This commit was manufactured by cvs2svn to create tag 'JS_150'.

git-svn-id: svn://10.0.0.236/tags/JS_150@180358 18797224-902f-48f8-a5cc-f745e15eee43

mozilla/js/src/Makefile.in

@@ -0,0 +1,375 @@
+# -*- Mode: makefile -*-
+#
+# ***** BEGIN LICENSE BLOCK *****
+# Version: MPL 1.1/GPL 2.0/LGPL 2.1
+#
+# The contents of this file are subject to the Mozilla Public License Version
+# 1.1 (the "License"); you may not use this file except in compliance with
+# the License. You may obtain a copy of the License at
+# http://www.mozilla.org/MPL/
+#
+# Software distributed under the License is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+# for the specific language governing rights and limitations under the
+# License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#
+# Alternatively, the contents of this file may be used under the terms of
+# either of the GNU General Public License Version 2 or later (the "GPL"),
+# or the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+# in which case the provisions of the GPL or the LGPL are applicable instead
+# of those above. If you wish to allow use of your version of this file only
+# under the terms of either the GPL or the LGPL, and not to allow others to
+# use your version of this file under the terms of the MPL, indicate your
+# decision by deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL or the LGPL. If you do not delete
+# the provisions above, a recipient may use your version of this file under
+# the terms of any one of the MPL, the GPL or the LGPL.
+#
+# ***** END LICENSE BLOCK *****
+
+DEPTH		= ../..
+topsrcdir	= @top_srcdir@
+srcdir		= @srcdir@
+VPATH		= @srcdir@
+
+include $(DEPTH)/config/autoconf.mk
+
+MODULE		= js
+LIBRARY_NAME	= mozjs
+LIB_IS_C_ONLY	= 1
+GRE_MODULE	= 1
+
+ifeq ($(OS_ARCH),WINNT)
+LIBRARY_NAME	= js$(MOZ_BITS)$(VERSION_NUMBER)
+RESFILE		= js$(MOZ_BITS)40.res
+endif
+
+PACKAGE_FILE = js.pkg
+
+# JavaScript must be built shared, even for static builds, as it is used by
+# other modules which are always built shared. Failure to do so results in
+# the js code getting copied into xpinstall and jsd as well as mozilla-bin,
+# and then the static data cells used for locking no longer work.
+FORCE_SHARED_LIB = 1
+
+CSRCS		= \
+		jsapi.c \
+		jsarena.c \
+		jsarray.c \
+		jsatom.c \
+		jsbool.c \
+		jscntxt.c \
+		jsdate.c \
+		jsdbgapi.c \
+		jsdhash.c \
+		jsdtoa.c \
+		jsemit.c \
+		jsexn.c \
+		jsfun.c \
+		jsgc.c \
+		jshash.c \
+		jsinterp.c \
+		jslock.c \
+		jslog2.c \
+		jslong.c \
+		jsmath.c \
+		jsnum.c \
+		jsobj.c \
+		jsopcode.c \
+		jsparse.c \
+		jsprf.c \
+		jsregexp.c \
+		jsscan.c \
+		jsscope.c \
+		jsscript.c \
+		jsstr.c \
+		jsutil.c \
+		jsxdrapi.c \
+		prmjtime.c \
+		$(NULL)
+
+EXPORTS		= \
+		jsautocfg.h \
+		js.msg \
+		jsapi.h \
+		jsarray.h \
+		jsarena.h \
+		jsatom.h \
+		jsbit.h \
+		jsbool.h \
+		jsclist.h \
+		jscntxt.h \
+		jscompat.h \
+		jsconfig.h \
+		jsdate.h \
+		jsdbgapi.h \
+		jsdhash.h \
+		jsemit.h \
+		jsfun.h \
+		jsgc.h \
+		jshash.h \
+		jsinterp.h \
+		jslock.h \
+		jslong.h \
+		jsmath.h \
+		jsnum.h \
+		jsobj.h \
+		jsopcode.tbl \
+		jsopcode.h \
+		jsosdep.h \
+		jsotypes.h \
+		jsparse.h \
+		jsprf.h \
+		jsprvtd.h \
+		jspubtd.h \
+		jsregexp.h \
+		jsscan.h \
+		jsscope.h \
+		jsscript.h \
+		jsstr.h \
+		jstypes.h \
+		jsutil.h \
+		jsxdrapi.h \
+		jsstddef.h \
+		$(NULL)
+
+ifeq ($(OS_ARCH),WINNT)
+EXPORTS		+= jscpucfg.h
+endif
+
+FDLIBM_LIBRARY	= fdlibm/$(LIB_PREFIX)fdm.$(LIB_SUFFIX)
+JSMATH_PRELINK	= jsmathtemp.o
+JS_SAFE_ARENA	= 1
+
+DASH_R		= -r
+
+include $(topsrcdir)/config/config.mk
+
+EXTRA_DSO_LDOPTS += $(NSPR_LIBS)
+
+ifeq (,$(filter-out OS2 WINNT,$(OS_ARCH)))
+SHARED_LIBRARY_LIBS += $(FDLIBM_LIBRARY)
+endif
+
+# When using gcc the assembly is inlined in the C-file (see jslock.c)
+ifeq ($(OS_ARCH),SunOS)
+ifneq ($(OS_TEST),i86pc)
+ifndef GNU_CC
+ASFILES		= lock_$(OS_ARCH).s
+endif
+endif
+endif
+
+ifndef BUILD_OPT
+MOCHAFILE	= 1
+endif
+
+ifndef NSBUILDROOT
+JSJAVA_STUBHEADERS = \
+		-I$(topsrcdir)/sun-java/include/_gen \
+		-I$(topsrcdir)/sun-java/netscape/javascript/_jri \
+		-I$(topsrcdir)/sun-java/netscape/security/_jri
+else
+JSJAVA_STUBHEADERS = -I$(JRI_GEN_DIR) -I$(JDK_GEN_DIR)
+endif
+
+JSJAVA_CFLAGS	= \
+		-I$(topsrcdir)/sun-java/md-include \
+		-I$(topsrcdir)/sun-java/include \
+		$(JSJAVA_STUBHEADERS)
+
+include $(topsrcdir)/config/rules.mk
+
+DEFINES		+= -DEXPORT_JS_API 
+
+INCLUDES	+= -I$(srcdir)
+
+# MSVC '-Gy' cc flag and '/OPT:REF' linker flag cause JS_GetArgument and
+# JS_GetLocalVariable to be folded to the same address by the linker, 
+# leading to a crash on startup. See bug 151066. So, in optimized builds,
+# add the /OPT:NOICF flag, which turns off 'identical COMDAT folding'.
+#
+# N.B.: 'identical COMDAT folding' that folds functions whose addresses
+# are taken violates the ISO C and C++ standards.
+ifndef MOZ_DEBUG
+ifeq (_WINNT,$(GNU_CC)_$(OS_ARCH))
+LDFLAGS         += /OPT:NOICF
+endif
+endif
+
+GARBAGE		+= $(JSMATH_PRELINK) jscpucfg.o jsautocfg.h jsautocfg.tmp jscpucfg
+
+ifneq (,$(CROSS_COMPILE)$(filter-out WINNT,$(OS_ARCH)))
+TARGETS		+= jscpucfg$(HOST_BIN_SUFFIX)
+endif
+
+ifdef JS_SAFE_ARENA
+DEFINES		+= -DJS_USE_SAFE_ARENA
+endif
+
+ifdef JS_THREADSAFE
+DEFINES		+= -DJS_THREADSAFE
+endif
+
+ifdef JS_NO_THIN_LOCKS
+DEFINES		+= -DJS_USE_ONLY_NSPR_LOCKS
+endif
+
+ifdef JS_VERSION
+DEFINES		+= -DJS_VERSION=$(JS_VERSION)
+endif
+
+ifneq ($(findstring -L,$(NSPR_LIBS)),)
+NSPR_STATIC_PATH = $(subst -L,,$(findstring -L,$(NSPR_LIBS)))
+else
+NSPR_STATIC_PATH = $(DIST)/lib
+endif
+
+LDFLAGS		+= $(pathsubst -l%,$(NSPR_STATIC_PATH)/%.a,$(NSPR_LIBS))
+
+# BeOS and HP-UX do not require the extra linking of "-lm"
+ifeq (,$(filter BeOS HP-UX WINNT OpenVMS,$(OS_ARCH)))
+LDFLAGS		+= -lm
+endif
+
+# Prevent floating point errors caused by VC++ optimizations
+ifeq ($(OS_ARCH)_$(GNU_CC),WINNT_)
+CFLAGS += /Op
+endif # WINNT
+
+ifeq ($(OS_ARCH),FreeBSD)
+LDFLAGS		+= -pthread
+endif
+ifeq ($(OS_ARCH),IRIX)
+ifdef USE_N32
+DASH_R		+= -n32
+endif
+endif
+ifeq ($(OS_ARCH),Linux)
+LDFLAGS		+= -ldl
+endif
+ifeq ($(OS_ARCH),OSF1)
+LDFLAGS		+= -lc_r
+endif
+ifeq ($(OS_ARCH),SunOS)
+ifeq ($(TARGET_CPU),sparc)
+
+ifdef JS_ULTRASPARC_OPTS
+DEFINES += -DULTRA_SPARC
+ifdef GNU_CC
+CFLAGS   += -Wa,-xarch=v8plus,-DULTRA_SPARC,-P,-L,-D_ASM,-D__STDC__=0
+CXXFLAGS += -Wa,-xarch=v8plus,-DULTRA_SPARC,-P,-L,-D_ASM,-D__STDC__=0,-K,PIC
+else
+ASFLAGS  += -xarch=v8plus -DULTRA_SPARC -P -L -D_ASM -D__STDC__=0 -K PIC
+endif # GNU_CC
+endif # JS_ULTRASPARC_OPTS
+
+endif
+ifeq ($(OS_RELEASE),4.1)
+LDFLAGS		+= -ldl -lnsl
+else
+LDFLAGS		+= -lposix4 -ldl -lnsl -lsocket
+endif
+endif
+
+ifeq ($(OS_ARCH),QNX)
+ifneq ($(OS_TARGET),NTO)
+# Don't use wildcard here, because we only want this resolved at link time.
+OBJS		+= fdlibm/*.o
+endif
+endif
+
+ifeq ($(OS_ARCH),IRIX)
+ifndef GNU_CC
+_COMPILE_CFLAGS  = $(patsubst -O%,-O1,$(COMPILE_CFLAGS))
+jsapi.o jsarena.o jsarray.o jsatom.o jsemit.o jsfun.o jsinterp.o jsregexp.o jsparse.o jsopcode.o jsscript.o: %.o: %.c Makefile.in
+	$(REPORT_BUILD)
+	@$(MAKE_DEPS_AUTO)
+	$(CC) -o $@ -c $(_COMPILE_CFLAGS) $<
+endif
+endif
+
+# On OS/2 & win32 we are already linking against fdlibm, so don't bother
+# creating jsmathtemp
+ifeq (,$(filter OS2 WINNT OpenVMS,$(OS_ARCH)))
+# special rule for jsmath.o since we want to incrementally link
+# against fdlibm to pull in only what is needed
+# Do this in a single step to avoid dependency problems
+jsmath.o: jsmath.c $(FDLIBM_LIBRARY) Makefile.in
+	$(REPORT_BUILD)
+	@$(MAKE_DEPS_AUTO)
+	$(ELOG) $(CC) $(OUTOPTION)$(JSMATH_PRELINK) -c $(COMPILE_CFLAGS) $<
+ifeq ($(OS_ARCH),QNX)
+ifneq ($(OS_TARGET),NTO)
+	@cp $(JSMATH_PRELINK) $@
+else
+	$(LD) $(DASH_R) -o $@ $(JSMATH_PRELINK) $(FDLIBM_LIBRARY)
+endif
+else
+	$(LD) $(DASH_R) -o $@ $(JSMATH_PRELINK) $(FDLIBM_LIBRARY)
+endif
+	@$(RM) -f $(JSMATH_PRELINK)
+else
+# Create dependency so we build fdlibm
+jsmath.o: $(FDLIBM_LIBRARY) Makefile.in
+endif
+
+# An AIX Optimization bug causes PR_dtoa() & JS_dtoa to produce wrong result.
+# This suppresses optimization for this single compilation unit.
+ifeq ($(OS_ARCH),AIX)
+jsatom.o: jsatom.c Makefile.in
+	$(REPORT_BUILD)
+	@$(MAKE_DEPS_AUTO)
+	$(CC) -o $@ -c $(filter-out $(MOZ_OPTIMIZE_FLAGS), $(COMPILE_CFLAGS)) $<
+jsdtoa.o: jsdtoa.c Makefile.in
+	$(REPORT_BUILD)
+	@$(MAKE_DEPS_AUTO)
+	$(CC) -o $@ -c $(filter-out $(MOZ_OPTIMIZE_FLAGS), $(COMPILE_CFLAGS)) $<
+endif
+
+$(FDLIBM_LIBRARY):
+	$(MAKE) -C $(@D) $(@F)
+
+jsopcode.h jsopcode.c: jsopcode.tbl
+
+ifeq (,$(CROSS_COMPILE)$(filter-out WINNT,$(OS_ARCH)))
+jsautocfg.h:
+	touch $@
+else
+jsautocfg.h: jscpucfg$(HOST_BIN_SUFFIX)
+	@rm -f $@ jsautocfg.tmp
+	./jscpucfg > jsautocfg.tmp
+	mv jsautocfg.tmp $@
+endif
+
+# jscpucfg is a strange target
+# Needs to be built with the host compiler but needs to include
+# the mdcpucfg for the target so it needs the appropriate target defines
+ifdef HOST_NSPR_MDCPUCFG
+HOST_CC := $(HOST_CC) -DMDCPUCFG=$(TARGET_NSPR_MDCPUCFG)
+endif
+
+ifeq ($(OS_ARCH),QNX)
+ifneq ($(OS_TARGET),NTO)
+# QNX's compiler apparently can't build a binary directly from a source file.
+jscpucfg.o: jscpucfg.c Makefile.in
+	$(HOST_CC) $(HOST_CFLAGS) -c $(DEFINES) $(NSPR_CFLAGS) -o $@ $<
+
+jscpucfg: jscpucfg.o
+	$(HOST_CC) $(HOST_CFLAGS) $(DEFINES) -o $@ $<
+endif
+else
+jscpucfg$(HOST_BIN_SUFFIX): jscpucfg.c Makefile.in
+	$(HOST_CC) $(HOST_CFLAGS) $(DEFINES) $(NSPR_CFLAGS) $(OUTOPTION)$@ $<
+endif
+

mozilla/js/src/Makefile.ref

@@ -0,0 +1,372 @@
+# -*- Mode: makefile -*-
+#
+# ***** BEGIN LICENSE BLOCK *****
+# Version: MPL 1.1/GPL 2.0/LGPL 2.1
+#
+# The contents of this file are subject to the Mozilla Public License Version
+# 1.1 (the "License"); you may not use this file except in compliance with
+# the License. You may obtain a copy of the License at
+# http://www.mozilla.org/MPL/
+#
+# Software distributed under the License is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+# for the specific language governing rights and limitations under the
+# License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#   Michael Ang <mang@subcarrier.org>
+#   Kevin Buhr <buhr@stat.wisc.edu>
+#
+# Alternatively, the contents of this file may be used under the terms of
+# either of the GNU General Public License Version 2 or later (the "GPL"),
+# or the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+# in which case the provisions of the GPL or the LGPL are applicable instead
+# of those above. If you wish to allow use of your version of this file only
+# under the terms of either the GPL or the LGPL, and not to allow others to
+# use your version of this file under the terms of the MPL, indicate your
+# decision by deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL or the LGPL. If you do not delete
+# the provisions above, a recipient may use your version of this file under
+# the terms of any one of the MPL, the GPL or the LGPL.
+#
+# ***** END LICENSE BLOCK *****
+
+#
+# JSRef GNUmake makefile.
+#
+# Note: dependency rules are missing for some files (some
+#       .h, all .msg, etc.)  Re-make clean if in doubt.
+#
+
+
+DEPTH = .
+
+include config.mk
+
+#NS_USE_NATIVE = 1
+
+ifdef USE_MSVC
+OTHER_LIBS += fdlibm/$(OBJDIR)/fdlibm.lib
+else
+OTHER_LIBS += -Lfdlibm/$(OBJDIR) -lfdm
+endif
+
+ifdef JS_THREADSAFE
+DEFINES += -DJS_THREADSAFE
+INCLUDES += -I../../dist/$(OBJDIR)/include
+ifdef USE_MSVC
+OTHER_LIBS += ../../dist/$(OBJDIR)/lib/libnspr${NSPR_LIBSUFFIX}.lib
+else
+OTHER_LIBS += -L../../dist/$(OBJDIR)/lib -lnspr${NSPR_LIBSUFFIX}
+endif
+endif
+
+ifdef JS_NO_THIN_LOCKS
+DEFINES += -DJS_USE_ONLY_NSPR_LOCKS
+endif
+
+ifdef JS_HAS_FILE_OBJECT
+DEFINES += -DJS_HAS_FILE_OBJECT
+endif
+
+#
+# XCFLAGS may be set in the environment or on the gmake command line
+#
+CFLAGS          += $(OPTIMIZER) $(OS_CFLAGS) $(DEFINES) $(INCLUDES) $(XCFLAGS)
+
+LDFLAGS		= $(XLDFLAGS)
+
+ifndef NO_LIBM
+LDFLAGS += -lm
+endif
+
+# Prevent floating point errors caused by VC++ optimizations
+ifeq ($(OS_ARCH),WINNT)
+CFLAGS += /Op
+endif # WINNT
+
+#
+# Ask perl what flags it was built with, so we can build js with similar flags
+# and link properly.  Viva gmake.
+#
+ifdef JS_PERLCONNECT
+DEFINES += -DPERLCONNECT -D_GNU_SOURCE
+
+PERLCFLAGS := $(shell perl -MExtUtils::Embed -e ccopts)
+PERLLDFLAGS := $(shell perl -MExtUtils::Embed -e ldopts)
+
+# perl erroneously reports compiler flag -rdynamic (interpreted by ld
+# as -r) when it really meant -export-dynamic.
+PERLLDFLAGS := $(subst -rdynamic,-export-dynamic,$(PERLLDFLAGS))
+
+CFLAGS += $(PERLCFLAGS)
+#LDFLAGS += $(PERLLDFLAGS) #PH removed this assgnment
+INCLUDES += -I. #needed for perlconnect/jsperl.c
+endif
+
+#
+#	Server-related changes :
+#
+ifdef NES40 
+DEFINES += -DNES40 
+endif 
+
+#
+# Line editing support.
+# Define JS_READLINE or JS_EDITLINE to enable line editing in the
+# js command-line interpreter.
+#
+ifdef JS_READLINE
+# For those platforms with the readline library installed.
+DEFINES += -DEDITLINE
+PROG_LIBS += -lreadline -ltermcap
+else
+ifdef JS_EDITLINE
+# Use the editline library, built locally.
+PREDIRS += editline
+DEFINES += -DEDITLINE
+PROG_LIBS += editline/$(OBJDIR)/libedit.a
+endif
+endif
+
+# For purify
+PURE_CFLAGS     = -DXP_UNIX $(OPTIMIZER) $(PURE_OS_CFLAGS) $(DEFINES) \
+                  $(INCLUDES) $(XCFLAGS)
+
+#
+# JS file lists
+#
+JS_HFILES =		\
+	jsarray.h	\
+	jsatom.h	\
+	jsbool.h	\
+	jsconfig.h	\
+	jscntxt.h	\
+	jsdate.h	\
+	jsemit.h	\
+	jsexn.h		\
+	jsfun.h		\
+	jsgc.h		\
+	jsinterp.h	\
+	jslibmath.h	\
+	jslock.h	\
+	jsmath.h	\
+	jsnum.h		\
+	jsobj.h		\
+	jsopcode.h      \
+	jsparse.h	\
+	jsarena.h	\
+	jsclist.h	\
+	jsdhash.h	\
+	jsdtoa.h	\
+	jshash.h	\
+	jslong.h	\
+	jsosdep.h	\
+	jstypes.h	\
+	jsprvtd.h	\
+	jspubtd.h	\
+	jsregexp.h	\
+	jsscan.h	\
+	jsscope.h	\
+	jsscript.h	\
+	jsstr.h		\
+	jsxdrapi.h	\
+	$(NULL)
+
+API_HFILES =		\
+	jsapi.h		\
+	jsdbgapi.h	\
+	$(NULL)
+
+OTHER_HFILES =		\
+	jsbit.h		\
+	jscompat.h	\
+	jscpucfg.h	\
+	jsotypes.h	\
+	jsstddef.h	\
+	prmjtime.h	\
+	resource.h	\
+	jsopcode.tbl	\
+	js.msg		\
+	jsshell.msg	\
+	$(NULL)
+
+ifndef PREBUILT_CPUCFG
+OTHER_HFILES += $(OBJDIR)/jsautocfg.h
+endif
+
+HFILES = $(JS_HFILES) $(API_HFILES) $(OTHER_HFILES)
+
+JS_CFILES =		\
+	jsapi.c		\
+	jsarena.c	\
+	jsarray.c	\
+	jsatom.c	\
+	jsbool.c	\
+	jscntxt.c	\
+	jsdate.c	\
+	jsdbgapi.c	\
+	jsdhash.c	\
+	jsdtoa.c	\
+	jsemit.c	\
+	jsexn.c		\
+	jsfun.c		\
+	jsgc.c		\
+	jshash.c	\
+	jsinterp.c	\
+	jslock.c	\
+	jslog2.c	\
+	jslong.c	\
+	jsmath.c	\
+	jsnum.c		\
+	jsobj.c		\
+	jsopcode.c      \
+	jsparse.c	\
+	jsprf.c		\
+	jsregexp.c	\
+	jsscan.c	\
+	jsscope.c	\
+	jsscript.c	\
+	jsstr.c		\
+	jsutil.c        \
+	jsxdrapi.c	\
+	prmjtime.c	\
+	$(NULL)
+
+PREDIRS	+= fdlibm
+
+ifdef USE_MSVC
+FDLIBM_LIBRARY = fdlibm/$(OBJDIR)/fdlibm.lib
+else
+FDLIBM_LIBRARY = fdlibm/$(OBJDIR)/libfdm.a
+endif
+JSMATH_PRELINK	= $(OBJDIR)/jsmathtemp.o
+# Flag for incremental linking
+DASH_R		= -r
+
+ifeq ($(OS_ARCH),QNX)
+ifneq ($(OS_TARGET),NTO)
+# Don't use wildcard here, because we only want this resolved at link time.
+OBJS		+= fdlibm/*.o
+endif
+endif
+
+ifdef JS_LIVECONNECT
+DIRS      += liveconnect
+endif
+
+ifdef JS_PERLCONNECT
+JS_CFILES += perlconnect/jsperl.c
+endif
+
+ifdef JS_HAS_FILE_OBJECT
+JS_CFILES += jsfile.c
+JS_HFILES += jsfile.h
+endif
+
+LIB_CFILES  = $(JS_CFILES)
+LIB_ASFILES := $(wildcard *_$(OS_ARCH).s)
+PROG_CFILES = js.c
+
+ifdef USE_MSVC
+LIBRARY = $(OBJDIR)/js32.lib
+SHARED_LIBRARY = $(OBJDIR)/js32.dll
+PROGRAM = $(OBJDIR)/js.exe
+else
+LIBRARY = $(OBJDIR)/libjs.a
+SHARED_LIBRARY = $(OBJDIR)/libjs.$(SO_SUFFIX)
+PROGRAM = $(OBJDIR)/js
+ifdef JS_PERLCONNECT
+PROG_LIBS += $(PERLLDFLAGS)
+endif
+endif
+
+include rules.mk
+
+MOZ_DEPTH = ../..
+include jsconfig.mk
+
+nsinstall-target:
+	cd ../../config; $(MAKE) OBJDIR=$(OBJDIR) OBJDIR_NAME=$(OBJDIR)
+ifdef USE_MSVC
+$(PROGRAM): $(PROG_OBJS) $(LIBRARY) $(FDLIBM_LIBRARY)
+	link.exe -out:"$@" $(EXE_LINK_FLAGS) $^
+else
+$(PROGRAM): $(PROG_OBJS) $(LIBRARY) $(FDLIBM_LIBRARY)
+	$(CC) -o $@ $(CFLAGS) $(PROG_OBJS) $(LIBRARY) $(LDFLAGS) $(OTHER_LIBS) \
+	    $(PROG_LIBS)
+endif
+
+$(PROGRAM).pure: $(PROG_OBJS) $(LIBRARY)
+	purify $(PUREFLAGS) \
+	    $(CC) -o $@ $(PURE_OS_CFLAGS) $(PROG_OBJS) $(LIBRARY) $(LDFLAGS) \
+		$(OTHER_LIBS) $(PROG_LIBS)
+
+ifndef PREBUILT_CPUCFG
+$(HFILES) $(CFILES): $(OBJDIR)/jsautocfg.h
+
+$(OBJDIR)/jsautocfg.h: $(OBJDIR)/jscpucfg
+	rm -f $@
+	$(OBJDIR)/jscpucfg > $@
+
+$(OBJDIR)/jscpucfg: $(OBJDIR)/jscpucfg.o
+	$(CC) -o $@ $(OBJDIR)/jscpucfg.o
+
+# Look in OBJDIR to find jsautocfg.h
+INCLUDES   += -I$(OBJDIR)
+
+# Add to TARGETS for clobber rule
+TARGETS += $(OBJDIR)/jsautocfg.h $(OBJDIR)/jscpucfg \
+	$(OBJDIR)/jscpucfg.o $(OBJDIR)/jsmathtemp.o
+endif
+
+
+# special rule for jsmath.o since we want to incrementally link
+# against fdlibm to pull in only what is needed
+$(OBJDIR)/jsmath.o: jsmath.c jsmath.h jslibmath.h $(FDLIBM_LIBRARY)
+ifneq (,$(filter OS2 WINNT,$(OS_ARCH)))
+	$(CC) -Fo$(JSMATH_PRELINK) -c $(CFLAGS) $<
+else
+	$(CC) -o $(JSMATH_PRELINK) -c $(CFLAGS) $<
+endif
+
+ifeq ($(OS_ARCH),QNX)
+ifneq ($(OS_TARGET),NTO)
+	@cp $(JSMATH_PRELINK) $@
+else	
+	$(LD) $(DASH_R) -o $@ $(JSMATH_PRELINK) $(FDLIBM_LIBRARY)
+endif
+else
+ifdef USE_MSVC
+	@echo Warning: to use $(LIBRARY) must also link against $(FDLIBM_LIBRARY)
+	@cp $(JSMATH_PRELINK) $@
+endif
+	$(LD) $(DASH_R) -o $@ $(JSMATH_PRELINK) $(FDLIBM_LIBRARY)
+endif
+
+# Note: generated headers must be built before descending
+#       into fdlibm directory
+$(FDLIBM_LIBRARY) :
+	$(MAKE) -C fdlibm -f Makefile.ref $(@F)
+
+#
+# Hardwire dependencies on jsopcode.tbl
+#
+jsopcode.h jsopcode.c: jsopcode.tbl
+
+-include $(DEPENDENCIES)
+
+TARNAME = jsref.tar
+TARFILES = files `cat files`
+
+SUFFIXES: .i
+%.i: %.c
+	$(CC) -C -E $(CFLAGS) $< > $*.i

mozilla/js/src/README.html

@@ -0,0 +1,826 @@
+<!-- ***** BEGIN LICENSE BLOCK *****
+   - Version: MPL 1.1/GPL 2.0/LGPL 2.1
+   -
+   - The contents of this file are subject to the Mozilla Public License Version
+   - 1.1 (the "License"); you may not use this file except in compliance with
+   - the License. You may obtain a copy of the License at
+   - http://www.mozilla.org/MPL/
+   -
+   - Software distributed under the License is distributed on an "AS IS" basis,
+   - WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+   - for the specific language governing rights and limitations under the
+   - License.
+   - 
+   - The Original Code is Mozilla Communicator client code, released
+   - March 31, 1998.
+   - 
+   - The Initial Developer of the Original Code is
+   - Netscape Communications Corporation.
+   - Portions created by the Initial Developer are Copyright (C) 1998-1999
+   - the Initial Developer. All Rights Reserved.
+   - 
+   - Contributor(s):
+   - 
+   - Alternatively, the contents of this file may be used under the terms of
+   - either of the GNU General Public License Version 2 or later (the "GPL"),
+   - or the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+   - in which case the provisions of the GPL or the LGPL are applicable instead
+   - of those above. If you wish to allow use of your version of this file only
+   - under the terms of either the GPL or the LGPL, and not to allow others to
+   - use your version of this file under the terms of the MPL, indicate your
+   - decision by deleting the provisions above and replace them with the notice
+   - and other provisions required by the GPL or the LGPL. If you do not delete
+   - the provisions above, a recipient may use your version of this file under
+   - the terms of any one of the MPL, the GPL or the LGPL.
+   -
+   - ***** END LICENSE BLOCK ***** -->
+<!doctype html public "-//w3c//dtd html 4.0 transitional//en">
+<html>
+<head>
+   <meta http-equiv="Content-Type" content="text/html; charset=iso-8859-1">
+   <meta name="GENERATOR" content="Mozilla/4.5 [en] (WinNT; I) [Netscape]">
+   <title>JavaScript Reference Implementation (JSRef) README</title>
+</head>
+<body>
+
+<h2>
+Table of Contents</h2>
+
+<ul>
+<li>
+<a href="#Introduction">Introduction</a></li>
+
+<li>
+<a href="#Build">Build conventions (standalone JS engine and shell)</a></li>
+
+<li>
+<a href="#Debugging">Debugging notes</a></li>
+
+<li>
+<a href="#Conventions">Naming and coding conventions</a></li>
+
+<li>
+<a href="#JSAPI">Using the JS API</a></li>
+
+<li>
+<a href="#Design">Design walk-through</a></li>
+
+<li>
+<a href="#Resources">Additional Resources (links, API docs, and newsgroups)</a></li>
+
+</ul>
+
+<h2>
+<a NAME="Introduction"></a>Introduction</h2>
+This is the README file for the&nbsp;<span CLASS=LXRSHORTDESC>JavaScript
+Reference (JSRef, now better known as SpiderMonkey) implementation.</span>
+It consists of build conventions
+and instructions, source code conventions, a design walk-through, and a
+brief file-by-file description of the source.
+<p><span CLASS=LXRLONGDESC>JSRef builds a library or DLL containing the
+JavaScript runtime (compiler, interpreter, decompiler, garbage collector,
+atom manager, standard classes). It then compiles a small "shell" program
+and links that with the library to make an interpreter that can be used
+interactively and with test .js files to run scripts.&nbsp; The code has
+no dependencies on the rest of the Mozilla codebase.</span>
+<p><i>Quick start tip</i>: skip to "Using the JS API" below, build the
+js shell, and play with the object named "it" (start by setting 'it.noisy
+= true').
+<h2>
+<a NAME="Build"></a>Build conventions (standalone JS engine and shell)
+(OUT OF DATE!)</h2>
+These build directions refer only to building the standalone JavaScript
+engine and shell.&nbsp; To build within the browser, refer to the <a 
+href="http://www.mozilla.org/build/">build
+directions</a> on the mozilla.org website.
+<p>By default, all platforms build a version of the JS engine that is <i>not</i>
+threadsafe.&nbsp; If you require thread-safety, you must also populate
+the <tt>mozilla/dist</tt> directory with <a href="http://www.mozilla.org/projects/nspr/reference/html/"
+>NSPR</a>
+headers and libraries.&nbsp; (NSPR implements a portable threading library,
+among other things.&nbsp; The source is downloadable via <a href="http://www.mozilla.org/cvs.html">CVS</a>
+from <tt><a href="http://lxr.mozilla.org/mozilla/source/nsprpub">mozilla/nsprpub</a></tt>.)&nbsp;
+Next, you must define <tt>JS_THREADSAFE</tt> when building the JS engine,
+either on the command-line (gmake/nmake) or in a universal header file.
+<h3>
+Windows</h3>
+
+<ul>
+<li>
+Use MSVC 4.2 or 5.0.</li>
+
+<li>
+For building from the IDE use <tt>js/src/js.mdp</tt>.&nbsp; (<tt>js.mdp</tt>
+is an MSVC4.2 project file, but if you load it into MSVC5, it will be converted
+to the newer project file format.)&nbsp; <font color="#CC0000">NOTE: makefile.win
+is an nmake file used only for building the JS-engine in the Mozilla browser.&nbsp;
+Don't attempt to use it to build the standalone JS-engine.</font></li>
+
+<li>
+If you prefer to build from the command-line, use '<tt>nmake -f js.mak</tt>'</li>
+
+<li>
+Executable shell <tt>js.exe</tt> and runtime library <tt>js32.dll</tt>
+are created in either <tt>js/src/Debug</tt> or <tt>js/src/Release</tt>.</li>
+</ul>
+
+<h3>
+Macintosh</h3>
+
+<ul>
+<li>
+Use CodeWarrior 3.x</li>
+
+<li>
+Load the project file <tt>js:src:macbuild:JSRef.mcp </tt>and select "Make"
+from the menu.</li>
+</ul>
+
+<h3>
+Unix</h3>
+
+<ul>
+<li>
+Use '<tt>gmake -f Makefile.ref</tt>' to build. To compile optimized code,
+pass <tt>BUILD_OPT=1</tt> on the gmake command line or preset it in the
+environment or <tt>Makefile.ref</tt>.&nbsp; <font color="#CC0000">NOTE:
+Do not attempt to use Makefile to build the standalone JavaScript engine.&nbsp;
+This file is used only for building the JS-engine in the Mozilla browser.</font></li>
+
+<li>
+<font color="#000000">Each platform on which JS is built must have a <tt>*.mk</tt>
+configuration file in the <tt>js/src/config</tt> directory.&nbsp; The configuration
+file specifies the compiler/linker to be used and allows for customization
+of command-line options.&nbsp; To date, the build system has been tested
+on Solaris, AIX, HP/UX, OSF, IRIX, x86 Linux and Windows NT.</font></li>
+
+<li>
+<font color="#000000">Most platforms will work with either the vendor compiler
+</font>or
+<a href="ftp://prep.ai.mit.edu/pub/gnu">gcc</a>.&nbsp;
+(Except that HP builds only work using the native compiler.&nbsp; gcc won't
+link correctly with shared libraries on that platform.&nbsp; If someone
+knows a way to fix this, <a href="mailto:wynholds@netscape.com">let us
+know</a>.)</li>
+
+<li>
+<font color="#000000">If you define <tt>JS_LIVECONNECT</tt>, gmake will
+descend into the liveconnect directory and build 
+<a href="http://lxr.mozilla.org/mozilla/source/js/src/liveconnect/README.html">LiveConnect</a>
+after building the JS engine.</font></li>
+
+<li>
+To build a binary drop (a zip'ed up file of headers, libraries, binaries),
+check out <tt>mozilla/config</tt> and <tt>mozilla/nsprpub/config</tt>.&nbsp;
+Use '<tt>gmake -f Makefile.ref nsinstall-target all export ship</tt>'</li>
+</ul>
+
+<h2>
+<a NAME="Debugging"></a>Debugging notes</h2>
+
+<ul>
+<li>
+To turn on GC instrumentation, define <tt>JS_GCMETER</tt>.</li>
+
+<ul>
+<li>
+To turn on GC mark-phase debugging, useful to find leaked objects by their
+address, and to dump the GC heap, define <tt>GC_MARK_DEBUG</tt>.
+See the code in jsgc.c around the declaration and use of
+<tt>js_LiveThingToFind</tt>.</li>
+
+<li>
+To turn on the arena package's instrumentation, define <tt>JS_ARENAMETER</tt>.</li>
+
+<li>
+To turn on the hash table package's metering, define <tt>JS_HASHMETER</tt>.</li>
+</ul>
+
+<h2>
+<a NAME="Conventions"></a>Naming and coding conventions</h2>
+
+<ul>
+<li>
+Public function names begin with <tt>JS_</tt> followed by capitalized "intercaps",
+e.g. <tt>JS_NewObject</tt>.</li>
+
+<li>
+Extern but library-private function names use a <tt>js_</tt> prefix and
+mixed case, e.g. <tt>js_SearchScope</tt>.</li>
+
+<li>
+Most static function names have unprefixed, mixed-case names: <tt>GetChar</tt>.</li>
+
+<li>
+But static native methods of JS objects have lowercase, underscore-separated
+or intercaps names, e.g., <tt>str_indexOf</tt>.</li>
+
+<li>
+And library-private and static data use underscores, not intercaps (but
+library-private data do use a <tt>js_</tt> prefix).</li>
+
+<li>
+Scalar type names are lowercase and js-prefixed: <tt>jsdouble</tt>.</li>
+
+<li>
+Aggregate type names are JS-prefixed and mixed-case: <tt>JSObject.</tt></li>
+
+<li>
+Macros are generally <tt>ALL_CAPS </tt>and underscored, to call out potential
+side effects, multiple uses of a formal argument, etc.</li>
+
+<li>
+Four spaces of indentation per statement nesting level.</li>
+
+<li>
+Tabs are taken to be eight spaces, and an Emacs magic comment at the top
+of each file tries to help. If you're using MSVC or similar, you'll want
+to set tab width to 8, and help convert these files to be space-filled.
+<font color="#CC0000">Do not add hard tabs to source files; do remove them
+whenever possible.</font></li>
+
+<li>
+DLL entry points have their return type expanded within a <tt>JS_PUBLIC_API()</tt>
+macro call, to get the right Windows secret type qualifiers in the right
+places for all build variants.</li>
+
+<li>
+Callback functions that might be called from a DLL are similarly macroized
+with <tt>JS_STATIC_DLL_CALLBACK</tt> (if the function otherwise would be
+static to hide its name) or <tt>JS_DLL_CALLBACK</tt> (this macro takes
+no type argument; it should be used after the return type and before the
+function name).</li>
+</ul>
+
+<h2>
+<a NAME="JSAPI"></a>Using the JS API</h2>
+
+<h4>
+Starting up</h4>
+
+<pre><tt>&nbsp;&nbsp;&nbsp; /*
+&nbsp;&nbsp;&nbsp;&nbsp; * Tune this to avoid wasting space for shallow stacks, while saving on
+&nbsp;&nbsp;&nbsp;&nbsp; * malloc overhead/fragmentation for deep or highly-variable stacks.
+&nbsp;&nbsp;&nbsp;&nbsp; */
+&nbsp;&nbsp;&nbsp; #define STACK_CHUNK_SIZE&nbsp;&nbsp;&nbsp; 8192
+
+&nbsp;&nbsp;&nbsp; JSRuntime *rt;
+&nbsp;&nbsp;&nbsp; JSContext *cx;
+
+&nbsp;&nbsp;&nbsp; /* You need a runtime and one or more contexts to do anything with JS. */
+&nbsp;&nbsp;&nbsp; rt = JS_NewRuntime(0x400000L);
+&nbsp;&nbsp;&nbsp; if (!rt)
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; fail("can't create JavaScript runtime");
+&nbsp;&nbsp;&nbsp; cx = JS_NewContext(rt, STACK_CHUNK_SIZE);
+&nbsp;&nbsp;&nbsp; if (!cx)
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; fail("can't create JavaScript context");
+
+&nbsp;&nbsp;&nbsp; /*
+&nbsp;&nbsp;&nbsp;&nbsp; * The context definitely wants a global object, in order to have standard
+&nbsp;&nbsp;&nbsp;&nbsp; * classes and functions like Date and parseInt.&nbsp; See below for details on
+&nbsp;&nbsp;&nbsp;&nbsp; * JS_NewObject.
+&nbsp;&nbsp;&nbsp;&nbsp; */
+&nbsp;&nbsp;&nbsp; JSObject *globalObj;
+
+&nbsp;&nbsp;&nbsp; globalObj = JS_NewObject(cx, &amp;my_global_class, 0, 0);
+&nbsp;&nbsp;&nbsp; JS_InitStandardClasses(cx, globalObj);</tt></pre>
+
+<h4>
+Defining objects and properties</h4>
+
+<pre><tt>&nbsp;&nbsp;&nbsp; /* Statically initialize a class to make "one-off" objects. */
+&nbsp;&nbsp;&nbsp; JSClass my_class = {
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; "MyClass",
+
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; /* All of these can be replaced with the corresponding JS_*Stub
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; function pointers. */
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; my_addProperty, my_delProperty, my_getProperty, my_setProperty,
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; my_enumerate,&nbsp;&nbsp; my_resolve,&nbsp;&nbsp;&nbsp;&nbsp; my_convert,&nbsp;&nbsp;&nbsp;&nbsp; my_finalize
+&nbsp;&nbsp;&nbsp; };
+
+&nbsp;&nbsp;&nbsp; JSObject *obj;
+
+&nbsp;&nbsp;&nbsp; /*
+&nbsp;&nbsp;&nbsp;&nbsp; * Define an object named in the global scope that can be enumerated by
+&nbsp;&nbsp;&nbsp;&nbsp; * for/in loops.&nbsp; The parent object is passed as the second argument, as
+&nbsp;&nbsp;&nbsp;&nbsp; * with all other API calls that take an object/name pair.&nbsp; The prototype
+&nbsp;&nbsp;&nbsp;&nbsp; * passed in is null, so the default object prototype will be used.
+&nbsp;&nbsp;&nbsp;&nbsp; */
+&nbsp;&nbsp;&nbsp; obj = JS_DefineObject(cx, globalObj, "myObject", &amp;my_class, NULL,
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; JSPROP_ENUMERATE);
+
+&nbsp;&nbsp;&nbsp; /*
+&nbsp;&nbsp;&nbsp;&nbsp; * Define a bunch of properties with a JSPropertySpec array statically
+&nbsp;&nbsp;&nbsp;&nbsp; * initialized and terminated with a null-name entry.&nbsp; Besides its name,
+&nbsp;&nbsp;&nbsp;&nbsp; * each property has a "tiny" identifier (MY_COLOR, e.g.) that can be used
+&nbsp;&nbsp;&nbsp;&nbsp; * in switch statements (in a common my_getProperty function, for example).
+&nbsp;&nbsp;&nbsp;&nbsp; */
+&nbsp;&nbsp;&nbsp; enum my_tinyid {
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; MY_COLOR, MY_HEIGHT, MY_WIDTH, MY_FUNNY, MY_ARRAY, MY_RDONLY
+&nbsp;&nbsp;&nbsp; };
+
+&nbsp;&nbsp;&nbsp; static JSPropertySpec my_props[] = {
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; {"color",&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; MY_COLOR,&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; JSPROP_ENUMERATE},
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; {"height",&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; MY_HEIGHT,&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; JSPROP_ENUMERATE},
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; {"width",&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; MY_WIDTH,&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; JSPROP_ENUMERATE},
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; {"funny",&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; MY_FUNNY,&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; JSPROP_ENUMERATE},
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; {"array",&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; MY_ARRAY,&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; JSPROP_ENUMERATE},
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; {"rdonly",&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; MY_RDONLY,&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; JSPROP_READONLY},
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; {0}
+&nbsp;&nbsp;&nbsp; };
+
+&nbsp;&nbsp;&nbsp; JS_DefineProperties(cx, obj, my_props);
+
+&nbsp;&nbsp;&nbsp; /*
+&nbsp;&nbsp;&nbsp;&nbsp; * Given the above definitions and call to JS_DefineProperties, obj will
+&nbsp;&nbsp;&nbsp;&nbsp; * need this sort of "getter" method in its class (my_class, above).&nbsp; See
+&nbsp;&nbsp;&nbsp;&nbsp; * the example for the "It" class in js.c.
+&nbsp;&nbsp;&nbsp;&nbsp; */
+&nbsp;&nbsp;&nbsp; static JSBool
+&nbsp;&nbsp;&nbsp; my_getProperty(JSContext *cx, JSObject *obj, jsval id, jsval *vp)
+&nbsp;&nbsp;&nbsp; {
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; if (JSVAL_IS_INT(id)) {
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; switch (JSVAL_TO_INT(id)) {
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; case MY_COLOR:&nbsp; *vp = . . .; break;
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; case MY_HEIGHT: *vp = . . .; break;
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; case MY_WIDTH:&nbsp; *vp = . . .; break;
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; case MY_FUNNY:&nbsp; *vp = . . .; break;
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; case MY_ARRAY:&nbsp; *vp = . . .; break;
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; case MY_RDONLY: *vp = . . .; break;
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; }
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; }
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; return JS_TRUE;
+&nbsp;&nbsp;&nbsp; }</tt></pre>
+
+<h4>
+Defining functions</h4>
+
+<pre><tt>&nbsp;&nbsp;&nbsp; /* Define a bunch of native functions first: */
+&nbsp;&nbsp;&nbsp; static JSBool
+&nbsp;&nbsp;&nbsp; my_abs(JSContext *cx, JSObject *obj, uintN argc, jsval *argv, jsval *rval)
+&nbsp;&nbsp;&nbsp; {
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; jsdouble x, z;
+
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; if (!JS_ValueToNumber(cx, argv[0], &amp;x))
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; return JS_FALSE;
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; z = (x &lt; 0) ? -x : x;
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; return JS_NewDoubleValue(cx, z, rval);
+&nbsp;&nbsp;&nbsp; }
+
+&nbsp;&nbsp;&nbsp; . . .
+
+&nbsp;&nbsp;&nbsp; /*
+&nbsp;&nbsp;&nbsp;&nbsp; * Use a JSFunctionSpec array terminated with a null name to define a
+&nbsp;&nbsp;&nbsp;&nbsp; * bunch of native functions.
+&nbsp;&nbsp;&nbsp;&nbsp; */
+&nbsp;&nbsp;&nbsp; static JSFunctionSpec my_functions[] = {
+&nbsp;&nbsp;&nbsp; /*&nbsp;&nbsp;&nbsp; name&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; native&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; nargs&nbsp;&nbsp;&nbsp; */
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; {"abs",&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; my_abs,&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; 1},
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; {"acos",&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; my_acos,&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; 1},
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; {"asin",&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; my_asin,&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; 1},
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; . . .
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; {0}
+&nbsp;&nbsp;&nbsp; };
+
+&nbsp;&nbsp;&nbsp; /*
+&nbsp;&nbsp;&nbsp;&nbsp; * Pass a particular object to define methods for it alone.&nbsp; If you pass
+&nbsp;&nbsp;&nbsp;&nbsp; * a prototype object, the methods will apply to all instances past and
+&nbsp;&nbsp;&nbsp;&nbsp; * future of the prototype's class (see below for classes).
+&nbsp;&nbsp;&nbsp;&nbsp; */
+&nbsp;&nbsp;&nbsp; JS_DefineFunctions(cx, globalObj, my_functions);</tt></pre>
+
+<h4>
+Defining classes</h4>
+
+<pre><tt>&nbsp;&nbsp;&nbsp; /*
+&nbsp;&nbsp;&nbsp;&nbsp; * This pulls together the above API elements by defining a constructor
+&nbsp;&nbsp;&nbsp;&nbsp; * function, a prototype object, and properties of the prototype and of
+&nbsp;&nbsp;&nbsp;&nbsp; * the constructor, all with one API call.
+&nbsp;&nbsp;&nbsp;&nbsp; *
+&nbsp;&nbsp;&nbsp;&nbsp; * Initialize a class by defining its constructor function, prototype, and
+&nbsp;&nbsp;&nbsp;&nbsp; * per-instance and per-class properties.&nbsp; The latter are called "static"
+&nbsp;&nbsp;&nbsp;&nbsp; * below by analogy to Java.&nbsp; They are defined in the constructor object's
+&nbsp;&nbsp;&nbsp;&nbsp; * scope, so that 'MyClass.myStaticProp' works along with 'new MyClass()'.
+&nbsp;&nbsp;&nbsp;&nbsp; *
+&nbsp;&nbsp;&nbsp;&nbsp; * JS_InitClass takes a lot of arguments, but you can pass null for any of
+&nbsp;&nbsp;&nbsp;&nbsp; * the last four if there are no such properties or methods.
+&nbsp;&nbsp;&nbsp;&nbsp; *
+&nbsp;&nbsp;&nbsp;&nbsp; * Note that you do not need to call JS_InitClass to make a new instance of
+&nbsp;&nbsp;&nbsp;&nbsp; * that class -- otherwise there would be a chicken-and-egg problem making
+&nbsp;&nbsp;&nbsp;&nbsp; * the global object -- but you should call JS_InitClass if you require a
+&nbsp;&nbsp;&nbsp;&nbsp; * constructor function for script authors to call via new, and/or a class
+&nbsp;&nbsp;&nbsp;&nbsp; * prototype object ('MyClass.prototype') for authors to extend with new
+&nbsp;&nbsp;&nbsp;&nbsp; * properties at run-time.  In general, if you want to support multiple
+&nbsp;&nbsp;&nbsp;&nbsp; * instances that share behavior, use JS_InitClass.
+&nbsp;&nbsp;&nbsp;&nbsp; */
+&nbsp;&nbsp;&nbsp; protoObj = JS_InitClass(cx, globalObj, NULL, &amp;my_class,
+
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; /* native constructor function and min arg count */
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; MyClass, 0,
+
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; /* prototype object properties and methods -- these
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; will be "inherited" by all instances through
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; delegation up the instance's prototype link. */
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; my_props, my_methods,
+
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; /* class constructor properties and methods */
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; my_static_props, my_static_methods);</tt></pre>
+
+<h4>
+Running scripts</h4>
+
+<pre><tt>&nbsp;&nbsp;&nbsp; /* These should indicate source location for diagnostics. */
+&nbsp;&nbsp;&nbsp; char *filename;
+&nbsp;&nbsp;&nbsp; uintN lineno;
+
+&nbsp;&nbsp;&nbsp; /*
+&nbsp;&nbsp;&nbsp;&nbsp; * The return value comes back here -- if it could be a GC thing, you must
+&nbsp;&nbsp;&nbsp;&nbsp; * add it to the GC's "root set" with JS_AddRoot(cx, &amp;thing) where thing
+&nbsp;&nbsp;&nbsp;&nbsp; * is a JSString *, JSObject *, or jsdouble *, and remove the root before
+&nbsp;&nbsp;&nbsp;&nbsp; * rval goes out of scope, or when rval is no longer needed.
+&nbsp;&nbsp;&nbsp;&nbsp; */
+&nbsp;&nbsp;&nbsp; jsval rval;
+&nbsp;&nbsp;&nbsp; JSBool ok;
+
+&nbsp;&nbsp;&nbsp; /*
+&nbsp;&nbsp;&nbsp;&nbsp; * Some example source in a C string.&nbsp; Larger, non-null-terminated buffers
+&nbsp;&nbsp;&nbsp;&nbsp; * can be used, if you pass the buffer length to JS_EvaluateScript.
+&nbsp;&nbsp;&nbsp;&nbsp; */
+&nbsp;&nbsp;&nbsp; char *source = "x * f(y)";
+
+&nbsp;&nbsp;&nbsp; ok = JS_EvaluateScript(cx, globalObj, source, strlen(source),
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; filename, lineno, &amp;rval);
+
+&nbsp;&nbsp;&nbsp; if (ok) {
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; /* Should get a number back from the example source. */
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; jsdouble d;
+
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; ok = JS_ValueToNumber(cx, rval, &amp;d);
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; . . .
+&nbsp;&nbsp;&nbsp; }</tt></pre>
+
+<h4>
+Calling functions</h4>
+
+<pre><tt>&nbsp;&nbsp;&nbsp; /* Call a global function named "foo" that takes no arguments. */
+&nbsp;&nbsp;&nbsp; ok = JS_CallFunctionName(cx, globalObj, "foo", 0, 0, &amp;rval);
+
+&nbsp;&nbsp;&nbsp; jsval argv[2];
+
+&nbsp;&nbsp;&nbsp; /* Call a function in obj's scope named "method", passing two arguments. */
+&nbsp;&nbsp;&nbsp; argv[0] = . . .;
+&nbsp;&nbsp;&nbsp; argv[1] = . . .;
+&nbsp;&nbsp;&nbsp; ok = JS_CallFunctionName(cx, obj, "method", 2, argv, &amp;rval);</tt></pre>
+
+<h4>
+Shutting down</h4>
+
+<pre><tt>&nbsp;&nbsp;&nbsp; /* For each context you've created: */
+&nbsp;&nbsp;&nbsp; JS_DestroyContext(cx);
+
+&nbsp;&nbsp;&nbsp; /* For each runtime: */
+&nbsp;&nbsp;&nbsp; JS_DestroyRuntime(rt);
+
+&nbsp;&nbsp;&nbsp; /* And finally: */
+&nbsp;&nbsp;&nbsp; JS_ShutDown();</tt></pre>
+
+<h4>
+Debugging API</h4>
+See the<tt> trap, untrap, watch, unwatch, line2pc</tt>, and <tt>pc2line</tt>
+commands in <tt>js.c</tt>. Also the (scant) comments in <i>jsdbgapi.h</i>.
+<h2>
+<a NAME="Design"></a>Design walk-through</h2>
+This section must be brief for now -- it could easily turn into a book.
+<h4>
+JS "JavaScript Proper"</h4>
+JS modules declare and implement the JavaScript compiler, interpreter,
+decompiler, GC and atom manager, and standard classes.
+<p>JavaScript uses untyped bytecode and runtime type tagging of data values.
+The <tt>jsval</tt> type is a signed machine word that contains either a
+signed integer value (if the low bit is set), or a type-tagged pointer
+or boolean value (if the low bit is clear). Tagged pointers all refer to
+8-byte-aligned things in the GC heap.
+<p>Objects consist of a possibly shared structural description, called
+the map or scope; and unshared property values in a vector, called the
+slots. Object properties are associated with nonnegative integers stored
+in <tt>jsval</tt>'s, or with atoms (unique string descriptors) if named
+by an identifier or a non-integral index expression.
+<p>Scripts contain bytecode, source annotations, and a pool of string,
+number, and identifier literals. Functions are objects that extend scripts
+or native functions with formal parameters, a literal syntax, and a distinct
+primitive type ("function").
+<p>The compiler consists of a recursive-descent parser and a random-logic
+rather than table-driven lexical scanner. Semantic and lexical feedback
+are used to disambiguate hard cases such as missing semicolons, assignable
+expressions ("lvalues" in C parlance), etc. The parser generates bytecode
+as it parses, using fixup lists for downward branches and code buffering
+and rewriting for exceptional cases such as for loops. It attempts no error
+recovery. The interpreter executes the bytecode of top-level scripts, and
+calls itself indirectly to interpret function bodies (which are also scripts).
+All state associated with an interpreter instance is passed through formal
+parameters to the interpreter entry point; most implicit state is collected
+in a type named JSContext. Therefore, all API and almost all other functions
+in JSRef take a JSContext pointer as their first argument.
+<p>The decompiler translates postfix bytecode into infix source by consulting
+a separate byte-sized code, called source notes, to disambiguate bytecodes
+that result from more than one grammatical production.
+<p>The GC is a mark-and-sweep, non-conservative (exact) collector. It
+can allocate only fixed-sized things -- the current size is two machine
+words. It is used to hold JS object and string descriptors (but not property
+lists or string bytes), and double-precision floating point numbers. It
+runs automatically only when maxbytes (as passed to <tt>JS_NewRuntime()</tt>)
+bytes of GC things have been allocated and another thing-allocation request
+is made. JS API users should call <tt>JS_GC()</tt> or <tt>JS_MaybeGC()</tt>
+between script executions or from the branch callback, as often as necessary.
+<p>An important point about the GC's "exactness": you must add roots for
+new objects created by your native methods if you store references to them
+into a non-JS structure in the malloc heap or in static data. Also, if
+you make a new object in a native method, but do not store it through the
+<tt>rval</tt>
+result parameter (see math_abs in the "Using the JS API" section above)
+so that it is in a known root, the object is guaranteed to survive only
+until another new object is created. Either lock the first new object when
+making two in a row, or store it in a root you've added, or store it via
+rval.
+See the <a href="http://www.mozilla.org/js/spidermonkey/gctips.html">GC tips</a>
+document for more.
+<p>The atom manager consists of a hash table associating strings uniquely
+with scanner/parser information such as keyword type, index in script or
+function literal pool, etc. Atoms play three roles in JSRef: as literals
+referred to by unaligned 16-bit immediate bytecode operands, as unique
+string descriptors for efficient property name hashing, and as members
+of the root GC set for exact GC.
+<p>Native objects and methods for arrays, booleans, dates, functions, numbers,
+and strings are implemented using the JS API and certain internal interfaces
+used as "fast paths".
+<p>In general, errors are signaled by false or unoverloaded-null return
+values, and are reported using <tt>JS_ReportError()</tt> or one of its
+variants by the lowest level in order to provide the most detail. Client
+code can substitute its own error reporting function and suppress errors,
+or reflect them into Java or some other runtime system as exceptions, GUI
+dialogs, etc..
+<h2>
+File walk-through (OUT OF DATE!)</h2>
+
+<h4>
+jsapi.c, jsapi.h</h4>
+The public API to be used by almost all client code.&nbsp; If your client
+code can't make do with <tt>jsapi.h</tt>, and must reach into a friend
+or private js* file, please let us know so we can extend <tt>jsapi.h</tt>
+to include what you need in a fashion that we can support over the long
+run.
+<h4>
+jspubtd.h, jsprvtd.h</h4>
+These files exist to group struct and scalar typedefs so they can be used
+everywhere without dragging in struct definitions from N different files.
+The <tt>jspubtd.h</tt> file contains public typedefs, and is included by
+<tt>jsapi.h</tt>.
+The <tt>jsprvtd.h</tt> file contains private typedefs and is included by
+various .h files that need type names, but not type sizes or declarations.
+<h4>
+jsdbgapi.c, jsdbgapi.h</h4>
+The Debugging API, still very much under development. Provided so far:
+<ul>
+<li>
+Traps, with which breakpoints, single-stepping, step over, step out, and
+so on can be implemented. The debugger will have to consult jsopcode.def
+on its own to figure out where to plant trap instructions to implement
+functions like step out, but a future jsdbgapi.h will provide convenience
+interfaces to do these things. At most one trap per bytecode can be set.
+When a script (<tt>JSScript</tt>) is destroyed, all traps set in its bytecode
+are cleared.</li>
+
+<li>
+Watchpoints, for intercepting set operations on properties and running
+a debugger-supplied function that receives the old value and a pointer
+to the new one, which it can use to modify the new value being set.</li>
+
+<li>
+Line number to PC and back mapping functions. The line-to-PC direction
+"rounds" toward the next bytecode generated from a line greater than or
+equal to the input line, and may return the PC of a for-loop update part,
+if given the line number of the loop body's closing brace. Any line after
+the last one in a script or function maps to a PC one byte beyond the last
+bytecode in the script. An example, from perfect.js:</li>
+
+<pre><tt>14&nbsp;&nbsp; function perfect(n)
+15&nbsp;&nbsp; {
+16&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; print("The perfect numbers up to " +&nbsp; n + " are:");
+17
+18&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; // We build sumOfDivisors[i] to hold a string expression for
+19&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; // the sum of the divisors of i, excluding i itself.
+20&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; var sumOfDivisors = new ExprArray(n+1,1);
+21&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; for (var divisor = 2; divisor &lt;= n; divisor++) {
+22&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; for (var j = divisor + divisor; j &lt;= n; j += divisor) {
+23&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; sumOfDivisors[j] += " + " + divisor;
+24&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; }
+25&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; // At this point everything up to 'divisor' has its sumOfDivisors
+26&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; // expression calculated, so we can determine whether it's perfect
+27&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; // already by evaluating.
+28&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; if (eval(sumOfDivisors[divisor]) == divisor) {
+29&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; print("" + divisor + " = " + sumOfDivisors[divisor]);
+30&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; }
+31&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; }
+32&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; delete sumOfDivisors;
+33&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; print("That's all.");
+34&nbsp;&nbsp; }</tt></pre>
+The line number to PC and back mappings can be tested using the js program
+with the following script:
+<pre><tt>&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; load("perfect.js")
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; print(perfect)
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; dis(perfect)
+
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; print()
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; for (var ln = 0; ln &lt;= 40; ln++) {
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; var pc = line2pc(perfect,ln)
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; var ln2 = pc2line(perfect,pc)
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; print("\tline " + ln + " => pc " + pc + " => line " + ln2)
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; }</tt></pre>
+The result of the for loop over lines 0 to 40 inclusive is:
+<pre><tt>&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 0 => pc 0 => line 16
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 1 => pc 0 => line 16
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 2 => pc 0 => line 16
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 3 => pc 0 => line 16
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 4 => pc 0 => line 16
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 5 => pc 0 => line 16
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 6 => pc 0 => line 16
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 7 => pc 0 => line 16
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 8 => pc 0 => line 16
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 9 => pc 0 => line 16
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 10 => pc 0 => line 16
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 11 => pc 0 => line 16
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 12 => pc 0 => line 16
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 13 => pc 0 => line 16
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 14 => pc 0 => line 16
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 15 => pc 0 => line 16
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 16 => pc 0 => line 16
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 17 => pc 19 => line 20
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 18 => pc 19 => line 20
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 19 => pc 19 => line 20
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 20 => pc 19 => line 20
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 21 => pc 36 => line 21
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 22 => pc 53 => line 22
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 23 => pc 74 => line 23
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 24 => pc 92 => line 22
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 25 => pc 106 => line 28
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 26 => pc 106 => line 28
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 27 => pc 106 => line 28
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 28 => pc 106 => line 28
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 29 => pc 127 => line 29
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 30 => pc 154 => line 21
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 31 => pc 154 => line 21
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 32 => pc 161 => line 32
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 33 => pc 172 => line 33
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 34 => pc 172 => line 33
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 35 => pc 172 => line 33
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 36 => pc 172 => line 33
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 37 => pc 172 => line 33
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 38 => pc 172 => line 33
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 39 => pc 172 => line 33
+&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp; line 40 => pc 172 => line 33</tt></pre>
+</ul>
+
+<h4>
+jsconfig.h</h4>
+Various configuration macros defined as 0 or 1 depending on how <tt>JS_VERSION</tt>
+is defined (as 10 for JavaScript 1.0, 11 for JavaScript 1.1, etc.). Not
+all macros are tested around related code yet. In particular, JS 1.0 support
+is missing from JSRef. JS 1.2 support will appear in a future JSRef release.
+<br>&nbsp;
+<h4>
+js.c</h4>
+The "JS shell", a simple interpreter program that uses the JS API and more
+than a few internal interfaces (some of these internal interfaces could
+be replaced by <tt>jsapi.h</tt> calls). The js program built from this
+source provides a test vehicle for evaluating scripts and calling functions,
+trying out new debugger primitives, etc.
+<h4>
+jsarray.*, jsbool.*, jdsdate.*, jsfun.*, jsmath.*, jsnum.*, jsstr.*</h4>
+These file pairs implement the standard classes and (where they exist)
+their underlying primitive types. They have similar structure, generally
+starting with class definitions and continuing with internal constructors,
+finalizers, and helper functions.
+<h4>
+jsobj.*, jsscope.*</h4>
+These two pairs declare and implement the JS object system. All of the
+following happen here:
+<ul>
+<li>
+creating objects by class and prototype, and finalizing objects;</li>
+
+<li>
+defining, looking up, getting, setting, and deleting properties;</li>
+
+<li>
+creating and destroying properties and binding names to them.</li>
+</ul>
+The details of a native object's map (scope) are mostly hidden in
+<tt>jsscope.[ch]</tt>.
+<h4>
+jsatom.c, jsatom.h</h4>
+The atom manager. Contains well-known string constants, their atoms, the
+global atom hash table and related state, the js_Atomize() function that
+turns a counted string of bytes into an atom, and literal pool (<tt>JSAtomMap</tt>)
+methods.
+<h4>
+jsgc.c, jsgc.h</h4>
+[TBD]
+<h4>
+jsinterp.*, jscntxt.*</h4>
+The bytecode interpreter, and related functions such as Call and AllocStack,
+live in <i>jsinterp.c</i>. The JSContext constructor and destructor are
+factored out into <i>jscntxt.c</i> for minimal linking when the compiler
+part of JS is split from the interpreter part into a separate program.
+<h4>
+jsemit.*, jsopcode.tbl, jsopcode.*, jsparse.*, jsscan.*, jsscript.*</h4>
+Compiler and decompiler modules. The <i>jsopcode.tbl</i> file is a C preprocessor
+source that defines almost everything there is to know about JS bytecodes.
+See its major comment for how to use it. For now, a debugger will use it
+and its dependents such as <i>jsopcode.h</i> directly, but over time we
+intend to extend <i>jsdbgapi.h</i> to hide uninteresting details and provide
+conveniences. The code generator is split across paragraphs of code in
+<i>jsparse.c</i>,
+and the utility methods called on <tt>JSCodeGenerator</tt> appear in <i>jsemit.c</i>.
+Source notes generated by <i>jsparse.c</i> and
+<i>jsemit.c</i> are used
+in <i>jsscript.c</i> to map line number to program counter and back.
+<h4>
+jstypes.h, jslog2.c</h4>
+Fundamental representation types and utility macros. This file alone among
+all .h files in JSRef must be included first by .c files. It is not nested
+in .h files, as other prerequisite .h files generally are, since it is
+also a direct dependency of most .c files and would be over-included if
+nested in addition to being directly included. The one "not-quite-a-macro
+macro" is the <tt>JS_CeilingLog2()</tt> function in <i>jslog2.c</i>.
+<h4>
+jsarena.c, jsarena.h</h4>
+Last-In-First-Out allocation macros that amortize malloc costs and allow
+for en-masse freeing. See the paper mentioned in prarena.h's major comment.
+<h4>
+jsutil.c, jsutil.h</h4>
+The <tt>JS_ASSERT</tt> macro is used throughout JSRef source as a proof
+device to make invariants and preconditions clear to the reader, and to
+hold the line during maintenance and evolution against regressions or violations
+of assumptions that it would be too expensive to test unconditionally at
+run-time. Certain assertions are followed by run-time tests that cope with
+assertion failure, but only where I'm too smart or paranoid to believe
+the assertion will never fail...
+<h4>
+jsclist.h</h4>
+Doubly-linked circular list struct and macros.
+<h4>
+jscpucfg.c</h4>
+This standalone program generates <i>jscpucfg.h</i>, a header file containing
+bytes per word and other constants that depend on CPU architecture and
+C compiler type model. It tries to discover most of these constants by
+running its own experiments on the build host, so if you are cross-compiling,
+beware.
+<h4>
+prdtoa.c, prdtoa.h</h4>
+David Gay's portable double-precision floating point to string conversion
+code, with Permission To Use notice included.
+<h4>
+prhash.c, prhash.h</h4>
+Portable, extensible hash tables. These use multiplicative hash for strength
+reduction over division hash, yet with very good key distribution over
+power of two table sizes. Collisions resolve via chaining, so each entry
+burns a malloc and can fragment the heap.
+<h4>
+prlong.c, prlong.h</h4>
+64-bit integer emulation, and compatible macros that use C's long long
+type where it exists (my last company mapped long long to a 128-bit type,
+but no real architecture does 128-bit ints yet).
+<h4>
+jsosdep.h</h4>
+Annoying OS dependencies rationalized into a few "feature-test" macros
+such as <tt>JS_HAVE_LONG_LONG</tt>.
+<h4>
+jsprf.*</h4>
+Portable, buffer-overrun-resistant sprintf and friends. For no good reason
+save lack of time, the %e, %f, and %g formats cause your system's native
+sprintf, rather than <tt>JS_dtoa()</tt>, to be used. This bug doesn't affect
+JSRef, because it uses its own <tt>JS_dtoa()</tt> call in <i>jsnum.c</i>
+to convert from double to string, but it's a bug that we'll fix later,
+and one you should be aware of if you intend to use a <tt>JS_*printf()</tt>&nbsp;
+function with your own floating type arguments - various vendor sprintf's
+mishandle NaN, +/-Inf, and some even print normal floating values inaccurately.
+<h4>
+prmjtime.c, prmjtime.h</h4>
+Time functions. These interfaces are named in a way that makes local vs.
+universal time confusion likely. Caveat emptor, and we're working on it.
+To make matters worse, Java (and therefore JavaScript) uses "local" time
+numbers (offsets from the epoch) in its Date class.
+
+
+<h2>
+<a NAME="Resources"></a>Additional Resources (links, API docs, and newsgroups)</h2>
+<ul>
+<li><a href ="http://www.mozilla.org/js/">http://www.mozilla.org/js/</a>
+<li><a href ="http://www.mozilla.org/js/spidermonkey/">http://www.mozilla.org/js/spidermonkey/</a>
+<li><a href ="news://news.mozilla.org/netscape.public.mozilla.jseng">news://news.mozilla.org/netscape.public.mozilla.jseng</a>
+</ul>
+
+
+
+</body>
+</html>

