+30&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; }
+31&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; }
+32&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; delete sumOfDivisors;
+33&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; print("That's all.");
+34&nbsp;&nbsp; }</tt></pre>
+The line number to PC and back mappings can be tested using the js program
+with the following script:
+<pre><tt>&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; load("perfect.js")
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; print(perfect)
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; dis(perfect)
+
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; print()
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; for (var ln = 0; ln &lt;= 40; ln++) {
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; var pc = line2pc(perfect,ln)
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; var ln2 = pc2line(perfect,pc)
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; print("\tline " + ln + " => pc " + pc + " => line " + ln2)
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; }</tt></pre>
+The result of the for loop over lines 0 to 40 inclusive is:
+<pre><tt>&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 0 => pc 0 => line 16
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 1 => pc 0 => line 16
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 2 => pc 0 => line 16
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 3 => pc 0 => line 16
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 4 => pc 0 => line 16
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 5 => pc 0 => line 16
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 6 => pc 0 => line 16
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 7 => pc 0 => line 16
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 8 => pc 0 => line 16
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 9 => pc 0 => line 16
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 10 => pc 0 => line 16
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 11 => pc 0 => line 16
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 12 => pc 0 => line 16
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 13 => pc 0 => line 16
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 14 => pc 0 => line 16
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 15 => pc 0 => line 16
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 16 => pc 0 => line 16
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 17 => pc 19 => line 20
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 18 => pc 19 => line 20
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 19 => pc 19 => line 20
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 20 => pc 19 => line 20
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 21 => pc 36 => line 21
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 22 => pc 53 => line 22
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 23 => pc 74 => line 23
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 24 => pc 92 => line 22
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 25 => pc 106 => line 28
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 26 => pc 106 => line 28
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 27 => pc 106 => line 28
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 28 => pc 106 => line 28
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 29 => pc 127 => line 29
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 30 => pc 154 => line 21
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 31 => pc 154 => line 21
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 32 => pc 161 => line 32
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 33 => pc 172 => line 33
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 34 => pc 172 => line 33
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 35 => pc 172 => line 33
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 36 => pc 172 => line 33
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 37 => pc 172 => line 33
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 38 => pc 172 => line 33
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 39 => pc 172 => line 33
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 40 => pc 172 => line 33</tt></pre>
+</ul>
+
+<h4>
+jsconfig.h</h4>
+Various configuration macros defined as 0 or 1 depending on how <tt>JS_VERSION</tt>
+is defined (as 10 for JavaScript 1.0, 11 for JavaScript 1.1, etc.). Not
+all macros are tested around related code yet. In particular, JS 1.0 support
+is missing from JSRef. JS 1.2 support will appear in a future JSRef release.
+<br>&nbsp;
+<h4>
+js.c</h4>
+The "JS shell", a simple interpreter program that uses the JS API and more
+than a few internal interfaces (some of these internal interfaces could
+be replaced by <tt>jsapi.h</tt> calls). The js program built from this
+source provides a test vehicle for evaluating scripts and calling functions,
+trying out new debugger primitives, etc.
+<h4>
+jsarray.*, jsbool.*, jdsdate.*, jsfun.*, jsmath.*, jsnum.*, jsstr.*</h4>
+These file pairs implement the standard classes and (where they exist)
+their underlying primitive types. They have similar structure, generally
+starting with class definitions and continuing with internal constructors,
+finalizers, and helper functions.
+<h4>
+jsobj.*, jsscope.*</h4>
+These two pairs declare and implement the JS object system. All of the
+following happen here:
+<ul>
+<li>
+creating objects by class and prototype, and finalizing objects;</li>
+
+<li>
+defining, looking up, getting, setting, and deleting properties;</li>
+
+<li>
+creating and destroying properties and binding names to them.</li>
+</ul>
+The details of an object map (scope) are mostly hidden in <tt>jsscope.[ch]</tt>,
+where scopes start out as linked lists of symbols, and grow after some
+threshold into PR hash tables.
+<h4>
+jsatom.c, jsatom.h</h4>
+The atom manager. Contains well-known string constants, their atoms, the
+global atom hash table and related state, the js_Atomize() function that
+turns a counted string of bytes into an atom, and literal pool (<tt>JSAtomMap</tt>)
+methods.
+<h4>
+jsgc.c, jsgc.h</h4>
+[TBD]
+<h4>
+jsinterp.*, jscntxt.*</h4>
+The bytecode interpreter, and related functions such as Call and AllocStack,
+live in <i>jsinterp.c</i>. The JSContext constructor and destructor are
+factored out into <i>jscntxt.c</i> for minimal linking when the compiler
+part of JS is split from the interpreter part into a separate program.
+<h4>
+jsemit.*, jsopcode.tbl, jsopcode.*, jsparse.*, jsscan.*, jsscript.*</h4>
+Compiler and decompiler modules. The <i>jsopcode.tbl</i> file is a C preprocessor
+source that defines almost everything there is to know about JS bytecodes.
+See its major comment for how to use it. For now, a debugger will use it
+and its dependents such as <i>jsopcode.h</i> directly, but over time we
+intend to extend <i>jsdbgapi.h</i> to hide uninteresting details and provide
+conveniences. The code generator is split across paragraphs of code in
+<i>jsparse.c</i>,
+and the utility methods called on <tt>JSCodeGenerator</tt> appear in <i>jsemit.c</i>.
+Source notes generated by <i>jsparse.c</i> and
+<i>jsemit.c</i> are used
+in <i>jsscript.c</i> to map line number to program counter and back.
+<h4>
+jstypes.h, jslog2.c</h4>
+Fundamental representation types and utility macros. This file alone among
+all .h files in JSRef must be included first by .c files. It is not nested
+in .h files, as other prerequisite .h files generally are, since it is
+also a direct dependency of most .c files and would be over-included if
+nested in addition to being directly included. The one "not-quite-a-macro
+macro" is the <tt>JS_CeilingLog2()</tt> function in <i>jslog2.c</i>.
+<h4>
+jsarena.c, jsarena.h</h4>
+Last-In-First-Out allocation macros that amortize malloc costs and allow
+for en-masse freeing. See the paper mentioned in prarena.h's major comment.
+<h4>
+jsutil.c, jsutil.h</h4>
+The <tt>JS_ASSERT</tt> macro is used throughout JSRef source as a proof
+device to make invariants and preconditions clear to the reader, and to
+hold the line during maintenance and evolution against regressions or violations
+of assumptions that it would be too expensive to test unconditionally at
+run-time. Certain assertions are followed by run-time tests that cope with
+assertion failure, but only where I'm too smart or paranoid to believe
+the assertion will never fail...
+<h4>
+jsclist.h</h4>
+Doubly-linked circular list struct and macros.
+<h4>
+jscpucfg.c</h4>
+This standalone program generates <i>jscpucfg.h</i>, a header file containing
+bytes per word and other constants that depend on CPU architecture and
+C compiler type model. It tries to discover most of these constants by
+running its own experiments on the build host, so if you are cross-compiling,
+beware.
+<h4>
+prdtoa.c, prdtoa.h</h4>
+David Gay's portable double-precision floating point to string conversion
+code, with Permission To Use notice included.
+<h4>
+prhash.c, prhash.h</h4>
+Portable, extensible hash tables. These use multiplicative hash for strength
+reduction over division hash, yet with very good key distribution over
+power of two table sizes. Collisions resolve via chaining, so each entry
+burns a malloc and can fragment the heap.
+<h4>
+prlong.c, prlong.h</h4>
+64-bit integer emulation, and compatible macros that use C's long long
+type where it exists (my last company mapped long long to a 128-bit type,
+but no real architecture does 128-bit ints yet).
+<h4>
+jsosdep.h</h4>
+Annoying OS dependencies rationalized into a few "feature-test" macros
+such as <tt>JS_HAVE_LONG_LONG</tt>.
+<h4>
+jsprf.*</h4>
+Portable, buffer-overrun-resistant sprintf and friends. For no good reason
+save lack of time, the %e, %f, and %g formats cause your system's native
+sprintf, rather than <tt>JS_dtoa()</tt>, to be used. This bug doesn't affect
+JSRef, because it uses its own <tt>JS_dtoa()</tt> call in <i>jsnum.c</i>
+to convert from double to string, but it's a bug that we'll fix later,
+and one you should be aware of if you intend to use a <tt>JS_*printf()</tt>&nbsp;
+function with your own floating type arguments - various vendor sprintf's
+mishandle NaN, +/-Inf, and some even print normal floating values inaccurately.
+<h4>
+prmjtime.c, prmjtime.h</h4>
+Time functions. These interfaces are named in a way that makes local vs.
+universal time confusion likely. Caveat emptor, and we're working on it.
+To make matters worse, Java (and therefore JavaScript) uses "local" time
+numbers (offsets from the epoch) in its Date class.
+
+
+<h2>
+<a NAME="Resources"></a>Additional Resources (links, API docs, and newsgroups)</h2>
+<ul>
+<li><a href ="http://www.mozilla.org/js/">http://www.mozilla.org/js/</a>
+<li><a href ="http://www.mozilla.org/js/spidermonkey/">http://www.mozilla.org/js/spidermonkey/</a>
+<li><a href ="news://news.mozilla.org/netscape.public.mozilla.jseng">news://news.mozilla.org/netscape.public.mozilla.jseng</a>
+</ul>
+
+
+
+</body>
+</html>

mozilla/js/src/SpiderMonkey.rsp

@@ -0,0 +1,12 @@
+mozilla/js/src/*
+mozilla/js/src/config/*
+mozilla/js/src/fdlibm/*
+mozilla/js/src/liveconnect/*
+mozilla/js/src/liveconnect/_jni/*
+mozilla/js/src/liveconnect/classes/*
+mozilla/js/src/liveconnect/classes/netscape/*
+mozilla/js/src/liveconnect/classes/netscape/javascript/*
+mozilla/js/src/liveconnect/config/*
+mozilla/js/src/liveconnect/macbuild/*
+mozilla/js/src/liveconnect/macbuild/JavaSession/*
+mozilla/js/src/macbuild/*

mozilla/js/src/config.mk

@@ -0,0 +1,125 @@
+# 
+# The contents of this file are subject to the Netscape Public
+# License Version 1.1 (the "License"); you may not use this file
+# except in compliance with the License. You may obtain a copy of
+# the License at http://www.mozilla.org/NPL/
+# 
+# Software distributed under the License is distributed on an "AS
+# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express or
+# implied. See the License for the specific language governing
+# rights and limitations under the License.
+# 
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+# 
+# The Initial Developer of the Original Code is Netscape
+# Communications Corporation. Portions created by Netscape are
+# Copyright (C) 1998-1999 Netscape Communications Corporation. All
+# Rights Reserved.
+# 
+# Contributor(s):
+# 
+# Alternatively, the contents of this file may be used under the
+# terms of the GNU Public License (the "GPL"), in which case the
+# provisions of the GPL are applicable instead of those above.
+# If you wish to allow use of your version of this file only
+# under the terms of the GPL and not to allow others to use your
+# version of this file under the NPL, indicate your decision by
+# deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL.  If you do not delete
+# the provisions above, a recipient may use your version of this
+# file under either the NPL or the GPL.
+# 
+
+ifdef JS_DIST
+DIST = $(JS_DIST)
+else
+DIST = $(DEPTH)/../../dist/$(OBJDIR)
+endif
+
+# Set os+release dependent make variables
+OS_ARCH         := $(subst /,_,$(shell uname -s | sed /\ /s//_/))
+
+# Attempt to differentiate between SunOS 5.4 and x86 5.4
+OS_CPUARCH      := $(shell uname -m)
+ifeq ($(OS_CPUARCH),i86pc)
+OS_RELEASE      := $(shell uname -r)_$(OS_CPUARCH)
+else
+ifeq ($(OS_ARCH),AIX)
+OS_RELEASE      := $(shell uname -v).$(shell uname -r)
+else
+OS_RELEASE      := $(shell uname -r)
+endif
+endif
+ifeq ($(OS_ARCH),IRIX64)
+OS_ARCH         := IRIX
+endif
+
+# Virtually all Linux versions are identical.
+# Any distinctions are handled in linux.h
+ifeq ($(OS_ARCH),Linux)
+OS_CONFIG      := Linux_All
+else
+ifeq ($(OS_ARCH),dgux)
+OS_CONFIG      := dgux
+else
+OS_CONFIG       := $(OS_ARCH)$(OS_OBJTYPE)$(OS_RELEASE)
+endif
+endif
+
+ASFLAGS         =
+DEFINES         =
+
+ifeq ($(OS_ARCH), WINNT)
+INSTALL = nsinstall
+CP = cp
+else
+INSTALL	= $(DEPTH)/../../dist/$(OBJDIR)/bin/nsinstall
+CP = cp
+endif
+
+ifdef BUILD_OPT
+OPTIMIZER  = -O
+DEFINES    += -UDEBUG -DNDEBUG -UDEBUG_$(shell whoami)
+OBJDIR_TAG = _OPT
+else
+ifdef USE_MSVC
+OPTIMIZER  = -Zi
+else
+OPTIMIZER  = -g
+endif
+DEFINES    += -DDEBUG -DDEBUG_$(shell whoami)
+OBJDIR_TAG = _DBG
+endif
+
+SO_SUFFIX = so
+
+NS_USE_NATIVE = 1
+
+# Java stuff
+CLASSDIR     = $(DEPTH)/liveconnect/classes
+JAVA_CLASSES = $(patsubst %.java,%.class,$(JAVA_SRCS))
+TARGETS     += $(addprefix $(CLASSDIR)/$(OBJDIR)/$(JARPATH)/, $(JAVA_CLASSES))
+JAVAC        = $(JDK)/bin/javac
+JAVAC_FLAGS  = -classpath "$(CLASSPATH)" -d $(CLASSDIR)/$(OBJDIR)
+ifeq ($(OS_ARCH), WINNT)
+  SEP        = ;
+else
+  SEP        = :
+endif
+CLASSPATH    = $(JDK)/lib/classes.zip$(SEP)$(CLASSDIR)/$(OBJDIR)
+
+include $(DEPTH)/config/$(OS_CONFIG).mk
+
+# Name of the binary code directories
+ifdef BUILD_IDG
+OBJDIR          = $(OS_CONFIG)$(OBJDIR_TAG).OBJD
+else
+OBJDIR          = $(OS_CONFIG)$(OBJDIR_TAG).OBJ
+endif
+VPATH           = $(OBJDIR)
+
+# Automatic make dependencies file
+DEPENDENCIES    = $(OBJDIR)/.md
+
+LCJAR = js14lc30.jar

mozilla/js/src/config/AIX4.1.mk

@@ -0,0 +1,59 @@
+#
+# The contents of this file are subject to the Netscape Public
+# License Version 1.1 (the "License"); you may not use this file
+# except in compliance with the License. You may obtain a copy of
+# the License at http://www.mozilla.org/NPL/
+#
+# Software distributed under the License is distributed on an "AS
+# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+# implied. See the License for the specific language governing
+# rights and limitations under the License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation. All
+# Rights Reserved.
+#
+# Contributor(s): 
+#
+# Alternatively, the contents of this file may be used under the
+# terms of the GNU Public License (the "GPL"), in which case the
+# provisions of the GPL are applicable instead of those above.
+# If you wish to allow use of your version of this file only
+# under the terms of the GPL and not to allow others to use your
+# version of this file under the NPL, indicate your decision by
+# deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL.  If you do not delete
+# the provisions above, a recipient may use your version of this
+# file under either the NPL or the GPL.
+#
+
+#
+# Config stuff for AIX
+#
+
+CC = xlC_r
+CCC = xlC_r
+
+RANLIB = ranlib
+
+#.c.o:
+#	$(CC) -c -MD $*.d $(CFLAGS) $<
+ARCH := aix
+CPU_ARCH = rs6000
+GFX_ARCH = x
+INLINES = js_compare_and_swap:js_fast_lock1:js_fast_unlock1:js_lock_get_slot:js_lock_set_slot:js_lock_scope1
+
+OS_CFLAGS = -qarch=com -qinline+$(INLINES) -DXP_UNIX -DAIX -DAIXV3 -DSYSV
+OS_LIBS = -lbsd -lsvld -lm
+#-lpthreads -lc_r
+
+MKSHLIB = $(LD) -bM:SRE -bh:4 -bnoentry -berok
+XLDFLAGS += -lc
+
+ifdef JS_THREADSAFE
+XLDFLAGS += -lsvld
+endif

mozilla/js/src/config/AIX4.2.mk

@@ -0,0 +1,58 @@
+#
+# The contents of this file are subject to the Netscape Public
+# License Version 1.1 (the "License"); you may not use this file
+# except in compliance with the License. You may obtain a copy of
+# the License at http://www.mozilla.org/NPL/
+#
+# Software distributed under the License is distributed on an "AS
+# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+# implied. See the License for the specific language governing
+# rights and limitations under the License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation. All
+# Rights Reserved.
+#
+# Contributor(s): 
+#
+# Alternatively, the contents of this file may be used under the
+# terms of the GNU Public License (the "GPL"), in which case the
+# provisions of the GPL are applicable instead of those above.
+# If you wish to allow use of your version of this file only
+# under the terms of the GPL and not to allow others to use your
+# version of this file under the NPL, indicate your decision by
+# deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL.  If you do not delete
+# the provisions above, a recipient may use your version of this
+# file under either the NPL or the GPL.
+#
+
+#
+# Config stuff for AIX
+#
+
+CC = xlC_r
+CCC = xlC_r
+CFLAGS += -qarch=com -qnoansialias -qinline+$(INLINES) -DXP_UNIX -DAIX -DAIXV3 -DSYSV
+
+RANLIB = ranlib
+
+#.c.o:
+#	$(CC) -c -MD $*.d $(CFLAGS) $<
+ARCH := aix
+CPU_ARCH = rs6000
+GFX_ARCH = x
+INLINES = js_compare_and_swap:js_fast_lock1:js_fast_unlock1:js_lock_get_slot:js_lock_set_slot:js_lock_scope1
+
+#-lpthreads -lc_r
+
+MKSHLIB = /usr/lpp/xlC/bin/makeC++SharedLib_r -p 0 -G -berok
+
+ifdef JS_THREADSAFE
+XLDFLAGS += -ldl
+endif
+

mozilla/js/src/config/AIX4.3.mk

@@ -0,0 +1,59 @@
+#
+# The contents of this file are subject to the Netscape Public
+# License Version 1.1 (the "License"); you may not use this file
+# except in compliance with the License. You may obtain a copy of
+# the License at http://www.mozilla.org/NPL/
+#
+# Software distributed under the License is distributed on an "AS
+# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+# implied. See the License for the specific language governing
+# rights and limitations under the License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation. All
+# Rights Reserved.
+#
+# Contributor(s): 
+#
+# Alternatively, the contents of this file may be used under the
+# terms of the GNU Public License (the "GPL"), in which case the
+# provisions of the GPL are applicable instead of those above.
+# If you wish to allow use of your version of this file only
+# under the terms of the GPL and not to allow others to use your
+# version of this file under the NPL, indicate your decision by
+# deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL.  If you do not delete
+# the provisions above, a recipient may use your version of this
+# file under either the NPL or the GPL.
+#
+
+#
+# Config stuff for AIX
+#
+
+CC = xlC_r
+CCC = xlC_r
+CFLAGS += -qarch=com -qnoansialias -qinline+$(INLINES) -DXP_UNIX -DAIX -DAIXV3 -DSYSV -DAIX4_3
+
+RANLIB = ranlib
+
+#.c.o:
+#	$(CC) -c -MD $*.d $(CFLAGS) $<
+ARCH := aix
+CPU_ARCH = rs6000
+GFX_ARCH = x
+INLINES = js_compare_and_swap:js_fast_lock1:js_fast_unlock1:js_lock_get_slot:js_lock_set_slot:js_lock_scope1
+
+#-lpthreads -lc_r
+
+MKSHLIB_BIN = /usr/lpp/xlC/bin/makeC++SharedLib_r
+MKSHLIB = $(MKSHLIB_BIN) -p 0 -G -berok -bM:UR
+
+ifdef JS_THREADSAFE
+XLDFLAGS += -ldl
+endif
+

mozilla/js/src/config/HP-UXB.10.10.mk

@@ -0,0 +1,71 @@
+#
+# The contents of this file are subject to the Netscape Public
+# License Version 1.1 (the "License"); you may not use this file
+# except in compliance with the License. You may obtain a copy of
+# the License at http://www.mozilla.org/NPL/
+#
+# Software distributed under the License is distributed on an "AS
+# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+# implied. See the License for the specific language governing
+# rights and limitations under the License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation. All
+# Rights Reserved.
+#
+# Contributor(s): 
+#
+# Alternatively, the contents of this file may be used under the
+# terms of the GNU Public License (the "GPL"), in which case the
+# provisions of the GPL are applicable instead of those above.
+# If you wish to allow use of your version of this file only
+# under the terms of the GPL and not to allow others to use your
+# version of this file under the NPL, indicate your decision by
+# deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL.  If you do not delete
+# the provisions above, a recipient may use your version of this
+# file under either the NPL or the GPL.
+#
+
+#
+# Config stuff for HPUX
+#
+
+# CC = gcc
+# CCC = g++
+# CFLAGS +=  -Wall -Wno-format -fPIC
+
+CC  = cc -Ae +Z
+CCC = CC -Ae +a1 +eh +Z
+
+RANLIB = echo
+MKSHLIB = $(LD) -b
+
+SO_SUFFIX = sl
+
+#.c.o:
+#	$(CC) -c -MD $*.d $(CFLAGS) $<
+
+CPU_ARCH = hppa
+GFX_ARCH = x
+
+OS_CFLAGS = -DXP_UNIX -DHPUX -DSYSV
+OS_LIBS = -ldld
+
+ifeq ($(OS_RELEASE),B.10)
+PLATFORM_FLAGS		+= -DHPUX10 -Dhpux10
+PORT_FLAGS		+= -DRW_NO_OVERLOAD_SCHAR -DHAVE_MODEL_H
+ifeq ($(OS_VERSION),.10)
+PLATFORM_FLAGS		+= -DHPUX10_10
+endif
+ifeq ($(OS_VERSION),.20)
+PLATFORM_FLAGS		+= -DHPUX10_20
+endif
+ifeq ($(OS_VERSION),.30)
+PLATFORM_FLAGS		+= -DHPUX10_30
+endif
+endif

mozilla/js/src/config/HP-UXB.10.20.mk

@@ -0,0 +1,71 @@
+#
+# The contents of this file are subject to the Netscape Public
+# License Version 1.1 (the "License"); you may not use this file
+# except in compliance with the License. You may obtain a copy of
+# the License at http://www.mozilla.org/NPL/
+#
+# Software distributed under the License is distributed on an "AS
+# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+# implied. See the License for the specific language governing
+# rights and limitations under the License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation. All
+# Rights Reserved.
+#
+# Contributor(s): 
+#
+# Alternatively, the contents of this file may be used under the
+# terms of the GNU Public License (the "GPL"), in which case the
+# provisions of the GPL are applicable instead of those above.
+# If you wish to allow use of your version of this file only
+# under the terms of the GPL and not to allow others to use your
+# version of this file under the NPL, indicate your decision by
+# deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL.  If you do not delete
+# the provisions above, a recipient may use your version of this
+# file under either the NPL or the GPL.
+#
+
+#
+# Config stuff for HPUX
+#
+
+# CC = gcc
+# CCC = g++
+# CFLAGS +=  -Wall -Wno-format -fPIC
+
+CC  = cc -Ae +Z
+CCC = CC -Ae +a1 +eh +Z
+
+RANLIB = echo
+MKSHLIB = $(LD) -b
+
+SO_SUFFIX = sl
+
+#.c.o:
+#	$(CC) -c -MD $*.d $(CFLAGS) $<
+
+CPU_ARCH = hppa
+GFX_ARCH = x
+
+OS_CFLAGS = -DXP_UNIX -DHPUX -DSYSV
+OS_LIBS = -ldld
+
+ifeq ($(OS_RELEASE),B.10)
+PLATFORM_FLAGS		+= -DHPUX10 -Dhpux10
+PORT_FLAGS		+= -DRW_NO_OVERLOAD_SCHAR -DHAVE_MODEL_H
+ifeq ($(OS_VERSION),.10)
+PLATFORM_FLAGS		+= -DHPUX10_10
+endif
+ifeq ($(OS_VERSION),.20)
+PLATFORM_FLAGS		+= -DHPUX10_20
+endif
+ifeq ($(OS_VERSION),.30)
+PLATFORM_FLAGS		+= -DHPUX10_30
+endif
+endif

mozilla/js/src/config/HP-UXB.11.00.mk

@@ -0,0 +1,74 @@
+#
+# The contents of this file are subject to the Netscape Public
+# License Version 1.1 (the "License"); you may not use this file
+# except in compliance with the License. You may obtain a copy of
+# the License at http://www.mozilla.org/NPL/
+#
+# Software distributed under the License is distributed on an "AS
+# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+# implied. See the License for the specific language governing
+# rights and limitations under the License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation. All
+# Rights Reserved.
+#
+# Contributor(s): 
+#
+# Alternatively, the contents of this file may be used under the
+# terms of the GNU Public License (the "GPL"), in which case the
+# provisions of the GPL are applicable instead of those above.
+# If you wish to allow use of your version of this file only
+# under the terms of the GPL and not to allow others to use your
+# version of this file under the NPL, indicate your decision by
+# deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL.  If you do not delete
+# the provisions above, a recipient may use your version of this
+# file under either the NPL or the GPL.
+#
+
+#
+# Config stuff for HPUX
+#
+
+ifdef NS_USE_NATIVE
+  CC  = cc +Z +DAportable +DS2.0 +u4
+#  LD  = aCC +Z -b -Wl,+s -Wl,-B,symbolic
+else
+  CC = gcc -Wall -Wno-format -fPIC
+  CCC = g++ -Wall -Wno-format -fPIC
+endif
+
+RANLIB = echo
+MKSHLIB = $(LD) -b
+
+SO_SUFFIX = sl
+
+#.c.o:
+#	$(CC) -c -MD $*.d $(CFLAGS) $<
+
+CPU_ARCH = hppa
+GFX_ARCH = x
+
+OS_CFLAGS = -DXP_UNIX -DHPUX -DSYSV -D_HPUX -DNATIVE -D_POSIX_C_SOURCE=199506L
+OS_LIBS = -ldld
+
+XLDFLAGS = -lpthread
+
+ifeq ($(OS_RELEASE),B.10)
+PLATFORM_FLAGS		+= -DHPUX10 -Dhpux10
+PORT_FLAGS		+= -DRW_NO_OVERLOAD_SCHAR -DHAVE_MODEL_H
+ifeq ($(OS_VERSION),.10)
+PLATFORM_FLAGS		+= -DHPUX10_10
+endif
+ifeq ($(OS_VERSION),.20)
+PLATFORM_FLAGS		+= -DHPUX10_20
+endif
+ifeq ($(OS_VERSION),.30)
+PLATFORM_FLAGS		+= -DHPUX10_30
+endif
+endif

mozilla/js/src/config/IRIX.mk

@@ -0,0 +1,81 @@
+#
+# The contents of this file are subject to the Netscape Public
+# License Version 1.1 (the "License"); you may not use this file
+# except in compliance with the License. You may obtain a copy of
+# the License at http://www.mozilla.org/NPL/
+#
+# Software distributed under the License is distributed on an "AS
+# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+# implied. See the License for the specific language governing
+# rights and limitations under the License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation. All
+# Rights Reserved.
+#
+# Contributor(s): 
+#
+# Alternatively, the contents of this file may be used under the
+# terms of the GNU Public License (the "GPL"), in which case the
+# provisions of the GPL are applicable instead of those above.
+# If you wish to allow use of your version of this file only
+# under the terms of the GPL and not to allow others to use your
+# version of this file under the NPL, indicate your decision by
+# deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL.  If you do not delete
+# the provisions above, a recipient may use your version of this
+# file under either the NPL or the GPL.
+#
+
+#
+# Config stuff for IRIX
+#
+
+CPU_ARCH = mips
+GFX_ARCH = x
+
+RANLIB = /bin/true
+
+#NS_USE_GCC = 1
+
+ifndef NS_USE_NATIVE
+CC = gcc
+CCC = g++
+AS = $(CC) -x assembler-with-cpp
+ODD_CFLAGS = -Wall -Wno-format
+ifdef BUILD_OPT
+OPTIMIZER = -O6
+endif
+else
+ifeq ($(OS_RELEASE),6.2)
+CC	= cc -n32 -DIRIX6_2
+endif
+ifeq ($(OS_RELEASE),6.3)
+CC	= cc -n32 -DIRIX6_3
+endif
+ifeq ($(OS_RELEASE),6.5)
+CC	= cc -n32 -DIRIX6_5
+endif
+CCC = CC
+# LD  = CC
+ODD_CFLAGS = -fullwarn -xansi
+ifdef BUILD_OPT
+OPTIMIZER += -Olimit 4000
+endif
+endif
+
+# For purify
+HAVE_PURIFY = 1
+PURE_OS_CFLAGS = $(ODD_CFLAGS) -DXP_UNIX -DSVR4 -DSW_THREADS -DIRIX
+
+OS_CFLAGS = $(PURE_OS_CFLAGS) -MDupdate $(DEPENDENCIES)
+
+BSDECHO	= echo
+MKSHLIB = $(LD) -n32 -shared
+
+# Use the editline library to provide line-editing support.
+JS_EDITLINE = 1

mozilla/js/src/config/IRIX5.3.mk

@@ -0,0 +1,38 @@
+#
+# The contents of this file are subject to the Netscape Public
+# License Version 1.1 (the "License"); you may not use this file
+# except in compliance with the License. You may obtain a copy of
+# the License at http://www.mozilla.org/NPL/
+#
+# Software distributed under the License is distributed on an "AS
+# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+# implied. See the License for the specific language governing
+# rights and limitations under the License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation. All
+# Rights Reserved.
+#
+# Contributor(s): 
+#
+# Alternatively, the contents of this file may be used under the
+# terms of the GNU Public License (the "GPL"), in which case the
+# provisions of the GPL are applicable instead of those above.
+# If you wish to allow use of your version of this file only
+# under the terms of the GPL and not to allow others to use your
+# version of this file under the NPL, indicate your decision by
+# deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL.  If you do not delete
+# the provisions above, a recipient may use your version of this
+# file under either the NPL or the GPL.
+#
+
+#
+# Config stuff for IRIX5.3
+#
+
+include $(DEPTH)/config/IRIX.mk

mozilla/js/src/config/IRIX6.1.mk

@@ -0,0 +1,38 @@
+#
+# The contents of this file are subject to the Netscape Public
+# License Version 1.1 (the "License"); you may not use this file
+# except in compliance with the License. You may obtain a copy of
+# the License at http://www.mozilla.org/NPL/
+#
+# Software distributed under the License is distributed on an "AS
+# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+# implied. See the License for the specific language governing
+# rights and limitations under the License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation. All
+# Rights Reserved.
+#
+# Contributor(s): 
+#
+# Alternatively, the contents of this file may be used under the
+# terms of the GNU Public License (the "GPL"), in which case the
+# provisions of the GPL are applicable instead of those above.
+# If you wish to allow use of your version of this file only
+# under the terms of the GPL and not to allow others to use your
+# version of this file under the NPL, indicate your decision by
+# deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL.  If you do not delete
+# the provisions above, a recipient may use your version of this
+# file under either the NPL or the GPL.
+#
+
+#
+# Config stuff for IRIX6.3
+#
+
+include $(DEPTH)/config/IRIX.mk

mozilla/js/src/config/IRIX6.2.mk

@@ -0,0 +1,38 @@
+#
+# The contents of this file are subject to the Netscape Public
+# License Version 1.1 (the "License"); you may not use this file
+# except in compliance with the License. You may obtain a copy of
+# the License at http://www.mozilla.org/NPL/
+#
+# Software distributed under the License is distributed on an "AS
+# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+# implied. See the License for the specific language governing
+# rights and limitations under the License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation. All
+# Rights Reserved.
+#
+# Contributor(s): 
+#
+# Alternatively, the contents of this file may be used under the
+# terms of the GNU Public License (the "GPL"), in which case the
+# provisions of the GPL are applicable instead of those above.
+# If you wish to allow use of your version of this file only
+# under the terms of the GPL and not to allow others to use your
+# version of this file under the NPL, indicate your decision by
+# deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL.  If you do not delete
+# the provisions above, a recipient may use your version of this
+# file under either the NPL or the GPL.
+#
+
+#
+# Config stuff for IRIX6.3
+#
+
+include $(DEPTH)/config/IRIX.mk

mozilla/js/src/config/IRIX6.3.mk

@@ -0,0 +1,38 @@
+#
+# The contents of this file are subject to the Netscape Public
+# License Version 1.1 (the "License"); you may not use this file
+# except in compliance with the License. You may obtain a copy of
+# the License at http://www.mozilla.org/NPL/
+#
+# Software distributed under the License is distributed on an "AS
+# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+# implied. See the License for the specific language governing
+# rights and limitations under the License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation. All
+# Rights Reserved.
+#
+# Contributor(s): 
+#
+# Alternatively, the contents of this file may be used under the
+# terms of the GNU Public License (the "GPL"), in which case the
+# provisions of the GPL are applicable instead of those above.
+# If you wish to allow use of your version of this file only
+# under the terms of the GPL and not to allow others to use your
+# version of this file under the NPL, indicate your decision by
+# deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL.  If you do not delete
+# the provisions above, a recipient may use your version of this
+# file under either the NPL or the GPL.
+#
+
+#
+# Config stuff for IRIX6.3
+#
+
+include $(DEPTH)/config/IRIX.mk

mozilla/js/src/config/IRIX6.5.mk

@@ -0,0 +1,38 @@
+#
+# The contents of this file are subject to the Netscape Public
+# License Version 1.1 (the "License"); you may not use this file
+# except in compliance with the License. You may obtain a copy of
+# the License at http://www.mozilla.org/NPL/
+#
+# Software distributed under the License is distributed on an "AS
+# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+# implied. See the License for the specific language governing
+# rights and limitations under the License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation. All
+# Rights Reserved.
+#
+# Contributor(s): 
+#
+# Alternatively, the contents of this file may be used under the
+# terms of the GNU Public License (the "GPL"), in which case the
+# provisions of the GPL are applicable instead of those above.
+# If you wish to allow use of your version of this file only
+# under the terms of the GPL and not to allow others to use your
+# version of this file under the NPL, indicate your decision by
+# deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL.  If you do not delete
+# the provisions above, a recipient may use your version of this
+# file under either the NPL or the GPL.
+#
+
+#
+# Config stuff for IRIX6.3
+#
+
+include $(DEPTH)/config/IRIX.mk

mozilla/js/src/config/Linux_All.mk

@@ -0,0 +1,82 @@
+#
+# The contents of this file are subject to the Netscape Public
+# License Version 1.1 (the "License"); you may not use this file
+# except in compliance with the License. You may obtain a copy of
+# the License at http://www.mozilla.org/NPL/
+#
+# Software distributed under the License is distributed on an "AS
+# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+# implied. See the License for the specific language governing
+# rights and limitations under the License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation. All
+# Rights Reserved.
+#
+# Contributor(s): 
+#
+# Alternatively, the contents of this file may be used under the
+# terms of the GNU Public License (the "GPL"), in which case the
+# provisions of the GPL are applicable instead of those above.
+# If you wish to allow use of your version of this file only
+# under the terms of the GPL and not to allow others to use your
+# version of this file under the NPL, indicate your decision by
+# deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL.  If you do not delete
+# the provisions above, a recipient may use your version of this
+# file under either the NPL or the GPL.
+#
+
+#
+# Config for all versions of Linux
+#
+
+CC = gcc
+CCC = g++
+CFLAGS +=  -Wall -Wno-format
+OS_CFLAGS = -DXP_UNIX -DSVR4 -DSYSV -D_BSD_SOURCE -DPOSIX_SOURCE
+
+RANLIB = echo
+MKSHLIB = $(LD) -shared $(XMKSHLIBOPTS)
+
+#.c.o:
+#      $(CC) -c -MD $*.d $(CFLAGS) $<
+
+CPU_ARCH = $(shell uname -m)
+ifeq (86,$(findstring 86,$(CPU_ARCH)))
+CPU_ARCH = x86
+OS_CFLAGS+= -DX86_LINUX
+
+ifeq (gcc, $(CC))
+# if using gcc on x86, check version for opt bug 
+# (http://bugzilla.mozilla.org/show_bug.cgi?id=24892)
+GCC_VERSION := $(shell gcc -v 2>&1 | grep version | awk '{ print $$3 }')
+GCC_LIST:=$(sort 2.91.66 $(GCC_VERSION) )
+
+ifeq (2.91.66, $(firstword $(GCC_LIST)))
+CFLAGS+= -DGCC_OPT_BUG
+endif
+endif
+
+endif
+GFX_ARCH = x
+
+OS_LIBS = -lm -lc
+
+ASFLAGS += -x assembler-with-cpp
+
+
+ifeq ($(CPU_ARCH),alpha)
+
+# Ask the C compiler on alpha linux to let us work with denormalized
+# double values, which are required by the ECMA spec.
+
+OS_CFLAGS += -mieee
+endif
+
+# Use the editline library to provide line-editing support.
+JS_EDITLINE = 1

mozilla/js/src/config/Mac_OS10.0.mk

@@ -0,0 +1,77 @@
+#
+# The contents of this file are subject to the Netscape Public
+# License Version 1.1 (the "License"); you may not use this file
+# except in compliance with the License. You may obtain a copy of
+# the License at http://www.mozilla.org/NPL/
+#
+# Software distributed under the License is distributed on an "AS
+# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+# implied. See the License for the specific language governing
+# rights and limitations under the License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation. All
+# Rights Reserved.
+#
+# Contributor(s): 
+#
+#  Steve Zellers (zellers@apple.com)
+#
+# Alternatively, the contents of this file may be used under the
+# terms of the GNU Public License (the "GPL"), in which case the
+# provisions of the GPL are applicable instead of those above.
+# If you wish to allow use of your version of this file only
+# under the terms of the GPL and not to allow others to use your
+# version of this file under the NPL, indicate your decision by
+# deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL.  If you do not delete
+# the provisions above, a recipient may use your version of this
+# file under either the NPL or the GPL.
+#
+
+#
+# Config for Mac OS X as of PR3
+# Just ripped from Linux config
+#
+
+CC = cc
+CCC = g++
+CFLAGS +=  -Wall -Wno-format
+OS_CFLAGS = -DXP_UNIX -DSVR4 -DSYSV -D_BSD_SOURCE -DPOSIX_SOURCE 
+-DRHAPSODY
+
+RANLIB = ranlib
+MKSHLIB = libtool -dynamic $(XMKSHLIBOPTS) -framework System
+
+#.c.o:
+#      $(CC) -c -MD $*.d $(CFLAGS) $<
+
+CPU_ARCH = $(shell uname -m)
+ifeq (86,$(findstring 86,$(CPU_ARCH)))
+CPU_ARCH = x86
+OS_CFLAGS+= -DX86_LINUX
+endif
+GFX_ARCH = x
+
+OS_LIBS = -lc -framework System
+
+ASFLAGS += -x assembler-with-cpp
+
+ifeq ($(CPU_ARCH),alpha)
+
+# Ask the C compiler on alpha linux to let us work with denormalized
+# double values, which are required by the ECMA spec.
+
+OS_CFLAGS += -mieee
+endif
+
+# Use the editline library to provide line-editing support.
+JS_EDITLINE = 1
+
+# Don't allow Makefile.ref to use libmath
+NO_LIBM = 1
+

mozilla/js/src/config/OSF1V4.0.mk

@@ -0,0 +1,66 @@
+#
+# The contents of this file are subject to the Netscape Public
+# License Version 1.1 (the "License"); you may not use this file
+# except in compliance with the License. You may obtain a copy of
+# the License at http://www.mozilla.org/NPL/
+#
+# Software distributed under the License is distributed on an "AS
+# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+# implied. See the License for the specific language governing
+# rights and limitations under the License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation. All
+# Rights Reserved.
+#
+# Contributor(s): 
+#
+# Alternatively, the contents of this file may be used under the
+# terms of the GNU Public License (the "GPL"), in which case the
+# provisions of the GPL are applicable instead of those above.
+# If you wish to allow use of your version of this file only
+# under the terms of the GPL and not to allow others to use your
+# version of this file under the NPL, indicate your decision by
+# deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL.  If you do not delete
+# the provisions above, a recipient may use your version of this
+# file under either the NPL or the GPL.
+#
+
+#
+# Config stuff for Data General DG/UX
+#
+
+#
+#  Initial DG/UX port by Marc Fraioli (fraioli@dg-rtp.dg.com)
+#
+
+ifndef NS_USE_NATIVE
+CC = gcc
+CCC = g++
+CFLAGS +=  -mieee -Wall -Wno-format
+else
+CC  = cc
+CCC = cxx
+CFLAGS += -ieee -std
+# LD  = cxx
+endif
+
+RANLIB = echo
+MKSHLIB = $(LD) -shared -taso -all -expect_unresolved "*"
+
+#
+#  _DGUX_SOURCE is needed to turn on a lot of stuff in the headers if 
+#      you're not using DG's compiler.  It shouldn't hurt if you are.
+#
+#  _POSIX4A_DRAFT10_SOURCE is needed to pick up localtime_r, used in
+#      prtime.c
+#
+OS_CFLAGS = -DXP_UNIX -DSVR4 -DSYSV -DDGUX -D_DGUX_SOURCE -D_POSIX4A_DRAFT10_SOURCE -DOSF1
+OS_LIBS = -lsocket -lnsl 
+
+NOSUCHFILE = /no-such-file

mozilla/js/src/config/SunOS4.1.4.mk

@@ -0,0 +1,95 @@
+#
+# The contents of this file are subject to the Netscape Public
+# License Version 1.1 (the "License"); you may not use this file
+# except in compliance with the License. You may obtain a copy of
+# the License at http://www.mozilla.org/NPL/
+#
+# Software distributed under the License is distributed on an "AS
+# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+# implied. See the License for the specific language governing
+# rights and limitations under the License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation. All
+# Rights Reserved.
+#
+# Contributor(s): 
+#
+# Alternatively, the contents of this file may be used under the
+# terms of the GNU Public License (the "GPL"), in which case the
+# provisions of the GPL are applicable instead of those above.
+# If you wish to allow use of your version of this file only
+# under the terms of the GPL and not to allow others to use your
+# version of this file under the NPL, indicate your decision by
+# deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL.  If you do not delete
+# the provisions above, a recipient may use your version of this
+# file under either the NPL or the GPL.
+#
+
+#
+# Config stuff for SunOS4.1
+#
+
+CC = gcc
+CCC = g++
+RANLIB = ranlib
+
+#.c.o:
+#	$(CC) -c -MD $*.d $(CFLAGS) $<
+
+CPU_ARCH = sparc
+GFX_ARCH = x
+
+# A pile of -D's to build xfe on sunos
+MOZ_CFLAGS = -DSTRINGS_ALIGNED -DNO_REGEX -DNO_ISDIR -DUSE_RE_COMP \
+	     -DNO_REGCOMP -DUSE_GETWD -DNO_MEMMOVE -DNO_ALLOCA \
+	     -DBOGUS_MB_MAX -DNO_CONST
+
+# Purify doesn't like -MDupdate
+NOMD_OS_CFLAGS = -DXP_UNIX -Wall -Wno-format -DSW_THREADS -DSUNOS4 -DNEED_SYSCALL \
+		 $(MOZ_CFLAGS)
+
+OS_CFLAGS = $(NOMD_OS_CFLAGS) -MDupdate $(DEPENDENCIES)
+OS_LIBS = -ldl -lm
+
+MKSHLIB = $(LD) -L$(MOTIF)/lib
+
+HAVE_PURIFY = 1
+MOTIF = /home/motif/usr
+MOTIFLIB = -L$(MOTIF)/lib -lXm
+INCLUDES += -I/usr/X11R5/include -I$(MOTIF)/include
+
+NOSUCHFILE = /solaris-rm-f-sucks
+
+LOCALE_MAP = $(DEPTH)/cmd/xfe/intl/sunos.lm
+
+EN_LOCALE = en_US
+DE_LOCALE = de
+FR_LOCALE = fr
+JP_LOCALE = ja
+SJIS_LOCALE = ja_JP.SJIS
+KR_LOCALE = ko
+CN_LOCALE = zh
+TW_LOCALE = zh_TW
+I2_LOCALE = i2
+IT_LOCALE = it
+SV_LOCALE = sv
+ES_LOCALE = es
+NL_LOCALE = nl
+PT_LOCALE = pt
+
+LOC_LIB_DIR = /usr/openwin/lib/locale
+
+BSDECHO	= echo
+
+#
+# These defines are for building unix plugins
+#
+BUILD_UNIX_PLUGINS = 1
+DSO_LDOPTS =
+DSO_LDFLAGS =