mozilla/js/src/SpiderMonkey.rsp

@@ -0,0 +1,12 @@
+mozilla/js/src/*
+mozilla/js/src/config/*
+mozilla/js/src/fdlibm/*
+mozilla/js/src/liveconnect/*
+mozilla/js/src/liveconnect/_jni/*
+mozilla/js/src/liveconnect/classes/*
+mozilla/js/src/liveconnect/classes/netscape/*
+mozilla/js/src/liveconnect/classes/netscape/javascript/*
+mozilla/js/src/liveconnect/config/*
+mozilla/js/src/liveconnect/macbuild/*
+mozilla/js/src/liveconnect/macbuild/JavaSession/*
+mozilla/js/src/macbuild/*

mozilla/js/src/config.mk

@@ -0,0 +1,166 @@
+# -*- Mode: makefile -*-
+# 
+# ***** BEGIN LICENSE BLOCK *****
+# Version: MPL 1.1/GPL 2.0/LGPL 2.1
+#
+# The contents of this file are subject to the Mozilla Public License Version
+# 1.1 (the "License"); you may not use this file except in compliance with
+# the License. You may obtain a copy of the License at
+# http://www.mozilla.org/MPL/
+#
+# Software distributed under the License is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+# for the specific language governing rights and limitations under the
+# License.
+# 
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+# 
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998-1999
+# the Initial Developer. All Rights Reserved.
+# 
+# Contributor(s):
+# 
+# Alternatively, the contents of this file may be used under the terms of
+# either of the GNU General Public License Version 2 or later (the "GPL"),
+# or the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+# in which case the provisions of the GPL or the LGPL are applicable instead
+# of those above. If you wish to allow use of your version of this file only
+# under the terms of either the GPL or the LGPL, and not to allow others to
+# use your version of this file under the terms of the MPL, indicate your
+# decision by deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL or the LGPL. If you do not delete
+# the provisions above, a recipient may use your version of this file under
+# the terms of any one of the MPL, the GPL or the LGPL.
+# 
+# ***** END LICENSE BLOCK *****
+
+ifdef JS_DIST
+DIST = $(JS_DIST)
+else
+DIST = $(DEPTH)/../../dist/$(OBJDIR)
+endif
+
+# Set os+release dependent make variables
+OS_ARCH         := $(subst /,_,$(shell uname -s | sed /\ /s//_/))
+
+# Attempt to differentiate between SunOS 5.4 and x86 5.4
+OS_CPUARCH      := $(shell uname -m)
+ifeq ($(OS_CPUARCH),i86pc)
+OS_RELEASE      := $(shell uname -r)_$(OS_CPUARCH)
+else
+ifeq ($(OS_ARCH),AIX)
+OS_RELEASE      := $(shell uname -v).$(shell uname -r)
+else
+OS_RELEASE      := $(shell uname -r)
+endif
+endif
+ifeq ($(OS_ARCH),IRIX64)
+OS_ARCH         := IRIX
+endif
+
+# Handle output from win32 unames other than Netscape's version
+ifeq (,$(filter-out Windows_95 Windows_98 CYGWIN_95-4.0 CYGWIN_98-4.10, $(OS_ARCH)))
+	OS_ARCH   := WIN95
+endif
+ifeq ($(OS_ARCH),WIN95)
+	OS_ARCH	   := WINNT
+	OS_RELEASE := 4.0
+endif
+ifeq ($(OS_ARCH), Windows_NT)
+	OS_ARCH    := WINNT
+	OS_MINOR_RELEASE := $(shell uname -v)
+	ifeq ($(OS_MINOR_RELEASE),00)
+		OS_MINOR_RELEASE = 0
+	endif
+	OS_RELEASE := $(OS_RELEASE).$(OS_MINOR_RELEASE)
+endif
+ifeq (CYGWIN_NT,$(findstring CYGWIN_NT,$(OS_ARCH)))
+	OS_RELEASE := $(patsubst CYGWIN_NT-%,%,$(OS_ARCH))
+	OS_ARCH    := WINNT
+endif
+ifeq ($(OS_ARCH), CYGWIN32_NT)
+	OS_ARCH    := WINNT
+endif
+
+# Virtually all Linux versions are identical.
+# Any distinctions are handled in linux.h
+ifeq ($(OS_ARCH),Linux)
+OS_CONFIG      := Linux_All
+else
+ifeq ($(OS_ARCH),dgux)
+OS_CONFIG      := dgux
+else
+ifeq ($(OS_ARCH),Darwin)
+OS_CONFIG      := Darwin
+else
+OS_CONFIG       := $(OS_ARCH)$(OS_OBJTYPE)$(OS_RELEASE)
+endif
+endif
+endif
+
+ASFLAGS         =
+DEFINES         =
+
+ifeq ($(OS_ARCH), WINNT)
+INSTALL = nsinstall
+CP = cp
+else
+INSTALL	= $(DEPTH)/../../dist/$(OBJDIR)/bin/nsinstall
+CP = cp
+endif
+
+ifdef BUILD_OPT
+OPTIMIZER  = -O
+DEFINES    += -UDEBUG -DNDEBUG -UDEBUG_$(shell whoami)
+OBJDIR_TAG = _OPT
+else
+ifdef USE_MSVC
+OPTIMIZER  = -Zi
+else
+OPTIMIZER  = -g
+endif
+DEFINES    += -DDEBUG -DDEBUG_$(shell whoami)
+OBJDIR_TAG = _DBG
+endif
+
+SO_SUFFIX = so
+
+NS_USE_NATIVE = 1
+
+# Java stuff
+CLASSDIR     = $(DEPTH)/liveconnect/classes
+JAVA_CLASSES = $(patsubst %.java,%.class,$(JAVA_SRCS))
+TARGETS     += $(addprefix $(CLASSDIR)/$(OBJDIR)/$(JARPATH)/, $(JAVA_CLASSES))
+JAVAC        = $(JDK)/bin/javac
+JAVAC_FLAGS  = -classpath "$(CLASSPATH)" -d $(CLASSDIR)/$(OBJDIR)
+ifeq ($(OS_ARCH), WINNT)
+  SEP        = ;
+else
+  SEP        = :
+endif
+CLASSPATH    = $(JDK)/lib/classes.zip$(SEP)$(CLASSDIR)/$(OBJDIR)
+
+include $(DEPTH)/config/$(OS_CONFIG).mk
+
+# Name of the binary code directories
+ifdef BUILD_IDG
+OBJDIR          = $(OS_CONFIG)$(OBJDIR_TAG).OBJD
+else
+OBJDIR          = $(OS_CONFIG)$(OBJDIR_TAG).OBJ
+endif
+VPATH           = $(OBJDIR)
+
+# Automatic make dependencies file
+DEPENDENCIES    = $(OBJDIR)/.md
+
+LCJAR = js15lc30.jar
+
+# Library name
+LIBDIR := lib
+ifeq ($(CPU_ARCH), x86_64)
+LIBDIR := lib64
+endif
+

mozilla/js/src/config/AIX4.1.mk

@@ -0,0 +1,65 @@
+# -*- Mode: makefile -*-
+#
+# ***** BEGIN LICENSE BLOCK *****
+# Version: MPL 1.1/GPL 2.0/LGPL 2.1
+#
+# The contents of this file are subject to the Mozilla Public License Version
+# 1.1 (the "License"); you may not use this file except in compliance with
+# the License. You may obtain a copy of the License at
+# http://www.mozilla.org/MPL/
+#
+# Software distributed under the License is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+# for the specific language governing rights and limitations under the
+# License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#
+# Alternatively, the contents of this file may be used under the terms of
+# either the GNU General Public License Version 2 or later (the "GPL"), or
+# the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+# in which case the provisions of the GPL or the LGPL are applicable instead
+# of those above. If you wish to allow use of your version of this file only
+# under the terms of either the GPL or the LGPL, and not to allow others to
+# use your version of this file under the terms of the MPL, indicate your
+# decision by deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL or the LGPL. If you do not delete
+# the provisions above, a recipient may use your version of this file under
+# the terms of any one of the MPL, the GPL or the LGPL.
+#
+# ***** END LICENSE BLOCK *****
+
+#
+# Config stuff for AIX
+#
+
+CC = xlC_r
+CCC = xlC_r
+
+RANLIB = ranlib
+
+#.c.o:
+#	$(CC) -c -MD $*.d $(CFLAGS) $<
+ARCH := aix
+CPU_ARCH = rs6000
+GFX_ARCH = x
+INLINES = js_compare_and_swap:js_fast_lock1:js_fast_unlock1:js_lock_get_slot:js_lock_set_slot:js_lock_scope1
+
+OS_CFLAGS = -qarch=com -qinline+$(INLINES) -DXP_UNIX -DAIX -DAIXV3 -DSYSV -DHAVE_LOCALTIME_R
+OS_LIBS = -lbsd -lsvld -lm
+#-lpthreads -lc_r
+
+MKSHLIB = $(LD) -bM:SRE -bh:4 -bnoentry -berok
+XLDFLAGS += -lc
+
+ifdef JS_THREADSAFE
+XLDFLAGS += -lsvld
+endif

mozilla/js/src/config/AIX4.2.mk

@@ -0,0 +1,64 @@
+# -*- Mode: makefile -*-
+#
+# ***** BEGIN LICENSE BLOCK *****
+# Version: MPL 1.1/GPL 2.0/LGPL 2.1
+#
+# The contents of this file are subject to the Mozilla Public License Version
+# 1.1 (the "License"); you may not use this file except in compliance with
+# the License. You may obtain a copy of the License at
+# http://www.mozilla.org/MPL/
+#
+# Software distributed under the License is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+# for the specific language governing rights and limitations under the
+# License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#
+# Alternatively, the contents of this file may be used under the terms of
+# either the GNU General Public License Version 2 or later (the "GPL"), or
+# the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+# in which case the provisions of the GPL or the LGPL are applicable instead
+# of those above. If you wish to allow use of your version of this file only
+# under the terms of either the GPL or the LGPL, and not to allow others to
+# use your version of this file under the terms of the MPL, indicate your
+# decision by deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL or the LGPL. If you do not delete
+# the provisions above, a recipient may use your version of this file under
+# the terms of any one of the MPL, the GPL or the LGPL.
+#
+# ***** END LICENSE BLOCK *****
+
+#
+# Config stuff for AIX
+#
+
+CC = xlC_r
+CCC = xlC_r
+CFLAGS += -qarch=com -qnoansialias -qinline+$(INLINES) -DXP_UNIX -DAIX -DAIXV3 -DSYSV -DHAVE_LOCALTIME_R
+
+RANLIB = ranlib
+
+#.c.o:
+#	$(CC) -c -MD $*.d $(CFLAGS) $<
+ARCH := aix
+CPU_ARCH = rs6000
+GFX_ARCH = x
+INLINES = js_compare_and_swap:js_fast_lock1:js_fast_unlock1:js_lock_get_slot:js_lock_set_slot:js_lock_scope1
+
+#-lpthreads -lc_r
+
+MKSHLIB = /usr/lpp/xlC/bin/makeC++SharedLib_r -p 0 -G -berok
+
+ifdef JS_THREADSAFE
+XLDFLAGS += -ldl
+endif
+

mozilla/js/src/config/AIX4.3.mk

@@ -0,0 +1,65 @@
+# -*- Mode: makefile -*-
+#
+# ***** BEGIN LICENSE BLOCK *****
+# Version: MPL 1.1/GPL 2.0/LGPL 2.1
+#
+# The contents of this file are subject to the Mozilla Public License Version
+# 1.1 (the "License"); you may not use this file except in compliance with
+# the License. You may obtain a copy of the License at
+# http://www.mozilla.org/MPL/
+#
+# Software distributed under the License is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+# for the specific language governing rights and limitations under the
+# License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#
+# Alternatively, the contents of this file may be used under the terms of
+# either the GNU General Public License Version 2 or later (the "GPL"), or
+# the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+# in which case the provisions of the GPL or the LGPL are applicable instead
+# of those above. If you wish to allow use of your version of this file only
+# under the terms of either the GPL or the LGPL, and not to allow others to
+# use your version of this file under the terms of the MPL, indicate your
+# decision by deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL or the LGPL. If you do not delete
+# the provisions above, a recipient may use your version of this file under
+# the terms of any one of the MPL, the GPL or the LGPL.
+#
+# ***** END LICENSE BLOCK *****
+
+#
+# Config stuff for AIX
+#
+
+CC = xlC_r
+CCC = xlC_r
+CFLAGS += -qarch=com -qnoansialias -qinline+$(INLINES) -DXP_UNIX -DAIX -DAIXV3 -DSYSV -DAIX4_3 -DHAVE_LOCALTIME_R
+
+RANLIB = ranlib
+
+#.c.o:
+#	$(CC) -c -MD $*.d $(CFLAGS) $<
+ARCH := aix
+CPU_ARCH = rs6000
+GFX_ARCH = x
+INLINES = js_compare_and_swap:js_fast_lock1:js_fast_unlock1:js_lock_get_slot:js_lock_set_slot:js_lock_scope1
+
+#-lpthreads -lc_r
+
+MKSHLIB_BIN = /usr/ibmcxx/bin/makeC++SharedLib_r
+MKSHLIB = $(MKSHLIB_BIN) -p 0 -G -berok -bM:UR
+
+ifdef JS_THREADSAFE
+XLDFLAGS += -ldl
+endif
+

mozilla/js/src/config/Darwin.mk

@@ -0,0 +1,81 @@
+# -*- Mode: makefile -*-
+#
+# ***** BEGIN LICENSE BLOCK *****
+# Version: MPL 1.1/GPL 2.0/LGPL 2.1
+#
+# The contents of this file are subject to the Mozilla Public License Version
+# 1.1 (the "License"); you may not use this file except in compliance with
+# the License. You may obtain a copy of the License at
+# http://www.mozilla.org/MPL/
+#
+# Software distributed under the License is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+# for the specific language governing rights and limitations under the
+# License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#   Steve Zellers (zellers@apple.com)
+#
+# Alternatively, the contents of this file may be used under the terms of
+# either the GNU General Public License Version 2 or later (the "GPL"), or
+# the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+# in which case the provisions of the GPL or the LGPL are applicable instead
+# of those above. If you wish to allow use of your version of this file only
+# under the terms of either the GPL or the LGPL, and not to allow others to
+# use your version of this file under the terms of the MPL, indicate your
+# decision by deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL or the LGPL. If you do not delete
+# the provisions above, a recipient may use your version of this file under
+# the terms of any one of the MPL, the GPL or the LGPL.
+#
+# ***** END LICENSE BLOCK *****
+
+#
+# Config for Mac OS X as of PR3
+# Just ripped from Linux config
+#
+
+CC = cc
+CCC = g++
+CFLAGS +=  -Wall -Wno-format
+OS_CFLAGS = -DXP_UNIX -DSVR4 -DSYSV -D_BSD_SOURCE -DPOSIX_SOURCE -DDARWIN
+
+RANLIB = ranlib
+MKSHLIB = libtool $(XMKSHLIBOPTS) -framework System
+
+#.c.o:
+#      $(CC) -c -MD $*.d $(CFLAGS) $<
+
+CPU_ARCH = $(shell uname -m)
+ifeq (86,$(findstring 86,$(CPU_ARCH)))
+CPU_ARCH = x86
+OS_CFLAGS+= -DX86_LINUX
+endif
+GFX_ARCH = x
+
+OS_LIBS = -lc -framework System
+
+ASFLAGS += -x assembler-with-cpp
+
+ifeq ($(CPU_ARCH),alpha)
+
+# Ask the C compiler on alpha linux to let us work with denormalized
+# double values, which are required by the ECMA spec.
+
+OS_CFLAGS += -mieee
+endif
+
+# Use the editline library to provide line-editing support.
+JS_EDITLINE = 1
+
+# Don't allow Makefile.ref to use libmath
+NO_LIBM = 1
+

mozilla/js/src/config/Darwin1.3.mk

@@ -0,0 +1,81 @@
+# -*- Mode: makefile -*-
+#
+# ***** BEGIN LICENSE BLOCK *****
+# Version: MPL 1.1/GPL 2.0/LGPL 2.1
+#
+# The contents of this file are subject to the Mozilla Public License Version
+# 1.1 (the "License"); you may not use this file except in compliance with
+# the License. You may obtain a copy of the License at
+# http://www.mozilla.org/MPL/
+#
+# Software distributed under the License is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+# for the specific language governing rights and limitations under the
+# License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#   Steve Zellers (zellers@apple.com)
+#
+# Alternatively, the contents of this file may be used under the terms of
+# either the GNU General Public License Version 2 or later (the "GPL"), or
+# the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+# in which case the provisions of the GPL or the LGPL are applicable instead
+# of those above. If you wish to allow use of your version of this file only
+# under the terms of either the GPL or the LGPL, and not to allow others to
+# use your version of this file under the terms of the MPL, indicate your
+# decision by deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL or the LGPL. If you do not delete
+# the provisions above, a recipient may use your version of this file under
+# the terms of any one of the MPL, the GPL or the LGPL.
+#
+# ***** END LICENSE BLOCK *****
+
+#
+# Config for Mac OS X as of PR3
+# Just ripped from Linux config
+#
+
+CC = cc
+CCC = g++
+CFLAGS +=  -Wall -Wno-format
+OS_CFLAGS = -DXP_UNIX -DSVR4 -DSYSV -D_BSD_SOURCE -DPOSIX_SOURCE -DRHAPSODY
+
+RANLIB = ranlib
+MKSHLIB = libtool $(XMKSHLIBOPTS) -framework System
+
+#.c.o:
+#      $(CC) -c -MD $*.d $(CFLAGS) $<
+
+CPU_ARCH = $(shell uname -m)
+ifeq (86,$(findstring 86,$(CPU_ARCH)))
+CPU_ARCH = x86
+OS_CFLAGS+= -DX86_LINUX
+endif
+GFX_ARCH = x
+
+OS_LIBS = -lc -framework System
+
+ASFLAGS += -x assembler-with-cpp
+
+ifeq ($(CPU_ARCH),alpha)
+
+# Ask the C compiler on alpha linux to let us work with denormalized
+# double values, which are required by the ECMA spec.
+
+OS_CFLAGS += -mieee
+endif
+
+# Use the editline library to provide line-editing support.
+JS_EDITLINE = 1
+
+# Don't allow Makefile.ref to use libmath
+NO_LIBM = 1
+

mozilla/js/src/config/Darwin1.4.mk

@@ -0,0 +1,41 @@
+# -*- Mode: makefile -*-
+#
+# ***** BEGIN LICENSE BLOCK *****
+# Version: MPL 1.1/GPL 2.0/LGPL 2.1
+#
+# The contents of this file are subject to the Mozilla Public License Version
+# 1.1 (the "License"); you may not use this file except in compliance with
+# the License. You may obtain a copy of the License at
+# http://www.mozilla.org/MPL/
+#
+# Software distributed under the License is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+# for the specific language governing rights and limitations under the
+# License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#   Mike McCabe <mike+mozilla@meer.net>
+#
+# Alternatively, the contents of this file may be used under the terms of
+# either the GNU General Public License Version 2 or later (the "GPL"), or
+# the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+# in which case the provisions of the GPL or the LGPL are applicable instead
+# of those above. If you wish to allow use of your version of this file only
+# under the terms of either the GPL or the LGPL, and not to allow others to
+# use your version of this file under the terms of the MPL, indicate your
+# decision by deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL or the LGPL. If you do not delete
+# the provisions above, a recipient may use your version of this file under
+# the terms of any one of the MPL, the GPL or the LGPL.
+#
+# ***** END LICENSE BLOCK *****
+
+include $(DEPTH)/config/Darwin1.3.mk

mozilla/js/src/config/Darwin5.2.mk

@@ -0,0 +1,81 @@
+# -*- Mode: makefile -*-
+#
+# ***** BEGIN LICENSE BLOCK *****
+# Version: MPL 1.1/GPL 2.0/LGPL 2.1
+#
+# The contents of this file are subject to the Mozilla Public License Version
+# 1.1 (the "License"); you may not use this file except in compliance with
+# the License. You may obtain a copy of the License at
+# http://www.mozilla.org/MPL/
+#
+# Software distributed under the License is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+# for the specific language governing rights and limitations under the
+# License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#   Steve Zellers (zellers@apple.com)
+#
+# Alternatively, the contents of this file may be used under the terms of
+# either the GNU General Public License Version 2 or later (the "GPL"), or
+# the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+# in which case the provisions of the GPL or the LGPL are applicable instead
+# of those above. If you wish to allow use of your version of this file only
+# under the terms of either the GPL or the LGPL, and not to allow others to
+# use your version of this file under the terms of the MPL, indicate your
+# decision by deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL or the LGPL. If you do not delete
+# the provisions above, a recipient may use your version of this file under
+# the terms of any one of the MPL, the GPL or the LGPL.
+#
+# ***** END LICENSE BLOCK *****
+
+#
+# Config for Mac OS X as of PR3
+# Just ripped from Linux config
+#
+
+CC = cc
+CCC = g++
+CFLAGS +=  -Wall -Wno-format
+OS_CFLAGS = -DXP_UNIX -DSVR4 -DSYSV -D_BSD_SOURCE -DPOSIX_SOURCE -DDARWIN
+
+RANLIB = ranlib
+MKSHLIB = libtool $(XMKSHLIBOPTS) -framework System
+
+#.c.o:
+#      $(CC) -c -MD $*.d $(CFLAGS) $<
+
+CPU_ARCH = $(shell uname -m)
+ifeq (86,$(findstring 86,$(CPU_ARCH)))
+CPU_ARCH = x86
+OS_CFLAGS+= -DX86_LINUX
+endif
+GFX_ARCH = x
+
+OS_LIBS = -lc -framework System
+
+ASFLAGS += -x assembler-with-cpp
+
+ifeq ($(CPU_ARCH),alpha)
+
+# Ask the C compiler on alpha linux to let us work with denormalized
+# double values, which are required by the ECMA spec.
+
+OS_CFLAGS += -mieee
+endif
+
+# Use the editline library to provide line-editing support.
+JS_EDITLINE = 1
+
+# Don't allow Makefile.ref to use libmath
+NO_LIBM = 1
+

mozilla/js/src/config/Darwin5.3.mk

@@ -0,0 +1,81 @@
+# -*- Mode: makefile -*-
+#
+# ***** BEGIN LICENSE BLOCK *****
+# Version: MPL 1.1/GPL 2.0/LGPL 2.1
+#
+# The contents of this file are subject to the Mozilla Public License Version
+# 1.1 (the "License"); you may not use this file except in compliance with
+# the License. You may obtain a copy of the License at
+# http://www.mozilla.org/MPL/
+#
+# Software distributed under the License is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+# for the specific language governing rights and limitations under the
+# License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#   Steve Zellers (zellers@apple.com)
+#
+# Alternatively, the contents of this file may be used under the terms of
+# either the GNU General Public License Version 2 or later (the "GPL"), or
+# the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+# in which case the provisions of the GPL or the LGPL are applicable instead
+# of those above. If you wish to allow use of your version of this file only
+# under the terms of either the GPL or the LGPL, and not to allow others to
+# use your version of this file under the terms of the MPL, indicate your
+# decision by deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL or the LGPL. If you do not delete
+# the provisions above, a recipient may use your version of this file under
+# the terms of any one of the MPL, the GPL or the LGPL.
+#
+# ***** END LICENSE BLOCK *****
+
+#
+# Config for Mac OS X as of PR3
+# Just ripped from Linux config
+#
+
+CC = cc
+CCC = g++
+CFLAGS +=  -Wall -Wno-format
+OS_CFLAGS = -DXP_UNIX -DSVR4 -DSYSV -D_BSD_SOURCE -DPOSIX_SOURCE -DDARWIN
+
+RANLIB = ranlib
+MKSHLIB = libtool $(XMKSHLIBOPTS) -framework System
+
+#.c.o:
+#      $(CC) -c -MD $*.d $(CFLAGS) $<
+
+CPU_ARCH = $(shell uname -m)
+ifeq (86,$(findstring 86,$(CPU_ARCH)))
+CPU_ARCH = x86
+OS_CFLAGS+= -DX86_LINUX
+endif
+GFX_ARCH = x
+
+OS_LIBS = -lc -framework System
+
+ASFLAGS += -x assembler-with-cpp
+
+ifeq ($(CPU_ARCH),alpha)
+
+# Ask the C compiler on alpha linux to let us work with denormalized
+# double values, which are required by the ECMA spec.
+
+OS_CFLAGS += -mieee
+endif
+
+# Use the editline library to provide line-editing support.
+JS_EDITLINE = 1
+
+# Don't allow Makefile.ref to use libmath
+NO_LIBM = 1
+

mozilla/js/src/config/HP-UXB.10.10.mk

@@ -0,0 +1,77 @@
+# -*- Mode: makefile -*-
+#
+# ***** BEGIN LICENSE BLOCK *****
+# Version: MPL 1.1/GPL 2.0/LGPL 2.1
+#
+# The contents of this file are subject to the Mozilla Public License Version
+# 1.1 (the "License"); you may not use this file except in compliance with
+# the License. You may obtain a copy of the License at
+# http://www.mozilla.org/MPL/
+#
+# Software distributed under the License is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+# for the specific language governing rights and limitations under the
+# License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#
+# Alternatively, the contents of this file may be used under the terms of
+# either the GNU General Public License Version 2 or later (the "GPL"), or
+# the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+# in which case the provisions of the GPL or the LGPL are applicable instead
+# of those above. If you wish to allow use of your version of this file only
+# under the terms of either the GPL or the LGPL, and not to allow others to
+# use your version of this file under the terms of the MPL, indicate your
+# decision by deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL or the LGPL. If you do not delete
+# the provisions above, a recipient may use your version of this file under
+# the terms of any one of the MPL, the GPL or the LGPL.
+#
+# ***** END LICENSE BLOCK *****
+
+#
+# Config stuff for HPUX
+#
+
+# CC = gcc
+# CCC = g++
+# CFLAGS +=  -Wall -Wno-format -fPIC
+
+CC  = cc -Ae +Z
+CCC = CC -Ae +a1 +eh +Z
+
+RANLIB = echo
+MKSHLIB = $(LD) -b
+
+SO_SUFFIX = sl
+
+#.c.o:
+#	$(CC) -c -MD $*.d $(CFLAGS) $<
+
+CPU_ARCH = hppa
+GFX_ARCH = x
+
+OS_CFLAGS = -DXP_UNIX -DHPUX -DSYSV -DHAVE_LOCALTIME_R
+OS_LIBS = -ldld
+
+ifeq ($(OS_RELEASE),B.10)
+PLATFORM_FLAGS		+= -DHPUX10 -Dhpux10
+PORT_FLAGS		+= -DRW_NO_OVERLOAD_SCHAR -DHAVE_MODEL_H
+ifeq ($(OS_VERSION),.10)
+PLATFORM_FLAGS		+= -DHPUX10_10
+endif
+ifeq ($(OS_VERSION),.20)
+PLATFORM_FLAGS		+= -DHPUX10_20
+endif
+ifeq ($(OS_VERSION),.30)
+PLATFORM_FLAGS		+= -DHPUX10_30
+endif
+endif

mozilla/js/src/config/HP-UXB.10.20.mk

@@ -0,0 +1,77 @@
+# -*- Mode: makefile -*-
+#
+# ***** BEGIN LICENSE BLOCK *****
+# Version: MPL 1.1/GPL 2.0/LGPL 2.1
+#
+# The contents of this file are subject to the Mozilla Public License Version
+# 1.1 (the "License"); you may not use this file except in compliance with
+# the License. You may obtain a copy of the License at
+# http://www.mozilla.org/MPL/
+#
+# Software distributed under the License is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+# for the specific language governing rights and limitations under the
+# License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#
+# Alternatively, the contents of this file may be used under the terms of
+# either the GNU General Public License Version 2 or later (the "GPL"), or
+# the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+# in which case the provisions of the GPL or the LGPL are applicable instead
+# of those above. If you wish to allow use of your version of this file only
+# under the terms of either the GPL or the LGPL, and not to allow others to
+# use your version of this file under the terms of the MPL, indicate your
+# decision by deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL or the LGPL. If you do not delete
+# the provisions above, a recipient may use your version of this file under
+# the terms of any one of the MPL, the GPL or the LGPL.
+#
+# ***** END LICENSE BLOCK *****
+
+#
+# Config stuff for HPUX
+#
+
+# CC = gcc
+# CCC = g++
+# CFLAGS +=  -Wall -Wno-format -fPIC
+
+CC  = cc -Ae +Z
+CCC = CC -Ae +a1 +eh +Z
+
+RANLIB = echo
+MKSHLIB = $(LD) -b
+
+SO_SUFFIX = sl
+
+#.c.o:
+#	$(CC) -c -MD $*.d $(CFLAGS) $<
+
+CPU_ARCH = hppa
+GFX_ARCH = x
+
+OS_CFLAGS = -DXP_UNIX -DHPUX -DSYSV -DHAVE_LOCALTIME_R
+OS_LIBS = -ldld
+
+ifeq ($(OS_RELEASE),B.10)
+PLATFORM_FLAGS		+= -DHPUX10 -Dhpux10
+PORT_FLAGS		+= -DRW_NO_OVERLOAD_SCHAR -DHAVE_MODEL_H
+ifeq ($(OS_VERSION),.10)
+PLATFORM_FLAGS		+= -DHPUX10_10
+endif
+ifeq ($(OS_VERSION),.20)
+PLATFORM_FLAGS		+= -DHPUX10_20
+endif
+ifeq ($(OS_VERSION),.30)
+PLATFORM_FLAGS		+= -DHPUX10_30
+endif
+endif

mozilla/js/src/config/HP-UXB.11.00.mk

@@ -0,0 +1,80 @@
+# -*- Mode: makefile -*-
+#
+# ***** BEGIN LICENSE BLOCK *****
+# Version: MPL 1.1/GPL 2.0/LGPL 2.1
+#
+# The contents of this file are subject to the Mozilla Public License Version
+# 1.1 (the "License"); you may not use this file except in compliance with
+# the License. You may obtain a copy of the License at
+# http://www.mozilla.org/MPL/
+#
+# Software distributed under the License is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+# for the specific language governing rights and limitations under the
+# License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#
+# Alternatively, the contents of this file may be used under the terms of
+# either the GNU General Public License Version 2 or later (the "GPL"), or
+# the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+# in which case the provisions of the GPL or the LGPL are applicable instead
+# of those above. If you wish to allow use of your version of this file only
+# under the terms of either the GPL or the LGPL, and not to allow others to
+# use your version of this file under the terms of the MPL, indicate your
+# decision by deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL or the LGPL. If you do not delete
+# the provisions above, a recipient may use your version of this file under
+# the terms of any one of the MPL, the GPL or the LGPL.
+#
+# ***** END LICENSE BLOCK *****
+
+#
+# Config stuff for HPUX
+#
+
+ifdef NS_USE_NATIVE
+  CC  = cc +Z +DAportable +DS2.0 +u4
+#  LD  = aCC +Z -b -Wl,+s -Wl,-B,symbolic
+else
+  CC = gcc -Wall -Wno-format -fPIC
+  CCC = g++ -Wall -Wno-format -fPIC
+endif
+
+RANLIB = echo
+MKSHLIB = $(LD) -b
+
+SO_SUFFIX = sl
+
+#.c.o:
+#	$(CC) -c -MD $*.d $(CFLAGS) $<
+
+CPU_ARCH = hppa
+GFX_ARCH = x
+
+OS_CFLAGS = -DXP_UNIX -DHPUX -DSYSV -D_HPUX -DNATIVE -D_POSIX_C_SOURCE=199506L -DHAVE_LOCALTIME_R
+OS_LIBS = -ldld
+
+XLDFLAGS = -lpthread
+
+ifeq ($(OS_RELEASE),B.10)
+PLATFORM_FLAGS		+= -DHPUX10 -Dhpux10
+PORT_FLAGS		+= -DRW_NO_OVERLOAD_SCHAR -DHAVE_MODEL_H
+ifeq ($(OS_VERSION),.10)
+PLATFORM_FLAGS		+= -DHPUX10_10
+endif
+ifeq ($(OS_VERSION),.20)
+PLATFORM_FLAGS		+= -DHPUX10_20
+endif
+ifeq ($(OS_VERSION),.30)
+PLATFORM_FLAGS		+= -DHPUX10_30
+endif
+endif

mozilla/js/src/config/IRIX.mk

@@ -0,0 +1,87 @@
+# -*- Mode: makefile -*-
+#
+# ***** BEGIN LICENSE BLOCK *****
+# Version: MPL 1.1/GPL 2.0/LGPL 2.1
+#
+# The contents of this file are subject to the Mozilla Public License Version
+# 1.1 (the "License"); you may not use this file except in compliance with
+# the License. You may obtain a copy of the License at
+# http://www.mozilla.org/MPL/
+#
+# Software distributed under the License is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+# for the specific language governing rights and limitations under the
+# License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#
+# Alternatively, the contents of this file may be used under the terms of
+# either the GNU General Public License Version 2 or later (the "GPL"), or
+# the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+# in which case the provisions of the GPL or the LGPL are applicable instead
+# of those above. If you wish to allow use of your version of this file only
+# under the terms of either the GPL or the LGPL, and not to allow others to
+# use your version of this file under the terms of the MPL, indicate your
+# decision by deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL or the LGPL. If you do not delete
+# the provisions above, a recipient may use your version of this file under
+# the terms of any one of the MPL, the GPL or the LGPL.
+#
+# ***** END LICENSE BLOCK *****
+
+#
+# Config stuff for IRIX
+#
+
+CPU_ARCH = mips
+GFX_ARCH = x
+
+RANLIB = /bin/true
+
+#NS_USE_GCC = 1
+
+ifndef NS_USE_NATIVE
+CC = gcc
+CCC = g++
+AS = $(CC) -x assembler-with-cpp
+ODD_CFLAGS = -Wall -Wno-format
+ifdef BUILD_OPT
+OPTIMIZER = -O6
+endif
+else
+ifeq ($(OS_RELEASE),6.2)
+CC	= cc -n32 -DIRIX6_2
+endif
+ifeq ($(OS_RELEASE),6.3)
+CC	= cc -n32 -DIRIX6_3
+endif
+ifeq ($(OS_RELEASE),6.5)
+CC	= cc -n32 -DIRIX6_5
+endif
+CCC = CC
+# LD  = CC
+ODD_CFLAGS = -fullwarn -xansi
+ifdef BUILD_OPT
+OPTIMIZER += -Olimit 4000
+endif
+endif
+
+# For purify
+HAVE_PURIFY = 1
+PURE_OS_CFLAGS = $(ODD_CFLAGS) -DXP_UNIX -DSVR4 -DSW_THREADS -DIRIX -DHAVE_LOCALTIME_R
+
+OS_CFLAGS = $(PURE_OS_CFLAGS) -MDupdate $(DEPENDENCIES)
+
+BSDECHO	= echo
+MKSHLIB = $(LD) -n32 -shared
+
+# Use the editline library to provide line-editing support.
+JS_EDITLINE = 1

mozilla/js/src/config/IRIX5.3.mk

@@ -0,0 +1,44 @@
+# -*- Mode: makefile -*-
+#
+# ***** BEGIN LICENSE BLOCK *****
+# Version: MPL 1.1/GPL 2.0/LGPL 2.1
+#
+# The contents of this file are subject to the Mozilla Public License Version
+# 1.1 (the "License"); you may not use this file except in compliance with
+# the License. You may obtain a copy of the License at
+# http://www.mozilla.org/MPL/
+#
+# Software distributed under the License is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+# for the specific language governing rights and limitations under the
+# License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#
+# Alternatively, the contents of this file may be used under the terms of
+# either the GNU General Public License Version 2 or later (the "GPL"), or
+# the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+# in which case the provisions of the GPL or the LGPL are applicable instead
+# of those above. If you wish to allow use of your version of this file only
+# under the terms of either the GPL or the LGPL, and not to allow others to
+# use your version of this file under the terms of the MPL, indicate your
+# decision by deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL or the LGPL. If you do not delete
+# the provisions above, a recipient may use your version of this file under
+# the terms of any one of the MPL, the GPL or the LGPL.
+#
+# ***** END LICENSE BLOCK *****
+
+#
+# Config stuff for IRIX5.3
+#
+
+include $(DEPTH)/config/IRIX.mk

mozilla/js/src/config/IRIX6.1.mk

@@ -0,0 +1,44 @@
+# -*- Mode: makefile -*-
+#
+# ***** BEGIN LICENSE BLOCK *****
+# Version: MPL 1.1/GPL 2.0/LGPL 2.1
+#
+# The contents of this file are subject to the Mozilla Public License Version
+# 1.1 (the "License"); you may not use this file except in compliance with
+# the License. You may obtain a copy of the License at
+# http://www.mozilla.org/MPL/
+#
+# Software distributed under the License is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+# for the specific language governing rights and limitations under the
+# License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#
+# Alternatively, the contents of this file may be used under the terms of
+# either the GNU General Public License Version 2 or later (the "GPL"), or
+# the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+# in which case the provisions of the GPL or the LGPL are applicable instead
+# of those above. If you wish to allow use of your version of this file only
+# under the terms of either the GPL or the LGPL, and not to allow others to
+# use your version of this file under the terms of the MPL, indicate your
+# decision by deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL or the LGPL. If you do not delete
+# the provisions above, a recipient may use your version of this file under
+# the terms of any one of the MPL, the GPL or the LGPL.
+#
+# ***** END LICENSE BLOCK *****
+
+#
+# Config stuff for IRIX6.3
+#
+
+include $(DEPTH)/config/IRIX.mk

mozilla/js/src/config/IRIX6.2.mk

@@ -0,0 +1,44 @@
+# -*- Mode: makefile -*-
+#
+# ***** BEGIN LICENSE BLOCK *****
+# Version: MPL 1.1/GPL 2.0/LGPL 2.1
+#
+# The contents of this file are subject to the Mozilla Public License Version
+# 1.1 (the "License"); you may not use this file except in compliance with
+# the License. You may obtain a copy of the License at
+# http://www.mozilla.org/MPL/
+#
+# Software distributed under the License is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+# for the specific language governing rights and limitations under the
+# License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#
+# Alternatively, the contents of this file may be used under the terms of
+# either the GNU General Public License Version 2 or later (the "GPL"), or
+# the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+# in which case the provisions of the GPL or the LGPL are applicable instead
+# of those above. If you wish to allow use of your version of this file only
+# under the terms of either the GPL or the LGPL, and not to allow others to
+# use your version of this file under the terms of the MPL, indicate your
+# decision by deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL or the LGPL. If you do not delete
+# the provisions above, a recipient may use your version of this file under
+# the terms of any one of the MPL, the GPL or the LGPL.
+#
+# ***** END LICENSE BLOCK *****
+
+#
+# Config stuff for IRIX6.3
+#
+
+include $(DEPTH)/config/IRIX.mk

mozilla/js/src/config/IRIX6.3.mk

@@ -0,0 +1,44 @@
+# -*- Mode: makefile -*-
+#
+# ***** BEGIN LICENSE BLOCK *****
+# Version: MPL 1.1/GPL 2.0/LGPL 2.1
+#
+# The contents of this file are subject to the Mozilla Public License Version
+# 1.1 (the "License"); you may not use this file except in compliance with
+# the License. You may obtain a copy of the License at
+# http://www.mozilla.org/MPL/
+#
+# Software distributed under the License is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+# for the specific language governing rights and limitations under the
+# License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#
+# Alternatively, the contents of this file may be used under the terms of
+# either the GNU General Public License Version 2 or later (the "GPL"), or
+# the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+# in which case the provisions of the GPL or the LGPL are applicable instead
+# of those above. If you wish to allow use of your version of this file only
+# under the terms of either the GPL or the LGPL, and not to allow others to
+# use your version of this file under the terms of the MPL, indicate your
+# decision by deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL or the LGPL. If you do not delete
+# the provisions above, a recipient may use your version of this file under
+# the terms of any one of the MPL, the GPL or the LGPL.
+#
+# ***** END LICENSE BLOCK *****
+
+#
+# Config stuff for IRIX6.3
+#
+
+include $(DEPTH)/config/IRIX.mk

mozilla/js/src/config/IRIX6.5.mk

@@ -0,0 +1,44 @@
+# -*- Mode: makefile -*-
+#
+# ***** BEGIN LICENSE BLOCK *****
+# Version: MPL 1.1/GPL 2.0/LGPL 2.1
+#
+# The contents of this file are subject to the Mozilla Public License Version
+# 1.1 (the "License"); you may not use this file except in compliance with
+# the License. You may obtain a copy of the License at
+# http://www.mozilla.org/MPL/
+#
+# Software distributed under the License is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+# for the specific language governing rights and limitations under the
+# License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#
+# Alternatively, the contents of this file may be used under the terms of
+# either the GNU General Public License Version 2 or later (the "GPL"), or
+# the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+# in which case the provisions of the GPL or the LGPL are applicable instead
+# of those above. If you wish to allow use of your version of this file only
+# under the terms of either the GPL or the LGPL, and not to allow others to
+# use your version of this file under the terms of the MPL, indicate your
+# decision by deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL or the LGPL. If you do not delete
+# the provisions above, a recipient may use your version of this file under
+# the terms of any one of the MPL, the GPL or the LGPL.
+#
+# ***** END LICENSE BLOCK *****
+
+#
+# Config stuff for IRIX6.3
+#
+
+include $(DEPTH)/config/IRIX.mk

mozilla/js/src/config/Linux_All.mk

@@ -0,0 +1,103 @@
+# -*- Mode: makefile -*-
+#
+# ***** BEGIN LICENSE BLOCK *****
+# Version: MPL 1.1/GPL 2.0/LGPL 2.1
+#
+# The contents of this file are subject to the Mozilla Public License Version
+# 1.1 (the "License"); you may not use this file except in compliance with
+# the License. You may obtain a copy of the License at
+# http://www.mozilla.org/MPL/
+#
+# Software distributed under the License is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+# for the specific language governing rights and limitations under the
+# License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#
+# Alternatively, the contents of this file may be used under the terms of
+# either the GNU General Public License Version 2 or later (the "GPL"), or
+# the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+# in which case the provisions of the GPL or the LGPL are applicable instead
+# of those above. If you wish to allow use of your version of this file only
+# under the terms of either the GPL or the LGPL, and not to allow others to
+# use your version of this file under the terms of the MPL, indicate your
+# decision by deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL or the LGPL. If you do not delete
+# the provisions above, a recipient may use your version of this file under
+# the terms of any one of the MPL, the GPL or the LGPL.
+#
+# ***** END LICENSE BLOCK *****
+
+#
+# Config for all versions of Linux
+#
+
+CC = gcc
+CCC = g++
+CFLAGS +=  -Wall -Wno-format
+OS_CFLAGS = -DXP_UNIX -DSVR4 -DSYSV -D_BSD_SOURCE -DPOSIX_SOURCE -DHAVE_LOCALTIME_R
+
+RANLIB = echo
+MKSHLIB = $(LD) -shared $(XMKSHLIBOPTS)
+
+#.c.o:
+#      $(CC) -c -MD $*.d $(CFLAGS) $<
+
+CPU_ARCH = $(shell uname -m)
+# don't filter in x86-64 architecture
+ifneq (x86_64,$(CPU_ARCH))
+ifeq (86,$(findstring 86,$(CPU_ARCH)))
+CPU_ARCH = x86
+OS_CFLAGS+= -DX86_LINUX
+
+ifeq (gcc, $(CC))
+# if using gcc on x86, check version for opt bug 
+# (http://bugzilla.mozilla.org/show_bug.cgi?id=24892)
+GCC_VERSION := $(shell gcc -v 2>&1 | grep version | awk '{ print $$3 }')
+GCC_LIST:=$(sort 2.91.66 $(GCC_VERSION) )
+
+ifeq (2.91.66, $(firstword $(GCC_LIST)))
+CFLAGS+= -DGCC_OPT_BUG
+endif
+endif
+endif
+endif
+
+GFX_ARCH = x
+
+OS_LIBS = -lm -lc
+
+ASFLAGS += -x assembler-with-cpp
+
+
+ifeq ($(CPU_ARCH),alpha)
+
+# Ask the C compiler on alpha linux to let us work with denormalized
+# double values, which are required by the ECMA spec.
+
+OS_CFLAGS += -mieee
+endif
+
+# Use the editline library to provide line-editing support.
+JS_EDITLINE = 1
+
+ifeq ($(CPU_ARCH),x86_64)
+# Use VA_COPY() standard macro on x86-64
+# FIXME: better use it everywhere
+OS_CFLAGS += -DHAVE_VA_COPY -DVA_COPY=va_copy
+endif
+
+ifeq ($(CPU_ARCH),x86_64)
+# We need PIC code for shared libraries
+# FIXME: better patch rules.mk & fdlibm/Makefile*
+OS_CFLAGS += -DPIC -fPIC
+endif

mozilla/js/src/config/Mac_OS10.0.mk

@@ -0,0 +1,82 @@
+# -*- Mode: makefile -*-
+#
+# ***** BEGIN LICENSE BLOCK *****
+# Version: MPL 1.1/GPL 2.0/LGPL 2.1
+#
+# The contents of this file are subject to the Mozilla Public License Version
+# 1.1 (the "License"); you may not use this file except in compliance with
+# the License. You may obtain a copy of the License at
+# http://www.mozilla.org/MPL/
+#
+# Software distributed under the License is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+# for the specific language governing rights and limitations under the
+# License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#   Steve Zellers (zellers@apple.com)
+#
+# Alternatively, the contents of this file may be used under the terms of
+# either the GNU General Public License Version 2 or later (the "GPL"), or
+# the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+# in which case the provisions of the GPL or the LGPL are applicable instead
+# of those above. If you wish to allow use of your version of this file only
+# under the terms of either the GPL or the LGPL, and not to allow others to
+# use your version of this file under the terms of the MPL, indicate your
+# decision by deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL or the LGPL. If you do not delete
+# the provisions above, a recipient may use your version of this file under
+# the terms of any one of the MPL, the GPL or the LGPL.
+#
+# ***** END LICENSE BLOCK *****
+
+#
+# Config for Mac OS X as of PR3
+# Just ripped from Linux config
+#
+
+CC = cc
+CCC = g++
+CFLAGS +=  -Wall -Wno-format
+OS_CFLAGS = -DXP_UNIX -DSVR4 -DSYSV -D_BSD_SOURCE -DPOSIX_SOURCE 
+-DRHAPSODY
+
+RANLIB = ranlib
+MKSHLIB = libtool -dynamic $(XMKSHLIBOPTS) -framework System
+
+#.c.o:
+#      $(CC) -c -MD $*.d $(CFLAGS) $<
+
+CPU_ARCH = $(shell uname -m)
+ifeq (86,$(findstring 86,$(CPU_ARCH)))
+CPU_ARCH = x86
+OS_CFLAGS+= -DX86_LINUX
+endif
+GFX_ARCH = x
+
+OS_LIBS = -lc -framework System
+
+ASFLAGS += -x assembler-with-cpp
+
+ifeq ($(CPU_ARCH),alpha)
+
+# Ask the C compiler on alpha linux to let us work with denormalized
+# double values, which are required by the ECMA spec.
+
+OS_CFLAGS += -mieee
+endif
+
+# Use the editline library to provide line-editing support.
+JS_EDITLINE = 1
+
+# Don't allow Makefile.ref to use libmath
+NO_LIBM = 1
+

mozilla/js/src/config/OSF1V4.0.mk

@@ -0,0 +1,72 @@
+# -*- Mode: makefile -*-
+#
+# ***** BEGIN LICENSE BLOCK *****
+# Version: MPL 1.1/GPL 2.0/LGPL 2.1
+#
+# The contents of this file are subject to the Mozilla Public License Version
+# 1.1 (the "License"); you may not use this file except in compliance with
+# the License. You may obtain a copy of the License at
+# http://www.mozilla.org/MPL/
+#
+# Software distributed under the License is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+# for the specific language governing rights and limitations under the
+# License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#
+# Alternatively, the contents of this file may be used under the terms of
+# either the GNU General Public License Version 2 or later (the "GPL"), or
+# the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+# in which case the provisions of the GPL or the LGPL are applicable instead
+# of those above. If you wish to allow use of your version of this file only
+# under the terms of either the GPL or the LGPL, and not to allow others to
+# use your version of this file under the terms of the MPL, indicate your
+# decision by deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL or the LGPL. If you do not delete
+# the provisions above, a recipient may use your version of this file under
+# the terms of any one of the MPL, the GPL or the LGPL.
+#
+# ***** END LICENSE BLOCK *****
+
+#
+# Config stuff for Data General DG/UX
+#
+
+#
+#  Initial DG/UX port by Marc Fraioli (fraioli@dg-rtp.dg.com)
+#
+
+ifndef NS_USE_NATIVE
+CC = gcc
+CCC = g++
+CFLAGS +=  -mieee -Wall -Wno-format
+else
+CC  = cc
+CCC = cxx
+CFLAGS += -ieee -std
+# LD  = cxx
+endif
+
+RANLIB = echo
+MKSHLIB = $(LD) -shared -taso -all -expect_unresolved "*"
+
+#
+#  _DGUX_SOURCE is needed to turn on a lot of stuff in the headers if 
+#      you're not using DG's compiler.  It shouldn't hurt if you are.
+#
+#  _POSIX4A_DRAFT10_SOURCE is needed to pick up localtime_r, used in
+#      prtime.c
+#
+OS_CFLAGS = -DXP_UNIX -DSVR4 -DSYSV -DDGUX -D_DGUX_SOURCE -D_POSIX4A_DRAFT10_SOURCE -DOSF1 -DHAVE_LOCALTIME_R
+OS_LIBS = -lsocket -lnsl 
+
+NOSUCHFILE = /no-such-file

mozilla/js/src/config/OSF1V5.0.mk

@@ -0,0 +1,69 @@
+# -*- Mode: makefile -*-
+#
+# ***** BEGIN LICENSE BLOCK *****
+# Version: MPL 1.1/GPL 2.0/LGPL 2.1
+#
+# The contents of this file are subject to the Mozilla Public License Version
+# 1.1 (the "License"); you may not use this file except in compliance with
+# the License. You may obtain a copy of the License at
+# http://www.mozilla.org/MPL/
+#
+# Software distributed under the License is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+# for the specific language governing rights and limitations under the
+# License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#
+# Alternatively, the contents of this file may be used under the terms of
+# either the GNU General Public License Version 2 or later (the "GPL"), or
+# the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+# in which case the provisions of the GPL or the LGPL are applicable instead
+# of those above. If you wish to allow use of your version of this file only
+# under the terms of either the GPL or the LGPL, and not to allow others to
+# use your version of this file under the terms of the MPL, indicate your
+# decision by deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL or the LGPL. If you do not delete
+# the provisions above, a recipient may use your version of this file under
+# the terms of any one of the MPL, the GPL or the LGPL.
+#
+# ***** END LICENSE BLOCK *****
+
+#
+# Config stuff for Tru64 Unix 5.0
+#
+
+#
+#  Initial DG/UX port by Marc Fraioli (fraioli@dg-rtp.dg.com)
+#
+
+ifndef NS_USE_NATIVE
+CC = gcc
+CCC = g++
+CFLAGS +=  -mieee -Wall -Wno-format
+else
+CC  = cc
+CCC = cxx
+CFLAGS += -ieee -std -pthread
+# LD  = cxx
+endif
+
+RANLIB = echo
+MKSHLIB = $(LD) -shared -all -expect_unresolved "*"
+
+#
+#  _POSIX4A_DRAFT10_SOURCE is needed to pick up localtime_r, used in
+#      prtime.c
+#
+OS_CFLAGS = -DXP_UNIX -DSVR4 -DSYSV -D_POSIX4A_DRAFT10_SOURCE -DOSF1 -DHAVE_LOCALTIME_R
+OS_LIBS = -lsocket -lnsl 
+
+NOSUCHFILE = /no-such-file

mozilla/js/src/config/SunOS4.1.4.mk

@@ -0,0 +1,101 @@
+# -*- Mode: makefile -*-
+#
+# ***** BEGIN LICENSE BLOCK *****
+# Version: MPL 1.1/GPL 2.0/LGPL 2.1
+#
+# The contents of this file are subject to the Mozilla Public License Version
+# 1.1 (the "License"); you may not use this file except in compliance with
+# the License. You may obtain a copy of the License at
+# http://www.mozilla.org/MPL/
+#
+# Software distributed under the License is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+# for the specific language governing rights and limitations under the
+# License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#
+# Alternatively, the contents of this file may be used under the terms of
+# either the GNU General Public License Version 2 or later (the "GPL"), or
+# the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+# in which case the provisions of the GPL or the LGPL are applicable instead
+# of those above. If you wish to allow use of your version of this file only
+# under the terms of either the GPL or the LGPL, and not to allow others to
+# use your version of this file under the terms of the MPL, indicate your
+# decision by deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL or the LGPL. If you do not delete
+# the provisions above, a recipient may use your version of this file under
+# the terms of any one of the MPL, the GPL or the LGPL.
+#
+# ***** END LICENSE BLOCK *****
+
+#
+# Config stuff for SunOS4.1
+#
+
+CC = gcc
+CCC = g++
+RANLIB = ranlib
+
+#.c.o:
+#	$(CC) -c -MD $*.d $(CFLAGS) $<
+
+CPU_ARCH = sparc
+GFX_ARCH = x
+
+# A pile of -D's to build xfe on sunos
+MOZ_CFLAGS = -DSTRINGS_ALIGNED -DNO_REGEX -DNO_ISDIR -DUSE_RE_COMP \
+	     -DNO_REGCOMP -DUSE_GETWD -DNO_MEMMOVE -DNO_ALLOCA \
+	     -DBOGUS_MB_MAX -DNO_CONST
+
+# Purify doesn't like -MDupdate
+NOMD_OS_CFLAGS = -DXP_UNIX -Wall -Wno-format -DSW_THREADS -DSUNOS4 -DNEED_SYSCALL \
+		 $(MOZ_CFLAGS)
+
+OS_CFLAGS = $(NOMD_OS_CFLAGS) -MDupdate $(DEPENDENCIES)
+OS_LIBS = -ldl -lm
+
+MKSHLIB = $(LD) -L$(MOTIF)/lib
+
+HAVE_PURIFY = 1
+MOTIF = /home/motif/usr
+MOTIFLIB = -L$(MOTIF)/lib -lXm
+INCLUDES += -I/usr/X11R5/include -I$(MOTIF)/include
+
+NOSUCHFILE = /solaris-rm-f-sucks
+
+LOCALE_MAP = $(DEPTH)/cmd/xfe/intl/sunos.lm
+
+EN_LOCALE = en_US
+DE_LOCALE = de
+FR_LOCALE = fr
+JP_LOCALE = ja
+SJIS_LOCALE = ja_JP.SJIS
+KR_LOCALE = ko
+CN_LOCALE = zh
+TW_LOCALE = zh_TW
+I2_LOCALE = i2
+IT_LOCALE = it
+SV_LOCALE = sv
+ES_LOCALE = es
+NL_LOCALE = nl
+PT_LOCALE = pt
+
+LOC_LIB_DIR = /usr/openwin/lib/locale
+
+BSDECHO	= echo
+
+#
+# These defines are for building unix plugins
+#
+BUILD_UNIX_PLUGINS = 1
+DSO_LDOPTS =
+DSO_LDFLAGS =

mozilla/js/src/config/SunOS5.3.mk

@@ -0,0 +1,91 @@
+# -*- Mode: makefile -*-
+#
+# ***** BEGIN LICENSE BLOCK *****
+# Version: MPL 1.1/GPL 2.0/LGPL 2.1
+#
+# The contents of this file are subject to the Mozilla Public License Version
+# 1.1 (the "License"); you may not use this file except in compliance with
+# the License. You may obtain a copy of the License at
+# http://www.mozilla.org/MPL/
+#
+# Software distributed under the License is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+# for the specific language governing rights and limitations under the
+# License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#
+# Alternatively, the contents of this file may be used under the terms of
+# either the GNU General Public License Version 2 or later (the "GPL"), or
+# the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+# in which case the provisions of the GPL or the LGPL are applicable instead
+# of those above. If you wish to allow use of your version of this file only
+# under the terms of either the GPL or the LGPL, and not to allow others to
+# use your version of this file under the terms of the MPL, indicate your
+# decision by deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL or the LGPL. If you do not delete
+# the provisions above, a recipient may use your version of this file under
+# the terms of any one of the MPL, the GPL or the LGPL.
+#
+# ***** END LICENSE BLOCK *****
+
+#
+# Config stuff for SunOS5.3
+#
+
+CC = gcc
+CCC = g++
+CFLAGS +=  -Wall -Wno-format
+
+#CC = /opt/SUNWspro/SC3.0.1/bin/cc
+RANLIB = echo
+
+#.c.o:
+#	$(CC) -c -MD $*.d $(CFLAGS) $<
+
+CPU_ARCH = sparc
+GFX_ARCH = x
+
+OS_CFLAGS = -DXP_UNIX -DSVR4 -DSYSV -DSOLARIS -DHAVE_LOCALTIME_R
+OS_LIBS = -lsocket -lnsl -ldl
+
+ASFLAGS	        += -P -L -K PIC -D_ASM -D__STDC__=0
+
+HAVE_PURIFY = 1
+
+NOSUCHFILE = /solaris-rm-f-sucks
+
+ifndef JS_NO_ULTRA
+ULTRA_OPTIONS := -xarch=v8plus
+ULTRA_OPTIONSD := -DULTRA_SPARC
+else
+ULTRA_OPTIONS := -xarch=v8
+ULTRA_OPTIONSD :=
+endif
+
+ifeq ($(OS_CPUARCH),sun4u)
+DEFINES 	+= $(ULTRA_OPTIONSD)
+ifeq ($(findstring gcc,$(CC)),gcc)
+DEFINES         += -Wa,$(ULTRA_OPTIONS),$(ULTRA_OPTIONSD)
+else
+ASFLAGS         += $(ULTRA_OPTIONS) $(ULTRA_OPTIONSD)
+endif
+endif
+
+ifeq ($(OS_CPUARCH),sun4m)
+ifeq ($(findstring gcc,$(CC)),gcc)
+DEFINES         += -Wa,-xarch=v8
+else
+ASFLAGS         += -xarch=v8
+endif
+endif
+
+MKSHLIB = $(LD) -G

mozilla/js/src/config/SunOS5.4.mk

@@ -0,0 +1,92 @@
+# -*- Mode: makefile -*-
+#
+# ***** BEGIN LICENSE BLOCK *****
+# Version: MPL 1.1/GPL 2.0/LGPL 2.1
+#
+# The contents of this file are subject to the Mozilla Public License Version
+# 1.1 (the "License"); you may not use this file except in compliance with
+# the License. You may obtain a copy of the License at
+# http://www.mozilla.org/MPL/
+#
+# Software distributed under the License is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+# for the specific language governing rights and limitations under the
+# License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#
+# Alternatively, the contents of this file may be used under the terms of
+# either the GNU General Public License Version 2 or later (the "GPL"), or
+# the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+# in which case the provisions of the GPL or the LGPL are applicable instead
+# of those above. If you wish to allow use of your version of this file only
+# under the terms of either the GPL or the LGPL, and not to allow others to
+# use your version of this file under the terms of the MPL, indicate your
+# decision by deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL or the LGPL. If you do not delete
+# the provisions above, a recipient may use your version of this file under
+# the terms of any one of the MPL, the GPL or the LGPL.
+#
+# ***** END LICENSE BLOCK *****
+
+#
+# Config stuff for SunOS5.4
+#
+
+ifdef NS_USE_NATIVE
+CC = cc
+CCC = CC
+else
+CC = gcc
+CCC = g++
+CFLAGS += -Wall -Wno-format
+endif
+
+RANLIB = echo
+
+CPU_ARCH = sparc
+GFX_ARCH = x
+
+OS_CFLAGS = -DXP_UNIX -DSVR4 -DSYSV -D__svr4 -DSOLARIS -DHAVE_LOCALTIME_R
+OS_LIBS = -lsocket -lnsl -ldl
+
+ASFLAGS	        += -P -L -K PIC -D_ASM -D__STDC__=0
+
+HAVE_PURIFY = 1
+
+NOSUCHFILE = /solaris-rm-f-sucks
+
+ifndef JS_NO_ULTRA
+ULTRA_OPTIONS := -xarch=v8plus
+ULTRA_OPTIONSD := -DULTRA_SPARC
+else
+ULTRA_OPTIONS := -xarch=v8
+ULTRA_OPTIONSD :=
+endif
+
+ifeq ($(OS_CPUARCH),sun4u)
+DEFINES 	+= $(ULTRA_OPTIONSD)
+ifeq ($(findstring gcc,$(CC)),gcc)
+DEFINES         += -Wa,$(ULTRA_OPTIONS),$(ULTRA_OPTIONSD)
+else
+ASFLAGS         += $(ULTRA_OPTIONS) $(ULTRA_OPTIONSD)
+endif
+endif
+
+ifeq ($(OS_CPUARCH),sun4m)
+ifeq ($(findstring gcc,$(CC)),gcc)
+DEFINES         += -Wa,-xarch=v8
+else
+ASFLAGS         += -xarch=v8
+endif
+endif
+
+MKSHLIB = $(LD) -G

mozilla/js/src/config/SunOS5.5.1.mk

@@ -0,0 +1,44 @@
+# -*- Mode: makefile -*-
+#
+# ***** BEGIN LICENSE BLOCK *****
+# Version: MPL 1.1/GPL 2.0/LGPL 2.1
+#
+# The contents of this file are subject to the Mozilla Public License Version
+# 1.1 (the "License"); you may not use this file except in compliance with
+# the License. You may obtain a copy of the License at
+# http://www.mozilla.org/MPL/
+#
+# Software distributed under the License is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+# for the specific language governing rights and limitations under the
+# License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#
+# Alternatively, the contents of this file may be used under the terms of
+# either the GNU General Public License Version 2 or later (the "GPL"), or
+# the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+# in which case the provisions of the GPL or the LGPL are applicable instead
+# of those above. If you wish to allow use of your version of this file only
+# under the terms of either the GPL or the LGPL, and not to allow others to
+# use your version of this file under the terms of the MPL, indicate your
+# decision by deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL or the LGPL. If you do not delete
+# the provisions above, a recipient may use your version of this file under
+# the terms of any one of the MPL, the GPL or the LGPL.
+#
+# ***** END LICENSE BLOCK *****
+
+#
+# Config stuff for SunOS5.5.1
+#
+
+include $(DEPTH)/config/SunOS5.5.mk

mozilla/js/src/config/SunOS5.5.mk

@@ -0,0 +1,87 @@
+# -*- Mode: makefile -*-
+#
+# ***** BEGIN LICENSE BLOCK *****
+# Version: MPL 1.1/GPL 2.0/LGPL 2.1
+#
+# The contents of this file are subject to the Mozilla Public License Version
+# 1.1 (the "License"); you may not use this file except in compliance with
+# the License. You may obtain a copy of the License at
+# http://www.mozilla.org/MPL/
+#
+# Software distributed under the License is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+# for the specific language governing rights and limitations under the
+# License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#
+# Alternatively, the contents of this file may be used under the terms of
+# either the GNU General Public License Version 2 or later (the "GPL"), or
+# the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+# in which case the provisions of the GPL or the LGPL are applicable instead
+# of those above. If you wish to allow use of your version of this file only
+# under the terms of either the GPL or the LGPL, and not to allow others to
+# use your version of this file under the terms of the MPL, indicate your
+# decision by deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL or the LGPL. If you do not delete
+# the provisions above, a recipient may use your version of this file under
+# the terms of any one of the MPL, the GPL or the LGPL.
+#
+# ***** END LICENSE BLOCK *****
+
+#
+# Config stuff for SunOS5.5
+#
+
+AS = /usr/ccs/bin/as
+ifndef NS_USE_NATIVE
+CC = gcc
+CCC = g++
+CFLAGS +=  -Wall -Wno-format
+else
+CC = cc
+CCC = CC
+endif
+
+RANLIB = echo
+
+#.c.o:
+#	$(CC) -c -MD $*.d $(CFLAGS) $<
+
+CPU_ARCH = sparc
+GFX_ARCH = x
+
+OS_CFLAGS = -DXP_UNIX -DSVR4 -DSYSV -DSOLARIS -DHAVE_LOCALTIME_R
+OS_LIBS = -lsocket -lnsl -ldl
+
+ASFLAGS	        += -P -L -K PIC -D_ASM -D__STDC__=0
+
+HAVE_PURIFY = 1
+
+NOSUCHFILE = /solaris-rm-f-sucks
+
+ifeq ($(OS_CPUARCH),sun4u)	# ultra sparc?
+ifeq ($(CC),gcc)		# using gcc?
+ifndef JS_NO_ULTRA		# do we want ultra?
+ifdef JS_THREADSAFE		# only in thread-safe mode
+DEFINES 	+= -DULTRA_SPARC
+DEFINES         += -Wa,-xarch=v8plus,-DULTRA_SPARC
+else
+ASFLAGS         += -xarch=v8plus -DULTRA_SPARC
+endif
+endif
+endif
+endif
+
+MKSHLIB = $(LD) -G
+
+# Use the editline library to provide line-editing support.
+JS_EDITLINE = 1

mozilla/js/src/config/SunOS5.6.mk

@@ -0,0 +1,89 @@
+# -*- Mode: makefile -*-
+#
+# ***** BEGIN LICENSE BLOCK *****
+# Version: MPL 1.1/GPL 2.0/LGPL 2.1
+#
+# The contents of this file are subject to the Mozilla Public License Version
+# 1.1 (the "License"); you may not use this file except in compliance with
+# the License. You may obtain a copy of the License at
+# http://www.mozilla.org/MPL/
+#
+# Software distributed under the License is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+# for the specific language governing rights and limitations under the
+# License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#
+# Alternatively, the contents of this file may be used under the terms of
+# either the GNU General Public License Version 2 or later (the "GPL"), or
+# the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+# in which case the provisions of the GPL or the LGPL are applicable instead
+# of those above. If you wish to allow use of your version of this file only
+# under the terms of either the GPL or the LGPL, and not to allow others to
+# use your version of this file under the terms of the MPL, indicate your
+# decision by deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL or the LGPL. If you do not delete
+# the provisions above, a recipient may use your version of this file under
+# the terms of any one of the MPL, the GPL or the LGPL.
+#
+# ***** END LICENSE BLOCK *****
+
+#
+# Config stuff for SunOS5.5
+#
+
+AS = /usr/ccs/bin/as
+ifndef NS_USE_NATIVE
+  CC = gcc
+  CCC = g++
+  CFLAGS +=  -Wall -Wno-format
+else
+  CC = cc
+  CCC = CC
+  CFLAGS += -mt -KPIC
+#  LD = CC
+endif
+
+RANLIB = echo
+
+#.c.o:
+#	$(CC) -c -MD $*.d $(CFLAGS) $<
+
+CPU_ARCH = sparc
+GFX_ARCH = x
+
+OS_CFLAGS = -DXP_UNIX -DSVR4 -DSYSV -DSOLARIS -DHAVE_LOCALTIME_R
+OS_LIBS = -lsocket -lnsl -ldl
+
+ASFLAGS	        += -P -L -K PIC -D_ASM -D__STDC__=0
+
+HAVE_PURIFY = 1
+
+NOSUCHFILE = /solaris-rm-f-sucks
+
+ifeq ($(OS_CPUARCH),sun4u)	# ultra sparc?
+ifeq ($(CC),gcc)		# using gcc?
+ifndef JS_NO_ULTRA		# do we want ultra?
+ifdef JS_THREADSAFE		# only in thread-safe mode
+DEFINES 	+= -DULTRA_SPARC
+DEFINES         += -Wa,-xarch=v8plus,-DULTRA_SPARC
+else
+ASFLAGS         += -xarch=v8plus -DULTRA_SPARC
+endif
+endif
+endif
+endif
+
+MKSHLIB = $(LD) -G
+
+# Use the editline library to provide line-editing support.
+JS_EDITLINE = 1

mozilla/js/src/config/SunOS5.7.mk

@@ -0,0 +1,44 @@
+# -*- Mode: makefile -*-
+#
+# ***** BEGIN LICENSE BLOCK *****
+# Version: MPL 1.1/GPL 2.0/LGPL 2.1
+#
+# The contents of this file are subject to the Mozilla Public License Version
+# 1.1 (the "License"); you may not use this file except in compliance with
+# the License. You may obtain a copy of the License at
+# http://www.mozilla.org/MPL/
+#
+# Software distributed under the License is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+# for the specific language governing rights and limitations under the
+# License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1999
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#
+# Alternatively, the contents of this file may be used under the terms of
+# either the GNU General Public License Version 2 or later (the "GPL"), or
+# the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+# in which case the provisions of the GPL or the LGPL are applicable instead
+# of those above. If you wish to allow use of your version of this file only
+# under the terms of either the GPL or the LGPL, and not to allow others to
+# use your version of this file under the terms of the MPL, indicate your
+# decision by deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL or the LGPL. If you do not delete
+# the provisions above, a recipient may use your version of this file under
+# the terms of any one of the MPL, the GPL or the LGPL.
+#
+# ***** END LICENSE BLOCK *****
+
+#
+# Config stuff for SunOS5.7
+#
+
+include $(DEPTH)/config/SunOS5.5.mk

mozilla/js/src/config/SunOS5.8.mk

@@ -0,0 +1,44 @@
+# -*- Mode: makefile -*-
+#
+# ***** BEGIN LICENSE BLOCK *****
+# Version: MPL 1.1/GPL 2.0/LGPL 2.1
+#
+# The contents of this file are subject to the Mozilla Public License Version
+# 1.1 (the "License"); you may not use this file except in compliance with
+# the License. You may obtain a copy of the License at
+# http://www.mozilla.org/MPL/
+#
+# Software distributed under the License is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+# for the specific language governing rights and limitations under the
+# License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1999
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#
+# Alternatively, the contents of this file may be used under the terms of
+# either the GNU General Public License Version 2 or later (the "GPL"), or
+# the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+# in which case the provisions of the GPL or the LGPL are applicable instead
+# of those above. If you wish to allow use of your version of this file only
+# under the terms of either the GPL or the LGPL, and not to allow others to
+# use your version of this file under the terms of the MPL, indicate your
+# decision by deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL or the LGPL. If you do not delete
+# the provisions above, a recipient may use your version of this file under
+# the terms of any one of the MPL, the GPL or the LGPL.
+#
+# ***** END LICENSE BLOCK *****
+
+#
+# Config stuff for SunOS5.8
+#
+
+include $(DEPTH)/config/SunOS5.5.mk

mozilla/js/src/config/SunOS5.9.mk

@@ -0,0 +1,44 @@
+# -*- Mode: makefile -*-
+#
+# ***** BEGIN LICENSE BLOCK *****
+# Version: MPL 1.1/GPL 2.0/LGPL 2.1
+#
+# The contents of this file are subject to the Mozilla Public License Version
+# 1.1 (the "License"); you may not use this file except in compliance with
+# the License. You may obtain a copy of the License at
+# http://www.mozilla.org/MPL/
+#
+# Software distributed under the License is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+# for the specific language governing rights and limitations under the
+# License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1999
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#
+# Alternatively, the contents of this file may be used under the terms of
+# either the GNU General Public License Version 2 or later (the "GPL"), or
+# the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+# in which case the provisions of the GPL or the LGPL are applicable instead
+# of those above. If you wish to allow use of your version of this file only
+# under the terms of either the GPL or the LGPL, and not to allow others to
+# use your version of this file under the terms of the MPL, indicate your
+# decision by deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL or the LGPL. If you do not delete
+# the provisions above, a recipient may use your version of this file under
+# the terms of any one of the MPL, the GPL or the LGPL.
+#
+# ***** END LICENSE BLOCK *****
+
+#
+# Config stuff for SunOS5.9
+#
+
+include $(DEPTH)/config/SunOS5.5.mk

mozilla/js/src/config/WINNT4.0.mk

@@ -0,0 +1,112 @@
+# -*- Mode: makefile -*-
+#
+# ***** BEGIN LICENSE BLOCK *****
+# Version: MPL 1.1/GPL 2.0/LGPL 2.1
+#
+# The contents of this file are subject to the Mozilla Public License Version
+# 1.1 (the "License"); you may not use this file except in compliance with
+# the License. You may obtain a copy of the License at
+# http://www.mozilla.org/MPL/
+#
+# Software distributed under the License is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+# for the specific language governing rights and limitations under the
+# License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#
+# Alternatively, the contents of this file may be used under the terms of
+# either the GNU General Public License Version 2 or later (the "GPL"), or
+# the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+# in which case the provisions of the GPL or the LGPL are applicable instead
+# of those above. If you wish to allow use of your version of this file only
+# under the terms of either the GPL or the LGPL, and not to allow others to
+# use your version of this file under the terms of the MPL, indicate your
+# decision by deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL or the LGPL. If you do not delete
+# the provisions above, a recipient may use your version of this file under
+# the terms of any one of the MPL, the GPL or the LGPL.
+#
+# ***** END LICENSE BLOCK *****
+
+#
+# Config for Windows NT using MS Visual C++ (version?)
+#
+
+CC = cl
+
+RANLIB = echo
+
+#.c.o:
+#      $(CC) -c -MD $*.d $(CFLAGS) $<
+
+CPU_ARCH = x86 # XXX fixme
+GFX_ARCH = win32
+
+# MSVC compiler options for both debug/optimize
+# -nologo  - suppress copyright message
+# -W3      - Warning level 3
+# -Gm      - enable minimal rebuild
+# -Z7      - put debug info into the executable, not in .pdb file
+# -YX      - automatic precompiled headers
+# -GX      - enable C++ exception support
+WIN_CFLAGS = -nologo -W3 -Fp$(OBJDIR)/js.pch
+
+# MSVC compiler options for debug builds linked to MSVCRTD.DLL
+# -MDd     - link with MSVCRTD.LIB (Dynamically-linked, multi-threaded, debug C-runtime)
+# -Od      - minimal optimization
+WIN_IDG_CFLAGS = -MDd -Od -Z7 
+
+# MSVC compiler options for debug builds linked to MSVCRT.DLL
+# -MD      - link with MSVCRT.LIB (Dynamically-linked, multi-threaded, debug C-runtime)
+# -Od      - minimal optimization
+WIN_DEBUG_CFLAGS = -MD -Od -Z7 
+
+# MSVC compiler options for release (optimized) builds
+# -MD      - link with MSVCRT.LIB (Dynamically-linked, multi-threaded, C-runtime)
+# -O2      - Optimize for speed
+# -G5      - Optimize for Pentium
+WIN_OPT_CFLAGS = -MD -O2
+
+ifdef BUILD_OPT
+OPTIMIZER = $(WIN_OPT_CFLAGS)
+else
+ifdef BUILD_IDG
+OPTIMIZER = $(WIN_IDG_CFLAGS)
+else
+OPTIMIZER = $(WIN_DEBUG_CFLAGS)
+endif
+endif
+
+OS_CFLAGS = -D_X86_=1 -DXP_WIN -DXP_WIN32 -DWIN32 -D_WINDOWS -D_WIN32 $(WIN_CFLAGS)
+JSDLL_CFLAGS = -DEXPORT_JS_API
+OS_LIBS = -lm -lc
+
+PREBUILT_CPUCFG = 1
+USE_MSVC = 1
+
+LIB_LINK_FLAGS=kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib\
+ advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib oldnames.lib -nologo\
+ -subsystem:windows -dll -debug -pdb:none\
+ -machine:I386\
+ -opt:ref -opt:noicf
+
+EXE_LINK_FLAGS=kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib\
+ advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib oldnames.lib -nologo\
+ -subsystem:console -debug -pdb:none\
+ -machine:I386\
+ -opt:ref -opt:noicf
+
+# CAFEDIR = t:/cafe
+# JCLASSPATH = $(CAFEDIR)/Java/Lib/classes.zip
+# JAVAC = $(CAFEDIR)/Bin/sj.exe
+# JAVAH = $(CAFEDIR)/Java/Bin/javah.exe
+# JCFLAGS = -I$(CAFEDIR)/Java/Include -I$(CAFEDIR)/Java/Include/win32

mozilla/js/src/config/WINNT5.0.mk

@@ -0,0 +1,112 @@
+# -*- Mode: makefile -*-
+#
+# ***** BEGIN LICENSE BLOCK *****
+# Version: MPL 1.1/GPL 2.0/LGPL 2.1
+#
+# The contents of this file are subject to the Mozilla Public License Version
+# 1.1 (the "License"); you may not use this file except in compliance with
+# the License. You may obtain a copy of the License at
+# http://www.mozilla.org/MPL/
+#
+# Software distributed under the License is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+# for the specific language governing rights and limitations under the
+# License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#
+# Alternatively, the contents of this file may be used under the terms of
+# either the GNU General Public License Version 2 or later (the "GPL"), or
+# the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+# in which case the provisions of the GPL or the LGPL are applicable instead
+# of those above. If you wish to allow use of your version of this file only
+# under the terms of either the GPL or the LGPL, and not to allow others to
+# use your version of this file under the terms of the MPL, indicate your
+# decision by deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL or the LGPL. If you do not delete
+# the provisions above, a recipient may use your version of this file under
+# the terms of any one of the MPL, the GPL or the LGPL.
+#
+# ***** END LICENSE BLOCK *****
+
+#
+# Config for Windows NT using MS Visual C++ (version?)
+#
+
+CC = cl
+
+RANLIB = echo
+
+#.c.o:
+#      $(CC) -c -MD $*.d $(CFLAGS) $<
+
+CPU_ARCH = x86 # XXX fixme
+GFX_ARCH = win32
+
+# MSVC compiler options for both debug/optimize
+# -nologo  - suppress copyright message
+# -W3      - Warning level 3
+# -Gm      - enable minimal rebuild
+# -Z7      - put debug info into the executable, not in .pdb file
+# -YX      - automatic precompiled headers
+# -GX      - enable C++ exception support
+WIN_CFLAGS = -nologo -W3 -Fp$(OBJDIR)/js.pch
+
+# MSVC compiler options for debug builds linked to MSVCRTD.DLL
+# -MDd     - link with MSVCRTD.LIB (Dynamically-linked, multi-threaded, debug C-runtime)
+# -Od      - minimal optimization
+WIN_IDG_CFLAGS = -MDd -Od -Z7 
+
+# MSVC compiler options for debug builds linked to MSVCRT.DLL
+# -MD      - link with MSVCRT.LIB (Dynamically-linked, multi-threaded, debug C-runtime)
+# -Od      - minimal optimization
+WIN_DEBUG_CFLAGS = -MD -Od -Z7 
+
+# MSVC compiler options for release (optimized) builds
+# -MD      - link with MSVCRT.LIB (Dynamically-linked, multi-threaded, C-runtime)
+# -O2      - Optimize for speed
+# -G5      - Optimize for Pentium
+WIN_OPT_CFLAGS = -MD -O2
+
+ifdef BUILD_OPT
+OPTIMIZER = $(WIN_OPT_CFLAGS)
+else
+ifdef BUILD_IDG
+OPTIMIZER = $(WIN_IDG_CFLAGS)
+else
+OPTIMIZER = $(WIN_DEBUG_CFLAGS)
+endif
+endif
+
+OS_CFLAGS = -D_X86_=1 -DXP_WIN -DXP_WIN32 -DWIN32 -D_WINDOWS -D_WIN32 $(WIN_CFLAGS)
+JSDLL_CFLAGS = -DEXPORT_JS_API
+OS_LIBS = -lm -lc
+
+PREBUILT_CPUCFG = 1
+USE_MSVC = 1
+
+LIB_LINK_FLAGS=kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib\
+ advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib oldnames.lib -nologo\
+ -subsystem:windows -dll -debug -pdb:none\
+ -machine:I386\
+ -opt:ref -opt:noicf
+
+EXE_LINK_FLAGS=kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib\
+ advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib oldnames.lib -nologo\
+ -subsystem:console -debug -pdb:none\
+ -machine:I386\
+ -opt:ref -opt:noicf
+
+# CAFEDIR = t:/cafe
+# JCLASSPATH = $(CAFEDIR)/Java/Lib/classes.zip
+# JAVAC = $(CAFEDIR)/Bin/sj.exe
+# JAVAH = $(CAFEDIR)/Java/Bin/javah.exe
+# JCFLAGS = -I$(CAFEDIR)/Java/Include -I$(CAFEDIR)/Java/Include/win32

mozilla/js/src/config/WINNT5.1.mk

@@ -0,0 +1,112 @@
+# -*- Mode: makefile -*-
+#
+# ***** BEGIN LICENSE BLOCK *****
+# Version: MPL 1.1/GPL 2.0/LGPL 2.1
+#
+# The contents of this file are subject to the Mozilla Public License Version
+# 1.1 (the "License"); you may not use this file except in compliance with
+# the License. You may obtain a copy of the License at
+# http://www.mozilla.org/MPL/
+#
+# Software distributed under the License is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+# for the specific language governing rights and limitations under the
+# License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#
+# Alternatively, the contents of this file may be used under the terms of
+# either the GNU General Public License Version 2 or later (the "GPL"), or
+# the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+# in which case the provisions of the GPL or the LGPL are applicable instead
+# of those above. If you wish to allow use of your version of this file only
+# under the terms of either the GPL or the LGPL, and not to allow others to
+# use your version of this file under the terms of the MPL, indicate your
+# decision by deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL or the LGPL. If you do not delete
+# the provisions above, a recipient may use your version of this file under
+# the terms of any one of the MPL, the GPL or the LGPL.
+#
+# ***** END LICENSE BLOCK *****
+
+#
+# Config for Windows NT using MS Visual C++ (version?)
+#
+
+CC = cl
+
+RANLIB = echo
+
+#.c.o:
+#      $(CC) -c -MD $*.d $(CFLAGS) $<
+
+CPU_ARCH = x86 # XXX fixme
+GFX_ARCH = win32
+
+# MSVC compiler options for both debug/optimize
+# -nologo  - suppress copyright message
+# -W3      - Warning level 3
+# -Gm      - enable minimal rebuild
+# -Z7      - put debug info into the executable, not in .pdb file
+# -YX      - automatic precompiled headers
+# -GX      - enable C++ exception support
+WIN_CFLAGS = -nologo -W3 -Fp$(OBJDIR)/js.pch
+
+# MSVC compiler options for debug builds linked to MSVCRTD.DLL
+# -MDd     - link with MSVCRTD.LIB (Dynamically-linked, multi-threaded, debug C-runtime)
+# -Od      - minimal optimization
+WIN_IDG_CFLAGS = -MDd -Od -Z7 
+
+# MSVC compiler options for debug builds linked to MSVCRT.DLL
+# -MD      - link with MSVCRT.LIB (Dynamically-linked, multi-threaded, debug C-runtime)
+# -Od      - minimal optimization
+WIN_DEBUG_CFLAGS = -MD -Od -Z7 
+
+# MSVC compiler options for release (optimized) builds
+# -MD      - link with MSVCRT.LIB (Dynamically-linked, multi-threaded, C-runtime)
+# -O2      - Optimize for speed
+# -G5      - Optimize for Pentium
+WIN_OPT_CFLAGS = -MD -O2
+
+ifdef BUILD_OPT
+OPTIMIZER = $(WIN_OPT_CFLAGS)
+else
+ifdef BUILD_IDG
+OPTIMIZER = $(WIN_IDG_CFLAGS)
+else
+OPTIMIZER = $(WIN_DEBUG_CFLAGS)
+endif
+endif
+
+OS_CFLAGS = -D_X86_=1 -DXP_WIN -DXP_WIN32 -DWIN32 -D_WINDOWS -D_WIN32 $(WIN_CFLAGS)
+JSDLL_CFLAGS = -DEXPORT_JS_API
+OS_LIBS = -lm -lc
+
+PREBUILT_CPUCFG = 1
+USE_MSVC = 1
+
+LIB_LINK_FLAGS=kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib\
+ advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib oldnames.lib -nologo\
+ -subsystem:windows -dll -debug -pdb:none\
+ -machine:I386\
+ -opt:ref -opt:noicf
+
+EXE_LINK_FLAGS=kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib\
+ advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib oldnames.lib -nologo\
+ -subsystem:console -debug -pdb:none\
+ -machine:I386\
+ -opt:ref -opt:noicf
+
+# CAFEDIR = t:/cafe
+# JCLASSPATH = $(CAFEDIR)/Java/Lib/classes.zip
+# JAVAC = $(CAFEDIR)/Bin/sj.exe
+# JAVAH = $(CAFEDIR)/Java/Bin/javah.exe
+# JCFLAGS = -I$(CAFEDIR)/Java/Include -I$(CAFEDIR)/Java/Include/win32

mozilla/js/src/config/WINNT5.2.mk

@@ -0,0 +1,112 @@
+# -*- Mode: makefile -*-
+#
+# ***** BEGIN LICENSE BLOCK *****
+# Version: MPL 1.1/GPL 2.0/LGPL 2.1
+#
+# The contents of this file are subject to the Mozilla Public License Version
+# 1.1 (the "License"); you may not use this file except in compliance with
+# the License. You may obtain a copy of the License at
+# http://www.mozilla.org/MPL/
+#
+# Software distributed under the License is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+# for the specific language governing rights and limitations under the
+# License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#
+# Alternatively, the contents of this file may be used under the terms of
+# either the GNU General Public License Version 2 or later (the "GPL"), or
+# the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+# in which case the provisions of the GPL or the LGPL are applicable instead
+# of those above. If you wish to allow use of your version of this file only
+# under the terms of either the GPL or the LGPL, and not to allow others to
+# use your version of this file under the terms of the MPL, indicate your
+# decision by deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL or the LGPL. If you do not delete
+# the provisions above, a recipient may use your version of this file under
+# the terms of any one of the MPL, the GPL or the LGPL.
+#
+# ***** END LICENSE BLOCK *****
+
+#
+# Config for Windows NT using MS Visual C++ (version?)
+#
+
+CC = cl
+
+RANLIB = echo
+
+#.c.o:
+#      $(CC) -c -MD $*.d $(CFLAGS) $<
+
+CPU_ARCH = x86 # XXX fixme
+GFX_ARCH = win32
+
+# MSVC compiler options for both debug/optimize
+# -nologo  - suppress copyright message
+# -W3      - Warning level 3
+# -Gm      - enable minimal rebuild
+# -Z7      - put debug info into the executable, not in .pdb file
+# -YX      - automatic precompiled headers
+# -GX      - enable C++ exception support
+WIN_CFLAGS = -nologo -W3 -Fp$(OBJDIR)/js.pch
+
+# MSVC compiler options for debug builds linked to MSVCRTD.DLL
+# -MDd     - link with MSVCRTD.LIB (Dynamically-linked, multi-threaded, debug C-runtime)
+# -Od      - minimal optimization
+WIN_IDG_CFLAGS = -MDd -Od -Z7 
+
+# MSVC compiler options for debug builds linked to MSVCRT.DLL
+# -MD      - link with MSVCRT.LIB (Dynamically-linked, multi-threaded, debug C-runtime)
+# -Od      - minimal optimization
+WIN_DEBUG_CFLAGS = -MD -Od -Z7 
+
+# MSVC compiler options for release (optimized) builds
+# -MD      - link with MSVCRT.LIB (Dynamically-linked, multi-threaded, C-runtime)
+# -O2      - Optimize for speed
+# -G5      - Optimize for Pentium
+WIN_OPT_CFLAGS = -MD -O2
+
+ifdef BUILD_OPT
+OPTIMIZER = $(WIN_OPT_CFLAGS)
+else
+ifdef BUILD_IDG
+OPTIMIZER = $(WIN_IDG_CFLAGS)
+else
+OPTIMIZER = $(WIN_DEBUG_CFLAGS)
+endif
+endif
+
+OS_CFLAGS = -D_X86_=1 -DXP_WIN -DXP_WIN32 -DWIN32 -D_WINDOWS -D_WIN32 $(WIN_CFLAGS)
+JSDLL_CFLAGS = -DEXPORT_JS_API
+OS_LIBS = -lm -lc
+
+PREBUILT_CPUCFG = 1
+USE_MSVC = 1
+
+LIB_LINK_FLAGS=kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib\
+ advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib oldnames.lib -nologo\
+ -subsystem:windows -dll -debug -pdb:none\
+ -machine:I386\
+ -opt:ref -opt:noicf
+
+EXE_LINK_FLAGS=kernel32.lib user32.lib gdi32.lib winspool.lib comdlg32.lib\
+ advapi32.lib shell32.lib ole32.lib oleaut32.lib uuid.lib oldnames.lib -nologo\
+ -subsystem:console -debug -pdb:none\
+ -machine:I386\
+ -opt:ref -opt:noicf
+
+# CAFEDIR = t:/cafe
+# JCLASSPATH = $(CAFEDIR)/Java/Lib/classes.zip
+# JAVAC = $(CAFEDIR)/Bin/sj.exe
+# JAVAH = $(CAFEDIR)/Java/Bin/javah.exe
+# JCFLAGS = -I$(CAFEDIR)/Java/Include -I$(CAFEDIR)/Java/Include/win32

mozilla/js/src/config/dgux.mk

@@ -0,0 +1,64 @@
+# -*- Mode: makefile -*-
+#
+# ***** BEGIN LICENSE BLOCK *****
+# Version: MPL 1.1/GPL 2.0/LGPL 2.1
+#
+# The contents of this file are subject to the Mozilla Public License Version
+# 1.1 (the "License"); you may not use this file except in compliance with
+# the License. You may obtain a copy of the License at
+# http://www.mozilla.org/MPL/
+#
+# Software distributed under the License is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+# for the specific language governing rights and limitations under the
+# License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#
+# Alternatively, the contents of this file may be used under the terms of
+# either the GNU General Public License Version 2 or later (the "GPL"), or
+# the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+# in which case the provisions of the GPL or the LGPL are applicable instead
+# of those above. If you wish to allow use of your version of this file only
+# under the terms of either the GPL or the LGPL, and not to allow others to
+# use your version of this file under the terms of the MPL, indicate your
+# decision by deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL or the LGPL. If you do not delete
+# the provisions above, a recipient may use your version of this file under
+# the terms of any one of the MPL, the GPL or the LGPL.
+#
+# ***** END LICENSE BLOCK *****
+
+#
+# Config stuff for Data General DG/UX
+#
+
+#
+#  Initial DG/UX port by Marc Fraioli (fraioli@dg-rtp.dg.com)
+#
+
+AS = as
+CC = gcc 
+CCC = g++ 
+
+RANLIB = echo
+
+#
+#  _DGUX_SOURCE is needed to turn on a lot of stuff in the headers if 
+#      you're not using DG's compiler.  It shouldn't hurt if you are.
+#
+#  _POSIX4A_DRAFT10_SOURCE is needed to pick up localtime_r, used in
+#      prtime.c
+#
+OS_CFLAGS = -DXP_UNIX -DSVR4 -DSYSV -DDGUX -D_DGUX_SOURCE -D_POSIX4A_DRAFT10_SOURCE -DHAVE_LOCALTIME_R
+OS_LIBS = -lsocket -lnsl 
+
+NOSUCHFILE = /no-such-file

mozilla/js/src/editline/Makefile.ref

@@ -0,0 +1,144 @@
+# -*- Mode: makefile -*-
+#
+# ***** BEGIN LICENSE BLOCK *****
+# Version: MPL 1.1/GPL 2.0/LGPL 2.1
+#
+# The contents of this file are subject to the Mozilla Public License Version
+# 1.1 (the "License"); you may not use this file except in compliance with
+# the License. You may obtain a copy of the License at
+# http://www.mozilla.org/MPL/
+#
+# Software distributed under the License is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+# for the specific language governing rights and limitations under the
+# License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is
+# Simmule Turner and Rich Salz.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#
+# Alternatively, the contents of this file may be used under the terms of
+# either the GNU General Public License Version 2 or later (the "GPL"), or
+# the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+# in which case the provisions of the GPL or the LGPL are applicable instead
+# of those above. If you wish to allow use of your version of this file only
+# under the terms of either the GPL or the LGPL, and not to allow others to
+# use your version of this file under the terms of the MPL, indicate your
+# decision by deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL or the LGPL. If you do not delete
+# the provisions above, a recipient may use your version of this file under
+# the terms of any one of the MPL, the GPL or the LGPL.
+#
+# ***** END LICENSE BLOCK *****
+
+#
+# Copyright 1992,1993 Simmule Turner and Rich Salz.  All rights reserved.
+#
+# This software is not subject to any license of the American Telephone
+# and Telegraph Company or of the Regents of the University of California.
+#
+# Permission is granted to anyone to use this software for any purpose on
+# any computer system, and to alter it and redistribute it freely, subject
+# to the following restrictions:
+# 1. The authors are not responsible for the consequences of use of this
+#    software, no matter how awful, even if they arise from flaws in it.
+# 2. The origin of this software must not be misrepresented, either by
+#    explicit claim or by omission.  Since few users ever read sources,
+#    credits must appear in the documentation.
+# 3. Altered versions must be plainly marked as such, and must not be
+#    misrepresented as being the original software.  Since few users
+#    ever read sources, credits must appear in the documentation.
+# 4. This notice may not be removed or altered.
+#
+
+#
+#  Unix makefile for editline library.
+#
+
+##  Set your options:
+##	-DANSI_ARROWS		ANSI arrows keys work like emacs.
+##	-DHAVE_STDLIB		Have <stdlib.h>.
+##	-DHAVE_TCGETATTR	Have tcgetattr(), tcsetattr().
+##	-DHAVE_TERMIO		Have "struct termio" and <termio.h>
+##	(If neither of above two, we use <sgttyb.h> and BSD ioctl's)
+##	-DHIDE			Make static functions static (non debug).
+##	-DHIST_SIZE=n		History size.
+##	-DNEED_STRDUP		Don't have strdup().
+##	-DUNIQUE_HISTORY	Don't save command if same as last one.
+##	-DUSE_DIRENT		Use <dirent.h>, not <sys/dir.h>?
+##	-DUSE_TERMCAP		Use the termcap library for terminal size
+##				see LDFLAGS, below, if you set this.
+##	-DNEED_PERROR		Don't have perror() (used in testit)
+
+##  If you have -DUSE_TERMCAP, set this as appropriate:
+#LDFLAGS = -ltermlib
+#LDFLAGS = -ltermcap
+
+DEFS	= -DANSI_ARROWS -DHAVE_TCGETATTR -DHIDE -DUSE_DIRENT -DSYS_UNIX \
+	-DHAVE_STDLIB -DUNIQUE_HISTORY
+
+DEPTH           = ..
+
+include $(DEPTH)/config.mk
+
+#
+# Default IEEE libm
+#
+CFLAGS          += -DXP_UNIX $(OPTIMIZER) $(OS_CFLAGS) $(DEFINES) $(INCLUDES) \
+		  -DJSFILE $(XCFLAGS) $(DEFS)
+
+INCFILES = editline.h
+.INIT: $(INCFILES)
+.KEEP_STATE:
+EDITLINE_CFILES = editline.c sysunix.c
+
+EDITLINE_OBJS = $(addprefix $(OBJDIR)/, $(EDITLINE_CFILES:.c=.o))
+
+LIBRARY = $(OBJDIR)/libedit.a
+
+define MAKE_OBJDIR
+if test ! -d $(@D); then rm -rf $(@D); mkdir $(@D); fi
+endef
+
+all: $(LIBRARY) 
+
+export:
+
+$(OBJDIR)/%: %.c
+	@$(MAKE_OBJDIR)
+	$(CC) -o $@ $(CFLAGS) $*.c $(LDFLAGS)
+
+$(OBJDIR)/%.o: %.c
+	@$(MAKE_OBJDIR)
+	$(CC) -o $@ -c $(CFLAGS) $*.c
+
+$(OBJDIR)/%.o: %.s
+	@$(MAKE_OBJDIR)
+	$(AS) -o $@ $(ASFLAGS) $*.s
+
+$(LIBRARY): $(EDITLINE_OBJS)
+	$(AR) rv $@ $?
+	$(RANLIB) $@
+
+#libedit.a : $(EDITLINE_OBJS) 
+#	$(AR) cru $(OBJDIR)/libedit.a $(EDITLINE_OBJS)
+#	$(RANLIB) $(OBJDIR)/libedit.a
+
+clean:
+	rm -rf $(EDITLINE_OBJS)
+
+clobber:
+	rm -rf $(EDITLINE_OBJS) $(LIBRARY) $(DEPENDENCIES)
+
+SUFFIXES: .i
+%.i: %.c
+	$(CC) -C -E $(CFLAGS) $< > $*.i
+
+
+

mozilla/js/src/editline/README

@@ -0,0 +1,83 @@
+The files in this directory provide simple line-editing and history
+support for the standalone javascript engine, through the 'editline'
+library.
+
+editline has only been enabled for those platforms on which it is
+known to build; to try it on a different platform, define JS_EDITLINE
+before building.  Line editing (and js.c) is not a supported feature
+of the javascript library, so your mileage my vary.
+
+The editline API is a compatible subset of the FSF readline API; if
+you have readline installed and would like to link to that instead,
+define JS_READLINE.  Note that the readline library is distributed
+under the GPL, so any resulting binaries are not legally
+distributable.
+
+The editline files used here have been modified to work with the js
+build system and to quiet some compiler warnings, and also to remove
+filename-completion support.
+
+If anyone knows of a more recent version of these files, or a site on
+which they are being maintained, please let me know!
+
+Mike McCabe, mccabe@netscape.com
+
+
+The original README file distributed with the editline library follows.
+
+
+
+This is a line-editing library.  It can be linked into almost any
+program to provide command-line editing and recall.
+
+It is call-compatible with the FSF readline library, but it is a
+fraction of the size (and offers fewer features).  It does not use
+standard I/O.  It is distributed under a "C News-like" copyright.
+
+Configuration is done in the Makefile.  Type "make testit" to get
+a small slow shell for testing.
+
+An earlier version was distributed with Byron's rc.  Principal
+changes over that version include:
+	Faster.
+	Is eight-bit clean (thanks to brendan@cs.widener.edu)
+	Written in K&R C, but ANSI compliant (gcc all warnings)
+	Propagates EOF properly; rc trip test now passes
+	Doesn't need or use or provide memmove.
+	More robust
+	Calling sequence changed to be compatible with readline.
+	Test program, new manpage, better configuration
+	More system-independant; includes Unix and OS-9 support.
+
+This contains some changes since the posting to comp.sources.misc:
+	Bugfix for completion on absolute pathnames.
+	Better handling of M-n versus showing raw 8bit chars.
+	Better signal handling.
+	Now supports termios/termio/sgttyb ioctl's.
+	Add M-m command to toggle how 8bit data is displayed.
+
+There is one known bug:
+	History-searching redraws the line wrong if the text
+	retrieved is shorter then the prompt.
+
+Enjoy,
+	Rich $alz
+	<rsalz@osf.org>
+
+ Copyright 1992,1993 Simmule Turner and Rich Salz.  All rights reserved.
+
+ This software is not subject to any license of the American Telephone
+ and Telegraph Company or of the Regents of the University of California.
+
+ Permission is granted to anyone to use this software for any purpose on
+ any computer system, and to alter it and redistribute it freely, subject
+ to the following restrictions:
+ 1. The authors are not responsible for the consequences of use of this
+    software, no matter how awful, even if they arise from flaws in it.
+ 2. The origin of this software must not be misrepresented, either by
+    explicit claim or by omission.  Since few users ever read sources,
+    credits must appear in the documentation.
+ 3. Altered versions must be plainly marked as such, and must not be
+    misrepresented as being the original software.  Since few users
+    ever read sources, credits must appear in the documentation.
+ 4. This notice may not be removed or altered.