mozilla/js/src/config/SunOS5.3.mk

@@ -0,0 +1,85 @@
+#
+# The contents of this file are subject to the Netscape Public
+# License Version 1.1 (the "License"); you may not use this file
+# except in compliance with the License. You may obtain a copy of
+# the License at http://www.mozilla.org/NPL/
+#
+# Software distributed under the License is distributed on an "AS
+# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+# implied. See the License for the specific language governing
+# rights and limitations under the License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation. All
+# Rights Reserved.
+#
+# Contributor(s): 
+#
+# Alternatively, the contents of this file may be used under the
+# terms of the GNU Public License (the "GPL"), in which case the
+# provisions of the GPL are applicable instead of those above.
+# If you wish to allow use of your version of this file only
+# under the terms of the GPL and not to allow others to use your
+# version of this file under the NPL, indicate your decision by
+# deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL.  If you do not delete
+# the provisions above, a recipient may use your version of this
+# file under either the NPL or the GPL.
+#
+
+#
+# Config stuff for SunOS5.3
+#
+
+CC = gcc
+CCC = g++
+CFLAGS +=  -Wall -Wno-format
+
+#CC = /opt/SUNWspro/SC3.0.1/bin/cc
+RANLIB = echo
+
+#.c.o:
+#	$(CC) -c -MD $*.d $(CFLAGS) $<
+
+CPU_ARCH = sparc
+GFX_ARCH = x
+
+OS_CFLAGS = -DXP_UNIX -DSVR4 -DSYSV -DSOLARIS
+OS_LIBS = -lsocket -lnsl -ldl
+
+ASFLAGS	        += -P -L -K PIC -D_ASM -D__STDC__=0
+
+HAVE_PURIFY = 1
+
+NOSUCHFILE = /solaris-rm-f-sucks
+
+ifndef JS_NO_ULTRA
+ULTRA_OPTIONS := -xarch=v8plus
+ULTRA_OPTIONSD := -DULTRA_SPARC
+else
+ULTRA_OPTIONS := -xarch=v8
+ULTRA_OPTIONSD :=
+endif
+
+ifeq ($(OS_CPUARCH),sun4u)
+DEFINES 	+= $(ULTRA_OPTIONSD)
+ifeq ($(findstring gcc,$(CC)),gcc)
+DEFINES         += -Wa,$(ULTRA_OPTIONS),$(ULTRA_OPTIONSD)
+else
+ASFLAGS         += $(ULTRA_OPTIONS) $(ULTRA_OPTIONSD)
+endif
+endif
+
+ifeq ($(OS_CPUARCH),sun4m)
+ifeq ($(findstring gcc,$(CC)),gcc)
+DEFINES         += -Wa,-xarch=v8
+else
+ASFLAGS         += -xarch=v8
+endif
+endif
+
+MKSHLIB = $(LD) -G

mozilla/js/src/config/SunOS5.4.mk

@@ -0,0 +1,86 @@
+#
+# The contents of this file are subject to the Netscape Public
+# License Version 1.1 (the "License"); you may not use this file
+# except in compliance with the License. You may obtain a copy of
+# the License at http://www.mozilla.org/NPL/
+#
+# Software distributed under the License is distributed on an "AS
+# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+# implied. See the License for the specific language governing
+# rights and limitations under the License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation. All
+# Rights Reserved.
+#
+# Contributor(s): 
+#
+# Alternatively, the contents of this file may be used under the
+# terms of the GNU Public License (the "GPL"), in which case the
+# provisions of the GPL are applicable instead of those above.
+# If you wish to allow use of your version of this file only
+# under the terms of the GPL and not to allow others to use your
+# version of this file under the NPL, indicate your decision by
+# deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL.  If you do not delete
+# the provisions above, a recipient may use your version of this
+# file under either the NPL or the GPL.
+#
+
+#
+# Config stuff for SunOS5.4
+#
+
+ifdef NS_USE_NATIVE
+CC = cc
+CCC = CC
+else
+CC = gcc
+CCC = g++
+CFLAGS += -Wall -Wno-format
+endif
+
+RANLIB = echo
+
+CPU_ARCH = sparc
+GFX_ARCH = x
+
+OS_CFLAGS = -DXP_UNIX -DSVR4 -DSYSV -D__svr4 -DSOLARIS
+OS_LIBS = -lsocket -lnsl -ldl
+
+ASFLAGS	        += -P -L -K PIC -D_ASM -D__STDC__=0
+
+HAVE_PURIFY = 1
+
+NOSUCHFILE = /solaris-rm-f-sucks
+
+ifndef JS_NO_ULTRA
+ULTRA_OPTIONS := -xarch=v8plus
+ULTRA_OPTIONSD := -DULTRA_SPARC
+else
+ULTRA_OPTIONS := -xarch=v8
+ULTRA_OPTIONSD :=
+endif
+
+ifeq ($(OS_CPUARCH),sun4u)
+DEFINES 	+= $(ULTRA_OPTIONSD)
+ifeq ($(findstring gcc,$(CC)),gcc)
+DEFINES         += -Wa,$(ULTRA_OPTIONS),$(ULTRA_OPTIONSD)
+else
+ASFLAGS         += $(ULTRA_OPTIONS) $(ULTRA_OPTIONSD)
+endif
+endif
+
+ifeq ($(OS_CPUARCH),sun4m)
+ifeq ($(findstring gcc,$(CC)),gcc)
+DEFINES         += -Wa,-xarch=v8
+else
+ASFLAGS         += -xarch=v8
+endif
+endif
+
+MKSHLIB = $(LD) -G

mozilla/js/src/config/SunOS5.5.1.mk

@@ -0,0 +1,38 @@
+#
+# The contents of this file are subject to the Netscape Public
+# License Version 1.1 (the "License"); you may not use this file
+# except in compliance with the License. You may obtain a copy of
+# the License at http://www.mozilla.org/NPL/
+#
+# Software distributed under the License is distributed on an "AS
+# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+# implied. See the License for the specific language governing
+# rights and limitations under the License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation. All
+# Rights Reserved.
+#
+# Contributor(s): 
+#
+# Alternatively, the contents of this file may be used under the
+# terms of the GNU Public License (the "GPL"), in which case the
+# provisions of the GPL are applicable instead of those above.
+# If you wish to allow use of your version of this file only
+# under the terms of the GPL and not to allow others to use your
+# version of this file under the NPL, indicate your decision by
+# deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL.  If you do not delete
+# the provisions above, a recipient may use your version of this
+# file under either the NPL or the GPL.
+#
+
+#
+# Config stuff for SunOS5.5.1
+#
+
+include $(DEPTH)/config/SunOS5.5.mk

mozilla/js/src/config/SunOS5.5.mk

@@ -0,0 +1,81 @@
+#
+# The contents of this file are subject to the Netscape Public
+# License Version 1.1 (the "License"); you may not use this file
+# except in compliance with the License. You may obtain a copy of
+# the License at http://www.mozilla.org/NPL/
+#
+# Software distributed under the License is distributed on an "AS
+# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+# implied. See the License for the specific language governing
+# rights and limitations under the License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation. All
+# Rights Reserved.
+#
+# Contributor(s): 
+#
+# Alternatively, the contents of this file may be used under the
+# terms of the GNU Public License (the "GPL"), in which case the
+# provisions of the GPL are applicable instead of those above.
+# If you wish to allow use of your version of this file only
+# under the terms of the GPL and not to allow others to use your
+# version of this file under the NPL, indicate your decision by
+# deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL.  If you do not delete
+# the provisions above, a recipient may use your version of this
+# file under either the NPL or the GPL.
+#
+
+#
+# Config stuff for SunOS5.5
+#
+
+AS = as
+ifndef NS_USE_NATIVE
+CC = gcc
+CCC = g++
+CFLAGS +=  -Wall -Wno-format
+else
+CC = cc
+CCC = CC
+endif
+
+RANLIB = echo
+
+#.c.o:
+#	$(CC) -c -MD $*.d $(CFLAGS) $<
+
+CPU_ARCH = sparc
+GFX_ARCH = x
+
+OS_CFLAGS = -DXP_UNIX -DSVR4 -DSYSV -DSOLARIS
+OS_LIBS = -lsocket -lnsl -ldl
+
+ASFLAGS	        += -P -L -K PIC -D_ASM -D__STDC__=0
+
+HAVE_PURIFY = 1
+
+NOSUCHFILE = /solaris-rm-f-sucks
+
+ifeq ($(OS_CPUARCH),sun4u)	# ultra sparc?
+ifeq ($(CC),gcc)		# using gcc?
+ifndef JS_NO_ULTRA		# do we want ultra?
+ifdef JS_THREADSAFE		# only in thread-safe mode
+DEFINES 	+= -DULTRA_SPARC
+DEFINES         += -Wa,-xarch=v8plus,-DULTRA_SPARC
+else
+ASFLAGS         += -xarch=v8plus -DULTRA_SPARC
+endif
+endif
+endif
+endif
+
+MKSHLIB = $(LD) -G
+
+# Use the editline library to provide line-editing support.
+JS_EDITLINE = 1

mozilla/js/src/config/SunOS5.6.mk

@@ -0,0 +1,83 @@
+#
+# The contents of this file are subject to the Netscape Public
+# License Version 1.1 (the "License"); you may not use this file
+# except in compliance with the License. You may obtain a copy of
+# the License at http://www.mozilla.org/NPL/
+#
+# Software distributed under the License is distributed on an "AS
+# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+# implied. See the License for the specific language governing
+# rights and limitations under the License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation. All
+# Rights Reserved.
+#
+# Contributor(s): 
+#
+# Alternatively, the contents of this file may be used under the
+# terms of the GNU Public License (the "GPL"), in which case the
+# provisions of the GPL are applicable instead of those above.
+# If you wish to allow use of your version of this file only
+# under the terms of the GPL and not to allow others to use your
+# version of this file under the NPL, indicate your decision by
+# deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL.  If you do not delete
+# the provisions above, a recipient may use your version of this
+# file under either the NPL or the GPL.
+#
+
+#
+# Config stuff for SunOS5.5
+#
+
+AS = as
+ifndef NS_USE_NATIVE
+  CC = gcc
+  CCC = g++
+  CFLAGS +=  -Wall -Wno-format
+else
+  CC = cc
+  CCC = CC
+  CFLAGS += -mt -KPIC
+#  LD = CC
+endif
+
+RANLIB = echo
+
+#.c.o:
+#	$(CC) -c -MD $*.d $(CFLAGS) $<
+
+CPU_ARCH = sparc
+GFX_ARCH = x
+
+OS_CFLAGS = -DXP_UNIX -DSVR4 -DSYSV -DSOLARIS
+OS_LIBS = -lsocket -lnsl -ldl
+
+ASFLAGS	        += -P -L -K PIC -D_ASM -D__STDC__=0
+
+HAVE_PURIFY = 1
+
+NOSUCHFILE = /solaris-rm-f-sucks
+
+ifeq ($(OS_CPUARCH),sun4u)	# ultra sparc?
+ifeq ($(CC),gcc)		# using gcc?
+ifndef JS_NO_ULTRA		# do we want ultra?
+ifdef JS_THREADSAFE		# only in thread-safe mode
+DEFINES 	+= -DULTRA_SPARC
+DEFINES         += -Wa,-xarch=v8plus,-DULTRA_SPARC
+else
+ASFLAGS         += -xarch=v8plus -DULTRA_SPARC
+endif
+endif
+endif
+endif
+
+MKSHLIB = $(LD) -G
+
+# Use the editline library to provide line-editing support.
+JS_EDITLINE = 1

mozilla/js/src/config/SunOS5.7.mk

@@ -0,0 +1,38 @@
+#
+# The contents of this file are subject to the Netscape Public
+# License Version 1.1 (the "License"); you may not use this file
+# except in compliance with the License. You may obtain a copy of
+# the License at http://www.mozilla.org/NPL/
+#
+# Software distributed under the License is distributed on an "AS
+# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+# implied. See the License for the specific language governing
+# rights and limitations under the License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1999 Netscape Communications Corporation. All
+# Rights Reserved.
+#
+# Contributor(s): 
+#
+# Alternatively, the contents of this file may be used under the
+# terms of the GNU Public License (the "GPL"), in which case the
+# provisions of the GPL are applicable instead of those above.
+# If you wish to allow use of your version of this file only
+# under the terms of the GPL and not to allow others to use your
+# version of this file under the NPL, indicate your decision by
+# deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL.  If you do not delete
+# the provisions above, a recipient may use your version of this
+# file under either the NPL or the GPL.
+#
+
+#
+# Config stuff for SunOS5.7
+#
+
+include $(DEPTH)/config/SunOS5.5.mk

mozilla/js/src/config/WINNT4.0.mk

@@ -0,0 +1,103 @@
+#
+# The contents of this file are subject to the Netscape Public
+# License Version 1.1 (the "License"); you may not use this file
+# except in compliance with the License. You may obtain a copy of
+# the License at http://www.mozilla.org/NPL/
+#
+# Software distributed under the License is distributed on an "AS
+# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+# implied. See the License for the specific language governing
+# rights and limitations under the License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation. All
+# Rights Reserved.
+#
+# Contributor(s): 
+#
+# Alternatively, the contents of this file may be used under the
+# terms of the GNU Public License (the "GPL"), in which case the
+# provisions of the GPL are applicable instead of those above.
+# If you wish to allow use of your version of this file only
+# under the terms of the GPL and not to allow others to use your
+# version of this file under the NPL, indicate your decision by
+# deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL.  If you do not delete
+# the provisions above, a recipient may use your version of this
+# file under either the NPL or the GPL.
+
+#
+# Config for Windows NT using MS Visual C++ (version?)
+#
+
+CC = cl
+
+RANLIB = echo
+
+#.c.o:
+#      $(CC) -c -MD $*.d $(CFLAGS) $<
+
+CPU_ARCH = x86 # XXX fixme
+GFX_ARCH = win32
+
+# MSVC compiler options for both debug/optimize
+# /nologo  - suppress copyright message
+# /W3      - Warning level 3
+# /Gm      - enable minimal rebuild
+# /Z7      - put debug info into the executable, not in .pdb file
+# /YX      - automatic precompiled headers
+# /GX      - enable C++ exception support
+WIN_CFLAGS = /nologo /W3 /Fp$(OBJDIR)/js.pch
+
+# MSVC compiler options for debug builds linked to MSVCRTD.DLL
+# /MDd     - link with MSVCRTD.LIB (Dynamically-linked, multi-threaded, debug C-runtime)
+# /Od      - minimal optimization
+WIN_IDG_CFLAGS = /MDd /Od /Z7 
+
+# MSVC compiler options for debug builds linked to MSVCRT.DLL
+# /MD      - link with MSVCRT.LIB (Dynamically-linked, multi-threaded, debug C-runtime)
+# /Od      - minimal optimization
+WIN_DEBUG_CFLAGS = /MD /Od /Z7 
+
+# MSVC compiler options for release (optimized) builds
+# /MD      - link with MSVCRT.LIB (Dynamically-linked, multi-threaded, C-runtime)
+# /O2      - Optimize for speed
+# /G5      - Optimize for Pentium
+WIN_OPT_CFLAGS = /MD /O2
+
+ifdef BUILD_OPT
+OPTIMIZER = $(WIN_OPT_CFLAGS)
+else
+ifdef BUILD_IDG
+OPTIMIZER = $(WIN_IDG_CFLAGS)
+else
+OPTIMIZER = $(WIN_DEBUG_CFLAGS)
+endif
+endif
+
+OS_CFLAGS = -DXP_PC -DWIN32 -D_WINDOWS -D_WIN32 $(WIN_CFLAGS)
+JSDLL_CFLAGS = -DEXPORT_JS_API
+OS_LIBS = -lm -lc
+
+PREBUILT_CPUCFG = 1
+USE_MSVC = 1
+
+LIB_LINK_FLAGS=kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib\
+ advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib oldnames.lib /nologo\
+ /subsystem:windows /dll /debug /pdb:none\
+ /machine:I386
+
+EXE_LINK_FLAGS=kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib\
+ advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib oldnames.lib /nologo\
+ /subsystem:console /debug /pdb:none\
+ /machine:I386
+
+# CAFEDIR = t:/cafe
+# JCLASSPATH = $(CAFEDIR)/Java/Lib/classes.zip
+# JAVAC = $(CAFEDIR)/Bin/sj.exe
+# JAVAH = $(CAFEDIR)/Java/Bin/javah.exe
+# JCFLAGS = -I$(CAFEDIR)/Java/Include -I$(CAFEDIR)/Java/Include/win32

mozilla/js/src/config/dgux.mk

@@ -0,0 +1,58 @@
+#
+# The contents of this file are subject to the Netscape Public
+# License Version 1.1 (the "License"); you may not use this file
+# except in compliance with the License. You may obtain a copy of
+# the License at http://www.mozilla.org/NPL/
+#
+# Software distributed under the License is distributed on an "AS
+# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+# implied. See the License for the specific language governing
+# rights and limitations under the License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is Netscape
+# Communications Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation. All
+# Rights Reserved.
+#
+# Contributor(s): 
+#
+# Alternatively, the contents of this file may be used under the
+# terms of the GNU Public License (the "GPL"), in which case the
+# provisions of the GPL are applicable instead of those above.
+# If you wish to allow use of your version of this file only
+# under the terms of the GPL and not to allow others to use your
+# version of this file under the NPL, indicate your decision by
+# deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL.  If you do not delete
+# the provisions above, a recipient may use your version of this
+# file under either the NPL or the GPL.
+#
+
+#
+# Config stuff for Data General DG/UX
+#
+
+#
+#  Initial DG/UX port by Marc Fraioli (fraioli@dg-rtp.dg.com)
+#
+
+AS = as
+CC = gcc 
+CCC = g++ 
+
+RANLIB = echo
+
+#
+#  _DGUX_SOURCE is needed to turn on a lot of stuff in the headers if 
+#      you're not using DG's compiler.  It shouldn't hurt if you are.
+#
+#  _POSIX4A_DRAFT10_SOURCE is needed to pick up localtime_r, used in
+#      prtime.c
+#
+OS_CFLAGS = -DXP_UNIX -DSVR4 -DSYSV -DDGUX -D_DGUX_SOURCE -D_POSIX4A_DRAFT10_SOURCE
+OS_LIBS = -lsocket -lnsl 
+
+NOSUCHFILE = /no-such-file

mozilla/js/src/fdlibm/Makefile.in

@@ -0,0 +1,122 @@
+#
+# The contents of this file are subject to the Netscape Public
+# License Version 1.1 (the "License"); you may not use this file
+# except in compliance with the License. You may obtain a copy of
+# the License at http://www.mozilla.org/NPL/
+#
+# Software distributed under the License is distributed on an "AS
+# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+# implied. See the License for the specific language governing
+# rights and limitations under the License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is Netscape Communications
+# Corporation.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation. All
+# Rights Reserved.
+#
+# Contributor(s): 
+#
+# Alternatively, the contents of this file may be used under the
+# terms of the GNU Public License (the "GPL"), in which case the
+# provisions of the GPL are applicable instead of those above.
+# If you wish to allow use of your version of this file only
+# under the terms of the GPL and not to allow others to use your
+# version of this file under the NPL, indicate your decision by
+# deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL.  If you do not delete
+# the provisions above, a recipient may use your version of this
+# file under either the NPL or the GPL.
+#
+
+DEPTH		= ../../..
+topsrcdir	= @top_srcdir@
+srcdir		= @srcdir@
+VPATH		= @srcdir@
+
+include $(DEPTH)/config/autoconf.mk
+
+MODULE		= js
+LIBRARY_NAME	= fdm
+
+CSRCS		= \
+		e_acos.c \
+		e_asin.c \
+		e_atan2.c \
+		e_exp.c \
+		e_fmod.c \
+		e_log.c \
+		e_pow.c \
+		e_rem_pio2.c \
+		s_scalbn.c \
+		e_sqrt.c \
+		k_cos.c \
+		k_sin.c \
+		k_rem_pio2.c \
+		k_tan.c \
+		s_atan.c \
+		s_ceil.c \
+		s_copysign.c \
+		s_cos.c \
+		s_fabs.c \
+		s_finite.c \
+		s_floor.c \
+		s_isnan.c \
+		s_lib_version.c \
+		s_sin.c \
+		s_tan.c \
+		w_acos.c \
+		w_asin.c \
+		w_atan2.c \
+		w_exp.c \
+		w_fmod.c \
+		w_log.c \
+		w_pow.c \
+		w_sqrt.c \
+		$(NULL)
+
+EXPORTS		= fdlibm.h
+
+# we need to force a static lib for the linking that js/src/Makefile.in wants
+# to do, and we don't really need a shared library ever, so:
+override NO_SHARED_LIB=1
+override NO_STATIC_LIB=
+
+include $(topsrcdir)/config/rules.mk
+
+#
+# Default IEEE libm
+#
+CFLAGS		+= -D_IEEE_LIBM -DGCC_OPT_BUG
+
+ifeq ($(OS_ARCH),Linux)
+LDFLAGS		+= -ldl
+endif
+
+ifeq ($(OS_ARCH),OSF1)
+LDFLAGS		+= -lc_r
+endif
+
+ifeq ($(OS_ARCH),SunOS)
+LDFLAGS		+= -lposix4 -ldl -lnsl -lsocket
+ifeq ($(CPU_ARCH),sparc)
+
+ifndef JS_NO_ULTRA
+ULTRA_OPTIONS	:= -xarch=v8plus,-DULTRA_SPARC
+ULTRA_OPTIONSCC	:= -DULTRA_SPARC
+else
+ULTRA_OPTIONS	:= -xarch=v8
+ULTRA_OPTIONSCC	:=
+endif
+
+ifeq ($(shell uname -m),sun4u)
+ASFLAGS		+= -Wa,$(ULTRA_OPTIONS),-P,-L,-D_ASM,-D__STDC__=0 $(ULTRA_OPTIONSCC)
+else
+ASFLAGS		+= -Wa,-xarch=v8,-P,-L,-D_ASM,-D__STDC__=0
+endif
+
+endif
+endif
+

mozilla/js/src/fdlibm/Makefile.ref

@@ -0,0 +1,183 @@
+#
+# The contents of this file are subject to the Netscape Public
+# License Version 1.1 (the "License"); you may not use this file
+# except in compliance with the License. You may obtain a copy of
+# the License at http://www.mozilla.org/NPL/
+#
+# Software distributed under the License is distributed on an "AS
+# IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+# implied. See the License for the specific language governing
+# rights and limitations under the License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is Sun Microsystems,
+# Inc.  Portions created by Netscape are
+# Copyright (C) 1998 Netscape Communications Corporation. All
+# Rights Reserved.
+#
+# Contributor(s): 
+#
+# Alternatively, the contents of this file may be used under the
+# terms of the GNU Public License (the "GPL"), in which case the
+# provisions of the GPL are applicable instead of those above.
+# If you wish to allow use of your version of this file only
+# under the terms of the GPL and not to allow others to use your
+# version of this file under the NPL, indicate your decision by
+# deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL.  If you do not delete
+# the provisions above, a recipient may use your version of this
+# file under either the NPL or the GPL.
+
+#
+#  @(#)Makefile 1.4 95/01/18 
+# 
+#  ====================================================
+#  Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+# 
+#  Developed at SunSoft, a Sun Microsystems, Inc. business.
+#  Permission to use, copy, modify, and distribute this
+#  software is freely granted, provided that this notice 
+#  is preserved.
+#  ====================================================
+# 
+# 
+
+#
+# There are two options in making libm at fdlibm compile time:
+#       _IEEE_LIBM      --- IEEE libm; smaller, and somewhat faster
+#       _MULTI_LIBM     --- Support multi-standard at runtime by 
+#                           imposing wrapper functions defined in 
+#                           fdlibm.h:
+#                               _IEEE_MODE      -- IEEE
+#                               _XOPEN_MODE     -- X/OPEN
+#                               _POSIX_MODE     -- POSIX/ANSI
+#                               _SVID3_MODE     -- SVID
+#
+# Here is how to set up CFLAGS to create the desired libm at 
+# compile time:
+#
+#       CFLAGS = -D_IEEE_LIBM           ... IEEE libm (recommended)
+#       CFLAGS = -D_SVID3_MODE  ... Multi-standard supported
+#                                           libm with SVID as the 
+#                                           default standard
+#       CFLAGS = -D_XOPEN_MODE  ... Multi-standard supported
+#                                           libm with XOPEN as the 
+#                                           default standard
+#       CFLAGS = -D_POSIX_MODE  ... Multi-standard supported
+#                                           libm with POSIX as the 
+#                                           default standard
+#       CFLAGS =                        ... Multi-standard supported
+#                                           libm with IEEE as the 
+#                                           default standard
+# 
+# NOTE: if scalb's second arguement is an int, then one must
+# define _SCALB_INT in CFLAGS. The default prototype of scalb
+# is double scalb(double, double)
+#
+
+DEPTH           = ..
+
+include $(DEPTH)/config.mk
+
+#
+# Default IEEE libm
+#
+CFLAGS          += -DXP_UNIX $(OPTIMIZER) $(OS_CFLAGS) $(DEFINES) $(INCLUDES) \
+		  -DJSFILE $(XCFLAGS) -D_IEEE_LIBM
+
+
+
+#CC = cc
+
+INCFILES = fdlibm.h
+.INIT: $(INCFILES)
+.KEEP_STATE:
+FDLIBM_CFILES =         \
+	k_standard.c k_rem_pio2.c \
+	k_cos.c k_sin.c k_tan.c \
+	e_acos.c e_acosh.c e_asin.c e_atan2.c \
+	e_atanh.c e_cosh.c e_exp.c e_fmod.c \
+	e_gamma.c e_gamma_r.c e_hypot.c e_j0.c \
+	e_j1.c e_jn.c e_lgamma.c e_lgamma_r.c \
+	e_log.c e_log10.c e_pow.c e_rem_pio2.c e_remainder.c \
+	e_scalb.c e_sinh.c e_sqrt.c \
+	w_acos.c w_acosh.c w_asin.c w_atan2.c \
+	w_atanh.c w_cosh.c w_exp.c w_fmod.c \
+	w_gamma.c w_gamma_r.c w_hypot.c w_j0.c \
+	w_j1.c w_jn.c w_lgamma.c w_lgamma_r.c \
+	w_log.c w_log10.c w_pow.c w_remainder.c \
+	w_scalb.c w_sinh.c w_sqrt.c \
+	s_asinh.c s_atan.c s_cbrt.c s_ceil.c s_copysign.c \
+	s_cos.c s_erf.c s_expm1.c s_fabs.c s_finite.c s_floor.c \
+	s_frexp.c s_ilogb.c s_isnan.c s_ldexp.c s_lib_version.c \
+	s_log1p.c s_logb.c s_matherr.c s_modf.c s_nextafter.c \
+	s_rint.c s_scalbn.c s_signgam.c s_significand.c s_sin.c \
+	s_tan.c s_tanh.c
+
+ifdef USE_MSVC
+FDLIBM_OBJS = $(addprefix $(OBJDIR)/, $(FDLIBM_CFILES:.c=.obj))
+else
+FDLIBM_OBJS = $(addprefix $(OBJDIR)/, $(FDLIBM_CFILES:.c=.o))
+endif
+
+ifdef USE_MSVC
+LIBRARY = $(OBJDIR)/fdlibm.lib
+else
+LIBRARY = $(OBJDIR)/libfdm.a
+endif
+
+define MAKE_OBJDIR
+if test ! -d $(@D); then rm -rf $(@D); mkdir $(@D); fi
+endef
+
+all: $(LIBRARY) 
+
+export:
+
+$(OBJDIR)/%: %.c
+	@$(MAKE_OBJDIR)
+	$(CC) -o $@ $(CFLAGS) $*.c $(LDFLAGS)
+
+$(OBJDIR)/%.o: %.c
+	@$(MAKE_OBJDIR)
+	$(CC) -o $@ -c $(CFLAGS) $*.c
+
+$(OBJDIR)/%.o: %.s
+	@$(MAKE_OBJDIR)
+	$(AS) -o $@ $(ASFLAGS) $*.s
+
+# windows only
+$(OBJDIR)/%.obj: %.c
+	@$(MAKE_OBJDIR)
+	$(CC) -Fo$(OBJDIR)/ -c $(CFLAGS) $*.c
+
+ifeq ($(OS_ARCH),OS2)
+$(LIBRARY): $(FDLIBM_OBJS)
+	$(AR) $@ $? $(AR_OS2_SUFFIX)
+	$(RANLIB) $@
+else
+ifdef USE_MSVC
+$(LIBRARY): $(FDLIBM_OBJS)
+	lib.exe /out:"$@" $?
+else
+$(LIBRARY): $(FDLIBM_OBJS)
+	$(AR) rv $@ $?
+	$(RANLIB) $@
+endif
+endif
+
+libfdm.a : $(FDLIBM_OBJS) 
+	$(AR) cru $(OBJDIR)/libfdm.a $(FDLIBM_OBJS)
+	$(RANLIB) $(OBJDIR)/libfdm.a
+
+clean:
+	rm -rf $(FDLIBM_OBJS)
+
+clobber:
+	rm -rf $(FDLIBM_OBJS) $(LIBRARY) $(DEPENDENCIES)
+
+SUFFIXES: .i
+%.i: %.c
+	$(CC) -C -E $(CFLAGS) $< > $*.i

mozilla/js/src/fdlibm/e_acos.c

@@ -0,0 +1,143 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public
+ * License Version 1.1 (the "License"); you may not use this file
+ * except in compliance with the License. You may obtain a copy of
+ * the License at http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the License is distributed on an "AS
+ * IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+ * implied. See the License for the specific language governing
+ * rights and limitations under the License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is Sun Microsystems,
+ * Inc.  Portions created by Netscape are
+ * Copyright (C) 1998 Netscape Communications Corporation. All
+ * Rights Reserved.
+ *
+ * Contributor(s): 
+ *
+ * Alternatively, the contents of this file may be used under the
+ * terms of the GNU Public License (the "GPL"), in which case the
+ * provisions of the GPL are applicable instead of those above.
+ * If you wish to allow use of your version of this file only
+ * under the terms of the GPL and not to allow others to use your
+ * version of this file under the NPL, indicate your decision by
+ * deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL.  If you do not delete
+ * the provisions above, a recipient may use your version of this
+ * file under either the NPL or the GPL.
+ */
+
+/* @(#)e_acos.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* __ieee754_acos(x)
+ * Method :                  
+ *	acos(x)  = pi/2 - asin(x)
+ *	acos(-x) = pi/2 + asin(x)
+ * For |x|<=0.5
+ *	acos(x) = pi/2 - (x + x*x^2*R(x^2))	(see asin.c)
+ * For x>0.5
+ * 	acos(x) = pi/2 - (pi/2 - 2asin(sqrt((1-x)/2)))
+ *		= 2asin(sqrt((1-x)/2))  
+ *		= 2s + 2s*z*R(z) 	...z=(1-x)/2, s=sqrt(z)
+ *		= 2f + (2c + 2s*z*R(z))
+ *     where f=hi part of s, and c = (z-f*f)/(s+f) is the correction term
+ *     for f so that f+c ~ sqrt(z).
+ * For x<-0.5
+ *	acos(x) = pi - 2asin(sqrt((1-|x|)/2))
+ *		= pi - 0.5*(s+s*z*R(z)), where z=(1-|x|)/2,s=sqrt(z)
+ *
+ * Special cases:
+ *	if x is NaN, return x itself;
+ *	if |x|>1, return NaN with invalid signal.
+ *
+ * Function needed: sqrt
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double 
+#else
+static double 
+#endif
+one=  1.00000000000000000000e+00, /* 0x3FF00000, 0x00000000 */
+pi =  3.14159265358979311600e+00, /* 0x400921FB, 0x54442D18 */
+pio2_hi =  1.57079632679489655800e+00, /* 0x3FF921FB, 0x54442D18 */
+pio2_lo =  6.12323399573676603587e-17, /* 0x3C91A626, 0x33145C07 */
+pS0 =  1.66666666666666657415e-01, /* 0x3FC55555, 0x55555555 */
+pS1 = -3.25565818622400915405e-01, /* 0xBFD4D612, 0x03EB6F7D */
+pS2 =  2.01212532134862925881e-01, /* 0x3FC9C155, 0x0E884455 */
+pS3 = -4.00555345006794114027e-02, /* 0xBFA48228, 0xB5688F3B */
+pS4 =  7.91534994289814532176e-04, /* 0x3F49EFE0, 0x7501B288 */
+pS5 =  3.47933107596021167570e-05, /* 0x3F023DE1, 0x0DFDF709 */
+qS1 = -2.40339491173441421878e+00, /* 0xC0033A27, 0x1C8A2D4B */
+qS2 =  2.02094576023350569471e+00, /* 0x40002AE5, 0x9C598AC8 */
+qS3 = -6.88283971605453293030e-01, /* 0xBFE6066C, 0x1B8D0159 */
+qS4 =  7.70381505559019352791e-02; /* 0x3FB3B8C5, 0xB12E9282 */
+
+#ifdef __STDC__
+	double __ieee754_acos(double x)
+#else
+	double __ieee754_acos(x)
+	double x;
+#endif
+{
+#ifdef GCC_OPT_BUG
+        volatile double df;
+#else
+        double df;
+#endif
+	double z,p,q,r,w,s,c;
+	int hx,ix;
+	hx = __HI(x);
+	ix = hx&0x7fffffff;
+	if(ix>=0x3ff00000) {	/* |x| >= 1 */
+	    if(((ix-0x3ff00000)|__LO(x))==0) {	/* |x|==1 */
+		if(hx>0) return 0.0;		/* acos(1) = 0  */
+		else return pi+2.0*pio2_lo;	/* acos(-1)= pi */
+	    }
+	    return (x-x)/(x-x);		/* acos(|x|>1) is NaN */
+	}
+	if(ix<0x3fe00000) {	/* |x| < 0.5 */
+	    if(ix<=0x3c600000) return pio2_hi+pio2_lo;/*if|x|<2**-57*/
+	    z = x*x;
+	    p = z*(pS0+z*(pS1+z*(pS2+z*(pS3+z*(pS4+z*pS5)))));
+	    q = one+z*(qS1+z*(qS2+z*(qS3+z*qS4)));
+	    r = p/q;
+	    return pio2_hi - (x - (pio2_lo-x*r));
+	} else  if (hx<0) {		/* x < -0.5 */
+	    z = (one+x)*0.5;
+	    p = z*(pS0+z*(pS1+z*(pS2+z*(pS3+z*(pS4+z*pS5)))));
+	    q = one+z*(qS1+z*(qS2+z*(qS3+z*qS4)));
+	    s = fd_sqrt(z);
+	    r = p/q;
+	    w = r*s-pio2_lo;
+	    return pi - 2.0*(s+w);
+	} else {			/* x > 0.5 */
+	    z = (one-x)*0.5;
+	    s = fd_sqrt(z);
+	    df = s;
+	    __LO(df) = 0;
+	    c  = (z-df*df)/(s+df);
+	    p = z*(pS0+z*(pS1+z*(pS2+z*(pS3+z*(pS4+z*pS5)))));
+	    q = one+z*(qS1+z*(qS2+z*(qS3+z*qS4)));
+	    r = p/q;
+	    w = r*s+c;
+	    return 2.0*(df+w);
+	}
+}

mozilla/js/src/fdlibm/e_acosh.c

@@ -0,0 +1,98 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public
+ * License Version 1.1 (the "License"); you may not use this file
+ * except in compliance with the License. You may obtain a copy of
+ * the License at http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the License is distributed on an "AS
+ * IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+ * implied. See the License for the specific language governing
+ * rights and limitations under the License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is Sun Microsystems,
+ * Inc.  Portions created by Netscape are
+ * Copyright (C) 1998 Netscape Communications Corporation. All
+ * Rights Reserved.
+ *
+ * Contributor(s): 
+ *
+ * Alternatively, the contents of this file may be used under the
+ * terms of the GNU Public License (the "GPL"), in which case the
+ * provisions of the GPL are applicable instead of those above.
+ * If you wish to allow use of your version of this file only
+ * under the terms of the GPL and not to allow others to use your
+ * version of this file under the NPL, indicate your decision by
+ * deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL.  If you do not delete
+ * the provisions above, a recipient may use your version of this
+ * file under either the NPL or the GPL.
+ */
+
+/* @(#)e_acosh.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ *
+ */
+
+/* __ieee754_acosh(x)
+ * Method :
+ *	Based on 
+ *		acosh(x) = log [ x + sqrt(x*x-1) ]
+ *	we have
+ *		acosh(x) := log(x)+ln2,	if x is large; else
+ *		acosh(x) := log(2x-1/(sqrt(x*x-1)+x)) if x>2; else
+ *		acosh(x) := log1p(t+sqrt(2.0*t+t*t)); where t=x-1.
+ *
+ * Special cases:
+ *	acosh(x) is NaN with signal if x<1.
+ *	acosh(NaN) is NaN without signal.
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double 
+#else
+static double 
+#endif
+one	= 1.0,
+ln2	= 6.93147180559945286227e-01;  /* 0x3FE62E42, 0xFEFA39EF */
+
+#ifdef __STDC__
+	double __ieee754_acosh(double x)
+#else
+	double __ieee754_acosh(x)
+	double x;
+#endif
+{	
+	double t;
+	int hx;
+	hx = __HI(x);
+	if(hx<0x3ff00000) {		/* x < 1 */
+	    return (x-x)/(x-x);
+	} else if(hx >=0x41b00000) {	/* x > 2**28 */
+	    if(hx >=0x7ff00000) {	/* x is inf of NaN */
+	        return x+x;
+	    } else 
+		return __ieee754_log(x)+ln2;	/* acosh(huge)=log(2x) */
+	} else if(((hx-0x3ff00000)|__LO(x))==0) {
+	    return 0.0;			/* acosh(1) = 0 */
+	} else if (hx > 0x40000000) {	/* 2**28 > x > 2 */
+	    t=x*x;
+	    return __ieee754_log(2.0*x-one/(x+fd_sqrt(t-one)));
+	} else {			/* 1<x<2 */
+	    t = x-one;
+	    return fd_log1p(t+fd_sqrt(2.0*t+t*t));
+	}
+}

mozilla/js/src/fdlibm/e_asin.c

@@ -0,0 +1,152 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public
+ * License Version 1.1 (the "License"); you may not use this file
+ * except in compliance with the License. You may obtain a copy of
+ * the License at http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the License is distributed on an "AS
+ * IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+ * implied. See the License for the specific language governing
+ * rights and limitations under the License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is Sun Microsystems,
+ * Inc.  Portions created by Netscape are
+ * Copyright (C) 1998 Netscape Communications Corporation. All
+ * Rights Reserved.
+ *
+ * Contributor(s): 
+ *
+ * Alternatively, the contents of this file may be used under the
+ * terms of the GNU Public License (the "GPL"), in which case the
+ * provisions of the GPL are applicable instead of those above.
+ * If you wish to allow use of your version of this file only
+ * under the terms of the GPL and not to allow others to use your
+ * version of this file under the NPL, indicate your decision by
+ * deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL.  If you do not delete
+ * the provisions above, a recipient may use your version of this
+ * file under either the NPL or the GPL.
+ */
+
+/* @(#)e_asin.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* __ieee754_asin(x)
+ * Method :                  
+ *	Since  asin(x) = x + x^3/6 + x^5*3/40 + x^7*15/336 + ...
+ *	we approximate asin(x) on [0,0.5] by
+ *		asin(x) = x + x*x^2*R(x^2)
+ *	where
+ *		R(x^2) is a rational approximation of (asin(x)-x)/x^3 
+ *	and its remez error is bounded by
+ *		|(asin(x)-x)/x^3 - R(x^2)| < 2^(-58.75)
+ *
+ *	For x in [0.5,1]
+ *		asin(x) = pi/2-2*asin(sqrt((1-x)/2))
+ *	Let y = (1-x), z = y/2, s := sqrt(z), and pio2_hi+pio2_lo=pi/2;
+ *	then for x>0.98
+ *		asin(x) = pi/2 - 2*(s+s*z*R(z))
+ *			= pio2_hi - (2*(s+s*z*R(z)) - pio2_lo)
+ *	For x<=0.98, let pio4_hi = pio2_hi/2, then
+ *		f = hi part of s;
+ *		c = sqrt(z) - f = (z-f*f)/(s+f) 	...f+c=sqrt(z)
+ *	and
+ *		asin(x) = pi/2 - 2*(s+s*z*R(z))
+ *			= pio4_hi+(pio4-2s)-(2s*z*R(z)-pio2_lo)
+ *			= pio4_hi+(pio4-2f)-(2s*z*R(z)-(pio2_lo+2c))
+ *
+ * Special cases:
+ *	if x is NaN, return x itself;
+ *	if |x|>1, return NaN with invalid signal.
+ *
+ */
+
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double 
+#else
+static double 
+#endif
+one =  1.00000000000000000000e+00, /* 0x3FF00000, 0x00000000 */
+really_big =  1.000e+300,
+pio2_hi =  1.57079632679489655800e+00, /* 0x3FF921FB, 0x54442D18 */
+pio2_lo =  6.12323399573676603587e-17, /* 0x3C91A626, 0x33145C07 */
+pio4_hi =  7.85398163397448278999e-01, /* 0x3FE921FB, 0x54442D18 */
+	/* coefficient for R(x^2) */
+pS0 =  1.66666666666666657415e-01, /* 0x3FC55555, 0x55555555 */
+pS1 = -3.25565818622400915405e-01, /* 0xBFD4D612, 0x03EB6F7D */
+pS2 =  2.01212532134862925881e-01, /* 0x3FC9C155, 0x0E884455 */
+pS3 = -4.00555345006794114027e-02, /* 0xBFA48228, 0xB5688F3B */
+pS4 =  7.91534994289814532176e-04, /* 0x3F49EFE0, 0x7501B288 */
+pS5 =  3.47933107596021167570e-05, /* 0x3F023DE1, 0x0DFDF709 */
+qS1 = -2.40339491173441421878e+00, /* 0xC0033A27, 0x1C8A2D4B */
+qS2 =  2.02094576023350569471e+00, /* 0x40002AE5, 0x9C598AC8 */
+qS3 = -6.88283971605453293030e-01, /* 0xBFE6066C, 0x1B8D0159 */
+qS4 =  7.70381505559019352791e-02; /* 0x3FB3B8C5, 0xB12E9282 */
+
+#ifdef __STDC__
+	double __ieee754_asin(double x)
+#else
+	double __ieee754_asin(x)
+	double x;
+#endif
+{
+#ifdef GCC_OPT_BUG
+        volatile double w;
+#else
+        double w;
+#endif
+	double t,p,q,c,r,s;
+	int hx,ix;
+	hx = __HI(x);
+	ix = hx&0x7fffffff;
+	if(ix>= 0x3ff00000) {		/* |x|>= 1 */
+	    if(((ix-0x3ff00000)|__LO(x))==0)
+		    /* asin(1)=+-pi/2 with inexact */
+		return x*pio2_hi+x*pio2_lo;	
+	    return (x-x)/(x-x);		/* asin(|x|>1) is NaN */   
+	} else if (ix<0x3fe00000) {	/* |x|<0.5 */
+	    if(ix<0x3e400000) {		/* if |x| < 2**-27 */
+		if(really_big+x>one) return x;/* return x with inexact if x!=0*/
+	    } else 
+		t = x*x;
+		p = t*(pS0+t*(pS1+t*(pS2+t*(pS3+t*(pS4+t*pS5)))));
+		q = one+t*(qS1+t*(qS2+t*(qS3+t*qS4)));
+		w = p/q;
+		return x+x*w;
+	}
+	/* 1> |x|>= 0.5 */
+	w = one-fd_fabs(x);
+	t = w*0.5;
+	p = t*(pS0+t*(pS1+t*(pS2+t*(pS3+t*(pS4+t*pS5)))));
+	q = one+t*(qS1+t*(qS2+t*(qS3+t*qS4)));
+	s = fd_sqrt(t);
+	if(ix>=0x3FEF3333) { 	/* if |x| > 0.975 */
+	    w = p/q;
+	    t = pio2_hi-(2.0*(s+s*w)-pio2_lo);
+	} else {
+	    w  = s;
+	    __LO(w) = 0;
+	    c  = (t-w*w)/(s+w);
+	    r  = p/q;
+	    p  = 2.0*s*r-(pio2_lo-2.0*c);
+	    q  = pio4_hi-2.0*w;
+	    t  = pio4_hi-(p-q);
+	}    
+	if(hx>0) return t; else return -t;    
+}