mozilla/js/src/editline/editline.3

@@ -0,0 +1,175 @@
+.TH EDITLINE 3
+.SH NAME
+editline \- command-line editing library with history
+.SH SYNOPSIS
+.nf
+.B "char *"
+.B "readline(prompt)"
+.B "     char	*prompt;"
+
+.B "void"
+.B "add_history(line)"
+.B "    char	*line;"
+.fi
+.SH DESCRIPTION
+.I Editline
+is a library that provides an line-editing interface with text recall.
+It is intended to be compatible with the
+.I readline
+library provided by the Free Software Foundation, but much smaller.
+The bulk of this manual page describes the user interface.
+.PP
+The
+.I readline
+routine returns a line of text with the trailing newline removed.
+The data is returned in a buffer allocated with
+.IR malloc (3),
+so the space should be released with
+.IR free (3)
+when the calling program is done with it.
+Before accepting input from the user, the specified
+.I prompt
+is displayed on the terminal.
+.PP
+The
+.I add_history
+routine makes a copy of the specified
+.I line
+and adds it to the internal history list.
+.SS "User Interface"
+A program that uses this library provides a simple emacs-like editing
+interface to its users.
+A line may be edited before it is sent to the calling program by typing either
+control characters or escape sequences.
+A control character, shown as a caret followed by a letter, is typed by
+holding down the ``control'' key while the letter is typed.
+For example, ``^A'' is a control-A.
+An escape sequence is entered by typing the ``escape'' key followed by one or
+more characters.
+The escape key is abbreviated as ``ESC.''
+Note that unlike control keys, case matters in escape sequences; ``ESC\ F''
+is not the same as ``ESC\ f''.
+.PP
+An editing command may be typed anywhere on the line, not just at the
+beginning.
+In addition, a return may also be typed anywhere on the line, not just at
+the end.
+.PP
+Most editing commands may be given a repeat count,
+.IR n ,
+where
+.I n
+is a number.
+To enter a repeat count, type the escape key, the number, and then
+the command to execute.
+For example, ``ESC\ 4\ ^f'' moves forward four characters.
+If a command may be given a repeat count then the text ``[n]'' is given at the
+end of its description.
+.PP
+The following control characters are accepted:
+.RS
+.nf
+.ta \w'ESC DEL  'u
+^A	Move to the beginning of the line
+^B	Move left (backwards) [n]
+^D	Delete character [n]
+^E	Move to end of line
+^F	Move right (forwards) [n]
+^G	Ring the bell
+^H	Delete character before cursor (backspace key) [n]
+^I	Complete filename (tab key); see below
+^J	Done with line (return key)
+^K	Kill to end of line (or column [n])
+^L	Redisplay line
+^M	Done with line (alternate return key)
+^N	Get next line from history [n]
+^P	Get previous line from history [n]
+^R	Search backward (forward if [n]) through history for text;
+\&	must start line if text begins with an uparrow
+^T	Transpose characters
+^V	Insert next character, even if it is an edit command
+^W	Wipe to the mark
+^X^X	Exchange current location and mark
+^Y	Yank back last killed text
+^[	Start an escape sequence (escape key)
+^]c	Move forward to next character ``c''
+^?	Delete character before cursor (delete key) [n]
+.fi
+.RE
+.PP
+The following escape sequences are provided.
+.RS
+.nf
+.ta \w'ESC DEL  'u
+ESC\ ^H	Delete previous word (backspace key) [n]
+ESC\ DEL	Delete previous word (delete key) [n]
+ESC\ SP	Set the mark (space key); see ^X^X and ^Y above
+ESC\ \.	Get the last (or [n]'th) word from previous line
+ESC\ \?	Show possible completions; see below
+ESC\ <	Move to start of history
+ESC\ >	Move to end of history
+ESC\ b	Move backward a word [n]
+ESC\ d	Delete word under cursor [n]
+ESC\ f	Move forward a word [n]
+ESC\ l	Make word lowercase [n]
+ESC\ m	Toggle if 8bit chars display normally or with ``M\-'' prefix
+ESC\ u	Make word uppercase [n]
+ESC\ y	Yank back last killed text
+ESC\ v	Show library version
+ESC\ w	Make area up to mark yankable
+ESC\ nn	Set repeat count to the number nn
+ESC\ C	Read from environment variable ``_C_'', where C is
+\&	an uppercase letter
+.fi
+.RE
+.PP
+The
+.I editline
+library has a small macro facility.
+If you type the escape key followed by an uppercase letter,
+.IR C ,
+then the contents of the environment variable
+.I _C_
+are read in as if you had typed them at the keyboard.
+For example, if the variable
+.I _L_
+contains the following:
+.RS
+^A^Kecho '^V^[[H^V^[[2J'^M
+.RE
+Then typing ``ESC L'' will move to the beginning of the line, kill the
+entire line, enter the echo command needed to clear the terminal (if your
+terminal is like a VT-100), and send the line back to the shell.
+.PP
+The
+.I editline
+library also does filename completion.
+Suppose the root directory has the following files in it:
+.RS
+.nf
+.ta \w'core   'u
+bin	vmunix
+core	vmunix.old
+.fi
+.RE
+If you type ``rm\ /v'' and then the tab key.
+.I Editline
+will then finish off as much of the name as possible by adding ``munix''.
+Because the name is not unique, it will then beep.
+If you type the escape key and a question mark, it will display the
+two choices.
+If you then type a period and a tab, the library will finish off the filename
+for you:
+.RS
+.nf
+.RI "rm /v[TAB]" munix .TAB old
+.fi
+.RE
+The tab key is shown by ``[TAB]'' and the automatically-entered text
+is shown in italics.
+.SH "BUGS AND LIMITATIONS"
+Cannot handle lines more than 80 columns.
+.SH AUTHORS
+Simmule R. Turner <uunet.uu.net!capitol!sysgo!simmy>
+and Rich $alz <rsalz@osf.org>.
+Original manual page by DaviD W. Sanderson <dws@ssec.wisc.edu>.

mozilla/js/src/editline/editline.h

@@ -0,0 +1,135 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * ***** BEGIN LICENSE BLOCK *****
+ * Version: MPL 1.1/GPL 2.0/LGPL 2.1
+ *
+ * The contents of this file are subject to the Mozilla Public License Version
+ * 1.1 (the "License"); you may not use this file except in compliance with
+ * the License. You may obtain a copy of the License at
+ * http://www.mozilla.org/MPL/
+ *
+ * Software distributed under the License is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+ * for the specific language governing rights and limitations under the
+ * License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is
+ * Simmule Turner and Rich Salz.
+ * Portions created by the Initial Developer are Copyright (C) 1998
+ * the Initial Developer. All Rights Reserved.
+ *
+ * Contributor(s):
+ *
+ * Alternatively, the contents of this file may be used under the terms of
+ * either the GNU General Public License Version 2 or later (the "GPL"), or
+ * the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+ * in which case the provisions of the GPL or the LGPL are applicable instead
+ * of those above. If you wish to allow use of your version of this file only
+ * under the terms of either the GPL or the LGPL, and not to allow others to
+ * use your version of this file under the terms of the MPL, indicate your
+ * decision by deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL or the LGPL. If you do not delete
+ * the provisions above, a recipient may use your version of this file under
+ * the terms of any one of the MPL, the GPL or the LGPL.
+ *
+ * ***** END LICENSE BLOCK ***** */
+
+/*
+ * Copyright 1992,1993 Simmule Turner and Rich Salz.  All rights reserved.
+ *
+ * This software is not subject to any license of the American Telephone
+ * and Telegraph Company or of the Regents of the University of California.
+ *
+ * Permission is granted to anyone to use this software for any purpose on
+ * any computer system, and to alter it and redistribute it freely, subject
+ * to the following restrictions:
+ * 1. The authors are not responsible for the consequences of use of this
+ *    software, no matter how awful, even if they arise from flaws in it.
+ * 2. The origin of this software must not be misrepresented, either by
+ *    explicit claim or by omission.  Since few users ever read sources,
+ *    credits must appear in the documentation.
+ * 3. Altered versions must be plainly marked as such, and must not be
+ *    misrepresented as being the original software.  Since few users
+ *    ever read sources, credits must appear in the documentation.
+ * 4. This notice may not be removed or altered.
+ */
+
+/*
+**  Internal header file for editline library.
+*/
+#include <stdio.h>
+#if	defined(HAVE_STDLIB)
+#include <stdlib.h>
+#include <string.h>
+#endif	/* defined(HAVE_STDLIB) */
+#if	defined(SYS_UNIX)
+#include "unix.h"
+#endif	/* defined(SYS_UNIX) */
+#if	defined(SYS_OS9)
+#include "os9.h"
+#endif	/* defined(SYS_OS9) */
+
+#if	!defined(SIZE_T)
+#define SIZE_T	unsigned int
+#endif	/* !defined(SIZE_T) */
+
+typedef unsigned char	CHAR;
+
+#if	defined(HIDE)
+#define STATIC	static
+#else
+#define STATIC	/* NULL */
+#endif	/* !defined(HIDE) */
+
+#if	!defined(CONST)
+#if	defined(__STDC__)
+#define CONST	const
+#else
+#define CONST
+#endif	/* defined(__STDC__) */
+#endif	/* !defined(CONST) */
+
+
+#define MEM_INC		64
+#define SCREEN_INC	256
+
+#define DISPOSE(p)	free((char *)(p))
+#define NEW(T, c)	\
+	((T *)malloc((unsigned int)(sizeof (T) * (c))))
+#define RENEW(p, T, c)	\
+	(p = (T *)realloc((char *)(p), (unsigned int)(sizeof (T) * (c))))
+#define COPYFROMTO(new, p, len)	\
+	(void)memcpy((char *)(new), (char *)(p), (int)(len))
+
+
+/*
+**  Variables and routines internal to this package.
+*/
+extern int	rl_eof;
+extern int	rl_erase;
+extern int	rl_intr;
+extern int	rl_kill;
+extern int	rl_quit;
+extern char	*rl_complete();
+extern int	rl_list_possib();
+extern void	rl_ttyset();
+extern void	rl_add_slash();
+
+#if	!defined(HAVE_STDLIB)
+extern char	*getenv();
+extern char	*malloc();
+extern char	*realloc();
+extern char	*memcpy();
+extern char	*strcat();
+extern char	*strchr();
+extern char	*strrchr();
+extern char	*strcpy();
+extern char	*strdup();
+extern int	strcmp();
+extern int	strlen();
+extern int	strncmp();
+#endif	/* !defined(HAVE_STDLIB) */
+

mozilla/js/src/editline/sysunix.c

@@ -0,0 +1,182 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * ***** BEGIN LICENSE BLOCK *****
+ * Version: MPL 1.1/GPL 2.0/LGPL 2.1
+ *
+ * The contents of this file are subject to the Mozilla Public License Version
+ * 1.1 (the "License"); you may not use this file except in compliance with
+ * the License. You may obtain a copy of the License at
+ * http://www.mozilla.org/MPL/
+ *
+ * Software distributed under the License is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+ * for the specific language governing rights and limitations under the
+ * License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is
+ * Simmule Turner and Rich Salz.
+ * Portions created by the Initial Developer are Copyright (C) 1998
+ * the Initial Developer. All Rights Reserved.
+ *
+ * Contributor(s):
+ *
+ * Alternatively, the contents of this file may be used under the terms of
+ * either the GNU General Public License Version 2 or later (the "GPL"), or
+ * the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+ * in which case the provisions of the GPL or the LGPL are applicable instead
+ * of those above. If you wish to allow use of your version of this file only
+ * under the terms of either the GPL or the LGPL, and not to allow others to
+ * use your version of this file under the terms of the MPL, indicate your
+ * decision by deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL or the LGPL. If you do not delete
+ * the provisions above, a recipient may use your version of this file under
+ * the terms of any one of the MPL, the GPL or the LGPL.
+ *
+ * ***** END LICENSE BLOCK ***** */
+
+/*
+ * Copyright 1992,1993 Simmule Turner and Rich Salz.  All rights reserved.
+ *
+ * This software is not subject to any license of the American Telephone
+ * and Telegraph Company or of the Regents of the University of California.
+ *
+ * Permission is granted to anyone to use this software for any purpose on
+ * any computer system, and to alter it and redistribute it freely, subject
+ * to the following restrictions:
+ * 1. The authors are not responsible for the consequences of use of this
+ *    software, no matter how awful, even if they arise from flaws in it.
+ * 2. The origin of this software must not be misrepresented, either by
+ *    explicit claim or by omission.  Since few users ever read sources,
+ *    credits must appear in the documentation.
+ * 3. Altered versions must be plainly marked as such, and must not be
+ *    misrepresented as being the original software.  Since few users
+ *    ever read sources, credits must appear in the documentation.
+ * 4. This notice may not be removed or altered.
+ */
+
+
+/*
+**  Unix system-dependant routines for editline library.
+*/
+#include "editline.h"
+
+#if	defined(HAVE_TCGETATTR)
+#include <termios.h>
+
+void
+rl_ttyset(Reset)
+    int				Reset;
+{
+    static struct termios	old;
+    struct termios		new;
+
+    if (Reset == 0) {
+	(void)tcgetattr(0, &old);
+	rl_erase = old.c_cc[VERASE];
+	rl_kill = old.c_cc[VKILL];
+	rl_eof = old.c_cc[VEOF];
+	rl_intr = old.c_cc[VINTR];
+	rl_quit = old.c_cc[VQUIT];
+
+	new = old;
+	new.c_cc[VINTR] = -1;
+	new.c_cc[VQUIT] = -1;
+	new.c_lflag &= ~(ECHO | ICANON);
+	new.c_iflag &= ~(ISTRIP | INPCK);
+	new.c_cc[VMIN] = 1;
+	new.c_cc[VTIME] = 0;
+	(void)tcsetattr(0, TCSADRAIN, &new);
+    }
+    else
+	(void)tcsetattr(0, TCSADRAIN, &old);
+}
+
+#else
+#if	defined(HAVE_TERMIO)
+#include <termio.h>
+
+void
+rl_ttyset(Reset)
+    int				Reset;
+{
+    static struct termio	old;
+    struct termio		new;
+
+    if (Reset == 0) {
+	(void)ioctl(0, TCGETA, &old);
+	rl_erase = old.c_cc[VERASE];
+	rl_kill = old.c_cc[VKILL];
+	rl_eof = old.c_cc[VEOF];
+	rl_intr = old.c_cc[VINTR];
+	rl_quit = old.c_cc[VQUIT];
+
+	new = old;
+	new.c_cc[VINTR] = -1;
+	new.c_cc[VQUIT] = -1;
+	new.c_lflag &= ~(ECHO | ICANON);
+	new.c_iflag &= ~(ISTRIP | INPCK);
+	new.c_cc[VMIN] = 1;
+	new.c_cc[VTIME] = 0;
+	(void)ioctl(0, TCSETAW, &new);
+    }
+    else
+	(void)ioctl(0, TCSETAW, &old);
+}
+
+#else
+#include <sgtty.h>
+
+void
+rl_ttyset(Reset)
+    int				Reset;
+{
+    static struct sgttyb	old_sgttyb;
+    static struct tchars	old_tchars;
+    struct sgttyb		new_sgttyb;
+    struct tchars		new_tchars;
+
+    if (Reset == 0) {
+	(void)ioctl(0, TIOCGETP, &old_sgttyb);
+	rl_erase = old_sgttyb.sg_erase;
+	rl_kill = old_sgttyb.sg_kill;
+
+	(void)ioctl(0, TIOCGETC, &old_tchars);
+	rl_eof = old_tchars.t_eofc;
+	rl_intr = old_tchars.t_intrc;
+	rl_quit = old_tchars.t_quitc;
+
+	new_sgttyb = old_sgttyb;
+	new_sgttyb.sg_flags &= ~ECHO;
+	new_sgttyb.sg_flags |= RAW;
+#if	defined(PASS8)
+	new_sgttyb.sg_flags |= PASS8;
+#endif	/* defined(PASS8) */
+	(void)ioctl(0, TIOCSETP, &new_sgttyb);
+
+	new_tchars = old_tchars;
+	new_tchars.t_intrc = -1;
+	new_tchars.t_quitc = -1;
+	(void)ioctl(0, TIOCSETC, &new_tchars);
+    }
+    else {
+	(void)ioctl(0, TIOCSETP, &old_sgttyb);
+	(void)ioctl(0, TIOCSETC, &old_tchars);
+    }
+}
+#endif	/* defined(HAVE_TERMIO) */
+#endif	/* defined(HAVE_TCGETATTR) */
+
+void
+rl_add_slash(path, p)
+    char	*path;
+    char	*p;
+{
+    struct stat	Sb;
+
+    if (stat(path, &Sb) >= 0)
+	(void)strcat(p, S_ISDIR(Sb.st_mode) ? "/" : " ");
+}
+

mozilla/js/src/editline/unix.h

@@ -0,0 +1,82 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * ***** BEGIN LICENSE BLOCK *****
+ * Version: MPL 1.1/GPL 2.0/LGPL 2.1
+ *
+ * The contents of this file are subject to the Mozilla Public License Version
+ * 1.1 (the "License"); you may not use this file except in compliance with
+ * the License. You may obtain a copy of the License at
+ * http://www.mozilla.org/MPL/
+ *
+ * Software distributed under the License is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+ * for the specific language governing rights and limitations under the
+ * License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is
+ * Simmule Turner and Rich Salz.
+ * Portions created by the Initial Developer are Copyright (C) 1998
+ * the Initial Developer. All Rights Reserved.
+ *
+ * Contributor(s):
+ *
+ * Alternatively, the contents of this file may be used under the terms of
+ * either the GNU General Public License Version 2 or later (the "GPL"), or
+ * the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+ * in which case the provisions of the GPL or the LGPL are applicable instead
+ * of those above. If you wish to allow use of your version of this file only
+ * under the terms of either the GPL or the LGPL, and not to allow others to
+ * use your version of this file under the terms of the MPL, indicate your
+ * decision by deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL or the LGPL. If you do not delete
+ * the provisions above, a recipient may use your version of this file under
+ * the terms of any one of the MPL, the GPL or the LGPL.
+ *
+ * ***** END LICENSE BLOCK ***** */
+
+/*
+ * Copyright 1992,1993 Simmule Turner and Rich Salz.  All rights reserved.
+ *
+ * This software is not subject to any license of the American Telephone
+ * and Telegraph Company or of the Regents of the University of California.
+ *
+ * Permission is granted to anyone to use this software for any purpose on
+ * any computer system, and to alter it and redistribute it freely, subject
+ * to the following restrictions:
+ * 1. The authors are not responsible for the consequences of use of this
+ *    software, no matter how awful, even if they arise from flaws in it.
+ * 2. The origin of this software must not be misrepresented, either by
+ *    explicit claim or by omission.  Since few users ever read sources,
+ *    credits must appear in the documentation.
+ * 3. Altered versions must be plainly marked as such, and must not be
+ *    misrepresented as being the original software.  Since few users
+ *    ever read sources, credits must appear in the documentation.
+ * 4. This notice may not be removed or altered.
+ */
+
+
+/*
+**  Editline system header file for Unix.
+*/
+
+#define CRLF		"\r\n"
+#define FORWARD		STATIC
+
+#include <sys/types.h>
+#include <sys/stat.h>
+
+#if	defined(USE_DIRENT)
+#include <dirent.h>
+typedef struct dirent	DIRENTRY;
+#else
+#include <sys/dir.h>
+typedef struct direct	DIRENTRY;
+#endif	/* defined(USE_DIRENT) */
+
+#if	!defined(S_ISDIR)
+#define S_ISDIR(m)		(((m) & S_IFMT) == S_IFDIR)
+#endif	/* !defined(S_ISDIR) */
+

mozilla/js/src/fdlibm/Makefile.in

@@ -0,0 +1,127 @@
+#
+# ***** BEGIN LICENSE BLOCK *****
+# Version: MPL 1.1/GPL 2.0/LGPL 2.1
+#
+# The contents of this file are subject to the Mozilla Public License Version
+# 1.1 (the "License"); you may not use this file except in compliance with
+# the License. You may obtain a copy of the License at
+# http://www.mozilla.org/MPL/
+#
+# Software distributed under the License is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+# for the specific language governing rights and limitations under the
+# License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is
+# Netscape Communications Corporation.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#
+# Alternatively, the contents of this file may be used under the terms of
+# either of the GNU General Public License Version 2 or later (the "GPL"),
+# or the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+# in which case the provisions of the GPL or the LGPL are applicable instead
+# of those above. If you wish to allow use of your version of this file only
+# under the terms of either the GPL or the LGPL, and not to allow others to
+# use your version of this file under the terms of the MPL, indicate your
+# decision by deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL or the LGPL. If you do not delete
+# the provisions above, a recipient may use your version of this file under
+# the terms of any one of the MPL, the GPL or the LGPL.
+#
+# ***** END LICENSE BLOCK *****
+
+DEPTH		= ../../..
+topsrcdir	= @top_srcdir@
+srcdir		= @srcdir@
+VPATH		= @srcdir@
+
+include $(DEPTH)/config/autoconf.mk
+
+MODULE		= js
+LIBRARY_NAME	= fdm
+
+CSRCS		= \
+		e_acos.c \
+		e_asin.c \
+		e_atan2.c \
+		e_exp.c \
+		e_fmod.c \
+		e_log.c \
+		e_pow.c \
+		e_rem_pio2.c \
+		s_scalbn.c \
+		e_sqrt.c \
+		k_cos.c \
+		k_sin.c \
+		k_rem_pio2.c \
+		k_tan.c \
+		s_atan.c \
+		s_ceil.c \
+		s_copysign.c \
+		s_cos.c \
+		s_fabs.c \
+		s_finite.c \
+		s_floor.c \
+		s_isnan.c \
+		s_lib_version.c \
+		s_sin.c \
+		s_tan.c \
+		w_acos.c \
+		w_asin.c \
+		w_atan2.c \
+		w_exp.c \
+		w_fmod.c \
+		w_log.c \
+		w_pow.c \
+		w_sqrt.c \
+		$(NULL)
+
+EXPORTS		= fdlibm.h
+
+# we need to force a static lib for the linking that js/src/Makefile.in wants
+# to do, and we don't really need a shared library ever, so:
+FORCE_STATIC_LIB = 1
+FORCE_USE_PIC = 1
+
+include $(topsrcdir)/config/rules.mk
+
+#
+# Default IEEE libm
+#
+CFLAGS		+= -D_IEEE_LIBM
+
+ifeq ($(OS_ARCH),Linux)
+LDFLAGS		+= -ldl
+endif
+
+ifeq ($(OS_ARCH),OSF1)
+LDFLAGS		+= -lc_r
+endif
+
+ifeq ($(OS_ARCH),SunOS)
+LDFLAGS		+= -lposix4 -ldl -lnsl -lsocket
+ifeq ($(CPU_ARCH),sparc)
+
+ifndef JS_NO_ULTRA
+ULTRA_OPTIONS	:= -xarch=v8plus,-DULTRA_SPARC
+ULTRA_OPTIONSCC	:= -DULTRA_SPARC
+else
+ULTRA_OPTIONS	:= -xarch=v8
+ULTRA_OPTIONSCC	:=
+endif
+
+ifeq ($(shell uname -m),sun4u)
+ASFLAGS		+= -Wa,$(ULTRA_OPTIONS),-P,-L,-D_ASM,-D__STDC__=0 $(ULTRA_OPTIONSCC)
+else
+ASFLAGS		+= -Wa,-xarch=v8,-P,-L,-D_ASM,-D__STDC__=0
+endif
+
+endif
+endif
+

mozilla/js/src/fdlibm/Makefile.ref

@@ -0,0 +1,192 @@
+# -*- Mode: makefile -*-
+#
+# ***** BEGIN LICENSE BLOCK *****
+# Version: MPL 1.1/GPL 2.0/LGPL 2.1
+#
+# The contents of this file are subject to the Mozilla Public License Version
+# 1.1 (the "License"); you may not use this file except in compliance with
+# the License. You may obtain a copy of the License at
+# http://www.mozilla.org/MPL/
+#
+# Software distributed under the License is distributed on an "AS IS" basis,
+# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+# for the specific language governing rights and limitations under the
+# License.
+#
+# The Original Code is Mozilla Communicator client code, released
+# March 31, 1998.
+#
+# The Initial Developer of the Original Code is
+# Sun Microsystems, Inc.
+# Portions created by the Initial Developer are Copyright (C) 1998
+# the Initial Developer. All Rights Reserved.
+#
+# Contributor(s):
+#
+# Alternatively, the contents of this file may be used under the terms of
+# either of the GNU General Public License Version 2 or later (the "GPL"),
+# or the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+# in which case the provisions of the GPL or the LGPL are applicable instead
+# of those above. If you wish to allow use of your version of this file only
+# under the terms of either the GPL or the LGPL, and not to allow others to
+# use your version of this file under the terms of the MPL, indicate your
+# decision by deleting the provisions above and replace them with the notice
+# and other provisions required by the GPL or the LGPL. If you do not delete
+# the provisions above, a recipient may use your version of this file under
+# the terms of any one of the MPL, the GPL or the LGPL.
+#
+# ***** END LICENSE BLOCK *****
+
+#
+#  @(#)Makefile 1.4 95/01/18 
+# 
+#  ====================================================
+#  Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+# 
+#  Developed at SunSoft, a Sun Microsystems, Inc. business.
+#  Permission to use, copy, modify, and distribute this
+#  software is freely granted, provided that this notice 
+#  is preserved.
+#  ====================================================
+# 
+# 
+
+#
+# There are two options in making libm at fdlibm compile time:
+#       _IEEE_LIBM      --- IEEE libm; smaller, and somewhat faster
+#       _MULTI_LIBM     --- Support multi-standard at runtime by 
+#                           imposing wrapper functions defined in 
+#                           fdlibm.h:
+#                               _IEEE_MODE      -- IEEE
+#                               _XOPEN_MODE     -- X/OPEN
+#                               _POSIX_MODE     -- POSIX/ANSI
+#                               _SVID3_MODE     -- SVID
+#
+# Here is how to set up CFLAGS to create the desired libm at 
+# compile time:
+#
+#       CFLAGS = -D_IEEE_LIBM           ... IEEE libm (recommended)
+#       CFLAGS = -D_SVID3_MODE  ... Multi-standard supported
+#                                           libm with SVID as the 
+#                                           default standard
+#       CFLAGS = -D_XOPEN_MODE  ... Multi-standard supported
+#                                           libm with XOPEN as the 
+#                                           default standard
+#       CFLAGS = -D_POSIX_MODE  ... Multi-standard supported
+#                                           libm with POSIX as the 
+#                                           default standard
+#       CFLAGS =                        ... Multi-standard supported
+#                                           libm with IEEE as the 
+#                                           default standard
+# 
+# NOTE: if scalb's second arguement is an int, then one must
+# define _SCALB_INT in CFLAGS. The default prototype of scalb
+# is double scalb(double, double)
+#
+
+DEPTH           = ..
+
+include $(DEPTH)/config.mk
+
+#
+# Default IEEE libm
+#
+CFLAGS          += -DXP_UNIX $(OPTIMIZER) $(OS_CFLAGS) $(DEFINES) $(INCLUDES) \
+		  -DJSFILE $(XCFLAGS) -D_IEEE_LIBM
+
+# Need for jstypes.h and friends
+INCLUDES += -I..
+INCLUDES += -I../$(OBJDIR)
+
+#CC = cc
+
+INCFILES = fdlibm.h
+.INIT: $(INCFILES)
+.KEEP_STATE:
+FDLIBM_CFILES =         \
+	k_standard.c k_rem_pio2.c \
+	k_cos.c k_sin.c k_tan.c \
+	e_acos.c e_acosh.c e_asin.c e_atan2.c \
+	e_atanh.c e_cosh.c e_exp.c e_fmod.c \
+	e_gamma.c e_gamma_r.c e_hypot.c e_j0.c \
+	e_j1.c e_jn.c e_lgamma.c e_lgamma_r.c \
+	e_log.c e_log10.c e_pow.c e_rem_pio2.c e_remainder.c \
+	e_scalb.c e_sinh.c e_sqrt.c \
+	w_acos.c w_acosh.c w_asin.c w_atan2.c \
+	w_atanh.c w_cosh.c w_exp.c w_fmod.c \
+	w_gamma.c w_gamma_r.c w_hypot.c w_j0.c \
+	w_j1.c w_jn.c w_lgamma.c w_lgamma_r.c \
+	w_log.c w_log10.c w_pow.c w_remainder.c \
+	w_scalb.c w_sinh.c w_sqrt.c \
+	s_asinh.c s_atan.c s_cbrt.c s_ceil.c s_copysign.c \
+	s_cos.c s_erf.c s_expm1.c s_fabs.c s_finite.c s_floor.c \
+	s_frexp.c s_ilogb.c s_isnan.c s_ldexp.c s_lib_version.c \
+	s_log1p.c s_logb.c s_matherr.c s_modf.c s_nextafter.c \
+	s_rint.c s_scalbn.c s_signgam.c s_significand.c s_sin.c \
+	s_tan.c s_tanh.c
+
+ifdef USE_MSVC
+FDLIBM_OBJS = $(addprefix $(OBJDIR)/, $(FDLIBM_CFILES:.c=.obj))
+else
+FDLIBM_OBJS = $(addprefix $(OBJDIR)/, $(FDLIBM_CFILES:.c=.o))
+endif
+
+ifdef USE_MSVC
+LIBRARY = $(OBJDIR)/fdlibm.lib
+else
+LIBRARY = $(OBJDIR)/libfdm.a
+endif
+
+define MAKE_OBJDIR
+if test ! -d $(@D); then rm -rf $(@D); mkdir -p $(@D); fi
+endef
+
+all: $(LIBRARY) 
+
+export:
+
+$(OBJDIR)/%: %.c
+	@$(MAKE_OBJDIR)
+	$(CC) -o $@ $(CFLAGS) $*.c $(LDFLAGS)
+
+$(OBJDIR)/%.o: %.c
+	@$(MAKE_OBJDIR)
+	$(CC) -o $@ -c $(CFLAGS) $*.c
+
+$(OBJDIR)/%.o: %.s
+	@$(MAKE_OBJDIR)
+	$(AS) -o $@ $(ASFLAGS) $*.s
+
+# windows only
+$(OBJDIR)/%.obj: %.c
+	@$(MAKE_OBJDIR)
+	$(CC) -Fo$(OBJDIR)/ -c $(CFLAGS) $*.c
+
+ifeq ($(OS_ARCH),OS2)
+$(LIBRARY): $(FDLIBM_OBJS)
+	$(AR) $@ $? $(AR_OS2_SUFFIX)
+	$(RANLIB) $@
+else
+ifdef USE_MSVC
+$(LIBRARY): $(FDLIBM_OBJS)
+	lib.exe /out:"$@" $?
+else
+$(LIBRARY): $(FDLIBM_OBJS)
+	$(AR) rv $@ $?
+	$(RANLIB) $@
+endif
+endif
+
+libfdm.a : $(FDLIBM_OBJS) 
+	$(AR) cru $(OBJDIR)/libfdm.a $(FDLIBM_OBJS)
+	$(RANLIB) $(OBJDIR)/libfdm.a
+
+clean:
+	rm -rf $(FDLIBM_OBJS)
+
+clobber:
+	rm -rf $(FDLIBM_OBJS) $(LIBRARY) $(DEPENDENCIES)
+
+SUFFIXES: .i
+%.i: %.c
+	$(CC) -C -E $(CFLAGS) $< > $*.i

mozilla/js/src/fdlibm/e_acos.c

@@ -0,0 +1,147 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * ***** BEGIN LICENSE BLOCK *****
+ * Version: MPL 1.1/GPL 2.0/LGPL 2.1
+ *
+ * The contents of this file are subject to the Mozilla Public License Version
+ * 1.1 (the "License"); you may not use this file except in compliance with
+ * the License. You may obtain a copy of the License at
+ * http://www.mozilla.org/MPL/
+ *
+ * Software distributed under the License is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+ * for the specific language governing rights and limitations under the
+ * License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is
+ * Sun Microsystems, Inc.
+ * Portions created by the Initial Developer are Copyright (C) 1998
+ * the Initial Developer. All Rights Reserved.
+ *
+ * Contributor(s):
+ *
+ * Alternatively, the contents of this file may be used under the terms of
+ * either of the GNU General Public License Version 2 or later (the "GPL"),
+ * or the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+ * in which case the provisions of the GPL or the LGPL are applicable instead
+ * of those above. If you wish to allow use of your version of this file only
+ * under the terms of either the GPL or the LGPL, and not to allow others to
+ * use your version of this file under the terms of the MPL, indicate your
+ * decision by deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL or the LGPL. If you do not delete
+ * the provisions above, a recipient may use your version of this file under
+ * the terms of any one of the MPL, the GPL or the LGPL.
+ *
+ * ***** END LICENSE BLOCK ***** */
+
+/* @(#)e_acos.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* __ieee754_acos(x)
+ * Method :                  
+ *	acos(x)  = pi/2 - asin(x)
+ *	acos(-x) = pi/2 + asin(x)
+ * For |x|<=0.5
+ *	acos(x) = pi/2 - (x + x*x^2*R(x^2))	(see asin.c)
+ * For x>0.5
+ * 	acos(x) = pi/2 - (pi/2 - 2asin(sqrt((1-x)/2)))
+ *		= 2asin(sqrt((1-x)/2))  
+ *		= 2s + 2s*z*R(z) 	...z=(1-x)/2, s=sqrt(z)
+ *		= 2f + (2c + 2s*z*R(z))
+ *     where f=hi part of s, and c = (z-f*f)/(s+f) is the correction term
+ *     for f so that f+c ~ sqrt(z).
+ * For x<-0.5
+ *	acos(x) = pi - 2asin(sqrt((1-|x|)/2))
+ *		= pi - 0.5*(s+s*z*R(z)), where z=(1-|x|)/2,s=sqrt(z)
+ *
+ * Special cases:
+ *	if x is NaN, return x itself;
+ *	if |x|>1, return NaN with invalid signal.
+ *
+ * Function needed: sqrt
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double 
+#else
+static double 
+#endif
+one=  1.00000000000000000000e+00, /* 0x3FF00000, 0x00000000 */
+pi =  3.14159265358979311600e+00, /* 0x400921FB, 0x54442D18 */
+pio2_hi =  1.57079632679489655800e+00, /* 0x3FF921FB, 0x54442D18 */
+pio2_lo =  6.12323399573676603587e-17, /* 0x3C91A626, 0x33145C07 */
+pS0 =  1.66666666666666657415e-01, /* 0x3FC55555, 0x55555555 */
+pS1 = -3.25565818622400915405e-01, /* 0xBFD4D612, 0x03EB6F7D */
+pS2 =  2.01212532134862925881e-01, /* 0x3FC9C155, 0x0E884455 */
+pS3 = -4.00555345006794114027e-02, /* 0xBFA48228, 0xB5688F3B */
+pS4 =  7.91534994289814532176e-04, /* 0x3F49EFE0, 0x7501B288 */
+pS5 =  3.47933107596021167570e-05, /* 0x3F023DE1, 0x0DFDF709 */
+qS1 = -2.40339491173441421878e+00, /* 0xC0033A27, 0x1C8A2D4B */
+qS2 =  2.02094576023350569471e+00, /* 0x40002AE5, 0x9C598AC8 */
+qS3 = -6.88283971605453293030e-01, /* 0xBFE6066C, 0x1B8D0159 */
+qS4 =  7.70381505559019352791e-02; /* 0x3FB3B8C5, 0xB12E9282 */
+
+#ifdef __STDC__
+	double __ieee754_acos(double x)
+#else
+	double __ieee754_acos(x)
+	double x;
+#endif
+{
+        fd_twoints u;
+        double df;
+	double z,p,q,r,w,s,c;
+	int hx,ix;
+        u.d = x;
+	hx = __HI(u);
+	ix = hx&0x7fffffff;
+	if(ix>=0x3ff00000) {	/* |x| >= 1 */
+	    if(((ix-0x3ff00000)|__LO(u))==0) {	/* |x|==1 */
+		if(hx>0) return 0.0;		/* acos(1) = 0  */
+		else return pi+2.0*pio2_lo;	/* acos(-1)= pi */
+	    }
+	    return (x-x)/(x-x);		/* acos(|x|>1) is NaN */
+	}
+	if(ix<0x3fe00000) {	/* |x| < 0.5 */
+	    if(ix<=0x3c600000) return pio2_hi+pio2_lo;/*if|x|<2**-57*/
+	    z = x*x;
+	    p = z*(pS0+z*(pS1+z*(pS2+z*(pS3+z*(pS4+z*pS5)))));
+	    q = one+z*(qS1+z*(qS2+z*(qS3+z*qS4)));
+	    r = p/q;
+	    return pio2_hi - (x - (pio2_lo-x*r));
+	} else  if (hx<0) {		/* x < -0.5 */
+	    z = (one+x)*0.5;
+	    p = z*(pS0+z*(pS1+z*(pS2+z*(pS3+z*(pS4+z*pS5)))));
+	    q = one+z*(qS1+z*(qS2+z*(qS3+z*qS4)));
+	    s = fd_sqrt(z);
+	    r = p/q;
+	    w = r*s-pio2_lo;
+	    return pi - 2.0*(s+w);
+	} else {			/* x > 0.5 */
+	    z = (one-x)*0.5;
+	    s = fd_sqrt(z);
+	    u.d = s;
+	    __LO(u) = 0;
+            df = u.d;
+	    c  = (z-df*df)/(s+df);
+	    p = z*(pS0+z*(pS1+z*(pS2+z*(pS3+z*(pS4+z*pS5)))));
+	    q = one+z*(qS1+z*(qS2+z*(qS3+z*qS4)));
+	    r = p/q;
+	    w = r*s+c;
+	    return 2.0*(df+w);
+	}
+}

mozilla/js/src/fdlibm/e_acosh.c

@@ -0,0 +1,105 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * ***** BEGIN LICENSE BLOCK *****
+ * Version: MPL 1.1/GPL 2.0/LGPL 2.1
+ *
+ * The contents of this file are subject to the Mozilla Public License Version
+ * 1.1 (the "License"); you may not use this file except in compliance with
+ * the License. You may obtain a copy of the License at
+ * http://www.mozilla.org/MPL/
+ *
+ * Software distributed under the License is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+ * for the specific language governing rights and limitations under the
+ * License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is
+ * Sun Microsystems, Inc.
+ * Portions created by the Initial Developer are Copyright (C) 1998
+ * the Initial Developer. All Rights Reserved.
+ *
+ * Contributor(s):
+ *
+ * Alternatively, the contents of this file may be used under the terms of
+ * either of the GNU General Public License Version 2 or later (the "GPL"),
+ * or the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+ * in which case the provisions of the GPL or the LGPL are applicable instead
+ * of those above. If you wish to allow use of your version of this file only
+ * under the terms of either the GPL or the LGPL, and not to allow others to
+ * use your version of this file under the terms of the MPL, indicate your
+ * decision by deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL or the LGPL. If you do not delete
+ * the provisions above, a recipient may use your version of this file under
+ * the terms of any one of the MPL, the GPL or the LGPL.
+ *
+ * ***** END LICENSE BLOCK ***** */
+
+/* @(#)e_acosh.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ *
+ */
+
+/* __ieee754_acosh(x)
+ * Method :
+ *	Based on 
+ *		acosh(x) = log [ x + sqrt(x*x-1) ]
+ *	we have
+ *		acosh(x) := log(x)+ln2,	if x is large; else
+ *		acosh(x) := log(2x-1/(sqrt(x*x-1)+x)) if x>2; else
+ *		acosh(x) := log1p(t+sqrt(2.0*t+t*t)); where t=x-1.
+ *
+ * Special cases:
+ *	acosh(x) is NaN with signal if x<1.
+ *	acosh(NaN) is NaN without signal.
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double 
+#else
+static double 
+#endif
+one	= 1.0,
+ln2	= 6.93147180559945286227e-01;  /* 0x3FE62E42, 0xFEFA39EF */
+
+#ifdef __STDC__
+	double __ieee754_acosh(double x)
+#else
+	double __ieee754_acosh(x)
+	double x;
+#endif
+{	
+        fd_twoints u;
+	double t;
+	int hx;
+        u.d = x;
+	hx = __HI(u);
+	if(hx<0x3ff00000) {		/* x < 1 */
+	    return (x-x)/(x-x);
+	} else if(hx >=0x41b00000) {	/* x > 2**28 */
+	    if(hx >=0x7ff00000) {	/* x is inf of NaN */
+	        return x+x;
+	    } else 
+		return __ieee754_log(x)+ln2;	/* acosh(huge)=log(2x) */
+	} else if(((hx-0x3ff00000)|__LO(u))==0) {
+	    return 0.0;			/* acosh(1) = 0 */
+	} else if (hx > 0x40000000) {	/* 2**28 > x > 2 */
+	    t=x*x;
+	    return __ieee754_log(2.0*x-one/(x+fd_sqrt(t-one)));
+	} else {			/* 1<x<2 */
+	    t = x-one;
+	    return fd_log1p(t+fd_sqrt(2.0*t+t*t));
+	}
+}

mozilla/js/src/fdlibm/e_asin.c

@@ -0,0 +1,156 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * ***** BEGIN LICENSE BLOCK *****
+ * Version: MPL 1.1/GPL 2.0/LGPL 2.1
+ *
+ * The contents of this file are subject to the Mozilla Public License Version
+ * 1.1 (the "License"); you may not use this file except in compliance with
+ * the License. You may obtain a copy of the License at
+ * http://www.mozilla.org/MPL/
+ *
+ * Software distributed under the License is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+ * for the specific language governing rights and limitations under the
+ * License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is
+ * Sun Microsystems, Inc.
+ * Portions created by the Initial Developer are Copyright (C) 1998
+ * the Initial Developer. All Rights Reserved.
+ *
+ * Contributor(s):
+ *
+ * Alternatively, the contents of this file may be used under the terms of
+ * either of the GNU General Public License Version 2 or later (the "GPL"),
+ * or the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+ * in which case the provisions of the GPL or the LGPL are applicable instead
+ * of those above. If you wish to allow use of your version of this file only
+ * under the terms of either the GPL or the LGPL, and not to allow others to
+ * use your version of this file under the terms of the MPL, indicate your
+ * decision by deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL or the LGPL. If you do not delete
+ * the provisions above, a recipient may use your version of this file under
+ * the terms of any one of the MPL, the GPL or the LGPL.
+ *
+ * ***** END LICENSE BLOCK ***** */
+
+/* @(#)e_asin.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* __ieee754_asin(x)
+ * Method :                  
+ *	Since  asin(x) = x + x^3/6 + x^5*3/40 + x^7*15/336 + ...
+ *	we approximate asin(x) on [0,0.5] by
+ *		asin(x) = x + x*x^2*R(x^2)
+ *	where
+ *		R(x^2) is a rational approximation of (asin(x)-x)/x^3 
+ *	and its remez error is bounded by
+ *		|(asin(x)-x)/x^3 - R(x^2)| < 2^(-58.75)
+ *
+ *	For x in [0.5,1]
+ *		asin(x) = pi/2-2*asin(sqrt((1-x)/2))
+ *	Let y = (1-x), z = y/2, s := sqrt(z), and pio2_hi+pio2_lo=pi/2;
+ *	then for x>0.98
+ *		asin(x) = pi/2 - 2*(s+s*z*R(z))
+ *			= pio2_hi - (2*(s+s*z*R(z)) - pio2_lo)
+ *	For x<=0.98, let pio4_hi = pio2_hi/2, then
+ *		f = hi part of s;
+ *		c = sqrt(z) - f = (z-f*f)/(s+f) 	...f+c=sqrt(z)
+ *	and
+ *		asin(x) = pi/2 - 2*(s+s*z*R(z))
+ *			= pio4_hi+(pio4-2s)-(2s*z*R(z)-pio2_lo)
+ *			= pio4_hi+(pio4-2f)-(2s*z*R(z)-(pio2_lo+2c))
+ *
+ * Special cases:
+ *	if x is NaN, return x itself;
+ *	if |x|>1, return NaN with invalid signal.
+ *
+ */
+
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double 
+#else
+static double 
+#endif
+one =  1.00000000000000000000e+00, /* 0x3FF00000, 0x00000000 */
+really_big =  1.000e+300,
+pio2_hi =  1.57079632679489655800e+00, /* 0x3FF921FB, 0x54442D18 */
+pio2_lo =  6.12323399573676603587e-17, /* 0x3C91A626, 0x33145C07 */
+pio4_hi =  7.85398163397448278999e-01, /* 0x3FE921FB, 0x54442D18 */
+	/* coefficient for R(x^2) */
+pS0 =  1.66666666666666657415e-01, /* 0x3FC55555, 0x55555555 */
+pS1 = -3.25565818622400915405e-01, /* 0xBFD4D612, 0x03EB6F7D */
+pS2 =  2.01212532134862925881e-01, /* 0x3FC9C155, 0x0E884455 */
+pS3 = -4.00555345006794114027e-02, /* 0xBFA48228, 0xB5688F3B */
+pS4 =  7.91534994289814532176e-04, /* 0x3F49EFE0, 0x7501B288 */
+pS5 =  3.47933107596021167570e-05, /* 0x3F023DE1, 0x0DFDF709 */
+qS1 = -2.40339491173441421878e+00, /* 0xC0033A27, 0x1C8A2D4B */
+qS2 =  2.02094576023350569471e+00, /* 0x40002AE5, 0x9C598AC8 */
+qS3 = -6.88283971605453293030e-01, /* 0xBFE6066C, 0x1B8D0159 */
+qS4 =  7.70381505559019352791e-02; /* 0x3FB3B8C5, 0xB12E9282 */
+
+#ifdef __STDC__
+	double __ieee754_asin(double x)
+#else
+	double __ieee754_asin(x)
+	double x;
+#endif
+{
+        fd_twoints u;
+	double w,t,p,q,c,r,s;
+	int hx,ix;
+        u.d = x;
+	hx = __HI(u);
+        x = u.d;
+	ix = hx&0x7fffffff;
+	if(ix>= 0x3ff00000) {		/* |x|>= 1 */
+	    if(((ix-0x3ff00000)|__LO(u))==0)
+		    /* asin(1)=+-pi/2 with inexact */
+		return x*pio2_hi+x*pio2_lo;	
+	    return (x-x)/(x-x);		/* asin(|x|>1) is NaN */   
+	} else if (ix<0x3fe00000) {	/* |x|<0.5 */
+	    if(ix<0x3e400000) {		/* if |x| < 2**-27 */
+		if(really_big+x>one) return x;/* return x with inexact if x!=0*/
+	    } else 
+		t = x*x;
+		p = t*(pS0+t*(pS1+t*(pS2+t*(pS3+t*(pS4+t*pS5)))));
+		q = one+t*(qS1+t*(qS2+t*(qS3+t*qS4)));
+		w = p/q;
+		return x+x*w;
+	}
+	/* 1> |x|>= 0.5 */
+	w = one-fd_fabs(x);
+	t = w*0.5;
+	p = t*(pS0+t*(pS1+t*(pS2+t*(pS3+t*(pS4+t*pS5)))));
+	q = one+t*(qS1+t*(qS2+t*(qS3+t*qS4)));
+	s = fd_sqrt(t);
+	if(ix>=0x3FEF3333) { 	/* if |x| > 0.975 */
+	    w = p/q;
+	    t = pio2_hi-(2.0*(s+s*w)-pio2_lo);
+	} else {
+	    u.d  = s;
+	    __LO(u) = 0;
+            w = u.d;
+	    c  = (t-w*w)/(s+w);
+	    r  = p/q;
+	    p  = 2.0*s*r-(pio2_lo-2.0*c);
+	    q  = pio4_hi-2.0*w;
+	    t  = pio4_hi-(p-q);
+	}    
+	if(hx>0) return t; else return -t;    
+}

mozilla/js/src/fdlibm/e_atan2.c

@@ -0,0 +1,165 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * ***** BEGIN LICENSE BLOCK *****
+ * Version: MPL 1.1/GPL 2.0/LGPL 2.1
+ *
+ * The contents of this file are subject to the Mozilla Public License Version
+ * 1.1 (the "License"); you may not use this file except in compliance with
+ * the License. You may obtain a copy of the License at
+ * http://www.mozilla.org/MPL/
+ *
+ * Software distributed under the License is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+ * for the specific language governing rights and limitations under the
+ * License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is
+ * Sun Microsystems, Inc.
+ * Portions created by the Initial Developer are Copyright (C) 1998
+ * the Initial Developer. All Rights Reserved.
+ *
+ * Contributor(s):
+ *
+ * Alternatively, the contents of this file may be used under the terms of
+ * either of the GNU General Public License Version 2 or later (the "GPL"),
+ * or the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+ * in which case the provisions of the GPL or the LGPL are applicable instead
+ * of those above. If you wish to allow use of your version of this file only
+ * under the terms of either the GPL or the LGPL, and not to allow others to
+ * use your version of this file under the terms of the MPL, indicate your
+ * decision by deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL or the LGPL. If you do not delete
+ * the provisions above, a recipient may use your version of this file under
+ * the terms of any one of the MPL, the GPL or the LGPL.
+ *
+ * ***** END LICENSE BLOCK ***** */
+
+/* @(#)e_atan2.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ *
+ */
+
+/* __ieee754_atan2(y,x)
+ * Method :
+ *	1. Reduce y to positive by atan2(y,x)=-atan2(-y,x).
+ *	2. Reduce x to positive by (if x and y are unexceptional): 
+ *		ARG (x+iy) = arctan(y/x)   	   ... if x > 0,
+ *		ARG (x+iy) = pi - arctan[y/(-x)]   ... if x < 0,
+ *
+ * Special cases:
+ *
+ *	ATAN2((anything), NaN ) is NaN;
+ *	ATAN2(NAN , (anything) ) is NaN;
+ *	ATAN2(+-0, +(anything but NaN)) is +-0  ;
+ *	ATAN2(+-0, -(anything but NaN)) is +-pi ;
+ *	ATAN2(+-(anything but 0 and NaN), 0) is +-pi/2;
+ *	ATAN2(+-(anything but INF and NaN), +INF) is +-0 ;
+ *	ATAN2(+-(anything but INF and NaN), -INF) is +-pi;
+ *	ATAN2(+-INF,+INF ) is +-pi/4 ;
+ *	ATAN2(+-INF,-INF ) is +-3pi/4;
+ *	ATAN2(+-INF, (anything but,0,NaN, and INF)) is +-pi/2;
+ *
+ * Constants:
+ * The hexadecimal values are the intended ones for the following 
+ * constants. The decimal values may be used, provided that the 
+ * compiler will convert from decimal to binary accurately enough 
+ * to produce the hexadecimal values shown.
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double 
+#else
+static double 
+#endif
+tiny  = 1.0e-300,
+zero  = 0.0,
+pi_o_4  = 7.8539816339744827900E-01, /* 0x3FE921FB, 0x54442D18 */
+pi_o_2  = 1.5707963267948965580E+00, /* 0x3FF921FB, 0x54442D18 */
+pi      = 3.1415926535897931160E+00, /* 0x400921FB, 0x54442D18 */
+pi_lo   = 1.2246467991473531772E-16; /* 0x3CA1A626, 0x33145C07 */
+
+#ifdef __STDC__
+	double __ieee754_atan2(double y, double x)
+#else
+	double __ieee754_atan2(y,x)
+	double  y,x;
+#endif
+{  
+        fd_twoints ux, uy, uz;
+	double z;
+	int k,m,hx,hy,ix,iy;
+	unsigned lx,ly;
+
+        ux.d = x; uy.d = y;
+	hx = __HI(ux); ix = hx&0x7fffffff;
+	lx = __LO(ux);
+	hy = __HI(uy); iy = hy&0x7fffffff;
+	ly = __LO(uy);
+	if(((ix|((lx|-(int)lx)>>31))>0x7ff00000)||
+	   ((iy|((ly|-(int)ly)>>31))>0x7ff00000))	/* x or y is NaN */
+	   return x+y;
+	if(((hx-0x3ff00000)|lx)==0) return fd_atan(y);   /* x=1.0 */
+	m = ((hy>>31)&1)|((hx>>30)&2);	/* 2*sign(x)+sign(y) */
+
+    /* when y = 0 */
+	if((iy|ly)==0) {
+	    switch(m) {
+		case 0: 
+		case 1: return y; 	/* atan(+-0,+anything)=+-0 */
+		case 2: return  pi+tiny;/* atan(+0,-anything) = pi */
+		case 3: return -pi-tiny;/* atan(-0,-anything) =-pi */
+	    }
+	}
+    /* when x = 0 */
+	if((ix|lx)==0) return (hy<0)?  -pi_o_2-tiny: pi_o_2+tiny;
+	    
+    /* when x is INF */
+	if(ix==0x7ff00000) {
+	    if(iy==0x7ff00000) {
+		switch(m) {
+		    case 0: return  pi_o_4+tiny;/* atan(+INF,+INF) */
+		    case 1: return -pi_o_4-tiny;/* atan(-INF,+INF) */
+		    case 2: return  3.0*pi_o_4+tiny;/*atan(+INF,-INF)*/
+		    case 3: return -3.0*pi_o_4-tiny;/*atan(-INF,-INF)*/
+		}
+	    } else {
+		switch(m) {
+		    case 0: return  zero  ;	/* atan(+...,+INF) */
+		    case 1: return -zero  ;	/* atan(-...,+INF) */
+		    case 2: return  pi+tiny  ;	/* atan(+...,-INF) */
+		    case 3: return -pi-tiny  ;	/* atan(-...,-INF) */
+		}
+	    }
+	}
+    /* when y is INF */
+	if(iy==0x7ff00000) return (hy<0)? -pi_o_2-tiny: pi_o_2+tiny;
+
+    /* compute y/x */
+	k = (iy-ix)>>20;
+	if(k > 60) z=pi_o_2+0.5*pi_lo; 	/* |y/x| >  2**60 */
+	else if(hx<0&&k<-60) z=0.0; 	/* |y|/x < -2**60 */
+	else z=fd_atan(fd_fabs(y/x));		/* safe to do y/x */
+	switch (m) {
+	    case 0: return       z  ;	/* atan(+,+) */
+	    case 1: uz.d = z;
+                    __HI(uz) ^= 0x80000000;
+                    z = uz.d;
+		    return       z  ;	/* atan(-,+) */
+	    case 2: return  pi-(z-pi_lo);/* atan(+,-) */
+	    default: /* case 3 */
+	    	    return  (z-pi_lo)-pi;/* atan(-,-) */
+	}
+}

mozilla/js/src/fdlibm/e_atanh.c

@@ -0,0 +1,110 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * ***** BEGIN LICENSE BLOCK *****
+ * Version: MPL 1.1/GPL 2.0/LGPL 2.1
+ *
+ * The contents of this file are subject to the Mozilla Public License Version
+ * 1.1 (the "License"); you may not use this file except in compliance with
+ * the License. You may obtain a copy of the License at
+ * http://www.mozilla.org/MPL/
+ *
+ * Software distributed under the License is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+ * for the specific language governing rights and limitations under the
+ * License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is
+ * Sun Microsystems, Inc.
+ * Portions created by the Initial Developer are Copyright (C) 1998
+ * the Initial Developer. All Rights Reserved.
+ *
+ * Contributor(s):
+ *
+ * Alternatively, the contents of this file may be used under the terms of
+ * either of the GNU General Public License Version 2 or later (the "GPL"),
+ * or the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+ * in which case the provisions of the GPL or the LGPL are applicable instead
+ * of those above. If you wish to allow use of your version of this file only
+ * under the terms of either the GPL or the LGPL, and not to allow others to
+ * use your version of this file under the terms of the MPL, indicate your
+ * decision by deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL or the LGPL. If you do not delete
+ * the provisions above, a recipient may use your version of this file under
+ * the terms of any one of the MPL, the GPL or the LGPL.
+ *
+ * ***** END LICENSE BLOCK ***** */
+
+/* @(#)e_atanh.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ *
+ */
+
+/* __ieee754_atanh(x)
+ * Method :
+ *    1.Reduced x to positive by atanh(-x) = -atanh(x)
+ *    2.For x>=0.5
+ *                  1              2x                          x
+ *	atanh(x) = --- * log(1 + -------) = 0.5 * log1p(2 * --------)
+ *                  2             1 - x                      1 - x
+ *	
+ * 	For x<0.5
+ *	atanh(x) = 0.5*log1p(2x+2x*x/(1-x))
+ *
+ * Special cases:
+ *	atanh(x) is NaN if |x| > 1 with signal;
+ *	atanh(NaN) is that NaN with no signal;
+ *	atanh(+-1) is +-INF with signal.
+ *
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double one = 1.0, really_big = 1e300;
+#else
+static double one = 1.0, really_big = 1e300;
+#endif
+
+static double zero = 0.0;
+
+#ifdef __STDC__
+	double __ieee754_atanh(double x)
+#else
+	double __ieee754_atanh(x)
+	double x;
+#endif
+{
+	double t;
+	int hx,ix;
+	unsigned lx;
+        fd_twoints u;
+        u.d = x;
+	hx = __HI(u);		/* high word */
+	lx = __LO(u);		/* low word */
+	ix = hx&0x7fffffff;
+	if ((ix|((lx|(-(int)lx))>>31))>0x3ff00000) /* |x|>1 */
+	    return (x-x)/(x-x);
+	if(ix==0x3ff00000) 
+	    return x/zero;
+	if(ix<0x3e300000&&(really_big+x)>zero) return x;	/* x<2**-28 */
+        u.d = x;
+	__HI(u) = ix;		/* x <- |x| */
+        x = u.d;
+	if(ix<0x3fe00000) {		/* x < 0.5 */
+	    t = x+x;
+	    t = 0.5*fd_log1p(t+t*x/(one-x));
+	} else 
+	    t = 0.5*fd_log1p((x+x)/(one-x));
+	if(hx>=0) return t; else return -t;
+}