mozilla/js/src/fdlibm/e_atan2.c

@@ -0,0 +1,156 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public
+ * License Version 1.1 (the "License"); you may not use this file
+ * except in compliance with the License. You may obtain a copy of
+ * the License at http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the License is distributed on an "AS
+ * IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+ * implied. See the License for the specific language governing
+ * rights and limitations under the License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is Sun Microsystems,
+ * Inc.  Portions created by Netscape are
+ * Copyright (C) 1998 Netscape Communications Corporation. All
+ * Rights Reserved.
+ *
+ * Contributor(s): 
+ *
+ * Alternatively, the contents of this file may be used under the
+ * terms of the GNU Public License (the "GPL"), in which case the
+ * provisions of the GPL are applicable instead of those above.
+ * If you wish to allow use of your version of this file only
+ * under the terms of the GPL and not to allow others to use your
+ * version of this file under the NPL, indicate your decision by
+ * deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL.  If you do not delete
+ * the provisions above, a recipient may use your version of this
+ * file under either the NPL or the GPL.
+ */
+
+/* @(#)e_atan2.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ *
+ */
+
+/* __ieee754_atan2(y,x)
+ * Method :
+ *	1. Reduce y to positive by atan2(y,x)=-atan2(-y,x).
+ *	2. Reduce x to positive by (if x and y are unexceptional): 
+ *		ARG (x+iy) = arctan(y/x)   	   ... if x > 0,
+ *		ARG (x+iy) = pi - arctan[y/(-x)]   ... if x < 0,
+ *
+ * Special cases:
+ *
+ *	ATAN2((anything), NaN ) is NaN;
+ *	ATAN2(NAN , (anything) ) is NaN;
+ *	ATAN2(+-0, +(anything but NaN)) is +-0  ;
+ *	ATAN2(+-0, -(anything but NaN)) is +-pi ;
+ *	ATAN2(+-(anything but 0 and NaN), 0) is +-pi/2;
+ *	ATAN2(+-(anything but INF and NaN), +INF) is +-0 ;
+ *	ATAN2(+-(anything but INF and NaN), -INF) is +-pi;
+ *	ATAN2(+-INF,+INF ) is +-pi/4 ;
+ *	ATAN2(+-INF,-INF ) is +-3pi/4;
+ *	ATAN2(+-INF, (anything but,0,NaN, and INF)) is +-pi/2;
+ *
+ * Constants:
+ * The hexadecimal values are the intended ones for the following 
+ * constants. The decimal values may be used, provided that the 
+ * compiler will convert from decimal to binary accurately enough 
+ * to produce the hexadecimal values shown.
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double 
+#else
+static double 
+#endif
+tiny  = 1.0e-300,
+zero  = 0.0,
+pi_o_4  = 7.8539816339744827900E-01, /* 0x3FE921FB, 0x54442D18 */
+pi_o_2  = 1.5707963267948965580E+00, /* 0x3FF921FB, 0x54442D18 */
+pi      = 3.1415926535897931160E+00, /* 0x400921FB, 0x54442D18 */
+pi_lo   = 1.2246467991473531772E-16; /* 0x3CA1A626, 0x33145C07 */
+
+#ifdef __STDC__
+	double __ieee754_atan2(double y, double x)
+#else
+	double __ieee754_atan2(y,x)
+	double  y,x;
+#endif
+{  
+	double z;
+	int k,m,hx,hy,ix,iy;
+	unsigned lx,ly;
+
+	hx = __HI(x); ix = hx&0x7fffffff;
+	lx = __LO(x);
+	hy = __HI(y); iy = hy&0x7fffffff;
+	ly = __LO(y);
+	if(((ix|((lx|-(int)lx)>>31))>0x7ff00000)||
+	   ((iy|((ly|-(int)ly)>>31))>0x7ff00000))	/* x or y is NaN */
+	   return x+y;
+	if(((hx-0x3ff00000)|lx)==0) return fd_atan(y);   /* x=1.0 */
+	m = ((hy>>31)&1)|((hx>>30)&2);	/* 2*sign(x)+sign(y) */
+
+    /* when y = 0 */
+	if((iy|ly)==0) {
+	    switch(m) {
+		case 0: 
+		case 1: return y; 	/* atan(+-0,+anything)=+-0 */
+		case 2: return  pi+tiny;/* atan(+0,-anything) = pi */
+		case 3: return -pi-tiny;/* atan(-0,-anything) =-pi */
+	    }
+	}
+    /* when x = 0 */
+	if((ix|lx)==0) return (hy<0)?  -pi_o_2-tiny: pi_o_2+tiny;
+	    
+    /* when x is INF */
+	if(ix==0x7ff00000) {
+	    if(iy==0x7ff00000) {
+		switch(m) {
+		    case 0: return  pi_o_4+tiny;/* atan(+INF,+INF) */
+		    case 1: return -pi_o_4-tiny;/* atan(-INF,+INF) */
+		    case 2: return  3.0*pi_o_4+tiny;/*atan(+INF,-INF)*/
+		    case 3: return -3.0*pi_o_4-tiny;/*atan(-INF,-INF)*/
+		}
+	    } else {
+		switch(m) {
+		    case 0: return  zero  ;	/* atan(+...,+INF) */
+		    case 1: return -zero  ;	/* atan(-...,+INF) */
+		    case 2: return  pi+tiny  ;	/* atan(+...,-INF) */
+		    case 3: return -pi-tiny  ;	/* atan(-...,-INF) */
+		}
+	    }
+	}
+    /* when y is INF */
+	if(iy==0x7ff00000) return (hy<0)? -pi_o_2-tiny: pi_o_2+tiny;
+
+    /* compute y/x */
+	k = (iy-ix)>>20;
+	if(k > 60) z=pi_o_2+0.5*pi_lo; 	/* |y/x| >  2**60 */
+	else if(hx<0&&k<-60) z=0.0; 	/* |y|/x < -2**60 */
+	else z=fd_atan(fd_fabs(y/x));		/* safe to do y/x */
+	switch (m) {
+	    case 0: return       z  ;	/* atan(+,+) */
+	    case 1: __HI(z) ^= 0x80000000;
+		    return       z  ;	/* atan(-,+) */
+	    case 2: return  pi-(z-pi_lo);/* atan(+,-) */
+	    default: /* case 3 */
+	    	    return  (z-pi_lo)-pi;/* atan(-,-) */
+	}
+}

mozilla/js/src/fdlibm/e_atanh.c

@@ -0,0 +1,101 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public
+ * License Version 1.1 (the "License"); you may not use this file
+ * except in compliance with the License. You may obtain a copy of
+ * the License at http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the License is distributed on an "AS
+ * IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+ * implied. See the License for the specific language governing
+ * rights and limitations under the License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is Sun Microsystems,
+ * Inc.  Portions created by Netscape are
+ * Copyright (C) 1998 Netscape Communications Corporation. All
+ * Rights Reserved.
+ *
+ * Contributor(s): 
+ *
+ * Alternatively, the contents of this file may be used under the
+ * terms of the GNU Public License (the "GPL"), in which case the
+ * provisions of the GPL are applicable instead of those above.
+ * If you wish to allow use of your version of this file only
+ * under the terms of the GPL and not to allow others to use your
+ * version of this file under the NPL, indicate your decision by
+ * deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL.  If you do not delete
+ * the provisions above, a recipient may use your version of this
+ * file under either the NPL or the GPL.
+ */
+
+/* @(#)e_atanh.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ *
+ */
+
+/* __ieee754_atanh(x)
+ * Method :
+ *    1.Reduced x to positive by atanh(-x) = -atanh(x)
+ *    2.For x>=0.5
+ *                  1              2x                          x
+ *	atanh(x) = --- * log(1 + -------) = 0.5 * log1p(2 * --------)
+ *                  2             1 - x                      1 - x
+ *	
+ * 	For x<0.5
+ *	atanh(x) = 0.5*log1p(2x+2x*x/(1-x))
+ *
+ * Special cases:
+ *	atanh(x) is NaN if |x| > 1 with signal;
+ *	atanh(NaN) is that NaN with no signal;
+ *	atanh(+-1) is +-INF with signal.
+ *
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double one = 1.0, really_big = 1e300;
+#else
+static double one = 1.0, really_big = 1e300;
+#endif
+
+static double zero = 0.0;
+
+#ifdef __STDC__
+	double __ieee754_atanh(double x)
+#else
+	double __ieee754_atanh(x)
+	double x;
+#endif
+{
+	double t;
+	int hx,ix;
+	unsigned lx;
+	hx = __HI(x);		/* high word */
+	lx = __LO(x);		/* low word */
+	ix = hx&0x7fffffff;
+	if ((ix|((lx|(-(int)lx))>>31))>0x3ff00000) /* |x|>1 */
+	    return (x-x)/(x-x);
+	if(ix==0x3ff00000) 
+	    return x/zero;
+	if(ix<0x3e300000&&(really_big+x)>zero) return x;	/* x<2**-28 */
+	__HI(x) = ix;		/* x <- |x| */
+	if(ix<0x3fe00000) {		/* x < 0.5 */
+	    t = x+x;
+	    t = 0.5*fd_log1p(t+t*x/(one-x));
+	} else 
+	    t = 0.5*fd_log1p((x+x)/(one-x));
+	if(hx>=0) return t; else return -t;
+}

mozilla/js/src/fdlibm/e_cosh.c

@@ -0,0 +1,126 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public
+ * License Version 1.1 (the "License"); you may not use this file
+ * except in compliance with the License. You may obtain a copy of
+ * the License at http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the License is distributed on an "AS
+ * IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+ * implied. See the License for the specific language governing
+ * rights and limitations under the License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is Sun Microsystems,
+ * Inc.  Portions created by Netscape are
+ * Copyright (C) 1998 Netscape Communications Corporation. All
+ * Rights Reserved.
+ *
+ * Contributor(s): 
+ *
+ * Alternatively, the contents of this file may be used under the
+ * terms of the GNU Public License (the "GPL"), in which case the
+ * provisions of the GPL are applicable instead of those above.
+ * If you wish to allow use of your version of this file only
+ * under the terms of the GPL and not to allow others to use your
+ * version of this file under the NPL, indicate your decision by
+ * deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL.  If you do not delete
+ * the provisions above, a recipient may use your version of this
+ * file under either the NPL or the GPL.
+ */
+
+/* @(#)e_cosh.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* __ieee754_cosh(x)
+ * Method : 
+ * mathematically cosh(x) if defined to be (exp(x)+exp(-x))/2
+ *	1. Replace x by |x| (cosh(x) = cosh(-x)). 
+ *	2. 
+ *		                                        [ exp(x) - 1 ]^2 
+ *	    0        <= x <= ln2/2  :  cosh(x) := 1 + -------------------
+ *			       			           2*exp(x)
+ *
+ *		                                  exp(x) +  1/exp(x)
+ *	    ln2/2    <= x <= 22     :  cosh(x) := -------------------
+ *			       			          2
+ *	    22       <= x <= lnovft :  cosh(x) := exp(x)/2 
+ *	    lnovft   <= x <= ln2ovft:  cosh(x) := exp(x/2)/2 * exp(x/2)
+ *	    ln2ovft  <  x	    :  cosh(x) := huge*huge (overflow)
+ *
+ * Special cases:
+ *	cosh(x) is |x| if x is +INF, -INF, or NaN.
+ *	only cosh(0)=1 is exact for finite x.
+ */
+
+#include "fdlibm.h"
+
+#ifdef _WIN32
+#define huge myhuge
+#endif
+
+#ifdef __STDC__
+static const double one = 1.0, half=0.5, really_big = 1.0e300;
+#else
+static double one = 1.0, half=0.5, really_big = 1.0e300;
+#endif
+
+#ifdef __STDC__
+	double __ieee754_cosh(double x)
+#else
+	double __ieee754_cosh(x)
+	double x;
+#endif
+{	
+	double t,w;
+	int ix;
+	unsigned lx;
+
+    /* High word of |x|. */
+	ix = __HI(x);
+	ix &= 0x7fffffff;
+
+    /* x is INF or NaN */
+	if(ix>=0x7ff00000) return x*x;	
+
+    /* |x| in [0,0.5*ln2], return 1+expm1(|x|)^2/(2*exp(|x|)) */
+	if(ix<0x3fd62e43) {
+	    t = fd_expm1(fd_fabs(x));
+	    w = one+t;
+	    if (ix<0x3c800000) return w;	/* cosh(tiny) = 1 */
+	    return one+(t*t)/(w+w);
+	}
+
+    /* |x| in [0.5*ln2,22], return (exp(|x|)+1/exp(|x|)/2; */
+	if (ix < 0x40360000) {
+		t = __ieee754_exp(fd_fabs(x));
+		return half*t+half/t;
+	}
+
+    /* |x| in [22, log(maxdouble)] return half*exp(|x|) */
+	if (ix < 0x40862E42)  return half*__ieee754_exp(fd_fabs(x));
+
+    /* |x| in [log(maxdouble), overflowthresold] */
+	lx = *( (((*(unsigned*)&one)>>29)) + (unsigned*)&x);
+	if (ix<0x408633CE || 
+	      (ix==0x408633ce)&&(lx<=(unsigned)0x8fb9f87d)) {
+	    w = __ieee754_exp(half*fd_fabs(x));
+	    t = half*w;
+	    return t*w;
+	}
+
+    /* |x| > overflowthresold, cosh(x) overflow */
+	return really_big*really_big;
+}

mozilla/js/src/fdlibm/e_exp.c

@@ -0,0 +1,200 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public
+ * License Version 1.1 (the "License"); you may not use this file
+ * except in compliance with the License. You may obtain a copy of
+ * the License at http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the License is distributed on an "AS
+ * IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+ * implied. See the License for the specific language governing
+ * rights and limitations under the License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is Sun Microsystems,
+ * Inc.  Portions created by Netscape are
+ * Copyright (C) 1998 Netscape Communications Corporation. All
+ * Rights Reserved.
+ *
+ * Contributor(s): 
+ *
+ * Alternatively, the contents of this file may be used under the
+ * terms of the GNU Public License (the "GPL"), in which case the
+ * provisions of the GPL are applicable instead of those above.
+ * If you wish to allow use of your version of this file only
+ * under the terms of the GPL and not to allow others to use your
+ * version of this file under the NPL, indicate your decision by
+ * deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL.  If you do not delete
+ * the provisions above, a recipient may use your version of this
+ * file under either the NPL or the GPL.
+ */
+
+/* @(#)e_exp.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* __ieee754_exp(x)
+ * Returns the exponential of x.
+ *
+ * Method
+ *   1. Argument reduction:
+ *      Reduce x to an r so that |r| <= 0.5*ln2 ~ 0.34658.
+ *	Given x, find r and integer k such that
+ *
+ *               x = k*ln2 + r,  |r| <= 0.5*ln2.  
+ *
+ *      Here r will be represented as r = hi-lo for better 
+ *	accuracy.
+ *
+ *   2. Approximation of exp(r) by a special rational function on
+ *	the interval [0,0.34658]:
+ *	Write
+ *	    R(r**2) = r*(exp(r)+1)/(exp(r)-1) = 2 + r*r/6 - r**4/360 + ...
+ *      We use a special Reme algorithm on [0,0.34658] to generate 
+ * 	a polynomial of degree 5 to approximate R. The maximum error 
+ *	of this polynomial approximation is bounded by 2**-59. In
+ *	other words,
+ *	    R(z) ~ 2.0 + P1*z + P2*z**2 + P3*z**3 + P4*z**4 + P5*z**5
+ *  	(where z=r*r, and the values of P1 to P5 are listed below)
+ *	and
+ *	    |                  5          |     -59
+ *	    | 2.0+P1*z+...+P5*z   -  R(z) | <= 2 
+ *	    |                             |
+ *	The computation of exp(r) thus becomes
+ *                             2*r
+ *		exp(r) = 1 + -------
+ *		              R - r
+ *                                 r*R1(r)	
+ *		       = 1 + r + ----------- (for better accuracy)
+ *		                  2 - R1(r)
+ *	where
+ *			         2       4             10
+ *		R1(r) = r - (P1*r  + P2*r  + ... + P5*r   ).
+ *	
+ *   3. Scale back to obtain exp(x):
+ *	From step 1, we have
+ *	   exp(x) = 2^k * exp(r)
+ *
+ * Special cases:
+ *	exp(INF) is INF, exp(NaN) is NaN;
+ *	exp(-INF) is 0, and
+ *	for finite argument, only exp(0)=1 is exact.
+ *
+ * Accuracy:
+ *	according to an error analysis, the error is always less than
+ *	1 ulp (unit in the last place).
+ *
+ * Misc. info.
+ *	For IEEE double 
+ *	    if x >  7.09782712893383973096e+02 then exp(x) overflow
+ *	    if x < -7.45133219101941108420e+02 then exp(x) underflow
+ *
+ * Constants:
+ * The hexadecimal values are the intended ones for the following 
+ * constants. The decimal values may be used, provided that the 
+ * compiler will convert from decimal to binary accurately enough
+ * to produce the hexadecimal values shown.
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double
+#else
+static double
+#endif
+one	= 1.0,
+halF[2]	= {0.5,-0.5,},
+really_big	= 1.0e+300,
+twom1000= 9.33263618503218878990e-302,     /* 2**-1000=0x01700000,0*/
+o_threshold=  7.09782712893383973096e+02,  /* 0x40862E42, 0xFEFA39EF */
+u_threshold= -7.45133219101941108420e+02,  /* 0xc0874910, 0xD52D3051 */
+ln2HI[2]   ={ 6.93147180369123816490e-01,  /* 0x3fe62e42, 0xfee00000 */
+	     -6.93147180369123816490e-01,},/* 0xbfe62e42, 0xfee00000 */
+ln2LO[2]   ={ 1.90821492927058770002e-10,  /* 0x3dea39ef, 0x35793c76 */
+	     -1.90821492927058770002e-10,},/* 0xbdea39ef, 0x35793c76 */
+invln2 =  1.44269504088896338700e+00, /* 0x3ff71547, 0x652b82fe */
+P1   =  1.66666666666666019037e-01, /* 0x3FC55555, 0x5555553E */
+P2   = -2.77777777770155933842e-03, /* 0xBF66C16C, 0x16BEBD93 */
+P3   =  6.61375632143793436117e-05, /* 0x3F11566A, 0xAF25DE2C */
+P4   = -1.65339022054652515390e-06, /* 0xBEBBBD41, 0xC5D26BF1 */
+P5   =  4.13813679705723846039e-08; /* 0x3E663769, 0x72BEA4D0 */
+
+
+#ifdef __STDC__
+	double __ieee754_exp(double x)	/* default IEEE double exp */
+#else
+	double __ieee754_exp(x)	/* default IEEE double exp */
+	double x;
+#endif
+{
+#ifdef GCC_OPT_BUG
+        volatile int xsb;
+#else
+        int xsb;
+#endif
+	double y,hi,lo,c,t;
+	int k;
+	unsigned hx;
+
+	hx  = __HI(x);	/* high word of x */
+	xsb = (hx>>31)&1;		/* sign bit of x */
+	hx &= 0x7fffffff;		/* high word of |x| */
+        k = 0; /* prevent warning */
+
+    /* filter out non-finite argument */
+	if(hx >= 0x40862E42) {			/* if |x|>=709.78... */
+            if(hx>=0x7ff00000) {
+		if(((hx&0xfffff)|__LO(x))!=0) 
+		     return x+x; 		/* NaN */
+		else return (xsb==0)? x:0.0;	/* exp(+-inf)={inf,0} */
+	    }
+	    if(x > o_threshold) return really_big*really_big; /* overflow */
+	    if(x < u_threshold) return twom1000*twom1000; /* underflow */
+	}
+
+    /* argument reduction */
+	if(hx > 0x3fd62e42) {		/* if  |x| > 0.5 ln2 */ 
+	    if(hx < 0x3FF0A2B2) {	/* and |x| < 1.5 ln2 */
+		hi = x-ln2HI[xsb]; lo=ln2LO[xsb]; k = 1-xsb-xsb;
+	    } else {
+		k  = (int)(invln2*x+halF[xsb]);
+		t  = k;
+		hi = x - t*ln2HI[0];	/* t*ln2HI is exact here */
+		lo = t*ln2LO[0];
+	    }
+	    x  = hi - lo;
+	} 
+	else if(hx < 0x3e300000)  {	/* when |x|<2**-28 */
+	    if(really_big+x>one) return one+x;/* trigger inexact */
+	}
+	else {
+            k = 0;
+            hi = 0; /* Unused when k = 0, but prevent warning. */
+            lo = 0;
+        }
+
+    /* x is now in primary range */
+	t  = x*x;
+	c  = x - t*(P1+t*(P2+t*(P3+t*(P4+t*P5))));
+	if(k==0) 	return one-((x*c)/(c-2.0)-x); 
+	else 		y = one-((lo-(x*c)/(2.0-c))-hi);
+	if(k >= -1021) {
+	    __HI(y) += (k<<20);	/* add k to y's exponent */
+	    return y;
+	} else {
+	    __HI(y) += ((k+1000)<<20);/* add k to y's exponent */
+	    return y*twom1000;
+	}
+}

mozilla/js/src/fdlibm/e_fmod.c

@@ -0,0 +1,173 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public
+ * License Version 1.1 (the "License"); you may not use this file
+ * except in compliance with the License. You may obtain a copy of
+ * the License at http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the License is distributed on an "AS
+ * IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+ * implied. See the License for the specific language governing
+ * rights and limitations under the License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is Sun Microsystems,
+ * Inc.  Portions created by Netscape are
+ * Copyright (C) 1998 Netscape Communications Corporation. All
+ * Rights Reserved.
+ *
+ * Contributor(s): 
+ *
+ * Alternatively, the contents of this file may be used under the
+ * terms of the GNU Public License (the "GPL"), in which case the
+ * provisions of the GPL are applicable instead of those above.
+ * If you wish to allow use of your version of this file only
+ * under the terms of the GPL and not to allow others to use your
+ * version of this file under the NPL, indicate your decision by
+ * deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL.  If you do not delete
+ * the provisions above, a recipient may use your version of this
+ * file under either the NPL or the GPL.
+ */
+
+/* @(#)e_fmod.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* 
+ * __ieee754_fmod(x,y)
+ * Return x mod y in exact arithmetic
+ * Method: shift and subtract
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double one = 1.0, Zero[] = {0.0, -0.0,};
+#else
+static double one = 1.0, Zero[] = {0.0, -0.0,};
+#endif
+
+#ifdef __STDC__
+	double __ieee754_fmod(double x, double y)
+#else
+	double __ieee754_fmod(x,y)
+	double x,y ;
+#endif
+{
+	int n,hx,hy,hz,ix,iy,sx,i;
+	unsigned lx,ly,lz;
+
+	hx = __HI(x);		/* high word of x */
+	lx = __LO(x);		/* low  word of x */
+	hy = __HI(y);		/* high word of y */
+	ly = __LO(y);		/* low  word of y */
+	sx = hx&0x80000000;		/* sign of x */
+	hx ^=sx;		/* |x| */
+	hy &= 0x7fffffff;	/* |y| */
+
+    /* purge off exception values */
+	if((hy|ly)==0||(hx>=0x7ff00000)||	/* y=0,or x not finite */
+	  ((hy|((ly|-(int)ly)>>31))>0x7ff00000))	/* or y is NaN */
+	    return (x*y)/(x*y);
+	if(hx<=hy) {
+	    if((hx<hy)||(lx<ly)) return x;	/* |x|<|y| return x */
+	    if(lx==ly) 
+		return Zero[(unsigned)sx>>31];	/* |x|=|y| return x*0*/
+	}
+
+    /* determine ix = ilogb(x) */
+	if(hx<0x00100000) {	/* subnormal x */
+	    if(hx==0) {
+		for (ix = -1043, i=lx; i>0; i<<=1) ix -=1;
+	    } else {
+		for (ix = -1022,i=(hx<<11); i>0; i<<=1) ix -=1;
+	    }
+	} else ix = (hx>>20)-1023;
+
+    /* determine iy = ilogb(y) */
+	if(hy<0x00100000) {	/* subnormal y */
+	    if(hy==0) {
+		for (iy = -1043, i=ly; i>0; i<<=1) iy -=1;
+	    } else {
+		for (iy = -1022,i=(hy<<11); i>0; i<<=1) iy -=1;
+	    }
+	} else iy = (hy>>20)-1023;
+
+    /* set up {hx,lx}, {hy,ly} and align y to x */
+	if(ix >= -1022) 
+	    hx = 0x00100000|(0x000fffff&hx);
+	else {		/* subnormal x, shift x to normal */
+	    n = -1022-ix;
+	    if(n<=31) {
+	        hx = (hx<<n)|(lx>>(32-n));
+	        lx <<= n;
+	    } else {
+		hx = lx<<(n-32);
+		lx = 0;
+	    }
+	}
+	if(iy >= -1022) 
+	    hy = 0x00100000|(0x000fffff&hy);
+	else {		/* subnormal y, shift y to normal */
+	    n = -1022-iy;
+	    if(n<=31) {
+	        hy = (hy<<n)|(ly>>(32-n));
+	        ly <<= n;
+	    } else {
+		hy = ly<<(n-32);
+		ly = 0;
+	    }
+	}
+
+    /* fix point fmod */
+	n = ix - iy;
+	while(n--) {
+	    hz=hx-hy;lz=lx-ly; if(lx<ly) hz -= 1;
+	    if(hz<0){hx = hx+hx+(lx>>31); lx = lx+lx;}
+	    else {
+	    	if((hz|lz)==0) 		/* return sign(x)*0 */
+		    return Zero[(unsigned)sx>>31];
+	    	hx = hz+hz+(lz>>31); lx = lz+lz;
+	    }
+	}
+	hz=hx-hy;lz=lx-ly; if(lx<ly) hz -= 1;
+	if(hz>=0) {hx=hz;lx=lz;}
+
+    /* convert back to floating value and restore the sign */
+	if((hx|lx)==0) 			/* return sign(x)*0 */
+	    return Zero[(unsigned)sx>>31];	
+	while(hx<0x00100000) {		/* normalize x */
+	    hx = hx+hx+(lx>>31); lx = lx+lx;
+	    iy -= 1;
+	}
+	if(iy>= -1022) {	/* normalize output */
+	    hx = ((hx-0x00100000)|((iy+1023)<<20));
+	    __HI(x) = hx|sx;
+	    __LO(x) = lx;
+	} else {		/* subnormal output */
+	    n = -1022 - iy;
+	    if(n<=20) {
+		lx = (lx>>n)|((unsigned)hx<<(32-n));
+		hx >>= n;
+	    } else if (n<=31) {
+		lx = (hx<<(32-n))|(lx>>n); hx = sx;
+	    } else {
+		lx = hx>>(n-32); hx = sx;
+	    }
+	    __HI(x) = hx|sx;
+	    __LO(x) = lx;
+	    x *= one;		/* create necessary signal */
+	}
+	return x;		/* exact output */
+}

mozilla/js/src/fdlibm/e_gamma.c

@@ -0,0 +1,66 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public
+ * License Version 1.1 (the "License"); you may not use this file
+ * except in compliance with the License. You may obtain a copy of
+ * the License at http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the License is distributed on an "AS
+ * IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+ * implied. See the License for the specific language governing
+ * rights and limitations under the License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is Sun Microsystems,
+ * Inc.  Portions created by Netscape are
+ * Copyright (C) 1998 Netscape Communications Corporation. All
+ * Rights Reserved.
+ *
+ * Contributor(s): 
+ *
+ * Alternatively, the contents of this file may be used under the
+ * terms of the GNU Public License (the "GPL"), in which case the
+ * provisions of the GPL are applicable instead of those above.
+ * If you wish to allow use of your version of this file only
+ * under the terms of the GPL and not to allow others to use your
+ * version of this file under the NPL, indicate your decision by
+ * deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL.  If you do not delete
+ * the provisions above, a recipient may use your version of this
+ * file under either the NPL or the GPL.
+ */
+
+/* @(#)e_gamma.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ *
+ */
+
+/* __ieee754_gamma(x)
+ * Return the logarithm of the Gamma function of x.
+ *
+ * Method: call __ieee754_gamma_r
+ */
+
+#include "fdlibm.h"
+
+extern int signgam;
+
+#ifdef __STDC__
+	double __ieee754_gamma(double x)
+#else
+	double __ieee754_gamma(x)
+	double x;
+#endif
+{
+	return __ieee754_gamma_r(x,&signgam);
+}

mozilla/js/src/fdlibm/e_gamma_r.c

@@ -0,0 +1,65 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public
+ * License Version 1.1 (the "License"); you may not use this file
+ * except in compliance with the License. You may obtain a copy of
+ * the License at http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the License is distributed on an "AS
+ * IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+ * implied. See the License for the specific language governing
+ * rights and limitations under the License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is Sun Microsystems,
+ * Inc.  Portions created by Netscape are
+ * Copyright (C) 1998 Netscape Communications Corporation. All
+ * Rights Reserved.
+ *
+ * Contributor(s): 
+ *
+ * Alternatively, the contents of this file may be used under the
+ * terms of the GNU Public License (the "GPL"), in which case the
+ * provisions of the GPL are applicable instead of those above.
+ * If you wish to allow use of your version of this file only
+ * under the terms of the GPL and not to allow others to use your
+ * version of this file under the NPL, indicate your decision by
+ * deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL.  If you do not delete
+ * the provisions above, a recipient may use your version of this
+ * file under either the NPL or the GPL.
+ */
+
+/* @(#)e_gamma_r.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ *
+ */
+
+/* __ieee754_gamma_r(x, signgamp)
+ * Reentrant version of the logarithm of the Gamma function 
+ * with user provide pointer for the sign of Gamma(x). 
+ *
+ * Method: See __ieee754_lgamma_r
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+	double __ieee754_gamma_r(double x, int *signgamp)
+#else
+	double __ieee754_gamma_r(x,signgamp)
+	double x; int *signgamp;
+#endif
+{
+	return __ieee754_lgamma_r(x,signgamp);
+}

mozilla/js/src/fdlibm/e_hypot.c

@@ -0,0 +1,148 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public
+ * License Version 1.1 (the "License"); you may not use this file
+ * except in compliance with the License. You may obtain a copy of
+ * the License at http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the License is distributed on an "AS
+ * IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+ * implied. See the License for the specific language governing
+ * rights and limitations under the License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is Sun Microsystems,
+ * Inc.  Portions created by Netscape are
+ * Copyright (C) 1998 Netscape Communications Corporation. All
+ * Rights Reserved.
+ *
+ * Contributor(s): 
+ *
+ * Alternatively, the contents of this file may be used under the
+ * terms of the GNU Public License (the "GPL"), in which case the
+ * provisions of the GPL are applicable instead of those above.
+ * If you wish to allow use of your version of this file only
+ * under the terms of the GPL and not to allow others to use your
+ * version of this file under the NPL, indicate your decision by
+ * deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL.  If you do not delete
+ * the provisions above, a recipient may use your version of this
+ * file under either the NPL or the GPL.
+ */
+
+/* @(#)e_hypot.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* __ieee754_hypot(x,y)
+ *
+ * Method :                  
+ *	If (assume round-to-nearest) z=x*x+y*y 
+ *	has error less than sqrt(2)/2 ulp, than 
+ *	sqrt(z) has error less than 1 ulp (exercise).
+ *
+ *	So, compute sqrt(x*x+y*y) with some care as 
+ *	follows to get the error below 1 ulp:
+ *
+ *	Assume x>y>0;
+ *	(if possible, set rounding to round-to-nearest)
+ *	1. if x > 2y  use
+ *		x1*x1+(y*y+(x2*(x+x1))) for x*x+y*y
+ *	where x1 = x with lower 32 bits cleared, x2 = x-x1; else
+ *	2. if x <= 2y use
+ *		t1*y1+((x-y)*(x-y)+(t1*y2+t2*y))
+ *	where t1 = 2x with lower 32 bits cleared, t2 = 2x-t1, 
+ *	y1= y with lower 32 bits chopped, y2 = y-y1.
+ *		
+ *	NOTE: scaling may be necessary if some argument is too 
+ *	      large or too tiny
+ *
+ * Special cases:
+ *	hypot(x,y) is INF if x or y is +INF or -INF; else
+ *	hypot(x,y) is NAN if x or y is NAN.
+ *
+ * Accuracy:
+ * 	hypot(x,y) returns sqrt(x^2+y^2) with error less 
+ * 	than 1 ulps (units in the last place) 
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+	double __ieee754_hypot(double x, double y)
+#else
+	double __ieee754_hypot(x,y)
+	double x, y;
+#endif
+{
+	double a=x,b=y,t1,t2,y1,y2,w;
+	int j,k,ha,hb;
+
+	ha = __HI(x)&0x7fffffff;	/* high word of  x */
+	hb = __HI(y)&0x7fffffff;	/* high word of  y */
+	if(hb > ha) {a=y;b=x;j=ha; ha=hb;hb=j;} else {a=x;b=y;}
+	__HI(a) = ha;	/* a <- |a| */
+	__HI(b) = hb;	/* b <- |b| */
+	if((ha-hb)>0x3c00000) {return a+b;} /* x/y > 2**60 */
+	k=0;
+	if(ha > 0x5f300000) {	/* a>2**500 */
+	   if(ha >= 0x7ff00000) {	/* Inf or NaN */
+	       w = a+b;			/* for sNaN */
+	       if(((ha&0xfffff)|__LO(a))==0) w = a;
+	       if(((hb^0x7ff00000)|__LO(b))==0) w = b;
+	       return w;
+	   }
+	   /* scale a and b by 2**-600 */
+	   ha -= 0x25800000; hb -= 0x25800000;	k += 600;
+	   __HI(a) = ha;
+	   __HI(b) = hb;
+	}
+	if(hb < 0x20b00000) {	/* b < 2**-500 */
+	    if(hb <= 0x000fffff) {	/* subnormal b or 0 */	
+		if((hb|(__LO(b)))==0) return a;
+		t1=0;
+		__HI(t1) = 0x7fd00000;	/* t1=2^1022 */
+		b *= t1;
+		a *= t1;
+		k -= 1022;
+	    } else {		/* scale a and b by 2^600 */
+	        ha += 0x25800000; 	/* a *= 2^600 */
+		hb += 0x25800000;	/* b *= 2^600 */
+		k -= 600;
+	   	__HI(a) = ha;
+	   	__HI(b) = hb;
+	    }
+	}
+    /* medium size a and b */
+	w = a-b;
+	if (w>b) {
+	    t1 = 0;
+	    __HI(t1) = ha;
+	    t2 = a-t1;
+	    w  = fd_sqrt(t1*t1-(b*(-b)-t2*(a+t1)));
+	} else {
+	    a  = a+a;
+	    y1 = 0;
+	    __HI(y1) = hb;
+	    y2 = b - y1;
+	    t1 = 0;
+	    __HI(t1) = ha+0x00100000;
+	    t2 = a - t1;
+	    w  = fd_sqrt(t1*y1-(w*(-w)-(t1*y2+t2*b)));
+	}
+	if(k!=0) {
+	    t1 = 1.0;
+	    __HI(t1) += (k<<20);
+	    return t1*w;
+	} else return w;
+}