mozilla/js/src/fdlibm/e_cosh.c

@@ -0,0 +1,133 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * ***** BEGIN LICENSE BLOCK *****
+ * Version: MPL 1.1/GPL 2.0/LGPL 2.1
+ *
+ * The contents of this file are subject to the Mozilla Public License Version
+ * 1.1 (the "License"); you may not use this file except in compliance with
+ * the License. You may obtain a copy of the License at
+ * http://www.mozilla.org/MPL/
+ *
+ * Software distributed under the License is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+ * for the specific language governing rights and limitations under the
+ * License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is
+ * Sun Microsystems, Inc.
+ * Portions created by the Initial Developer are Copyright (C) 1998
+ * the Initial Developer. All Rights Reserved.
+ *
+ * Contributor(s):
+ *
+ * Alternatively, the contents of this file may be used under the terms of
+ * either of the GNU General Public License Version 2 or later (the "GPL"),
+ * or the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+ * in which case the provisions of the GPL or the LGPL are applicable instead
+ * of those above. If you wish to allow use of your version of this file only
+ * under the terms of either the GPL or the LGPL, and not to allow others to
+ * use your version of this file under the terms of the MPL, indicate your
+ * decision by deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL or the LGPL. If you do not delete
+ * the provisions above, a recipient may use your version of this file under
+ * the terms of any one of the MPL, the GPL or the LGPL.
+ *
+ * ***** END LICENSE BLOCK ***** */
+
+/* @(#)e_cosh.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* __ieee754_cosh(x)
+ * Method : 
+ * mathematically cosh(x) if defined to be (exp(x)+exp(-x))/2
+ *	1. Replace x by |x| (cosh(x) = cosh(-x)). 
+ *	2. 
+ *		                                        [ exp(x) - 1 ]^2 
+ *	    0        <= x <= ln2/2  :  cosh(x) := 1 + -------------------
+ *			       			           2*exp(x)
+ *
+ *		                                  exp(x) +  1/exp(x)
+ *	    ln2/2    <= x <= 22     :  cosh(x) := -------------------
+ *			       			          2
+ *	    22       <= x <= lnovft :  cosh(x) := exp(x)/2 
+ *	    lnovft   <= x <= ln2ovft:  cosh(x) := exp(x/2)/2 * exp(x/2)
+ *	    ln2ovft  <  x	    :  cosh(x) := huge*huge (overflow)
+ *
+ * Special cases:
+ *	cosh(x) is |x| if x is +INF, -INF, or NaN.
+ *	only cosh(0)=1 is exact for finite x.
+ */
+
+#include "fdlibm.h"
+
+#ifdef _WIN32
+#define huge myhuge
+#endif
+
+#ifdef __STDC__
+static const double one = 1.0, half=0.5, really_big = 1.0e300;
+#else
+static double one = 1.0, half=0.5, really_big = 1.0e300;
+#endif
+
+#ifdef __STDC__
+	double __ieee754_cosh(double x)
+#else
+	double __ieee754_cosh(x)
+	double x;
+#endif
+{	
+        fd_twoints u;
+	double t,w;
+	int ix;
+	unsigned lx;
+        
+    /* High word of |x|. */
+        u.d = x;
+	ix = __HI(u);
+	ix &= 0x7fffffff;
+
+    /* x is INF or NaN */
+	if(ix>=0x7ff00000) return x*x;	
+
+    /* |x| in [0,0.5*ln2], return 1+expm1(|x|)^2/(2*exp(|x|)) */
+	if(ix<0x3fd62e43) {
+	    t = fd_expm1(fd_fabs(x));
+	    w = one+t;
+	    if (ix<0x3c800000) return w;	/* cosh(tiny) = 1 */
+	    return one+(t*t)/(w+w);
+	}
+
+    /* |x| in [0.5*ln2,22], return (exp(|x|)+1/exp(|x|)/2; */
+	if (ix < 0x40360000) {
+		t = __ieee754_exp(fd_fabs(x));
+		return half*t+half/t;
+	}
+
+    /* |x| in [22, log(maxdouble)] return half*exp(|x|) */
+	if (ix < 0x40862E42)  return half*__ieee754_exp(fd_fabs(x));
+
+    /* |x| in [log(maxdouble), overflowthresold] */
+	lx = *( (((*(unsigned*)&one)>>29)) + (unsigned*)&x);
+	if (ix<0x408633CE || 
+	      (ix==0x408633ce)&&(lx<=(unsigned)0x8fb9f87d)) {
+	    w = __ieee754_exp(half*fd_fabs(x));
+	    t = half*w;
+	    return t*w;
+	}
+
+    /* |x| > overflowthresold, cosh(x) overflow */
+	return really_big*really_big;
+}

mozilla/js/src/fdlibm/e_exp.c

@@ -0,0 +1,202 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * ***** BEGIN LICENSE BLOCK *****
+ * Version: MPL 1.1/GPL 2.0/LGPL 2.1
+ *
+ * The contents of this file are subject to the Mozilla Public License Version
+ * 1.1 (the "License"); you may not use this file except in compliance with
+ * the License. You may obtain a copy of the License at
+ * http://www.mozilla.org/MPL/
+ *
+ * Software distributed under the License is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+ * for the specific language governing rights and limitations under the
+ * License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is
+ * Sun Microsystems, Inc.
+ * Portions created by the Initial Developer are Copyright (C) 1998
+ * the Initial Developer. All Rights Reserved.
+ *
+ * Contributor(s):
+ *
+ * Alternatively, the contents of this file may be used under the terms of
+ * either of the GNU General Public License Version 2 or later (the "GPL"),
+ * or the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+ * in which case the provisions of the GPL or the LGPL are applicable instead
+ * of those above. If you wish to allow use of your version of this file only
+ * under the terms of either the GPL or the LGPL, and not to allow others to
+ * use your version of this file under the terms of the MPL, indicate your
+ * decision by deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL or the LGPL. If you do not delete
+ * the provisions above, a recipient may use your version of this file under
+ * the terms of any one of the MPL, the GPL or the LGPL.
+ *
+ * ***** END LICENSE BLOCK ***** */
+
+/* @(#)e_exp.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* __ieee754_exp(x)
+ * Returns the exponential of x.
+ *
+ * Method
+ *   1. Argument reduction:
+ *      Reduce x to an r so that |r| <= 0.5*ln2 ~ 0.34658.
+ *	Given x, find r and integer k such that
+ *
+ *               x = k*ln2 + r,  |r| <= 0.5*ln2.  
+ *
+ *      Here r will be represented as r = hi-lo for better 
+ *	accuracy.
+ *
+ *   2. Approximation of exp(r) by a special rational function on
+ *	the interval [0,0.34658]:
+ *	Write
+ *	    R(r**2) = r*(exp(r)+1)/(exp(r)-1) = 2 + r*r/6 - r**4/360 + ...
+ *      We use a special Reme algorithm on [0,0.34658] to generate 
+ * 	a polynomial of degree 5 to approximate R. The maximum error 
+ *	of this polynomial approximation is bounded by 2**-59. In
+ *	other words,
+ *	    R(z) ~ 2.0 + P1*z + P2*z**2 + P3*z**3 + P4*z**4 + P5*z**5
+ *  	(where z=r*r, and the values of P1 to P5 are listed below)
+ *	and
+ *	    |                  5          |     -59
+ *	    | 2.0+P1*z+...+P5*z   -  R(z) | <= 2 
+ *	    |                             |
+ *	The computation of exp(r) thus becomes
+ *                             2*r
+ *		exp(r) = 1 + -------
+ *		              R - r
+ *                                 r*R1(r)	
+ *		       = 1 + r + ----------- (for better accuracy)
+ *		                  2 - R1(r)
+ *	where
+ *			         2       4             10
+ *		R1(r) = r - (P1*r  + P2*r  + ... + P5*r   ).
+ *	
+ *   3. Scale back to obtain exp(x):
+ *	From step 1, we have
+ *	   exp(x) = 2^k * exp(r)
+ *
+ * Special cases:
+ *	exp(INF) is INF, exp(NaN) is NaN;
+ *	exp(-INF) is 0, and
+ *	for finite argument, only exp(0)=1 is exact.
+ *
+ * Accuracy:
+ *	according to an error analysis, the error is always less than
+ *	1 ulp (unit in the last place).
+ *
+ * Misc. info.
+ *	For IEEE double 
+ *	    if x >  7.09782712893383973096e+02 then exp(x) overflow
+ *	    if x < -7.45133219101941108420e+02 then exp(x) underflow
+ *
+ * Constants:
+ * The hexadecimal values are the intended ones for the following 
+ * constants. The decimal values may be used, provided that the 
+ * compiler will convert from decimal to binary accurately enough
+ * to produce the hexadecimal values shown.
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double
+#else
+static double
+#endif
+one	= 1.0,
+halF[2]	= {0.5,-0.5,},
+really_big	= 1.0e+300,
+twom1000= 9.33263618503218878990e-302,     /* 2**-1000=0x01700000,0*/
+o_threshold=  7.09782712893383973096e+02,  /* 0x40862E42, 0xFEFA39EF */
+u_threshold= -7.45133219101941108420e+02,  /* 0xc0874910, 0xD52D3051 */
+ln2HI[2]   ={ 6.93147180369123816490e-01,  /* 0x3fe62e42, 0xfee00000 */
+	     -6.93147180369123816490e-01,},/* 0xbfe62e42, 0xfee00000 */
+ln2LO[2]   ={ 1.90821492927058770002e-10,  /* 0x3dea39ef, 0x35793c76 */
+	     -1.90821492927058770002e-10,},/* 0xbdea39ef, 0x35793c76 */
+invln2 =  1.44269504088896338700e+00, /* 0x3ff71547, 0x652b82fe */
+P1   =  1.66666666666666019037e-01, /* 0x3FC55555, 0x5555553E */
+P2   = -2.77777777770155933842e-03, /* 0xBF66C16C, 0x16BEBD93 */
+P3   =  6.61375632143793436117e-05, /* 0x3F11566A, 0xAF25DE2C */
+P4   = -1.65339022054652515390e-06, /* 0xBEBBBD41, 0xC5D26BF1 */
+P5   =  4.13813679705723846039e-08; /* 0x3E663769, 0x72BEA4D0 */
+
+
+#ifdef __STDC__
+	double __ieee754_exp(double x)	/* default IEEE double exp */
+#else
+	double __ieee754_exp(x)	/* default IEEE double exp */
+	double x;
+#endif
+{
+        fd_twoints u;
+	double y,hi,lo,c,t;
+	int k, xsb;
+	unsigned hx;
+
+        u.d = x;
+	hx  = __HI(u);	/* high word of x */
+	xsb = (hx>>31)&1;		/* sign bit of x */
+	hx &= 0x7fffffff;		/* high word of |x| */
+
+    /* filter out non-finite argument */
+	if(hx >= 0x40862E42) {			/* if |x|>=709.78... */
+            if(hx>=0x7ff00000) {
+                u.d = x;
+		if(((hx&0xfffff)|__LO(u))!=0)
+		     return x+x; 		/* NaN */
+		else return (xsb==0)? x:0.0;	/* exp(+-inf)={inf,0} */
+	    }
+	    if(x > o_threshold) return really_big*really_big; /* overflow */
+	    if(x < u_threshold) return twom1000*twom1000; /* underflow */
+	}
+
+    /* argument reduction */
+	if(hx > 0x3fd62e42) {		/* if  |x| > 0.5 ln2 */ 
+	    if(hx < 0x3FF0A2B2) {	/* and |x| < 1.5 ln2 */
+		hi = x-ln2HI[xsb]; lo=ln2LO[xsb]; k = 1-xsb-xsb;
+	    } else {
+		k  = (int)(invln2*x+halF[xsb]);
+		t  = k;
+		hi = x - t*ln2HI[0];	/* t*ln2HI is exact here */
+		lo = t*ln2LO[0];
+	    }
+	    x  = hi - lo;
+	} 
+	else if(hx < 0x3e300000)  {	/* when |x|<2**-28 */
+	    if(really_big+x>one) return one+x;/* trigger inexact */
+	}
+	else k = 0;
+
+    /* x is now in primary range */
+	t  = x*x;
+	c  = x - t*(P1+t*(P2+t*(P3+t*(P4+t*P5))));
+	if(k==0) 	return one-((x*c)/(c-2.0)-x); 
+	else 		y = one-((lo-(x*c)/(2.0-c))-hi);
+	if(k >= -1021) {
+            u.d = y;
+	    __HI(u) += (k<<20);	/* add k to y's exponent */
+            y = u.d;
+	    return y;
+	} else {
+            u.d = y;
+	    __HI(u) += ((k+1000)<<20);/* add k to y's exponent */
+            y = u.d;
+	    return y*twom1000;
+	}
+}

mozilla/js/src/fdlibm/e_fmod.c

@@ -0,0 +1,184 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * ***** BEGIN LICENSE BLOCK *****
+ * Version: MPL 1.1/GPL 2.0/LGPL 2.1
+ *
+ * The contents of this file are subject to the Mozilla Public License Version
+ * 1.1 (the "License"); you may not use this file except in compliance with
+ * the License. You may obtain a copy of the License at
+ * http://www.mozilla.org/MPL/
+ *
+ * Software distributed under the License is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+ * for the specific language governing rights and limitations under the
+ * License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is
+ * Sun Microsystems, Inc.
+ * Portions created by the Initial Developer are Copyright (C) 1998
+ * the Initial Developer. All Rights Reserved.
+ *
+ * Contributor(s):
+ *
+ * Alternatively, the contents of this file may be used under the terms of
+ * either of the GNU General Public License Version 2 or later (the "GPL"),
+ * or the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+ * in which case the provisions of the GPL or the LGPL are applicable instead
+ * of those above. If you wish to allow use of your version of this file only
+ * under the terms of either the GPL or the LGPL, and not to allow others to
+ * use your version of this file under the terms of the MPL, indicate your
+ * decision by deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL or the LGPL. If you do not delete
+ * the provisions above, a recipient may use your version of this file under
+ * the terms of any one of the MPL, the GPL or the LGPL.
+ *
+ * ***** END LICENSE BLOCK ***** */
+
+/* @(#)e_fmod.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* 
+ * __ieee754_fmod(x,y)
+ * Return x mod y in exact arithmetic
+ * Method: shift and subtract
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double one = 1.0, Zero[] = {0.0, -0.0,};
+#else
+static double one = 1.0, Zero[] = {0.0, -0.0,};
+#endif
+
+#ifdef __STDC__
+	double __ieee754_fmod(double x, double y)
+#else
+	double __ieee754_fmod(x,y)
+	double x,y ;
+#endif
+{
+        fd_twoints ux, uy;
+	int n,hx,hy,hz,ix,iy,sx,i;
+	unsigned lx,ly,lz;
+
+        ux.d = x; uy.d = y;
+	hx = __HI(ux);		/* high word of x */
+	lx = __LO(ux);		/* low  word of x */
+	hy = __HI(uy);		/* high word of y */
+	ly = __LO(uy);		/* low  word of y */
+	sx = hx&0x80000000;		/* sign of x */
+	hx ^=sx;		/* |x| */
+	hy &= 0x7fffffff;	/* |y| */
+
+    /* purge off exception values */
+	if((hy|ly)==0||(hx>=0x7ff00000)||	/* y=0,or x not finite */
+	  ((hy|((ly|-(int)ly)>>31))>0x7ff00000))	/* or y is NaN */
+	    return (x*y)/(x*y);
+	if(hx<=hy) {
+	    if((hx<hy)||(lx<ly)) return x;	/* |x|<|y| return x */
+	    if(lx==ly) 
+		return Zero[(unsigned)sx>>31];	/* |x|=|y| return x*0*/
+	}
+
+    /* determine ix = ilogb(x) */
+	if(hx<0x00100000) {	/* subnormal x */
+	    if(hx==0) {
+		for (ix = -1043, i=lx; i>0; i<<=1) ix -=1;
+	    } else {
+		for (ix = -1022,i=(hx<<11); i>0; i<<=1) ix -=1;
+	    }
+	} else ix = (hx>>20)-1023;
+
+    /* determine iy = ilogb(y) */
+	if(hy<0x00100000) {	/* subnormal y */
+	    if(hy==0) {
+		for (iy = -1043, i=ly; i>0; i<<=1) iy -=1;
+	    } else {
+		for (iy = -1022,i=(hy<<11); i>0; i<<=1) iy -=1;
+	    }
+	} else iy = (hy>>20)-1023;
+
+    /* set up {hx,lx}, {hy,ly} and align y to x */
+	if(ix >= -1022) 
+	    hx = 0x00100000|(0x000fffff&hx);
+	else {		/* subnormal x, shift x to normal */
+	    n = -1022-ix;
+	    if(n<=31) {
+	        hx = (hx<<n)|(lx>>(32-n));
+	        lx <<= n;
+	    } else {
+		hx = lx<<(n-32);
+		lx = 0;
+	    }
+	}
+	if(iy >= -1022) 
+	    hy = 0x00100000|(0x000fffff&hy);
+	else {		/* subnormal y, shift y to normal */
+	    n = -1022-iy;
+	    if(n<=31) {
+	        hy = (hy<<n)|(ly>>(32-n));
+	        ly <<= n;
+	    } else {
+		hy = ly<<(n-32);
+		ly = 0;
+	    }
+	}
+
+    /* fix point fmod */
+	n = ix - iy;
+	while(n--) {
+	    hz=hx-hy;lz=lx-ly; if(lx<ly) hz -= 1;
+	    if(hz<0){hx = hx+hx+(lx>>31); lx = lx+lx;}
+	    else {
+	    	if((hz|lz)==0) 		/* return sign(x)*0 */
+		    return Zero[(unsigned)sx>>31];
+	    	hx = hz+hz+(lz>>31); lx = lz+lz;
+	    }
+	}
+	hz=hx-hy;lz=lx-ly; if(lx<ly) hz -= 1;
+	if(hz>=0) {hx=hz;lx=lz;}
+
+    /* convert back to floating value and restore the sign */
+	if((hx|lx)==0) 			/* return sign(x)*0 */
+	    return Zero[(unsigned)sx>>31];	
+	while(hx<0x00100000) {		/* normalize x */
+	    hx = hx+hx+(lx>>31); lx = lx+lx;
+	    iy -= 1;
+	}
+	if(iy>= -1022) {	/* normalize output */
+	    hx = ((hx-0x00100000)|((iy+1023)<<20));
+            ux.d = x;
+	    __HI(ux) = hx|sx;
+	    __LO(ux) = lx;
+            x = ux.d;
+	} else {		/* subnormal output */
+	    n = -1022 - iy;
+	    if(n<=20) {
+		lx = (lx>>n)|((unsigned)hx<<(32-n));
+		hx >>= n;
+	    } else if (n<=31) {
+		lx = (hx<<(32-n))|(lx>>n); hx = sx;
+	    } else {
+		lx = hx>>(n-32); hx = sx;
+	    }
+            ux.d = x;
+	    __HI(ux) = hx|sx;
+	    __LO(ux) = lx;
+            x = ux.d;
+	    x *= one;		/* create necessary signal */
+	}
+	return x;		/* exact output */
+}

mozilla/js/src/fdlibm/e_gamma.c

@@ -0,0 +1,71 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * ***** BEGIN LICENSE BLOCK *****
+ * Version: MPL 1.1/GPL 2.0/LGPL 2.1
+ *
+ * The contents of this file are subject to the Mozilla Public License Version
+ * 1.1 (the "License"); you may not use this file except in compliance with
+ * the License. You may obtain a copy of the License at
+ * http://www.mozilla.org/MPL/
+ *
+ * Software distributed under the License is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+ * for the specific language governing rights and limitations under the
+ * License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is
+ * Sun Microsystems, Inc.
+ * Portions created by the Initial Developer are Copyright (C) 1998
+ * the Initial Developer. All Rights Reserved.
+ *
+ * Contributor(s):
+ *
+ * Alternatively, the contents of this file may be used under the terms of
+ * either of the GNU General Public License Version 2 or later (the "GPL"),
+ * or the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+ * in which case the provisions of the GPL or the LGPL are applicable instead
+ * of those above. If you wish to allow use of your version of this file only
+ * under the terms of either the GPL or the LGPL, and not to allow others to
+ * use your version of this file under the terms of the MPL, indicate your
+ * decision by deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL or the LGPL. If you do not delete
+ * the provisions above, a recipient may use your version of this file under
+ * the terms of any one of the MPL, the GPL or the LGPL.
+ *
+ * ***** END LICENSE BLOCK ***** */
+
+/* @(#)e_gamma.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ *
+ */
+
+/* __ieee754_gamma(x)
+ * Return the logarithm of the Gamma function of x.
+ *
+ * Method: call __ieee754_gamma_r
+ */
+
+#include "fdlibm.h"
+
+extern int signgam;
+
+#ifdef __STDC__
+	double __ieee754_gamma(double x)
+#else
+	double __ieee754_gamma(x)
+	double x;
+#endif
+{
+	return __ieee754_gamma_r(x,&signgam);
+}

mozilla/js/src/fdlibm/e_gamma_r.c

@@ -0,0 +1,70 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * ***** BEGIN LICENSE BLOCK *****
+ * Version: MPL 1.1/GPL 2.0/LGPL 2.1
+ *
+ * The contents of this file are subject to the Mozilla Public License Version
+ * 1.1 (the "License"); you may not use this file except in compliance with
+ * the License. You may obtain a copy of the License at
+ * http://www.mozilla.org/MPL/
+ *
+ * Software distributed under the License is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+ * for the specific language governing rights and limitations under the
+ * License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is
+ * Sun Microsystems, Inc.
+ * Portions created by the Initial Developer are Copyright (C) 1998
+ * the Initial Developer. All Rights Reserved.
+ *
+ * Contributor(s):
+ *
+ * Alternatively, the contents of this file may be used under the terms of
+ * either of the GNU General Public License Version 2 or later (the "GPL"),
+ * or the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+ * in which case the provisions of the GPL or the LGPL are applicable instead
+ * of those above. If you wish to allow use of your version of this file only
+ * under the terms of either the GPL or the LGPL, and not to allow others to
+ * use your version of this file under the terms of the MPL, indicate your
+ * decision by deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL or the LGPL. If you do not delete
+ * the provisions above, a recipient may use your version of this file under
+ * the terms of any one of the MPL, the GPL or the LGPL.
+ *
+ * ***** END LICENSE BLOCK ***** */
+
+/* @(#)e_gamma_r.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ *
+ */
+
+/* __ieee754_gamma_r(x, signgamp)
+ * Reentrant version of the logarithm of the Gamma function 
+ * with user provide pointer for the sign of Gamma(x). 
+ *
+ * Method: See __ieee754_lgamma_r
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+	double __ieee754_gamma_r(double x, int *signgamp)
+#else
+	double __ieee754_gamma_r(x,signgamp)
+	double x; int *signgamp;
+#endif
+{
+	return __ieee754_lgamma_r(x,signgamp);
+}

mozilla/js/src/fdlibm/e_hypot.c

@@ -0,0 +1,173 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * ***** BEGIN LICENSE BLOCK *****
+ * Version: MPL 1.1/GPL 2.0/LGPL 2.1
+ *
+ * The contents of this file are subject to the Mozilla Public License Version
+ * 1.1 (the "License"); you may not use this file except in compliance with
+ * the License. You may obtain a copy of the License at
+ * http://www.mozilla.org/MPL/
+ *
+ * Software distributed under the License is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+ * for the specific language governing rights and limitations under the
+ * License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is
+ * Sun Microsystems, Inc.
+ * Portions created by the Initial Developer are Copyright (C) 1998
+ * the Initial Developer. All Rights Reserved.
+ *
+ * Contributor(s):
+ *
+ * Alternatively, the contents of this file may be used under the terms of
+ * either of the GNU General Public License Version 2 or later (the "GPL"),
+ * or the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+ * in which case the provisions of the GPL or the LGPL are applicable instead
+ * of those above. If you wish to allow use of your version of this file only
+ * under the terms of either the GPL or the LGPL, and not to allow others to
+ * use your version of this file under the terms of the MPL, indicate your
+ * decision by deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL or the LGPL. If you do not delete
+ * the provisions above, a recipient may use your version of this file under
+ * the terms of any one of the MPL, the GPL or the LGPL.
+ *
+ * ***** END LICENSE BLOCK ***** */
+
+/* @(#)e_hypot.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* __ieee754_hypot(x,y)
+ *
+ * Method :                  
+ *	If (assume round-to-nearest) z=x*x+y*y 
+ *	has error less than sqrt(2)/2 ulp, than 
+ *	sqrt(z) has error less than 1 ulp (exercise).
+ *
+ *	So, compute sqrt(x*x+y*y) with some care as 
+ *	follows to get the error below 1 ulp:
+ *
+ *	Assume x>y>0;
+ *	(if possible, set rounding to round-to-nearest)
+ *	1. if x > 2y  use
+ *		x1*x1+(y*y+(x2*(x+x1))) for x*x+y*y
+ *	where x1 = x with lower 32 bits cleared, x2 = x-x1; else
+ *	2. if x <= 2y use
+ *		t1*y1+((x-y)*(x-y)+(t1*y2+t2*y))
+ *	where t1 = 2x with lower 32 bits cleared, t2 = 2x-t1, 
+ *	y1= y with lower 32 bits chopped, y2 = y-y1.
+ *		
+ *	NOTE: scaling may be necessary if some argument is too 
+ *	      large or too tiny
+ *
+ * Special cases:
+ *	hypot(x,y) is INF if x or y is +INF or -INF; else
+ *	hypot(x,y) is NAN if x or y is NAN.
+ *
+ * Accuracy:
+ * 	hypot(x,y) returns sqrt(x^2+y^2) with error less 
+ * 	than 1 ulps (units in the last place) 
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+	double __ieee754_hypot(double x, double y)
+#else
+	double __ieee754_hypot(x,y)
+	double x, y;
+#endif
+{
+        fd_twoints ux, uy;
+	double a=x,b=y,t1,t2,y1,y2,w;
+	int j,k,ha,hb;
+        
+        ux.d = x; uy.d = y;
+	ha = __HI(ux)&0x7fffffff;	/* high word of  x */
+	hb = __HI(uy)&0x7fffffff;	/* high word of  y */
+	if(hb > ha) {a=y;b=x;j=ha; ha=hb;hb=j;} else {a=x;b=y;}
+        ux.d = a; uy.d = b;
+	__HI(ux) = ha;	/* a <- |a| */
+	__HI(uy) = hb;	/* b <- |b| */
+        a = ux.d; b = uy.d;
+	if((ha-hb)>0x3c00000) {return a+b;} /* x/y > 2**60 */
+	k=0;
+	if(ha > 0x5f300000) {	/* a>2**500 */
+	   if(ha >= 0x7ff00000) {	/* Inf or NaN */
+	       w = a+b;			/* for sNaN */
+               ux.d = a; uy.d = b;
+	       if(((ha&0xfffff)|__LO(ux))==0) w = a;
+	       if(((hb^0x7ff00000)|__LO(uy))==0) w = b;
+	       return w;
+	   }
+	   /* scale a and b by 2**-600 */
+	   ha -= 0x25800000; hb -= 0x25800000;	k += 600;
+           ux.d = a; uy.d = b;
+	   __HI(ux) = ha;
+	   __HI(uy) = hb;
+           a = ux.d; b = uy.d;
+	}
+	if(hb < 0x20b00000) {	/* b < 2**-500 */
+	    if(hb <= 0x000fffff) {	/* subnormal b or 0 */	
+                uy.d = b;
+		if((hb|(__LO(uy)))==0) return a;
+		t1=0;
+                ux.d = t1;
+		__HI(ux) = 0x7fd00000;	/* t1=2^1022 */
+                t1 = ux.d;
+		b *= t1;
+		a *= t1;
+		k -= 1022;
+	    } else {		/* scale a and b by 2^600 */
+	        ha += 0x25800000; 	/* a *= 2^600 */
+		hb += 0x25800000;	/* b *= 2^600 */
+		k -= 600;
+                ux.d = a; uy.d = b;
+	   	__HI(ux) = ha;
+	   	__HI(uy) = hb;
+                a = ux.d; b = uy.d;
+	    }
+	}
+    /* medium size a and b */
+	w = a-b;
+	if (w>b) {
+	    t1 = 0;
+            ux.d = t1;
+	    __HI(ux) = ha;
+            t1 = ux.d;
+	    t2 = a-t1;
+	    w  = fd_sqrt(t1*t1-(b*(-b)-t2*(a+t1)));
+	} else {
+	    a  = a+a;
+	    y1 = 0;
+            ux.d = y1;
+	    __HI(ux) = hb;
+            y1 = ux.d;
+	    y2 = b - y1;
+	    t1 = 0;
+            ux.d = t1;
+	    __HI(ux) = ha+0x00100000;
+            t1 = ux.d;
+	    t2 = a - t1;
+	    w  = fd_sqrt(t1*y1-(w*(-w)-(t1*y2+t2*b)));
+	}
+	if(k!=0) {
+	    t1 = 1.0;
+            ux.d = t1;
+	    __HI(ux) += (k<<20);
+            t1 = ux.d;
+	    return t1*w;
+	} else return w;
+}

mozilla/js/src/fdlibm/e_j0.c

@@ -0,0 +1,524 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * ***** BEGIN LICENSE BLOCK *****
+ * Version: MPL 1.1/GPL 2.0/LGPL 2.1
+ *
+ * The contents of this file are subject to the Mozilla Public License Version
+ * 1.1 (the "License"); you may not use this file except in compliance with
+ * the License. You may obtain a copy of the License at
+ * http://www.mozilla.org/MPL/
+ *
+ * Software distributed under the License is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+ * for the specific language governing rights and limitations under the
+ * License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is
+ * Sun Microsystems, Inc.
+ * Portions created by the Initial Developer are Copyright (C) 1998
+ * the Initial Developer. All Rights Reserved.
+ *
+ * Contributor(s):
+ *
+ * Alternatively, the contents of this file may be used under the terms of
+ * either of the GNU General Public License Version 2 or later (the "GPL"),
+ * or the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+ * in which case the provisions of the GPL or the LGPL are applicable instead
+ * of those above. If you wish to allow use of your version of this file only
+ * under the terms of either the GPL or the LGPL, and not to allow others to
+ * use your version of this file under the terms of the MPL, indicate your
+ * decision by deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL or the LGPL. If you do not delete
+ * the provisions above, a recipient may use your version of this file under
+ * the terms of any one of the MPL, the GPL or the LGPL.
+ *
+ * ***** END LICENSE BLOCK ***** */
+
+/* @(#)e_j0.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* __ieee754_j0(x), __ieee754_y0(x)
+ * Bessel function of the first and second kinds of order zero.
+ * Method -- j0(x):
+ *	1. For tiny x, we use j0(x) = 1 - x^2/4 + x^4/64 - ...
+ *	2. Reduce x to |x| since j0(x)=j0(-x),  and
+ *	   for x in (0,2)
+ *		j0(x) = 1-z/4+ z^2*R0/S0,  where z = x*x;
+ *	   (precision:  |j0-1+z/4-z^2R0/S0 |<2**-63.67 )
+ *	   for x in (2,inf)
+ * 		j0(x) = sqrt(2/(pi*x))*(p0(x)*cos(x0)-q0(x)*sin(x0))
+ * 	   where x0 = x-pi/4. It is better to compute sin(x0),cos(x0)
+ *	   as follow:
+ *		cos(x0) = cos(x)cos(pi/4)+sin(x)sin(pi/4)
+ *			= 1/sqrt(2) * (cos(x) + sin(x))
+ *		sin(x0) = sin(x)cos(pi/4)-cos(x)sin(pi/4)
+ *			= 1/sqrt(2) * (sin(x) - cos(x))
+ * 	   (To avoid cancellation, use
+ *		sin(x) +- cos(x) = -cos(2x)/(sin(x) -+ cos(x))
+ * 	    to compute the worse one.)
+ *	   
+ *	3 Special cases
+ *		j0(nan)= nan
+ *		j0(0) = 1
+ *		j0(inf) = 0
+ *		
+ * Method -- y0(x):
+ *	1. For x<2.
+ *	   Since 
+ *		y0(x) = 2/pi*(j0(x)*(ln(x/2)+Euler) + x^2/4 - ...)
+ *	   therefore y0(x)-2/pi*j0(x)*ln(x) is an even function.
+ *	   We use the following function to approximate y0,
+ *		y0(x) = U(z)/V(z) + (2/pi)*(j0(x)*ln(x)), z= x^2
+ *	   where 
+ *		U(z) = u00 + u01*z + ... + u06*z^6
+ *		V(z) = 1  + v01*z + ... + v04*z^4
+ *	   with absolute approximation error bounded by 2**-72.
+ *	   Note: For tiny x, U/V = u0 and j0(x)~1, hence
+ *		y0(tiny) = u0 + (2/pi)*ln(tiny), (choose tiny<2**-27)
+ *	2. For x>=2.
+ * 		y0(x) = sqrt(2/(pi*x))*(p0(x)*cos(x0)+q0(x)*sin(x0))
+ * 	   where x0 = x-pi/4. It is better to compute sin(x0),cos(x0)
+ *	   by the method mentioned above.
+ *	3. Special cases: y0(0)=-inf, y0(x<0)=NaN, y0(inf)=0.
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static double pzero(double), qzero(double);
+#else
+static double pzero(), qzero();
+#endif
+
+#ifdef __STDC__
+static const double 
+#else
+static double 
+#endif
+really_big 	= 1e300,
+one	= 1.0,
+invsqrtpi=  5.64189583547756279280e-01, /* 0x3FE20DD7, 0x50429B6D */
+tpi      =  6.36619772367581382433e-01, /* 0x3FE45F30, 0x6DC9C883 */
+ 		/* R0/S0 on [0, 2.00] */
+R02  =  1.56249999999999947958e-02, /* 0x3F8FFFFF, 0xFFFFFFFD */
+R03  = -1.89979294238854721751e-04, /* 0xBF28E6A5, 0xB61AC6E9 */
+R04  =  1.82954049532700665670e-06, /* 0x3EBEB1D1, 0x0C503919 */
+R05  = -4.61832688532103189199e-09, /* 0xBE33D5E7, 0x73D63FCE */
+S01  =  1.56191029464890010492e-02, /* 0x3F8FFCE8, 0x82C8C2A4 */
+S02  =  1.16926784663337450260e-04, /* 0x3F1EA6D2, 0xDD57DBF4 */
+S03  =  5.13546550207318111446e-07, /* 0x3EA13B54, 0xCE84D5A9 */
+S04  =  1.16614003333790000205e-09; /* 0x3E1408BC, 0xF4745D8F */
+
+static double zero = 0.0;
+
+#ifdef __STDC__
+	double __ieee754_j0(double x) 
+#else
+	double __ieee754_j0(x) 
+	double x;
+#endif
+{
+        fd_twoints un;
+	double z, s,c,ss,cc,r,u,v;
+	int hx,ix;
+
+        un.d = x;
+	hx = __HI(un);
+	ix = hx&0x7fffffff;
+	if(ix>=0x7ff00000) return one/(x*x);
+	x = fd_fabs(x);
+	if(ix >= 0x40000000) {	/* |x| >= 2.0 */
+		s = fd_sin(x);
+		c = fd_cos(x);
+		ss = s-c;
+		cc = s+c;
+		if(ix<0x7fe00000) {  /* make sure x+x not overflow */
+		    z = -fd_cos(x+x);
+		    if ((s*c)<zero) cc = z/ss;
+		    else 	    ss = z/cc;
+		}
+	/*
+	 * j0(x) = 1/sqrt(pi) * (P(0,x)*cc - Q(0,x)*ss) / sqrt(x)
+	 * y0(x) = 1/sqrt(pi) * (P(0,x)*ss + Q(0,x)*cc) / sqrt(x)
+	 */
+		if(ix>0x48000000) z = (invsqrtpi*cc)/fd_sqrt(x);
+		else {
+		    u = pzero(x); v = qzero(x);
+		    z = invsqrtpi*(u*cc-v*ss)/fd_sqrt(x);
+		}
+		return z;
+	}
+	if(ix<0x3f200000) {	/* |x| < 2**-13 */
+	    if(really_big+x>one) {	/* raise inexact if x != 0 */
+	        if(ix<0x3e400000) return one;	/* |x|<2**-27 */
+	        else 	      return one - 0.25*x*x;
+	    }
+	}
+	z = x*x;
+	r =  z*(R02+z*(R03+z*(R04+z*R05)));
+	s =  one+z*(S01+z*(S02+z*(S03+z*S04)));
+	if(ix < 0x3FF00000) {	/* |x| < 1.00 */
+	    return one + z*(-0.25+(r/s));
+	} else {
+	    u = 0.5*x;
+	    return((one+u)*(one-u)+z*(r/s));
+	}
+}
+
+#ifdef __STDC__
+static const double
+#else
+static double
+#endif
+u00  = -7.38042951086872317523e-02, /* 0xBFB2E4D6, 0x99CBD01F */
+u01  =  1.76666452509181115538e-01, /* 0x3FC69D01, 0x9DE9E3FC */
+u02  = -1.38185671945596898896e-02, /* 0xBF8C4CE8, 0xB16CFA97 */
+u03  =  3.47453432093683650238e-04, /* 0x3F36C54D, 0x20B29B6B */
+u04  = -3.81407053724364161125e-06, /* 0xBECFFEA7, 0x73D25CAD */
+u05  =  1.95590137035022920206e-08, /* 0x3E550057, 0x3B4EABD4 */
+u06  = -3.98205194132103398453e-11, /* 0xBDC5E43D, 0x693FB3C8 */
+v01  =  1.27304834834123699328e-02, /* 0x3F8A1270, 0x91C9C71A */
+v02  =  7.60068627350353253702e-05, /* 0x3F13ECBB, 0xF578C6C1 */
+v03  =  2.59150851840457805467e-07, /* 0x3E91642D, 0x7FF202FD */
+v04  =  4.41110311332675467403e-10; /* 0x3DFE5018, 0x3BD6D9EF */
+
+#ifdef __STDC__
+	double __ieee754_y0(double x) 
+#else
+	double __ieee754_y0(x) 
+	double x;
+#endif
+{
+        fd_twoints un;
+	double z, s,c,ss,cc,u,v;
+	int hx,ix,lx;
+
+        un.d = x;
+        hx = __HI(un);
+        ix = 0x7fffffff&hx;
+        lx = __LO(un);
+    /* Y0(NaN) is NaN, y0(-inf) is Nan, y0(inf) is 0  */
+	if(ix>=0x7ff00000) return  one/(x+x*x); 
+        if((ix|lx)==0) return -one/zero;
+        if(hx<0) return zero/zero;
+        if(ix >= 0x40000000) {  /* |x| >= 2.0 */
+        /* y0(x) = sqrt(2/(pi*x))*(p0(x)*sin(x0)+q0(x)*cos(x0))
+         * where x0 = x-pi/4
+         *      Better formula:
+         *              cos(x0) = cos(x)cos(pi/4)+sin(x)sin(pi/4)
+         *                      =  1/sqrt(2) * (sin(x) + cos(x))
+         *              sin(x0) = sin(x)cos(3pi/4)-cos(x)sin(3pi/4)
+         *                      =  1/sqrt(2) * (sin(x) - cos(x))
+         * To avoid cancellation, use
+         *              sin(x) +- cos(x) = -cos(2x)/(sin(x) -+ cos(x))
+         * to compute the worse one.
+         */
+                s = fd_sin(x);
+                c = fd_cos(x);
+                ss = s-c;
+                cc = s+c;
+	/*
+	 * j0(x) = 1/sqrt(pi) * (P(0,x)*cc - Q(0,x)*ss) / sqrt(x)
+	 * y0(x) = 1/sqrt(pi) * (P(0,x)*ss + Q(0,x)*cc) / sqrt(x)
+	 */
+                if(ix<0x7fe00000) {  /* make sure x+x not overflow */
+                    z = -fd_cos(x+x);
+                    if ((s*c)<zero) cc = z/ss;
+                    else            ss = z/cc;
+                }
+                if(ix>0x48000000) z = (invsqrtpi*ss)/fd_sqrt(x);
+                else {
+                    u = pzero(x); v = qzero(x);
+                    z = invsqrtpi*(u*ss+v*cc)/fd_sqrt(x);
+                }
+                return z;
+	}
+	if(ix<=0x3e400000) {	/* x < 2**-27 */
+	    return(u00 + tpi*__ieee754_log(x));
+	}
+	z = x*x;
+	u = u00+z*(u01+z*(u02+z*(u03+z*(u04+z*(u05+z*u06)))));
+	v = one+z*(v01+z*(v02+z*(v03+z*v04)));
+	return(u/v + tpi*(__ieee754_j0(x)*__ieee754_log(x)));
+}
+
+/* The asymptotic expansions of pzero is
+ *	1 - 9/128 s^2 + 11025/98304 s^4 - ...,	where s = 1/x.
+ * For x >= 2, We approximate pzero by
+ * 	pzero(x) = 1 + (R/S)
+ * where  R = pR0 + pR1*s^2 + pR2*s^4 + ... + pR5*s^10
+ * 	  S = 1 + pS0*s^2 + ... + pS4*s^10
+ * and
+ *	| pzero(x)-1-R/S | <= 2  ** ( -60.26)
+ */
+#ifdef __STDC__
+static const double pR8[6] = { /* for x in [inf, 8]=1/[0,0.125] */
+#else
+static double pR8[6] = { /* for x in [inf, 8]=1/[0,0.125] */
+#endif
+  0.00000000000000000000e+00, /* 0x00000000, 0x00000000 */
+ -7.03124999999900357484e-02, /* 0xBFB1FFFF, 0xFFFFFD32 */
+ -8.08167041275349795626e+00, /* 0xC02029D0, 0xB44FA779 */
+ -2.57063105679704847262e+02, /* 0xC0701102, 0x7B19E863 */
+ -2.48521641009428822144e+03, /* 0xC0A36A6E, 0xCD4DCAFC */
+ -5.25304380490729545272e+03, /* 0xC0B4850B, 0x36CC643D */
+};
+#ifdef __STDC__
+static const double pS8[5] = {
+#else
+static double pS8[5] = {
+#endif
+  1.16534364619668181717e+02, /* 0x405D2233, 0x07A96751 */
+  3.83374475364121826715e+03, /* 0x40ADF37D, 0x50596938 */
+  4.05978572648472545552e+04, /* 0x40E3D2BB, 0x6EB6B05F */
+  1.16752972564375915681e+05, /* 0x40FC810F, 0x8F9FA9BD */
+  4.76277284146730962675e+04, /* 0x40E74177, 0x4F2C49DC */
+};
+
+#ifdef __STDC__
+static const double pR5[6] = { /* for x in [8,4.5454]=1/[0.125,0.22001] */
+#else
+static double pR5[6] = { /* for x in [8,4.5454]=1/[0.125,0.22001] */
+#endif
+ -1.14125464691894502584e-11, /* 0xBDA918B1, 0x47E495CC */
+ -7.03124940873599280078e-02, /* 0xBFB1FFFF, 0xE69AFBC6 */
+ -4.15961064470587782438e+00, /* 0xC010A370, 0xF90C6BBF */
+ -6.76747652265167261021e+01, /* 0xC050EB2F, 0x5A7D1783 */
+ -3.31231299649172967747e+02, /* 0xC074B3B3, 0x6742CC63 */
+ -3.46433388365604912451e+02, /* 0xC075A6EF, 0x28A38BD7 */
+};
+#ifdef __STDC__
+static const double pS5[5] = {
+#else
+static double pS5[5] = {
+#endif
+  6.07539382692300335975e+01, /* 0x404E6081, 0x0C98C5DE */
+  1.05125230595704579173e+03, /* 0x40906D02, 0x5C7E2864 */
+  5.97897094333855784498e+03, /* 0x40B75AF8, 0x8FBE1D60 */
+  9.62544514357774460223e+03, /* 0x40C2CCB8, 0xFA76FA38 */
+  2.40605815922939109441e+03, /* 0x40A2CC1D, 0xC70BE864 */
+};
+
+#ifdef __STDC__
+static const double pR3[6] = {/* for x in [4.547,2.8571]=1/[0.2199,0.35001] */
+#else
+static double pR3[6] = {/* for x in [4.547,2.8571]=1/[0.2199,0.35001] */
+#endif
+ -2.54704601771951915620e-09, /* 0xBE25E103, 0x6FE1AA86 */
+ -7.03119616381481654654e-02, /* 0xBFB1FFF6, 0xF7C0E24B */
+ -2.40903221549529611423e+00, /* 0xC00345B2, 0xAEA48074 */
+ -2.19659774734883086467e+01, /* 0xC035F74A, 0x4CB94E14 */
+ -5.80791704701737572236e+01, /* 0xC04D0A22, 0x420A1A45 */
+ -3.14479470594888503854e+01, /* 0xC03F72AC, 0xA892D80F */
+};
+#ifdef __STDC__
+static const double pS3[5] = {
+#else
+static double pS3[5] = {
+#endif
+  3.58560338055209726349e+01, /* 0x4041ED92, 0x84077DD3 */
+  3.61513983050303863820e+02, /* 0x40769839, 0x464A7C0E */
+  1.19360783792111533330e+03, /* 0x4092A66E, 0x6D1061D6 */
+  1.12799679856907414432e+03, /* 0x40919FFC, 0xB8C39B7E */
+  1.73580930813335754692e+02, /* 0x4065B296, 0xFC379081 */
+};
+
+#ifdef __STDC__
+static const double pR2[6] = {/* for x in [2.8570,2]=1/[0.3499,0.5] */
+#else
+static double pR2[6] = {/* for x in [2.8570,2]=1/[0.3499,0.5] */
+#endif
+ -8.87534333032526411254e-08, /* 0xBE77D316, 0xE927026D */
+ -7.03030995483624743247e-02, /* 0xBFB1FF62, 0x495E1E42 */
+ -1.45073846780952986357e+00, /* 0xBFF73639, 0x8A24A843 */
+ -7.63569613823527770791e+00, /* 0xC01E8AF3, 0xEDAFA7F3 */
+ -1.11931668860356747786e+01, /* 0xC02662E6, 0xC5246303 */
+ -3.23364579351335335033e+00, /* 0xC009DE81, 0xAF8FE70F */
+};
+#ifdef __STDC__
+static const double pS2[5] = {
+#else
+static double pS2[5] = {
+#endif
+  2.22202997532088808441e+01, /* 0x40363865, 0x908B5959 */
+  1.36206794218215208048e+02, /* 0x4061069E, 0x0EE8878F */
+  2.70470278658083486789e+02, /* 0x4070E786, 0x42EA079B */
+  1.53875394208320329881e+02, /* 0x40633C03, 0x3AB6FAFF */
+  1.46576176948256193810e+01, /* 0x402D50B3, 0x44391809 */
+};
+
+#ifdef __STDC__
+	static double pzero(double x)
+#else
+	static double pzero(x)
+	double x;
+#endif
+{
+#ifdef __STDC__
+	const double *p,*q;
+#else
+	double *p,*q;
+#endif
+        fd_twoints u;
+	double z,r,s;
+	int ix;
+        u.d = x;
+	ix = 0x7fffffff&__HI(u);
+	if(ix>=0x40200000)     {p = pR8; q= pS8;}
+	else if(ix>=0x40122E8B){p = pR5; q= pS5;}
+	else if(ix>=0x4006DB6D){p = pR3; q= pS3;}
+	else if(ix>=0x40000000){p = pR2; q= pS2;}
+	z = one/(x*x);
+	r = p[0]+z*(p[1]+z*(p[2]+z*(p[3]+z*(p[4]+z*p[5]))));
+	s = one+z*(q[0]+z*(q[1]+z*(q[2]+z*(q[3]+z*q[4]))));
+	return one+ r/s;
+}
+		
+
+/* For x >= 8, the asymptotic expansions of qzero is
+ *	-1/8 s + 75/1024 s^3 - ..., where s = 1/x.
+ * We approximate pzero by
+ * 	qzero(x) = s*(-1.25 + (R/S))
+ * where  R = qR0 + qR1*s^2 + qR2*s^4 + ... + qR5*s^10
+ * 	  S = 1 + qS0*s^2 + ... + qS5*s^12
+ * and
+ *	| qzero(x)/s +1.25-R/S | <= 2  ** ( -61.22)
+ */
+#ifdef __STDC__
+static const double qR8[6] = { /* for x in [inf, 8]=1/[0,0.125] */
+#else
+static double qR8[6] = { /* for x in [inf, 8]=1/[0,0.125] */
+#endif
+  0.00000000000000000000e+00, /* 0x00000000, 0x00000000 */
+  7.32421874999935051953e-02, /* 0x3FB2BFFF, 0xFFFFFE2C */
+  1.17682064682252693899e+01, /* 0x40278952, 0x5BB334D6 */
+  5.57673380256401856059e+02, /* 0x40816D63, 0x15301825 */
+  8.85919720756468632317e+03, /* 0x40C14D99, 0x3E18F46D */
+  3.70146267776887834771e+04, /* 0x40E212D4, 0x0E901566 */
+};
+#ifdef __STDC__
+static const double qS8[6] = {
+#else
+static double qS8[6] = {
+#endif
+  1.63776026895689824414e+02, /* 0x406478D5, 0x365B39BC */
+  8.09834494656449805916e+03, /* 0x40BFA258, 0x4E6B0563 */
+  1.42538291419120476348e+05, /* 0x41016652, 0x54D38C3F */
+  8.03309257119514397345e+05, /* 0x412883DA, 0x83A52B43 */
+  8.40501579819060512818e+05, /* 0x4129A66B, 0x28DE0B3D */
+ -3.43899293537866615225e+05, /* 0xC114FD6D, 0x2C9530C5 */
+};
+
+#ifdef __STDC__
+static const double qR5[6] = { /* for x in [8,4.5454]=1/[0.125,0.22001] */
+#else
+static double qR5[6] = { /* for x in [8,4.5454]=1/[0.125,0.22001] */
+#endif
+  1.84085963594515531381e-11, /* 0x3DB43D8F, 0x29CC8CD9 */
+  7.32421766612684765896e-02, /* 0x3FB2BFFF, 0xD172B04C */
+  5.83563508962056953777e+00, /* 0x401757B0, 0xB9953DD3 */
+  1.35111577286449829671e+02, /* 0x4060E392, 0x0A8788E9 */
+  1.02724376596164097464e+03, /* 0x40900CF9, 0x9DC8C481 */
+  1.98997785864605384631e+03, /* 0x409F17E9, 0x53C6E3A6 */
+};
+#ifdef __STDC__
+static const double qS5[6] = {
+#else
+static double qS5[6] = {
+#endif
+  8.27766102236537761883e+01, /* 0x4054B1B3, 0xFB5E1543 */
+  2.07781416421392987104e+03, /* 0x40A03BA0, 0xDA21C0CE */
+  1.88472887785718085070e+04, /* 0x40D267D2, 0x7B591E6D */
+  5.67511122894947329769e+04, /* 0x40EBB5E3, 0x97E02372 */
+  3.59767538425114471465e+04, /* 0x40E19118, 0x1F7A54A0 */
+ -5.35434275601944773371e+03, /* 0xC0B4EA57, 0xBEDBC609 */
+};
+
+#ifdef __STDC__
+static const double qR3[6] = {/* for x in [4.547,2.8571]=1/[0.2199,0.35001] */
+#else
+static double qR3[6] = {/* for x in [4.547,2.8571]=1/[0.2199,0.35001] */
+#endif
+  4.37741014089738620906e-09, /* 0x3E32CD03, 0x6ADECB82 */
+  7.32411180042911447163e-02, /* 0x3FB2BFEE, 0x0E8D0842 */
+  3.34423137516170720929e+00, /* 0x400AC0FC, 0x61149CF5 */
+  4.26218440745412650017e+01, /* 0x40454F98, 0x962DAEDD */
+  1.70808091340565596283e+02, /* 0x406559DB, 0xE25EFD1F */
+  1.66733948696651168575e+02, /* 0x4064D77C, 0x81FA21E0 */
+};
+#ifdef __STDC__
+static const double qS3[6] = {
+#else
+static double qS3[6] = {
+#endif
+  4.87588729724587182091e+01, /* 0x40486122, 0xBFE343A6 */
+  7.09689221056606015736e+02, /* 0x40862D83, 0x86544EB3 */
+  3.70414822620111362994e+03, /* 0x40ACF04B, 0xE44DFC63 */
+  6.46042516752568917582e+03, /* 0x40B93C6C, 0xD7C76A28 */
+  2.51633368920368957333e+03, /* 0x40A3A8AA, 0xD94FB1C0 */
+ -1.49247451836156386662e+02, /* 0xC062A7EB, 0x201CF40F */
+};
+
+#ifdef __STDC__
+static const double qR2[6] = {/* for x in [2.8570,2]=1/[0.3499,0.5] */
+#else
+static double qR2[6] = {/* for x in [2.8570,2]=1/[0.3499,0.5] */
+#endif
+  1.50444444886983272379e-07, /* 0x3E84313B, 0x54F76BDB */
+  7.32234265963079278272e-02, /* 0x3FB2BEC5, 0x3E883E34 */
+  1.99819174093815998816e+00, /* 0x3FFFF897, 0xE727779C */
+  1.44956029347885735348e+01, /* 0x402CFDBF, 0xAAF96FE5 */
+  3.16662317504781540833e+01, /* 0x403FAA8E, 0x29FBDC4A */
+  1.62527075710929267416e+01, /* 0x403040B1, 0x71814BB4 */
+};
+#ifdef __STDC__
+static const double qS2[6] = {
+#else
+static double qS2[6] = {
+#endif
+  3.03655848355219184498e+01, /* 0x403E5D96, 0xF7C07AED */
+  2.69348118608049844624e+02, /* 0x4070D591, 0xE4D14B40 */
+  8.44783757595320139444e+02, /* 0x408A6645, 0x22B3BF22 */
+  8.82935845112488550512e+02, /* 0x408B977C, 0x9C5CC214 */
+  2.12666388511798828631e+02, /* 0x406A9553, 0x0E001365 */
+ -5.31095493882666946917e+00, /* 0xC0153E6A, 0xF8B32931 */
+};
+
+#ifdef __STDC__
+	static double qzero(double x)
+#else
+	static double qzero(x)
+	double x;
+#endif
+{
+#ifdef __STDC__
+	const double *p,*q;
+#else
+	double *p,*q;
+#endif
+        fd_twoints u;
+	double s,r,z;
+	int ix;
+        u.d = x;
+	ix = 0x7fffffff&__HI(u);
+	if(ix>=0x40200000)     {p = qR8; q= qS8;}
+	else if(ix>=0x40122E8B){p = qR5; q= qS5;}
+	else if(ix>=0x4006DB6D){p = qR3; q= qS3;}
+	else if(ix>=0x40000000){p = qR2; q= qS2;}
+	z = one/(x*x);
+	r = p[0]+z*(p[1]+z*(p[2]+z*(p[3]+z*(p[4]+z*p[5]))));
+	s = one+z*(q[0]+z*(q[1]+z*(q[2]+z*(q[3]+z*(q[4]+z*q[5])))));
+	return (-.125 + r/s)/x;
+}