mozilla/js/src/fdlibm/e_j0.c

@@ -0,0 +1,511 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public
+ * License Version 1.1 (the "License"); you may not use this file
+ * except in compliance with the License. You may obtain a copy of
+ * the License at http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the License is distributed on an "AS
+ * IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+ * implied. See the License for the specific language governing
+ * rights and limitations under the License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is Sun Microsystems,
+ * Inc.  Portions created by Netscape are
+ * Copyright (C) 1998 Netscape Communications Corporation. All
+ * Rights Reserved.
+ *
+ * Contributor(s): 
+ *
+ * Alternatively, the contents of this file may be used under the
+ * terms of the GNU Public License (the "GPL"), in which case the
+ * provisions of the GPL are applicable instead of those above.
+ * If you wish to allow use of your version of this file only
+ * under the terms of the GPL and not to allow others to use your
+ * version of this file under the NPL, indicate your decision by
+ * deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL.  If you do not delete
+ * the provisions above, a recipient may use your version of this
+ * file under either the NPL or the GPL.
+ */
+
+/* @(#)e_j0.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* __ieee754_j0(x), __ieee754_y0(x)
+ * Bessel function of the first and second kinds of order zero.
+ * Method -- j0(x):
+ *	1. For tiny x, we use j0(x) = 1 - x^2/4 + x^4/64 - ...
+ *	2. Reduce x to |x| since j0(x)=j0(-x),  and
+ *	   for x in (0,2)
+ *		j0(x) = 1-z/4+ z^2*R0/S0,  where z = x*x;
+ *	   (precision:  |j0-1+z/4-z^2R0/S0 |<2**-63.67 )
+ *	   for x in (2,inf)
+ * 		j0(x) = sqrt(2/(pi*x))*(p0(x)*cos(x0)-q0(x)*sin(x0))
+ * 	   where x0 = x-pi/4. It is better to compute sin(x0),cos(x0)
+ *	   as follow:
+ *		cos(x0) = cos(x)cos(pi/4)+sin(x)sin(pi/4)
+ *			= 1/sqrt(2) * (cos(x) + sin(x))
+ *		sin(x0) = sin(x)cos(pi/4)-cos(x)sin(pi/4)
+ *			= 1/sqrt(2) * (sin(x) - cos(x))
+ * 	   (To avoid cancellation, use
+ *		sin(x) +- cos(x) = -cos(2x)/(sin(x) -+ cos(x))
+ * 	    to compute the worse one.)
+ *	   
+ *	3 Special cases
+ *		j0(nan)= nan
+ *		j0(0) = 1
+ *		j0(inf) = 0
+ *		
+ * Method -- y0(x):
+ *	1. For x<2.
+ *	   Since 
+ *		y0(x) = 2/pi*(j0(x)*(ln(x/2)+Euler) + x^2/4 - ...)
+ *	   therefore y0(x)-2/pi*j0(x)*ln(x) is an even function.
+ *	   We use the following function to approximate y0,
+ *		y0(x) = U(z)/V(z) + (2/pi)*(j0(x)*ln(x)), z= x^2
+ *	   where 
+ *		U(z) = u00 + u01*z + ... + u06*z^6
+ *		V(z) = 1  + v01*z + ... + v04*z^4
+ *	   with absolute approximation error bounded by 2**-72.
+ *	   Note: For tiny x, U/V = u0 and j0(x)~1, hence
+ *		y0(tiny) = u0 + (2/pi)*ln(tiny), (choose tiny<2**-27)
+ *	2. For x>=2.
+ * 		y0(x) = sqrt(2/(pi*x))*(p0(x)*cos(x0)+q0(x)*sin(x0))
+ * 	   where x0 = x-pi/4. It is better to compute sin(x0),cos(x0)
+ *	   by the method mentioned above.
+ *	3. Special cases: y0(0)=-inf, y0(x<0)=NaN, y0(inf)=0.
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static double pzero(double), qzero(double);
+#else
+static double pzero(), qzero();
+#endif
+
+#ifdef __STDC__
+static const double 
+#else
+static double 
+#endif
+really_big 	= 1e300,
+one	= 1.0,
+invsqrtpi=  5.64189583547756279280e-01, /* 0x3FE20DD7, 0x50429B6D */
+tpi      =  6.36619772367581382433e-01, /* 0x3FE45F30, 0x6DC9C883 */
+ 		/* R0/S0 on [0, 2.00] */
+R02  =  1.56249999999999947958e-02, /* 0x3F8FFFFF, 0xFFFFFFFD */
+R03  = -1.89979294238854721751e-04, /* 0xBF28E6A5, 0xB61AC6E9 */
+R04  =  1.82954049532700665670e-06, /* 0x3EBEB1D1, 0x0C503919 */
+R05  = -4.61832688532103189199e-09, /* 0xBE33D5E7, 0x73D63FCE */
+S01  =  1.56191029464890010492e-02, /* 0x3F8FFCE8, 0x82C8C2A4 */
+S02  =  1.16926784663337450260e-04, /* 0x3F1EA6D2, 0xDD57DBF4 */
+S03  =  5.13546550207318111446e-07, /* 0x3EA13B54, 0xCE84D5A9 */
+S04  =  1.16614003333790000205e-09; /* 0x3E1408BC, 0xF4745D8F */
+
+static double zero = 0.0;
+
+#ifdef __STDC__
+	double __ieee754_j0(double x) 
+#else
+	double __ieee754_j0(x) 
+	double x;
+#endif
+{
+	double z, s,c,ss,cc,r,u,v;
+	int hx,ix;
+
+	hx = __HI(x);
+	ix = hx&0x7fffffff;
+	if(ix>=0x7ff00000) return one/(x*x);
+	x = fd_fabs(x);
+	if(ix >= 0x40000000) {	/* |x| >= 2.0 */
+		s = fd_sin(x);
+		c = fd_cos(x);
+		ss = s-c;
+		cc = s+c;
+		if(ix<0x7fe00000) {  /* make sure x+x not overflow */
+		    z = -fd_cos(x+x);
+		    if ((s*c)<zero) cc = z/ss;
+		    else 	    ss = z/cc;
+		}
+	/*
+	 * j0(x) = 1/sqrt(pi) * (P(0,x)*cc - Q(0,x)*ss) / sqrt(x)
+	 * y0(x) = 1/sqrt(pi) * (P(0,x)*ss + Q(0,x)*cc) / sqrt(x)
+	 */
+		if(ix>0x48000000) z = (invsqrtpi*cc)/fd_sqrt(x);
+		else {
+		    u = pzero(x); v = qzero(x);
+		    z = invsqrtpi*(u*cc-v*ss)/fd_sqrt(x);
+		}
+		return z;
+	}
+	if(ix<0x3f200000) {	/* |x| < 2**-13 */
+	    if(really_big+x>one) {	/* raise inexact if x != 0 */
+	        if(ix<0x3e400000) return one;	/* |x|<2**-27 */
+	        else 	      return one - 0.25*x*x;
+	    }
+	}
+	z = x*x;
+	r =  z*(R02+z*(R03+z*(R04+z*R05)));
+	s =  one+z*(S01+z*(S02+z*(S03+z*S04)));
+	if(ix < 0x3FF00000) {	/* |x| < 1.00 */
+	    return one + z*(-0.25+(r/s));
+	} else {
+	    u = 0.5*x;
+	    return((one+u)*(one-u)+z*(r/s));
+	}
+}
+
+#ifdef __STDC__
+static const double
+#else
+static double
+#endif
+u00  = -7.38042951086872317523e-02, /* 0xBFB2E4D6, 0x99CBD01F */
+u01  =  1.76666452509181115538e-01, /* 0x3FC69D01, 0x9DE9E3FC */
+u02  = -1.38185671945596898896e-02, /* 0xBF8C4CE8, 0xB16CFA97 */
+u03  =  3.47453432093683650238e-04, /* 0x3F36C54D, 0x20B29B6B */
+u04  = -3.81407053724364161125e-06, /* 0xBECFFEA7, 0x73D25CAD */
+u05  =  1.95590137035022920206e-08, /* 0x3E550057, 0x3B4EABD4 */
+u06  = -3.98205194132103398453e-11, /* 0xBDC5E43D, 0x693FB3C8 */
+v01  =  1.27304834834123699328e-02, /* 0x3F8A1270, 0x91C9C71A */
+v02  =  7.60068627350353253702e-05, /* 0x3F13ECBB, 0xF578C6C1 */
+v03  =  2.59150851840457805467e-07, /* 0x3E91642D, 0x7FF202FD */
+v04  =  4.41110311332675467403e-10; /* 0x3DFE5018, 0x3BD6D9EF */
+
+#ifdef __STDC__
+	double __ieee754_y0(double x) 
+#else
+	double __ieee754_y0(x) 
+	double x;
+#endif
+{
+	double z, s,c,ss,cc,u,v;
+	int hx,ix,lx;
+
+        hx = __HI(x);
+        ix = 0x7fffffff&hx;
+        lx = __LO(x);
+    /* Y0(NaN) is NaN, y0(-inf) is Nan, y0(inf) is 0  */
+	if(ix>=0x7ff00000) return  one/(x+x*x); 
+        if((ix|lx)==0) return -one/zero;
+        if(hx<0) return zero/zero;
+        if(ix >= 0x40000000) {  /* |x| >= 2.0 */
+        /* y0(x) = sqrt(2/(pi*x))*(p0(x)*sin(x0)+q0(x)*cos(x0))
+         * where x0 = x-pi/4
+         *      Better formula:
+         *              cos(x0) = cos(x)cos(pi/4)+sin(x)sin(pi/4)
+         *                      =  1/sqrt(2) * (sin(x) + cos(x))
+         *              sin(x0) = sin(x)cos(3pi/4)-cos(x)sin(3pi/4)
+         *                      =  1/sqrt(2) * (sin(x) - cos(x))
+         * To avoid cancellation, use
+         *              sin(x) +- cos(x) = -cos(2x)/(sin(x) -+ cos(x))
+         * to compute the worse one.
+         */
+                s = fd_sin(x);
+                c = fd_cos(x);
+                ss = s-c;
+                cc = s+c;
+	/*
+	 * j0(x) = 1/sqrt(pi) * (P(0,x)*cc - Q(0,x)*ss) / sqrt(x)
+	 * y0(x) = 1/sqrt(pi) * (P(0,x)*ss + Q(0,x)*cc) / sqrt(x)
+	 */
+                if(ix<0x7fe00000) {  /* make sure x+x not overflow */
+                    z = -fd_cos(x+x);
+                    if ((s*c)<zero) cc = z/ss;
+                    else            ss = z/cc;
+                }
+                if(ix>0x48000000) z = (invsqrtpi*ss)/fd_sqrt(x);
+                else {
+                    u = pzero(x); v = qzero(x);
+                    z = invsqrtpi*(u*ss+v*cc)/fd_sqrt(x);
+                }
+                return z;
+	}
+	if(ix<=0x3e400000) {	/* x < 2**-27 */
+	    return(u00 + tpi*__ieee754_log(x));
+	}
+	z = x*x;
+	u = u00+z*(u01+z*(u02+z*(u03+z*(u04+z*(u05+z*u06)))));
+	v = one+z*(v01+z*(v02+z*(v03+z*v04)));
+	return(u/v + tpi*(__ieee754_j0(x)*__ieee754_log(x)));
+}
+
+/* The asymptotic expansions of pzero is
+ *	1 - 9/128 s^2 + 11025/98304 s^4 - ...,	where s = 1/x.
+ * For x >= 2, We approximate pzero by
+ * 	pzero(x) = 1 + (R/S)
+ * where  R = pR0 + pR1*s^2 + pR2*s^4 + ... + pR5*s^10
+ * 	  S = 1 + pS0*s^2 + ... + pS4*s^10
+ * and
+ *	| pzero(x)-1-R/S | <= 2  ** ( -60.26)
+ */
+#ifdef __STDC__
+static const double pR8[6] = { /* for x in [inf, 8]=1/[0,0.125] */
+#else
+static double pR8[6] = { /* for x in [inf, 8]=1/[0,0.125] */
+#endif
+  0.00000000000000000000e+00, /* 0x00000000, 0x00000000 */
+ -7.03124999999900357484e-02, /* 0xBFB1FFFF, 0xFFFFFD32 */
+ -8.08167041275349795626e+00, /* 0xC02029D0, 0xB44FA779 */
+ -2.57063105679704847262e+02, /* 0xC0701102, 0x7B19E863 */
+ -2.48521641009428822144e+03, /* 0xC0A36A6E, 0xCD4DCAFC */
+ -5.25304380490729545272e+03, /* 0xC0B4850B, 0x36CC643D */
+};
+#ifdef __STDC__
+static const double pS8[5] = {
+#else
+static double pS8[5] = {
+#endif
+  1.16534364619668181717e+02, /* 0x405D2233, 0x07A96751 */
+  3.83374475364121826715e+03, /* 0x40ADF37D, 0x50596938 */
+  4.05978572648472545552e+04, /* 0x40E3D2BB, 0x6EB6B05F */
+  1.16752972564375915681e+05, /* 0x40FC810F, 0x8F9FA9BD */
+  4.76277284146730962675e+04, /* 0x40E74177, 0x4F2C49DC */
+};
+
+#ifdef __STDC__
+static const double pR5[6] = { /* for x in [8,4.5454]=1/[0.125,0.22001] */
+#else
+static double pR5[6] = { /* for x in [8,4.5454]=1/[0.125,0.22001] */
+#endif
+ -1.14125464691894502584e-11, /* 0xBDA918B1, 0x47E495CC */
+ -7.03124940873599280078e-02, /* 0xBFB1FFFF, 0xE69AFBC6 */
+ -4.15961064470587782438e+00, /* 0xC010A370, 0xF90C6BBF */
+ -6.76747652265167261021e+01, /* 0xC050EB2F, 0x5A7D1783 */
+ -3.31231299649172967747e+02, /* 0xC074B3B3, 0x6742CC63 */
+ -3.46433388365604912451e+02, /* 0xC075A6EF, 0x28A38BD7 */
+};
+#ifdef __STDC__
+static const double pS5[5] = {
+#else
+static double pS5[5] = {
+#endif
+  6.07539382692300335975e+01, /* 0x404E6081, 0x0C98C5DE */
+  1.05125230595704579173e+03, /* 0x40906D02, 0x5C7E2864 */
+  5.97897094333855784498e+03, /* 0x40B75AF8, 0x8FBE1D60 */
+  9.62544514357774460223e+03, /* 0x40C2CCB8, 0xFA76FA38 */
+  2.40605815922939109441e+03, /* 0x40A2CC1D, 0xC70BE864 */
+};
+
+#ifdef __STDC__
+static const double pR3[6] = {/* for x in [4.547,2.8571]=1/[0.2199,0.35001] */
+#else
+static double pR3[6] = {/* for x in [4.547,2.8571]=1/[0.2199,0.35001] */
+#endif
+ -2.54704601771951915620e-09, /* 0xBE25E103, 0x6FE1AA86 */
+ -7.03119616381481654654e-02, /* 0xBFB1FFF6, 0xF7C0E24B */
+ -2.40903221549529611423e+00, /* 0xC00345B2, 0xAEA48074 */
+ -2.19659774734883086467e+01, /* 0xC035F74A, 0x4CB94E14 */
+ -5.80791704701737572236e+01, /* 0xC04D0A22, 0x420A1A45 */
+ -3.14479470594888503854e+01, /* 0xC03F72AC, 0xA892D80F */
+};
+#ifdef __STDC__
+static const double pS3[5] = {
+#else
+static double pS3[5] = {
+#endif
+  3.58560338055209726349e+01, /* 0x4041ED92, 0x84077DD3 */
+  3.61513983050303863820e+02, /* 0x40769839, 0x464A7C0E */
+  1.19360783792111533330e+03, /* 0x4092A66E, 0x6D1061D6 */
+  1.12799679856907414432e+03, /* 0x40919FFC, 0xB8C39B7E */
+  1.73580930813335754692e+02, /* 0x4065B296, 0xFC379081 */
+};
+
+#ifdef __STDC__
+static const double pR2[6] = {/* for x in [2.8570,2]=1/[0.3499,0.5] */
+#else
+static double pR2[6] = {/* for x in [2.8570,2]=1/[0.3499,0.5] */
+#endif
+ -8.87534333032526411254e-08, /* 0xBE77D316, 0xE927026D */
+ -7.03030995483624743247e-02, /* 0xBFB1FF62, 0x495E1E42 */
+ -1.45073846780952986357e+00, /* 0xBFF73639, 0x8A24A843 */
+ -7.63569613823527770791e+00, /* 0xC01E8AF3, 0xEDAFA7F3 */
+ -1.11931668860356747786e+01, /* 0xC02662E6, 0xC5246303 */
+ -3.23364579351335335033e+00, /* 0xC009DE81, 0xAF8FE70F */
+};
+#ifdef __STDC__
+static const double pS2[5] = {
+#else
+static double pS2[5] = {
+#endif
+  2.22202997532088808441e+01, /* 0x40363865, 0x908B5959 */
+  1.36206794218215208048e+02, /* 0x4061069E, 0x0EE8878F */
+  2.70470278658083486789e+02, /* 0x4070E786, 0x42EA079B */
+  1.53875394208320329881e+02, /* 0x40633C03, 0x3AB6FAFF */
+  1.46576176948256193810e+01, /* 0x402D50B3, 0x44391809 */
+};
+
+#ifdef __STDC__
+	static double pzero(double x)
+#else
+	static double pzero(x)
+	double x;
+#endif
+{
+#ifdef __STDC__
+	const double *p,*q;
+#else
+	double *p,*q;
+#endif
+	double z,r,s;
+	int ix;
+	ix = 0x7fffffff&__HI(x);
+	if(ix>=0x40200000)     {p = pR8; q= pS8;}
+	else if(ix>=0x40122E8B){p = pR5; q= pS5;}
+	else if(ix>=0x4006DB6D){p = pR3; q= pS3;}
+	else if(ix>=0x40000000){p = pR2; q= pS2;}
+	z = one/(x*x);
+	r = p[0]+z*(p[1]+z*(p[2]+z*(p[3]+z*(p[4]+z*p[5]))));
+	s = one+z*(q[0]+z*(q[1]+z*(q[2]+z*(q[3]+z*q[4]))));
+	return one+ r/s;
+}
+		
+
+/* For x >= 8, the asymptotic expansions of qzero is
+ *	-1/8 s + 75/1024 s^3 - ..., where s = 1/x.
+ * We approximate pzero by
+ * 	qzero(x) = s*(-1.25 + (R/S))
+ * where  R = qR0 + qR1*s^2 + qR2*s^4 + ... + qR5*s^10
+ * 	  S = 1 + qS0*s^2 + ... + qS5*s^12
+ * and
+ *	| qzero(x)/s +1.25-R/S | <= 2  ** ( -61.22)
+ */
+#ifdef __STDC__
+static const double qR8[6] = { /* for x in [inf, 8]=1/[0,0.125] */
+#else
+static double qR8[6] = { /* for x in [inf, 8]=1/[0,0.125] */
+#endif
+  0.00000000000000000000e+00, /* 0x00000000, 0x00000000 */
+  7.32421874999935051953e-02, /* 0x3FB2BFFF, 0xFFFFFE2C */
+  1.17682064682252693899e+01, /* 0x40278952, 0x5BB334D6 */
+  5.57673380256401856059e+02, /* 0x40816D63, 0x15301825 */
+  8.85919720756468632317e+03, /* 0x40C14D99, 0x3E18F46D */
+  3.70146267776887834771e+04, /* 0x40E212D4, 0x0E901566 */
+};
+#ifdef __STDC__
+static const double qS8[6] = {
+#else
+static double qS8[6] = {
+#endif
+  1.63776026895689824414e+02, /* 0x406478D5, 0x365B39BC */
+  8.09834494656449805916e+03, /* 0x40BFA258, 0x4E6B0563 */
+  1.42538291419120476348e+05, /* 0x41016652, 0x54D38C3F */
+  8.03309257119514397345e+05, /* 0x412883DA, 0x83A52B43 */
+  8.40501579819060512818e+05, /* 0x4129A66B, 0x28DE0B3D */
+ -3.43899293537866615225e+05, /* 0xC114FD6D, 0x2C9530C5 */
+};
+
+#ifdef __STDC__
+static const double qR5[6] = { /* for x in [8,4.5454]=1/[0.125,0.22001] */
+#else
+static double qR5[6] = { /* for x in [8,4.5454]=1/[0.125,0.22001] */
+#endif
+  1.84085963594515531381e-11, /* 0x3DB43D8F, 0x29CC8CD9 */
+  7.32421766612684765896e-02, /* 0x3FB2BFFF, 0xD172B04C */
+  5.83563508962056953777e+00, /* 0x401757B0, 0xB9953DD3 */
+  1.35111577286449829671e+02, /* 0x4060E392, 0x0A8788E9 */
+  1.02724376596164097464e+03, /* 0x40900CF9, 0x9DC8C481 */
+  1.98997785864605384631e+03, /* 0x409F17E9, 0x53C6E3A6 */
+};
+#ifdef __STDC__
+static const double qS5[6] = {
+#else
+static double qS5[6] = {
+#endif
+  8.27766102236537761883e+01, /* 0x4054B1B3, 0xFB5E1543 */
+  2.07781416421392987104e+03, /* 0x40A03BA0, 0xDA21C0CE */
+  1.88472887785718085070e+04, /* 0x40D267D2, 0x7B591E6D */
+  5.67511122894947329769e+04, /* 0x40EBB5E3, 0x97E02372 */
+  3.59767538425114471465e+04, /* 0x40E19118, 0x1F7A54A0 */
+ -5.35434275601944773371e+03, /* 0xC0B4EA57, 0xBEDBC609 */
+};
+
+#ifdef __STDC__
+static const double qR3[6] = {/* for x in [4.547,2.8571]=1/[0.2199,0.35001] */
+#else
+static double qR3[6] = {/* for x in [4.547,2.8571]=1/[0.2199,0.35001] */
+#endif
+  4.37741014089738620906e-09, /* 0x3E32CD03, 0x6ADECB82 */
+  7.32411180042911447163e-02, /* 0x3FB2BFEE, 0x0E8D0842 */
+  3.34423137516170720929e+00, /* 0x400AC0FC, 0x61149CF5 */
+  4.26218440745412650017e+01, /* 0x40454F98, 0x962DAEDD */
+  1.70808091340565596283e+02, /* 0x406559DB, 0xE25EFD1F */
+  1.66733948696651168575e+02, /* 0x4064D77C, 0x81FA21E0 */
+};
+#ifdef __STDC__
+static const double qS3[6] = {
+#else
+static double qS3[6] = {
+#endif
+  4.87588729724587182091e+01, /* 0x40486122, 0xBFE343A6 */
+  7.09689221056606015736e+02, /* 0x40862D83, 0x86544EB3 */
+  3.70414822620111362994e+03, /* 0x40ACF04B, 0xE44DFC63 */
+  6.46042516752568917582e+03, /* 0x40B93C6C, 0xD7C76A28 */
+  2.51633368920368957333e+03, /* 0x40A3A8AA, 0xD94FB1C0 */
+ -1.49247451836156386662e+02, /* 0xC062A7EB, 0x201CF40F */
+};
+
+#ifdef __STDC__
+static const double qR2[6] = {/* for x in [2.8570,2]=1/[0.3499,0.5] */
+#else
+static double qR2[6] = {/* for x in [2.8570,2]=1/[0.3499,0.5] */
+#endif
+  1.50444444886983272379e-07, /* 0x3E84313B, 0x54F76BDB */
+  7.32234265963079278272e-02, /* 0x3FB2BEC5, 0x3E883E34 */
+  1.99819174093815998816e+00, /* 0x3FFFF897, 0xE727779C */
+  1.44956029347885735348e+01, /* 0x402CFDBF, 0xAAF96FE5 */
+  3.16662317504781540833e+01, /* 0x403FAA8E, 0x29FBDC4A */
+  1.62527075710929267416e+01, /* 0x403040B1, 0x71814BB4 */
+};
+#ifdef __STDC__
+static const double qS2[6] = {
+#else
+static double qS2[6] = {
+#endif
+  3.03655848355219184498e+01, /* 0x403E5D96, 0xF7C07AED */
+  2.69348118608049844624e+02, /* 0x4070D591, 0xE4D14B40 */
+  8.44783757595320139444e+02, /* 0x408A6645, 0x22B3BF22 */
+  8.82935845112488550512e+02, /* 0x408B977C, 0x9C5CC214 */
+  2.12666388511798828631e+02, /* 0x406A9553, 0x0E001365 */
+ -5.31095493882666946917e+00, /* 0xC0153E6A, 0xF8B32931 */
+};
+
+#ifdef __STDC__
+	static double qzero(double x)
+#else
+	static double qzero(x)
+	double x;
+#endif
+{
+#ifdef __STDC__
+	const double *p,*q;
+#else
+	double *p,*q;
+#endif
+	double s,r,z;
+	int ix;
+	ix = 0x7fffffff&__HI(x);
+	if(ix>=0x40200000)     {p = qR8; q= qS8;}
+	else if(ix>=0x40122E8B){p = qR5; q= qS5;}
+	else if(ix>=0x4006DB6D){p = qR3; q= qS3;}
+	else if(ix>=0x40000000){p = qR2; q= qS2;}
+	z = one/(x*x);
+	r = p[0]+z*(p[1]+z*(p[2]+z*(p[3]+z*(p[4]+z*p[5]))));
+	s = one+z*(q[0]+z*(q[1]+z*(q[2]+z*(q[3]+z*(q[4]+z*q[5])))));
+	return (-.125 + r/s)/x;
+}

mozilla/js/src/fdlibm/e_j1.c

@@ -0,0 +1,510 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public
+ * License Version 1.1 (the "License"); you may not use this file
+ * except in compliance with the License. You may obtain a copy of
+ * the License at http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the License is distributed on an "AS
+ * IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+ * implied. See the License for the specific language governing
+ * rights and limitations under the License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is Sun Microsystems,
+ * Inc.  Portions created by Netscape are
+ * Copyright (C) 1998 Netscape Communications Corporation. All
+ * Rights Reserved.
+ *
+ * Contributor(s): 
+ *
+ * Alternatively, the contents of this file may be used under the
+ * terms of the GNU Public License (the "GPL"), in which case the
+ * provisions of the GPL are applicable instead of those above.
+ * If you wish to allow use of your version of this file only
+ * under the terms of the GPL and not to allow others to use your
+ * version of this file under the NPL, indicate your decision by
+ * deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL.  If you do not delete
+ * the provisions above, a recipient may use your version of this
+ * file under either the NPL or the GPL.
+ */
+
+/* @(#)e_j1.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* __ieee754_j1(x), __ieee754_y1(x)
+ * Bessel function of the first and second kinds of order zero.
+ * Method -- j1(x):
+ *	1. For tiny x, we use j1(x) = x/2 - x^3/16 + x^5/384 - ...
+ *	2. Reduce x to |x| since j1(x)=-j1(-x),  and
+ *	   for x in (0,2)
+ *		j1(x) = x/2 + x*z*R0/S0,  where z = x*x;
+ *	   (precision:  |j1/x - 1/2 - R0/S0 |<2**-61.51 )
+ *	   for x in (2,inf)
+ * 		j1(x) = sqrt(2/(pi*x))*(p1(x)*cos(x1)-q1(x)*sin(x1))
+ * 		y1(x) = sqrt(2/(pi*x))*(p1(x)*sin(x1)+q1(x)*cos(x1))
+ * 	   where x1 = x-3*pi/4. It is better to compute sin(x1),cos(x1)
+ *	   as follow:
+ *		cos(x1) =  cos(x)cos(3pi/4)+sin(x)sin(3pi/4)
+ *			=  1/sqrt(2) * (sin(x) - cos(x))
+ *		sin(x1) =  sin(x)cos(3pi/4)-cos(x)sin(3pi/4)
+ *			= -1/sqrt(2) * (sin(x) + cos(x))
+ * 	   (To avoid cancellation, use
+ *		sin(x) +- cos(x) = -cos(2x)/(sin(x) -+ cos(x))
+ * 	    to compute the worse one.)
+ *	   
+ *	3 Special cases
+ *		j1(nan)= nan
+ *		j1(0) = 0
+ *		j1(inf) = 0
+ *		
+ * Method -- y1(x):
+ *	1. screen out x<=0 cases: y1(0)=-inf, y1(x<0)=NaN 
+ *	2. For x<2.
+ *	   Since 
+ *		y1(x) = 2/pi*(j1(x)*(ln(x/2)+Euler)-1/x-x/2+5/64*x^3-...)
+ *	   therefore y1(x)-2/pi*j1(x)*ln(x)-1/x is an odd function.
+ *	   We use the following function to approximate y1,
+ *		y1(x) = x*U(z)/V(z) + (2/pi)*(j1(x)*ln(x)-1/x), z= x^2
+ *	   where for x in [0,2] (abs err less than 2**-65.89)
+ *		U(z) = U0[0] + U0[1]*z + ... + U0[4]*z^4
+ *		V(z) = 1  + v0[0]*z + ... + v0[4]*z^5
+ *	   Note: For tiny x, 1/x dominate y1 and hence
+ *		y1(tiny) = -2/pi/tiny, (choose tiny<2**-54)
+ *	3. For x>=2.
+ * 		y1(x) = sqrt(2/(pi*x))*(p1(x)*sin(x1)+q1(x)*cos(x1))
+ * 	   where x1 = x-3*pi/4. It is better to compute sin(x1),cos(x1)
+ *	   by method mentioned above.
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static double pone(double), qone(double);
+#else
+static double pone(), qone();
+#endif
+
+#ifdef __STDC__
+static const double 
+#else
+static double 
+#endif
+really_big    = 1e300,
+one	= 1.0,
+invsqrtpi=  5.64189583547756279280e-01, /* 0x3FE20DD7, 0x50429B6D */
+tpi      =  6.36619772367581382433e-01, /* 0x3FE45F30, 0x6DC9C883 */
+	/* R0/S0 on [0,2] */
+r00  = -6.25000000000000000000e-02, /* 0xBFB00000, 0x00000000 */
+r01  =  1.40705666955189706048e-03, /* 0x3F570D9F, 0x98472C61 */
+r02  = -1.59955631084035597520e-05, /* 0xBEF0C5C6, 0xBA169668 */
+r03  =  4.96727999609584448412e-08, /* 0x3E6AAAFA, 0x46CA0BD9 */
+s01  =  1.91537599538363460805e-02, /* 0x3F939D0B, 0x12637E53 */
+s02  =  1.85946785588630915560e-04, /* 0x3F285F56, 0xB9CDF664 */
+s03  =  1.17718464042623683263e-06, /* 0x3EB3BFF8, 0x333F8498 */
+s04  =  5.04636257076217042715e-09, /* 0x3E35AC88, 0xC97DFF2C */
+s05  =  1.23542274426137913908e-11; /* 0x3DAB2ACF, 0xCFB97ED8 */
+
+static double zero    = 0.0;
+
+#ifdef __STDC__
+	double __ieee754_j1(double x) 
+#else
+	double __ieee754_j1(x) 
+	double x;
+#endif
+{
+	double z, s,c,ss,cc,r,u,v,y;
+	int hx,ix;
+
+	hx = __HI(x);
+	ix = hx&0x7fffffff;
+	if(ix>=0x7ff00000) return one/x;
+	y = fd_fabs(x);
+	if(ix >= 0x40000000) {	/* |x| >= 2.0 */
+		s = fd_sin(y);
+		c = fd_cos(y);
+		ss = -s-c;
+		cc = s-c;
+		if(ix<0x7fe00000) {  /* make sure y+y not overflow */
+		    z = fd_cos(y+y);
+		    if ((s*c)>zero) cc = z/ss;
+		    else 	    ss = z/cc;
+		}
+	/*
+	 * j1(x) = 1/sqrt(pi) * (P(1,x)*cc - Q(1,x)*ss) / sqrt(x)
+	 * y1(x) = 1/sqrt(pi) * (P(1,x)*ss + Q(1,x)*cc) / sqrt(x)
+	 */
+		if(ix>0x48000000) z = (invsqrtpi*cc)/fd_sqrt(y);
+		else {
+		    u = pone(y); v = qone(y);
+		    z = invsqrtpi*(u*cc-v*ss)/fd_sqrt(y);
+		}
+		if(hx<0) return -z;
+		else  	 return  z;
+	}
+	if(ix<0x3e400000) {	/* |x|<2**-27 */
+	    if(really_big+x>one) return 0.5*x;/* inexact if x!=0 necessary */
+	}
+	z = x*x;
+	r =  z*(r00+z*(r01+z*(r02+z*r03)));
+	s =  one+z*(s01+z*(s02+z*(s03+z*(s04+z*s05))));
+	r *= x;
+	return(x*0.5+r/s);
+}
+
+#ifdef __STDC__
+static const double U0[5] = {
+#else
+static double U0[5] = {
+#endif
+ -1.96057090646238940668e-01, /* 0xBFC91866, 0x143CBC8A */
+  5.04438716639811282616e-02, /* 0x3FA9D3C7, 0x76292CD1 */
+ -1.91256895875763547298e-03, /* 0xBF5F55E5, 0x4844F50F */
+  2.35252600561610495928e-05, /* 0x3EF8AB03, 0x8FA6B88E */
+ -9.19099158039878874504e-08, /* 0xBE78AC00, 0x569105B8 */
+};
+#ifdef __STDC__
+static const double V0[5] = {
+#else
+static double V0[5] = {
+#endif
+  1.99167318236649903973e-02, /* 0x3F94650D, 0x3F4DA9F0 */
+  2.02552581025135171496e-04, /* 0x3F2A8C89, 0x6C257764 */
+  1.35608801097516229404e-06, /* 0x3EB6C05A, 0x894E8CA6 */
+  6.22741452364621501295e-09, /* 0x3E3ABF1D, 0x5BA69A86 */
+  1.66559246207992079114e-11, /* 0x3DB25039, 0xDACA772A */
+};
+
+#ifdef __STDC__
+	double __ieee754_y1(double x) 
+#else
+	double __ieee754_y1(x) 
+	double x;
+#endif
+{
+	double z, s,c,ss,cc,u,v;
+	int hx,ix,lx;
+
+        hx = __HI(x);
+        ix = 0x7fffffff&hx;
+        lx = __LO(x);
+    /* if Y1(NaN) is NaN, Y1(-inf) is NaN, Y1(inf) is 0 */
+	if(ix>=0x7ff00000) return  one/(x+x*x); 
+        if((ix|lx)==0) return -one/zero;
+        if(hx<0) return zero/zero;
+        if(ix >= 0x40000000) {  /* |x| >= 2.0 */
+                s = fd_sin(x);
+                c = fd_cos(x);
+                ss = -s-c;
+                cc = s-c;
+                if(ix<0x7fe00000) {  /* make sure x+x not overflow */
+                    z = fd_cos(x+x);
+                    if ((s*c)>zero) cc = z/ss;
+                    else            ss = z/cc;
+                }
+        /* y1(x) = sqrt(2/(pi*x))*(p1(x)*sin(x0)+q1(x)*cos(x0))
+         * where x0 = x-3pi/4
+         *      Better formula:
+         *              cos(x0) = cos(x)cos(3pi/4)+sin(x)sin(3pi/4)
+         *                      =  1/sqrt(2) * (sin(x) - cos(x))
+         *              sin(x0) = sin(x)cos(3pi/4)-cos(x)sin(3pi/4)
+         *                      = -1/sqrt(2) * (cos(x) + sin(x))
+         * To avoid cancellation, use
+         *              sin(x) +- cos(x) = -cos(2x)/(sin(x) -+ cos(x))
+         * to compute the worse one.
+         */
+                if(ix>0x48000000) z = (invsqrtpi*ss)/fd_sqrt(x);
+                else {
+                    u = pone(x); v = qone(x);
+                    z = invsqrtpi*(u*ss+v*cc)/fd_sqrt(x);
+                }
+                return z;
+        } 
+        if(ix<=0x3c900000) {    /* x < 2**-54 */
+            return(-tpi/x);
+        } 
+        z = x*x;
+        u = U0[0]+z*(U0[1]+z*(U0[2]+z*(U0[3]+z*U0[4])));
+        v = one+z*(V0[0]+z*(V0[1]+z*(V0[2]+z*(V0[3]+z*V0[4]))));
+        return(x*(u/v) + tpi*(__ieee754_j1(x)*__ieee754_log(x)-one/x));
+}
+
+/* For x >= 8, the asymptotic expansions of pone is
+ *	1 + 15/128 s^2 - 4725/2^15 s^4 - ...,	where s = 1/x.
+ * We approximate pone by
+ * 	pone(x) = 1 + (R/S)
+ * where  R = pr0 + pr1*s^2 + pr2*s^4 + ... + pr5*s^10
+ * 	  S = 1 + ps0*s^2 + ... + ps4*s^10
+ * and
+ *	| pone(x)-1-R/S | <= 2  ** ( -60.06)
+ */
+
+#ifdef __STDC__
+static const double pr8[6] = { /* for x in [inf, 8]=1/[0,0.125] */
+#else
+static double pr8[6] = { /* for x in [inf, 8]=1/[0,0.125] */
+#endif
+  0.00000000000000000000e+00, /* 0x00000000, 0x00000000 */
+  1.17187499999988647970e-01, /* 0x3FBDFFFF, 0xFFFFFCCE */
+  1.32394806593073575129e+01, /* 0x402A7A9D, 0x357F7FCE */
+  4.12051854307378562225e+02, /* 0x4079C0D4, 0x652EA590 */
+  3.87474538913960532227e+03, /* 0x40AE457D, 0xA3A532CC */
+  7.91447954031891731574e+03, /* 0x40BEEA7A, 0xC32782DD */
+};
+#ifdef __STDC__
+static const double ps8[5] = {
+#else
+static double ps8[5] = {
+#endif
+  1.14207370375678408436e+02, /* 0x405C8D45, 0x8E656CAC */
+  3.65093083420853463394e+03, /* 0x40AC85DC, 0x964D274F */
+  3.69562060269033463555e+04, /* 0x40E20B86, 0x97C5BB7F */
+  9.76027935934950801311e+04, /* 0x40F7D42C, 0xB28F17BB */
+  3.08042720627888811578e+04, /* 0x40DE1511, 0x697A0B2D */
+};
+
+#ifdef __STDC__
+static const double pr5[6] = { /* for x in [8,4.5454]=1/[0.125,0.22001] */
+#else
+static double pr5[6] = { /* for x in [8,4.5454]=1/[0.125,0.22001] */
+#endif
+  1.31990519556243522749e-11, /* 0x3DAD0667, 0xDAE1CA7D */
+  1.17187493190614097638e-01, /* 0x3FBDFFFF, 0xE2C10043 */
+  6.80275127868432871736e+00, /* 0x401B3604, 0x6E6315E3 */
+  1.08308182990189109773e+02, /* 0x405B13B9, 0x452602ED */
+  5.17636139533199752805e+02, /* 0x40802D16, 0xD052D649 */
+  5.28715201363337541807e+02, /* 0x408085B8, 0xBB7E0CB7 */
+};
+#ifdef __STDC__
+static const double ps5[5] = {
+#else
+static double ps5[5] = {
+#endif
+  5.92805987221131331921e+01, /* 0x404DA3EA, 0xA8AF633D */
+  9.91401418733614377743e+02, /* 0x408EFB36, 0x1B066701 */
+  5.35326695291487976647e+03, /* 0x40B4E944, 0x5706B6FB */
+  7.84469031749551231769e+03, /* 0x40BEA4B0, 0xB8A5BB15 */
+  1.50404688810361062679e+03, /* 0x40978030, 0x036F5E51 */
+};
+
+#ifdef __STDC__
+static const double pr3[6] = {
+#else
+static double pr3[6] = {/* for x in [4.547,2.8571]=1/[0.2199,0.35001] */
+#endif
+  3.02503916137373618024e-09, /* 0x3E29FC21, 0xA7AD9EDD */
+  1.17186865567253592491e-01, /* 0x3FBDFFF5, 0x5B21D17B */
+  3.93297750033315640650e+00, /* 0x400F76BC, 0xE85EAD8A */
+  3.51194035591636932736e+01, /* 0x40418F48, 0x9DA6D129 */
+  9.10550110750781271918e+01, /* 0x4056C385, 0x4D2C1837 */
+  4.85590685197364919645e+01, /* 0x4048478F, 0x8EA83EE5 */
+};
+#ifdef __STDC__
+static const double ps3[5] = {
+#else
+static double ps3[5] = {
+#endif
+  3.47913095001251519989e+01, /* 0x40416549, 0xA134069C */
+  3.36762458747825746741e+02, /* 0x40750C33, 0x07F1A75F */
+  1.04687139975775130551e+03, /* 0x40905B7C, 0x5037D523 */
+  8.90811346398256432622e+02, /* 0x408BD67D, 0xA32E31E9 */
+  1.03787932439639277504e+02, /* 0x4059F26D, 0x7C2EED53 */
+};
+
+#ifdef __STDC__
+static const double pr2[6] = {/* for x in [2.8570,2]=1/[0.3499,0.5] */
+#else
+static double pr2[6] = {/* for x in [2.8570,2]=1/[0.3499,0.5] */
+#endif
+  1.07710830106873743082e-07, /* 0x3E7CE9D4, 0xF65544F4 */
+  1.17176219462683348094e-01, /* 0x3FBDFF42, 0xBE760D83 */
+  2.36851496667608785174e+00, /* 0x4002F2B7, 0xF98FAEC0 */
+  1.22426109148261232917e+01, /* 0x40287C37, 0x7F71A964 */
+  1.76939711271687727390e+01, /* 0x4031B1A8, 0x177F8EE2 */
+  5.07352312588818499250e+00, /* 0x40144B49, 0xA574C1FE */
+};
+#ifdef __STDC__
+static const double ps2[5] = {
+#else
+static double ps2[5] = {
+#endif
+  2.14364859363821409488e+01, /* 0x40356FBD, 0x8AD5ECDC */
+  1.25290227168402751090e+02, /* 0x405F5293, 0x14F92CD5 */
+  2.32276469057162813669e+02, /* 0x406D08D8, 0xD5A2DBD9 */
+  1.17679373287147100768e+02, /* 0x405D6B7A, 0xDA1884A9 */
+  8.36463893371618283368e+00, /* 0x4020BAB1, 0xF44E5192 */
+};
+
+#ifdef __STDC__
+	static double pone(double x)
+#else
+	static double pone(x)
+	double x;
+#endif
+{
+#ifdef __STDC__
+	const double *p,*q;
+#else
+	double *p,*q;
+#endif
+	double z,r,s;
+        int ix;
+        ix = 0x7fffffff&__HI(x);
+        if(ix>=0x40200000)     {p = pr8; q= ps8;}
+        else if(ix>=0x40122E8B){p = pr5; q= ps5;}
+        else if(ix>=0x4006DB6D){p = pr3; q= ps3;}
+        else if(ix>=0x40000000){p = pr2; q= ps2;}
+        z = one/(x*x);
+        r = p[0]+z*(p[1]+z*(p[2]+z*(p[3]+z*(p[4]+z*p[5]))));
+        s = one+z*(q[0]+z*(q[1]+z*(q[2]+z*(q[3]+z*q[4]))));
+        return one+ r/s;
+}
+		
+
+/* For x >= 8, the asymptotic expansions of qone is
+ *	3/8 s - 105/1024 s^3 - ..., where s = 1/x.
+ * We approximate pone by
+ * 	qone(x) = s*(0.375 + (R/S))
+ * where  R = qr1*s^2 + qr2*s^4 + ... + qr5*s^10
+ * 	  S = 1 + qs1*s^2 + ... + qs6*s^12
+ * and
+ *	| qone(x)/s -0.375-R/S | <= 2  ** ( -61.13)
+ */
+
+#ifdef __STDC__
+static const double qr8[6] = { /* for x in [inf, 8]=1/[0,0.125] */
+#else
+static double qr8[6] = { /* for x in [inf, 8]=1/[0,0.125] */
+#endif
+  0.00000000000000000000e+00, /* 0x00000000, 0x00000000 */
+ -1.02539062499992714161e-01, /* 0xBFBA3FFF, 0xFFFFFDF3 */
+ -1.62717534544589987888e+01, /* 0xC0304591, 0xA26779F7 */
+ -7.59601722513950107896e+02, /* 0xC087BCD0, 0x53E4B576 */
+ -1.18498066702429587167e+04, /* 0xC0C724E7, 0x40F87415 */
+ -4.84385124285750353010e+04, /* 0xC0E7A6D0, 0x65D09C6A */
+};
+#ifdef __STDC__
+static const double qs8[6] = {
+#else
+static double qs8[6] = {
+#endif
+  1.61395369700722909556e+02, /* 0x40642CA6, 0xDE5BCDE5 */
+  7.82538599923348465381e+03, /* 0x40BE9162, 0xD0D88419 */
+  1.33875336287249578163e+05, /* 0x4100579A, 0xB0B75E98 */
+  7.19657723683240939863e+05, /* 0x4125F653, 0x72869C19 */
+  6.66601232617776375264e+05, /* 0x412457D2, 0x7719AD5C */
+ -2.94490264303834643215e+05, /* 0xC111F969, 0x0EA5AA18 */
+};
+
+#ifdef __STDC__
+static const double qr5[6] = { /* for x in [8,4.5454]=1/[0.125,0.22001] */
+#else
+static double qr5[6] = { /* for x in [8,4.5454]=1/[0.125,0.22001] */
+#endif
+ -2.08979931141764104297e-11, /* 0xBDB6FA43, 0x1AA1A098 */
+ -1.02539050241375426231e-01, /* 0xBFBA3FFF, 0xCB597FEF */
+ -8.05644828123936029840e+00, /* 0xC0201CE6, 0xCA03AD4B */
+ -1.83669607474888380239e+02, /* 0xC066F56D, 0x6CA7B9B0 */
+ -1.37319376065508163265e+03, /* 0xC09574C6, 0x6931734F */
+ -2.61244440453215656817e+03, /* 0xC0A468E3, 0x88FDA79D */
+};
+#ifdef __STDC__
+static const double qs5[6] = {
+#else
+static double qs5[6] = {
+#endif
+  8.12765501384335777857e+01, /* 0x405451B2, 0xFF5A11B2 */
+  1.99179873460485964642e+03, /* 0x409F1F31, 0xE77BF839 */
+  1.74684851924908907677e+04, /* 0x40D10F1F, 0x0D64CE29 */
+  4.98514270910352279316e+04, /* 0x40E8576D, 0xAABAD197 */
+  2.79480751638918118260e+04, /* 0x40DB4B04, 0xCF7C364B */
+ -4.71918354795128470869e+03, /* 0xC0B26F2E, 0xFCFFA004 */
+};
+
+#ifdef __STDC__
+static const double qr3[6] = {
+#else
+static double qr3[6] = {/* for x in [4.547,2.8571]=1/[0.2199,0.35001] */
+#endif
+ -5.07831226461766561369e-09, /* 0xBE35CFA9, 0xD38FC84F */
+ -1.02537829820837089745e-01, /* 0xBFBA3FEB, 0x51AEED54 */
+ -4.61011581139473403113e+00, /* 0xC01270C2, 0x3302D9FF */
+ -5.78472216562783643212e+01, /* 0xC04CEC71, 0xC25D16DA */
+ -2.28244540737631695038e+02, /* 0xC06C87D3, 0x4718D55F */
+ -2.19210128478909325622e+02, /* 0xC06B66B9, 0x5F5C1BF6 */
+};
+#ifdef __STDC__
+static const double qs3[6] = {
+#else
+static double qs3[6] = {
+#endif
+  4.76651550323729509273e+01, /* 0x4047D523, 0xCCD367E4 */
+  6.73865112676699709482e+02, /* 0x40850EEB, 0xC031EE3E */
+  3.38015286679526343505e+03, /* 0x40AA684E, 0x448E7C9A */
+  5.54772909720722782367e+03, /* 0x40B5ABBA, 0xA61D54A6 */
+  1.90311919338810798763e+03, /* 0x409DBC7A, 0x0DD4DF4B */
+ -1.35201191444307340817e+02, /* 0xC060E670, 0x290A311F */
+};
+
+#ifdef __STDC__
+static const double qr2[6] = {/* for x in [2.8570,2]=1/[0.3499,0.5] */
+#else
+static double qr2[6] = {/* for x in [2.8570,2]=1/[0.3499,0.5] */
+#endif
+ -1.78381727510958865572e-07, /* 0xBE87F126, 0x44C626D2 */
+ -1.02517042607985553460e-01, /* 0xBFBA3E8E, 0x9148B010 */
+ -2.75220568278187460720e+00, /* 0xC0060484, 0x69BB4EDA */
+ -1.96636162643703720221e+01, /* 0xC033A9E2, 0xC168907F */
+ -4.23253133372830490089e+01, /* 0xC04529A3, 0xDE104AAA */
+ -2.13719211703704061733e+01, /* 0xC0355F36, 0x39CF6E52 */
+};
+#ifdef __STDC__
+static const double qs2[6] = {
+#else
+static double qs2[6] = {
+#endif
+  2.95333629060523854548e+01, /* 0x403D888A, 0x78AE64FF */
+  2.52981549982190529136e+02, /* 0x406F9F68, 0xDB821CBA */
+  7.57502834868645436472e+02, /* 0x4087AC05, 0xCE49A0F7 */
+  7.39393205320467245656e+02, /* 0x40871B25, 0x48D4C029 */
+  1.55949003336666123687e+02, /* 0x40637E5E, 0x3C3ED8D4 */
+ -4.95949898822628210127e+00, /* 0xC013D686, 0xE71BE86B */
+};
+
+#ifdef __STDC__
+	static double qone(double x)
+#else
+	static double qone(x)
+	double x;
+#endif
+{
+#ifdef __STDC__
+	const double *p,*q;
+#else
+	double *p,*q;
+#endif
+	double  s,r,z;
+	int ix;
+	ix = 0x7fffffff&__HI(x);
+	if(ix>=0x40200000)     {p = qr8; q= qs8;}
+	else if(ix>=0x40122E8B){p = qr5; q= qs5;}
+	else if(ix>=0x4006DB6D){p = qr3; q= qs3;}
+	else if(ix>=0x40000000){p = qr2; q= qs2;}
+	z = one/(x*x);
+	r = p[0]+z*(p[1]+z*(p[2]+z*(p[3]+z*(p[4]+z*p[5]))));
+	s = one+z*(q[0]+z*(q[1]+z*(q[2]+z*(q[3]+z*(q[4]+z*q[5])))));
+	return (.375 + r/s)/x;
+}