mozilla/js/src/fdlibm/e_j1.c

@@ -0,0 +1,523 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * ***** BEGIN LICENSE BLOCK *****
+ * Version: MPL 1.1/GPL 2.0/LGPL 2.1
+ *
+ * The contents of this file are subject to the Mozilla Public License Version
+ * 1.1 (the "License"); you may not use this file except in compliance with
+ * the License. You may obtain a copy of the License at
+ * http://www.mozilla.org/MPL/
+ *
+ * Software distributed under the License is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+ * for the specific language governing rights and limitations under the
+ * License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is
+ * Sun Microsystems, Inc.
+ * Portions created by the Initial Developer are Copyright (C) 1998
+ * the Initial Developer. All Rights Reserved.
+ *
+ * Contributor(s):
+ *
+ * Alternatively, the contents of this file may be used under the terms of
+ * either of the GNU General Public License Version 2 or later (the "GPL"),
+ * or the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+ * in which case the provisions of the GPL or the LGPL are applicable instead
+ * of those above. If you wish to allow use of your version of this file only
+ * under the terms of either the GPL or the LGPL, and not to allow others to
+ * use your version of this file under the terms of the MPL, indicate your
+ * decision by deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL or the LGPL. If you do not delete
+ * the provisions above, a recipient may use your version of this file under
+ * the terms of any one of the MPL, the GPL or the LGPL.
+ *
+ * ***** END LICENSE BLOCK ***** */
+
+/* @(#)e_j1.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* __ieee754_j1(x), __ieee754_y1(x)
+ * Bessel function of the first and second kinds of order zero.
+ * Method -- j1(x):
+ *	1. For tiny x, we use j1(x) = x/2 - x^3/16 + x^5/384 - ...
+ *	2. Reduce x to |x| since j1(x)=-j1(-x),  and
+ *	   for x in (0,2)
+ *		j1(x) = x/2 + x*z*R0/S0,  where z = x*x;
+ *	   (precision:  |j1/x - 1/2 - R0/S0 |<2**-61.51 )
+ *	   for x in (2,inf)
+ * 		j1(x) = sqrt(2/(pi*x))*(p1(x)*cos(x1)-q1(x)*sin(x1))
+ * 		y1(x) = sqrt(2/(pi*x))*(p1(x)*sin(x1)+q1(x)*cos(x1))
+ * 	   where x1 = x-3*pi/4. It is better to compute sin(x1),cos(x1)
+ *	   as follow:
+ *		cos(x1) =  cos(x)cos(3pi/4)+sin(x)sin(3pi/4)
+ *			=  1/sqrt(2) * (sin(x) - cos(x))
+ *		sin(x1) =  sin(x)cos(3pi/4)-cos(x)sin(3pi/4)
+ *			= -1/sqrt(2) * (sin(x) + cos(x))
+ * 	   (To avoid cancellation, use
+ *		sin(x) +- cos(x) = -cos(2x)/(sin(x) -+ cos(x))
+ * 	    to compute the worse one.)
+ *	   
+ *	3 Special cases
+ *		j1(nan)= nan
+ *		j1(0) = 0
+ *		j1(inf) = 0
+ *		
+ * Method -- y1(x):
+ *	1. screen out x<=0 cases: y1(0)=-inf, y1(x<0)=NaN 
+ *	2. For x<2.
+ *	   Since 
+ *		y1(x) = 2/pi*(j1(x)*(ln(x/2)+Euler)-1/x-x/2+5/64*x^3-...)
+ *	   therefore y1(x)-2/pi*j1(x)*ln(x)-1/x is an odd function.
+ *	   We use the following function to approximate y1,
+ *		y1(x) = x*U(z)/V(z) + (2/pi)*(j1(x)*ln(x)-1/x), z= x^2
+ *	   where for x in [0,2] (abs err less than 2**-65.89)
+ *		U(z) = U0[0] + U0[1]*z + ... + U0[4]*z^4
+ *		V(z) = 1  + v0[0]*z + ... + v0[4]*z^5
+ *	   Note: For tiny x, 1/x dominate y1 and hence
+ *		y1(tiny) = -2/pi/tiny, (choose tiny<2**-54)
+ *	3. For x>=2.
+ * 		y1(x) = sqrt(2/(pi*x))*(p1(x)*sin(x1)+q1(x)*cos(x1))
+ * 	   where x1 = x-3*pi/4. It is better to compute sin(x1),cos(x1)
+ *	   by method mentioned above.
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static double pone(double), qone(double);
+#else
+static double pone(), qone();
+#endif
+
+#ifdef __STDC__
+static const double 
+#else
+static double 
+#endif
+really_big    = 1e300,
+one	= 1.0,
+invsqrtpi=  5.64189583547756279280e-01, /* 0x3FE20DD7, 0x50429B6D */
+tpi      =  6.36619772367581382433e-01, /* 0x3FE45F30, 0x6DC9C883 */
+	/* R0/S0 on [0,2] */
+r00  = -6.25000000000000000000e-02, /* 0xBFB00000, 0x00000000 */
+r01  =  1.40705666955189706048e-03, /* 0x3F570D9F, 0x98472C61 */
+r02  = -1.59955631084035597520e-05, /* 0xBEF0C5C6, 0xBA169668 */
+r03  =  4.96727999609584448412e-08, /* 0x3E6AAAFA, 0x46CA0BD9 */
+s01  =  1.91537599538363460805e-02, /* 0x3F939D0B, 0x12637E53 */
+s02  =  1.85946785588630915560e-04, /* 0x3F285F56, 0xB9CDF664 */
+s03  =  1.17718464042623683263e-06, /* 0x3EB3BFF8, 0x333F8498 */
+s04  =  5.04636257076217042715e-09, /* 0x3E35AC88, 0xC97DFF2C */
+s05  =  1.23542274426137913908e-11; /* 0x3DAB2ACF, 0xCFB97ED8 */
+
+static double zero    = 0.0;
+
+#ifdef __STDC__
+	double __ieee754_j1(double x) 
+#else
+	double __ieee754_j1(x) 
+	double x;
+#endif
+{
+        fd_twoints un;
+	double z, s,c,ss,cc,r,u,v,y;
+	int hx,ix;
+
+        un.d = x;
+	hx = __HI(un);
+	ix = hx&0x7fffffff;
+	if(ix>=0x7ff00000) return one/x;
+	y = fd_fabs(x);
+	if(ix >= 0x40000000) {	/* |x| >= 2.0 */
+		s = fd_sin(y);
+		c = fd_cos(y);
+		ss = -s-c;
+		cc = s-c;
+		if(ix<0x7fe00000) {  /* make sure y+y not overflow */
+		    z = fd_cos(y+y);
+		    if ((s*c)>zero) cc = z/ss;
+		    else 	    ss = z/cc;
+		}
+	/*
+	 * j1(x) = 1/sqrt(pi) * (P(1,x)*cc - Q(1,x)*ss) / sqrt(x)
+	 * y1(x) = 1/sqrt(pi) * (P(1,x)*ss + Q(1,x)*cc) / sqrt(x)
+	 */
+		if(ix>0x48000000) z = (invsqrtpi*cc)/fd_sqrt(y);
+		else {
+		    u = pone(y); v = qone(y);
+		    z = invsqrtpi*(u*cc-v*ss)/fd_sqrt(y);
+		}
+		if(hx<0) return -z;
+		else  	 return  z;
+	}
+	if(ix<0x3e400000) {	/* |x|<2**-27 */
+	    if(really_big+x>one) return 0.5*x;/* inexact if x!=0 necessary */
+	}
+	z = x*x;
+	r =  z*(r00+z*(r01+z*(r02+z*r03)));
+	s =  one+z*(s01+z*(s02+z*(s03+z*(s04+z*s05))));
+	r *= x;
+	return(x*0.5+r/s);
+}
+
+#ifdef __STDC__
+static const double U0[5] = {
+#else
+static double U0[5] = {
+#endif
+ -1.96057090646238940668e-01, /* 0xBFC91866, 0x143CBC8A */
+  5.04438716639811282616e-02, /* 0x3FA9D3C7, 0x76292CD1 */
+ -1.91256895875763547298e-03, /* 0xBF5F55E5, 0x4844F50F */
+  2.35252600561610495928e-05, /* 0x3EF8AB03, 0x8FA6B88E */
+ -9.19099158039878874504e-08, /* 0xBE78AC00, 0x569105B8 */
+};
+#ifdef __STDC__
+static const double V0[5] = {
+#else
+static double V0[5] = {
+#endif
+  1.99167318236649903973e-02, /* 0x3F94650D, 0x3F4DA9F0 */
+  2.02552581025135171496e-04, /* 0x3F2A8C89, 0x6C257764 */
+  1.35608801097516229404e-06, /* 0x3EB6C05A, 0x894E8CA6 */
+  6.22741452364621501295e-09, /* 0x3E3ABF1D, 0x5BA69A86 */
+  1.66559246207992079114e-11, /* 0x3DB25039, 0xDACA772A */
+};
+
+#ifdef __STDC__
+	double __ieee754_y1(double x) 
+#else
+	double __ieee754_y1(x) 
+	double x;
+#endif
+{
+        fd_twoints un;
+	double z, s,c,ss,cc,u,v;
+	int hx,ix,lx;
+
+        un.d = x;
+        hx = __HI(un);
+        ix = 0x7fffffff&hx;
+        lx = __LO(un);
+    /* if Y1(NaN) is NaN, Y1(-inf) is NaN, Y1(inf) is 0 */
+	if(ix>=0x7ff00000) return  one/(x+x*x); 
+        if((ix|lx)==0) return -one/zero;
+        if(hx<0) return zero/zero;
+        if(ix >= 0x40000000) {  /* |x| >= 2.0 */
+                s = fd_sin(x);
+                c = fd_cos(x);
+                ss = -s-c;
+                cc = s-c;
+                if(ix<0x7fe00000) {  /* make sure x+x not overflow */
+                    z = fd_cos(x+x);
+                    if ((s*c)>zero) cc = z/ss;
+                    else            ss = z/cc;
+                }
+        /* y1(x) = sqrt(2/(pi*x))*(p1(x)*sin(x0)+q1(x)*cos(x0))
+         * where x0 = x-3pi/4
+         *      Better formula:
+         *              cos(x0) = cos(x)cos(3pi/4)+sin(x)sin(3pi/4)
+         *                      =  1/sqrt(2) * (sin(x) - cos(x))
+         *              sin(x0) = sin(x)cos(3pi/4)-cos(x)sin(3pi/4)
+         *                      = -1/sqrt(2) * (cos(x) + sin(x))
+         * To avoid cancellation, use
+         *              sin(x) +- cos(x) = -cos(2x)/(sin(x) -+ cos(x))
+         * to compute the worse one.
+         */
+                if(ix>0x48000000) z = (invsqrtpi*ss)/fd_sqrt(x);
+                else {
+                    u = pone(x); v = qone(x);
+                    z = invsqrtpi*(u*ss+v*cc)/fd_sqrt(x);
+                }
+                return z;
+        } 
+        if(ix<=0x3c900000) {    /* x < 2**-54 */
+            return(-tpi/x);
+        } 
+        z = x*x;
+        u = U0[0]+z*(U0[1]+z*(U0[2]+z*(U0[3]+z*U0[4])));
+        v = one+z*(V0[0]+z*(V0[1]+z*(V0[2]+z*(V0[3]+z*V0[4]))));
+        return(x*(u/v) + tpi*(__ieee754_j1(x)*__ieee754_log(x)-one/x));
+}
+
+/* For x >= 8, the asymptotic expansions of pone is
+ *	1 + 15/128 s^2 - 4725/2^15 s^4 - ...,	where s = 1/x.
+ * We approximate pone by
+ * 	pone(x) = 1 + (R/S)
+ * where  R = pr0 + pr1*s^2 + pr2*s^4 + ... + pr5*s^10
+ * 	  S = 1 + ps0*s^2 + ... + ps4*s^10
+ * and
+ *	| pone(x)-1-R/S | <= 2  ** ( -60.06)
+ */
+
+#ifdef __STDC__
+static const double pr8[6] = { /* for x in [inf, 8]=1/[0,0.125] */
+#else
+static double pr8[6] = { /* for x in [inf, 8]=1/[0,0.125] */
+#endif
+  0.00000000000000000000e+00, /* 0x00000000, 0x00000000 */
+  1.17187499999988647970e-01, /* 0x3FBDFFFF, 0xFFFFFCCE */
+  1.32394806593073575129e+01, /* 0x402A7A9D, 0x357F7FCE */
+  4.12051854307378562225e+02, /* 0x4079C0D4, 0x652EA590 */
+  3.87474538913960532227e+03, /* 0x40AE457D, 0xA3A532CC */
+  7.91447954031891731574e+03, /* 0x40BEEA7A, 0xC32782DD */
+};
+#ifdef __STDC__
+static const double ps8[5] = {
+#else
+static double ps8[5] = {
+#endif
+  1.14207370375678408436e+02, /* 0x405C8D45, 0x8E656CAC */
+  3.65093083420853463394e+03, /* 0x40AC85DC, 0x964D274F */
+  3.69562060269033463555e+04, /* 0x40E20B86, 0x97C5BB7F */
+  9.76027935934950801311e+04, /* 0x40F7D42C, 0xB28F17BB */
+  3.08042720627888811578e+04, /* 0x40DE1511, 0x697A0B2D */
+};
+
+#ifdef __STDC__
+static const double pr5[6] = { /* for x in [8,4.5454]=1/[0.125,0.22001] */
+#else
+static double pr5[6] = { /* for x in [8,4.5454]=1/[0.125,0.22001] */
+#endif
+  1.31990519556243522749e-11, /* 0x3DAD0667, 0xDAE1CA7D */
+  1.17187493190614097638e-01, /* 0x3FBDFFFF, 0xE2C10043 */
+  6.80275127868432871736e+00, /* 0x401B3604, 0x6E6315E3 */
+  1.08308182990189109773e+02, /* 0x405B13B9, 0x452602ED */
+  5.17636139533199752805e+02, /* 0x40802D16, 0xD052D649 */
+  5.28715201363337541807e+02, /* 0x408085B8, 0xBB7E0CB7 */
+};
+#ifdef __STDC__
+static const double ps5[5] = {
+#else
+static double ps5[5] = {
+#endif
+  5.92805987221131331921e+01, /* 0x404DA3EA, 0xA8AF633D */
+  9.91401418733614377743e+02, /* 0x408EFB36, 0x1B066701 */
+  5.35326695291487976647e+03, /* 0x40B4E944, 0x5706B6FB */
+  7.84469031749551231769e+03, /* 0x40BEA4B0, 0xB8A5BB15 */
+  1.50404688810361062679e+03, /* 0x40978030, 0x036F5E51 */
+};
+
+#ifdef __STDC__
+static const double pr3[6] = {
+#else
+static double pr3[6] = {/* for x in [4.547,2.8571]=1/[0.2199,0.35001] */
+#endif
+  3.02503916137373618024e-09, /* 0x3E29FC21, 0xA7AD9EDD */
+  1.17186865567253592491e-01, /* 0x3FBDFFF5, 0x5B21D17B */
+  3.93297750033315640650e+00, /* 0x400F76BC, 0xE85EAD8A */
+  3.51194035591636932736e+01, /* 0x40418F48, 0x9DA6D129 */
+  9.10550110750781271918e+01, /* 0x4056C385, 0x4D2C1837 */
+  4.85590685197364919645e+01, /* 0x4048478F, 0x8EA83EE5 */
+};
+#ifdef __STDC__
+static const double ps3[5] = {
+#else
+static double ps3[5] = {
+#endif
+  3.47913095001251519989e+01, /* 0x40416549, 0xA134069C */
+  3.36762458747825746741e+02, /* 0x40750C33, 0x07F1A75F */
+  1.04687139975775130551e+03, /* 0x40905B7C, 0x5037D523 */
+  8.90811346398256432622e+02, /* 0x408BD67D, 0xA32E31E9 */
+  1.03787932439639277504e+02, /* 0x4059F26D, 0x7C2EED53 */
+};
+
+#ifdef __STDC__
+static const double pr2[6] = {/* for x in [2.8570,2]=1/[0.3499,0.5] */
+#else
+static double pr2[6] = {/* for x in [2.8570,2]=1/[0.3499,0.5] */
+#endif
+  1.07710830106873743082e-07, /* 0x3E7CE9D4, 0xF65544F4 */
+  1.17176219462683348094e-01, /* 0x3FBDFF42, 0xBE760D83 */
+  2.36851496667608785174e+00, /* 0x4002F2B7, 0xF98FAEC0 */
+  1.22426109148261232917e+01, /* 0x40287C37, 0x7F71A964 */
+  1.76939711271687727390e+01, /* 0x4031B1A8, 0x177F8EE2 */
+  5.07352312588818499250e+00, /* 0x40144B49, 0xA574C1FE */
+};
+#ifdef __STDC__
+static const double ps2[5] = {
+#else
+static double ps2[5] = {
+#endif
+  2.14364859363821409488e+01, /* 0x40356FBD, 0x8AD5ECDC */
+  1.25290227168402751090e+02, /* 0x405F5293, 0x14F92CD5 */
+  2.32276469057162813669e+02, /* 0x406D08D8, 0xD5A2DBD9 */
+  1.17679373287147100768e+02, /* 0x405D6B7A, 0xDA1884A9 */
+  8.36463893371618283368e+00, /* 0x4020BAB1, 0xF44E5192 */
+};
+
+#ifdef __STDC__
+	static double pone(double x)
+#else
+	static double pone(x)
+	double x;
+#endif
+{
+#ifdef __STDC__
+	const double *p,*q;
+#else
+	double *p,*q;
+#endif
+        fd_twoints un;
+	double z,r,s;
+        int ix;
+        un.d = x;
+        ix = 0x7fffffff&__HI(un);
+        if(ix>=0x40200000)     {p = pr8; q= ps8;}
+        else if(ix>=0x40122E8B){p = pr5; q= ps5;}
+        else if(ix>=0x4006DB6D){p = pr3; q= ps3;}
+        else if(ix>=0x40000000){p = pr2; q= ps2;}
+        z = one/(x*x);
+        r = p[0]+z*(p[1]+z*(p[2]+z*(p[3]+z*(p[4]+z*p[5]))));
+        s = one+z*(q[0]+z*(q[1]+z*(q[2]+z*(q[3]+z*q[4]))));
+        return one+ r/s;
+}
+		
+
+/* For x >= 8, the asymptotic expansions of qone is
+ *	3/8 s - 105/1024 s^3 - ..., where s = 1/x.
+ * We approximate pone by
+ * 	qone(x) = s*(0.375 + (R/S))
+ * where  R = qr1*s^2 + qr2*s^4 + ... + qr5*s^10
+ * 	  S = 1 + qs1*s^2 + ... + qs6*s^12
+ * and
+ *	| qone(x)/s -0.375-R/S | <= 2  ** ( -61.13)
+ */
+
+#ifdef __STDC__
+static const double qr8[6] = { /* for x in [inf, 8]=1/[0,0.125] */
+#else
+static double qr8[6] = { /* for x in [inf, 8]=1/[0,0.125] */
+#endif
+  0.00000000000000000000e+00, /* 0x00000000, 0x00000000 */
+ -1.02539062499992714161e-01, /* 0xBFBA3FFF, 0xFFFFFDF3 */
+ -1.62717534544589987888e+01, /* 0xC0304591, 0xA26779F7 */
+ -7.59601722513950107896e+02, /* 0xC087BCD0, 0x53E4B576 */
+ -1.18498066702429587167e+04, /* 0xC0C724E7, 0x40F87415 */
+ -4.84385124285750353010e+04, /* 0xC0E7A6D0, 0x65D09C6A */
+};
+#ifdef __STDC__
+static const double qs8[6] = {
+#else
+static double qs8[6] = {
+#endif
+  1.61395369700722909556e+02, /* 0x40642CA6, 0xDE5BCDE5 */
+  7.82538599923348465381e+03, /* 0x40BE9162, 0xD0D88419 */
+  1.33875336287249578163e+05, /* 0x4100579A, 0xB0B75E98 */
+  7.19657723683240939863e+05, /* 0x4125F653, 0x72869C19 */
+  6.66601232617776375264e+05, /* 0x412457D2, 0x7719AD5C */
+ -2.94490264303834643215e+05, /* 0xC111F969, 0x0EA5AA18 */
+};
+
+#ifdef __STDC__
+static const double qr5[6] = { /* for x in [8,4.5454]=1/[0.125,0.22001] */
+#else
+static double qr5[6] = { /* for x in [8,4.5454]=1/[0.125,0.22001] */
+#endif
+ -2.08979931141764104297e-11, /* 0xBDB6FA43, 0x1AA1A098 */
+ -1.02539050241375426231e-01, /* 0xBFBA3FFF, 0xCB597FEF */
+ -8.05644828123936029840e+00, /* 0xC0201CE6, 0xCA03AD4B */
+ -1.83669607474888380239e+02, /* 0xC066F56D, 0x6CA7B9B0 */
+ -1.37319376065508163265e+03, /* 0xC09574C6, 0x6931734F */
+ -2.61244440453215656817e+03, /* 0xC0A468E3, 0x88FDA79D */
+};
+#ifdef __STDC__
+static const double qs5[6] = {
+#else
+static double qs5[6] = {
+#endif
+  8.12765501384335777857e+01, /* 0x405451B2, 0xFF5A11B2 */
+  1.99179873460485964642e+03, /* 0x409F1F31, 0xE77BF839 */
+  1.74684851924908907677e+04, /* 0x40D10F1F, 0x0D64CE29 */
+  4.98514270910352279316e+04, /* 0x40E8576D, 0xAABAD197 */
+  2.79480751638918118260e+04, /* 0x40DB4B04, 0xCF7C364B */
+ -4.71918354795128470869e+03, /* 0xC0B26F2E, 0xFCFFA004 */
+};
+
+#ifdef __STDC__
+static const double qr3[6] = {
+#else
+static double qr3[6] = {/* for x in [4.547,2.8571]=1/[0.2199,0.35001] */
+#endif
+ -5.07831226461766561369e-09, /* 0xBE35CFA9, 0xD38FC84F */
+ -1.02537829820837089745e-01, /* 0xBFBA3FEB, 0x51AEED54 */
+ -4.61011581139473403113e+00, /* 0xC01270C2, 0x3302D9FF */
+ -5.78472216562783643212e+01, /* 0xC04CEC71, 0xC25D16DA */
+ -2.28244540737631695038e+02, /* 0xC06C87D3, 0x4718D55F */
+ -2.19210128478909325622e+02, /* 0xC06B66B9, 0x5F5C1BF6 */
+};
+#ifdef __STDC__
+static const double qs3[6] = {
+#else
+static double qs3[6] = {
+#endif
+  4.76651550323729509273e+01, /* 0x4047D523, 0xCCD367E4 */
+  6.73865112676699709482e+02, /* 0x40850EEB, 0xC031EE3E */
+  3.38015286679526343505e+03, /* 0x40AA684E, 0x448E7C9A */
+  5.54772909720722782367e+03, /* 0x40B5ABBA, 0xA61D54A6 */
+  1.90311919338810798763e+03, /* 0x409DBC7A, 0x0DD4DF4B */
+ -1.35201191444307340817e+02, /* 0xC060E670, 0x290A311F */
+};
+
+#ifdef __STDC__
+static const double qr2[6] = {/* for x in [2.8570,2]=1/[0.3499,0.5] */
+#else
+static double qr2[6] = {/* for x in [2.8570,2]=1/[0.3499,0.5] */
+#endif
+ -1.78381727510958865572e-07, /* 0xBE87F126, 0x44C626D2 */
+ -1.02517042607985553460e-01, /* 0xBFBA3E8E, 0x9148B010 */
+ -2.75220568278187460720e+00, /* 0xC0060484, 0x69BB4EDA */
+ -1.96636162643703720221e+01, /* 0xC033A9E2, 0xC168907F */
+ -4.23253133372830490089e+01, /* 0xC04529A3, 0xDE104AAA */
+ -2.13719211703704061733e+01, /* 0xC0355F36, 0x39CF6E52 */
+};
+#ifdef __STDC__
+static const double qs2[6] = {
+#else
+static double qs2[6] = {
+#endif
+  2.95333629060523854548e+01, /* 0x403D888A, 0x78AE64FF */
+  2.52981549982190529136e+02, /* 0x406F9F68, 0xDB821CBA */
+  7.57502834868645436472e+02, /* 0x4087AC05, 0xCE49A0F7 */
+  7.39393205320467245656e+02, /* 0x40871B25, 0x48D4C029 */
+  1.55949003336666123687e+02, /* 0x40637E5E, 0x3C3ED8D4 */
+ -4.95949898822628210127e+00, /* 0xC013D686, 0xE71BE86B */
+};
+
+#ifdef __STDC__
+	static double qone(double x)
+#else
+	static double qone(x)
+	double x;
+#endif
+{
+#ifdef __STDC__
+	const double *p,*q;
+#else
+	double *p,*q;
+#endif
+        fd_twoints un;
+	double  s,r,z;
+	int ix;
+        un.d = x;
+	ix = 0x7fffffff&__HI(un);
+	if(ix>=0x40200000)     {p = qr8; q= qs8;}
+	else if(ix>=0x40122E8B){p = qr5; q= qs5;}
+	else if(ix>=0x4006DB6D){p = qr3; q= qs3;}
+	else if(ix>=0x40000000){p = qr2; q= qs2;}
+	z = one/(x*x);
+	r = p[0]+z*(p[1]+z*(p[2]+z*(p[3]+z*(p[4]+z*p[5]))));
+	s = one+z*(q[0]+z*(q[1]+z*(q[2]+z*(q[3]+z*(q[4]+z*q[5])))));
+	return (.375 + r/s)/x;
+}

mozilla/js/src/fdlibm/e_jn.c

@@ -0,0 +1,315 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * ***** BEGIN LICENSE BLOCK *****
+ * Version: MPL 1.1/GPL 2.0/LGPL 2.1
+ *
+ * The contents of this file are subject to the Mozilla Public License Version
+ * 1.1 (the "License"); you may not use this file except in compliance with
+ * the License. You may obtain a copy of the License at
+ * http://www.mozilla.org/MPL/
+ *
+ * Software distributed under the License is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+ * for the specific language governing rights and limitations under the
+ * License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is
+ * Sun Microsystems, Inc.
+ * Portions created by the Initial Developer are Copyright (C) 1998
+ * the Initial Developer. All Rights Reserved.
+ *
+ * Contributor(s):
+ *
+ * Alternatively, the contents of this file may be used under the terms of
+ * either of the GNU General Public License Version 2 or later (the "GPL"),
+ * or the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+ * in which case the provisions of the GPL or the LGPL are applicable instead
+ * of those above. If you wish to allow use of your version of this file only
+ * under the terms of either the GPL or the LGPL, and not to allow others to
+ * use your version of this file under the terms of the MPL, indicate your
+ * decision by deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL or the LGPL. If you do not delete
+ * the provisions above, a recipient may use your version of this file under
+ * the terms of any one of the MPL, the GPL or the LGPL.
+ *
+ * ***** END LICENSE BLOCK ***** */
+
+/* @(#)e_jn.c 1.4 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/*
+ * __ieee754_jn(n, x), __ieee754_yn(n, x)
+ * floating point Bessel's function of the 1st and 2nd kind
+ * of order n
+ *          
+ * Special cases:
+ *	y0(0)=y1(0)=yn(n,0) = -inf with division by zero signal;
+ *	y0(-ve)=y1(-ve)=yn(n,-ve) are NaN with invalid signal.
+ * Note 2. About jn(n,x), yn(n,x)
+ *	For n=0, j0(x) is called,
+ *	for n=1, j1(x) is called,
+ *	for n<x, forward recursion us used starting
+ *	from values of j0(x) and j1(x).
+ *	for n>x, a continued fraction approximation to
+ *	j(n,x)/j(n-1,x) is evaluated and then backward
+ *	recursion is used starting from a supposed value
+ *	for j(n,x). The resulting value of j(0,x) is
+ *	compared with the actual value to correct the
+ *	supposed value of j(n,x).
+ *
+ *	yn(n,x) is similar in all respects, except
+ *	that forward recursion is used for all
+ *	values of n>1.
+ *	
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double
+#else
+static double
+#endif
+invsqrtpi=  5.64189583547756279280e-01, /* 0x3FE20DD7, 0x50429B6D */
+two   =  2.00000000000000000000e+00, /* 0x40000000, 0x00000000 */
+one   =  1.00000000000000000000e+00; /* 0x3FF00000, 0x00000000 */
+
+static double zero  =  0.00000000000000000000e+00;
+
+#ifdef __STDC__
+	double __ieee754_jn(int n, double x)
+#else
+	double __ieee754_jn(n,x)
+	int n; double x;
+#endif
+{
+        fd_twoints u;
+	int i,hx,ix,lx, sgn;
+	double a, b, temp, di;
+	double z, w;
+
+    /* J(-n,x) = (-1)^n * J(n, x), J(n, -x) = (-1)^n * J(n, x)
+     * Thus, J(-n,x) = J(n,-x)
+     */
+        u.d = x;
+	hx = __HI(u);
+	ix = 0x7fffffff&hx;
+	lx = __LO(u);
+    /* if J(n,NaN) is NaN */
+	if((ix|((unsigned)(lx|-lx))>>31)>0x7ff00000) return x+x;
+	if(n<0){		
+		n = -n;
+		x = -x;
+		hx ^= 0x80000000;
+	}
+	if(n==0) return(__ieee754_j0(x));
+	if(n==1) return(__ieee754_j1(x));
+	sgn = (n&1)&(hx>>31);	/* even n -- 0, odd n -- sign(x) */
+	x = fd_fabs(x);
+	if((ix|lx)==0||ix>=0x7ff00000) 	/* if x is 0 or inf */
+	    b = zero;
+	else if((double)n<=x) {   
+		/* Safe to use J(n+1,x)=2n/x *J(n,x)-J(n-1,x) */
+	    if(ix>=0x52D00000) { /* x > 2**302 */
+    /* (x >> n**2) 
+     *	    Jn(x) = cos(x-(2n+1)*pi/4)*sqrt(2/x*pi)
+     *	    Yn(x) = sin(x-(2n+1)*pi/4)*sqrt(2/x*pi)
+     *	    Let s=sin(x), c=cos(x), 
+     *		xn=x-(2n+1)*pi/4, sqt2 = sqrt(2),then
+     *
+     *		   n	sin(xn)*sqt2	cos(xn)*sqt2
+     *		----------------------------------
+     *		   0	 s-c		 c+s
+     *		   1	-s-c 		-c+s
+     *		   2	-s+c		-c-s
+     *		   3	 s+c		 c-s
+     */
+		switch(n&3) {
+		    case 0: temp =  fd_cos(x)+fd_sin(x); break;
+		    case 1: temp = -fd_cos(x)+fd_sin(x); break;
+		    case 2: temp = -fd_cos(x)-fd_sin(x); break;
+		    case 3: temp =  fd_cos(x)-fd_sin(x); break;
+		}
+		b = invsqrtpi*temp/fd_sqrt(x);
+	    } else {	
+	        a = __ieee754_j0(x);
+	        b = __ieee754_j1(x);
+	        for(i=1;i<n;i++){
+		    temp = b;
+		    b = b*((double)(i+i)/x) - a; /* avoid underflow */
+		    a = temp;
+	        }
+	    }
+	} else {
+	    if(ix<0x3e100000) {	/* x < 2**-29 */
+    /* x is tiny, return the first Taylor expansion of J(n,x) 
+     * J(n,x) = 1/n!*(x/2)^n  - ...
+     */
+		if(n>33)	/* underflow */
+		    b = zero;
+		else {
+		    temp = x*0.5; b = temp;
+		    for (a=one,i=2;i<=n;i++) {
+			a *= (double)i;		/* a = n! */
+			b *= temp;		/* b = (x/2)^n */
+		    }
+		    b = b/a;
+		}
+	    } else {
+		/* use backward recurrence */
+		/* 			x      x^2      x^2       
+		 *  J(n,x)/J(n-1,x) =  ----   ------   ------   .....
+		 *			2n  - 2(n+1) - 2(n+2)
+		 *
+		 * 			1      1        1       
+		 *  (for large x)   =  ----  ------   ------   .....
+		 *			2n   2(n+1)   2(n+2)
+		 *			-- - ------ - ------ - 
+		 *			 x     x         x
+		 *
+		 * Let w = 2n/x and h=2/x, then the above quotient
+		 * is equal to the continued fraction:
+		 *		    1
+		 *	= -----------------------
+		 *		       1
+		 *	   w - -----------------
+		 *			  1
+		 * 	        w+h - ---------
+		 *		       w+2h - ...
+		 *
+		 * To determine how many terms needed, let
+		 * Q(0) = w, Q(1) = w(w+h) - 1,
+		 * Q(k) = (w+k*h)*Q(k-1) - Q(k-2),
+		 * When Q(k) > 1e4	good for single 
+		 * When Q(k) > 1e9	good for double 
+		 * When Q(k) > 1e17	good for quadruple 
+		 */
+	    /* determine k */
+		double t,v;
+		double q0,q1,h,tmp; int k,m;
+		w  = (n+n)/(double)x; h = 2.0/(double)x;
+		q0 = w;  z = w+h; q1 = w*z - 1.0; k=1;
+		while(q1<1.0e9) {
+			k += 1; z += h;
+			tmp = z*q1 - q0;
+			q0 = q1;
+			q1 = tmp;
+		}
+		m = n+n;
+		for(t=zero, i = 2*(n+k); i>=m; i -= 2) t = one/(i/x-t);
+		a = t;
+		b = one;
+		/*  estimate log((2/x)^n*n!) = n*log(2/x)+n*ln(n)
+		 *  Hence, if n*(log(2n/x)) > ...
+		 *  single 8.8722839355e+01
+		 *  double 7.09782712893383973096e+02
+		 *  long double 1.1356523406294143949491931077970765006170e+04
+		 *  then recurrent value may overflow and the result is 
+		 *  likely underflow to zero
+		 */
+		tmp = n;
+		v = two/x;
+		tmp = tmp*__ieee754_log(fd_fabs(v*tmp));
+		if(tmp<7.09782712893383973096e+02) {
+	    	    for(i=n-1,di=(double)(i+i);i>0;i--){
+		        temp = b;
+			b *= di;
+			b  = b/x - a;
+		        a = temp;
+			di -= two;
+	     	    }
+		} else {
+	    	    for(i=n-1,di=(double)(i+i);i>0;i--){
+		        temp = b;
+			b *= di;
+			b  = b/x - a;
+		        a = temp;
+			di -= two;
+		    /* scale b to avoid spurious overflow */
+			if(b>1e100) {
+			    a /= b;
+			    t /= b;
+			    b  = one;
+			}
+	     	    }
+		}
+	    	b = (t*__ieee754_j0(x)/b);
+	    }
+	}
+	if(sgn==1) return -b; else return b;
+}
+
+#ifdef __STDC__
+	double __ieee754_yn(int n, double x) 
+#else
+	double __ieee754_yn(n,x) 
+	int n; double x;
+#endif
+{
+        fd_twoints u;
+	int i,hx,ix,lx;
+	int sign;
+	double a, b, temp;
+
+        u.d = x;
+	hx = __HI(u);
+	ix = 0x7fffffff&hx;
+	lx = __LO(u);
+    /* if Y(n,NaN) is NaN */
+	if((ix|((unsigned)(lx|-lx))>>31)>0x7ff00000) return x+x;
+	if((ix|lx)==0) return -one/zero;
+	if(hx<0) return zero/zero;
+	sign = 1;
+	if(n<0){
+		n = -n;
+		sign = 1 - ((n&1)<<1);
+	}
+	if(n==0) return(__ieee754_y0(x));
+	if(n==1) return(sign*__ieee754_y1(x));
+	if(ix==0x7ff00000) return zero;
+	if(ix>=0x52D00000) { /* x > 2**302 */
+    /* (x >> n**2) 
+     *	    Jn(x) = cos(x-(2n+1)*pi/4)*sqrt(2/x*pi)
+     *	    Yn(x) = sin(x-(2n+1)*pi/4)*sqrt(2/x*pi)
+     *	    Let s=sin(x), c=cos(x), 
+     *		xn=x-(2n+1)*pi/4, sqt2 = sqrt(2),then
+     *
+     *		   n	sin(xn)*sqt2	cos(xn)*sqt2
+     *		----------------------------------
+     *		   0	 s-c		 c+s
+     *		   1	-s-c 		-c+s
+     *		   2	-s+c		-c-s
+     *		   3	 s+c		 c-s
+     */
+		switch(n&3) {
+		    case 0: temp =  fd_sin(x)-fd_cos(x); break;
+		    case 1: temp = -fd_sin(x)-fd_cos(x); break;
+		    case 2: temp = -fd_sin(x)+fd_cos(x); break;
+		    case 3: temp =  fd_sin(x)+fd_cos(x); break;
+		}
+		b = invsqrtpi*temp/fd_sqrt(x);
+	} else {
+	    a = __ieee754_y0(x);
+	    b = __ieee754_y1(x);
+	/* quit if b is -inf */
+            u.d = b;
+	    for(i=1;i<n&&(__HI(u) != 0xfff00000);i++){ 
+		temp = b;
+		b = ((double)(i+i)/x)*b - a;
+		a = temp;
+	    }
+	}
+	if(sign>0) return b; else return -b;
+}

mozilla/js/src/fdlibm/e_lgamma.c

@@ -0,0 +1,71 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * ***** BEGIN LICENSE BLOCK *****
+ * Version: MPL 1.1/GPL 2.0/LGPL 2.1
+ *
+ * The contents of this file are subject to the Mozilla Public License Version
+ * 1.1 (the "License"); you may not use this file except in compliance with
+ * the License. You may obtain a copy of the License at
+ * http://www.mozilla.org/MPL/
+ *
+ * Software distributed under the License is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+ * for the specific language governing rights and limitations under the
+ * License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is
+ * Sun Microsystems, Inc.
+ * Portions created by the Initial Developer are Copyright (C) 1998
+ * the Initial Developer. All Rights Reserved.
+ *
+ * Contributor(s):
+ *
+ * Alternatively, the contents of this file may be used under the terms of
+ * either of the GNU General Public License Version 2 or later (the "GPL"),
+ * or the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+ * in which case the provisions of the GPL or the LGPL are applicable instead
+ * of those above. If you wish to allow use of your version of this file only
+ * under the terms of either the GPL or the LGPL, and not to allow others to
+ * use your version of this file under the terms of the MPL, indicate your
+ * decision by deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL or the LGPL. If you do not delete
+ * the provisions above, a recipient may use your version of this file under
+ * the terms of any one of the MPL, the GPL or the LGPL.
+ *
+ * ***** END LICENSE BLOCK ***** */
+
+/* @(#)e_lgamma.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ *
+ */
+
+/* __ieee754_lgamma(x)
+ * Return the logarithm of the Gamma function of x.
+ *
+ * Method: call __ieee754_lgamma_r
+ */
+
+#include "fdlibm.h"
+
+extern int signgam;
+
+#ifdef __STDC__
+	double __ieee754_lgamma(double x)
+#else
+	double __ieee754_lgamma(x)
+	double x;
+#endif
+{
+	return __ieee754_lgamma_r(x,&signgam);
+}

mozilla/js/src/fdlibm/e_lgamma_r.c

@@ -0,0 +1,347 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * ***** BEGIN LICENSE BLOCK *****
+ * Version: MPL 1.1/GPL 2.0/LGPL 2.1
+ *
+ * The contents of this file are subject to the Mozilla Public License Version
+ * 1.1 (the "License"); you may not use this file except in compliance with
+ * the License. You may obtain a copy of the License at
+ * http://www.mozilla.org/MPL/
+ *
+ * Software distributed under the License is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+ * for the specific language governing rights and limitations under the
+ * License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is
+ * Sun Microsystems, Inc.
+ * Portions created by the Initial Developer are Copyright (C) 1998
+ * the Initial Developer. All Rights Reserved.
+ *
+ * Contributor(s):
+ *
+ * Alternatively, the contents of this file may be used under the terms of
+ * either of the GNU General Public License Version 2 or later (the "GPL"),
+ * or the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+ * in which case the provisions of the GPL or the LGPL are applicable instead
+ * of those above. If you wish to allow use of your version of this file only
+ * under the terms of either the GPL or the LGPL, and not to allow others to
+ * use your version of this file under the terms of the MPL, indicate your
+ * decision by deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL or the LGPL. If you do not delete
+ * the provisions above, a recipient may use your version of this file under
+ * the terms of any one of the MPL, the GPL or the LGPL.
+ *
+ * ***** END LICENSE BLOCK ***** */
+
+/* @(#)e_lgamma_r.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ *
+ */
+
+/* __ieee754_lgamma_r(x, signgamp)
+ * Reentrant version of the logarithm of the Gamma function 
+ * with user provide pointer for the sign of Gamma(x). 
+ *
+ * Method:
+ *   1. Argument Reduction for 0 < x <= 8
+ * 	Since gamma(1+s)=s*gamma(s), for x in [0,8], we may 
+ * 	reduce x to a number in [1.5,2.5] by
+ * 		lgamma(1+s) = log(s) + lgamma(s)
+ *	for example,
+ *		lgamma(7.3) = log(6.3) + lgamma(6.3)
+ *			    = log(6.3*5.3) + lgamma(5.3)
+ *			    = log(6.3*5.3*4.3*3.3*2.3) + lgamma(2.3)
+ *   2. Polynomial approximation of lgamma around its
+ *	minimun ymin=1.461632144968362245 to maintain monotonicity.
+ *	On [ymin-0.23, ymin+0.27] (i.e., [1.23164,1.73163]), use
+ *		Let z = x-ymin;
+ *		lgamma(x) = -1.214862905358496078218 + z^2*poly(z)
+ *	where
+ *		poly(z) is a 14 degree polynomial.
+ *   2. Rational approximation in the primary interval [2,3]
+ *	We use the following approximation:
+ *		s = x-2.0;
+ *		lgamma(x) = 0.5*s + s*P(s)/Q(s)
+ *	with accuracy
+ *		|P/Q - (lgamma(x)-0.5s)| < 2**-61.71
+ *	Our algorithms are based on the following observation
+ *
+ *                             zeta(2)-1    2    zeta(3)-1    3
+ * lgamma(2+s) = s*(1-Euler) + --------- * s  -  --------- * s  + ...
+ *                                 2                 3
+ *
+ *	where Euler = 0.5771... is the Euler constant, which is very
+ *	close to 0.5.
+ *
+ *   3. For x>=8, we have
+ *	lgamma(x)~(x-0.5)log(x)-x+0.5*log(2pi)+1/(12x)-1/(360x**3)+....
+ *	(better formula:
+ *	   lgamma(x)~(x-0.5)*(log(x)-1)-.5*(log(2pi)-1) + ...)
+ *	Let z = 1/x, then we approximation
+ *		f(z) = lgamma(x) - (x-0.5)(log(x)-1)
+ *	by
+ *	  			    3       5             11
+ *		w = w0 + w1*z + w2*z  + w3*z  + ... + w6*z
+ *	where 
+ *		|w - f(z)| < 2**-58.74
+ *		
+ *   4. For negative x, since (G is gamma function)
+ *		-x*G(-x)*G(x) = pi/sin(pi*x),
+ * 	we have
+ * 		G(x) = pi/(sin(pi*x)*(-x)*G(-x))
+ *	since G(-x) is positive, sign(G(x)) = sign(sin(pi*x)) for x<0
+ *	Hence, for x<0, signgam = sign(sin(pi*x)) and 
+ *		lgamma(x) = log(|Gamma(x)|)
+ *			  = log(pi/(|x*sin(pi*x)|)) - lgamma(-x);
+ *	Note: one should avoid compute pi*(-x) directly in the 
+ *	      computation of sin(pi*(-x)).
+ *		
+ *   5. Special Cases
+ *		lgamma(2+s) ~ s*(1-Euler) for tiny s
+ *		lgamma(1)=lgamma(2)=0
+ *		lgamma(x) ~ -log(x) for tiny x
+ *		lgamma(0) = lgamma(inf) = inf
+ *	 	lgamma(-integer) = +-inf
+ *	
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double 
+#else
+static double 
+#endif
+two52=  4.50359962737049600000e+15, /* 0x43300000, 0x00000000 */
+half=  5.00000000000000000000e-01, /* 0x3FE00000, 0x00000000 */
+one =  1.00000000000000000000e+00, /* 0x3FF00000, 0x00000000 */
+pi  =  3.14159265358979311600e+00, /* 0x400921FB, 0x54442D18 */
+a0  =  7.72156649015328655494e-02, /* 0x3FB3C467, 0xE37DB0C8 */
+a1  =  3.22467033424113591611e-01, /* 0x3FD4A34C, 0xC4A60FAD */
+a2  =  6.73523010531292681824e-02, /* 0x3FB13E00, 0x1A5562A7 */
+a3  =  2.05808084325167332806e-02, /* 0x3F951322, 0xAC92547B */
+a4  =  7.38555086081402883957e-03, /* 0x3F7E404F, 0xB68FEFE8 */
+a5  =  2.89051383673415629091e-03, /* 0x3F67ADD8, 0xCCB7926B */
+a6  =  1.19270763183362067845e-03, /* 0x3F538A94, 0x116F3F5D */
+a7  =  5.10069792153511336608e-04, /* 0x3F40B6C6, 0x89B99C00 */
+a8  =  2.20862790713908385557e-04, /* 0x3F2CF2EC, 0xED10E54D */
+a9  =  1.08011567247583939954e-04, /* 0x3F1C5088, 0x987DFB07 */
+a10 =  2.52144565451257326939e-05, /* 0x3EFA7074, 0x428CFA52 */
+a11 =  4.48640949618915160150e-05, /* 0x3F07858E, 0x90A45837 */
+tc  =  1.46163214496836224576e+00, /* 0x3FF762D8, 0x6356BE3F */
+tf  = -1.21486290535849611461e-01, /* 0xBFBF19B9, 0xBCC38A42 */
+/* tt = -(tail of tf) */
+tt  = -3.63867699703950536541e-18, /* 0xBC50C7CA, 0xA48A971F */
+t0  =  4.83836122723810047042e-01, /* 0x3FDEF72B, 0xC8EE38A2 */
+t1  = -1.47587722994593911752e-01, /* 0xBFC2E427, 0x8DC6C509 */
+t2  =  6.46249402391333854778e-02, /* 0x3FB08B42, 0x94D5419B */
+t3  = -3.27885410759859649565e-02, /* 0xBFA0C9A8, 0xDF35B713 */
+t4  =  1.79706750811820387126e-02, /* 0x3F9266E7, 0x970AF9EC */
+t5  = -1.03142241298341437450e-02, /* 0xBF851F9F, 0xBA91EC6A */
+t6  =  6.10053870246291332635e-03, /* 0x3F78FCE0, 0xE370E344 */
+t7  = -3.68452016781138256760e-03, /* 0xBF6E2EFF, 0xB3E914D7 */
+t8  =  2.25964780900612472250e-03, /* 0x3F6282D3, 0x2E15C915 */
+t9  = -1.40346469989232843813e-03, /* 0xBF56FE8E, 0xBF2D1AF1 */
+t10 =  8.81081882437654011382e-04, /* 0x3F4CDF0C, 0xEF61A8E9 */
+t11 = -5.38595305356740546715e-04, /* 0xBF41A610, 0x9C73E0EC */
+t12 =  3.15632070903625950361e-04, /* 0x3F34AF6D, 0x6C0EBBF7 */
+t13 = -3.12754168375120860518e-04, /* 0xBF347F24, 0xECC38C38 */
+t14 =  3.35529192635519073543e-04, /* 0x3F35FD3E, 0xE8C2D3F4 */
+u0  = -7.72156649015328655494e-02, /* 0xBFB3C467, 0xE37DB0C8 */
+u1  =  6.32827064025093366517e-01, /* 0x3FE4401E, 0x8B005DFF */
+u2  =  1.45492250137234768737e+00, /* 0x3FF7475C, 0xD119BD6F */
+u3  =  9.77717527963372745603e-01, /* 0x3FEF4976, 0x44EA8450 */
+u4  =  2.28963728064692451092e-01, /* 0x3FCD4EAE, 0xF6010924 */
+u5  =  1.33810918536787660377e-02, /* 0x3F8B678B, 0xBF2BAB09 */
+v1  =  2.45597793713041134822e+00, /* 0x4003A5D7, 0xC2BD619C */
+v2  =  2.12848976379893395361e+00, /* 0x40010725, 0xA42B18F5 */
+v3  =  7.69285150456672783825e-01, /* 0x3FE89DFB, 0xE45050AF */
+v4  =  1.04222645593369134254e-01, /* 0x3FBAAE55, 0xD6537C88 */
+v5  =  3.21709242282423911810e-03, /* 0x3F6A5ABB, 0x57D0CF61 */
+s0  = -7.72156649015328655494e-02, /* 0xBFB3C467, 0xE37DB0C8 */
+s1  =  2.14982415960608852501e-01, /* 0x3FCB848B, 0x36E20878 */
+s2  =  3.25778796408930981787e-01, /* 0x3FD4D98F, 0x4F139F59 */
+s3  =  1.46350472652464452805e-01, /* 0x3FC2BB9C, 0xBEE5F2F7 */
+s4  =  2.66422703033638609560e-02, /* 0x3F9B481C, 0x7E939961 */
+s5  =  1.84028451407337715652e-03, /* 0x3F5E26B6, 0x7368F239 */
+s6  =  3.19475326584100867617e-05, /* 0x3F00BFEC, 0xDD17E945 */
+r1  =  1.39200533467621045958e+00, /* 0x3FF645A7, 0x62C4AB74 */
+r2  =  7.21935547567138069525e-01, /* 0x3FE71A18, 0x93D3DCDC */
+r3  =  1.71933865632803078993e-01, /* 0x3FC601ED, 0xCCFBDF27 */
+r4  =  1.86459191715652901344e-02, /* 0x3F9317EA, 0x742ED475 */
+r5  =  7.77942496381893596434e-04, /* 0x3F497DDA, 0xCA41A95B */
+r6  =  7.32668430744625636189e-06, /* 0x3EDEBAF7, 0xA5B38140 */
+w0  =  4.18938533204672725052e-01, /* 0x3FDACFE3, 0x90C97D69 */
+w1  =  8.33333333333329678849e-02, /* 0x3FB55555, 0x5555553B */
+w2  = -2.77777777728775536470e-03, /* 0xBF66C16C, 0x16B02E5C */
+w3  =  7.93650558643019558500e-04, /* 0x3F4A019F, 0x98CF38B6 */
+w4  = -5.95187557450339963135e-04, /* 0xBF4380CB, 0x8C0FE741 */
+w5  =  8.36339918996282139126e-04, /* 0x3F4B67BA, 0x4CDAD5D1 */
+w6  = -1.63092934096575273989e-03; /* 0xBF5AB89D, 0x0B9E43E4 */
+
+static double zero=  0.00000000000000000000e+00;
+
+#ifdef __STDC__
+	static double sin_pi(double x)
+#else
+	static double sin_pi(x)
+	double x;
+#endif
+{
+        fd_twoints u;
+	double y,z;
+	int n,ix;
+
+        u.d = x;
+	ix = 0x7fffffff&__HI(u);
+
+	if(ix<0x3fd00000) return __kernel_sin(pi*x,zero,0);
+	y = -x;		/* x is assume negative */
+
+    /*
+     * argument reduction, make sure inexact flag not raised if input
+     * is an integer
+     */
+	z = fd_floor(y);
+	if(z!=y) {				/* inexact anyway */
+	    y  *= 0.5;
+	    y   = 2.0*(y - fd_floor(y));		/* y = |x| mod 2.0 */
+	    n   = (int) (y*4.0);
+	} else {
+            if(ix>=0x43400000) {
+                y = zero; n = 0;                 /* y must be even */
+            } else {
+                if(ix<0x43300000) z = y+two52;	/* exact */
+                u.d = z;
+                n   = __LO(u)&1;        /* lower word of z */
+                y  = n;
+                n<<= 2;
+            }
+        }
+	switch (n) {
+	    case 0:   y =  __kernel_sin(pi*y,zero,0); break;
+	    case 1:   
+	    case 2:   y =  __kernel_cos(pi*(0.5-y),zero); break;
+	    case 3:  
+	    case 4:   y =  __kernel_sin(pi*(one-y),zero,0); break;
+	    case 5:
+	    case 6:   y = -__kernel_cos(pi*(y-1.5),zero); break;
+	    default:  y =  __kernel_sin(pi*(y-2.0),zero,0); break;
+	    }
+	return -y;
+}
+
+
+#ifdef __STDC__
+	double __ieee754_lgamma_r(double x, int *signgamp)
+#else
+	double __ieee754_lgamma_r(x,signgamp)
+	double x; int *signgamp;
+#endif
+{
+        fd_twoints u;
+	double t,y,z,nadj,p,p1,p2,p3,q,r,w;
+	int i,hx,lx,ix;
+
+        u.d = x;
+	hx = __HI(u);
+	lx = __LO(u);
+
+    /* purge off +-inf, NaN, +-0, and negative arguments */
+	*signgamp = 1;
+	ix = hx&0x7fffffff;
+	if(ix>=0x7ff00000) return x*x;
+	if((ix|lx)==0) return one/zero;
+	if(ix<0x3b900000) {	/* |x|<2**-70, return -log(|x|) */
+	    if(hx<0) {
+	        *signgamp = -1;
+	        return -__ieee754_log(-x);
+	    } else return -__ieee754_log(x);
+	}
+	if(hx<0) {
+	    if(ix>=0x43300000) 	/* |x|>=2**52, must be -integer */
+		return one/zero;
+	    t = sin_pi(x);
+	    if(t==zero) return one/zero; /* -integer */
+	    nadj = __ieee754_log(pi/fd_fabs(t*x));
+	    if(t<zero) *signgamp = -1;
+	    x = -x;
+	}
+
+    /* purge off 1 and 2 */
+	if((((ix-0x3ff00000)|lx)==0)||(((ix-0x40000000)|lx)==0)) r = 0;
+    /* for x < 2.0 */
+	else if(ix<0x40000000) {
+	    if(ix<=0x3feccccc) { 	/* lgamma(x) = lgamma(x+1)-log(x) */
+		r = -__ieee754_log(x);
+		if(ix>=0x3FE76944) {y = one-x; i= 0;}
+		else if(ix>=0x3FCDA661) {y= x-(tc-one); i=1;}
+	  	else {y = x; i=2;}
+	    } else {
+	  	r = zero;
+	        if(ix>=0x3FFBB4C3) {y=2.0-x;i=0;} /* [1.7316,2] */
+	        else if(ix>=0x3FF3B4C4) {y=x-tc;i=1;} /* [1.23,1.73] */
+		else {y=x-one;i=2;}
+	    }
+	    switch(i) {
+	      case 0:
+		z = y*y;
+		p1 = a0+z*(a2+z*(a4+z*(a6+z*(a8+z*a10))));
+		p2 = z*(a1+z*(a3+z*(a5+z*(a7+z*(a9+z*a11)))));
+		p  = y*p1+p2;
+		r  += (p-0.5*y); break;
+	      case 1:
+		z = y*y;
+		w = z*y;
+		p1 = t0+w*(t3+w*(t6+w*(t9 +w*t12)));	/* parallel comp */
+		p2 = t1+w*(t4+w*(t7+w*(t10+w*t13)));
+		p3 = t2+w*(t5+w*(t8+w*(t11+w*t14)));
+		p  = z*p1-(tt-w*(p2+y*p3));
+		r += (tf + p); break;
+	      case 2:	
+		p1 = y*(u0+y*(u1+y*(u2+y*(u3+y*(u4+y*u5)))));
+		p2 = one+y*(v1+y*(v2+y*(v3+y*(v4+y*v5))));
+		r += (-0.5*y + p1/p2);
+	    }
+	}
+	else if(ix<0x40200000) { 			/* x < 8.0 */
+	    i = (int)x;
+	    t = zero;
+	    y = x-(double)i;
+	    p = y*(s0+y*(s1+y*(s2+y*(s3+y*(s4+y*(s5+y*s6))))));
+	    q = one+y*(r1+y*(r2+y*(r3+y*(r4+y*(r5+y*r6)))));
+	    r = half*y+p/q;
+	    z = one;	/* lgamma(1+s) = log(s) + lgamma(s) */
+	    switch(i) {
+	    case 7: z *= (y+6.0);	/* FALLTHRU */
+	    case 6: z *= (y+5.0);	/* FALLTHRU */
+	    case 5: z *= (y+4.0);	/* FALLTHRU */
+	    case 4: z *= (y+3.0);	/* FALLTHRU */
+	    case 3: z *= (y+2.0);	/* FALLTHRU */
+		    r += __ieee754_log(z); break;
+	    }
+    /* 8.0 <= x < 2**58 */
+	} else if (ix < 0x43900000) {
+	    t = __ieee754_log(x);
+	    z = one/x;
+	    y = z*z;
+	    w = w0+z*(w1+y*(w2+y*(w3+y*(w4+y*(w5+y*w6)))));
+	    r = (x-half)*(t-one)+w;
+	} else 
+    /* 2**58 <= x <= inf */
+	    r =  x*(__ieee754_log(x)-one);
+	if(hx<0) r = nadj - r;
+	return r;
+}

mozilla/js/src/fdlibm/e_log.c

@@ -0,0 +1,184 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * ***** BEGIN LICENSE BLOCK *****
+ * Version: MPL 1.1/GPL 2.0/LGPL 2.1
+ *
+ * The contents of this file are subject to the Mozilla Public License Version
+ * 1.1 (the "License"); you may not use this file except in compliance with
+ * the License. You may obtain a copy of the License at
+ * http://www.mozilla.org/MPL/
+ *
+ * Software distributed under the License is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+ * for the specific language governing rights and limitations under the
+ * License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is
+ * Sun Microsystems, Inc.
+ * Portions created by the Initial Developer are Copyright (C) 1998
+ * the Initial Developer. All Rights Reserved.
+ *
+ * Contributor(s):
+ *
+ * Alternatively, the contents of this file may be used under the terms of
+ * either of the GNU General Public License Version 2 or later (the "GPL"),
+ * or the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+ * in which case the provisions of the GPL or the LGPL are applicable instead
+ * of those above. If you wish to allow use of your version of this file only
+ * under the terms of either the GPL or the LGPL, and not to allow others to
+ * use your version of this file under the terms of the MPL, indicate your
+ * decision by deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL or the LGPL. If you do not delete
+ * the provisions above, a recipient may use your version of this file under
+ * the terms of any one of the MPL, the GPL or the LGPL.
+ *
+ * ***** END LICENSE BLOCK ***** */
+
+/* @(#)e_log.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* __ieee754_log(x)
+ * Return the logrithm of x
+ *
+ * Method :                  
+ *   1. Argument Reduction: find k and f such that 
+ *			x = 2^k * (1+f), 
+ *	   where  sqrt(2)/2 < 1+f < sqrt(2) .
+ *
+ *   2. Approximation of log(1+f).
+ *	Let s = f/(2+f) ; based on log(1+f) = log(1+s) - log(1-s)
+ *		 = 2s + 2/3 s**3 + 2/5 s**5 + .....,
+ *	     	 = 2s + s*R
+ *      We use a special Reme algorithm on [0,0.1716] to generate 
+ * 	a polynomial of degree 14 to approximate R The maximum error 
+ *	of this polynomial approximation is bounded by 2**-58.45. In
+ *	other words,
+ *		        2      4      6      8      10      12      14
+ *	    R(z) ~ Lg1*s +Lg2*s +Lg3*s +Lg4*s +Lg5*s  +Lg6*s  +Lg7*s
+ *  	(the values of Lg1 to Lg7 are listed in the program)
+ *	and
+ *	    |      2          14          |     -58.45
+ *	    | Lg1*s +...+Lg7*s    -  R(z) | <= 2 
+ *	    |                             |
+ *	Note that 2s = f - s*f = f - hfsq + s*hfsq, where hfsq = f*f/2.
+ *	In order to guarantee error in log below 1ulp, we compute log
+ *	by
+ *		log(1+f) = f - s*(f - R)	(if f is not too large)
+ *		log(1+f) = f - (hfsq - s*(hfsq+R)).	(better accuracy)
+ *	
+ *	3. Finally,  log(x) = k*ln2 + log(1+f).  
+ *			    = k*ln2_hi+(f-(hfsq-(s*(hfsq+R)+k*ln2_lo)))
+ *	   Here ln2 is split into two floating point number: 
+ *			ln2_hi + ln2_lo,
+ *	   where n*ln2_hi is always exact for |n| < 2000.
+ *
+ * Special cases:
+ *	log(x) is NaN with signal if x < 0 (including -INF) ; 
+ *	log(+INF) is +INF; log(0) is -INF with signal;
+ *	log(NaN) is that NaN with no signal.
+ *
+ * Accuracy:
+ *	according to an error analysis, the error is always less than
+ *	1 ulp (unit in the last place).
+ *
+ * Constants:
+ * The hexadecimal values are the intended ones for the following 
+ * constants. The decimal values may be used, provided that the 
+ * compiler will convert from decimal to binary accurately enough 
+ * to produce the hexadecimal values shown.
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double
+#else
+static double
+#endif
+ln2_hi  =  6.93147180369123816490e-01,	/* 3fe62e42 fee00000 */
+ln2_lo  =  1.90821492927058770002e-10,	/* 3dea39ef 35793c76 */
+two54   =  1.80143985094819840000e+16,  /* 43500000 00000000 */
+Lg1 = 6.666666666666735130e-01,  /* 3FE55555 55555593 */
+Lg2 = 3.999999999940941908e-01,  /* 3FD99999 9997FA04 */
+Lg3 = 2.857142874366239149e-01,  /* 3FD24924 94229359 */
+Lg4 = 2.222219843214978396e-01,  /* 3FCC71C5 1D8E78AF */
+Lg5 = 1.818357216161805012e-01,  /* 3FC74664 96CB03DE */
+Lg6 = 1.531383769920937332e-01,  /* 3FC39A09 D078C69F */
+Lg7 = 1.479819860511658591e-01;  /* 3FC2F112 DF3E5244 */
+
+static double zero   =  0.0;
+
+#ifdef __STDC__
+	double __ieee754_log(double x)
+#else
+	double __ieee754_log(x)
+	double x;
+#endif
+{
+        fd_twoints u;
+	double hfsq,f,s,z,R,w,t1,t2,dk;
+	int k,hx,i,j;
+	unsigned lx;
+
+        u.d = x;
+	hx = __HI(u);		/* high word of x */
+	lx = __LO(u);		/* low  word of x */
+
+	k=0;
+	if (hx < 0x00100000) {			/* x < 2**-1022  */
+	    if (((hx&0x7fffffff)|lx)==0) 
+		return -two54/zero;		/* log(+-0)=-inf */
+	    if (hx<0) return (x-x)/zero;	/* log(-#) = NaN */
+	    k -= 54; x *= two54; /* subnormal number, scale up x */
+            u.d = x;
+	    hx = __HI(u);		/* high word of x */
+	} 
+	if (hx >= 0x7ff00000) return x+x;
+	k += (hx>>20)-1023;
+	hx &= 0x000fffff;
+	i = (hx+0x95f64)&0x100000;
+        u.d = x;
+	__HI(u) = hx|(i^0x3ff00000);	/* normalize x or x/2 */
+        x = u.d;
+	k += (i>>20);
+	f = x-1.0;
+	if((0x000fffff&(2+hx))<3) {	/* |f| < 2**-20 */
+	    if(f==zero) { 
+                if(k==0) return zero; else {dk=(double)k;
+                                            return dk*ln2_hi+dk*ln2_lo;} 
+            }
+	    R = f*f*(0.5-0.33333333333333333*f);
+	    if(k==0) return f-R; else {dk=(double)k;
+	    	     return dk*ln2_hi-((R-dk*ln2_lo)-f);}
+	}
+ 	s = f/(2.0+f); 
+	dk = (double)k;
+	z = s*s;
+	i = hx-0x6147a;
+	w = z*z;
+	j = 0x6b851-hx;
+	t1= w*(Lg2+w*(Lg4+w*Lg6)); 
+	t2= z*(Lg1+w*(Lg3+w*(Lg5+w*Lg7))); 
+	i |= j;
+	R = t2+t1;
+	if(i>0) {
+	    hfsq=0.5*f*f;
+	    if(k==0) return f-(hfsq-s*(hfsq+R)); else
+		     return dk*ln2_hi-((hfsq-(s*(hfsq+R)+dk*ln2_lo))-f);
+	} else {
+	    if(k==0) return f-s*(f-R); else
+		     return dk*ln2_hi-((s*(f-R)-dk*ln2_lo)-f);
+	}
+}

mozilla/js/src/fdlibm/e_log10.c

@@ -0,0 +1,134 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * ***** BEGIN LICENSE BLOCK *****
+ * Version: MPL 1.1/GPL 2.0/LGPL 2.1
+ *
+ * The contents of this file are subject to the Mozilla Public License Version
+ * 1.1 (the "License"); you may not use this file except in compliance with
+ * the License. You may obtain a copy of the License at
+ * http://www.mozilla.org/MPL/
+ *
+ * Software distributed under the License is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+ * for the specific language governing rights and limitations under the
+ * License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is
+ * Sun Microsystems, Inc.
+ * Portions created by the Initial Developer are Copyright (C) 1998
+ * the Initial Developer. All Rights Reserved.
+ *
+ * Contributor(s):
+ *
+ * Alternatively, the contents of this file may be used under the terms of
+ * either of the GNU General Public License Version 2 or later (the "GPL"),
+ * or the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+ * in which case the provisions of the GPL or the LGPL are applicable instead
+ * of those above. If you wish to allow use of your version of this file only
+ * under the terms of either the GPL or the LGPL, and not to allow others to
+ * use your version of this file under the terms of the MPL, indicate your
+ * decision by deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL or the LGPL. If you do not delete
+ * the provisions above, a recipient may use your version of this file under
+ * the terms of any one of the MPL, the GPL or the LGPL.
+ *
+ * ***** END LICENSE BLOCK ***** */
+
+/* @(#)e_log10.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* __ieee754_log10(x)
+ * Return the base 10 logarithm of x
+ * 
+ * Method :
+ *	Let log10_2hi = leading 40 bits of log10(2) and
+ *	    log10_2lo = log10(2) - log10_2hi,
+ *	    ivln10   = 1/log(10) rounded.
+ *	Then
+ *		n = ilogb(x), 
+ *		if(n<0)  n = n+1;
+ *		x = scalbn(x,-n);
+ *		log10(x) := n*log10_2hi + (n*log10_2lo + ivln10*log(x))
+ *
+ * Note 1:
+ *	To guarantee log10(10**n)=n, where 10**n is normal, the rounding 
+ *	mode must set to Round-to-Nearest.
+ * Note 2:
+ *	[1/log(10)] rounded to 53 bits has error  .198   ulps;
+ *	log10 is monotonic at all binary break points.
+ *
+ * Special cases:
+ *	log10(x) is NaN with signal if x < 0; 
+ *	log10(+INF) is +INF with no signal; log10(0) is -INF with signal;
+ *	log10(NaN) is that NaN with no signal;
+ *	log10(10**N) = N  for N=0,1,...,22.
+ *
+ * Constants:
+ * The hexadecimal values are the intended ones for the following constants.
+ * The decimal values may be used, provided that the compiler will convert
+ * from decimal to binary accurately enough to produce the hexadecimal values
+ * shown.
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double
+#else
+static double
+#endif
+two54      =  1.80143985094819840000e+16, /* 0x43500000, 0x00000000 */
+ivln10     =  4.34294481903251816668e-01, /* 0x3FDBCB7B, 0x1526E50E */
+log10_2hi  =  3.01029995663611771306e-01, /* 0x3FD34413, 0x509F6000 */
+log10_2lo  =  3.69423907715893078616e-13; /* 0x3D59FEF3, 0x11F12B36 */
+
+static double zero   =  0.0;
+
+#ifdef __STDC__
+	double __ieee754_log10(double x)
+#else
+	double __ieee754_log10(x)
+	double x;
+#endif
+{
+        fd_twoints u;
+	double y,z;
+	int i,k,hx;
+	unsigned lx;
+
+        u.d = x;
+	hx = __HI(u);	/* high word of x */
+	lx = __LO(u);	/* low word of x */
+
+        k=0;
+        if (hx < 0x00100000) {                  /* x < 2**-1022  */
+            if (((hx&0x7fffffff)|lx)==0)
+                return -two54/zero;             /* log(+-0)=-inf */
+            if (hx<0) return (x-x)/zero;        /* log(-#) = NaN */
+            k -= 54; x *= two54; /* subnormal number, scale up x */
+            u.d = x;
+            hx = __HI(u);                /* high word of x */
+        }
+	if (hx >= 0x7ff00000) return x+x;
+	k += (hx>>20)-1023;
+	i  = ((unsigned)k&0x80000000)>>31;
+        hx = (hx&0x000fffff)|((0x3ff-i)<<20);
+        y  = (double)(k+i);
+        u.d = x;
+        __HI(u) = hx;
+        x = u.d;
+	z  = y*log10_2lo + ivln10*__ieee754_log(x);
+	return  z+y*log10_2hi;
+}

mozilla/js/src/fdlibm/e_pow.c

@@ -0,0 +1,386 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * ***** BEGIN LICENSE BLOCK *****
+ * Version: MPL 1.1/GPL 2.0/LGPL 2.1
+ *
+ * The contents of this file are subject to the Mozilla Public License Version
+ * 1.1 (the "License"); you may not use this file except in compliance with
+ * the License. You may obtain a copy of the License at
+ * http://www.mozilla.org/MPL/
+ *
+ * Software distributed under the License is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+ * for the specific language governing rights and limitations under the
+ * License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is
+ * Sun Microsystems, Inc.
+ * Portions created by the Initial Developer are Copyright (C) 1998
+ * the Initial Developer. All Rights Reserved.
+ *
+ * Contributor(s):
+ *
+ * Alternatively, the contents of this file may be used under the terms of
+ * either of the GNU General Public License Version 2 or later (the "GPL"),
+ * or the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+ * in which case the provisions of the GPL or the LGPL are applicable instead
+ * of those above. If you wish to allow use of your version of this file only
+ * under the terms of either the GPL or the LGPL, and not to allow others to
+ * use your version of this file under the terms of the MPL, indicate your
+ * decision by deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL or the LGPL. If you do not delete
+ * the provisions above, a recipient may use your version of this file under
+ * the terms of any one of the MPL, the GPL or the LGPL.
+ *
+ * ***** END LICENSE BLOCK ***** */
+
+/* @(#)e_pow.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* __ieee754_pow(x,y) return x**y
+ *
+ *		      n
+ * Method:  Let x =  2   * (1+f)
+ *	1. Compute and return log2(x) in two pieces:
+ *		log2(x) = w1 + w2,
+ *	   where w1 has 53-24 = 29 bit trailing zeros.
+ *	2. Perform y*log2(x) = n+y' by simulating muti-precision 
+ *	   arithmetic, where |y'|<=0.5.
+ *	3. Return x**y = 2**n*exp(y'*log2)
+ *
+ * Special cases:
+ *	1.  (anything) ** 0  is 1
+ *	2.  (anything) ** 1  is itself
+ *	3.  (anything) ** NAN is NAN
+ *	4.  NAN ** (anything except 0) is NAN
+ *	5.  +-(|x| > 1) **  +INF is +INF
+ *	6.  +-(|x| > 1) **  -INF is +0
+ *	7.  +-(|x| < 1) **  +INF is +0
+ *	8.  +-(|x| < 1) **  -INF is +INF
+ *	9.  +-1         ** +-INF is NAN
+ *	10. +0 ** (+anything except 0, NAN)               is +0
+ *	11. -0 ** (+anything except 0, NAN, odd integer)  is +0
+ *	12. +0 ** (-anything except 0, NAN)               is +INF
+ *	13. -0 ** (-anything except 0, NAN, odd integer)  is +INF
+ *	14. -0 ** (odd integer) = -( +0 ** (odd integer) )
+ *	15. +INF ** (+anything except 0,NAN) is +INF
+ *	16. +INF ** (-anything except 0,NAN) is +0
+ *	17. -INF ** (anything)  = -0 ** (-anything)
+ *	18. (-anything) ** (integer) is (-1)**(integer)*(+anything**integer)
+ *	19. (-anything except 0 and inf) ** (non-integer) is NAN
+ *
+ * Accuracy:
+ *	pow(x,y) returns x**y nearly rounded. In particular
+ *			pow(integer,integer)
+ *	always returns the correct integer provided it is 
+ *	representable.
+ *
+ * Constants :
+ * The hexadecimal values are the intended ones for the following 
+ * constants. The decimal values may be used, provided that the 
+ * compiler will convert from decimal to binary accurately enough 
+ * to produce the hexadecimal values shown.
+ */
+
+#include "fdlibm.h"
+
+#if defined(_MSC_VER)
+/* Microsoft Compiler */
+#pragma warning( disable : 4723 ) /* disables potential divide by 0 warning */
+#endif
+
+#ifdef __STDC__
+static const double 
+#else
+static double 
+#endif
+bp[] = {1.0, 1.5,},
+dp_h[] = { 0.0, 5.84962487220764160156e-01,}, /* 0x3FE2B803, 0x40000000 */
+dp_l[] = { 0.0, 1.35003920212974897128e-08,}, /* 0x3E4CFDEB, 0x43CFD006 */
+zero    =  0.0,
+one	=  1.0,
+two	=  2.0,
+two53	=  9007199254740992.0,	/* 0x43400000, 0x00000000 */
+really_big	=  1.0e300,
+tiny    =  1.0e-300,
+	/* poly coefs for (3/2)*(log(x)-2s-2/3*s**3 */
+L1  =  5.99999999999994648725e-01, /* 0x3FE33333, 0x33333303 */
+L2  =  4.28571428578550184252e-01, /* 0x3FDB6DB6, 0xDB6FABFF */
+L3  =  3.33333329818377432918e-01, /* 0x3FD55555, 0x518F264D */
+L4  =  2.72728123808534006489e-01, /* 0x3FD17460, 0xA91D4101 */
+L5  =  2.30660745775561754067e-01, /* 0x3FCD864A, 0x93C9DB65 */
+L6  =  2.06975017800338417784e-01, /* 0x3FCA7E28, 0x4A454EEF */
+P1   =  1.66666666666666019037e-01, /* 0x3FC55555, 0x5555553E */
+P2   = -2.77777777770155933842e-03, /* 0xBF66C16C, 0x16BEBD93 */
+P3   =  6.61375632143793436117e-05, /* 0x3F11566A, 0xAF25DE2C */
+P4   = -1.65339022054652515390e-06, /* 0xBEBBBD41, 0xC5D26BF1 */
+P5   =  4.13813679705723846039e-08, /* 0x3E663769, 0x72BEA4D0 */
+lg2  =  6.93147180559945286227e-01, /* 0x3FE62E42, 0xFEFA39EF */
+lg2_h  =  6.93147182464599609375e-01, /* 0x3FE62E43, 0x00000000 */
+lg2_l  = -1.90465429995776804525e-09, /* 0xBE205C61, 0x0CA86C39 */
+ovt =  8.0085662595372944372e-0017, /* -(1024-log2(ovfl+.5ulp)) */
+cp    =  9.61796693925975554329e-01, /* 0x3FEEC709, 0xDC3A03FD =2/(3ln2) */
+cp_h  =  9.61796700954437255859e-01, /* 0x3FEEC709, 0xE0000000 =(float)cp */
+cp_l  = -7.02846165095275826516e-09, /* 0xBE3E2FE0, 0x145B01F5 =tail of cp_h*/
+ivln2    =  1.44269504088896338700e+00, /* 0x3FF71547, 0x652B82FE =1/ln2 */
+ivln2_h  =  1.44269502162933349609e+00, /* 0x3FF71547, 0x60000000 =24b 1/ln2*/
+ivln2_l  =  1.92596299112661746887e-08; /* 0x3E54AE0B, 0xF85DDF44 =1/ln2 tail*/
+
+#ifdef __STDC__
+	double __ieee754_pow(double x, double y)
+#else
+	double __ieee754_pow(x,y)
+	double x, y;
+#endif
+{
+        fd_twoints ux, uy, uz;
+        double y1,t1,p_h,t,z,ax;
+	double z_h,z_l,p_l;
+	double t2,r,s,u,v,w;
+	int i,j,k,yisint,n;
+	int hx,hy,ix,iy;
+	unsigned lx,ly;
+
+        ux.d = x; uy.d = y;
+	hx = __HI(ux); lx = __LO(ux);
+	hy = __HI(uy); ly = __LO(uy);
+	ix = hx&0x7fffffff;  iy = hy&0x7fffffff;
+
+    /* y==zero: x**0 = 1 */
+	if((iy|ly)==0) return one; 	
+
+    /* +-NaN return x+y */
+	if(ix > 0x7ff00000 || ((ix==0x7ff00000)&&(lx!=0)) ||
+	   iy > 0x7ff00000 || ((iy==0x7ff00000)&&(ly!=0))) 
+		return x+y;	
+
+    /* determine if y is an odd int when x < 0
+     * yisint = 0	... y is not an integer
+     * yisint = 1	... y is an odd int
+     * yisint = 2	... y is an even int
+     */
+	yisint  = 0;
+	if(hx<0) {	
+	    if(iy>=0x43400000) yisint = 2; /* even integer y */
+	    else if(iy>=0x3ff00000) {
+		k = (iy>>20)-0x3ff;	   /* exponent */
+		if(k>20) {
+		    j = ly>>(52-k);
+		    if((j<<(52-k))==(int)ly) yisint = 2-(j&1);
+		} else if(ly==0) {
+		    j = iy>>(20-k);
+		    if((j<<(20-k))==iy) yisint = 2-(j&1);
+		}
+	    }		
+	} 
+
+    /* special value of y */
+	if(ly==0) { 	
+	    if (iy==0x7ff00000) {	/* y is +-inf */
+	        if(((ix-0x3ff00000)|lx)==0)
+#ifdef _WIN32
+/* VC++ optimizer reduces y - y to 0 */ 
+                    return y / y;
+#else
+		    return  y - y;	/* inf**+-1 is NaN */
+#endif
+	        else if (ix >= 0x3ff00000)/* (|x|>1)**+-inf = inf,0 */
+		    return (hy>=0)? y: zero;
+	        else			/* (|x|<1)**-,+inf = inf,0 */
+		    return (hy<0)?-y: zero;
+	    } 
+	    if(iy==0x3ff00000) {	/* y is  +-1 */
+		if(hy<0) return one/x; else return x;
+	    }
+	    if(hy==0x40000000) return x*x; /* y is  2 */
+	    if(hy==0x3fe00000) {	/* y is  0.5 */
+		if(hx>=0)	/* x >= +0 */
+		return fd_sqrt(x);	
+	    }
+	}
+
+	ax   = fd_fabs(x);
+    /* special value of x */
+	if(lx==0) {
+	    if(ix==0x7ff00000||ix==0||ix==0x3ff00000){
+		z = ax;			/*x is +-0,+-inf,+-1*/
+		if(hy<0) z = one/z;	/* z = (1/|x|) */
+		if(hx<0) {
+		    if(((ix-0x3ff00000)|yisint)==0) {
+			z = (z-z)/(z-z); /* (-1)**non-int is NaN */
+		    } else if(yisint==1) {
+#ifdef HPUX
+                        uz.d = z;
+			__HI(uz) ^= 1<<31; /* some HPUXes cannot negate 0.. */
+                        z = uz.d;
+#else
+			z = -z;		/* (x<0)**odd = -(|x|**odd) */
+#endif
+			}
+		}
+		return z;
+	    }
+	}
+    
+    /* (x<0)**(non-int) is NaN */
+	if((((hx>>31)+1)|yisint)==0) return (x-x)/(x-x);
+
+    /* |y| is really_big */
+	if(iy>0x41e00000) { /* if |y| > 2**31 */
+	    if(iy>0x43f00000){	/* if |y| > 2**64, must o/uflow */
+		if(ix<=0x3fefffff) return (hy<0)? really_big*really_big:tiny*tiny;
+		if(ix>=0x3ff00000) return (hy>0)? really_big*really_big:tiny*tiny;
+	    }
+	/* over/underflow if x is not close to one */
+	    if(ix<0x3fefffff) return (hy<0)? really_big*really_big:tiny*tiny;
+	    if(ix>0x3ff00000) return (hy>0)? really_big*really_big:tiny*tiny;
+	/* now |1-x| is tiny <= 2**-20, suffice to compute 
+	   log(x) by x-x^2/2+x^3/3-x^4/4 */
+	    t = x-1;		/* t has 20 trailing zeros */
+	    w = (t*t)*(0.5-t*(0.3333333333333333333333-t*0.25));
+	    u = ivln2_h*t;	/* ivln2_h has 21 sig. bits */
+	    v = t*ivln2_l-w*ivln2;
+	    t1 = u+v;
+            uz.d = t1;
+	    __LO(uz) = 0;
+            t1 = uz.d;
+	    t2 = v-(t1-u);
+	} else {
+	    double s_h,t_h;
+	    double s2,s_l,t_l;
+	    n = 0;
+	/* take care subnormal number */
+	    if(ix<0x00100000) 
+		{ax *= two53; n -= 53; uz.d = ax; ix = __HI(uz); }
+	    n  += ((ix)>>20)-0x3ff;
+	    j  = ix&0x000fffff;
+	/* determine interval */
+	    ix = j|0x3ff00000;		/* normalize ix */
+	    if(j<=0x3988E) k=0;		/* |x|<sqrt(3/2) */
+	    else if(j<0xBB67A) k=1;	/* |x|<sqrt(3)   */
+	    else {k=0;n+=1;ix -= 0x00100000;}
+            uz.d = ax;
+	    __HI(uz) = ix;
+            ax = uz.d;
+
+	/* compute s = s_h+s_l = (x-1)/(x+1) or (x-1.5)/(x+1.5) */
+	    u = ax-bp[k];		/* bp[0]=1.0, bp[1]=1.5 */
+	    v = one/(ax+bp[k]);
+	    s = u*v;
+	    s_h = s;
+            uz.d = s_h;
+	    __LO(uz) = 0;
+            s_h = uz.d;
+	/* t_h=ax+bp[k] High */
+	    t_h = zero;
+            uz.d = t_h;
+	    __HI(uz)=((ix>>1)|0x20000000)+0x00080000+(k<<18); 
+            t_h = uz.d;
+	    t_l = ax - (t_h-bp[k]);
+	    s_l = v*((u-s_h*t_h)-s_h*t_l);
+	/* compute log(ax) */
+	    s2 = s*s;
+	    r = s2*s2*(L1+s2*(L2+s2*(L3+s2*(L4+s2*(L5+s2*L6)))));
+	    r += s_l*(s_h+s);
+	    s2  = s_h*s_h;
+	    t_h = 3.0+s2+r;
+            uz.d = t_h;
+	    __LO(uz) = 0;
+            t_h = uz.d;
+	    t_l = r-((t_h-3.0)-s2);
+	/* u+v = s*(1+...) */
+	    u = s_h*t_h;
+	    v = s_l*t_h+t_l*s;
+	/* 2/(3log2)*(s+...) */
+	    p_h = u+v;
+            uz.d = p_h;
+	    __LO(uz) = 0;
+            p_h = uz.d;
+	    p_l = v-(p_h-u);
+	    z_h = cp_h*p_h;		/* cp_h+cp_l = 2/(3*log2) */
+	    z_l = cp_l*p_h+p_l*cp+dp_l[k];
+	/* log2(ax) = (s+..)*2/(3*log2) = n + dp_h + z_h + z_l */
+	    t = (double)n;
+	    t1 = (((z_h+z_l)+dp_h[k])+t);
+            uz.d = t1;
+	    __LO(uz) = 0;
+            t1 = uz.d;
+	    t2 = z_l-(((t1-t)-dp_h[k])-z_h);
+	}
+
+	s = one; /* s (sign of result -ve**odd) = -1 else = 1 */
+	if((((hx>>31)+1)|(yisint-1))==0) s = -one;/* (-ve)**(odd int) */
+
+    /* split up y into y1+y2 and compute (y1+y2)*(t1+t2) */
+	y1  = y;
+        uy.d = y1;
+	__LO(uy) = 0;
+        y1 = uy.d;
+	p_l = (y-y1)*t1+y*t2;
+	p_h = y1*t1;
+	z = p_l+p_h;
+        uz.d = z;
+	j = __HI(uz);
+	i = __LO(uz);
+
+	if (j>=0x40900000) {				/* z >= 1024 */
+	    if(((j-0x40900000)|i)!=0)			/* if z > 1024 */
+		return s*really_big*really_big;			/* overflow */
+	    else {
+		if(p_l+ovt>z-p_h) return s*really_big*really_big;	/* overflow */
+	    }
+	} else if((j&0x7fffffff)>=0x4090cc00 ) {	/* z <= -1075 */
+	    if(((j-0xc090cc00)|i)!=0) 		/* z < -1075 */
+		return s*tiny*tiny;		/* underflow */
+	    else {
+		if(p_l<=z-p_h) return s*tiny*tiny;	/* underflow */
+	    }
+	}
+    /*
+     * compute 2**(p_h+p_l)
+     */
+	i = j&0x7fffffff;
+	k = (i>>20)-0x3ff;
+	n = 0;
+	if(i>0x3fe00000) {		/* if |z| > 0.5, set n = [z+0.5] */
+	    n = j+(0x00100000>>(k+1));
+	    k = ((n&0x7fffffff)>>20)-0x3ff;	/* new k for n */
+	    t = zero;
+            uz.d = t;
+	    __HI(uz) = (n&~(0x000fffff>>k));
+            t = uz.d;
+	    n = ((n&0x000fffff)|0x00100000)>>(20-k);
+	    if(j<0) n = -n;
+	    p_h -= t;
+	} 
+	t = p_l+p_h;
+        uz.d = t;
+	__LO(uz) = 0;
+        t = uz.d;
+	u = t*lg2_h;
+	v = (p_l-(t-p_h))*lg2+t*lg2_l;
+	z = u+v;
+	w = v-(z-u);
+	t  = z*z;
+	t1  = z - t*(P1+t*(P2+t*(P3+t*(P4+t*P5))));
+	r  = (z*t1)/(t1-two)-(w+z*w);
+	z  = one-(r-z);
+        uz.d = z;
+	j  = __HI(uz);
+	j += (n<<20);
+	if((j>>20)<=0) z = fd_scalbn(z,n);	/* subnormal output */
+	else { uz.d = z; __HI(uz) += (n<<20); z = uz.d; }
+	return s*z;
+}

mozilla/js/src/fdlibm/e_rem_pio2.c

@@ -0,0 +1,221 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * ***** BEGIN LICENSE BLOCK *****
+ * Version: MPL 1.1/GPL 2.0/LGPL 2.1
+ *
+ * The contents of this file are subject to the Mozilla Public License Version
+ * 1.1 (the "License"); you may not use this file except in compliance with
+ * the License. You may obtain a copy of the License at
+ * http://www.mozilla.org/MPL/
+ *
+ * Software distributed under the License is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+ * for the specific language governing rights and limitations under the
+ * License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is
+ * Sun Microsystems, Inc.
+ * Portions created by the Initial Developer are Copyright (C) 1998
+ * the Initial Developer. All Rights Reserved.
+ *
+ * Contributor(s):
+ *
+ * Alternatively, the contents of this file may be used under the terms of
+ * either of the GNU General Public License Version 2 or later (the "GPL"),
+ * or the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+ * in which case the provisions of the GPL or the LGPL are applicable instead
+ * of those above. If you wish to allow use of your version of this file only
+ * under the terms of either the GPL or the LGPL, and not to allow others to
+ * use your version of this file under the terms of the MPL, indicate your
+ * decision by deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL or the LGPL. If you do not delete
+ * the provisions above, a recipient may use your version of this file under
+ * the terms of any one of the MPL, the GPL or the LGPL.
+ *
+ * ***** END LICENSE BLOCK ***** */
+
+/* @(#)e_rem_pio2.c 1.4 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ *
+ */
+
+/* __ieee754_rem_pio2(x,y)
+ * 
+ * return the remainder of x rem pi/2 in y[0]+y[1] 
+ * use __kernel_rem_pio2()
+ */
+
+#include "fdlibm.h"
+
+/*
+ * Table of constants for 2/pi, 396 Hex digits (476 decimal) of 2/pi 
+ */
+#ifdef __STDC__
+static const int two_over_pi[] = {
+#else
+static int two_over_pi[] = {
+#endif
+0xA2F983, 0x6E4E44, 0x1529FC, 0x2757D1, 0xF534DD, 0xC0DB62, 
+0x95993C, 0x439041, 0xFE5163, 0xABDEBB, 0xC561B7, 0x246E3A, 
+0x424DD2, 0xE00649, 0x2EEA09, 0xD1921C, 0xFE1DEB, 0x1CB129, 
+0xA73EE8, 0x8235F5, 0x2EBB44, 0x84E99C, 0x7026B4, 0x5F7E41, 
+0x3991D6, 0x398353, 0x39F49C, 0x845F8B, 0xBDF928, 0x3B1FF8, 
+0x97FFDE, 0x05980F, 0xEF2F11, 0x8B5A0A, 0x6D1F6D, 0x367ECF, 
+0x27CB09, 0xB74F46, 0x3F669E, 0x5FEA2D, 0x7527BA, 0xC7EBE5, 
+0xF17B3D, 0x0739F7, 0x8A5292, 0xEA6BFB, 0x5FB11F, 0x8D5D08, 
+0x560330, 0x46FC7B, 0x6BABF0, 0xCFBC20, 0x9AF436, 0x1DA9E3, 
+0x91615E, 0xE61B08, 0x659985, 0x5F14A0, 0x68408D, 0xFFD880, 
+0x4D7327, 0x310606, 0x1556CA, 0x73A8C9, 0x60E27B, 0xC08C6B, 
+};
+
+#ifdef __STDC__
+static const int npio2_hw[] = {
+#else
+static int npio2_hw[] = {
+#endif
+0x3FF921FB, 0x400921FB, 0x4012D97C, 0x401921FB, 0x401F6A7A, 0x4022D97C,
+0x4025FDBB, 0x402921FB, 0x402C463A, 0x402F6A7A, 0x4031475C, 0x4032D97C,
+0x40346B9C, 0x4035FDBB, 0x40378FDB, 0x403921FB, 0x403AB41B, 0x403C463A,
+0x403DD85A, 0x403F6A7A, 0x40407E4C, 0x4041475C, 0x4042106C, 0x4042D97C,
+0x4043A28C, 0x40446B9C, 0x404534AC, 0x4045FDBB, 0x4046C6CB, 0x40478FDB,
+0x404858EB, 0x404921FB,
+};
+
+/*
+ * invpio2:  53 bits of 2/pi
+ * pio2_1:   first  33 bit of pi/2
+ * pio2_1t:  pi/2 - pio2_1
+ * pio2_2:   second 33 bit of pi/2
+ * pio2_2t:  pi/2 - (pio2_1+pio2_2)
+ * pio2_3:   third  33 bit of pi/2
+ * pio2_3t:  pi/2 - (pio2_1+pio2_2+pio2_3)
+ */
+
+#ifdef __STDC__
+static const double 
+#else
+static double 
+#endif
+zero =  0.00000000000000000000e+00, /* 0x00000000, 0x00000000 */
+half =  5.00000000000000000000e-01, /* 0x3FE00000, 0x00000000 */
+two24 =  1.67772160000000000000e+07, /* 0x41700000, 0x00000000 */
+invpio2 =  6.36619772367581382433e-01, /* 0x3FE45F30, 0x6DC9C883 */
+pio2_1  =  1.57079632673412561417e+00, /* 0x3FF921FB, 0x54400000 */
+pio2_1t =  6.07710050650619224932e-11, /* 0x3DD0B461, 0x1A626331 */
+pio2_2  =  6.07710050630396597660e-11, /* 0x3DD0B461, 0x1A600000 */
+pio2_2t =  2.02226624879595063154e-21, /* 0x3BA3198A, 0x2E037073 */
+pio2_3  =  2.02226624871116645580e-21, /* 0x3BA3198A, 0x2E000000 */
+pio2_3t =  8.47842766036889956997e-32; /* 0x397B839A, 0x252049C1 */
+
+#ifdef __STDC__
+	int __ieee754_rem_pio2(double x, double *y)
+#else
+	int __ieee754_rem_pio2(x,y)
+	double x,y[];
+#endif
+{
+        fd_twoints u, ux, uz;
+	double z,w,t,r,fn;
+	double tx[3];
+	int e0,i,j,nx,n,ix,hx;
+
+        u.d = x;
+	hx = __HI(u);		/* high word of x */
+	ix = hx&0x7fffffff;
+	if(ix<=0x3fe921fb)   /* |x| ~<= pi/4 , no need for reduction */
+	    {y[0] = x; y[1] = 0; return 0;}
+	if(ix<0x4002d97c) {  /* |x| < 3pi/4, special case with n=+-1 */
+	    if(hx>0) { 
+		z = x - pio2_1;
+		if(ix!=0x3ff921fb) { 	/* 33+53 bit pi is good enough */
+		    y[0] = z - pio2_1t;
+		    y[1] = (z-y[0])-pio2_1t;
+		} else {		/* near pi/2, use 33+33+53 bit pi */
+		    z -= pio2_2;
+		    y[0] = z - pio2_2t;
+		    y[1] = (z-y[0])-pio2_2t;
+		}
+		return 1;
+	    } else {	/* negative x */
+		z = x + pio2_1;
+		if(ix!=0x3ff921fb) { 	/* 33+53 bit pi is good enough */
+		    y[0] = z + pio2_1t;
+		    y[1] = (z-y[0])+pio2_1t;
+		} else {		/* near pi/2, use 33+33+53 bit pi */
+		    z += pio2_2;
+		    y[0] = z + pio2_2t;
+		    y[1] = (z-y[0])+pio2_2t;
+		}
+		return -1;
+	    }
+	}
+	if(ix<=0x413921fb) { /* |x| ~<= 2^19*(pi/2), medium size */
+	    t  = fd_fabs(x);
+	    n  = (int) (t*invpio2+half);
+	    fn = (double)n;
+	    r  = t-fn*pio2_1;
+	    w  = fn*pio2_1t;	/* 1st round good to 85 bit */
+	    if(n<32&&ix!=npio2_hw[n-1]) {	
+		y[0] = r-w;	/* quick check no cancellation */
+	    } else {
+	        j  = ix>>20;
+	        y[0] = r-w;
+                u.d = y[0];
+	        i = j-(((__HI(u))>>20)&0x7ff);
+	        if(i>16) {  /* 2nd iteration needed, good to 118 */
+		    t  = r;
+		    w  = fn*pio2_2;	
+		    r  = t-w;
+		    w  = fn*pio2_2t-((t-r)-w);	
+		    y[0] = r-w;
+                    u.d = y[0];
+		    i = j-(((__HI(u))>>20)&0x7ff);
+		    if(i>49)  {	/* 3rd iteration need, 151 bits acc */
+		    	t  = r;	/* will cover all possible cases */
+		    	w  = fn*pio2_3;	
+		    	r  = t-w;
+		    	w  = fn*pio2_3t-((t-r)-w);	
+		    	y[0] = r-w;
+		    }
+		}
+	    }
+	    y[1] = (r-y[0])-w;
+	    if(hx<0) 	{y[0] = -y[0]; y[1] = -y[1]; return -n;}
+	    else	 return n;
+	}
+    /* 
+     * all other (large) arguments
+     */
+	if(ix>=0x7ff00000) {		/* x is inf or NaN */
+	    y[0]=y[1]=x-x; return 0;
+	}
+    /* set z = scalbn(|x|,ilogb(x)-23) */
+        ux.d = x; uz.d = z;
+	__LO(uz) = __LO(ux);
+        z = uz.d;
+	e0 	= (ix>>20)-1046;	/* e0 = ilogb(z)-23; */
+        uz.d = z;
+	__HI(uz) = ix - (e0<<20);
+        z = uz.d;
+	for(i=0;i<2;i++) {
+		tx[i] = (double)((int)(z));
+		z     = (z-tx[i])*two24;
+	}
+	tx[2] = z;
+	nx = 3;
+	while(tx[nx-1]==zero) nx--;	/* skip zero term */
+	n  =  __kernel_rem_pio2(tx,y,e0,nx,2,two_over_pi);
+	if(hx<0) {y[0] = -y[0]; y[1] = -y[1]; return -n;}
+	return n;
+}

mozilla/js/src/fdlibm/e_remainder.c

@@ -0,0 +1,120 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * ***** BEGIN LICENSE BLOCK *****
+ * Version: MPL 1.1/GPL 2.0/LGPL 2.1
+ *
+ * The contents of this file are subject to the Mozilla Public License Version
+ * 1.1 (the "License"); you may not use this file except in compliance with
+ * the License. You may obtain a copy of the License at
+ * http://www.mozilla.org/MPL/
+ *
+ * Software distributed under the License is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+ * for the specific language governing rights and limitations under the
+ * License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is
+ * Sun Microsystems, Inc.
+ * Portions created by the Initial Developer are Copyright (C) 1998
+ * the Initial Developer. All Rights Reserved.
+ *
+ * Contributor(s):
+ *
+ * Alternatively, the contents of this file may be used under the terms of
+ * either of the GNU General Public License Version 2 or later (the "GPL"),
+ * or the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+ * in which case the provisions of the GPL or the LGPL are applicable instead
+ * of those above. If you wish to allow use of your version of this file only
+ * under the terms of either the GPL or the LGPL, and not to allow others to
+ * use your version of this file under the terms of the MPL, indicate your
+ * decision by deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL or the LGPL. If you do not delete
+ * the provisions above, a recipient may use your version of this file under
+ * the terms of any one of the MPL, the GPL or the LGPL.
+ *
+ * ***** END LICENSE BLOCK ***** */
+
+/* @(#)e_remainder.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* __ieee754_remainder(x,p)
+ * Return :                  
+ * 	returns  x REM p  =  x - [x/p]*p as if in infinite 
+ * 	precise arithmetic, where [x/p] is the (infinite bit) 
+ *	integer nearest x/p (in half way case choose the even one).
+ * Method : 
+ *	Based on fmod() return x-[x/p]chopped*p exactlp.
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double zero = 0.0;
+#else
+static double zero = 0.0;
+#endif
+
+
+#ifdef __STDC__
+	double __ieee754_remainder(double x, double p)
+#else
+	double __ieee754_remainder(x,p)
+	double x,p;
+#endif
+{
+        fd_twoints u;
+	int hx,hp;
+	unsigned sx,lx,lp;
+	double p_half;
+
+        u.d = x;
+	hx = __HI(u);		/* high word of x */
+	lx = __LO(u);		/* low  word of x */
+        u.d = p;
+	hp = __HI(u);		/* high word of p */
+	lp = __LO(u);		/* low  word of p */
+	sx = hx&0x80000000;
+	hp &= 0x7fffffff;
+	hx &= 0x7fffffff;
+
+    /* purge off exception values */
+	if((hp|lp)==0) return (x*p)/(x*p); 	/* p = 0 */
+	if((hx>=0x7ff00000)||			/* x not finite */
+	  ((hp>=0x7ff00000)&&			/* p is NaN */
+	  (((hp-0x7ff00000)|lp)!=0)))
+	    return (x*p)/(x*p);
+
+
+	if (hp<=0x7fdfffff) x = __ieee754_fmod(x,p+p);	/* now x < 2p */
+	if (((hx-hp)|(lx-lp))==0) return zero*x;
+	x  = fd_fabs(x);
+	p  = fd_fabs(p);
+	if (hp<0x00200000) {
+	    if(x+x>p) {
+		x-=p;
+		if(x+x>=p) x -= p;
+	    }
+	} else {
+	    p_half = 0.5*p;
+	    if(x>p_half) {
+		x-=p;
+		if(x>=p_half) x -= p;
+	    }
+	}
+        u.d = x;
+	__HI(u) ^= sx;
+        x = u.d;
+	return x;
+}

mozilla/js/src/fdlibm/e_scalb.c

@@ -0,0 +1,89 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * ***** BEGIN LICENSE BLOCK *****
+ * Version: MPL 1.1/GPL 2.0/LGPL 2.1
+ *
+ * The contents of this file are subject to the Mozilla Public License Version
+ * 1.1 (the "License"); you may not use this file except in compliance with
+ * the License. You may obtain a copy of the License at
+ * http://www.mozilla.org/MPL/
+ *
+ * Software distributed under the License is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+ * for the specific language governing rights and limitations under the
+ * License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is
+ * Sun Microsystems, Inc.
+ * Portions created by the Initial Developer are Copyright (C) 1998
+ * the Initial Developer. All Rights Reserved.
+ *
+ * Contributor(s):
+ *
+ * Alternatively, the contents of this file may be used under the terms of
+ * either of the GNU General Public License Version 2 or later (the "GPL"),
+ * or the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+ * in which case the provisions of the GPL or the LGPL are applicable instead
+ * of those above. If you wish to allow use of your version of this file only
+ * under the terms of either the GPL or the LGPL, and not to allow others to
+ * use your version of this file under the terms of the MPL, indicate your
+ * decision by deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL or the LGPL. If you do not delete
+ * the provisions above, a recipient may use your version of this file under
+ * the terms of any one of the MPL, the GPL or the LGPL.
+ *
+ * ***** END LICENSE BLOCK ***** */
+
+/* @(#)e_scalb.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/*
+ * __ieee754_scalb(x, fn) is provide for
+ * passing various standard test suite. One 
+ * should use scalbn() instead.
+ */
+
+#include "fdlibm.h"
+
+#ifdef _SCALB_INT
+#ifdef __STDC__
+	double __ieee754_scalb(double x, int fn)
+#else
+	double __ieee754_scalb(x,fn)
+	double x; int fn;
+#endif
+#else
+#ifdef __STDC__
+	double __ieee754_scalb(double x, double fn)
+#else
+	double __ieee754_scalb(x,fn)
+	double x, fn;
+#endif
+#endif
+{
+#ifdef _SCALB_INT
+	return fd_scalbn(x,fn);
+#else
+	if (fd_isnan(x)||fd_isnan(fn)) return x*fn;
+	if (!fd_finite(fn)) {
+	    if(fn>0.0) return x*fn;
+	    else       return x/(-fn);
+	}
+	if (fd_rint(fn)!=fn) return (fn-fn)/(fn-fn);
+	if ( fn > 65000.0) return fd_scalbn(x, 65000);
+	if (-fn > 65000.0) return fd_scalbn(x,-65000);
+	return fd_scalbn(x,(int)fn);
+#endif
+}

mozilla/js/src/fdlibm/e_sinh.c

@@ -0,0 +1,122 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * ***** BEGIN LICENSE BLOCK *****
+ * Version: MPL 1.1/GPL 2.0/LGPL 2.1
+ *
+ * The contents of this file are subject to the Mozilla Public License Version
+ * 1.1 (the "License"); you may not use this file except in compliance with
+ * the License. You may obtain a copy of the License at
+ * http://www.mozilla.org/MPL/
+ *
+ * Software distributed under the License is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+ * for the specific language governing rights and limitations under the
+ * License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is
+ * Sun Microsystems, Inc.
+ * Portions created by the Initial Developer are Copyright (C) 1998
+ * the Initial Developer. All Rights Reserved.
+ *
+ * Contributor(s):
+ *
+ * Alternatively, the contents of this file may be used under the terms of
+ * either of the GNU General Public License Version 2 or later (the "GPL"),
+ * or the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+ * in which case the provisions of the GPL or the LGPL are applicable instead
+ * of those above. If you wish to allow use of your version of this file only
+ * under the terms of either the GPL or the LGPL, and not to allow others to
+ * use your version of this file under the terms of the MPL, indicate your
+ * decision by deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL or the LGPL. If you do not delete
+ * the provisions above, a recipient may use your version of this file under
+ * the terms of any one of the MPL, the GPL or the LGPL.
+ *
+ * ***** END LICENSE BLOCK ***** */
+
+/* @(#)e_sinh.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* __ieee754_sinh(x)
+ * Method : 
+ * mathematically sinh(x) if defined to be (exp(x)-exp(-x))/2
+ *	1. Replace x by |x| (sinh(-x) = -sinh(x)). 
+ *	2. 
+ *		                                    E + E/(E+1)
+ *	    0        <= x <= 22     :  sinh(x) := --------------, E=expm1(x)
+ *			       			        2
+ *
+ *	    22       <= x <= lnovft :  sinh(x) := exp(x)/2 
+ *	    lnovft   <= x <= ln2ovft:  sinh(x) := exp(x/2)/2 * exp(x/2)
+ *	    ln2ovft  <  x	    :  sinh(x) := x*shuge (overflow)
+ *
+ * Special cases:
+ *	sinh(x) is |x| if x is +INF, -INF, or NaN.
+ *	only sinh(0)=0 is exact for finite x.
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double one = 1.0, shuge = 1.0e307;
+#else
+static double one = 1.0, shuge = 1.0e307;
+#endif
+
+#ifdef __STDC__
+	double __ieee754_sinh(double x)
+#else
+	double __ieee754_sinh(x)
+	double x;
+#endif
+{	
+        fd_twoints u;
+	double t,w,h;
+	int ix,jx;
+	unsigned lx;
+
+    /* High word of |x|. */
+        u.d = x;
+	jx = __HI(u);
+	ix = jx&0x7fffffff;
+
+    /* x is INF or NaN */
+	if(ix>=0x7ff00000) return x+x;	
+
+	h = 0.5;
+	if (jx<0) h = -h;
+    /* |x| in [0,22], return sign(x)*0.5*(E+E/(E+1))) */
+	if (ix < 0x40360000) {		/* |x|<22 */
+	    if (ix<0x3e300000) 		/* |x|<2**-28 */
+		if(shuge+x>one) return x;/* sinh(tiny) = tiny with inexact */
+	    t = fd_expm1(fd_fabs(x));
+	    if(ix<0x3ff00000) return h*(2.0*t-t*t/(t+one));
+	    return h*(t+t/(t+one));
+	}
+
+    /* |x| in [22, log(maxdouble)] return 0.5*exp(|x|) */
+	if (ix < 0x40862E42)  return h*__ieee754_exp(fd_fabs(x));
+
+    /* |x| in [log(maxdouble), overflowthresold] */
+	lx = *( (((*(unsigned*)&one)>>29)) + (unsigned*)&x);
+	if (ix<0x408633CE || (ix==0x408633ce)&&(lx<=(unsigned)0x8fb9f87d)) {
+	    w = __ieee754_exp(0.5*fd_fabs(x));
+	    t = h*w;
+	    return t*w;
+	}
+
+    /* |x| > overflowthresold, sinh(x) overflow */
+	return x*shuge;
+}

mozilla/js/src/fdlibm/e_sqrt.c

@@ -0,0 +1,497 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * ***** BEGIN LICENSE BLOCK *****
+ * Version: MPL 1.1/GPL 2.0/LGPL 2.1
+ *
+ * The contents of this file are subject to the Mozilla Public License Version
+ * 1.1 (the "License"); you may not use this file except in compliance with
+ * the License. You may obtain a copy of the License at
+ * http://www.mozilla.org/MPL/
+ *
+ * Software distributed under the License is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+ * for the specific language governing rights and limitations under the
+ * License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is
+ * Sun Microsystems, Inc.
+ * Portions created by the Initial Developer are Copyright (C) 1998
+ * the Initial Developer. All Rights Reserved.
+ *
+ * Contributor(s):
+ *
+ * Alternatively, the contents of this file may be used under the terms of
+ * either of the GNU General Public License Version 2 or later (the "GPL"),
+ * or the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+ * in which case the provisions of the GPL or the LGPL are applicable instead
+ * of those above. If you wish to allow use of your version of this file only
+ * under the terms of either the GPL or the LGPL, and not to allow others to
+ * use your version of this file under the terms of the MPL, indicate your
+ * decision by deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL or the LGPL. If you do not delete
+ * the provisions above, a recipient may use your version of this file under
+ * the terms of any one of the MPL, the GPL or the LGPL.
+ *
+ * ***** END LICENSE BLOCK ***** */
+/* @(#)e_sqrt.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* __ieee754_sqrt(x)
+ * Return correctly rounded sqrt.
+ *           ------------------------------------------
+ *	     |  Use the hardware sqrt if you have one |
+ *           ------------------------------------------
+ * Method: 
+ *   Bit by bit method using integer arithmetic. (Slow, but portable) 
+ *   1. Normalization
+ *	Scale x to y in [1,4) with even powers of 2: 
+ *	find an integer k such that  1 <= (y=x*2^(2k)) < 4, then
+ *		sqrt(y) = 2^k * sqrt(x)
+ *   2. Bit by bit computation
+ *	Let q  = sqrt(y) truncated to i bit after binary point (q = 1),
+ *	     i							 0
+ *                                     i+1         2
+ *	    s  = 2*q , and	y  =  2   * ( y - q  ).		(1)
+ *	     i      i            i                 i
+ *                                                        
+ *	To compute q    from q , one checks whether 
+ *		    i+1       i                       
+ *
+ *			      -(i+1) 2
+ *			(q + 2      ) <= y.			(2)
+ *     			  i
+ *							      -(i+1)
+ *	If (2) is false, then q   = q ; otherwise q   = q  + 2      .
+ *		 	       i+1   i             i+1   i
+ *
+ *	With some algebric manipulation, it is not difficult to see
+ *	that (2) is equivalent to 
+ *                             -(i+1)
+ *			s  +  2       <= y			(3)
+ *			 i                i
+ *
+ *	The advantage of (3) is that s  and y  can be computed by 
+ *				      i      i
+ *	the following recurrence formula:
+ *	    if (3) is false
+ *
+ *	    s     =  s  ,	y    = y   ;			(4)
+ *	     i+1      i		 i+1    i
+ *
+ *	    otherwise,
+ *                         -i                     -(i+1)
+ *	    s	  =  s  + 2  ,  y    = y  -  s  - 2  		(5)
+ *           i+1      i          i+1    i     i
+ *				
+ *	One may easily use induction to prove (4) and (5). 
+ *	Note. Since the left hand side of (3) contain only i+2 bits,
+ *	      it does not necessary to do a full (53-bit) comparison 
+ *	      in (3).
+ *   3. Final rounding
+ *	After generating the 53 bits result, we compute one more bit.
+ *	Together with the remainder, we can decide whether the
+ *	result is exact, bigger than 1/2ulp, or less than 1/2ulp
+ *	(it will never equal to 1/2ulp).
+ *	The rounding mode can be detected by checking whether
+ *	huge + tiny is equal to huge, and whether huge - tiny is
+ *	equal to huge for some floating point number "huge" and "tiny".
+ *		
+ * Special cases:
+ *	sqrt(+-0) = +-0 	... exact
+ *	sqrt(inf) = inf
+ *	sqrt(-ve) = NaN		... with invalid signal
+ *	sqrt(NaN) = NaN		... with invalid signal for signaling NaN
+ *
+ * Other methods : see the appended file at the end of the program below.
+ *---------------
+ */
+
+#include "fdlibm.h"
+
+#if defined(_MSC_VER)
+/* Microsoft Compiler */
+#pragma warning( disable : 4723 ) /* disables potential divide by 0 warning */
+#endif
+
+#ifdef __STDC__
+static	const double	one	= 1.0, tiny=1.0e-300;
+#else
+static	double	one	= 1.0, tiny=1.0e-300;
+#endif
+
+#ifdef __STDC__
+	double __ieee754_sqrt(double x)
+#else
+	double __ieee754_sqrt(x)
+	double x;
+#endif
+{
+        fd_twoints u;
+	double z;
+	int 	sign = (int)0x80000000; 
+	unsigned r,t1,s1,ix1,q1;
+	int ix0,s0,q,m,t,i;
+
+        u.d = x;
+	ix0 = __HI(u);			/* high word of x */
+	ix1 = __LO(u);		/* low word of x */
+
+    /* take care of Inf and NaN */
+	if((ix0&0x7ff00000)==0x7ff00000) {			
+	    return x*x+x;		/* sqrt(NaN)=NaN, sqrt(+inf)=+inf
+					   sqrt(-inf)=sNaN */
+	} 
+    /* take care of zero */
+	if(ix0<=0) {
+	    if(((ix0&(~sign))|ix1)==0) return x;/* sqrt(+-0) = +-0 */
+	    else if(ix0<0)
+		return (x-x)/(x-x);		/* sqrt(-ve) = sNaN */
+	}
+    /* normalize x */
+	m = (ix0>>20);
+	if(m==0) {				/* subnormal x */
+	    while(ix0==0) {
+		m -= 21;
+		ix0 |= (ix1>>11); ix1 <<= 21;
+	    }
+	    for(i=0;(ix0&0x00100000)==0;i++) ix0<<=1;
+	    m -= i-1;
+	    ix0 |= (ix1>>(32-i));
+	    ix1 <<= i;
+	}
+	m -= 1023;	/* unbias exponent */
+	ix0 = (ix0&0x000fffff)|0x00100000;
+	if(m&1){	/* odd m, double x to make it even */
+	    ix0 += ix0 + ((ix1&sign)>>31);
+	    ix1 += ix1;
+	}
+	m >>= 1;	/* m = [m/2] */
+
+    /* generate sqrt(x) bit by bit */
+	ix0 += ix0 + ((ix1&sign)>>31);
+	ix1 += ix1;
+	q = q1 = s0 = s1 = 0;	/* [q,q1] = sqrt(x) */
+	r = 0x00200000;		/* r = moving bit from right to left */
+
+	while(r!=0) {
+	    t = s0+r; 
+	    if(t<=ix0) { 
+		s0   = t+r; 
+		ix0 -= t; 
+		q   += r; 
+	    } 
+	    ix0 += ix0 + ((ix1&sign)>>31);
+	    ix1 += ix1;
+	    r>>=1;
+	}
+
+	r = sign;
+	while(r!=0) {
+	    t1 = s1+r; 
+	    t  = s0;
+	    if((t<ix0)||((t==ix0)&&(t1<=ix1))) { 
+		s1  = t1+r;
+		if(((int)(t1&sign)==sign)&&(s1&sign)==0) s0 += 1;
+		ix0 -= t;
+		if (ix1 < t1) ix0 -= 1;
+		ix1 -= t1;
+		q1  += r;
+	    }
+	    ix0 += ix0 + ((ix1&sign)>>31);
+	    ix1 += ix1;
+	    r>>=1;
+	}
+
+    /* use floating add to find out rounding direction */
+	if((ix0|ix1)!=0) {
+	    z = one-tiny; /* trigger inexact flag */
+	    if (z>=one) {
+	        z = one+tiny;
+	        if (q1==(unsigned)0xffffffff) { q1=0; q += 1;}
+		else if (z>one) {
+		    if (q1==(unsigned)0xfffffffe) q+=1;
+		    q1+=2; 
+		} else
+	            q1 += (q1&1);
+	    }
+	}
+	ix0 = (q>>1)+0x3fe00000;
+	ix1 =  q1>>1;
+	if ((q&1)==1) ix1 |= sign;
+	ix0 += (m <<20);
+        u.d = z;
+	__HI(u) = ix0;
+	__LO(u) = ix1;
+        z = u.d;
+	return z;
+}
+
+/*
+Other methods  (use floating-point arithmetic)
+-------------
+(This is a copy of a drafted paper by Prof W. Kahan 
+and K.C. Ng, written in May, 1986)
+
+	Two algorithms are given here to implement sqrt(x) 
+	(IEEE double precision arithmetic) in software.
+	Both supply sqrt(x) correctly rounded. The first algorithm (in
+	Section A) uses newton iterations and involves four divisions.
+	The second one uses reciproot iterations to avoid division, but
+	requires more multiplications. Both algorithms need the ability
+	to chop results of arithmetic operations instead of round them, 
+	and the INEXACT flag to indicate when an arithmetic operation
+	is executed exactly with no roundoff error, all part of the 
+	standard (IEEE 754-1985). The ability to perform shift, add,
+	subtract and logical AND operations upon 32-bit words is needed
+	too, though not part of the standard.
+
+A.  sqrt(x) by Newton Iteration
+
+   (1)	Initial approximation
+
+	Let x0 and x1 be the leading and the trailing 32-bit words of
+	a floating point number x (in IEEE double format) respectively 
+
+	    1    11		     52				  ...widths
+	   ------------------------------------------------------
+	x: |s|	  e     |	      f				|
+	   ------------------------------------------------------
+	      msb    lsb  msb				      lsb ...order
+
+ 
+	     ------------------------  	     ------------------------
+	x0:  |s|   e    |    f1     |	 x1: |          f2           |
+	     ------------------------  	     ------------------------
+
+	By performing shifts and subtracts on x0 and x1 (both regarded
+	as integers), we obtain an 8-bit approximation of sqrt(x) as
+	follows.
+
+		k  := (x0>>1) + 0x1ff80000;
+		y0 := k - T1[31&(k>>15)].	... y ~ sqrt(x) to 8 bits
+	Here k is a 32-bit integer and T1[] is an integer array containing
+	correction terms. Now magically the floating value of y (y's
+	leading 32-bit word is y0, the value of its trailing word is 0)
+	approximates sqrt(x) to almost 8-bit.
+
+	Value of T1:
+	static int T1[32]= {
+	0,	1024,	3062,	5746,	9193,	13348,	18162,	23592,
+	29598,	36145,	43202,	50740,	58733,	67158,	75992,	85215,
+	83599,	71378,	60428,	50647,	41945,	34246,	27478,	21581,
+	16499,	12183,	8588,	5674,	3403,	1742,	661,	130,};
+
+    (2)	Iterative refinement
+
+	Apply Heron's rule three times to y, we have y approximates 
+	sqrt(x) to within 1 ulp (Unit in the Last Place):
+
+		y := (y+x/y)/2		... almost 17 sig. bits
+		y := (y+x/y)/2		... almost 35 sig. bits
+		y := y-(y-x/y)/2	... within 1 ulp
+
+
+	Remark 1.
+	    Another way to improve y to within 1 ulp is:
+
+		y := (y+x/y)		... almost 17 sig. bits to 2*sqrt(x)
+		y := y - 0x00100006	... almost 18 sig. bits to sqrt(x)
+
+				2
+			    (x-y )*y
+		y := y + 2* ----------	...within 1 ulp
+			       2
+			     3y  + x
+
+
+	This formula has one division fewer than the one above; however,
+	it requires more multiplications and additions. Also x must be
+	scaled in advance to avoid spurious overflow in evaluating the
+	expression 3y*y+x. Hence it is not recommended uless division
+	is slow. If division is very slow, then one should use the 
+	reciproot algorithm given in section B.
+
+    (3) Final adjustment
+
+	By twiddling y's last bit it is possible to force y to be 
+	correctly rounded according to the prevailing rounding mode
+	as follows. Let r and i be copies of the rounding mode and
+	inexact flag before entering the square root program. Also we
+	use the expression y+-ulp for the next representable floating
+	numbers (up and down) of y. Note that y+-ulp = either fixed
+	point y+-1, or multiply y by nextafter(1,+-inf) in chopped
+	mode.
+
+		I := FALSE;	... reset INEXACT flag I
+		R := RZ;	... set rounding mode to round-toward-zero
+		z := x/y;	... chopped quotient, possibly inexact
+		If(not I) then {	... if the quotient is exact
+		    if(z=y) {
+		        I := i;	 ... restore inexact flag
+		        R := r;  ... restore rounded mode
+		        return sqrt(x):=y.
+		    } else {
+			z := z - ulp;	... special rounding
+		    }
+		}
+		i := TRUE;		... sqrt(x) is inexact
+		If (r=RN) then z=z+ulp	... rounded-to-nearest
+		If (r=RP) then {	... round-toward-+inf
+		    y = y+ulp; z=z+ulp;
+		}
+		y := y+z;		... chopped sum
+		y0:=y0-0x00100000;	... y := y/2 is correctly rounded.
+	        I := i;	 		... restore inexact flag
+	        R := r;  		... restore rounded mode
+	        return sqrt(x):=y.
+		    
+    (4)	Special cases
+
+	Square root of +inf, +-0, or NaN is itself;
+	Square root of a negative number is NaN with invalid signal.
+
+
+B.  sqrt(x) by Reciproot Iteration
+
+   (1)	Initial approximation
+
+	Let x0 and x1 be the leading and the trailing 32-bit words of
+	a floating point number x (in IEEE double format) respectively
+	(see section A). By performing shifs and subtracts on x0 and y0,
+	we obtain a 7.8-bit approximation of 1/sqrt(x) as follows.
+
+	    k := 0x5fe80000 - (x0>>1);
+	    y0:= k - T2[63&(k>>14)].	... y ~ 1/sqrt(x) to 7.8 bits
+
+	Here k is a 32-bit integer and T2[] is an integer array 
+	containing correction terms. Now magically the floating
+	value of y (y's leading 32-bit word is y0, the value of
+	its trailing word y1 is set to zero) approximates 1/sqrt(x)
+	to almost 7.8-bit.
+
+	Value of T2:
+	static int T2[64]= {
+	0x1500,	0x2ef8,	0x4d67,	0x6b02,	0x87be,	0xa395,	0xbe7a,	0xd866,
+	0xf14a,	0x1091b,0x11fcd,0x13552,0x14999,0x15c98,0x16e34,0x17e5f,
+	0x18d03,0x19a01,0x1a545,0x1ae8a,0x1b5c4,0x1bb01,0x1bfde,0x1c28d,
+	0x1c2de,0x1c0db,0x1ba73,0x1b11c,0x1a4b5,0x1953d,0x18266,0x16be0,
+	0x1683e,0x179d8,0x18a4d,0x19992,0x1a789,0x1b445,0x1bf61,0x1c989,
+	0x1d16d,0x1d77b,0x1dddf,0x1e2ad,0x1e5bf,0x1e6e8,0x1e654,0x1e3cd,
+	0x1df2a,0x1d635,0x1cb16,0x1be2c,0x1ae4e,0x19bde,0x1868e,0x16e2e,
+	0x1527f,0x1334a,0x11051,0xe951,	0xbe01,	0x8e0d,	0x5924,	0x1edd,};
+
+    (2)	Iterative refinement
+
+	Apply Reciproot iteration three times to y and multiply the
+	result by x to get an approximation z that matches sqrt(x)
+	to about 1 ulp. To be exact, we will have 
+		-1ulp < sqrt(x)-z<1.0625ulp.
+	
+	... set rounding mode to Round-to-nearest
+	   y := y*(1.5-0.5*x*y*y)	... almost 15 sig. bits to 1/sqrt(x)
+	   y := y*((1.5-2^-30)+0.5*x*y*y)... about 29 sig. bits to 1/sqrt(x)
+	... special arrangement for better accuracy
+	   z := x*y			... 29 bits to sqrt(x), with z*y<1
+	   z := z + 0.5*z*(1-z*y)	... about 1 ulp to sqrt(x)
+
+	Remark 2. The constant 1.5-2^-30 is chosen to bias the error so that
+	(a) the term z*y in the final iteration is always less than 1; 
+	(b) the error in the final result is biased upward so that
+		-1 ulp < sqrt(x) - z < 1.0625 ulp
+	    instead of |sqrt(x)-z|<1.03125ulp.
+
+    (3)	Final adjustment
+
+	By twiddling y's last bit it is possible to force y to be 
+	correctly rounded according to the prevailing rounding mode
+	as follows. Let r and i be copies of the rounding mode and
+	inexact flag before entering the square root program. Also we
+	use the expression y+-ulp for the next representable floating
+	numbers (up and down) of y. Note that y+-ulp = either fixed
+	point y+-1, or multiply y by nextafter(1,+-inf) in chopped
+	mode.
+
+	R := RZ;		... set rounding mode to round-toward-zero
+	switch(r) {
+	    case RN:		... round-to-nearest
+	       if(x<= z*(z-ulp)...chopped) z = z - ulp; else
+	       if(x<= z*(z+ulp)...chopped) z = z; else z = z+ulp;
+	       break;
+	    case RZ:case RM:	... round-to-zero or round-to--inf
+	       R:=RP;		... reset rounding mod to round-to-+inf
+	       if(x<z*z ... rounded up) z = z - ulp; else
+	       if(x>=(z+ulp)*(z+ulp) ...rounded up) z = z+ulp;
+	       break;
+	    case RP:		... round-to-+inf
+	       if(x>(z+ulp)*(z+ulp)...chopped) z = z+2*ulp; else
+	       if(x>z*z ...chopped) z = z+ulp;
+	       break;
+	}
+
+	Remark 3. The above comparisons can be done in fixed point. For
+	example, to compare x and w=z*z chopped, it suffices to compare
+	x1 and w1 (the trailing parts of x and w), regarding them as
+	two's complement integers.
+
+	...Is z an exact square root?
+	To determine whether z is an exact square root of x, let z1 be the
+	trailing part of z, and also let x0 and x1 be the leading and
+	trailing parts of x.
+
+	If ((z1&0x03ffffff)!=0)	... not exact if trailing 26 bits of z!=0
+	    I := 1;		... Raise Inexact flag: z is not exact
+	else {
+	    j := 1 - [(x0>>20)&1]	... j = logb(x) mod 2
+	    k := z1 >> 26;		... get z's 25-th and 26-th 
+					    fraction bits
+	    I := i or (k&j) or ((k&(j+j+1))!=(x1&3));
+	}
+	R:= r		... restore rounded mode
+	return sqrt(x):=z.
+
+	If multiplication is cheaper then the foregoing red tape, the 
+	Inexact flag can be evaluated by
+
+	    I := i;
+	    I := (z*z!=x) or I.
+
+	Note that z*z can overwrite I; this value must be sensed if it is 
+	True.
+
+	Remark 4. If z*z = x exactly, then bit 25 to bit 0 of z1 must be
+	zero.
+
+		    --------------------
+		z1: |        f2        | 
+		    --------------------
+		bit 31		   bit 0
+
+	Further more, bit 27 and 26 of z1, bit 0 and 1 of x1, and the odd
+	or even of logb(x) have the following relations:
+
+	-------------------------------------------------
+	bit 27,26 of z1		bit 1,0 of x1	logb(x)
+	-------------------------------------------------
+	00			00		odd and even
+	01			01		even
+	10			10		odd
+	10			00		even
+	11			01		even
+	-------------------------------------------------
+
+    (4)	Special cases (see (4) of Section A).	
+ 
+ */
+ 