mozilla/js/src/fdlibm/e_jn.c

@@ -0,0 +1,305 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public
+ * License Version 1.1 (the "License"); you may not use this file
+ * except in compliance with the License. You may obtain a copy of
+ * the License at http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the License is distributed on an "AS
+ * IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+ * implied. See the License for the specific language governing
+ * rights and limitations under the License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is Sun Microsystems,
+ * Inc.  Portions created by Netscape are
+ * Copyright (C) 1998 Netscape Communications Corporation. All
+ * Rights Reserved.
+ *
+ * Contributor(s): 
+ *
+ * Alternatively, the contents of this file may be used under the
+ * terms of the GNU Public License (the "GPL"), in which case the
+ * provisions of the GPL are applicable instead of those above.
+ * If you wish to allow use of your version of this file only
+ * under the terms of the GPL and not to allow others to use your
+ * version of this file under the NPL, indicate your decision by
+ * deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL.  If you do not delete
+ * the provisions above, a recipient may use your version of this
+ * file under either the NPL or the GPL.
+ */
+
+/* @(#)e_jn.c 1.4 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/*
+ * __ieee754_jn(n, x), __ieee754_yn(n, x)
+ * floating point Bessel's function of the 1st and 2nd kind
+ * of order n
+ *          
+ * Special cases:
+ *	y0(0)=y1(0)=yn(n,0) = -inf with division by zero signal;
+ *	y0(-ve)=y1(-ve)=yn(n,-ve) are NaN with invalid signal.
+ * Note 2. About jn(n,x), yn(n,x)
+ *	For n=0, j0(x) is called,
+ *	for n=1, j1(x) is called,
+ *	for n<x, forward recursion us used starting
+ *	from values of j0(x) and j1(x).
+ *	for n>x, a continued fraction approximation to
+ *	j(n,x)/j(n-1,x) is evaluated and then backward
+ *	recursion is used starting from a supposed value
+ *	for j(n,x). The resulting value of j(0,x) is
+ *	compared with the actual value to correct the
+ *	supposed value of j(n,x).
+ *
+ *	yn(n,x) is similar in all respects, except
+ *	that forward recursion is used for all
+ *	values of n>1.
+ *	
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double
+#else
+static double
+#endif
+invsqrtpi=  5.64189583547756279280e-01, /* 0x3FE20DD7, 0x50429B6D */
+two   =  2.00000000000000000000e+00, /* 0x40000000, 0x00000000 */
+one   =  1.00000000000000000000e+00; /* 0x3FF00000, 0x00000000 */
+
+static double zero  =  0.00000000000000000000e+00;
+
+#ifdef __STDC__
+	double __ieee754_jn(int n, double x)
+#else
+	double __ieee754_jn(n,x)
+	int n; double x;
+#endif
+{
+	int i,hx,ix,lx, sgn;
+	double a, b, temp, di;
+	double z, w;
+
+    /* J(-n,x) = (-1)^n * J(n, x), J(n, -x) = (-1)^n * J(n, x)
+     * Thus, J(-n,x) = J(n,-x)
+     */
+	hx = __HI(x);
+	ix = 0x7fffffff&hx;
+	lx = __LO(x);
+    /* if J(n,NaN) is NaN */
+	if((ix|((unsigned)(lx|-lx))>>31)>0x7ff00000) return x+x;
+	if(n<0){		
+		n = -n;
+		x = -x;
+		hx ^= 0x80000000;
+	}
+	if(n==0) return(__ieee754_j0(x));
+	if(n==1) return(__ieee754_j1(x));
+	sgn = (n&1)&(hx>>31);	/* even n -- 0, odd n -- sign(x) */
+	x = fd_fabs(x);
+	if((ix|lx)==0||ix>=0x7ff00000) 	/* if x is 0 or inf */
+	    b = zero;
+	else if((double)n<=x) {   
+		/* Safe to use J(n+1,x)=2n/x *J(n,x)-J(n-1,x) */
+	    if(ix>=0x52D00000) { /* x > 2**302 */
+    /* (x >> n**2) 
+     *	    Jn(x) = cos(x-(2n+1)*pi/4)*sqrt(2/x*pi)
+     *	    Yn(x) = sin(x-(2n+1)*pi/4)*sqrt(2/x*pi)
+     *	    Let s=sin(x), c=cos(x), 
+     *		xn=x-(2n+1)*pi/4, sqt2 = sqrt(2),then
+     *
+     *		   n	sin(xn)*sqt2	cos(xn)*sqt2
+     *		----------------------------------
+     *		   0	 s-c		 c+s
+     *		   1	-s-c 		-c+s
+     *		   2	-s+c		-c-s
+     *		   3	 s+c		 c-s
+     */
+		switch(n&3) {
+		    case 0: temp =  fd_cos(x)+fd_sin(x); break;
+		    case 1: temp = -fd_cos(x)+fd_sin(x); break;
+		    case 2: temp = -fd_cos(x)-fd_sin(x); break;
+		    case 3: temp =  fd_cos(x)-fd_sin(x); break;
+		}
+		b = invsqrtpi*temp/fd_sqrt(x);
+	    } else {	
+	        a = __ieee754_j0(x);
+	        b = __ieee754_j1(x);
+	        for(i=1;i<n;i++){
+		    temp = b;
+		    b = b*((double)(i+i)/x) - a; /* avoid underflow */
+		    a = temp;
+	        }
+	    }
+	} else {
+	    if(ix<0x3e100000) {	/* x < 2**-29 */
+    /* x is tiny, return the first Taylor expansion of J(n,x) 
+     * J(n,x) = 1/n!*(x/2)^n  - ...
+     */
+		if(n>33)	/* underflow */
+		    b = zero;
+		else {
+		    temp = x*0.5; b = temp;
+		    for (a=one,i=2;i<=n;i++) {
+			a *= (double)i;		/* a = n! */
+			b *= temp;		/* b = (x/2)^n */
+		    }
+		    b = b/a;
+		}
+	    } else {
+		/* use backward recurrence */
+		/* 			x      x^2      x^2       
+		 *  J(n,x)/J(n-1,x) =  ----   ------   ------   .....
+		 *			2n  - 2(n+1) - 2(n+2)
+		 *
+		 * 			1      1        1       
+		 *  (for large x)   =  ----  ------   ------   .....
+		 *			2n   2(n+1)   2(n+2)
+		 *			-- - ------ - ------ - 
+		 *			 x     x         x
+		 *
+		 * Let w = 2n/x and h=2/x, then the above quotient
+		 * is equal to the continued fraction:
+		 *		    1
+		 *	= -----------------------
+		 *		       1
+		 *	   w - -----------------
+		 *			  1
+		 * 	        w+h - ---------
+		 *		       w+2h - ...
+		 *
+		 * To determine how many terms needed, let
+		 * Q(0) = w, Q(1) = w(w+h) - 1,
+		 * Q(k) = (w+k*h)*Q(k-1) - Q(k-2),
+		 * When Q(k) > 1e4	good for single 
+		 * When Q(k) > 1e9	good for double 
+		 * When Q(k) > 1e17	good for quadruple 
+		 */
+	    /* determine k */
+		double t,v;
+		double q0,q1,h,tmp; int k,m;
+		w  = (n+n)/(double)x; h = 2.0/(double)x;
+		q0 = w;  z = w+h; q1 = w*z - 1.0; k=1;
+		while(q1<1.0e9) {
+			k += 1; z += h;
+			tmp = z*q1 - q0;
+			q0 = q1;
+			q1 = tmp;
+		}
+		m = n+n;
+		for(t=zero, i = 2*(n+k); i>=m; i -= 2) t = one/(i/x-t);
+		a = t;
+		b = one;
+		/*  estimate log((2/x)^n*n!) = n*log(2/x)+n*ln(n)
+		 *  Hence, if n*(log(2n/x)) > ...
+		 *  single 8.8722839355e+01
+		 *  double 7.09782712893383973096e+02
+		 *  long double 1.1356523406294143949491931077970765006170e+04
+		 *  then recurrent value may overflow and the result is 
+		 *  likely underflow to zero
+		 */
+		tmp = n;
+		v = two/x;
+		tmp = tmp*__ieee754_log(fd_fabs(v*tmp));
+		if(tmp<7.09782712893383973096e+02) {
+	    	    for(i=n-1,di=(double)(i+i);i>0;i--){
+		        temp = b;
+			b *= di;
+			b  = b/x - a;
+		        a = temp;
+			di -= two;
+	     	    }
+		} else {
+	    	    for(i=n-1,di=(double)(i+i);i>0;i--){
+		        temp = b;
+			b *= di;
+			b  = b/x - a;
+		        a = temp;
+			di -= two;
+		    /* scale b to avoid spurious overflow */
+			if(b>1e100) {
+			    a /= b;
+			    t /= b;
+			    b  = one;
+			}
+	     	    }
+		}
+	    	b = (t*__ieee754_j0(x)/b);
+	    }
+	}
+	if(sgn==1) return -b; else return b;
+}
+
+#ifdef __STDC__
+	double __ieee754_yn(int n, double x) 
+#else
+	double __ieee754_yn(n,x) 
+	int n; double x;
+#endif
+{
+	int i,hx,ix,lx;
+	int sign;
+	double a, b, temp;
+
+	hx = __HI(x);
+	ix = 0x7fffffff&hx;
+	lx = __LO(x);
+    /* if Y(n,NaN) is NaN */
+	if((ix|((unsigned)(lx|-lx))>>31)>0x7ff00000) return x+x;
+	if((ix|lx)==0) return -one/zero;
+	if(hx<0) return zero/zero;
+	sign = 1;
+	if(n<0){
+		n = -n;
+		sign = 1 - ((n&1)<<1);
+	}
+	if(n==0) return(__ieee754_y0(x));
+	if(n==1) return(sign*__ieee754_y1(x));
+	if(ix==0x7ff00000) return zero;
+	if(ix>=0x52D00000) { /* x > 2**302 */
+    /* (x >> n**2) 
+     *	    Jn(x) = cos(x-(2n+1)*pi/4)*sqrt(2/x*pi)
+     *	    Yn(x) = sin(x-(2n+1)*pi/4)*sqrt(2/x*pi)
+     *	    Let s=sin(x), c=cos(x), 
+     *		xn=x-(2n+1)*pi/4, sqt2 = sqrt(2),then
+     *
+     *		   n	sin(xn)*sqt2	cos(xn)*sqt2
+     *		----------------------------------
+     *		   0	 s-c		 c+s
+     *		   1	-s-c 		-c+s
+     *		   2	-s+c		-c-s
+     *		   3	 s+c		 c-s
+     */
+		switch(n&3) {
+		    case 0: temp =  fd_sin(x)-fd_cos(x); break;
+		    case 1: temp = -fd_sin(x)-fd_cos(x); break;
+		    case 2: temp = -fd_sin(x)+fd_cos(x); break;
+		    case 3: temp =  fd_sin(x)+fd_cos(x); break;
+		}
+		b = invsqrtpi*temp/fd_sqrt(x);
+	} else {
+	    a = __ieee754_y0(x);
+	    b = __ieee754_y1(x);
+	/* quit if b is -inf */
+	    for(i=1;i<n&&(__HI(b) != 0xfff00000);i++){ 
+		temp = b;
+		b = ((double)(i+i)/x)*b - a;
+		a = temp;
+	    }
+	}
+	if(sign>0) return b; else return -b;
+}

mozilla/js/src/fdlibm/e_lgamma.c

@@ -0,0 +1,66 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public
+ * License Version 1.1 (the "License"); you may not use this file
+ * except in compliance with the License. You may obtain a copy of
+ * the License at http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the License is distributed on an "AS
+ * IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+ * implied. See the License for the specific language governing
+ * rights and limitations under the License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is Sun Microsystems,
+ * Inc.  Portions created by Netscape are
+ * Copyright (C) 1998 Netscape Communications Corporation. All
+ * Rights Reserved.
+ *
+ * Contributor(s): 
+ *
+ * Alternatively, the contents of this file may be used under the
+ * terms of the GNU Public License (the "GPL"), in which case the
+ * provisions of the GPL are applicable instead of those above.
+ * If you wish to allow use of your version of this file only
+ * under the terms of the GPL and not to allow others to use your
+ * version of this file under the NPL, indicate your decision by
+ * deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL.  If you do not delete
+ * the provisions above, a recipient may use your version of this
+ * file under either the NPL or the GPL.
+ */
+
+/* @(#)e_lgamma.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ *
+ */
+
+/* __ieee754_lgamma(x)
+ * Return the logarithm of the Gamma function of x.
+ *
+ * Method: call __ieee754_lgamma_r
+ */
+
+#include "fdlibm.h"
+
+extern int signgam;
+
+#ifdef __STDC__
+	double __ieee754_lgamma(double x)
+#else
+	double __ieee754_lgamma(x)
+	double x;
+#endif
+{
+	return __ieee754_lgamma_r(x,&signgam);
+}

mozilla/js/src/fdlibm/e_lgamma_r.c

@@ -0,0 +1,337 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public
+ * License Version 1.1 (the "License"); you may not use this file
+ * except in compliance with the License. You may obtain a copy of
+ * the License at http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the License is distributed on an "AS
+ * IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+ * implied. See the License for the specific language governing
+ * rights and limitations under the License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is Sun Microsystems,
+ * Inc.  Portions created by Netscape are
+ * Copyright (C) 1998 Netscape Communications Corporation. All
+ * Rights Reserved.
+ *
+ * Contributor(s): 
+ *
+ * Alternatively, the contents of this file may be used under the
+ * terms of the GNU Public License (the "GPL"), in which case the
+ * provisions of the GPL are applicable instead of those above.
+ * If you wish to allow use of your version of this file only
+ * under the terms of the GPL and not to allow others to use your
+ * version of this file under the NPL, indicate your decision by
+ * deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL.  If you do not delete
+ * the provisions above, a recipient may use your version of this
+ * file under either the NPL or the GPL.
+ */
+
+/* @(#)e_lgamma_r.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ *
+ */
+
+/* __ieee754_lgamma_r(x, signgamp)
+ * Reentrant version of the logarithm of the Gamma function 
+ * with user provide pointer for the sign of Gamma(x). 
+ *
+ * Method:
+ *   1. Argument Reduction for 0 < x <= 8
+ * 	Since gamma(1+s)=s*gamma(s), for x in [0,8], we may 
+ * 	reduce x to a number in [1.5,2.5] by
+ * 		lgamma(1+s) = log(s) + lgamma(s)
+ *	for example,
+ *		lgamma(7.3) = log(6.3) + lgamma(6.3)
+ *			    = log(6.3*5.3) + lgamma(5.3)
+ *			    = log(6.3*5.3*4.3*3.3*2.3) + lgamma(2.3)
+ *   2. Polynomial approximation of lgamma around its
+ *	minimun ymin=1.461632144968362245 to maintain monotonicity.
+ *	On [ymin-0.23, ymin+0.27] (i.e., [1.23164,1.73163]), use
+ *		Let z = x-ymin;
+ *		lgamma(x) = -1.214862905358496078218 + z^2*poly(z)
+ *	where
+ *		poly(z) is a 14 degree polynomial.
+ *   2. Rational approximation in the primary interval [2,3]
+ *	We use the following approximation:
+ *		s = x-2.0;
+ *		lgamma(x) = 0.5*s + s*P(s)/Q(s)
+ *	with accuracy
+ *		|P/Q - (lgamma(x)-0.5s)| < 2**-61.71
+ *	Our algorithms are based on the following observation
+ *
+ *                             zeta(2)-1    2    zeta(3)-1    3
+ * lgamma(2+s) = s*(1-Euler) + --------- * s  -  --------- * s  + ...
+ *                                 2                 3
+ *
+ *	where Euler = 0.5771... is the Euler constant, which is very
+ *	close to 0.5.
+ *
+ *   3. For x>=8, we have
+ *	lgamma(x)~(x-0.5)log(x)-x+0.5*log(2pi)+1/(12x)-1/(360x**3)+....
+ *	(better formula:
+ *	   lgamma(x)~(x-0.5)*(log(x)-1)-.5*(log(2pi)-1) + ...)
+ *	Let z = 1/x, then we approximation
+ *		f(z) = lgamma(x) - (x-0.5)(log(x)-1)
+ *	by
+ *	  			    3       5             11
+ *		w = w0 + w1*z + w2*z  + w3*z  + ... + w6*z
+ *	where 
+ *		|w - f(z)| < 2**-58.74
+ *		
+ *   4. For negative x, since (G is gamma function)
+ *		-x*G(-x)*G(x) = pi/sin(pi*x),
+ * 	we have
+ * 		G(x) = pi/(sin(pi*x)*(-x)*G(-x))
+ *	since G(-x) is positive, sign(G(x)) = sign(sin(pi*x)) for x<0
+ *	Hence, for x<0, signgam = sign(sin(pi*x)) and 
+ *		lgamma(x) = log(|Gamma(x)|)
+ *			  = log(pi/(|x*sin(pi*x)|)) - lgamma(-x);
+ *	Note: one should avoid compute pi*(-x) directly in the 
+ *	      computation of sin(pi*(-x)).
+ *		
+ *   5. Special Cases
+ *		lgamma(2+s) ~ s*(1-Euler) for tiny s
+ *		lgamma(1)=lgamma(2)=0
+ *		lgamma(x) ~ -log(x) for tiny x
+ *		lgamma(0) = lgamma(inf) = inf
+ *	 	lgamma(-integer) = +-inf
+ *	
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double 
+#else
+static double 
+#endif
+two52=  4.50359962737049600000e+15, /* 0x43300000, 0x00000000 */
+half=  5.00000000000000000000e-01, /* 0x3FE00000, 0x00000000 */
+one =  1.00000000000000000000e+00, /* 0x3FF00000, 0x00000000 */
+pi  =  3.14159265358979311600e+00, /* 0x400921FB, 0x54442D18 */
+a0  =  7.72156649015328655494e-02, /* 0x3FB3C467, 0xE37DB0C8 */
+a1  =  3.22467033424113591611e-01, /* 0x3FD4A34C, 0xC4A60FAD */
+a2  =  6.73523010531292681824e-02, /* 0x3FB13E00, 0x1A5562A7 */
+a3  =  2.05808084325167332806e-02, /* 0x3F951322, 0xAC92547B */
+a4  =  7.38555086081402883957e-03, /* 0x3F7E404F, 0xB68FEFE8 */
+a5  =  2.89051383673415629091e-03, /* 0x3F67ADD8, 0xCCB7926B */
+a6  =  1.19270763183362067845e-03, /* 0x3F538A94, 0x116F3F5D */
+a7  =  5.10069792153511336608e-04, /* 0x3F40B6C6, 0x89B99C00 */
+a8  =  2.20862790713908385557e-04, /* 0x3F2CF2EC, 0xED10E54D */
+a9  =  1.08011567247583939954e-04, /* 0x3F1C5088, 0x987DFB07 */
+a10 =  2.52144565451257326939e-05, /* 0x3EFA7074, 0x428CFA52 */
+a11 =  4.48640949618915160150e-05, /* 0x3F07858E, 0x90A45837 */
+tc  =  1.46163214496836224576e+00, /* 0x3FF762D8, 0x6356BE3F */
+tf  = -1.21486290535849611461e-01, /* 0xBFBF19B9, 0xBCC38A42 */
+/* tt = -(tail of tf) */
+tt  = -3.63867699703950536541e-18, /* 0xBC50C7CA, 0xA48A971F */
+t0  =  4.83836122723810047042e-01, /* 0x3FDEF72B, 0xC8EE38A2 */
+t1  = -1.47587722994593911752e-01, /* 0xBFC2E427, 0x8DC6C509 */
+t2  =  6.46249402391333854778e-02, /* 0x3FB08B42, 0x94D5419B */
+t3  = -3.27885410759859649565e-02, /* 0xBFA0C9A8, 0xDF35B713 */
+t4  =  1.79706750811820387126e-02, /* 0x3F9266E7, 0x970AF9EC */
+t5  = -1.03142241298341437450e-02, /* 0xBF851F9F, 0xBA91EC6A */
+t6  =  6.10053870246291332635e-03, /* 0x3F78FCE0, 0xE370E344 */
+t7  = -3.68452016781138256760e-03, /* 0xBF6E2EFF, 0xB3E914D7 */
+t8  =  2.25964780900612472250e-03, /* 0x3F6282D3, 0x2E15C915 */
+t9  = -1.40346469989232843813e-03, /* 0xBF56FE8E, 0xBF2D1AF1 */
+t10 =  8.81081882437654011382e-04, /* 0x3F4CDF0C, 0xEF61A8E9 */
+t11 = -5.38595305356740546715e-04, /* 0xBF41A610, 0x9C73E0EC */
+t12 =  3.15632070903625950361e-04, /* 0x3F34AF6D, 0x6C0EBBF7 */
+t13 = -3.12754168375120860518e-04, /* 0xBF347F24, 0xECC38C38 */
+t14 =  3.35529192635519073543e-04, /* 0x3F35FD3E, 0xE8C2D3F4 */
+u0  = -7.72156649015328655494e-02, /* 0xBFB3C467, 0xE37DB0C8 */
+u1  =  6.32827064025093366517e-01, /* 0x3FE4401E, 0x8B005DFF */
+u2  =  1.45492250137234768737e+00, /* 0x3FF7475C, 0xD119BD6F */
+u3  =  9.77717527963372745603e-01, /* 0x3FEF4976, 0x44EA8450 */
+u4  =  2.28963728064692451092e-01, /* 0x3FCD4EAE, 0xF6010924 */
+u5  =  1.33810918536787660377e-02, /* 0x3F8B678B, 0xBF2BAB09 */
+v1  =  2.45597793713041134822e+00, /* 0x4003A5D7, 0xC2BD619C */
+v2  =  2.12848976379893395361e+00, /* 0x40010725, 0xA42B18F5 */
+v3  =  7.69285150456672783825e-01, /* 0x3FE89DFB, 0xE45050AF */
+v4  =  1.04222645593369134254e-01, /* 0x3FBAAE55, 0xD6537C88 */
+v5  =  3.21709242282423911810e-03, /* 0x3F6A5ABB, 0x57D0CF61 */
+s0  = -7.72156649015328655494e-02, /* 0xBFB3C467, 0xE37DB0C8 */
+s1  =  2.14982415960608852501e-01, /* 0x3FCB848B, 0x36E20878 */
+s2  =  3.25778796408930981787e-01, /* 0x3FD4D98F, 0x4F139F59 */
+s3  =  1.46350472652464452805e-01, /* 0x3FC2BB9C, 0xBEE5F2F7 */
+s4  =  2.66422703033638609560e-02, /* 0x3F9B481C, 0x7E939961 */
+s5  =  1.84028451407337715652e-03, /* 0x3F5E26B6, 0x7368F239 */
+s6  =  3.19475326584100867617e-05, /* 0x3F00BFEC, 0xDD17E945 */
+r1  =  1.39200533467621045958e+00, /* 0x3FF645A7, 0x62C4AB74 */
+r2  =  7.21935547567138069525e-01, /* 0x3FE71A18, 0x93D3DCDC */
+r3  =  1.71933865632803078993e-01, /* 0x3FC601ED, 0xCCFBDF27 */
+r4  =  1.86459191715652901344e-02, /* 0x3F9317EA, 0x742ED475 */
+r5  =  7.77942496381893596434e-04, /* 0x3F497DDA, 0xCA41A95B */
+r6  =  7.32668430744625636189e-06, /* 0x3EDEBAF7, 0xA5B38140 */
+w0  =  4.18938533204672725052e-01, /* 0x3FDACFE3, 0x90C97D69 */
+w1  =  8.33333333333329678849e-02, /* 0x3FB55555, 0x5555553B */
+w2  = -2.77777777728775536470e-03, /* 0xBF66C16C, 0x16B02E5C */
+w3  =  7.93650558643019558500e-04, /* 0x3F4A019F, 0x98CF38B6 */
+w4  = -5.95187557450339963135e-04, /* 0xBF4380CB, 0x8C0FE741 */
+w5  =  8.36339918996282139126e-04, /* 0x3F4B67BA, 0x4CDAD5D1 */
+w6  = -1.63092934096575273989e-03; /* 0xBF5AB89D, 0x0B9E43E4 */
+
+static double zero=  0.00000000000000000000e+00;
+
+#ifdef __STDC__
+	static double sin_pi(double x)
+#else
+	static double sin_pi(x)
+	double x;
+#endif
+{
+	double y,z;
+	int n,ix;
+
+	ix = 0x7fffffff&__HI(x);
+
+	if(ix<0x3fd00000) return __kernel_sin(pi*x,zero,0);
+	y = -x;		/* x is assume negative */
+
+    /*
+     * argument reduction, make sure inexact flag not raised if input
+     * is an integer
+     */
+	z = fd_floor(y);
+	if(z!=y) {				/* inexact anyway */
+	    y  *= 0.5;
+	    y   = 2.0*(y - fd_floor(y));		/* y = |x| mod 2.0 */
+	    n   = (int) (y*4.0);
+	} else {
+            if(ix>=0x43400000) {
+                y = zero; n = 0;                 /* y must be even */
+            } else {
+                if(ix<0x43300000) z = y+two52;	/* exact */
+                n   = __LO(z)&1;        /* lower word of z */
+                y  = n;
+                n<<= 2;
+            }
+        }
+	switch (n) {
+	    case 0:   y =  __kernel_sin(pi*y,zero,0); break;
+	    case 1:   
+	    case 2:   y =  __kernel_cos(pi*(0.5-y),zero); break;
+	    case 3:  
+	    case 4:   y =  __kernel_sin(pi*(one-y),zero,0); break;
+	    case 5:
+	    case 6:   y = -__kernel_cos(pi*(y-1.5),zero); break;
+	    default:  y =  __kernel_sin(pi*(y-2.0),zero,0); break;
+	    }
+	return -y;
+}
+
+
+#ifdef __STDC__
+	double __ieee754_lgamma_r(double x, int *signgamp)
+#else
+	double __ieee754_lgamma_r(x,signgamp)
+	double x; int *signgamp;
+#endif
+{
+	double t,y,z,nadj,p,p1,p2,p3,q,r,w;
+	int i,hx,lx,ix;
+
+	hx = __HI(x);
+	lx = __LO(x);
+
+    /* purge off +-inf, NaN, +-0, and negative arguments */
+	*signgamp = 1;
+	ix = hx&0x7fffffff;
+	if(ix>=0x7ff00000) return x*x;
+	if((ix|lx)==0) return one/zero;
+	if(ix<0x3b900000) {	/* |x|<2**-70, return -log(|x|) */
+	    if(hx<0) {
+	        *signgamp = -1;
+	        return -__ieee754_log(-x);
+	    } else return -__ieee754_log(x);
+	}
+	if(hx<0) {
+	    if(ix>=0x43300000) 	/* |x|>=2**52, must be -integer */
+		return one/zero;
+	    t = sin_pi(x);
+	    if(t==zero) return one/zero; /* -integer */
+	    nadj = __ieee754_log(pi/fd_fabs(t*x));
+	    if(t<zero) *signgamp = -1;
+	    x = -x;
+	}
+
+    /* purge off 1 and 2 */
+	if((((ix-0x3ff00000)|lx)==0)||(((ix-0x40000000)|lx)==0)) r = 0;
+    /* for x < 2.0 */
+	else if(ix<0x40000000) {
+	    if(ix<=0x3feccccc) { 	/* lgamma(x) = lgamma(x+1)-log(x) */
+		r = -__ieee754_log(x);
+		if(ix>=0x3FE76944) {y = one-x; i= 0;}
+		else if(ix>=0x3FCDA661) {y= x-(tc-one); i=1;}
+	  	else {y = x; i=2;}
+	    } else {
+	  	r = zero;
+	        if(ix>=0x3FFBB4C3) {y=2.0-x;i=0;} /* [1.7316,2] */
+	        else if(ix>=0x3FF3B4C4) {y=x-tc;i=1;} /* [1.23,1.73] */
+		else {y=x-one;i=2;}
+	    }
+	    switch(i) {
+	      case 0:
+		z = y*y;
+		p1 = a0+z*(a2+z*(a4+z*(a6+z*(a8+z*a10))));
+		p2 = z*(a1+z*(a3+z*(a5+z*(a7+z*(a9+z*a11)))));
+		p  = y*p1+p2;
+		r  += (p-0.5*y); break;
+	      case 1:
+		z = y*y;
+		w = z*y;
+		p1 = t0+w*(t3+w*(t6+w*(t9 +w*t12)));	/* parallel comp */
+		p2 = t1+w*(t4+w*(t7+w*(t10+w*t13)));
+		p3 = t2+w*(t5+w*(t8+w*(t11+w*t14)));
+		p  = z*p1-(tt-w*(p2+y*p3));
+		r += (tf + p); break;
+	      case 2:	
+		p1 = y*(u0+y*(u1+y*(u2+y*(u3+y*(u4+y*u5)))));
+		p2 = one+y*(v1+y*(v2+y*(v3+y*(v4+y*v5))));
+		r += (-0.5*y + p1/p2);
+	    }
+	}
+	else if(ix<0x40200000) { 			/* x < 8.0 */
+	    i = (int)x;
+	    t = zero;
+	    y = x-(double)i;
+	    p = y*(s0+y*(s1+y*(s2+y*(s3+y*(s4+y*(s5+y*s6))))));
+	    q = one+y*(r1+y*(r2+y*(r3+y*(r4+y*(r5+y*r6)))));
+	    r = half*y+p/q;
+	    z = one;	/* lgamma(1+s) = log(s) + lgamma(s) */
+	    switch(i) {
+	    case 7: z *= (y+6.0);	/* FALLTHRU */
+	    case 6: z *= (y+5.0);	/* FALLTHRU */
+	    case 5: z *= (y+4.0);	/* FALLTHRU */
+	    case 4: z *= (y+3.0);	/* FALLTHRU */
+	    case 3: z *= (y+2.0);	/* FALLTHRU */
+		    r += __ieee754_log(z); break;
+	    }
+    /* 8.0 <= x < 2**58 */
+	} else if (ix < 0x43900000) {
+	    t = __ieee754_log(x);
+	    z = one/x;
+	    y = z*z;
+	    w = w0+z*(w1+y*(w2+y*(w3+y*(w4+y*(w5+y*w6)))));
+	    r = (x-half)*(t-one)+w;
+	} else 
+    /* 2**58 <= x <= inf */
+	    r =  x*(__ieee754_log(x)-one);
+	if(hx<0) r = nadj - r;
+	return r;
+}

mozilla/js/src/fdlibm/e_log.c

@@ -0,0 +1,174 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public
+ * License Version 1.1 (the "License"); you may not use this file
+ * except in compliance with the License. You may obtain a copy of
+ * the License at http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the License is distributed on an "AS
+ * IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+ * implied. See the License for the specific language governing
+ * rights and limitations under the License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is Sun Microsystems,
+ * Inc.  Portions created by Netscape are
+ * Copyright (C) 1998 Netscape Communications Corporation. All
+ * Rights Reserved.
+ *
+ * Contributor(s): 
+ *
+ * Alternatively, the contents of this file may be used under the
+ * terms of the GNU Public License (the "GPL"), in which case the
+ * provisions of the GPL are applicable instead of those above.
+ * If you wish to allow use of your version of this file only
+ * under the terms of the GPL and not to allow others to use your
+ * version of this file under the NPL, indicate your decision by
+ * deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL.  If you do not delete
+ * the provisions above, a recipient may use your version of this
+ * file under either the NPL or the GPL.
+ */
+
+/* @(#)e_log.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* __ieee754_log(x)
+ * Return the logrithm of x
+ *
+ * Method :                  
+ *   1. Argument Reduction: find k and f such that 
+ *			x = 2^k * (1+f), 
+ *	   where  sqrt(2)/2 < 1+f < sqrt(2) .
+ *
+ *   2. Approximation of log(1+f).
+ *	Let s = f/(2+f) ; based on log(1+f) = log(1+s) - log(1-s)
+ *		 = 2s + 2/3 s**3 + 2/5 s**5 + .....,
+ *	     	 = 2s + s*R
+ *      We use a special Reme algorithm on [0,0.1716] to generate 
+ * 	a polynomial of degree 14 to approximate R The maximum error 
+ *	of this polynomial approximation is bounded by 2**-58.45. In
+ *	other words,
+ *		        2      4      6      8      10      12      14
+ *	    R(z) ~ Lg1*s +Lg2*s +Lg3*s +Lg4*s +Lg5*s  +Lg6*s  +Lg7*s
+ *  	(the values of Lg1 to Lg7 are listed in the program)
+ *	and
+ *	    |      2          14          |     -58.45
+ *	    | Lg1*s +...+Lg7*s    -  R(z) | <= 2 
+ *	    |                             |
+ *	Note that 2s = f - s*f = f - hfsq + s*hfsq, where hfsq = f*f/2.
+ *	In order to guarantee error in log below 1ulp, we compute log
+ *	by
+ *		log(1+f) = f - s*(f - R)	(if f is not too large)
+ *		log(1+f) = f - (hfsq - s*(hfsq+R)).	(better accuracy)
+ *	
+ *	3. Finally,  log(x) = k*ln2 + log(1+f).  
+ *			    = k*ln2_hi+(f-(hfsq-(s*(hfsq+R)+k*ln2_lo)))
+ *	   Here ln2 is split into two floating point number: 
+ *			ln2_hi + ln2_lo,
+ *	   where n*ln2_hi is always exact for |n| < 2000.
+ *
+ * Special cases:
+ *	log(x) is NaN with signal if x < 0 (including -INF) ; 
+ *	log(+INF) is +INF; log(0) is -INF with signal;
+ *	log(NaN) is that NaN with no signal.
+ *
+ * Accuracy:
+ *	according to an error analysis, the error is always less than
+ *	1 ulp (unit in the last place).
+ *
+ * Constants:
+ * The hexadecimal values are the intended ones for the following 
+ * constants. The decimal values may be used, provided that the 
+ * compiler will convert from decimal to binary accurately enough 
+ * to produce the hexadecimal values shown.
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double
+#else
+static double
+#endif
+ln2_hi  =  6.93147180369123816490e-01,	/* 3fe62e42 fee00000 */
+ln2_lo  =  1.90821492927058770002e-10,	/* 3dea39ef 35793c76 */
+two54   =  1.80143985094819840000e+16,  /* 43500000 00000000 */
+Lg1 = 6.666666666666735130e-01,  /* 3FE55555 55555593 */
+Lg2 = 3.999999999940941908e-01,  /* 3FD99999 9997FA04 */
+Lg3 = 2.857142874366239149e-01,  /* 3FD24924 94229359 */
+Lg4 = 2.222219843214978396e-01,  /* 3FCC71C5 1D8E78AF */
+Lg5 = 1.818357216161805012e-01,  /* 3FC74664 96CB03DE */
+Lg6 = 1.531383769920937332e-01,  /* 3FC39A09 D078C69F */
+Lg7 = 1.479819860511658591e-01;  /* 3FC2F112 DF3E5244 */
+
+static double zero   =  0.0;
+
+#ifdef __STDC__
+	double __ieee754_log(double x)
+#else
+	double __ieee754_log(x)
+	double x;
+#endif
+{
+	double hfsq,f,s,z,R,w,t1,t2,dk;
+	int k,hx,i,j;
+	unsigned lx;
+
+	hx = __HI(x);		/* high word of x */
+	lx = __LO(x);		/* low  word of x */
+
+	k=0;
+	if (hx < 0x00100000) {			/* x < 2**-1022  */
+	    if (((hx&0x7fffffff)|lx)==0) 
+		return -two54/zero;		/* log(+-0)=-inf */
+	    if (hx<0) return (x-x)/zero;	/* log(-#) = NaN */
+	    k -= 54; x *= two54; /* subnormal number, scale up x */
+	    hx = __HI(x);		/* high word of x */
+	} 
+	if (hx >= 0x7ff00000) return x+x;
+	k += (hx>>20)-1023;
+	hx &= 0x000fffff;
+	i = (hx+0x95f64)&0x100000;
+	__HI(x) = hx|(i^0x3ff00000);	/* normalize x or x/2 */
+	k += (i>>20);
+	f = x-1.0;
+	if((0x000fffff&(2+hx))<3) {	/* |f| < 2**-20 */
+	    if(f==zero) { 
+                if(k==0) return zero; else {dk=(double)k;
+                                            return dk*ln2_hi+dk*ln2_lo;} 
+            }
+	    R = f*f*(0.5-0.33333333333333333*f);
+	    if(k==0) return f-R; else {dk=(double)k;
+	    	     return dk*ln2_hi-((R-dk*ln2_lo)-f);}
+	}
+ 	s = f/(2.0+f); 
+	dk = (double)k;
+	z = s*s;
+	i = hx-0x6147a;
+	w = z*z;
+	j = 0x6b851-hx;
+	t1= w*(Lg2+w*(Lg4+w*Lg6)); 
+	t2= z*(Lg1+w*(Lg3+w*(Lg5+w*Lg7))); 
+	i |= j;
+	R = t2+t1;
+	if(i>0) {
+	    hfsq=0.5*f*f;
+	    if(k==0) return f-(hfsq-s*(hfsq+R)); else
+		     return dk*ln2_hi-((hfsq-(s*(hfsq+R)+dk*ln2_lo))-f);
+	} else {
+	    if(k==0) return f-s*(f-R); else
+		     return dk*ln2_hi-((s*(f-R)-dk*ln2_lo)-f);
+	}
+}

mozilla/js/src/fdlibm/e_log10.c

@@ -0,0 +1,124 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public
+ * License Version 1.1 (the "License"); you may not use this file
+ * except in compliance with the License. You may obtain a copy of
+ * the License at http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the License is distributed on an "AS
+ * IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+ * implied. See the License for the specific language governing
+ * rights and limitations under the License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is Sun Microsystems,
+ * Inc.  Portions created by Netscape are
+ * Copyright (C) 1998 Netscape Communications Corporation. All
+ * Rights Reserved.
+ *
+ * Contributor(s): 
+ *
+ * Alternatively, the contents of this file may be used under the
+ * terms of the GNU Public License (the "GPL"), in which case the
+ * provisions of the GPL are applicable instead of those above.
+ * If you wish to allow use of your version of this file only
+ * under the terms of the GPL and not to allow others to use your
+ * version of this file under the NPL, indicate your decision by
+ * deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL.  If you do not delete
+ * the provisions above, a recipient may use your version of this
+ * file under either the NPL or the GPL.
+ */
+
+/* @(#)e_log10.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* __ieee754_log10(x)
+ * Return the base 10 logarithm of x
+ * 
+ * Method :
+ *	Let log10_2hi = leading 40 bits of log10(2) and
+ *	    log10_2lo = log10(2) - log10_2hi,
+ *	    ivln10   = 1/log(10) rounded.
+ *	Then
+ *		n = ilogb(x), 
+ *		if(n<0)  n = n+1;
+ *		x = scalbn(x,-n);
+ *		log10(x) := n*log10_2hi + (n*log10_2lo + ivln10*log(x))
+ *
+ * Note 1:
+ *	To guarantee log10(10**n)=n, where 10**n is normal, the rounding 
+ *	mode must set to Round-to-Nearest.
+ * Note 2:
+ *	[1/log(10)] rounded to 53 bits has error  .198   ulps;
+ *	log10 is monotonic at all binary break points.
+ *
+ * Special cases:
+ *	log10(x) is NaN with signal if x < 0; 
+ *	log10(+INF) is +INF with no signal; log10(0) is -INF with signal;
+ *	log10(NaN) is that NaN with no signal;
+ *	log10(10**N) = N  for N=0,1,...,22.
+ *
+ * Constants:
+ * The hexadecimal values are the intended ones for the following constants.
+ * The decimal values may be used, provided that the compiler will convert
+ * from decimal to binary accurately enough to produce the hexadecimal values
+ * shown.
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double
+#else
+static double
+#endif
+two54      =  1.80143985094819840000e+16, /* 0x43500000, 0x00000000 */
+ivln10     =  4.34294481903251816668e-01, /* 0x3FDBCB7B, 0x1526E50E */
+log10_2hi  =  3.01029995663611771306e-01, /* 0x3FD34413, 0x509F6000 */
+log10_2lo  =  3.69423907715893078616e-13; /* 0x3D59FEF3, 0x11F12B36 */
+
+static double zero   =  0.0;
+
+#ifdef __STDC__
+	double __ieee754_log10(double x)
+#else
+	double __ieee754_log10(x)
+	double x;
+#endif
+{
+	double y,z;
+	int i,k,hx;
+	unsigned lx;
+
+	hx = __HI(x);	/* high word of x */
+	lx = __LO(x);	/* low word of x */
+
+        k=0;
+        if (hx < 0x00100000) {                  /* x < 2**-1022  */
+            if (((hx&0x7fffffff)|lx)==0)
+                return -two54/zero;             /* log(+-0)=-inf */
+            if (hx<0) return (x-x)/zero;        /* log(-#) = NaN */
+            k -= 54; x *= two54; /* subnormal number, scale up x */
+            hx = __HI(x);                /* high word of x */
+        }
+	if (hx >= 0x7ff00000) return x+x;
+	k += (hx>>20)-1023;
+	i  = ((unsigned)k&0x80000000)>>31;
+        hx = (hx&0x000fffff)|((0x3ff-i)<<20);
+        y  = (double)(k+i);
+        __HI(x) = hx;
+	z  = y*log10_2lo + ivln10*__ieee754_log(x);
+	return  z+y*log10_2hi;
+}

mozilla/js/src/fdlibm/e_pow.c

@@ -0,0 +1,358 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public
+ * License Version 1.1 (the "License"); you may not use this file
+ * except in compliance with the License. You may obtain a copy of
+ * the License at http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the License is distributed on an "AS
+ * IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+ * implied. See the License for the specific language governing
+ * rights and limitations under the License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is Sun Microsystems,
+ * Inc.  Portions created by Netscape are
+ * Copyright (C) 1998 Netscape Communications Corporation. All
+ * Rights Reserved.
+ *
+ * Contributor(s): 
+ *
+ * Alternatively, the contents of this file may be used under the
+ * terms of the GNU Public License (the "GPL"), in which case the
+ * provisions of the GPL are applicable instead of those above.
+ * If you wish to allow use of your version of this file only
+ * under the terms of the GPL and not to allow others to use your
+ * version of this file under the NPL, indicate your decision by
+ * deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL.  If you do not delete
+ * the provisions above, a recipient may use your version of this
+ * file under either the NPL or the GPL.
+ */
+
+/* @(#)e_pow.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* __ieee754_pow(x,y) return x**y
+ *
+ *		      n
+ * Method:  Let x =  2   * (1+f)
+ *	1. Compute and return log2(x) in two pieces:
+ *		log2(x) = w1 + w2,
+ *	   where w1 has 53-24 = 29 bit trailing zeros.
+ *	2. Perform y*log2(x) = n+y' by simulating muti-precision 
+ *	   arithmetic, where |y'|<=0.5.
+ *	3. Return x**y = 2**n*exp(y'*log2)
+ *
+ * Special cases:
+ *	1.  (anything) ** 0  is 1
+ *	2.  (anything) ** 1  is itself
+ *	3.  (anything) ** NAN is NAN
+ *	4.  NAN ** (anything except 0) is NAN
+ *	5.  +-(|x| > 1) **  +INF is +INF
+ *	6.  +-(|x| > 1) **  -INF is +0
+ *	7.  +-(|x| < 1) **  +INF is +0
+ *	8.  +-(|x| < 1) **  -INF is +INF
+ *	9.  +-1         ** +-INF is NAN
+ *	10. +0 ** (+anything except 0, NAN)               is +0
+ *	11. -0 ** (+anything except 0, NAN, odd integer)  is +0
+ *	12. +0 ** (-anything except 0, NAN)               is +INF
+ *	13. -0 ** (-anything except 0, NAN, odd integer)  is +INF
+ *	14. -0 ** (odd integer) = -( +0 ** (odd integer) )
+ *	15. +INF ** (+anything except 0,NAN) is +INF
+ *	16. +INF ** (-anything except 0,NAN) is +0
+ *	17. -INF ** (anything)  = -0 ** (-anything)
+ *	18. (-anything) ** (integer) is (-1)**(integer)*(+anything**integer)
+ *	19. (-anything except 0 and inf) ** (non-integer) is NAN
+ *
+ * Accuracy:
+ *	pow(x,y) returns x**y nearly rounded. In particular
+ *			pow(integer,integer)
+ *	always returns the correct integer provided it is 
+ *	representable.
+ *
+ * Constants :
+ * The hexadecimal values are the intended ones for the following 
+ * constants. The decimal values may be used, provided that the 
+ * compiler will convert from decimal to binary accurately enough 
+ * to produce the hexadecimal values shown.
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double 
+#else
+static double 
+#endif
+bp[] = {1.0, 1.5,},
+dp_h[] = { 0.0, 5.84962487220764160156e-01,}, /* 0x3FE2B803, 0x40000000 */
+dp_l[] = { 0.0, 1.35003920212974897128e-08,}, /* 0x3E4CFDEB, 0x43CFD006 */
+zero    =  0.0,
+one	=  1.0,
+two	=  2.0,
+two53	=  9007199254740992.0,	/* 0x43400000, 0x00000000 */
+really_big	=  1.0e300,
+tiny    =  1.0e-300,
+	/* poly coefs for (3/2)*(log(x)-2s-2/3*s**3 */
+L1  =  5.99999999999994648725e-01, /* 0x3FE33333, 0x33333303 */
+L2  =  4.28571428578550184252e-01, /* 0x3FDB6DB6, 0xDB6FABFF */
+L3  =  3.33333329818377432918e-01, /* 0x3FD55555, 0x518F264D */
+L4  =  2.72728123808534006489e-01, /* 0x3FD17460, 0xA91D4101 */
+L5  =  2.30660745775561754067e-01, /* 0x3FCD864A, 0x93C9DB65 */
+L6  =  2.06975017800338417784e-01, /* 0x3FCA7E28, 0x4A454EEF */
+P1   =  1.66666666666666019037e-01, /* 0x3FC55555, 0x5555553E */
+P2   = -2.77777777770155933842e-03, /* 0xBF66C16C, 0x16BEBD93 */
+P3   =  6.61375632143793436117e-05, /* 0x3F11566A, 0xAF25DE2C */
+P4   = -1.65339022054652515390e-06, /* 0xBEBBBD41, 0xC5D26BF1 */
+P5   =  4.13813679705723846039e-08, /* 0x3E663769, 0x72BEA4D0 */
+lg2  =  6.93147180559945286227e-01, /* 0x3FE62E42, 0xFEFA39EF */
+lg2_h  =  6.93147182464599609375e-01, /* 0x3FE62E43, 0x00000000 */
+lg2_l  = -1.90465429995776804525e-09, /* 0xBE205C61, 0x0CA86C39 */
+ovt =  8.0085662595372944372e-0017, /* -(1024-log2(ovfl+.5ulp)) */
+cp    =  9.61796693925975554329e-01, /* 0x3FEEC709, 0xDC3A03FD =2/(3ln2) */
+cp_h  =  9.61796700954437255859e-01, /* 0x3FEEC709, 0xE0000000 =(float)cp */
+cp_l  = -7.02846165095275826516e-09, /* 0xBE3E2FE0, 0x145B01F5 =tail of cp_h*/
+ivln2    =  1.44269504088896338700e+00, /* 0x3FF71547, 0x652B82FE =1/ln2 */
+ivln2_h  =  1.44269502162933349609e+00, /* 0x3FF71547, 0x60000000 =24b 1/ln2*/
+ivln2_l  =  1.92596299112661746887e-08; /* 0x3E54AE0B, 0xF85DDF44 =1/ln2 tail*/
+
+#ifdef __STDC__
+	double __ieee754_pow(double x, double y)
+#else
+	double __ieee754_pow(x,y)
+	double x, y;
+#endif
+{
+#ifdef GCC_OPT_BUG
+        volatile double y1,t1,p_h,t,z,ax;
+#else
+        double y1,t1,p_h,t,z,ax;
+#endif
+	double z_h,z_l,p_l;
+	double t2,r,s,u,v,w;
+	int i,j,k,yisint,n;
+	int hx,hy,ix,iy;
+	unsigned lx,ly;
+
+	hx = __HI(x); lx = __LO(x);
+	hy = __HI(y); ly = __LO(y);
+	ix = hx&0x7fffffff;  iy = hy&0x7fffffff;
+
+    /* y==zero: x**0 = 1 */
+	if((iy|ly)==0) return one; 	
+
+    /* +-NaN return x+y */
+	if(ix > 0x7ff00000 || ((ix==0x7ff00000)&&(lx!=0)) ||
+	   iy > 0x7ff00000 || ((iy==0x7ff00000)&&(ly!=0))) 
+		return x+y;	
+
+    /* determine if y is an odd int when x < 0
+     * yisint = 0	... y is not an integer
+     * yisint = 1	... y is an odd int
+     * yisint = 2	... y is an even int
+     */
+	yisint  = 0;
+	if(hx<0) {	
+	    if(iy>=0x43400000) yisint = 2; /* even integer y */
+	    else if(iy>=0x3ff00000) {
+		k = (iy>>20)-0x3ff;	   /* exponent */
+		if(k>20) {
+		    j = ly>>(52-k);
+		    if((j<<(52-k))==(int)ly) yisint = 2-(j&1);
+		} else if(ly==0) {
+		    j = iy>>(20-k);
+		    if((j<<(20-k))==iy) yisint = 2-(j&1);
+		}
+	    }		
+	} 
+
+    /* special value of y */
+	if(ly==0) { 	
+	    if (iy==0x7ff00000) {	/* y is +-inf */
+	        if(((ix-0x3ff00000)|lx)==0)
+#ifdef _WIN32
+/* VC++ optimizer reduces y - y to 0 */ 
+                    return y / y;
+#else
+		    return  y - y;	/* inf**+-1 is NaN */
+#endif
+	        else if (ix >= 0x3ff00000)/* (|x|>1)**+-inf = inf,0 */
+		    return (hy>=0)? y: zero;
+	        else			/* (|x|<1)**-,+inf = inf,0 */
+		    return (hy<0)?-y: zero;
+	    } 
+	    if(iy==0x3ff00000) {	/* y is  +-1 */
+		if(hy<0) return one/x; else return x;
+	    }
+	    if(hy==0x40000000) return x*x; /* y is  2 */
+	    if(hy==0x3fe00000) {	/* y is  0.5 */
+		if(hx>=0)	/* x >= +0 */
+		return fd_sqrt(x);	
+	    }
+	}
+
+	ax   = fd_fabs(x);
+    /* special value of x */
+	if(lx==0) {
+	    if(ix==0x7ff00000||ix==0||ix==0x3ff00000){
+		z = ax;			/*x is +-0,+-inf,+-1*/
+		if(hy<0) z = one/z;	/* z = (1/|x|) */
+		if(hx<0) {
+		    if(((ix-0x3ff00000)|yisint)==0) {
+			z = (z-z)/(z-z); /* (-1)**non-int is NaN */
+		    } else if(yisint==1) {
+#ifdef HPUX
+			__HI(z) ^= 1<<31; /* some HPUXes cannot negate 0.. */
+#else
+			z = -z;		/* (x<0)**odd = -(|x|**odd) */
+#endif
+			}
+		}
+		return z;
+	    }
+	}
+    
+    /* (x<0)**(non-int) is NaN */
+	if((((hx>>31)+1)|yisint)==0) return (x-x)/(x-x);
+
+    /* |y| is really_big */
+	if(iy>0x41e00000) { /* if |y| > 2**31 */
+	    if(iy>0x43f00000){	/* if |y| > 2**64, must o/uflow */
+		if(ix<=0x3fefffff) return (hy<0)? really_big*really_big:tiny*tiny;
+		if(ix>=0x3ff00000) return (hy>0)? really_big*really_big:tiny*tiny;
+	    }
+	/* over/underflow if x is not close to one */
+	    if(ix<0x3fefffff) return (hy<0)? really_big*really_big:tiny*tiny;
+	    if(ix>0x3ff00000) return (hy>0)? really_big*really_big:tiny*tiny;
+	/* now |1-x| is tiny <= 2**-20, suffice to compute 
+	   log(x) by x-x^2/2+x^3/3-x^4/4 */
+	    t = x-1;		/* t has 20 trailing zeros */
+	    w = (t*t)*(0.5-t*(0.3333333333333333333333-t*0.25));
+	    u = ivln2_h*t;	/* ivln2_h has 21 sig. bits */
+	    v = t*ivln2_l-w*ivln2;
+	    t1 = u+v;
+	    __LO(t1) = 0;
+	    t2 = v-(t1-u);
+	} else {
+#ifdef GCC_OPT_BUG
+	    volatile double s_h,t_h;
+#else
+	    double s_h,t_h;
+#endif
+	    double s2,s_l,t_l;
+	    n = 0;
+	/* take care subnormal number */
+	    if(ix<0x00100000)
+		{ax *= two53; n -= 53; ix = __HI(ax); }
+	    n  += ((ix)>>20)-0x3ff;
+	    j  = ix&0x000fffff;
+	/* determine interval */
+	    ix = j|0x3ff00000;		/* normalize ix */
+	    if(j<=0x3988E) k=0;		/* |x|<sqrt(3/2) */
+	    else if(j<0xBB67A) k=1;	/* |x|<sqrt(3)   */
+	    else {k=0;n+=1;ix -= 0x00100000;}
+	    __HI(ax) = ix;
+
+	/* compute s = s_h+s_l = (x-1)/(x+1) or (x-1.5)/(x+1.5) */
+	    u = ax-bp[k];		/* bp[0]=1.0, bp[1]=1.5 */
+	    v = one/(ax+bp[k]);
+	    s = u*v;
+	    s_h = s;
+	    __LO(s_h) = 0;
+	/* t_h=ax+bp[k] High */
+	    t_h = zero;
+	    __HI(t_h)=((ix>>1)|0x20000000)+0x00080000+(k<<18); 
+	    t_l = ax - (t_h-bp[k]);
+	    s_l = v*((u-s_h*t_h)-s_h*t_l);
+	/* compute log(ax) */
+	    s2 = s*s;
+	    r = s2*s2*(L1+s2*(L2+s2*(L3+s2*(L4+s2*(L5+s2*L6)))));
+	    r += s_l*(s_h+s);
+	    s2  = s_h*s_h;
+	    t_h = 3.0+s2+r;
+	    __LO(t_h) = 0;
+	    t_l = r-((t_h-3.0)-s2);
+	/* u+v = s*(1+...) */
+	    u = s_h*t_h;
+	    v = s_l*t_h+t_l*s;
+	/* 2/(3log2)*(s+...) */
+	    p_h = u+v;
+	    __LO(p_h) = 0;
+	    p_l = v-(p_h-u);
+	    z_h = cp_h*p_h;		/* cp_h+cp_l = 2/(3*log2) */
+	    z_l = cp_l*p_h+p_l*cp+dp_l[k];
+	/* log2(ax) = (s+..)*2/(3*log2) = n + dp_h + z_h + z_l */
+	    t = (double)n;
+	    t1 = (((z_h+z_l)+dp_h[k])+t);
+	    __LO(t1) = 0;
+	    t2 = z_l-(((t1-t)-dp_h[k])-z_h);
+	}
+
+	s = one; /* s (sign of result -ve**odd) = -1 else = 1 */
+	if((((hx>>31)+1)|(yisint-1))==0) s = -one;/* (-ve)**(odd int) */
+
+    /* split up y into y1+y2 and compute (y1+y2)*(t1+t2) */
+	y1  = y;
+	__LO(y1) = 0;
+	p_l = (y-y1)*t1+y*t2;
+	p_h = y1*t1;
+	z = p_l+p_h;
+	j = __HI(z);
+	i = __LO(z);
+
+	if (j>=0x40900000) {				/* z >= 1024 */
+	    if(((j-0x40900000)|i)!=0)			/* if z > 1024 */
+		return s*really_big*really_big;			/* overflow */
+	    else {
+		if(p_l+ovt>z-p_h) return s*really_big*really_big;	/* overflow */
+	    }
+	} else if((j&0x7fffffff)>=0x4090cc00 ) {	/* z <= -1075 */
+	    if(((j-0xc090cc00)|i)!=0) 		/* z < -1075 */
+		return s*tiny*tiny;		/* underflow */
+	    else {
+		if(p_l<=z-p_h) return s*tiny*tiny;	/* underflow */
+	    }
+	}
+    /*
+     * compute 2**(p_h+p_l)
+     */
+	i = j&0x7fffffff;
+	k = (i>>20)-0x3ff;
+	n = 0;
+	if(i>0x3fe00000) {		/* if |z| > 0.5, set n = [z+0.5] */
+	    n = j+(0x00100000>>(k+1));
+	    k = ((n&0x7fffffff)>>20)-0x3ff;	/* new k for n */
+	    t = zero;
+	    __HI(t) = (n&~(0x000fffff>>k));
+	    n = ((n&0x000fffff)|0x00100000)>>(20-k);
+	    if(j<0) n = -n;
+	    p_h -= t;
+	} 
+	t = p_l+p_h;
+	__LO(t) = 0;
+	u = t*lg2_h;
+	v = (p_l-(t-p_h))*lg2+t*lg2_l;
+	z = u+v;
+	w = v-(z-u);
+	t  = z*z;
+	t1  = z - t*(P1+t*(P2+t*(P3+t*(P4+t*P5))));
+	r  = (z*t1)/(t1-two)-(w+z*w);
+	z  = one-(r-z);
+	j  = __HI(z);
+	j += (n<<20);
+	if((j>>20)<=0) z = fd_scalbn(z,n);	/* subnormal output */
+	else __HI(z) += (n<<20);
+	return s*z;
+}

mozilla/js/src/fdlibm/e_rem_pio2.c

@@ -0,0 +1,208 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public
+ * License Version 1.1 (the "License"); you may not use this file
+ * except in compliance with the License. You may obtain a copy of
+ * the License at http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the License is distributed on an "AS
+ * IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+ * implied. See the License for the specific language governing
+ * rights and limitations under the License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is Sun Microsystems,
+ * Inc.  Portions created by Netscape are
+ * Copyright (C) 1998 Netscape Communications Corporation. All
+ * Rights Reserved.
+ *
+ * Contributor(s): 
+ *
+ * Alternatively, the contents of this file may be used under the
+ * terms of the GNU Public License (the "GPL"), in which case the
+ * provisions of the GPL are applicable instead of those above.
+ * If you wish to allow use of your version of this file only
+ * under the terms of the GPL and not to allow others to use your
+ * version of this file under the NPL, indicate your decision by
+ * deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL.  If you do not delete
+ * the provisions above, a recipient may use your version of this
+ * file under either the NPL or the GPL.
+ */
+
+/* @(#)e_rem_pio2.c 1.4 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ *
+ */
+
+/* __ieee754_rem_pio2(x,y)
+ * 
+ * return the remainder of x rem pi/2 in y[0]+y[1] 
+ * use __kernel_rem_pio2()
+ */
+
+#include "fdlibm.h"
+
+/*
+ * Table of constants for 2/pi, 396 Hex digits (476 decimal) of 2/pi 
+ */
+#ifdef __STDC__
+static const int two_over_pi[] = {
+#else
+static int two_over_pi[] = {
+#endif
+0xA2F983, 0x6E4E44, 0x1529FC, 0x2757D1, 0xF534DD, 0xC0DB62, 
+0x95993C, 0x439041, 0xFE5163, 0xABDEBB, 0xC561B7, 0x246E3A, 
+0x424DD2, 0xE00649, 0x2EEA09, 0xD1921C, 0xFE1DEB, 0x1CB129, 
+0xA73EE8, 0x8235F5, 0x2EBB44, 0x84E99C, 0x7026B4, 0x5F7E41, 
+0x3991D6, 0x398353, 0x39F49C, 0x845F8B, 0xBDF928, 0x3B1FF8, 
+0x97FFDE, 0x05980F, 0xEF2F11, 0x8B5A0A, 0x6D1F6D, 0x367ECF, 
+0x27CB09, 0xB74F46, 0x3F669E, 0x5FEA2D, 0x7527BA, 0xC7EBE5, 
+0xF17B3D, 0x0739F7, 0x8A5292, 0xEA6BFB, 0x5FB11F, 0x8D5D08, 
+0x560330, 0x46FC7B, 0x6BABF0, 0xCFBC20, 0x9AF436, 0x1DA9E3, 
+0x91615E, 0xE61B08, 0x659985, 0x5F14A0, 0x68408D, 0xFFD880, 
+0x4D7327, 0x310606, 0x1556CA, 0x73A8C9, 0x60E27B, 0xC08C6B, 
+};
+
+#ifdef __STDC__
+static const int npio2_hw[] = {
+#else
+static int npio2_hw[] = {
+#endif
+0x3FF921FB, 0x400921FB, 0x4012D97C, 0x401921FB, 0x401F6A7A, 0x4022D97C,
+0x4025FDBB, 0x402921FB, 0x402C463A, 0x402F6A7A, 0x4031475C, 0x4032D97C,
+0x40346B9C, 0x4035FDBB, 0x40378FDB, 0x403921FB, 0x403AB41B, 0x403C463A,
+0x403DD85A, 0x403F6A7A, 0x40407E4C, 0x4041475C, 0x4042106C, 0x4042D97C,
+0x4043A28C, 0x40446B9C, 0x404534AC, 0x4045FDBB, 0x4046C6CB, 0x40478FDB,
+0x404858EB, 0x404921FB,
+};
+
+/*
+ * invpio2:  53 bits of 2/pi
+ * pio2_1:   first  33 bit of pi/2
+ * pio2_1t:  pi/2 - pio2_1
+ * pio2_2:   second 33 bit of pi/2
+ * pio2_2t:  pi/2 - (pio2_1+pio2_2)
+ * pio2_3:   third  33 bit of pi/2
+ * pio2_3t:  pi/2 - (pio2_1+pio2_2+pio2_3)
+ */
+
+#ifdef __STDC__
+static const double 
+#else
+static double 
+#endif
+zero =  0.00000000000000000000e+00, /* 0x00000000, 0x00000000 */
+half =  5.00000000000000000000e-01, /* 0x3FE00000, 0x00000000 */
+two24 =  1.67772160000000000000e+07, /* 0x41700000, 0x00000000 */
+invpio2 =  6.36619772367581382433e-01, /* 0x3FE45F30, 0x6DC9C883 */
+pio2_1  =  1.57079632673412561417e+00, /* 0x3FF921FB, 0x54400000 */
+pio2_1t =  6.07710050650619224932e-11, /* 0x3DD0B461, 0x1A626331 */
+pio2_2  =  6.07710050630396597660e-11, /* 0x3DD0B461, 0x1A600000 */
+pio2_2t =  2.02226624879595063154e-21, /* 0x3BA3198A, 0x2E037073 */
+pio2_3  =  2.02226624871116645580e-21, /* 0x3BA3198A, 0x2E000000 */
+pio2_3t =  8.47842766036889956997e-32; /* 0x397B839A, 0x252049C1 */
+
+#ifdef __STDC__
+	int __ieee754_rem_pio2(double x, double *y)
+#else
+	int __ieee754_rem_pio2(x,y)
+	double x,y[];
+#endif
+{
+	double z,w,t,r,fn;
+	double tx[3];
+	int e0,i,j,nx,n,ix,hx;
+
+	hx = __HI(x);		/* high word of x */
+	ix = hx&0x7fffffff;
+	if(ix<=0x3fe921fb)   /* |x| ~<= pi/4 , no need for reduction */
+	    {y[0] = x; y[1] = 0; return 0;}
+	if(ix<0x4002d97c) {  /* |x| < 3pi/4, special case with n=+-1 */
+	    if(hx>0) { 
+		z = x - pio2_1;
+		if(ix!=0x3ff921fb) { 	/* 33+53 bit pi is good enough */
+		    y[0] = z - pio2_1t;
+		    y[1] = (z-y[0])-pio2_1t;
+		} else {		/* near pi/2, use 33+33+53 bit pi */
+		    z -= pio2_2;
+		    y[0] = z - pio2_2t;
+		    y[1] = (z-y[0])-pio2_2t;
+		}
+		return 1;
+	    } else {	/* negative x */
+		z = x + pio2_1;
+		if(ix!=0x3ff921fb) { 	/* 33+53 bit pi is good enough */
+		    y[0] = z + pio2_1t;
+		    y[1] = (z-y[0])+pio2_1t;
+		} else {		/* near pi/2, use 33+33+53 bit pi */
+		    z += pio2_2;
+		    y[0] = z + pio2_2t;
+		    y[1] = (z-y[0])+pio2_2t;
+		}
+		return -1;
+	    }
+	}
+	if(ix<=0x413921fb) { /* |x| ~<= 2^19*(pi/2), medium size */
+	    t  = fd_fabs(x);
+	    n  = (int) (t*invpio2+half);
+	    fn = (double)n;
+	    r  = t-fn*pio2_1;
+	    w  = fn*pio2_1t;	/* 1st round good to 85 bit */
+	    if(n<32&&ix!=npio2_hw[n-1]) {	
+		y[0] = r-w;	/* quick check no cancellation */
+	    } else {
+	        j  = ix>>20;
+	        y[0] = r-w; 
+	        i = j-(((__HI(y[0]))>>20)&0x7ff);
+	        if(i>16) {  /* 2nd iteration needed, good to 118 */
+		    t  = r;
+		    w  = fn*pio2_2;	
+		    r  = t-w;
+		    w  = fn*pio2_2t-((t-r)-w);	
+		    y[0] = r-w;
+		    i = j-(((__HI(y[0]))>>20)&0x7ff);
+		    if(i>49)  {	/* 3rd iteration need, 151 bits acc */
+		    	t  = r;	/* will cover all possible cases */
+		    	w  = fn*pio2_3;	
+		    	r  = t-w;
+		    	w  = fn*pio2_3t-((t-r)-w);	
+		    	y[0] = r-w;
+		    }
+		}
+	    }
+	    y[1] = (r-y[0])-w;
+	    if(hx<0) 	{y[0] = -y[0]; y[1] = -y[1]; return -n;}
+	    else	 return n;
+	}
+    /* 
+     * all other (large) arguments
+     */
+	if(ix>=0x7ff00000) {		/* x is inf or NaN */
+	    y[0]=y[1]=x-x; return 0;
+	}
+    /* set z = scalbn(|x|,ilogb(x)-23) */
+	__LO(z) = __LO(x);
+	e0 	= (ix>>20)-1046;	/* e0 = ilogb(z)-23; */
+	__HI(z) = ix - (e0<<20);
+	for(i=0;i<2;i++) {
+		tx[i] = (double)((int)(z));
+		z     = (z-tx[i])*two24;
+	}
+	tx[2] = z;
+	nx = 3;
+	while(tx[nx-1]==zero) nx--;	/* skip zero term */
+	n  =  __kernel_rem_pio2(tx,y,e0,nx,2,two_over_pi);
+	if(hx<0) {y[0] = -y[0]; y[1] = -y[1]; return -n;}
+	return n;
+}

mozilla/js/src/fdlibm/e_remainder.c

@@ -0,0 +1,110 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public
+ * License Version 1.1 (the "License"); you may not use this file
+ * except in compliance with the License. You may obtain a copy of
+ * the License at http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the License is distributed on an "AS
+ * IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+ * implied. See the License for the specific language governing
+ * rights and limitations under the License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is Sun Microsystems,
+ * Inc.  Portions created by Netscape are
+ * Copyright (C) 1998 Netscape Communications Corporation. All
+ * Rights Reserved.
+ *
+ * Contributor(s): 
+ *
+ * Alternatively, the contents of this file may be used under the
+ * terms of the GNU Public License (the "GPL"), in which case the
+ * provisions of the GPL are applicable instead of those above.
+ * If you wish to allow use of your version of this file only
+ * under the terms of the GPL and not to allow others to use your
+ * version of this file under the NPL, indicate your decision by
+ * deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL.  If you do not delete
+ * the provisions above, a recipient may use your version of this
+ * file under either the NPL or the GPL.
+ */
+
+/* @(#)e_remainder.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* __ieee754_remainder(x,p)
+ * Return :                  
+ * 	returns  x REM p  =  x - [x/p]*p as if in infinite 
+ * 	precise arithmetic, where [x/p] is the (infinite bit) 
+ *	integer nearest x/p (in half way case choose the even one).
+ * Method : 
+ *	Based on fmod() return x-[x/p]chopped*p exactlp.
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double zero = 0.0;
+#else
+static double zero = 0.0;
+#endif
+
+
+#ifdef __STDC__
+	double __ieee754_remainder(double x, double p)
+#else
+	double __ieee754_remainder(x,p)
+	double x,p;
+#endif
+{
+	int hx,hp;
+	unsigned sx,lx,lp;
+	double p_half;
+
+	hx = __HI(x);		/* high word of x */
+	lx = __LO(x);		/* low  word of x */
+	hp = __HI(p);		/* high word of p */
+	lp = __LO(p);		/* low  word of p */
+	sx = hx&0x80000000;
+	hp &= 0x7fffffff;
+	hx &= 0x7fffffff;
+
+    /* purge off exception values */
+	if((hp|lp)==0) return (x*p)/(x*p); 	/* p = 0 */
+	if((hx>=0x7ff00000)||			/* x not finite */
+	  ((hp>=0x7ff00000)&&			/* p is NaN */
+	  (((hp-0x7ff00000)|lp)!=0)))
+	    return (x*p)/(x*p);
+
+
+	if (hp<=0x7fdfffff) x = __ieee754_fmod(x,p+p);	/* now x < 2p */
+	if (((hx-hp)|(lx-lp))==0) return zero*x;
+	x  = fd_fabs(x);
+	p  = fd_fabs(p);
+	if (hp<0x00200000) {
+	    if(x+x>p) {
+		x-=p;
+		if(x+x>=p) x -= p;
+	    }
+	} else {
+	    p_half = 0.5*p;
+	    if(x>p_half) {
+		x-=p;
+		if(x>=p_half) x -= p;
+	    }
+	}
+	__HI(x) ^= sx;
+	return x;
+}

mozilla/js/src/fdlibm/e_scalb.c

@@ -0,0 +1,84 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public
+ * License Version 1.1 (the "License"); you may not use this file
+ * except in compliance with the License. You may obtain a copy of
+ * the License at http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the License is distributed on an "AS
+ * IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+ * implied. See the License for the specific language governing
+ * rights and limitations under the License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is Sun Microsystems,
+ * Inc.  Portions created by Netscape are
+ * Copyright (C) 1998 Netscape Communications Corporation. All
+ * Rights Reserved.
+ *
+ * Contributor(s): 
+ *
+ * Alternatively, the contents of this file may be used under the
+ * terms of the GNU Public License (the "GPL"), in which case the
+ * provisions of the GPL are applicable instead of those above.
+ * If you wish to allow use of your version of this file only
+ * under the terms of the GPL and not to allow others to use your
+ * version of this file under the NPL, indicate your decision by
+ * deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL.  If you do not delete
+ * the provisions above, a recipient may use your version of this
+ * file under either the NPL or the GPL.
+ */
+
+/* @(#)e_scalb.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/*
+ * __ieee754_scalb(x, fn) is provide for
+ * passing various standard test suite. One 
+ * should use scalbn() instead.
+ */
+
+#include "fdlibm.h"
+
+#ifdef _SCALB_INT
+#ifdef __STDC__
+	double __ieee754_scalb(double x, int fn)
+#else
+	double __ieee754_scalb(x,fn)
+	double x; int fn;
+#endif
+#else
+#ifdef __STDC__
+	double __ieee754_scalb(double x, double fn)
+#else
+	double __ieee754_scalb(x,fn)
+	double x, fn;
+#endif
+#endif
+{
+#ifdef _SCALB_INT
+	return fd_scalbn(x,fn);
+#else
+	if (fd_isnan(x)||fd_isnan(fn)) return x*fn;
+	if (!fd_finite(fn)) {
+	    if(fn>0.0) return x*fn;
+	    else       return x/(-fn);
+	}
+	if (fd_rint(fn)!=fn) return (fn-fn)/(fn-fn);
+	if ( fn > 65000.0) return fd_scalbn(x, 65000);
+	if (-fn > 65000.0) return fd_scalbn(x,-65000);
+	return fd_scalbn(x,(int)fn);
+#endif
+}

mozilla/js/src/fdlibm/e_sinh.c

@@ -0,0 +1,115 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public
+ * License Version 1.1 (the "License"); you may not use this file
+ * except in compliance with the License. You may obtain a copy of
+ * the License at http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the License is distributed on an "AS
+ * IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+ * implied. See the License for the specific language governing
+ * rights and limitations under the License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is Sun Microsystems,
+ * Inc.  Portions created by Netscape are
+ * Copyright (C) 1998 Netscape Communications Corporation. All
+ * Rights Reserved.
+ *
+ * Contributor(s): 
+ *
+ * Alternatively, the contents of this file may be used under the
+ * terms of the GNU Public License (the "GPL"), in which case the
+ * provisions of the GPL are applicable instead of those above.
+ * If you wish to allow use of your version of this file only
+ * under the terms of the GPL and not to allow others to use your
+ * version of this file under the NPL, indicate your decision by
+ * deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL.  If you do not delete
+ * the provisions above, a recipient may use your version of this
+ * file under either the NPL or the GPL.
+ */
+
+/* @(#)e_sinh.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* __ieee754_sinh(x)
+ * Method : 
+ * mathematically sinh(x) if defined to be (exp(x)-exp(-x))/2
+ *	1. Replace x by |x| (sinh(-x) = -sinh(x)). 
+ *	2. 
+ *		                                    E + E/(E+1)
+ *	    0        <= x <= 22     :  sinh(x) := --------------, E=expm1(x)
+ *			       			        2
+ *
+ *	    22       <= x <= lnovft :  sinh(x) := exp(x)/2 
+ *	    lnovft   <= x <= ln2ovft:  sinh(x) := exp(x/2)/2 * exp(x/2)
+ *	    ln2ovft  <  x	    :  sinh(x) := x*shuge (overflow)
+ *
+ * Special cases:
+ *	sinh(x) is |x| if x is +INF, -INF, or NaN.
+ *	only sinh(0)=0 is exact for finite x.
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double one = 1.0, shuge = 1.0e307;
+#else
+static double one = 1.0, shuge = 1.0e307;
+#endif
+
+#ifdef __STDC__
+	double __ieee754_sinh(double x)
+#else
+	double __ieee754_sinh(x)
+	double x;
+#endif
+{	
+	double t,w,h;
+	int ix,jx;
+	unsigned lx;
+
+    /* High word of |x|. */
+	jx = __HI(x);
+	ix = jx&0x7fffffff;
+
+    /* x is INF or NaN */
+	if(ix>=0x7ff00000) return x+x;	
+
+	h = 0.5;
+	if (jx<0) h = -h;
+    /* |x| in [0,22], return sign(x)*0.5*(E+E/(E+1))) */
+	if (ix < 0x40360000) {		/* |x|<22 */
+	    if (ix<0x3e300000) 		/* |x|<2**-28 */
+		if(shuge+x>one) return x;/* sinh(tiny) = tiny with inexact */
+	    t = fd_expm1(fd_fabs(x));
+	    if(ix<0x3ff00000) return h*(2.0*t-t*t/(t+one));
+	    return h*(t+t/(t+one));
+	}
+
+    /* |x| in [22, log(maxdouble)] return 0.5*exp(|x|) */
+	if (ix < 0x40862E42)  return h*__ieee754_exp(fd_fabs(x));
+
+    /* |x| in [log(maxdouble), overflowthresold] */
+	lx = *( (((*(unsigned*)&one)>>29)) + (unsigned*)&x);
+	if (ix<0x408633CE || (ix==0x408633ce)&&(lx<=(unsigned)0x8fb9f87d)) {
+	    w = __ieee754_exp(0.5*fd_fabs(x));
+	    t = h*w;
+	    return t*w;
+	}
+
+    /* |x| > overflowthresold, sinh(x) overflow */
+	return x*shuge;
+}

mozilla/js/src/fdlibm/e_sqrt.c

@@ -0,0 +1,483 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public
+ * License Version 1.1 (the "License"); you may not use this file
+ * except in compliance with the License. You may obtain a copy of
+ * the License at http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the License is distributed on an "AS
+ * IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+ * implied. See the License for the specific language governing
+ * rights and limitations under the License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is Sun Microsystems,
+ * Inc.  Portions created by Netscape are
+ * Copyright (C) 1998 Netscape Communications Corporation. All
+ * Rights Reserved.
+ *
+ * Contributor(s): 
+ *
+ * Alternatively, the contents of this file may be used under the
+ * terms of the GNU Public License (the "GPL"), in which case the
+ * provisions of the GPL are applicable instead of those above.
+ * If you wish to allow use of your version of this file only
+ * under the terms of the GPL and not to allow others to use your
+ * version of this file under the NPL, indicate your decision by
+ * deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL.  If you do not delete
+ * the provisions above, a recipient may use your version of this
+ * file under either the NPL or the GPL.
+ */
+/* @(#)e_sqrt.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* __ieee754_sqrt(x)
+ * Return correctly rounded sqrt.
+ *           ------------------------------------------
+ *	     |  Use the hardware sqrt if you have one |
+ *           ------------------------------------------
+ * Method: 
+ *   Bit by bit method using integer arithmetic. (Slow, but portable) 
+ *   1. Normalization
+ *	Scale x to y in [1,4) with even powers of 2: 
+ *	find an integer k such that  1 <= (y=x*2^(2k)) < 4, then
+ *		sqrt(x) = 2^k * sqrt(y)
+ *   2. Bit by bit computation
+ *	Let q  = sqrt(y) truncated to i bit after binary point (q = 1),
+ *	     i							 0
+ *                                     i+1         2
+ *	    s  = 2*q , and	y  =  2   * ( y - q  ).		(1)
+ *	     i      i            i                 i
+ *                                                        
+ *	To compute q    from q , one checks whether 
+ *		    i+1       i                       
+ *
+ *			      -(i+1) 2
+ *			(q + 2      ) <= y.			(2)
+ *     			  i
+ *							      -(i+1)
+ *	If (2) is false, then q   = q ; otherwise q   = q  + 2      .
+ *		 	       i+1   i             i+1   i
+ *
+ *	With some algebric manipulation, it is not difficult to see
+ *	that (2) is equivalent to 
+ *                             -(i+1)
+ *			s  +  2       <= y			(3)
+ *			 i                i
+ *
+ *	The advantage of (3) is that s  and y  can be computed by 
+ *				      i      i
+ *	the following recurrence formula:
+ *	    if (3) is false
+ *
+ *	    s     =  s  ,	y    = y   ;			(4)
+ *	     i+1      i		 i+1    i
+ *
+ *	    otherwise,
+ *                         -i                     -(i+1)
+ *	    s	  =  s  + 2  ,  y    = y  -  s  - 2  		(5)
+ *           i+1      i          i+1    i     i
+ *				
+ *	One may easily use induction to prove (4) and (5). 
+ *	Note. Since the left hand side of (3) contain only i+2 bits,
+ *	      it does not necessary to do a full (53-bit) comparison 
+ *	      in (3).
+ *   3. Final rounding
+ *	After generating the 53 bits result, we compute one more bit.
+ *	Together with the remainder, we can decide whether the
+ *	result is exact, bigger than 1/2ulp, or less than 1/2ulp
+ *	(it will never equal to 1/2ulp).
+ *	The rounding mode can be detected by checking whether
+ *	huge + tiny is equal to huge, and whether huge - tiny is
+ *	equal to huge for some floating point number "huge" and "tiny".
+ *		
+ * Special cases:
+ *	sqrt(+-0) = +-0 	... exact
+ *	sqrt(inf) = inf
+ *	sqrt(-ve) = NaN		... with invalid signal
+ *	sqrt(NaN) = NaN		... with invalid signal for signaling NaN
+ *
+ * Other methods : see the appended file at the end of the program below.
+ *---------------
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static	const double	one	= 1.0, tiny=1.0e-300;
+#else
+static	double	one	= 1.0, tiny=1.0e-300;
+#endif
+
+#ifdef __STDC__
+	double __ieee754_sqrt(double x)
+#else
+	double __ieee754_sqrt(x)
+	double x;
+#endif
+{
+	double z;
+	int 	sign = (int)0x80000000; 
+	unsigned r,t1,s1,ix1,q1;
+	int ix0,s0,q,m,t,i;
+
+	ix0 = __HI(x);			/* high word of x */
+	ix1 = __LO(x);		/* low word of x */
+
+    /* take care of Inf and NaN */
+	if((ix0&0x7ff00000)==0x7ff00000) {			
+	    return x*x+x;		/* sqrt(NaN)=NaN, sqrt(+inf)=+inf
+					   sqrt(-inf)=sNaN */
+	} 
+    /* take care of zero */
+	if(ix0<=0) {
+	    if(((ix0&(~sign))|ix1)==0) return x;/* sqrt(+-0) = +-0 */
+	    else if(ix0<0)
+		return (x-x)/(x-x);		/* sqrt(-ve) = sNaN */
+	}
+    /* normalize x */
+	m = (ix0>>20);
+	if(m==0) {				/* subnormal x */
+	    while(ix0==0) {
+		m -= 21;
+		ix0 |= (ix1>>11); ix1 <<= 21;
+	    }
+	    for(i=0;(ix0&0x00100000)==0;i++) ix0<<=1;
+	    m -= i-1;
+	    ix0 |= (ix1>>(32-i));
+	    ix1 <<= i;
+	}
+	m -= 1023;	/* unbias exponent */
+	ix0 = (ix0&0x000fffff)|0x00100000;
+	if(m&1){	/* odd m, double x to make it even */
+	    ix0 += ix0 + ((ix1&sign)>>31);
+	    ix1 += ix1;
+	}
+	m >>= 1;	/* m = [m/2] */
+
+    /* generate sqrt(x) bit by bit */
+	ix0 += ix0 + ((ix1&sign)>>31);
+	ix1 += ix1;
+	q = q1 = s0 = s1 = 0;	/* [q,q1] = sqrt(x) */
+	r = 0x00200000;		/* r = moving bit from right to left */
+
+	while(r!=0) {
+	    t = s0+r; 
+	    if(t<=ix0) { 
+		s0   = t+r; 
+		ix0 -= t; 
+		q   += r; 
+	    } 
+	    ix0 += ix0 + ((ix1&sign)>>31);
+	    ix1 += ix1;
+	    r>>=1;
+	}
+
+	r = sign;
+	while(r!=0) {
+	    t1 = s1+r; 
+	    t  = s0;
+	    if((t<ix0)||((t==ix0)&&(t1<=ix1))) { 
+		s1  = t1+r;
+		if(((int)(t1&sign)==sign)&&(s1&sign)==0) s0 += 1;
+		ix0 -= t;
+		if (ix1 < t1) ix0 -= 1;
+		ix1 -= t1;
+		q1  += r;
+	    }
+	    ix0 += ix0 + ((ix1&sign)>>31);
+	    ix1 += ix1;
+	    r>>=1;
+	}
+
+    /* use floating add to find out rounding direction */
+	if((ix0|ix1)!=0) {
+	    z = one-tiny; /* trigger inexact flag */
+	    if (z>=one) {
+	        z = one+tiny;
+	        if (q1==(unsigned)0xffffffff) { q1=0; q += 1;}
+		else if (z>one) {
+		    if (q1==(unsigned)0xfffffffe) q+=1;
+		    q1+=2; 
+		} else
+	            q1 += (q1&1);
+	    }
+	}
+	ix0 = (q>>1)+0x3fe00000;
+	ix1 =  q1>>1;
+	if ((q&1)==1) ix1 |= sign;
+	ix0 += (m <<20);
+	__HI(z) = ix0;
+	__LO(z) = ix1;
+	return z;
+}
+
+/*
+Other methods  (use floating-point arithmetic)
+-------------
+(This is a copy of a drafted paper by Prof W. Kahan 
+and K.C. Ng, written in May, 1986)
+
+	Two algorithms are given here to implement sqrt(x) 
+	(IEEE double precision arithmetic) in software.
+	Both supply sqrt(x) correctly rounded. The first algorithm (in
+	Section A) uses newton iterations and involves four divisions.
+	The second one uses reciproot iterations to avoid division, but
+	requires more multiplications. Both algorithms need the ability
+	to chop results of arithmetic operations instead of round them, 
+	and the INEXACT flag to indicate when an arithmetic operation
+	is executed exactly with no roundoff error, all part of the 
+	standard (IEEE 754-1985). The ability to perform shift, add,
+	subtract and logical AND operations upon 32-bit words is needed
+	too, though not part of the standard.
+
+A.  sqrt(x) by Newton Iteration
+
+   (1)	Initial approximation
+
+	Let x0 and x1 be the leading and the trailing 32-bit words of
+	a floating point number x (in IEEE double format) respectively 
+
+	    1    11		     52				  ...widths
+	   ------------------------------------------------------
+	x: |s|	  e     |	      f				|
+	   ------------------------------------------------------
+	      msb    lsb  msb				      lsb ...order
+
+ 
+	     ------------------------  	     ------------------------
+	x0:  |s|   e    |    f1     |	 x1: |          f2           |
+	     ------------------------  	     ------------------------
+
+	By performing shifts and subtracts on x0 and x1 (both regarded
+	as integers), we obtain an 8-bit approximation of sqrt(x) as
+	follows.
+
+		k  := (x0>>1) + 0x1ff80000;
+		y0 := k - T1[31&(k>>15)].	... y ~ sqrt(x) to 8 bits
+	Here k is a 32-bit integer and T1[] is an integer array containing
+	correction terms. Now magically the floating value of y (y's
+	leading 32-bit word is y0, the value of its trailing word is 0)
+	approximates sqrt(x) to almost 8-bit.
+
+	Value of T1:
+	static int T1[32]= {
+	0,	1024,	3062,	5746,	9193,	13348,	18162,	23592,
+	29598,	36145,	43202,	50740,	58733,	67158,	75992,	85215,
+	83599,	71378,	60428,	50647,	41945,	34246,	27478,	21581,
+	16499,	12183,	8588,	5674,	3403,	1742,	661,	130,};
+
+    (2)	Iterative refinement
+
+	Apply Heron's rule three times to y, we have y approximates 
+	sqrt(x) to within 1 ulp (Unit in the Last Place):
+
+		y := (y+x/y)/2		... almost 17 sig. bits
+		y := (y+x/y)/2		... almost 35 sig. bits
+		y := y-(y-x/y)/2	... within 1 ulp
+
+
+	Remark 1.
+	    Another way to improve y to within 1 ulp is:
+
+		y := (y+x/y)		... almost 17 sig. bits to 2*sqrt(x)
+		y := y - 0x00100006	... almost 18 sig. bits to sqrt(x)
+
+				2
+			    (x-y )*y
+		y := y + 2* ----------	...within 1 ulp
+			       2
+			     3y  + x
+
+
+	This formula has one division fewer than the one above; however,
+	it requires more multiplications and additions. Also x must be
+	scaled in advance to avoid spurious overflow in evaluating the
+	expression 3y*y+x. Hence it is not recommended uless division
+	is slow. If division is very slow, then one should use the 
+	reciproot algorithm given in section B.
+
+    (3) Final adjustment
+
+	By twiddling y's last bit it is possible to force y to be 
+	correctly rounded according to the prevailing rounding mode
+	as follows. Let r and i be copies of the rounding mode and
+	inexact flag before entering the square root program. Also we
+	use the expression y+-ulp for the next representable floating
+	numbers (up and down) of y. Note that y+-ulp = either fixed
+	point y+-1, or multiply y by nextafter(1,+-inf) in chopped
+	mode.
+
+		I := FALSE;	... reset INEXACT flag I
+		R := RZ;	... set rounding mode to round-toward-zero
+		z := x/y;	... chopped quotient, possibly inexact
+		If(not I) then {	... if the quotient is exact
+		    if(z=y) {
+		        I := i;	 ... restore inexact flag
+		        R := r;  ... restore rounded mode
+		        return sqrt(x):=y.
+		    } else {
+			z := z - ulp;	... special rounding
+		    }
+		}
+		i := TRUE;		... sqrt(x) is inexact
+		If (r=RN) then z=z+ulp	... rounded-to-nearest
+		If (r=RP) then {	... round-toward-+inf
+		    y = y+ulp; z=z+ulp;
+		}
+		y := y+z;		... chopped sum
+		y0:=y0-0x00100000;	... y := y/2 is correctly rounded.
+	        I := i;	 		... restore inexact flag
+	        R := r;  		... restore rounded mode
+	        return sqrt(x):=y.
+		    
+    (4)	Special cases
+
+	Square root of +inf, +-0, or NaN is itself;
+	Square root of a negative number is NaN with invalid signal.
+
+
+B.  sqrt(x) by Reciproot Iteration
+
+   (1)	Initial approximation
+
+	Let x0 and x1 be the leading and the trailing 32-bit words of
+	a floating point number x (in IEEE double format) respectively
+	(see section A). By performing shifs and subtracts on x0 and y0,
+	we obtain a 7.8-bit approximation of 1/sqrt(x) as follows.
+
+	    k := 0x5fe80000 - (x0>>1);
+	    y0:= k - T2[63&(k>>14)].	... y ~ 1/sqrt(x) to 7.8 bits
+
+	Here k is a 32-bit integer and T2[] is an integer array 
+	containing correction terms. Now magically the floating
+	value of y (y's leading 32-bit word is y0, the value of
+	its trailing word y1 is set to zero) approximates 1/sqrt(x)
+	to almost 7.8-bit.
+
+	Value of T2:
+	static int T2[64]= {
+	0x1500,	0x2ef8,	0x4d67,	0x6b02,	0x87be,	0xa395,	0xbe7a,	0xd866,
+	0xf14a,	0x1091b,0x11fcd,0x13552,0x14999,0x15c98,0x16e34,0x17e5f,
+	0x18d03,0x19a01,0x1a545,0x1ae8a,0x1b5c4,0x1bb01,0x1bfde,0x1c28d,
+	0x1c2de,0x1c0db,0x1ba73,0x1b11c,0x1a4b5,0x1953d,0x18266,0x16be0,
+	0x1683e,0x179d8,0x18a4d,0x19992,0x1a789,0x1b445,0x1bf61,0x1c989,
+	0x1d16d,0x1d77b,0x1dddf,0x1e2ad,0x1e5bf,0x1e6e8,0x1e654,0x1e3cd,
+	0x1df2a,0x1d635,0x1cb16,0x1be2c,0x1ae4e,0x19bde,0x1868e,0x16e2e,
+	0x1527f,0x1334a,0x11051,0xe951,	0xbe01,	0x8e0d,	0x5924,	0x1edd,};
+
+    (2)	Iterative refinement
+
+	Apply Reciproot iteration three times to y and multiply the
+	result by x to get an approximation z that matches sqrt(x)
+	to about 1 ulp. To be exact, we will have 
+		-1ulp < sqrt(x)-z<1.0625ulp.
+	
+	... set rounding mode to Round-to-nearest
+	   y := y*(1.5-0.5*x*y*y)	... almost 15 sig. bits to 1/sqrt(x)
+	   y := y*((1.5-2^-30)+0.5*x*y*y)... about 29 sig. bits to 1/sqrt(x)
+	... special arrangement for better accuracy
+	   z := x*y			... 29 bits to sqrt(x), with z*y<1
+	   z := z + 0.5*z*(1-z*y)	... about 1 ulp to sqrt(x)
+
+	Remark 2. The constant 1.5-2^-30 is chosen to bias the error so that
+	(a) the term z*y in the final iteration is always less than 1; 
+	(b) the error in the final result is biased upward so that
+		-1 ulp < sqrt(x) - z < 1.0625 ulp
+	    instead of |sqrt(x)-z|<1.03125ulp.
+
+    (3)	Final adjustment
+
+	By twiddling y's last bit it is possible to force y to be 
+	correctly rounded according to the prevailing rounding mode
+	as follows. Let r and i be copies of the rounding mode and
+	inexact flag before entering the square root program. Also we
+	use the expression y+-ulp for the next representable floating
+	numbers (up and down) of y. Note that y+-ulp = either fixed
+	point y+-1, or multiply y by nextafter(1,+-inf) in chopped
+	mode.
+
+	R := RZ;		... set rounding mode to round-toward-zero
+	switch(r) {
+	    case RN:		... round-to-nearest
+	       if(x<= z*(z-ulp)...chopped) z = z - ulp; else
+	       if(x<= z*(z+ulp)...chopped) z = z; else z = z+ulp;
+	       break;
+	    case RZ:case RM:	... round-to-zero or round-to--inf
+	       R:=RP;		... reset rounding mod to round-to-+inf
+	       if(x<z*z ... rounded up) z = z - ulp; else
+	       if(x>=(z+ulp)*(z+ulp) ...rounded up) z = z+ulp;
+	       break;
+	    case RP:		... round-to-+inf
+	       if(x>(z+ulp)*(z+ulp)...chopped) z = z+2*ulp; else
+	       if(x>z*z ...chopped) z = z+ulp;
+	       break;
+	}
+
+	Remark 3. The above comparisons can be done in fixed point. For
+	example, to compare x and w=z*z chopped, it suffices to compare
+	x1 and w1 (the trailing parts of x and w), regarding them as
+	two's complement integers.
+
+	...Is z an exact square root?
+	To determine whether z is an exact square root of x, let z1 be the
+	trailing part of z, and also let x0 and x1 be the leading and
+	trailing parts of x.
+
+	If ((z1&0x03ffffff)!=0)	... not exact if trailing 26 bits of z!=0
+	    I := 1;		... Raise Inexact flag: z is not exact
+	else {
+	    j := 1 - [(x0>>20)&1]	... j = logb(x) mod 2
+	    k := z1 >> 26;		... get z's 25-th and 26-th 
+					    fraction bits
+	    I := i or (k&j) or ((k&(j+j+1))!=(x1&3));
+	}
+	R:= r		... restore rounded mode
+	return sqrt(x):=z.
+
+	If multiplication is cheaper then the foregoing red tape, the 
+	Inexact flag can be evaluated by
+
+	    I := i;
+	    I := (z*z!=x) or I.
+
+	Note that z*z can overwrite I; this value must be sensed if it is 
+	True.
+
+	Remark 4. If z*z = x exactly, then bit 25 to bit 0 of z1 must be
+	zero.
+
+		    --------------------
+		z1: |        f2        | 
+		    --------------------
+		bit 31		   bit 0
+
+	Further more, bit 27 and 26 of z1, bit 0 and 1 of x1, and the odd
+	or even of logb(x) have the following relations:
+
+	-------------------------------------------------
+	bit 27,26 of z1		bit 1,0 of x1	logb(x)
+	-------------------------------------------------
+	00			00		odd and even
+	01			01		even
+	10			10		odd
+	10			00		even
+	11			01		even
+	-------------------------------------------------
+
+    (4)	Special cases (see (4) of Section A).	
+ 
+ */
+ 

mozilla/js/src/fdlibm/fdlibm.h

@@ -0,0 +1,262 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public
+ * License Version 1.1 (the "License"); you may not use this file
+ * except in compliance with the License. You may obtain a copy of
+ * the License at http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the License is distributed on an "AS
+ * IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+ * implied. See the License for the specific language governing
+ * rights and limitations under the License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is Sun Microsystems,
+ * Inc.  Portions created by Netscape are
+ * Copyright (C) 1998 Netscape Communications Corporation. All
+ * Rights Reserved.
+ *
+ * Contributor(s): 
+ *
+ * Alternatively, the contents of this file may be used under the
+ * terms of the GNU Public License (the "GPL"), in which case the
+ * provisions of the GPL are applicable instead of those above.
+ * If you wish to allow use of your version of this file only
+ * under the terms of the GPL and not to allow others to use your
+ * version of this file under the NPL, indicate your decision by
+ * deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL.  If you do not delete
+ * the provisions above, a recipient may use your version of this
+ * file under either the NPL or the GPL.
+ */
+
+/* @(#)fdlibm.h 1.5 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* Modified defines start here.. */
+#ifdef _WIN32
+#define huge myhuge
+#define __LITTLE_ENDIAN
+#endif
+
+#ifdef X86_LINUX
+#define __LITTLE_ENDIAN
+#endif
+
+/* End here. The rest is the standard file. */
+
+#ifdef __NEWVALID	/* special setup for Sun test regime */
+#if defined(i386) || defined(i486) || \
+	defined(intel) || defined(x86) || defined(i86pc)
+#define __LITTLE_ENDIAN
+#endif
+#endif
+
+
+#ifdef __LITTLE_ENDIAN
+#define __HI(x) *(1+(int*)&x)
+#define __LO(x) *(int*)&x
+#define __HIp(x) *(1+(int*)x)
+#define __LOp(x) *(int*)x
+#else
+#define __HI(x) *(int*)&x
+#define __LO(x) *(1+(int*)&x)
+#define __HIp(x) *(int*)x
+#define __LOp(x) *(1+(int*)x)
+#endif
+
+#ifdef __STDC__
+#define	__P(p)	p
+#else
+#define	__P(p)	()
+#endif
+
+/*
+ * ANSI/POSIX
+ */
+
+extern int signgam;
+
+#define	MAXFLOAT	((float)3.40282346638528860e+38)
+
+enum fdversion {fdlibm_ieee = -1, fdlibm_svid, fdlibm_xopen, fdlibm_posix};
+
+#define _LIB_VERSION_TYPE enum fdversion
+#define _LIB_VERSION _fdlib_version  
+
+/* if global variable _LIB_VERSION is not desirable, one may 
+ * change the following to be a constant by: 
+ *	#define _LIB_VERSION_TYPE const enum version
+ * In that case, after one initializes the value _LIB_VERSION (see
+ * s_lib_version.c) during compile time, it cannot be modified
+ * in the middle of a program
+ */ 
+extern  _LIB_VERSION_TYPE  _LIB_VERSION;
+
+#define _IEEE_  fdlibm_ieee
+#define _SVID_  fdlibm_svid
+#define _XOPEN_ fdlibm_xopen
+#define _POSIX_ fdlibm_posix
+
+struct exception {
+	int type;
+	char *name;
+	double arg1;
+	double arg2;
+	double retval;
+};
+
+#define	HUGE		MAXFLOAT
+
+/* 
+ * set X_TLOSS = pi*2**52, which is possibly defined in <values.h>
+ * (one may replace the following line by "#include <values.h>")
+ */
+
+#define X_TLOSS		1.41484755040568800000e+16 
+
+#define	DOMAIN		1
+#define	SING		2
+#define	OVERFLOW	3
+#define	UNDERFLOW	4
+#define	TLOSS		5
+#define	PLOSS		6
+
+/*
+ * ANSI/POSIX
+ */
+
+extern double fd_acos __P((double));
+extern double fd_asin __P((double));
+extern double fd_atan __P((double));
+extern double fd_atan2 __P((double, double));
+extern double fd_cos __P((double));
+extern double fd_sin __P((double));
+extern double fd_tan __P((double));
+ 
+extern double fd_cosh __P((double));
+extern double fd_sinh __P((double));
+extern double fd_tanh __P((double));
+
+extern double fd_exp __P((double));
+extern double fd_frexp __P((double, int *));
+extern double fd_ldexp __P((double, int));
+extern double fd_log __P((double));
+extern double fd_log10 __P((double));
+extern double fd_modf __P((double, double *));
+
+extern double fd_pow __P((double, double));
+extern double fd_sqrt __P((double));
+
+extern double fd_ceil __P((double));
+extern double fd_fabs __P((double));
+extern double fd_floor __P((double));
+extern double fd_fmod __P((double, double));
+
+extern double fd_erf __P((double));
+extern double fd_erfc __P((double));
+extern double fd_gamma __P((double));
+extern double fd_hypot __P((double, double));
+extern int fd_isnan __P((double));
+extern int fd_finite __P((double));
+extern double fd_j0 __P((double));
+extern double fd_j1 __P((double));
+extern double fd_jn __P((int, double));
+extern double fd_lgamma __P((double));
+extern double fd_y0 __P((double));
+extern double fd_y1 __P((double));
+extern double fd_yn __P((int, double));
+
+extern double fd_acosh __P((double));
+extern double fd_asinh __P((double));
+extern double fd_atanh __P((double));
+extern double fd_cbrt __P((double));
+extern double fd_logb __P((double));
+extern double fd_nextafter __P((double, double));
+extern double fd_remainder __P((double, double));
+#ifdef _SCALB_INT
+extern double fd_scalb __P((double, int));
+#else
+extern double fd_scalb __P((double, double));
+#endif
+
+extern int fd_matherr __P((struct exception *));
+
+/*
+ * IEEE Test Vector
+ */
+extern double significand __P((double));
+
+/*
+ * Functions callable from C, intended to support IEEE arithmetic.
+ */
+extern double fd_copysign __P((double, double));
+extern int fd_ilogb __P((double));
+extern double fd_rint __P((double));
+extern double fd_scalbn __P((double, int));
+
+/*
+ * BSD math library entry points
+ */
+extern double fd_expm1 __P((double));
+extern double fd_log1p __P((double));
+
+/*
+ * Reentrant version of gamma & lgamma; passes signgam back by reference
+ * as the second argument; user must allocate space for signgam.
+ */
+#ifdef _REENTRANT
+extern double gamma_r __P((double, int *));
+extern double lgamma_r __P((double, int *));
+#endif	/* _REENTRANT */
+
+/* ieee style elementary functions */
+extern double __ieee754_sqrt __P((double));			
+extern double __ieee754_acos __P((double));			
+extern double __ieee754_acosh __P((double));			
+extern double __ieee754_log __P((double));			
+extern double __ieee754_atanh __P((double));			
+extern double __ieee754_asin __P((double));			
+extern double __ieee754_atan2 __P((double,double));			
+extern double __ieee754_exp __P((double));
+extern double __ieee754_cosh __P((double));
+extern double __ieee754_fmod __P((double,double));
+extern double __ieee754_pow __P((double,double));
+extern double __ieee754_lgamma_r __P((double,int *));
+extern double __ieee754_gamma_r __P((double,int *));
+extern double __ieee754_lgamma __P((double));
+extern double __ieee754_gamma __P((double));
+extern double __ieee754_log10 __P((double));
+extern double __ieee754_sinh __P((double));
+extern double __ieee754_hypot __P((double,double));
+extern double __ieee754_j0 __P((double));
+extern double __ieee754_j1 __P((double));
+extern double __ieee754_y0 __P((double));
+extern double __ieee754_y1 __P((double));
+extern double __ieee754_jn __P((int,double));
+extern double __ieee754_yn __P((int,double));
+extern double __ieee754_remainder __P((double,double));
+extern int    __ieee754_rem_pio2 __P((double,double*));
+#ifdef _SCALB_INT
+extern double __ieee754_scalb __P((double,int));
+#else
+extern double __ieee754_scalb __P((double,double));
+#endif
+
+/* fdlibm kernel function */
+extern double __kernel_standard __P((double,double,int));	
+extern double __kernel_sin __P((double,double,int));
+extern double __kernel_cos __P((double,double));
+extern double __kernel_tan __P((double,double,int));
+extern int    __kernel_rem_pio2 __P((double*,double*,int,int,int,const int*));

mozilla/js/src/fdlibm/k_cos.c

@@ -0,0 +1,125 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public
+ * License Version 1.1 (the "License"); you may not use this file
+ * except in compliance with the License. You may obtain a copy of
+ * the License at http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the License is distributed on an "AS
+ * IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+ * implied. See the License for the specific language governing
+ * rights and limitations under the License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is Sun Microsystems,
+ * Inc.  Portions created by Netscape are
+ * Copyright (C) 1998 Netscape Communications Corporation. All
+ * Rights Reserved.
+ *
+ * Contributor(s): 
+ *
+ * Alternatively, the contents of this file may be used under the
+ * terms of the GNU Public License (the "GPL"), in which case the
+ * provisions of the GPL are applicable instead of those above.
+ * If you wish to allow use of your version of this file only
+ * under the terms of the GPL and not to allow others to use your
+ * version of this file under the NPL, indicate your decision by
+ * deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL.  If you do not delete
+ * the provisions above, a recipient may use your version of this
+ * file under either the NPL or the GPL.
+ */
+
+/* @(#)k_cos.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/*
+ * __kernel_cos( x,  y )
+ * kernel cos function on [-pi/4, pi/4], pi/4 ~ 0.785398164
+ * Input x is assumed to be bounded by ~pi/4 in magnitude.
+ * Input y is the tail of x. 
+ *
+ * Algorithm
+ *	1. Since cos(-x) = cos(x), we need only to consider positive x.
+ *	2. if x < 2^-27 (hx<0x3e400000 0), return 1 with inexact if x!=0.
+ *	3. cos(x) is approximated by a polynomial of degree 14 on
+ *	   [0,pi/4]
+ *		  	                 4            14
+ *	   	cos(x) ~ 1 - x*x/2 + C1*x + ... + C6*x
+ *	   where the remez error is
+ *	
+ * 	|              2     4     6     8     10    12     14 |     -58
+ * 	|cos(x)-(1-.5*x +C1*x +C2*x +C3*x +C4*x +C5*x  +C6*x  )| <= 2
+ * 	|    					               | 
+ * 
+ * 	               4     6     8     10    12     14 
+ *	4. let r = C1*x +C2*x +C3*x +C4*x +C5*x  +C6*x  , then
+ *	       cos(x) = 1 - x*x/2 + r
+ *	   since cos(x+y) ~ cos(x) - sin(x)*y 
+ *			  ~ cos(x) - x*y,
+ *	   a correction term is necessary in cos(x) and hence
+ *		cos(x+y) = 1 - (x*x/2 - (r - x*y))
+ *	   For better accuracy when x > 0.3, let qx = |x|/4 with
+ *	   the last 32 bits mask off, and if x > 0.78125, let qx = 0.28125.
+ *	   Then
+ *		cos(x+y) = (1-qx) - ((x*x/2-qx) - (r-x*y)).
+ *	   Note that 1-qx and (x*x/2-qx) is EXACT here, and the
+ *	   magnitude of the latter is at least a quarter of x*x/2,
+ *	   thus, reducing the rounding error in the subtraction.
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double 
+#else
+static double 
+#endif
+one =  1.00000000000000000000e+00, /* 0x3FF00000, 0x00000000 */
+C1  =  4.16666666666666019037e-02, /* 0x3FA55555, 0x5555554C */
+C2  = -1.38888888888741095749e-03, /* 0xBF56C16C, 0x16C15177 */
+C3  =  2.48015872894767294178e-05, /* 0x3EFA01A0, 0x19CB1590 */
+C4  = -2.75573143513906633035e-07, /* 0xBE927E4F, 0x809C52AD */
+C5  =  2.08757232129817482790e-09, /* 0x3E21EE9E, 0xBDB4B1C4 */
+C6  = -1.13596475577881948265e-11; /* 0xBDA8FAE9, 0xBE8838D4 */
+
+#ifdef __STDC__
+	double __kernel_cos(double x, double y)
+#else
+	double __kernel_cos(x, y)
+	double x,y;
+#endif
+{
+	double a,hz,z,r,qx;
+	int ix;
+	ix = __HI(x)&0x7fffffff;	/* ix = |x|'s high word*/
+	if(ix<0x3e400000) {			/* if x < 2**27 */
+	    if(((int)x)==0) return one;		/* generate inexact */
+	}
+	z  = x*x;
+	r  = z*(C1+z*(C2+z*(C3+z*(C4+z*(C5+z*C6)))));
+	if(ix < 0x3FD33333) 			/* if |x| < 0.3 */ 
+	    return one - (0.5*z - (z*r - x*y));
+	else {
+	    if(ix > 0x3fe90000) {		/* x > 0.78125 */
+		qx = 0.28125;
+	    } else {
+	        __HI(qx) = ix-0x00200000;	/* x/4 */
+	        __LO(qx) = 0;
+	    }
+	    hz = 0.5*z-qx;
+	    a  = one-qx;
+	    return a - (hz - (z*r-x*y));
+	}
+}

mozilla/js/src/fdlibm/k_rem_pio2.c

@@ -0,0 +1,349 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public
+ * License Version 1.1 (the "License"); you may not use this file
+ * except in compliance with the License. You may obtain a copy of
+ * the License at http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the License is distributed on an "AS
+ * IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+ * implied. See the License for the specific language governing
+ * rights and limitations under the License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is Sun Microsystems,
+ * Inc.  Portions created by Netscape are
+ * Copyright (C) 1998 Netscape Communications Corporation. All
+ * Rights Reserved.
+ *
+ * Contributor(s): 
+ *
+ * Alternatively, the contents of this file may be used under the
+ * terms of the GNU Public License (the "GPL"), in which case the
+ * provisions of the GPL are applicable instead of those above.
+ * If you wish to allow use of your version of this file only
+ * under the terms of the GPL and not to allow others to use your
+ * version of this file under the NPL, indicate your decision by
+ * deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL.  If you do not delete
+ * the provisions above, a recipient may use your version of this
+ * file under either the NPL or the GPL.
+ */
+
+/* @(#)k_rem_pio2.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/*
+ * __kernel_rem_pio2(x,y,e0,nx,prec,ipio2)
+ * double x[],y[]; int e0,nx,prec; int ipio2[];
+ * 
+ * __kernel_rem_pio2 return the last three digits of N with 
+ *		y = x - N*pi/2
+ * so that |y| < pi/2.
+ *
+ * The method is to compute the integer (mod 8) and fraction parts of 
+ * (2/pi)*x without doing the full multiplication. In general we
+ * skip the part of the product that are known to be a huge integer (
+ * more accurately, = 0 mod 8 ). Thus the number of operations are
+ * independent of the exponent of the input.
+ *
+ * (2/pi) is represented by an array of 24-bit integers in ipio2[].
+ *
+ * Input parameters:
+ * 	x[]	The input value (must be positive) is broken into nx 
+ *		pieces of 24-bit integers in double precision format.
+ *		x[i] will be the i-th 24 bit of x. The scaled exponent 
+ *		of x[0] is given in input parameter e0 (i.e., x[0]*2^e0 
+ *		match x's up to 24 bits.
+ *
+ *		Example of breaking a double positive z into x[0]+x[1]+x[2]:
+ *			e0 = ilogb(z)-23
+ *			z  = scalbn(z,-e0)
+ *		for i = 0,1,2
+ *			x[i] = floor(z)
+ *			z    = (z-x[i])*2**24
+ *
+ *
+ *	y[]	ouput result in an array of double precision numbers.
+ *		The dimension of y[] is:
+ *			24-bit  precision	1
+ *			53-bit  precision	2
+ *			64-bit  precision	2
+ *			113-bit precision	3
+ *		The actual value is the sum of them. Thus for 113-bit
+ *		precison, one may have to do something like:
+ *
+ *		long double t,w,r_head, r_tail;
+ *		t = (long double)y[2] + (long double)y[1];
+ *		w = (long double)y[0];
+ *		r_head = t+w;
+ *		r_tail = w - (r_head - t);
+ *
+ *	e0	The exponent of x[0]
+ *
+ *	nx	dimension of x[]
+ *
+ *  	prec	an integer indicating the precision:
+ *			0	24  bits (single)
+ *			1	53  bits (double)
+ *			2	64  bits (extended)
+ *			3	113 bits (quad)
+ *
+ *	ipio2[]
+ *		integer array, contains the (24*i)-th to (24*i+23)-th 
+ *		bit of 2/pi after binary point. The corresponding 
+ *		floating value is
+ *
+ *			ipio2[i] * 2^(-24(i+1)).
+ *
+ * External function:
+ *	double scalbn(), floor();
+ *
+ *
+ * Here is the description of some local variables:
+ *
+ * 	jk	jk+1 is the initial number of terms of ipio2[] needed
+ *		in the computation. The recommended value is 2,3,4,
+ *		6 for single, double, extended,and quad.
+ *
+ * 	jz	local integer variable indicating the number of 
+ *		terms of ipio2[] used. 
+ *
+ *	jx	nx - 1
+ *
+ *	jv	index for pointing to the suitable ipio2[] for the
+ *		computation. In general, we want
+ *			( 2^e0*x[0] * ipio2[jv-1]*2^(-24jv) )/8
+ *		is an integer. Thus
+ *			e0-3-24*jv >= 0 or (e0-3)/24 >= jv
+ *		Hence jv = max(0,(e0-3)/24).
+ *
+ *	jp	jp+1 is the number of terms in PIo2[] needed, jp = jk.
+ *
+ * 	q[]	double array with integral value, representing the
+ *		24-bits chunk of the product of x and 2/pi.
+ *
+ *	q0	the corresponding exponent of q[0]. Note that the
+ *		exponent for q[i] would be q0-24*i.
+ *
+ *	PIo2[]	double precision array, obtained by cutting pi/2
+ *		into 24 bits chunks. 
+ *
+ *	f[]	ipio2[] in floating point 
+ *
+ *	iq[]	integer array by breaking up q[] in 24-bits chunk.
+ *
+ *	fq[]	final product of x*(2/pi) in fq[0],..,fq[jk]
+ *
+ *	ih	integer. If >0 it indicates q[] is >= 0.5, hence
+ *		it also indicates the *sign* of the result.
+ *
+ */
+
+
+/*
+ * Constants:
+ * The hexadecimal values are the intended ones for the following 
+ * constants. The decimal values may be used, provided that the 
+ * compiler will convert from decimal to binary accurately enough 
+ * to produce the hexadecimal values shown.
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const int init_jk[] = {2,3,4,6}; /* initial value for jk */
+#else
+static int init_jk[] = {2,3,4,6}; 
+#endif
+
+#ifdef __STDC__
+static const double PIo2[] = {
+#else
+static double PIo2[] = {
+#endif
+  1.57079625129699707031e+00, /* 0x3FF921FB, 0x40000000 */
+  7.54978941586159635335e-08, /* 0x3E74442D, 0x00000000 */
+  5.39030252995776476554e-15, /* 0x3CF84698, 0x80000000 */
+  3.28200341580791294123e-22, /* 0x3B78CC51, 0x60000000 */
+  1.27065575308067607349e-29, /* 0x39F01B83, 0x80000000 */
+  1.22933308981111328932e-36, /* 0x387A2520, 0x40000000 */
+  2.73370053816464559624e-44, /* 0x36E38222, 0x80000000 */
+  2.16741683877804819444e-51, /* 0x3569F31D, 0x00000000 */
+};
+
+#ifdef __STDC__
+static const double			
+#else
+static double			
+#endif
+zero   = 0.0,
+one    = 1.0,
+two24   =  1.67772160000000000000e+07, /* 0x41700000, 0x00000000 */
+twon24  =  5.96046447753906250000e-08; /* 0x3E700000, 0x00000000 */
+
+#ifdef __STDC__
+	int __kernel_rem_pio2(double *x, double *y, int e0, int nx, int prec, const int *ipio2) 
+#else
+	int __kernel_rem_pio2(x,y,e0,nx,prec,ipio2) 	
+	double x[], y[]; int e0,nx,prec; int ipio2[];
+#endif
+{
+	int jz,jx,jv,jp,jk,carry,n,iq[20],i,j,k,m,q0,ih;
+	double z,fw,f[20],fq[20],q[20];
+
+    /* initialize jk*/
+	jk = init_jk[prec];
+	jp = jk;
+
+    /* determine jx,jv,q0, note that 3>q0 */
+	jx =  nx-1;
+	jv = (e0-3)/24; if(jv<0) jv=0;
+	q0 =  e0-24*(jv+1);
+
+    /* set up f[0] to f[jx+jk] where f[jx+jk] = ipio2[jv+jk] */
+	j = jv-jx; m = jx+jk;
+	for(i=0;i<=m;i++,j++) f[i] = (j<0)? zero : (double) ipio2[j];
+
+    /* compute q[0],q[1],...q[jk] */
+	for (i=0;i<=jk;i++) {
+	    for(j=0,fw=0.0;j<=jx;j++) fw += x[j]*f[jx+i-j]; q[i] = fw;
+	}
+
+	jz = jk;
+recompute:
+    /* distill q[] into iq[] reversingly */
+	for(i=0,j=jz,z=q[jz];j>0;i++,j--) {
+	    fw    =  (double)((int)(twon24* z));
+	    iq[i] =  (int)(z-two24*fw);
+	    z     =  q[j-1]+fw;
+	}
+
+    /* compute n */
+	z  = fd_scalbn(z,q0);		/* actual value of z */
+	z -= 8.0*fd_floor(z*0.125);		/* trim off integer >= 8 */
+	n  = (int) z;
+	z -= (double)n;
+	ih = 0;
+	if(q0>0) {	/* need iq[jz-1] to determine n */
+	    i  = (iq[jz-1]>>(24-q0)); n += i;
+	    iq[jz-1] -= i<<(24-q0);
+	    ih = iq[jz-1]>>(23-q0);
+	} 
+	else if(q0==0) ih = iq[jz-1]>>23;
+	else if(z>=0.5) ih=2;
+
+	if(ih>0) {	/* q > 0.5 */
+	    n += 1; carry = 0;
+	    for(i=0;i<jz ;i++) {	/* compute 1-q */
+		j = iq[i];
+		if(carry==0) {
+		    if(j!=0) {
+			carry = 1; iq[i] = 0x1000000- j;
+		    }
+		} else  iq[i] = 0xffffff - j;
+	    }
+	    if(q0>0) {		/* rare case: chance is 1 in 12 */
+	        switch(q0) {
+	        case 1:
+	    	   iq[jz-1] &= 0x7fffff; break;
+	    	case 2:
+	    	   iq[jz-1] &= 0x3fffff; break;
+	        }
+	    }
+	    if(ih==2) {
+		z = one - z;
+		if(carry!=0) z -= fd_scalbn(one,q0);
+	    }
+	}
+
+    /* check if recomputation is needed */
+	if(z==zero) {
+	    j = 0;
+	    for (i=jz-1;i>=jk;i--) j |= iq[i];
+	    if(j==0) { /* need recomputation */
+		for(k=1;iq[jk-k]==0;k++);   /* k = no. of terms needed */
+
+		for(i=jz+1;i<=jz+k;i++) {   /* add q[jz+1] to q[jz+k] */
+		    f[jx+i] = (double) ipio2[jv+i];
+		    for(j=0,fw=0.0;j<=jx;j++) fw += x[j]*f[jx+i-j];
+		    q[i] = fw;
+		}
+		jz += k;
+		goto recompute;
+	    }
+	}
+
+    /* chop off zero terms */
+	if(z==0.0) {
+	    jz -= 1; q0 -= 24;
+	    while(iq[jz]==0) { jz--; q0-=24;}
+	} else { /* break z into 24-bit if necessary */
+	    z = fd_scalbn(z,-q0);
+	    if(z>=two24) { 
+		fw = (double)((int)(twon24*z));
+		iq[jz] = (int)(z-two24*fw);
+		jz += 1; q0 += 24;
+		iq[jz] = (int) fw;
+	    } else iq[jz] = (int) z ;
+	}
+
+    /* convert integer "bit" chunk to floating-point value */
+	fw = fd_scalbn(one,q0);
+	for(i=jz;i>=0;i--) {
+	    q[i] = fw*(double)iq[i]; fw*=twon24;
+	}
+
+    /* compute PIo2[0,...,jp]*q[jz,...,0] */
+	for(i=jz;i>=0;i--) {
+	    for(fw=0.0,k=0;k<=jp&&k<=jz-i;k++) fw += PIo2[k]*q[i+k];
+	    fq[jz-i] = fw;
+	}
+
+    /* compress fq[] into y[] */
+	switch(prec) {
+	    case 0:
+		fw = 0.0;
+		for (i=jz;i>=0;i--) fw += fq[i];
+		y[0] = (ih==0)? fw: -fw; 
+		break;
+	    case 1:
+	    case 2:
+		fw = 0.0;
+		for (i=jz;i>=0;i--) fw += fq[i]; 
+		y[0] = (ih==0)? fw: -fw; 
+		fw = fq[0]-fw;
+		for (i=1;i<=jz;i++) fw += fq[i];
+		y[1] = (ih==0)? fw: -fw; 
+		break;
+	    case 3:	/* painful */
+		for (i=jz;i>0;i--) {
+		    fw      = fq[i-1]+fq[i]; 
+		    fq[i]  += fq[i-1]-fw;
+		    fq[i-1] = fw;
+		}
+		for (i=jz;i>1;i--) {
+		    fw      = fq[i-1]+fq[i]; 
+		    fq[i]  += fq[i-1]-fw;
+		    fq[i-1] = fw;
+		}
+		for (fw=0.0,i=jz;i>=2;i--) fw += fq[i]; 
+		if(ih==0) {
+		    y[0] =  fq[0]; y[1] =  fq[1]; y[2] =  fw;
+		} else {
+		    y[0] = -fq[0]; y[1] = -fq[1]; y[2] = -fw;
+		}
+	}
+	return n&7;
+}

mozilla/js/src/fdlibm/k_sin.c

@@ -0,0 +1,107 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public
+ * License Version 1.1 (the "License"); you may not use this file
+ * except in compliance with the License. You may obtain a copy of
+ * the License at http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the License is distributed on an "AS
+ * IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+ * implied. See the License for the specific language governing
+ * rights and limitations under the License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is Sun Microsystems,
+ * Inc.  Portions created by Netscape are
+ * Copyright (C) 1998 Netscape Communications Corporation. All
+ * Rights Reserved.
+ *
+ * Contributor(s): 
+ *
+ * Alternatively, the contents of this file may be used under the
+ * terms of the GNU Public License (the "GPL"), in which case the
+ * provisions of the GPL are applicable instead of those above.
+ * If you wish to allow use of your version of this file only
+ * under the terms of the GPL and not to allow others to use your
+ * version of this file under the NPL, indicate your decision by
+ * deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL.  If you do not delete
+ * the provisions above, a recipient may use your version of this
+ * file under either the NPL or the GPL.
+ */
+
+/* @(#)k_sin.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* __kernel_sin( x, y, iy)
+ * kernel sin function on [-pi/4, pi/4], pi/4 ~ 0.7854
+ * Input x is assumed to be bounded by ~pi/4 in magnitude.
+ * Input y is the tail of x.
+ * Input iy indicates whether y is 0. (if iy=0, y assume to be 0). 
+ *
+ * Algorithm
+ *	1. Since sin(-x) = -sin(x), we need only to consider positive x. 
+ *	2. if x < 2^-27 (hx<0x3e400000 0), return x with inexact if x!=0.
+ *	3. sin(x) is approximated by a polynomial of degree 13 on
+ *	   [0,pi/4]
+ *		  	         3            13
+ *	   	sin(x) ~ x + S1*x + ... + S6*x
+ *	   where
+ *	
+ * 	|sin(x)         2     4     6     8     10     12  |     -58
+ * 	|----- - (1+S1*x +S2*x +S3*x +S4*x +S5*x  +S6*x   )| <= 2
+ * 	|  x 					           | 
+ * 
+ *	4. sin(x+y) = sin(x) + sin'(x')*y
+ *		    ~ sin(x) + (1-x*x/2)*y
+ *	   For better accuracy, let 
+ *		     3      2      2      2      2
+ *		r = x *(S2+x *(S3+x *(S4+x *(S5+x *S6))))
+ *	   then                   3    2
+ *		sin(x) = x + (S1*x + (x *(r-y/2)+y))
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double 
+#else
+static double 
+#endif
+half =  5.00000000000000000000e-01, /* 0x3FE00000, 0x00000000 */
+S1  = -1.66666666666666324348e-01, /* 0xBFC55555, 0x55555549 */
+S2  =  8.33333333332248946124e-03, /* 0x3F811111, 0x1110F8A6 */
+S3  = -1.98412698298579493134e-04, /* 0xBF2A01A0, 0x19C161D5 */
+S4  =  2.75573137070700676789e-06, /* 0x3EC71DE3, 0x57B1FE7D */
+S5  = -2.50507602534068634195e-08, /* 0xBE5AE5E6, 0x8A2B9CEB */
+S6  =  1.58969099521155010221e-10; /* 0x3DE5D93A, 0x5ACFD57C */
+
+#ifdef __STDC__
+	double __kernel_sin(double x, double y, int iy)
+#else
+	double __kernel_sin(x, y, iy)
+	double x,y; int iy;		/* iy=0 if y is zero */
+#endif
+{
+	double z,r,v;
+	int ix;
+	ix = __HI(x)&0x7fffffff;	/* high word of x */
+	if(ix<0x3e400000)			/* |x| < 2**-27 */
+	   {if((int)x==0) return x;}		/* generate inexact */
+	z	=  x*x;
+	v	=  z*x;
+	r	=  S2+z*(S3+z*(S4+z*(S5+z*S6)));
+	if(iy==0) return x+v*(S1+z*r);
+	else      return x-((z*(half*y-v*r)-y)-v*S1);
+}

mozilla/js/src/fdlibm/k_standard.c

@@ -0,0 +1,775 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public
+ * License Version 1.1 (the "License"); you may not use this file
+ * except in compliance with the License. You may obtain a copy of
+ * the License at http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the License is distributed on an "AS
+ * IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+ * implied. See the License for the specific language governing
+ * rights and limitations under the License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is Sun Microsystems,
+ * Inc.  Portions created by Netscape are
+ * Copyright (C) 1998 Netscape Communications Corporation. All
+ * Rights Reserved.
+ *
+ * Contributor(s): 
+ *
+ * Alternatively, the contents of this file may be used under the
+ * terms of the GNU Public License (the "GPL"), in which case the
+ * provisions of the GPL are applicable instead of those above.
+ * If you wish to allow use of your version of this file only
+ * under the terms of the GPL and not to allow others to use your
+ * version of this file under the NPL, indicate your decision by
+ * deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL.  If you do not delete
+ * the provisions above, a recipient may use your version of this
+ * file under either the NPL or the GPL.
+ */
+
+/* @(#)k_standard.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ *
+ */
+
+#include "fdlibm.h"
+
+/* XXX ugly hack to get msvc to link without error. */
+#if _LIB_VERSION == _IEEE_ && !defined(RHAPSODY)
+   int errno;
+#  define EDOM 0
+#  define ERANGE 0
+#else
+#  include <errno.h>
+#endif
+
+
+#ifndef _USE_WRITE
+#include <stdio.h>			/* fputs(), stderr */
+#define	WRITE2(u,v)	fputs(u, stderr)
+#else	/* !defined(_USE_WRITE) */
+#include <unistd.h>			/* write */
+#define	WRITE2(u,v)	write(2, u, v)
+#undef fflush
+#endif	/* !defined(_USE_WRITE) */
+
+static double zero = 0.0;	/* used as const */
+
+/* 
+ * Standard conformance (non-IEEE) on exception cases.
+ * Mapping:
+ *	1 -- acos(|x|>1)
+ *	2 -- asin(|x|>1)
+ *	3 -- atan2(+-0,+-0)
+ *	4 -- hypot overflow
+ *	5 -- cosh overflow
+ *	6 -- exp overflow
+ *	7 -- exp underflow
+ *	8 -- y0(0)
+ *	9 -- y0(-ve)
+ *	10-- y1(0)
+ *	11-- y1(-ve)
+ *	12-- yn(0)
+ *	13-- yn(-ve)
+ *	14-- lgamma(finite) overflow
+ *	15-- lgamma(-integer)
+ *	16-- log(0)
+ *	17-- log(x<0)
+ *	18-- log10(0)
+ *	19-- log10(x<0)
+ *	20-- pow(0.0,0.0)
+ *	21-- pow(x,y) overflow
+ *	22-- pow(x,y) underflow
+ *	23-- pow(0,negative) 
+ *	24-- pow(neg,non-integral)
+ *	25-- sinh(finite) overflow
+ *	26-- sqrt(negative)
+ *      27-- fmod(x,0)
+ *      28-- remainder(x,0)
+ *	29-- acosh(x<1)
+ *	30-- atanh(|x|>1)
+ *	31-- atanh(|x|=1)
+ *	32-- scalb overflow
+ *	33-- scalb underflow
+ *	34-- j0(|x|>X_TLOSS)
+ *	35-- y0(x>X_TLOSS)
+ *	36-- j1(|x|>X_TLOSS)
+ *	37-- y1(x>X_TLOSS)
+ *	38-- jn(|x|>X_TLOSS, n)
+ *	39-- yn(x>X_TLOSS, n)
+ *	40-- gamma(finite) overflow
+ *	41-- gamma(-integer)
+ *	42-- pow(NaN,0.0)
+ */
+
+
+#ifdef __STDC__
+	double __kernel_standard(double x, double y, int type) 
+#else
+	double __kernel_standard(x,y,type) 
+	double x,y; int type;
+#endif
+{
+	struct exception exc;
+#ifndef HUGE_VAL	/* this is the only routine that uses HUGE_VAL */ 
+#define HUGE_VAL inf
+	double inf = 0.0;
+
+	__HI(inf) = 0x7ff00000;	/* set inf to infinite */
+#endif
+
+#ifdef _USE_WRITE
+	(void) fflush(stdout);
+#endif
+	exc.arg1 = x;
+	exc.arg2 = y;
+	switch(type) {
+	    case 1:
+		/* acos(|x|>1) */
+		exc.type = DOMAIN;
+		exc.name = "acos";
+		exc.retval = zero;
+		if (_LIB_VERSION == _POSIX_)
+		  errno = EDOM;
+		else if (!fd_matherr(&exc)) {
+		  if(_LIB_VERSION == _SVID_) {
+		    (void) WRITE2("acos: DOMAIN error\n", 19);
+		  }
+		  errno = EDOM;
+		}
+		break;
+	    case 2:
+		/* asin(|x|>1) */
+		exc.type = DOMAIN;
+		exc.name = "asin";
+		exc.retval = zero;
+		if(_LIB_VERSION == _POSIX_)
+		  errno = EDOM;
+		else if (!fd_matherr(&exc)) {
+		  if(_LIB_VERSION == _SVID_) {
+		    	(void) WRITE2("asin: DOMAIN error\n", 19);
+		  }
+		  errno = EDOM;
+		}
+		break;
+	    case 3:
+		/* atan2(+-0,+-0) */
+		exc.arg1 = y;
+		exc.arg2 = x;
+		exc.type = DOMAIN;
+		exc.name = "atan2";
+		exc.retval = zero;
+		if(_LIB_VERSION == _POSIX_)
+		  errno = EDOM;
+		else if (!fd_matherr(&exc)) {
+		  if(_LIB_VERSION == _SVID_) {
+			(void) WRITE2("atan2: DOMAIN error\n", 20);
+		      }
+		  errno = EDOM;
+		}
+		break;
+	    case 4:
+		/* hypot(finite,finite) overflow */
+		exc.type = OVERFLOW;
+		exc.name = "hypot";
+		if (_LIB_VERSION == _SVID_)
+		  exc.retval = HUGE;
+		else
+		  exc.retval = HUGE_VAL;
+		if (_LIB_VERSION == _POSIX_)
+		  errno = ERANGE;
+		else if (!fd_matherr(&exc)) {
+			errno = ERANGE;
+		}
+		break;
+	    case 5:
+		/* cosh(finite) overflow */
+		exc.type = OVERFLOW;
+		exc.name = "cosh";
+		if (_LIB_VERSION == _SVID_)
+		  exc.retval = HUGE;
+		else
+		  exc.retval = HUGE_VAL;
+		if (_LIB_VERSION == _POSIX_)
+		  errno = ERANGE;
+		else if (!fd_matherr(&exc)) {
+			errno = ERANGE;
+		}
+		break;
+	    case 6:
+		/* exp(finite) overflow */
+		exc.type = OVERFLOW;
+		exc.name = "exp";
+		if (_LIB_VERSION == _SVID_)
+		  exc.retval = HUGE;
+		else
+		  exc.retval = HUGE_VAL;
+		if (_LIB_VERSION == _POSIX_)
+		  errno = ERANGE;
+		else if (!fd_matherr(&exc)) {
+			errno = ERANGE;
+		}
+		break;
+	    case 7:
+		/* exp(finite) underflow */
+		exc.type = UNDERFLOW;
+		exc.name = "exp";
+		exc.retval = zero;
+		if (_LIB_VERSION == _POSIX_)
+		  errno = ERANGE;
+		else if (!fd_matherr(&exc)) {
+			errno = ERANGE;
+		}
+		break;
+	    case 8:
+		/* y0(0) = -inf */
+		exc.type = DOMAIN;	/* should be SING for IEEE */
+		exc.name = "y0";
+		if (_LIB_VERSION == _SVID_)
+		  exc.retval = -HUGE;
+		else
+		  exc.retval = -HUGE_VAL;
+		if (_LIB_VERSION == _POSIX_)
+		  errno = EDOM;
+		else if (!fd_matherr(&exc)) {
+		  if (_LIB_VERSION == _SVID_) {
+			(void) WRITE2("y0: DOMAIN error\n", 17);
+		      }
+		  errno = EDOM;
+		}
+		break;
+	    case 9:
+		/* y0(x<0) = NaN */
+		exc.type = DOMAIN;
+		exc.name = "y0";
+		if (_LIB_VERSION == _SVID_)
+		  exc.retval = -HUGE;
+		else
+		  exc.retval = -HUGE_VAL;
+		if (_LIB_VERSION == _POSIX_)
+		  errno = EDOM;
+		else if (!fd_matherr(&exc)) {
+		  if (_LIB_VERSION == _SVID_) {
+			(void) WRITE2("y0: DOMAIN error\n", 17);
+		      }
+		  errno = EDOM;
+		}
+		break;
+	    case 10:
+		/* y1(0) = -inf */
+		exc.type = DOMAIN;	/* should be SING for IEEE */
+		exc.name = "y1";
+		if (_LIB_VERSION == _SVID_)
+		  exc.retval = -HUGE;
+		else
+		  exc.retval = -HUGE_VAL;
+		if (_LIB_VERSION == _POSIX_)
+		  errno = EDOM;
+		else if (!fd_matherr(&exc)) {
+		  if (_LIB_VERSION == _SVID_) {
+			(void) WRITE2("y1: DOMAIN error\n", 17);
+		      }
+		  errno = EDOM;
+		}
+		break;
+	    case 11:
+		/* y1(x<0) = NaN */
+		exc.type = DOMAIN;
+		exc.name = "y1";
+		if (_LIB_VERSION == _SVID_)
+		  exc.retval = -HUGE;
+		else
+		  exc.retval = -HUGE_VAL;
+		if (_LIB_VERSION == _POSIX_)
+		  errno = EDOM;
+		else if (!fd_matherr(&exc)) {
+		  if (_LIB_VERSION == _SVID_) {
+			(void) WRITE2("y1: DOMAIN error\n", 17);
+		      }
+		  errno = EDOM;
+		}
+		break;
+	    case 12:
+		/* yn(n,0) = -inf */
+		exc.type = DOMAIN;	/* should be SING for IEEE */
+		exc.name = "yn";
+		if (_LIB_VERSION == _SVID_)
+		  exc.retval = -HUGE;
+		else
+		  exc.retval = -HUGE_VAL;
+		if (_LIB_VERSION == _POSIX_)
+		  errno = EDOM;
+		else if (!fd_matherr(&exc)) {
+		  if (_LIB_VERSION == _SVID_) {
+			(void) WRITE2("yn: DOMAIN error\n", 17);
+		      }
+		  errno = EDOM;
+		}
+		break;
+	    case 13:
+		/* yn(x<0) = NaN */
+		exc.type = DOMAIN;
+		exc.name = "yn";
+		if (_LIB_VERSION == _SVID_)
+		  exc.retval = -HUGE;
+		else
+		  exc.retval = -HUGE_VAL;
+		if (_LIB_VERSION == _POSIX_)
+		  errno = EDOM;
+		else if (!fd_matherr(&exc)) {
+		  if (_LIB_VERSION == _SVID_) {
+			(void) WRITE2("yn: DOMAIN error\n", 17);
+		      }
+		  errno = EDOM;
+		}
+		break;
+	    case 14:
+		/* lgamma(finite) overflow */
+		exc.type = OVERFLOW;
+		exc.name = "lgamma";
+                if (_LIB_VERSION == _SVID_)
+                  exc.retval = HUGE;
+                else
+                  exc.retval = HUGE_VAL;
+                if (_LIB_VERSION == _POSIX_)
+			errno = ERANGE;
+                else if (!fd_matherr(&exc)) {
+                        errno = ERANGE;
+		}
+		break;
+	    case 15:
+		/* lgamma(-integer) or lgamma(0) */
+		exc.type = SING;
+		exc.name = "lgamma";
+                if (_LIB_VERSION == _SVID_)
+                  exc.retval = HUGE;
+                else
+                  exc.retval = HUGE_VAL;
+		if (_LIB_VERSION == _POSIX_)
+		  errno = EDOM;
+		else if (!fd_matherr(&exc)) {
+		  if (_LIB_VERSION == _SVID_) {
+			(void) WRITE2("lgamma: SING error\n", 19);
+		      }
+		  errno = EDOM;
+		}
+		break;
+	    case 16:
+		/* log(0) */
+		exc.type = SING;
+		exc.name = "log";
+		if (_LIB_VERSION == _SVID_)
+		  exc.retval = -HUGE;
+		else
+		  exc.retval = -HUGE_VAL;
+		if (_LIB_VERSION == _POSIX_)
+		  errno = ERANGE;
+		else if (!fd_matherr(&exc)) {
+		  if (_LIB_VERSION == _SVID_) {
+			(void) WRITE2("log: SING error\n", 16);
+		      }
+		  errno = EDOM;
+		}
+		break;
+	    case 17:
+		/* log(x<0) */
+		exc.type = DOMAIN;
+		exc.name = "log";
+		if (_LIB_VERSION == _SVID_)
+		  exc.retval = -HUGE;
+		else
+		  exc.retval = -HUGE_VAL;
+		if (_LIB_VERSION == _POSIX_)
+		  errno = EDOM;
+		else if (!fd_matherr(&exc)) {
+		  if (_LIB_VERSION == _SVID_) {
+			(void) WRITE2("log: DOMAIN error\n", 18);
+		      }
+		  errno = EDOM;
+		}
+		break;
+	    case 18:
+		/* log10(0) */
+		exc.type = SING;
+		exc.name = "log10";
+		if (_LIB_VERSION == _SVID_)
+		  exc.retval = -HUGE;
+		else
+		  exc.retval = -HUGE_VAL;
+		if (_LIB_VERSION == _POSIX_)
+		  errno = ERANGE;
+		else if (!fd_matherr(&exc)) {
+		  if (_LIB_VERSION == _SVID_) {
+			(void) WRITE2("log10: SING error\n", 18);
+		      }
+		  errno = EDOM;
+		}
+		break;
+	    case 19:
+		/* log10(x<0) */
+		exc.type = DOMAIN;
+		exc.name = "log10";
+		if (_LIB_VERSION == _SVID_)
+		  exc.retval = -HUGE;
+		else
+		  exc.retval = -HUGE_VAL;
+		if (_LIB_VERSION == _POSIX_)
+		  errno = EDOM;
+		else if (!fd_matherr(&exc)) {
+		  if (_LIB_VERSION == _SVID_) {
+			(void) WRITE2("log10: DOMAIN error\n", 20);
+		      }
+		  errno = EDOM;
+		}
+		break;
+	    case 20:
+		/* pow(0.0,0.0) */
+		/* error only if _LIB_VERSION == _SVID_ */
+		exc.type = DOMAIN;
+		exc.name = "pow";
+		exc.retval = zero;
+		if (_LIB_VERSION != _SVID_) exc.retval = 1.0;
+		else if (!fd_matherr(&exc)) {
+			(void) WRITE2("pow(0,0): DOMAIN error\n", 23);
+			errno = EDOM;
+		}
+		break;
+	    case 21:
+		/* pow(x,y) overflow */
+		exc.type = OVERFLOW;
+		exc.name = "pow";
+		if (_LIB_VERSION == _SVID_) {
+		  exc.retval = HUGE;
+		  y *= 0.5;
+		  if(x<zero&&fd_rint(y)!=y) exc.retval = -HUGE;
+		} else {
+		  exc.retval = HUGE_VAL;
+		  y *= 0.5;
+		  if(x<zero&&fd_rint(y)!=y) exc.retval = -HUGE_VAL;
+		}
+		if (_LIB_VERSION == _POSIX_)
+		  errno = ERANGE;
+		else if (!fd_matherr(&exc)) {
+			errno = ERANGE;
+		}
+		break;
+	    case 22:
+		/* pow(x,y) underflow */
+		exc.type = UNDERFLOW;
+		exc.name = "pow";
+		exc.retval =  zero;
+		if (_LIB_VERSION == _POSIX_)
+		  errno = ERANGE;
+		else if (!fd_matherr(&exc)) {
+			errno = ERANGE;
+		}
+		break;
+	    case 23:
+		/* 0**neg */
+		exc.type = DOMAIN;
+		exc.name = "pow";
+		if (_LIB_VERSION == _SVID_) 
+		  exc.retval = zero;
+		else
+		  exc.retval = -HUGE_VAL;
+		if (_LIB_VERSION == _POSIX_)
+		  errno = EDOM;
+		else if (!fd_matherr(&exc)) {
+		  if (_LIB_VERSION == _SVID_) {
+			(void) WRITE2("pow(0,neg): DOMAIN error\n", 25);
+		      }
+		  errno = EDOM;
+		}
+		break;
+	    case 24:
+		/* neg**non-integral */
+		exc.type = DOMAIN;
+		exc.name = "pow";
+		if (_LIB_VERSION == _SVID_) 
+		    exc.retval = zero;
+		else 
+		    exc.retval = zero/zero;	/* X/Open allow NaN */
+		if (_LIB_VERSION == _POSIX_) 
+		   errno = EDOM;
+		else if (!fd_matherr(&exc)) {
+		  if (_LIB_VERSION == _SVID_) {
+			(void) WRITE2("neg**non-integral: DOMAIN error\n", 32);
+		      }
+		  errno = EDOM;
+		}
+		break;
+	    case 25:
+		/* sinh(finite) overflow */
+		exc.type = OVERFLOW;
+		exc.name = "sinh";
+		if (_LIB_VERSION == _SVID_)
+		  exc.retval = ( (x>zero) ? HUGE : -HUGE);
+		else
+		  exc.retval = ( (x>zero) ? HUGE_VAL : -HUGE_VAL);
+		if (_LIB_VERSION == _POSIX_)
+		  errno = ERANGE;
+		else if (!fd_matherr(&exc)) {
+			errno = ERANGE;
+		}
+		break;
+	    case 26:
+		/* sqrt(x<0) */
+		exc.type = DOMAIN;
+		exc.name = "sqrt";
+		if (_LIB_VERSION == _SVID_)
+		  exc.retval = zero;
+		else
+		  exc.retval = zero/zero;
+		if (_LIB_VERSION == _POSIX_)
+		  errno = EDOM;
+		else if (!fd_matherr(&exc)) {
+		  if (_LIB_VERSION == _SVID_) {
+			(void) WRITE2("sqrt: DOMAIN error\n", 19);
+		      }
+		  errno = EDOM;
+		}
+		break;
+            case 27:
+                /* fmod(x,0) */
+                exc.type = DOMAIN;
+                exc.name = "fmod";
+                if (_LIB_VERSION == _SVID_)
+                    exc.retval = x;
+		else
+		    exc.retval = zero/zero;
+                if (_LIB_VERSION == _POSIX_)
+                  errno = EDOM;
+                else if (!fd_matherr(&exc)) {
+                  if (_LIB_VERSION == _SVID_) {
+                    (void) WRITE2("fmod:  DOMAIN error\n", 20);
+                  }
+                  errno = EDOM;
+                }
+                break;
+            case 28:
+                /* remainder(x,0) */
+                exc.type = DOMAIN;
+                exc.name = "remainder";
+                exc.retval = zero/zero;
+                if (_LIB_VERSION == _POSIX_)
+                  errno = EDOM;
+                else if (!fd_matherr(&exc)) {
+                  if (_LIB_VERSION == _SVID_) {
+                    (void) WRITE2("remainder: DOMAIN error\n", 24);
+                  }
+                  errno = EDOM;
+                }
+                break;
+            case 29:
+                /* acosh(x<1) */
+                exc.type = DOMAIN;
+                exc.name = "acosh";
+                exc.retval = zero/zero;
+                if (_LIB_VERSION == _POSIX_)
+                  errno = EDOM;
+                else if (!fd_matherr(&exc)) {
+                  if (_LIB_VERSION == _SVID_) {
+                    (void) WRITE2("acosh: DOMAIN error\n", 20);
+                  }
+                  errno = EDOM;
+                }
+                break;
+            case 30:
+                /* atanh(|x|>1) */
+                exc.type = DOMAIN;
+                exc.name = "atanh";
+                exc.retval = zero/zero;
+                if (_LIB_VERSION == _POSIX_)
+                  errno = EDOM;
+                else if (!fd_matherr(&exc)) {
+                  if (_LIB_VERSION == _SVID_) {
+                    (void) WRITE2("atanh: DOMAIN error\n", 20);
+                  }
+                  errno = EDOM;
+                }
+                break;
+            case 31:
+                /* atanh(|x|=1) */
+                exc.type = SING;
+                exc.name = "atanh";
+		exc.retval = x/zero;	/* sign(x)*inf */
+                if (_LIB_VERSION == _POSIX_)
+                  errno = EDOM;
+                else if (!fd_matherr(&exc)) {
+                  if (_LIB_VERSION == _SVID_) {
+                    (void) WRITE2("atanh: SING error\n", 18);
+                  }
+                  errno = EDOM;
+                }
+                break;
+	    case 32:
+		/* scalb overflow; SVID also returns +-HUGE_VAL */
+		exc.type = OVERFLOW;
+		exc.name = "scalb";
+		exc.retval = x > zero ? HUGE_VAL : -HUGE_VAL;
+		if (_LIB_VERSION == _POSIX_)
+		  errno = ERANGE;
+		else if (!fd_matherr(&exc)) {
+			errno = ERANGE;
+		}
+		break;
+	    case 33:
+		/* scalb underflow */
+		exc.type = UNDERFLOW;
+		exc.name = "scalb";
+		exc.retval = fd_copysign(zero,x);
+		if (_LIB_VERSION == _POSIX_)
+		  errno = ERANGE;
+		else if (!fd_matherr(&exc)) {
+			errno = ERANGE;
+		}
+		break;
+	    case 34:
+		/* j0(|x|>X_TLOSS) */
+                exc.type = TLOSS;
+                exc.name = "j0";
+                exc.retval = zero;
+                if (_LIB_VERSION == _POSIX_)
+                        errno = ERANGE;
+                else if (!fd_matherr(&exc)) {
+                        if (_LIB_VERSION == _SVID_) {
+                                (void) WRITE2(exc.name, 2);
+                                (void) WRITE2(": TLOSS error\n", 14);
+                        }
+                        errno = ERANGE;
+                }        
+		break;
+	    case 35:
+		/* y0(x>X_TLOSS) */
+                exc.type = TLOSS;
+                exc.name = "y0";
+                exc.retval = zero;
+                if (_LIB_VERSION == _POSIX_)
+                        errno = ERANGE;
+                else if (!fd_matherr(&exc)) {
+                        if (_LIB_VERSION == _SVID_) {
+                                (void) WRITE2(exc.name, 2);
+                                (void) WRITE2(": TLOSS error\n", 14);
+                        }
+                        errno = ERANGE;
+                }        
+		break;
+	    case 36:
+		/* j1(|x|>X_TLOSS) */
+                exc.type = TLOSS;
+                exc.name = "j1";
+                exc.retval = zero;
+                if (_LIB_VERSION == _POSIX_)
+                        errno = ERANGE;
+                else if (!fd_matherr(&exc)) {
+                        if (_LIB_VERSION == _SVID_) {
+                                (void) WRITE2(exc.name, 2);
+                                (void) WRITE2(": TLOSS error\n", 14);
+                        }
+                        errno = ERANGE;
+                }        
+		break;
+	    case 37:
+		/* y1(x>X_TLOSS) */
+                exc.type = TLOSS;
+                exc.name = "y1";
+                exc.retval = zero;
+                if (_LIB_VERSION == _POSIX_)
+                        errno = ERANGE;
+                else if (!fd_matherr(&exc)) {
+                        if (_LIB_VERSION == _SVID_) {
+                                (void) WRITE2(exc.name, 2);
+                                (void) WRITE2(": TLOSS error\n", 14);
+                        }
+                        errno = ERANGE;
+                }        
+		break;
+	    case 38:
+		/* jn(|x|>X_TLOSS) */
+                exc.type = TLOSS;
+                exc.name = "jn";
+                exc.retval = zero;
+                if (_LIB_VERSION == _POSIX_)
+                        errno = ERANGE;
+                else if (!fd_matherr(&exc)) {
+                        if (_LIB_VERSION == _SVID_) {
+                                (void) WRITE2(exc.name, 2);
+                                (void) WRITE2(": TLOSS error\n", 14);
+                        }
+                        errno = ERANGE;
+                }        
+		break;
+	    case 39:
+		/* yn(x>X_TLOSS) */
+                exc.type = TLOSS;
+                exc.name = "yn";
+                exc.retval = zero;
+                if (_LIB_VERSION == _POSIX_)
+                        errno = ERANGE;
+                else if (!fd_matherr(&exc)) {
+                        if (_LIB_VERSION == _SVID_) {
+                                (void) WRITE2(exc.name, 2);
+                                (void) WRITE2(": TLOSS error\n", 14);
+                        }
+                        errno = ERANGE;
+                }        
+		break;
+	    case 40:
+		/* gamma(finite) overflow */
+		exc.type = OVERFLOW;
+		exc.name = "gamma";
+                if (_LIB_VERSION == _SVID_)
+                  exc.retval = HUGE;
+                else
+                  exc.retval = HUGE_VAL;
+                if (_LIB_VERSION == _POSIX_)
+		  errno = ERANGE;
+                else if (!fd_matherr(&exc)) {
+                  errno = ERANGE;
+                }
+		break;
+	    case 41:
+		/* gamma(-integer) or gamma(0) */
+		exc.type = SING;
+		exc.name = "gamma";
+                if (_LIB_VERSION == _SVID_)
+                  exc.retval = HUGE;
+                else
+                  exc.retval = HUGE_VAL;
+		if (_LIB_VERSION == _POSIX_)
+		  errno = EDOM;
+		else if (!fd_matherr(&exc)) {
+		  if (_LIB_VERSION == _SVID_) {
+			(void) WRITE2("gamma: SING error\n", 18);
+		      }
+		  errno = EDOM;
+		}
+		break;
+	    case 42:
+		/* pow(NaN,0.0) */
+		/* error only if _LIB_VERSION == _SVID_ & _XOPEN_ */
+		exc.type = DOMAIN;
+		exc.name = "pow";
+		exc.retval = x;
+		if (_LIB_VERSION == _IEEE_ ||
+		    _LIB_VERSION == _POSIX_) exc.retval = 1.0;
+		else if (!fd_matherr(&exc)) {
+			errno = EDOM;
+		}
+		break;
+	}
+	return exc.retval; 
+}

mozilla/js/src/fdlibm/k_tan.c

@@ -0,0 +1,158 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public
+ * License Version 1.1 (the "License"); you may not use this file
+ * except in compliance with the License. You may obtain a copy of
+ * the License at http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the License is distributed on an "AS
+ * IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+ * implied. See the License for the specific language governing
+ * rights and limitations under the License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is Sun Microsystems,
+ * Inc.  Portions created by Netscape are
+ * Copyright (C) 1998 Netscape Communications Corporation. All
+ * Rights Reserved.
+ *
+ * Contributor(s): 
+ *
+ * Alternatively, the contents of this file may be used under the
+ * terms of the GNU Public License (the "GPL"), in which case the
+ * provisions of the GPL are applicable instead of those above.
+ * If you wish to allow use of your version of this file only
+ * under the terms of the GPL and not to allow others to use your
+ * version of this file under the NPL, indicate your decision by
+ * deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL.  If you do not delete
+ * the provisions above, a recipient may use your version of this
+ * file under either the NPL or the GPL.
+ */
+
+/* @(#)k_tan.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* __kernel_tan( x, y, k )
+ * kernel tan function on [-pi/4, pi/4], pi/4 ~ 0.7854
+ * Input x is assumed to be bounded by ~pi/4 in magnitude.
+ * Input y is the tail of x.
+ * Input k indicates whether tan (if k=1) or 
+ * -1/tan (if k= -1) is returned.
+ *
+ * Algorithm
+ *	1. Since tan(-x) = -tan(x), we need only to consider positive x. 
+ *	2. if x < 2^-28 (hx<0x3e300000 0), return x with inexact if x!=0.
+ *	3. tan(x) is approximated by a odd polynomial of degree 27 on
+ *	   [0,0.67434]
+ *		  	         3             27
+ *	   	tan(x) ~ x + T1*x + ... + T13*x
+ *	   where
+ *	
+ * 	        |tan(x)         2     4            26   |     -59.2
+ * 	        |----- - (1+T1*x +T2*x +.... +T13*x    )| <= 2
+ * 	        |  x 					| 
+ * 
+ *	   Note: tan(x+y) = tan(x) + tan'(x)*y
+ *		          ~ tan(x) + (1+x*x)*y
+ *	   Therefore, for better accuracy in computing tan(x+y), let 
+ *		     3      2      2       2       2
+ *		r = x *(T2+x *(T3+x *(...+x *(T12+x *T13))))
+ *	   then
+ *		 		    3    2
+ *		tan(x+y) = x + (T1*x + (x *(r+y)+y))
+ *
+ *      4. For x in [0.67434,pi/4],  let y = pi/4 - x, then
+ *		tan(x) = tan(pi/4-y) = (1-tan(y))/(1+tan(y))
+ *		       = 1 - 2*(tan(y) - (tan(y)^2)/(1+tan(y)))
+ */
+
+#include "fdlibm.h"
+#ifdef __STDC__
+static const double 
+#else
+static double 
+#endif
+one   =  1.00000000000000000000e+00, /* 0x3FF00000, 0x00000000 */
+pio4  =  7.85398163397448278999e-01, /* 0x3FE921FB, 0x54442D18 */
+pio4lo=  3.06161699786838301793e-17, /* 0x3C81A626, 0x33145C07 */
+T[] =  {
+  3.33333333333334091986e-01, /* 0x3FD55555, 0x55555563 */
+  1.33333333333201242699e-01, /* 0x3FC11111, 0x1110FE7A */
+  5.39682539762260521377e-02, /* 0x3FABA1BA, 0x1BB341FE */
+  2.18694882948595424599e-02, /* 0x3F9664F4, 0x8406D637 */
+  8.86323982359930005737e-03, /* 0x3F8226E3, 0xE96E8493 */
+  3.59207910759131235356e-03, /* 0x3F6D6D22, 0xC9560328 */
+  1.45620945432529025516e-03, /* 0x3F57DBC8, 0xFEE08315 */
+  5.88041240820264096874e-04, /* 0x3F4344D8, 0xF2F26501 */
+  2.46463134818469906812e-04, /* 0x3F3026F7, 0x1A8D1068 */
+  7.81794442939557092300e-05, /* 0x3F147E88, 0xA03792A6 */
+  7.14072491382608190305e-05, /* 0x3F12B80F, 0x32F0A7E9 */
+ -1.85586374855275456654e-05, /* 0xBEF375CB, 0xDB605373 */
+  2.59073051863633712884e-05, /* 0x3EFB2A70, 0x74BF7AD4 */
+};
+
+#ifdef __STDC__
+	double __kernel_tan(double x, double y, int iy)
+#else
+	double __kernel_tan(x, y, iy)
+	double x,y; int iy;
+#endif
+{
+	double z,r,v,w,s;
+	int ix,hx;
+	hx = __HI(x);	/* high word of x */
+	ix = hx&0x7fffffff;	/* high word of |x| */
+	if(ix<0x3e300000)			/* x < 2**-28 */
+	    {if((int)x==0) {			/* generate inexact */
+		if(((ix|__LO(x))|(iy+1))==0) return one/fd_fabs(x);
+		else return (iy==1)? x: -one/x;
+	    }
+	    }
+	if(ix>=0x3FE59428) { 			/* |x|>=0.6744 */
+	    if(hx<0) {x = -x; y = -y;}
+	    z = pio4-x;
+	    w = pio4lo-y;
+	    x = z+w; y = 0.0;
+	}
+	z	=  x*x;
+	w 	=  z*z;
+    /* Break x^5*(T[1]+x^2*T[2]+...) into
+     *	  x^5(T[1]+x^4*T[3]+...+x^20*T[11]) +
+     *	  x^5(x^2*(T[2]+x^4*T[4]+...+x^22*[T12]))
+     */
+	r = T[1]+w*(T[3]+w*(T[5]+w*(T[7]+w*(T[9]+w*T[11]))));
+	v = z*(T[2]+w*(T[4]+w*(T[6]+w*(T[8]+w*(T[10]+w*T[12])))));
+	s = z*x;
+	r = y + z*(s*(r+v)+y);
+	r += T[0]*s;
+	w = x+r;
+	if(ix>=0x3FE59428) {
+	    v = (double)iy;
+	    return (double)(1-((hx>>30)&2))*(v-2.0*(x-(w*w/(w+v)-r)));
+	}
+	if(iy==1) return w;
+	else {		/* if allow error up to 2 ulp, 
+			   simply return -1.0/(x+r) here */
+     /*  compute -1.0/(x+r) accurately */
+	    double a,t;
+	    z  = w;
+	    __LO(z) = 0;
+	    v  = r-(z - x); 	/* z+v = r+x */
+	    t = a  = -1.0/w;	/* a = -1.0/w */
+	    __LO(t) = 0;
+	    s  = 1.0+t*z;
+	    return t+a*(s+t*v);
+	}
+}

mozilla/js/src/fdlibm/makefile.win

@@ -0,0 +1,96 @@
+#// The contents of this file are subject to the Netscape Public
+#// License Version 1.1 (the "License"); you may not use this file
+#// except in compliance with the License. You may obtain a copy of
+#// the License at http://www.mozilla.org/NPL/
+#//
+#// Software distributed under the License is distributed on an "AS
+#// IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+#// implied. See the License for the specific language governing
+#// rights and limitations under the License.
+#//
+#// The Original Code is Mozilla Communicator client code, released
+#// March 31, 1998.
+#//
+#// The Initial Developer of the Original Code is Netscape
+#// Communications Corporation.  Portions created by Netscape are
+#// Copyright (C) 1998 Netscape Communications Corporation. All
+#// Rights Reserved.
+#//
+#// Contributor(s): 
+#//
+#// Alternatively, the contents of this file may be used under the
+#// terms of the GNU Public License (the "GPL"), in which case the
+#// provisions of the GPL are applicable instead of those above.
+#// If you wish to allow use of your version of this file only
+#// under the terms of the GPL and not to allow others to use your
+#// version of this file under the NPL, indicate your decision by
+#// deleting the provisions above and replace them with the notice
+#// and other provisions required by the GPL.  If you do not delete
+#// the provisions above, a recipient may use your version of this
+#// file under either the NPL or the GPL.
+
+#//------------------------------------------------------------------------
+#//
+#// Specify the depth of the current directory relative to the
+#// root of NS
+#//
+#//------------------------------------------------------------------------
+DEPTH=..\..\..
+include <$(DEPTH)\config\config.mak>
+
+#//------------------------------------------------------------------------
+#//
+#// Define any Public Make Variables here: (ie. PDFFILE, MAPFILE, ...)
+#//
+#//------------------------------------------------------------------------
+
+LIBRARY_NAME			= fdlibm
+
+#//------------------------------------------------------------------------
+#// 
+#// Define the files necessary to build the target (ie. OBJS)
+#//
+#//------------------------------------------------------------------------
+OBJS =		\
+	.\$(OBJDIR)\e_atan2.obj		\
+	.\$(OBJDIR)\e_pow.obj		\
+	.\$(OBJDIR)\e_sqrt.obj		\
+	.\$(OBJDIR)\k_standard.obj	\
+	.\$(OBJDIR)\s_atan.obj		\
+	.\$(OBJDIR)\s_copysign.obj	\
+	.\$(OBJDIR)\s_fabs.obj		\
+	.\$(OBJDIR)\s_finite.obj	\
+	.\$(OBJDIR)\s_isnan.obj		\
+	.\$(OBJDIR)\s_matherr.obj	\
+	.\$(OBJDIR)\s_rint.obj		\
+	.\$(OBJDIR)\s_scalbn.obj	\
+	.\$(OBJDIR)\w_atan2.obj		\
+	.\$(OBJDIR)\w_pow.obj		\
+	.\$(OBJDIR)\w_sqrt.obj		\
+	.\$(OBJDIR)\s_lib_version.obj	\
+	$(NULL)
+
+#//------------------------------------------------------------------------
+#//
+#// Include the common makefile rules
+#//
+#//------------------------------------------------------------------------
+include <$(DEPTH)\config\rules.mak>
+
+export:: $(LIBRARY)
+
+#//------------------------------------------------------------------------
+#//
+#// Standalone js.exe interpreter
+#//
+#//------------------------------------------------------------------------
+
+#//PROGRAM = $(OBJDIR)\js.exe
+#//js:	$(PROGRAM)
+#//
+#//$(PROGRAM): $(OBJDIR)\js.obj $(LIBRARY)
+#//	    @$(MAKE_OBJDIR)
+#//	    $(link) /debug /out:$(PROGRAM) $(OBJDIR)\js.obj $(DIST)\lib\pr3240.lib $(LIBRARY) $(LDFLAGS)
+#//
+#//$(OBJDIR)\js.obj: js.c
+#//		$(CC) /Fo$(OBJDIR)\js.obj js.c $(CFLAGS) -DJSFILE

mozilla/js/src/fdlibm/s_asinh.c

@@ -0,0 +1,94 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public
+ * License Version 1.1 (the "License"); you may not use this file
+ * except in compliance with the License. You may obtain a copy of
+ * the License at http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the License is distributed on an "AS
+ * IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+ * implied. See the License for the specific language governing
+ * rights and limitations under the License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is Sun Microsystems,
+ * Inc.  Portions created by Netscape are
+ * Copyright (C) 1998 Netscape Communications Corporation. All
+ * Rights Reserved.
+ *
+ * Contributor(s): 
+ *
+ * Alternatively, the contents of this file may be used under the
+ * terms of the GNU Public License (the "GPL"), in which case the
+ * provisions of the GPL are applicable instead of those above.
+ * If you wish to allow use of your version of this file only
+ * under the terms of the GPL and not to allow others to use your
+ * version of this file under the NPL, indicate your decision by
+ * deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL.  If you do not delete
+ * the provisions above, a recipient may use your version of this
+ * file under either the NPL or the GPL.
+ */
+
+/* @(#)s_asinh.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* asinh(x)
+ * Method :
+ *	Based on 
+ *		asinh(x) = sign(x) * log [ |x| + sqrt(x*x+1) ]
+ *	we have
+ *	asinh(x) := x  if  1+x*x=1,
+ *		 := sign(x)*(log(x)+ln2)) for large |x|, else
+ *		 := sign(x)*log(2|x|+1/(|x|+sqrt(x*x+1))) if|x|>2, else
+ *		 := sign(x)*log1p(|x| + x^2/(1 + sqrt(1+x^2)))  
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double 
+#else
+static double 
+#endif
+one =  1.00000000000000000000e+00, /* 0x3FF00000, 0x00000000 */
+ln2 =  6.93147180559945286227e-01, /* 0x3FE62E42, 0xFEFA39EF */
+really_big=  1.00000000000000000000e+300; 
+
+#ifdef __STDC__
+	double fd_asinh(double x)
+#else
+	double fd_asinh(x)
+	double x;
+#endif
+{	
+	double t,w;
+	int hx,ix;
+	hx = __HI(x);
+	ix = hx&0x7fffffff;
+	if(ix>=0x7ff00000) return x+x;	/* x is inf or NaN */
+	if(ix< 0x3e300000) {	/* |x|<2**-28 */
+	    if(really_big+x>one) return x;	/* return x inexact except 0 */
+	} 
+	if(ix>0x41b00000) {	/* |x| > 2**28 */
+	    w = __ieee754_log(fd_fabs(x))+ln2;
+	} else if (ix>0x40000000) {	/* 2**28 > |x| > 2.0 */
+	    t = fd_fabs(x);
+	    w = __ieee754_log(2.0*t+one/(fd_sqrt(x*x+one)+t));
+	} else {		/* 2.0 > |x| > 2**-28 */
+	    t = x*x;
+	    w =fd_log1p(fd_fabs(x)+t/(one+fd_sqrt(one+t)));
+	}
+	if(hx>0) return w; else return -w;
+}

mozilla/js/src/fdlibm/s_atan.c

@@ -0,0 +1,167 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public
+ * License Version 1.1 (the "License"); you may not use this file
+ * except in compliance with the License. You may obtain a copy of
+ * the License at http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the License is distributed on an "AS
+ * IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+ * implied. See the License for the specific language governing
+ * rights and limitations under the License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is Sun Microsystems,
+ * Inc.  Portions created by Netscape are
+ * Copyright (C) 1998 Netscape Communications Corporation. All
+ * Rights Reserved.
+ *
+ * Contributor(s): 
+ *
+ * Alternatively, the contents of this file may be used under the
+ * terms of the GNU Public License (the "GPL"), in which case the
+ * provisions of the GPL are applicable instead of those above.
+ * If you wish to allow use of your version of this file only
+ * under the terms of the GPL and not to allow others to use your
+ * version of this file under the NPL, indicate your decision by
+ * deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL.  If you do not delete
+ * the provisions above, a recipient may use your version of this
+ * file under either the NPL or the GPL.
+ */
+
+/* @(#)s_atan.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ *
+ */
+
+/* atan(x)
+ * Method
+ *   1. Reduce x to positive by atan(x) = -atan(-x).
+ *   2. According to the integer k=4t+0.25 chopped, t=x, the argument
+ *      is further reduced to one of the following intervals and the
+ *      arctangent of t is evaluated by the corresponding formula:
+ *
+ *      [0,7/16]      atan(x) = t-t^3*(a1+t^2*(a2+...(a10+t^2*a11)...)
+ *      [7/16,11/16]  atan(x) = atan(1/2) + atan( (t-0.5)/(1+t/2) )
+ *      [11/16.19/16] atan(x) = atan( 1 ) + atan( (t-1)/(1+t) )
+ *      [19/16,39/16] atan(x) = atan(3/2) + atan( (t-1.5)/(1+1.5t) )
+ *      [39/16,INF]   atan(x) = atan(INF) + atan( -1/t )
+ *
+ * Constants:
+ * The hexadecimal values are the intended ones for the following 
+ * constants. The decimal values may be used, provided that the 
+ * compiler will convert from decimal to binary accurately enough 
+ * to produce the hexadecimal values shown.
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double atanhi[] = {
+#else
+static double atanhi[] = {
+#endif
+  4.63647609000806093515e-01, /* atan(0.5)hi 0x3FDDAC67, 0x0561BB4F */
+  7.85398163397448278999e-01, /* atan(1.0)hi 0x3FE921FB, 0x54442D18 */
+  9.82793723247329054082e-01, /* atan(1.5)hi 0x3FEF730B, 0xD281F69B */
+  1.57079632679489655800e+00, /* atan(inf)hi 0x3FF921FB, 0x54442D18 */
+};
+
+#ifdef __STDC__
+static const double atanlo[] = {
+#else
+static double atanlo[] = {
+#endif
+  2.26987774529616870924e-17, /* atan(0.5)lo 0x3C7A2B7F, 0x222F65E2 */
+  3.06161699786838301793e-17, /* atan(1.0)lo 0x3C81A626, 0x33145C07 */
+  1.39033110312309984516e-17, /* atan(1.5)lo 0x3C700788, 0x7AF0CBBD */
+  6.12323399573676603587e-17, /* atan(inf)lo 0x3C91A626, 0x33145C07 */
+};
+
+#ifdef __STDC__
+static const double aT[] = {
+#else
+static double aT[] = {
+#endif
+  3.33333333333329318027e-01, /* 0x3FD55555, 0x5555550D */
+ -1.99999999998764832476e-01, /* 0xBFC99999, 0x9998EBC4 */
+  1.42857142725034663711e-01, /* 0x3FC24924, 0x920083FF */
+ -1.11111104054623557880e-01, /* 0xBFBC71C6, 0xFE231671 */
+  9.09088713343650656196e-02, /* 0x3FB745CD, 0xC54C206E */
+ -7.69187620504482999495e-02, /* 0xBFB3B0F2, 0xAF749A6D */
+  6.66107313738753120669e-02, /* 0x3FB10D66, 0xA0D03D51 */
+ -5.83357013379057348645e-02, /* 0xBFADDE2D, 0x52DEFD9A */
+  4.97687799461593236017e-02, /* 0x3FA97B4B, 0x24760DEB */
+ -3.65315727442169155270e-02, /* 0xBFA2B444, 0x2C6A6C2F */
+  1.62858201153657823623e-02, /* 0x3F90AD3A, 0xE322DA11 */
+};
+
+#ifdef __STDC__
+	static const double 
+#else
+	static double 
+#endif
+one   = 1.0,
+really_big   = 1.0e300;
+
+#ifdef __STDC__
+	double fd_atan(double x)
+#else
+	double fd_atan(x)
+	double x;
+#endif
+{
+	double w,s1,s2,z;
+	int ix,hx,id;
+
+	hx = __HI(x);
+	ix = hx&0x7fffffff;
+	if(ix>=0x44100000) {	/* if |x| >= 2^66 */
+	    if(ix>0x7ff00000||
+		(ix==0x7ff00000&&(__LO(x)!=0)))
+		return x+x;		/* NaN */
+	    if(hx>0) return  atanhi[3]+atanlo[3];
+	    else     return -atanhi[3]-atanlo[3];
+	} if (ix < 0x3fdc0000) {	/* |x| < 0.4375 */
+	    if (ix < 0x3e200000) {	/* |x| < 2^-29 */
+		if(really_big+x>one) return x;	/* raise inexact */
+	    }
+	    id = -1;
+	} else {
+	x = fd_fabs(x);
+	if (ix < 0x3ff30000) {		/* |x| < 1.1875 */
+	    if (ix < 0x3fe60000) {	/* 7/16 <=|x|<11/16 */
+		id = 0; x = (2.0*x-one)/(2.0+x); 
+	    } else {			/* 11/16<=|x|< 19/16 */
+		id = 1; x  = (x-one)/(x+one); 
+	    }
+	} else {
+	    if (ix < 0x40038000) {	/* |x| < 2.4375 */
+		id = 2; x  = (x-1.5)/(one+1.5*x);
+	    } else {			/* 2.4375 <= |x| < 2^66 */
+		id = 3; x  = -1.0/x;
+	    }
+	}}
+    /* end of argument reduction */
+	z = x*x;
+	w = z*z;
+    /* break sum from i=0 to 10 aT[i]z**(i+1) into odd and even poly */
+	s1 = z*(aT[0]+w*(aT[2]+w*(aT[4]+w*(aT[6]+w*(aT[8]+w*aT[10])))));
+	s2 = w*(aT[1]+w*(aT[3]+w*(aT[5]+w*(aT[7]+w*aT[9]))));
+	if (id<0) return x - x*(s1+s2);
+	else {
+	    z = atanhi[id] - ((x*(s1+s2) - atanlo[id]) - x);
+	    return (hx<0)? -z:z;
+	}
+}

mozilla/js/src/fdlibm/s_cbrt.c

@@ -0,0 +1,120 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public
+ * License Version 1.1 (the "License"); you may not use this file
+ * except in compliance with the License. You may obtain a copy of
+ * the License at http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the License is distributed on an "AS
+ * IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+ * implied. See the License for the specific language governing
+ * rights and limitations under the License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is Sun Microsystems,
+ * Inc.  Portions created by Netscape are
+ * Copyright (C) 1998 Netscape Communications Corporation. All
+ * Rights Reserved.
+ *
+ * Contributor(s): 
+ *
+ * Alternatively, the contents of this file may be used under the
+ * terms of the GNU Public License (the "GPL"), in which case the
+ * provisions of the GPL are applicable instead of those above.
+ * If you wish to allow use of your version of this file only
+ * under the terms of the GPL and not to allow others to use your
+ * version of this file under the NPL, indicate your decision by
+ * deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL.  If you do not delete
+ * the provisions above, a recipient may use your version of this
+ * file under either the NPL or the GPL.
+ */
+
+/* @(#)s_cbrt.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ *
+ */
+
+#include "fdlibm.h"
+
+/* cbrt(x)
+ * Return cube root of x
+ */
+#ifdef __STDC__
+static const unsigned 
+#else
+static unsigned 
+#endif
+	B1 = 715094163, /* B1 = (682-0.03306235651)*2**20 */
+	B2 = 696219795; /* B2 = (664-0.03306235651)*2**20 */
+
+#ifdef __STDC__
+static const double
+#else
+static double
+#endif
+C =  5.42857142857142815906e-01, /* 19/35     = 0x3FE15F15, 0xF15F15F1 */
+D = -7.05306122448979611050e-01, /* -864/1225 = 0xBFE691DE, 0x2532C834 */
+E =  1.41428571428571436819e+00, /* 99/70     = 0x3FF6A0EA, 0x0EA0EA0F */
+F =  1.60714285714285720630e+00, /* 45/28     = 0x3FF9B6DB, 0x6DB6DB6E */
+G =  3.57142857142857150787e-01; /* 5/14      = 0x3FD6DB6D, 0xB6DB6DB7 */
+
+#ifdef __STDC__
+	double fd_cbrt(double x) 
+#else
+	double fd_cbrt(x) 
+	double x;
+#endif
+{
+	int	hx;
+	double r,s,t=0.0,w;
+	unsigned sign;
+
+
+	hx = __HI(x);		/* high word of x */
+	sign=hx&0x80000000; 		/* sign= sign(x) */
+	hx  ^=sign;
+	if(hx>=0x7ff00000) return(x+x); /* cbrt(NaN,INF) is itself */
+	if((hx|__LO(x))==0) 
+	    return(x);		/* cbrt(0) is itself */
+
+	__HI(x) = hx;	/* x <- |x| */
+    /* rough cbrt to 5 bits */
+	if(hx<0x00100000) 		/* subnormal number */
+	  {__HI(t)=0x43500000; 		/* set t= 2**54 */
+	   t*=x; __HI(t)=__HI(t)/3+B2;
+	  }
+	else
+	  __HI(t)=hx/3+B1;	
+
+
+    /* new cbrt to 23 bits, may be implemented in single precision */
+	r=t*t/x;
+	s=C+r*t;
+	t*=G+F/(s+E+D/s);	
+
+    /* chopped to 20 bits and make it larger than cbrt(x) */ 
+	__LO(t)=0; __HI(t)+=0x00000001;
+
+
+    /* one step newton iteration to 53 bits with error less than 0.667 ulps */
+	s=t*t;		/* t*t is exact */
+	r=x/s;
+	w=t+t;
+	r=(r-t)/(w+r);	/* r-s is exact */
+	t=t+t*r;
+
+    /* retore the sign bit */
+	__HI(t) |= sign;
+	return(t);
+}

mozilla/js/src/fdlibm/s_ceil.c

@@ -0,0 +1,111 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * The contents of this file are subject to the Netscape Public
+ * License Version 1.1 (the "License"); you may not use this file
+ * except in compliance with the License. You may obtain a copy of
+ * the License at http://www.mozilla.org/NPL/
+ *
+ * Software distributed under the License is distributed on an "AS
+ * IS" basis, WITHOUT WARRANTY OF ANY KIND, either express oqr
+ * implied. See the License for the specific language governing
+ * rights and limitations under the License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is Sun Microsystems,
+ * Inc.  Portions created by Netscape are
+ * Copyright (C) 1998 Netscape Communications Corporation. All
+ * Rights Reserved.
+ *
+ * Contributor(s): 
+ *
+ * Alternatively, the contents of this file may be used under the
+ * terms of the GNU Public License (the "GPL"), in which case the
+ * provisions of the GPL are applicable instead of those above.
+ * If you wish to allow use of your version of this file only
+ * under the terms of the GPL and not to allow others to use your
+ * version of this file under the NPL, indicate your decision by
+ * deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL.  If you do not delete
+ * the provisions above, a recipient may use your version of this
+ * file under either the NPL or the GPL.
+ */
+
+/* @(#)s_ceil.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/*
+ * ceil(x)
+ * Return x rounded toward -inf to integral value
+ * Method:
+ *	Bit twiddling.
+ * Exception:
+ *	Inexact flag raised if x not equal to ceil(x).
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double really_big = 1.0e300;
+#else
+static double really_big = 1.0e300;
+#endif
+
+#ifdef __STDC__
+	double fd_ceil(double x)
+#else
+	double fd_ceil(x)
+	double x;
+#endif
+{
+	int i0,i1,j0;
+	unsigned i,j;
+	i0 =  __HI(x);
+	i1 =  __LO(x);
+	j0 = ((i0>>20)&0x7ff)-0x3ff;
+	if(j0<20) {
+	    if(j0<0) { 	/* raise inexact if x != 0 */
+		if(really_big+x>0.0) {/* return 0*sign(x) if |x|<1 */
+		    if(i0<0) {i0=0x80000000;i1=0;} 
+		    else if((i0|i1)!=0) { i0=0x3ff00000;i1=0;}
+		}
+	    } else {
+		i = (0x000fffff)>>j0;
+		if(((i0&i)|i1)==0) return x; /* x is integral */
+		if(really_big+x>0.0) {	/* raise inexact flag */
+		    if(i0>0) i0 += (0x00100000)>>j0;
+		    i0 &= (~i); i1=0;
+		}
+	    }
+	} else if (j0>51) {
+	    if(j0==0x400) return x+x;	/* inf or NaN */
+	    else return x;		/* x is integral */
+	} else {
+	    i = ((unsigned)(0xffffffff))>>(j0-20);
+	    if((i1&i)==0) return x;	/* x is integral */
+	    if(really_big+x>0.0) { 		/* raise inexact flag */
+		if(i0>0) {
+		    if(j0==20) i0+=1; 
+		    else {
+			j = i1 + (1<<(52-j0));
+			if((int)j<i1) i0+=1;	/* got a carry */
+			i1 = j;
+		    }
+		}
+		i1 &= (~i);
+	    }
+	}
+	__HI(x) = i0;
+	__LO(x) = i1;
+	return x;
+}