mozilla/js/src/fdlibm/fdlibm.h

@@ -0,0 +1,273 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * ***** BEGIN LICENSE BLOCK *****
+ * Version: MPL 1.1/GPL 2.0/LGPL 2.1
+ *
+ * The contents of this file are subject to the Mozilla Public License Version
+ * 1.1 (the "License"); you may not use this file except in compliance with
+ * the License. You may obtain a copy of the License at
+ * http://www.mozilla.org/MPL/
+ *
+ * Software distributed under the License is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+ * for the specific language governing rights and limitations under the
+ * License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is
+ * Sun Microsystems, Inc.
+ * Portions created by the Initial Developer are Copyright (C) 1998
+ * the Initial Developer. All Rights Reserved.
+ *
+ * Contributor(s):
+ *
+ * Alternatively, the contents of this file may be used under the terms of
+ * either of the GNU General Public License Version 2 or later (the "GPL"),
+ * or the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+ * in which case the provisions of the GPL or the LGPL are applicable instead
+ * of those above. If you wish to allow use of your version of this file only
+ * under the terms of either the GPL or the LGPL, and not to allow others to
+ * use your version of this file under the terms of the MPL, indicate your
+ * decision by deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL or the LGPL. If you do not delete
+ * the provisions above, a recipient may use your version of this file under
+ * the terms of any one of the MPL, the GPL or the LGPL.
+ *
+ * ***** END LICENSE BLOCK ***** */
+
+/* @(#)fdlibm.h 1.5 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* Modified defines start here.. */
+#undef __LITTLE_ENDIAN
+
+#ifdef _WIN32
+#define huge myhuge
+#define __LITTLE_ENDIAN
+#endif
+
+#ifdef XP_OS2
+#define __LITTLE_ENDIAN
+#endif
+
+#if defined(linux) && (defined(__i386__) || defined(__x86_64__))
+#define __LITTLE_ENDIAN
+#endif
+
+/* End here. The rest is the standard file. */
+
+#ifdef __NEWVALID	/* special setup for Sun test regime */
+#if defined(i386) || defined(i486) || \
+	defined(intel) || defined(x86) || defined(i86pc)
+#define __LITTLE_ENDIAN
+#endif
+#endif
+
+typedef union {
+#ifdef __LITTLE_ENDIAN
+    struct { int lo, hi; } ints;
+#else
+    struct { int hi, lo; } ints;
+#endif
+    double d;
+} fd_twoints;
+
+#define __HI(x) x.ints.hi
+#define __LO(x) x.ints.lo
+
+#undef __P
+#ifdef __STDC__
+#define	__P(p)	p
+#else
+#define	__P(p)	()
+#endif
+
+/*
+ * ANSI/POSIX
+ */
+
+extern int signgam;
+
+#define	MAXFLOAT	((float)3.40282346638528860e+38)
+
+enum fdversion {fdlibm_ieee = -1, fdlibm_svid, fdlibm_xopen, fdlibm_posix};
+
+#define _LIB_VERSION_TYPE enum fdversion
+#define _LIB_VERSION _fdlib_version  
+
+/* if global variable _LIB_VERSION is not desirable, one may 
+ * change the following to be a constant by: 
+ *	#define _LIB_VERSION_TYPE const enum version
+ * In that case, after one initializes the value _LIB_VERSION (see
+ * s_lib_version.c) during compile time, it cannot be modified
+ * in the middle of a program
+ */ 
+extern  _LIB_VERSION_TYPE  _LIB_VERSION;
+
+#define _IEEE_  fdlibm_ieee
+#define _SVID_  fdlibm_svid
+#define _XOPEN_ fdlibm_xopen
+#define _POSIX_ fdlibm_posix
+
+struct exception {
+	int type;
+	char *name;
+	double arg1;
+	double arg2;
+	double retval;
+};
+
+#define	HUGE		MAXFLOAT
+
+/* 
+ * set X_TLOSS = pi*2**52, which is possibly defined in <values.h>
+ * (one may replace the following line by "#include <values.h>")
+ */
+
+#define X_TLOSS		1.41484755040568800000e+16 
+
+#define	DOMAIN		1
+#define	SING		2
+#define	OVERFLOW	3
+#define	UNDERFLOW	4
+#define	TLOSS		5
+#define	PLOSS		6
+
+/*
+ * ANSI/POSIX
+ */
+
+extern double fd_acos __P((double));
+extern double fd_asin __P((double));
+extern double fd_atan __P((double));
+extern double fd_atan2 __P((double, double));
+extern double fd_cos __P((double));
+extern double fd_sin __P((double));
+extern double fd_tan __P((double));
+ 
+extern double fd_cosh __P((double));
+extern double fd_sinh __P((double));
+extern double fd_tanh __P((double));
+
+extern double fd_exp __P((double));
+extern double fd_frexp __P((double, int *));
+extern double fd_ldexp __P((double, int));
+extern double fd_log __P((double));
+extern double fd_log10 __P((double));
+extern double fd_modf __P((double, double *));
+
+extern double fd_pow __P((double, double));
+extern double fd_sqrt __P((double));
+
+extern double fd_ceil __P((double));
+extern double fd_fabs __P((double));
+extern double fd_floor __P((double));
+extern double fd_fmod __P((double, double));
+
+extern double fd_erf __P((double));
+extern double fd_erfc __P((double));
+extern double fd_gamma __P((double));
+extern double fd_hypot __P((double, double));
+extern int fd_isnan __P((double));
+extern int fd_finite __P((double));
+extern double fd_j0 __P((double));
+extern double fd_j1 __P((double));
+extern double fd_jn __P((int, double));
+extern double fd_lgamma __P((double));
+extern double fd_y0 __P((double));
+extern double fd_y1 __P((double));
+extern double fd_yn __P((int, double));
+
+extern double fd_acosh __P((double));
+extern double fd_asinh __P((double));
+extern double fd_atanh __P((double));
+extern double fd_cbrt __P((double));
+extern double fd_logb __P((double));
+extern double fd_nextafter __P((double, double));
+extern double fd_remainder __P((double, double));
+#ifdef _SCALB_INT
+extern double fd_scalb __P((double, int));
+#else
+extern double fd_scalb __P((double, double));
+#endif
+
+extern int fd_matherr __P((struct exception *));
+
+/*
+ * IEEE Test Vector
+ */
+extern double significand __P((double));
+
+/*
+ * Functions callable from C, intended to support IEEE arithmetic.
+ */
+extern double fd_copysign __P((double, double));
+extern int fd_ilogb __P((double));
+extern double fd_rint __P((double));
+extern double fd_scalbn __P((double, int));
+
+/*
+ * BSD math library entry points
+ */
+extern double fd_expm1 __P((double));
+extern double fd_log1p __P((double));
+
+/*
+ * Reentrant version of gamma & lgamma; passes signgam back by reference
+ * as the second argument; user must allocate space for signgam.
+ */
+#ifdef _REENTRANT
+extern double gamma_r __P((double, int *));
+extern double lgamma_r __P((double, int *));
+#endif	/* _REENTRANT */
+
+/* ieee style elementary functions */
+extern double __ieee754_sqrt __P((double));			
+extern double __ieee754_acos __P((double));			
+extern double __ieee754_acosh __P((double));			
+extern double __ieee754_log __P((double));			
+extern double __ieee754_atanh __P((double));			
+extern double __ieee754_asin __P((double));			
+extern double __ieee754_atan2 __P((double,double));			
+extern double __ieee754_exp __P((double));
+extern double __ieee754_cosh __P((double));
+extern double __ieee754_fmod __P((double,double));
+extern double __ieee754_pow __P((double,double));
+extern double __ieee754_lgamma_r __P((double,int *));
+extern double __ieee754_gamma_r __P((double,int *));
+extern double __ieee754_lgamma __P((double));
+extern double __ieee754_gamma __P((double));
+extern double __ieee754_log10 __P((double));
+extern double __ieee754_sinh __P((double));
+extern double __ieee754_hypot __P((double,double));
+extern double __ieee754_j0 __P((double));
+extern double __ieee754_j1 __P((double));
+extern double __ieee754_y0 __P((double));
+extern double __ieee754_y1 __P((double));
+extern double __ieee754_jn __P((int,double));
+extern double __ieee754_yn __P((int,double));
+extern double __ieee754_remainder __P((double,double));
+extern int    __ieee754_rem_pio2 __P((double,double*));
+#ifdef _SCALB_INT
+extern double __ieee754_scalb __P((double,int));
+#else
+extern double __ieee754_scalb __P((double,double));
+#endif
+
+/* fdlibm kernel function */
+extern double __kernel_standard __P((double,double,int,int*));
+extern double __kernel_sin __P((double,double,int));
+extern double __kernel_cos __P((double,double));
+extern double __kernel_tan __P((double,double,int));
+extern int    __kernel_rem_pio2 __P((double*,double*,int,int,int,const int*));

mozilla/js/src/fdlibm/k_cos.c

@@ -0,0 +1,134 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * ***** BEGIN LICENSE BLOCK *****
+ * Version: MPL 1.1/GPL 2.0/LGPL 2.1
+ *
+ * The contents of this file are subject to the Mozilla Public License Version
+ * 1.1 (the "License"); you may not use this file except in compliance with
+ * the License. You may obtain a copy of the License at
+ * http://www.mozilla.org/MPL/
+ *
+ * Software distributed under the License is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+ * for the specific language governing rights and limitations under the
+ * License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is
+ * Sun Microsystems, Inc.
+ * Portions created by the Initial Developer are Copyright (C) 1998
+ * the Initial Developer. All Rights Reserved.
+ *
+ * Contributor(s):
+ *
+ * Alternatively, the contents of this file may be used under the terms of
+ * either of the GNU General Public License Version 2 or later (the "GPL"),
+ * or the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+ * in which case the provisions of the GPL or the LGPL are applicable instead
+ * of those above. If you wish to allow use of your version of this file only
+ * under the terms of either the GPL or the LGPL, and not to allow others to
+ * use your version of this file under the terms of the MPL, indicate your
+ * decision by deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL or the LGPL. If you do not delete
+ * the provisions above, a recipient may use your version of this file under
+ * the terms of any one of the MPL, the GPL or the LGPL.
+ *
+ * ***** END LICENSE BLOCK ***** */
+
+/* @(#)k_cos.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/*
+ * __kernel_cos( x,  y )
+ * kernel cos function on [-pi/4, pi/4], pi/4 ~ 0.785398164
+ * Input x is assumed to be bounded by ~pi/4 in magnitude.
+ * Input y is the tail of x. 
+ *
+ * Algorithm
+ *	1. Since cos(-x) = cos(x), we need only to consider positive x.
+ *	2. if x < 2^-27 (hx<0x3e400000 0), return 1 with inexact if x!=0.
+ *	3. cos(x) is approximated by a polynomial of degree 14 on
+ *	   [0,pi/4]
+ *		  	                 4            14
+ *	   	cos(x) ~ 1 - x*x/2 + C1*x + ... + C6*x
+ *	   where the remez error is
+ *	
+ * 	|              2     4     6     8     10    12     14 |     -58
+ * 	|cos(x)-(1-.5*x +C1*x +C2*x +C3*x +C4*x +C5*x  +C6*x  )| <= 2
+ * 	|    					               | 
+ * 
+ * 	               4     6     8     10    12     14 
+ *	4. let r = C1*x +C2*x +C3*x +C4*x +C5*x  +C6*x  , then
+ *	       cos(x) = 1 - x*x/2 + r
+ *	   since cos(x+y) ~ cos(x) - sin(x)*y 
+ *			  ~ cos(x) - x*y,
+ *	   a correction term is necessary in cos(x) and hence
+ *		cos(x+y) = 1 - (x*x/2 - (r - x*y))
+ *	   For better accuracy when x > 0.3, let qx = |x|/4 with
+ *	   the last 32 bits mask off, and if x > 0.78125, let qx = 0.28125.
+ *	   Then
+ *		cos(x+y) = (1-qx) - ((x*x/2-qx) - (r-x*y)).
+ *	   Note that 1-qx and (x*x/2-qx) is EXACT here, and the
+ *	   magnitude of the latter is at least a quarter of x*x/2,
+ *	   thus, reducing the rounding error in the subtraction.
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double 
+#else
+static double 
+#endif
+one =  1.00000000000000000000e+00, /* 0x3FF00000, 0x00000000 */
+C1  =  4.16666666666666019037e-02, /* 0x3FA55555, 0x5555554C */
+C2  = -1.38888888888741095749e-03, /* 0xBF56C16C, 0x16C15177 */
+C3  =  2.48015872894767294178e-05, /* 0x3EFA01A0, 0x19CB1590 */
+C4  = -2.75573143513906633035e-07, /* 0xBE927E4F, 0x809C52AD */
+C5  =  2.08757232129817482790e-09, /* 0x3E21EE9E, 0xBDB4B1C4 */
+C6  = -1.13596475577881948265e-11; /* 0xBDA8FAE9, 0xBE8838D4 */
+
+#ifdef __STDC__
+	double __kernel_cos(double x, double y)
+#else
+	double __kernel_cos(x, y)
+	double x,y;
+#endif
+{
+        fd_twoints u;
+	double a,hz,z,r,qx;
+	int ix;
+        u.d = x;
+	ix = __HI(u)&0x7fffffff;	/* ix = |x|'s high word*/
+	if(ix<0x3e400000) {			/* if x < 2**27 */
+	    if(((int)x)==0) return one;		/* generate inexact */
+	}
+	z  = x*x;
+	r  = z*(C1+z*(C2+z*(C3+z*(C4+z*(C5+z*C6)))));
+	if(ix < 0x3FD33333) 			/* if |x| < 0.3 */ 
+	    return one - (0.5*z - (z*r - x*y));
+	else {
+	    if(ix > 0x3fe90000) {		/* x > 0.78125 */
+		qx = 0.28125;
+	    } else {
+                u.d = qx;
+	        __HI(u) = ix-0x00200000;	/* x/4 */
+	        __LO(u) = 0;
+                qx = u.d;
+	    }
+	    hz = 0.5*z-qx;
+	    a  = one-qx;
+	    return a - (hz - (z*r-x*y));
+	}
+}

mozilla/js/src/fdlibm/k_rem_pio2.c

@@ -0,0 +1,354 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * ***** BEGIN LICENSE BLOCK *****
+ * Version: MPL 1.1/GPL 2.0/LGPL 2.1
+ *
+ * The contents of this file are subject to the Mozilla Public License Version
+ * 1.1 (the "License"); you may not use this file except in compliance with
+ * the License. You may obtain a copy of the License at
+ * http://www.mozilla.org/MPL/
+ *
+ * Software distributed under the License is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+ * for the specific language governing rights and limitations under the
+ * License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is
+ * Sun Microsystems, Inc.
+ * Portions created by the Initial Developer are Copyright (C) 1998
+ * the Initial Developer. All Rights Reserved.
+ *
+ * Contributor(s):
+ *
+ * Alternatively, the contents of this file may be used under the terms of
+ * either of the GNU General Public License Version 2 or later (the "GPL"),
+ * or the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+ * in which case the provisions of the GPL or the LGPL are applicable instead
+ * of those above. If you wish to allow use of your version of this file only
+ * under the terms of either the GPL or the LGPL, and not to allow others to
+ * use your version of this file under the terms of the MPL, indicate your
+ * decision by deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL or the LGPL. If you do not delete
+ * the provisions above, a recipient may use your version of this file under
+ * the terms of any one of the MPL, the GPL or the LGPL.
+ *
+ * ***** END LICENSE BLOCK ***** */
+
+/* @(#)k_rem_pio2.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/*
+ * __kernel_rem_pio2(x,y,e0,nx,prec,ipio2)
+ * double x[],y[]; int e0,nx,prec; int ipio2[];
+ * 
+ * __kernel_rem_pio2 return the last three digits of N with 
+ *		y = x - N*pi/2
+ * so that |y| < pi/2.
+ *
+ * The method is to compute the integer (mod 8) and fraction parts of 
+ * (2/pi)*x without doing the full multiplication. In general we
+ * skip the part of the product that are known to be a huge integer (
+ * more accurately, = 0 mod 8 ). Thus the number of operations are
+ * independent of the exponent of the input.
+ *
+ * (2/pi) is represented by an array of 24-bit integers in ipio2[].
+ *
+ * Input parameters:
+ * 	x[]	The input value (must be positive) is broken into nx 
+ *		pieces of 24-bit integers in double precision format.
+ *		x[i] will be the i-th 24 bit of x. The scaled exponent 
+ *		of x[0] is given in input parameter e0 (i.e., x[0]*2^e0 
+ *		match x's up to 24 bits.
+ *
+ *		Example of breaking a double positive z into x[0]+x[1]+x[2]:
+ *			e0 = ilogb(z)-23
+ *			z  = scalbn(z,-e0)
+ *		for i = 0,1,2
+ *			x[i] = floor(z)
+ *			z    = (z-x[i])*2**24
+ *
+ *
+ *	y[]	ouput result in an array of double precision numbers.
+ *		The dimension of y[] is:
+ *			24-bit  precision	1
+ *			53-bit  precision	2
+ *			64-bit  precision	2
+ *			113-bit precision	3
+ *		The actual value is the sum of them. Thus for 113-bit
+ *		precison, one may have to do something like:
+ *
+ *		long double t,w,r_head, r_tail;
+ *		t = (long double)y[2] + (long double)y[1];
+ *		w = (long double)y[0];
+ *		r_head = t+w;
+ *		r_tail = w - (r_head - t);
+ *
+ *	e0	The exponent of x[0]
+ *
+ *	nx	dimension of x[]
+ *
+ *  	prec	an integer indicating the precision:
+ *			0	24  bits (single)
+ *			1	53  bits (double)
+ *			2	64  bits (extended)
+ *			3	113 bits (quad)
+ *
+ *	ipio2[]
+ *		integer array, contains the (24*i)-th to (24*i+23)-th 
+ *		bit of 2/pi after binary point. The corresponding 
+ *		floating value is
+ *
+ *			ipio2[i] * 2^(-24(i+1)).
+ *
+ * External function:
+ *	double scalbn(), floor();
+ *
+ *
+ * Here is the description of some local variables:
+ *
+ * 	jk	jk+1 is the initial number of terms of ipio2[] needed
+ *		in the computation. The recommended value is 2,3,4,
+ *		6 for single, double, extended,and quad.
+ *
+ * 	jz	local integer variable indicating the number of 
+ *		terms of ipio2[] used. 
+ *
+ *	jx	nx - 1
+ *
+ *	jv	index for pointing to the suitable ipio2[] for the
+ *		computation. In general, we want
+ *			( 2^e0*x[0] * ipio2[jv-1]*2^(-24jv) )/8
+ *		is an integer. Thus
+ *			e0-3-24*jv >= 0 or (e0-3)/24 >= jv
+ *		Hence jv = max(0,(e0-3)/24).
+ *
+ *	jp	jp+1 is the number of terms in PIo2[] needed, jp = jk.
+ *
+ * 	q[]	double array with integral value, representing the
+ *		24-bits chunk of the product of x and 2/pi.
+ *
+ *	q0	the corresponding exponent of q[0]. Note that the
+ *		exponent for q[i] would be q0-24*i.
+ *
+ *	PIo2[]	double precision array, obtained by cutting pi/2
+ *		into 24 bits chunks. 
+ *
+ *	f[]	ipio2[] in floating point 
+ *
+ *	iq[]	integer array by breaking up q[] in 24-bits chunk.
+ *
+ *	fq[]	final product of x*(2/pi) in fq[0],..,fq[jk]
+ *
+ *	ih	integer. If >0 it indicates q[] is >= 0.5, hence
+ *		it also indicates the *sign* of the result.
+ *
+ */
+
+
+/*
+ * Constants:
+ * The hexadecimal values are the intended ones for the following 
+ * constants. The decimal values may be used, provided that the 
+ * compiler will convert from decimal to binary accurately enough 
+ * to produce the hexadecimal values shown.
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const int init_jk[] = {2,3,4,6}; /* initial value for jk */
+#else
+static int init_jk[] = {2,3,4,6}; 
+#endif
+
+#ifdef __STDC__
+static const double PIo2[] = {
+#else
+static double PIo2[] = {
+#endif
+  1.57079625129699707031e+00, /* 0x3FF921FB, 0x40000000 */
+  7.54978941586159635335e-08, /* 0x3E74442D, 0x00000000 */
+  5.39030252995776476554e-15, /* 0x3CF84698, 0x80000000 */
+  3.28200341580791294123e-22, /* 0x3B78CC51, 0x60000000 */
+  1.27065575308067607349e-29, /* 0x39F01B83, 0x80000000 */
+  1.22933308981111328932e-36, /* 0x387A2520, 0x40000000 */
+  2.73370053816464559624e-44, /* 0x36E38222, 0x80000000 */
+  2.16741683877804819444e-51, /* 0x3569F31D, 0x00000000 */
+};
+
+#ifdef __STDC__
+static const double			
+#else
+static double			
+#endif
+zero   = 0.0,
+one    = 1.0,
+two24   =  1.67772160000000000000e+07, /* 0x41700000, 0x00000000 */
+twon24  =  5.96046447753906250000e-08; /* 0x3E700000, 0x00000000 */
+
+#ifdef __STDC__
+	int __kernel_rem_pio2(double *x, double *y, int e0, int nx, int prec, const int *ipio2) 
+#else
+	int __kernel_rem_pio2(x,y,e0,nx,prec,ipio2) 	
+	double x[], y[]; int e0,nx,prec; int ipio2[];
+#endif
+{
+	int jz,jx,jv,jp,jk,carry,n,iq[20],i,j,k,m,q0,ih;
+	double z,fw,f[20],fq[20],q[20];
+
+    /* initialize jk*/
+	jk = init_jk[prec];
+	jp = jk;
+
+    /* determine jx,jv,q0, note that 3>q0 */
+	jx =  nx-1;
+	jv = (e0-3)/24; if(jv<0) jv=0;
+	q0 =  e0-24*(jv+1);
+
+    /* set up f[0] to f[jx+jk] where f[jx+jk] = ipio2[jv+jk] */
+	j = jv-jx; m = jx+jk;
+	for(i=0;i<=m;i++,j++) f[i] = (j<0)? zero : (double) ipio2[j];
+
+    /* compute q[0],q[1],...q[jk] */
+	for (i=0;i<=jk;i++) {
+	    for(j=0,fw=0.0;j<=jx;j++) fw += x[j]*f[jx+i-j]; q[i] = fw;
+	}
+
+	jz = jk;
+recompute:
+    /* distill q[] into iq[] reversingly */
+	for(i=0,j=jz,z=q[jz];j>0;i++,j--) {
+	    fw    =  (double)((int)(twon24* z));
+	    iq[i] =  (int)(z-two24*fw);
+	    z     =  q[j-1]+fw;
+	}
+
+    /* compute n */
+	z  = fd_scalbn(z,q0);		/* actual value of z */
+	z -= 8.0*fd_floor(z*0.125);		/* trim off integer >= 8 */
+	n  = (int) z;
+	z -= (double)n;
+	ih = 0;
+	if(q0>0) {	/* need iq[jz-1] to determine n */
+	    i  = (iq[jz-1]>>(24-q0)); n += i;
+	    iq[jz-1] -= i<<(24-q0);
+	    ih = iq[jz-1]>>(23-q0);
+	} 
+	else if(q0==0) ih = iq[jz-1]>>23;
+	else if(z>=0.5) ih=2;
+
+	if(ih>0) {	/* q > 0.5 */
+	    n += 1; carry = 0;
+	    for(i=0;i<jz ;i++) {	/* compute 1-q */
+		j = iq[i];
+		if(carry==0) {
+		    if(j!=0) {
+			carry = 1; iq[i] = 0x1000000- j;
+		    }
+		} else  iq[i] = 0xffffff - j;
+	    }
+	    if(q0>0) {		/* rare case: chance is 1 in 12 */
+	        switch(q0) {
+	        case 1:
+	    	   iq[jz-1] &= 0x7fffff; break;
+	    	case 2:
+	    	   iq[jz-1] &= 0x3fffff; break;
+	        }
+	    }
+	    if(ih==2) {
+		z = one - z;
+		if(carry!=0) z -= fd_scalbn(one,q0);
+	    }
+	}
+
+    /* check if recomputation is needed */
+	if(z==zero) {
+	    j = 0;
+	    for (i=jz-1;i>=jk;i--) j |= iq[i];
+	    if(j==0) { /* need recomputation */
+		for(k=1;iq[jk-k]==0;k++);   /* k = no. of terms needed */
+
+		for(i=jz+1;i<=jz+k;i++) {   /* add q[jz+1] to q[jz+k] */
+		    f[jx+i] = (double) ipio2[jv+i];
+		    for(j=0,fw=0.0;j<=jx;j++) fw += x[j]*f[jx+i-j];
+		    q[i] = fw;
+		}
+		jz += k;
+		goto recompute;
+	    }
+	}
+
+    /* chop off zero terms */
+	if(z==0.0) {
+	    jz -= 1; q0 -= 24;
+	    while(iq[jz]==0) { jz--; q0-=24;}
+	} else { /* break z into 24-bit if necessary */
+	    z = fd_scalbn(z,-q0);
+	    if(z>=two24) { 
+		fw = (double)((int)(twon24*z));
+		iq[jz] = (int)(z-two24*fw);
+		jz += 1; q0 += 24;
+		iq[jz] = (int) fw;
+	    } else iq[jz] = (int) z ;
+	}
+
+    /* convert integer "bit" chunk to floating-point value */
+	fw = fd_scalbn(one,q0);
+	for(i=jz;i>=0;i--) {
+	    q[i] = fw*(double)iq[i]; fw*=twon24;
+	}
+
+    /* compute PIo2[0,...,jp]*q[jz,...,0] */
+	for(i=jz;i>=0;i--) {
+	    for(fw=0.0,k=0;k<=jp&&k<=jz-i;k++) fw += PIo2[k]*q[i+k];
+	    fq[jz-i] = fw;
+	}
+
+    /* compress fq[] into y[] */
+	switch(prec) {
+	    case 0:
+		fw = 0.0;
+		for (i=jz;i>=0;i--) fw += fq[i];
+		y[0] = (ih==0)? fw: -fw; 
+		break;
+	    case 1:
+	    case 2:
+		fw = 0.0;
+		for (i=jz;i>=0;i--) fw += fq[i]; 
+		y[0] = (ih==0)? fw: -fw; 
+		fw = fq[0]-fw;
+		for (i=1;i<=jz;i++) fw += fq[i];
+		y[1] = (ih==0)? fw: -fw; 
+		break;
+	    case 3:	/* painful */
+		for (i=jz;i>0;i--) {
+		    fw      = fq[i-1]+fq[i]; 
+		    fq[i]  += fq[i-1]-fw;
+		    fq[i-1] = fw;
+		}
+		for (i=jz;i>1;i--) {
+		    fw      = fq[i-1]+fq[i]; 
+		    fq[i]  += fq[i-1]-fw;
+		    fq[i-1] = fw;
+		}
+		for (fw=0.0,i=jz;i>=2;i--) fw += fq[i]; 
+		if(ih==0) {
+		    y[0] =  fq[0]; y[1] =  fq[1]; y[2] =  fw;
+		} else {
+		    y[0] = -fq[0]; y[1] = -fq[1]; y[2] = -fw;
+		}
+	}
+	return n&7;
+}

mozilla/js/src/fdlibm/k_sin.c

@@ -0,0 +1,114 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * ***** BEGIN LICENSE BLOCK *****
+ * Version: MPL 1.1/GPL 2.0/LGPL 2.1
+ *
+ * The contents of this file are subject to the Mozilla Public License Version
+ * 1.1 (the "License"); you may not use this file except in compliance with
+ * the License. You may obtain a copy of the License at
+ * http://www.mozilla.org/MPL/
+ *
+ * Software distributed under the License is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+ * for the specific language governing rights and limitations under the
+ * License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is
+ * Sun Microsystems, Inc.
+ * Portions created by the Initial Developer are Copyright (C) 1998
+ * the Initial Developer. All Rights Reserved.
+ *
+ * Contributor(s):
+ *
+ * Alternatively, the contents of this file may be used under the terms of
+ * either of the GNU General Public License Version 2 or later (the "GPL"),
+ * or the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+ * in which case the provisions of the GPL or the LGPL are applicable instead
+ * of those above. If you wish to allow use of your version of this file only
+ * under the terms of either the GPL or the LGPL, and not to allow others to
+ * use your version of this file under the terms of the MPL, indicate your
+ * decision by deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL or the LGPL. If you do not delete
+ * the provisions above, a recipient may use your version of this file under
+ * the terms of any one of the MPL, the GPL or the LGPL.
+ *
+ * ***** END LICENSE BLOCK ***** */
+
+/* @(#)k_sin.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* __kernel_sin( x, y, iy)
+ * kernel sin function on [-pi/4, pi/4], pi/4 ~ 0.7854
+ * Input x is assumed to be bounded by ~pi/4 in magnitude.
+ * Input y is the tail of x.
+ * Input iy indicates whether y is 0. (if iy=0, y assume to be 0). 
+ *
+ * Algorithm
+ *	1. Since sin(-x) = -sin(x), we need only to consider positive x. 
+ *	2. if x < 2^-27 (hx<0x3e400000 0), return x with inexact if x!=0.
+ *	3. sin(x) is approximated by a polynomial of degree 13 on
+ *	   [0,pi/4]
+ *		  	         3            13
+ *	   	sin(x) ~ x + S1*x + ... + S6*x
+ *	   where
+ *	
+ * 	|sin(x)         2     4     6     8     10     12  |     -58
+ * 	|----- - (1+S1*x +S2*x +S3*x +S4*x +S5*x  +S6*x   )| <= 2
+ * 	|  x 					           | 
+ * 
+ *	4. sin(x+y) = sin(x) + sin'(x')*y
+ *		    ~ sin(x) + (1-x*x/2)*y
+ *	   For better accuracy, let 
+ *		     3      2      2      2      2
+ *		r = x *(S2+x *(S3+x *(S4+x *(S5+x *S6))))
+ *	   then                   3    2
+ *		sin(x) = x + (S1*x + (x *(r-y/2)+y))
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double 
+#else
+static double 
+#endif
+half =  5.00000000000000000000e-01, /* 0x3FE00000, 0x00000000 */
+S1  = -1.66666666666666324348e-01, /* 0xBFC55555, 0x55555549 */
+S2  =  8.33333333332248946124e-03, /* 0x3F811111, 0x1110F8A6 */
+S3  = -1.98412698298579493134e-04, /* 0xBF2A01A0, 0x19C161D5 */
+S4  =  2.75573137070700676789e-06, /* 0x3EC71DE3, 0x57B1FE7D */
+S5  = -2.50507602534068634195e-08, /* 0xBE5AE5E6, 0x8A2B9CEB */
+S6  =  1.58969099521155010221e-10; /* 0x3DE5D93A, 0x5ACFD57C */
+
+#ifdef __STDC__
+	double __kernel_sin(double x, double y, int iy)
+#else
+	double __kernel_sin(x, y, iy)
+	double x,y; int iy;		/* iy=0 if y is zero */
+#endif
+{
+        fd_twoints u;
+	double z,r,v;
+	int ix;
+        u.d = x;
+	ix = __HI(u)&0x7fffffff;	/* high word of x */
+	if(ix<0x3e400000)			/* |x| < 2**-27 */
+	   {if((int)x==0) return x;}		/* generate inexact */
+	z	=  x*x;
+	v	=  z*x;
+	r	=  S2+z*(S3+z*(S4+z*(S5+z*S6)));
+	if(iy==0) return x+v*(S1+z*r);
+	else      return x-((z*(half*y-v*r)-y)-v*S1);
+}

mozilla/js/src/fdlibm/k_standard.c

@@ -0,0 +1,785 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * ***** BEGIN LICENSE BLOCK *****
+ * Version: MPL 1.1/GPL 2.0/LGPL 2.1
+ *
+ * The contents of this file are subject to the Mozilla Public License Version
+ * 1.1 (the "License"); you may not use this file except in compliance with
+ * the License. You may obtain a copy of the License at
+ * http://www.mozilla.org/MPL/
+ *
+ * Software distributed under the License is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+ * for the specific language governing rights and limitations under the
+ * License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is
+ * Sun Microsystems, Inc.
+ * Portions created by the Initial Developer are Copyright (C) 1998
+ * the Initial Developer. All Rights Reserved.
+ *
+ * Contributor(s):
+ *
+ * Alternatively, the contents of this file may be used under the terms of
+ * either of the GNU General Public License Version 2 or later (the "GPL"),
+ * or the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+ * in which case the provisions of the GPL or the LGPL are applicable instead
+ * of those above. If you wish to allow use of your version of this file only
+ * under the terms of either the GPL or the LGPL, and not to allow others to
+ * use your version of this file under the terms of the MPL, indicate your
+ * decision by deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL or the LGPL. If you do not delete
+ * the provisions above, a recipient may use your version of this file under
+ * the terms of any one of the MPL, the GPL or the LGPL.
+ *
+ * ***** END LICENSE BLOCK ***** */
+
+/* @(#)k_standard.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ *
+ */
+
+#include "fdlibm.h"
+
+/* XXX ugly hack to get msvc to link without error. */
+#if _LIB_VERSION == _IEEE_ && !(defined(DARWIN) || defined(XP_MACOSX))
+   int errno;
+#  define EDOM 0
+#  define ERANGE 0
+#else
+#  include <errno.h>
+#endif
+
+
+#ifndef _USE_WRITE
+#include <stdio.h>			/* fputs(), stderr */
+#define	WRITE2(u,v)	fputs(u, stderr)
+#else	/* !defined(_USE_WRITE) */
+#include <unistd.h>			/* write */
+#define	WRITE2(u,v)	write(2, u, v)
+#undef fflush
+#endif	/* !defined(_USE_WRITE) */
+
+static double zero = 0.0;	/* used as const */
+
+/* 
+ * Standard conformance (non-IEEE) on exception cases.
+ * Mapping:
+ *	1 -- acos(|x|>1)
+ *	2 -- asin(|x|>1)
+ *	3 -- atan2(+-0,+-0)
+ *	4 -- hypot overflow
+ *	5 -- cosh overflow
+ *	6 -- exp overflow
+ *	7 -- exp underflow
+ *	8 -- y0(0)
+ *	9 -- y0(-ve)
+ *	10-- y1(0)
+ *	11-- y1(-ve)
+ *	12-- yn(0)
+ *	13-- yn(-ve)
+ *	14-- lgamma(finite) overflow
+ *	15-- lgamma(-integer)
+ *	16-- log(0)
+ *	17-- log(x<0)
+ *	18-- log10(0)
+ *	19-- log10(x<0)
+ *	20-- pow(0.0,0.0)
+ *	21-- pow(x,y) overflow
+ *	22-- pow(x,y) underflow
+ *	23-- pow(0,negative) 
+ *	24-- pow(neg,non-integral)
+ *	25-- sinh(finite) overflow
+ *	26-- sqrt(negative)
+ *      27-- fmod(x,0)
+ *      28-- remainder(x,0)
+ *	29-- acosh(x<1)
+ *	30-- atanh(|x|>1)
+ *	31-- atanh(|x|=1)
+ *	32-- scalb overflow
+ *	33-- scalb underflow
+ *	34-- j0(|x|>X_TLOSS)
+ *	35-- y0(x>X_TLOSS)
+ *	36-- j1(|x|>X_TLOSS)
+ *	37-- y1(x>X_TLOSS)
+ *	38-- jn(|x|>X_TLOSS, n)
+ *	39-- yn(x>X_TLOSS, n)
+ *	40-- gamma(finite) overflow
+ *	41-- gamma(-integer)
+ *	42-- pow(NaN,0.0)
+ */
+
+
+#ifdef __STDC__
+	double __kernel_standard(double x, double y, int type, int *err)
+#else
+	double __kernel_standard(x,y,type, err)
+     double x,y; int type;int *err;
+#endif
+{
+	struct exception exc;
+#ifndef HUGE_VAL	/* this is the only routine that uses HUGE_VAL */ 
+#define HUGE_VAL inf
+	double inf = 0.0;
+        fd_twoints u;
+
+        u.d = inf;
+	__HI(u) = 0x7ff00000;	/* set inf to infinite */
+        inf = u.d;
+#endif
+
+    *err = 0;
+
+#ifdef _USE_WRITE
+	(void) fflush(stdout);
+#endif
+	exc.arg1 = x;
+	exc.arg2 = y;
+	switch(type) {
+	    case 1:
+		/* acos(|x|>1) */
+		exc.type = DOMAIN;
+		exc.name = "acos";
+		exc.retval = zero;
+		if (_LIB_VERSION == _POSIX_)
+		  *err = EDOM;
+		else if (!fd_matherr(&exc)) {
+		  if(_LIB_VERSION == _SVID_) {
+		    (void) WRITE2("acos: DOMAIN error\n", 19);
+		  }
+		  *err = EDOM;
+		}
+		break;
+	    case 2:
+		/* asin(|x|>1) */
+		exc.type = DOMAIN;
+		exc.name = "asin";
+		exc.retval = zero;
+		if(_LIB_VERSION == _POSIX_)
+		  *err = EDOM;
+		else if (!fd_matherr(&exc)) {
+		  if(_LIB_VERSION == _SVID_) {
+		    	(void) WRITE2("asin: DOMAIN error\n", 19);
+		  }
+		  *err = EDOM;
+		}
+		break;
+	    case 3:
+		/* atan2(+-0,+-0) */
+		exc.arg1 = y;
+		exc.arg2 = x;
+		exc.type = DOMAIN;
+		exc.name = "atan2";
+		exc.retval = zero;
+		if(_LIB_VERSION == _POSIX_)
+		  *err = EDOM;
+		else if (!fd_matherr(&exc)) {
+		  if(_LIB_VERSION == _SVID_) {
+			(void) WRITE2("atan2: DOMAIN error\n", 20);
+		      }
+		  *err = EDOM;
+		}
+		break;
+	    case 4:
+		/* hypot(finite,finite) overflow */
+		exc.type = OVERFLOW;
+		exc.name = "hypot";
+		if (_LIB_VERSION == _SVID_)
+		  exc.retval = HUGE;
+		else
+		  exc.retval = HUGE_VAL;
+		if (_LIB_VERSION == _POSIX_)
+		  *err = ERANGE;
+		else if (!fd_matherr(&exc)) {
+			*err = ERANGE;
+		}
+		break;
+	    case 5:
+		/* cosh(finite) overflow */
+		exc.type = OVERFLOW;
+		exc.name = "cosh";
+		if (_LIB_VERSION == _SVID_)
+		  exc.retval = HUGE;
+		else
+		  exc.retval = HUGE_VAL;
+		if (_LIB_VERSION == _POSIX_)
+		  *err = ERANGE;
+		else if (!fd_matherr(&exc)) {
+			*err = ERANGE;
+		}
+		break;
+	    case 6:
+		/* exp(finite) overflow */
+		exc.type = OVERFLOW;
+		exc.name = "exp";
+		if (_LIB_VERSION == _SVID_)
+		  exc.retval = HUGE;
+		else
+		  exc.retval = HUGE_VAL;
+		if (_LIB_VERSION == _POSIX_)
+		  *err = ERANGE;
+		else if (!fd_matherr(&exc)) {
+			*err = ERANGE;
+		}
+		break;
+	    case 7:
+		/* exp(finite) underflow */
+		exc.type = UNDERFLOW;
+		exc.name = "exp";
+		exc.retval = zero;
+		if (_LIB_VERSION == _POSIX_)
+		  *err = ERANGE;
+		else if (!fd_matherr(&exc)) {
+			*err = ERANGE;
+		}
+		break;
+	    case 8:
+		/* y0(0) = -inf */
+		exc.type = DOMAIN;	/* should be SING for IEEE */
+		exc.name = "y0";
+		if (_LIB_VERSION == _SVID_)
+		  exc.retval = -HUGE;
+		else
+		  exc.retval = -HUGE_VAL;
+		if (_LIB_VERSION == _POSIX_)
+		  *err = EDOM;
+		else if (!fd_matherr(&exc)) {
+		  if (_LIB_VERSION == _SVID_) {
+			(void) WRITE2("y0: DOMAIN error\n", 17);
+		      }
+		  *err = EDOM;
+		}
+		break;
+	    case 9:
+		/* y0(x<0) = NaN */
+		exc.type = DOMAIN;
+		exc.name = "y0";
+		if (_LIB_VERSION == _SVID_)
+		  exc.retval = -HUGE;
+		else
+		  exc.retval = -HUGE_VAL;
+		if (_LIB_VERSION == _POSIX_)
+		  *err = EDOM;
+		else if (!fd_matherr(&exc)) {
+		  if (_LIB_VERSION == _SVID_) {
+			(void) WRITE2("y0: DOMAIN error\n", 17);
+		      }
+		  *err = EDOM;
+		}
+		break;
+	    case 10:
+		/* y1(0) = -inf */
+		exc.type = DOMAIN;	/* should be SING for IEEE */
+		exc.name = "y1";
+		if (_LIB_VERSION == _SVID_)
+		  exc.retval = -HUGE;
+		else
+		  exc.retval = -HUGE_VAL;
+		if (_LIB_VERSION == _POSIX_)
+		  *err = EDOM;
+		else if (!fd_matherr(&exc)) {
+		  if (_LIB_VERSION == _SVID_) {
+			(void) WRITE2("y1: DOMAIN error\n", 17);
+		      }
+		  *err = EDOM;
+		}
+		break;
+	    case 11:
+		/* y1(x<0) = NaN */
+		exc.type = DOMAIN;
+		exc.name = "y1";
+		if (_LIB_VERSION == _SVID_)
+		  exc.retval = -HUGE;
+		else
+		  exc.retval = -HUGE_VAL;
+		if (_LIB_VERSION == _POSIX_)
+		  *err = EDOM;
+		else if (!fd_matherr(&exc)) {
+		  if (_LIB_VERSION == _SVID_) {
+			(void) WRITE2("y1: DOMAIN error\n", 17);
+		      }
+		  *err = EDOM;
+		}
+		break;
+	    case 12:
+		/* yn(n,0) = -inf */
+		exc.type = DOMAIN;	/* should be SING for IEEE */
+		exc.name = "yn";
+		if (_LIB_VERSION == _SVID_)
+		  exc.retval = -HUGE;
+		else
+		  exc.retval = -HUGE_VAL;
+		if (_LIB_VERSION == _POSIX_)
+		  *err = EDOM;
+		else if (!fd_matherr(&exc)) {
+		  if (_LIB_VERSION == _SVID_) {
+			(void) WRITE2("yn: DOMAIN error\n", 17);
+		      }
+		  *err = EDOM;
+		}
+		break;
+	    case 13:
+		/* yn(x<0) = NaN */
+		exc.type = DOMAIN;
+		exc.name = "yn";
+		if (_LIB_VERSION == _SVID_)
+		  exc.retval = -HUGE;
+		else
+		  exc.retval = -HUGE_VAL;
+		if (_LIB_VERSION == _POSIX_)
+		  *err = EDOM;
+		else if (!fd_matherr(&exc)) {
+		  if (_LIB_VERSION == _SVID_) {
+			(void) WRITE2("yn: DOMAIN error\n", 17);
+		      }
+		  *err = EDOM;
+		}
+		break;
+	    case 14:
+		/* lgamma(finite) overflow */
+		exc.type = OVERFLOW;
+		exc.name = "lgamma";
+                if (_LIB_VERSION == _SVID_)
+                  exc.retval = HUGE;
+                else
+                  exc.retval = HUGE_VAL;
+                if (_LIB_VERSION == _POSIX_)
+			*err = ERANGE;
+                else if (!fd_matherr(&exc)) {
+                        *err = ERANGE;
+		}
+		break;
+	    case 15:
+		/* lgamma(-integer) or lgamma(0) */
+		exc.type = SING;
+		exc.name = "lgamma";
+                if (_LIB_VERSION == _SVID_)
+                  exc.retval = HUGE;
+                else
+                  exc.retval = HUGE_VAL;
+		if (_LIB_VERSION == _POSIX_)
+		  *err = EDOM;
+		else if (!fd_matherr(&exc)) {
+		  if (_LIB_VERSION == _SVID_) {
+			(void) WRITE2("lgamma: SING error\n", 19);
+		      }
+		  *err = EDOM;
+		}
+		break;
+	    case 16:
+		/* log(0) */
+		exc.type = SING;
+		exc.name = "log";
+		if (_LIB_VERSION == _SVID_)
+		  exc.retval = -HUGE;
+		else
+		  exc.retval = -HUGE_VAL;
+		if (_LIB_VERSION == _POSIX_)
+		  *err = ERANGE;
+		else if (!fd_matherr(&exc)) {
+		  if (_LIB_VERSION == _SVID_) {
+			(void) WRITE2("log: SING error\n", 16);
+		      }
+		  *err = EDOM;
+		}
+		break;
+	    case 17:
+		/* log(x<0) */
+		exc.type = DOMAIN;
+		exc.name = "log";
+		if (_LIB_VERSION == _SVID_)
+		  exc.retval = -HUGE;
+		else
+		  exc.retval = -HUGE_VAL;
+		if (_LIB_VERSION == _POSIX_)
+		  *err = EDOM;
+		else if (!fd_matherr(&exc)) {
+		  if (_LIB_VERSION == _SVID_) {
+			(void) WRITE2("log: DOMAIN error\n", 18);
+		      }
+		  *err = EDOM;
+		}
+		break;
+	    case 18:
+		/* log10(0) */
+		exc.type = SING;
+		exc.name = "log10";
+		if (_LIB_VERSION == _SVID_)
+		  exc.retval = -HUGE;
+		else
+		  exc.retval = -HUGE_VAL;
+		if (_LIB_VERSION == _POSIX_)
+		  *err = ERANGE;
+		else if (!fd_matherr(&exc)) {
+		  if (_LIB_VERSION == _SVID_) {
+			(void) WRITE2("log10: SING error\n", 18);
+		      }
+		  *err = EDOM;
+		}
+		break;
+	    case 19:
+		/* log10(x<0) */
+		exc.type = DOMAIN;
+		exc.name = "log10";
+		if (_LIB_VERSION == _SVID_)
+		  exc.retval = -HUGE;
+		else
+		  exc.retval = -HUGE_VAL;
+		if (_LIB_VERSION == _POSIX_)
+		  *err = EDOM;
+		else if (!fd_matherr(&exc)) {
+		  if (_LIB_VERSION == _SVID_) {
+			(void) WRITE2("log10: DOMAIN error\n", 20);
+		      }
+		  *err = EDOM;
+		}
+		break;
+	    case 20:
+		/* pow(0.0,0.0) */
+		/* error only if _LIB_VERSION == _SVID_ */
+		exc.type = DOMAIN;
+		exc.name = "pow";
+		exc.retval = zero;
+		if (_LIB_VERSION != _SVID_) exc.retval = 1.0;
+		else if (!fd_matherr(&exc)) {
+			(void) WRITE2("pow(0,0): DOMAIN error\n", 23);
+			*err = EDOM;
+		}
+		break;
+	    case 21:
+		/* pow(x,y) overflow */
+		exc.type = OVERFLOW;
+		exc.name = "pow";
+		if (_LIB_VERSION == _SVID_) {
+		  exc.retval = HUGE;
+		  y *= 0.5;
+		  if(x<zero&&fd_rint(y)!=y) exc.retval = -HUGE;
+		} else {
+		  exc.retval = HUGE_VAL;
+		  y *= 0.5;
+		  if(x<zero&&fd_rint(y)!=y) exc.retval = -HUGE_VAL;
+		}
+		if (_LIB_VERSION == _POSIX_)
+		  *err = ERANGE;
+		else if (!fd_matherr(&exc)) {
+			*err = ERANGE;
+		}
+		break;
+	    case 22:
+		/* pow(x,y) underflow */
+		exc.type = UNDERFLOW;
+		exc.name = "pow";
+		exc.retval =  zero;
+		if (_LIB_VERSION == _POSIX_)
+		  *err = ERANGE;
+		else if (!fd_matherr(&exc)) {
+			*err = ERANGE;
+		}
+		break;
+	    case 23:
+		/* 0**neg */
+		exc.type = DOMAIN;
+		exc.name = "pow";
+		if (_LIB_VERSION == _SVID_) 
+		  exc.retval = zero;
+		else
+		  exc.retval = -HUGE_VAL;
+		if (_LIB_VERSION == _POSIX_)
+		  *err = EDOM;
+		else if (!fd_matherr(&exc)) {
+		  if (_LIB_VERSION == _SVID_) {
+			(void) WRITE2("pow(0,neg): DOMAIN error\n", 25);
+		      }
+		  *err = EDOM;
+		}
+		break;
+	    case 24:
+		/* neg**non-integral */
+		exc.type = DOMAIN;
+		exc.name = "pow";
+		if (_LIB_VERSION == _SVID_) 
+		    exc.retval = zero;
+		else 
+		    exc.retval = zero/zero;	/* X/Open allow NaN */
+		if (_LIB_VERSION == _POSIX_) 
+		   *err = EDOM;
+		else if (!fd_matherr(&exc)) {
+		  if (_LIB_VERSION == _SVID_) {
+			(void) WRITE2("neg**non-integral: DOMAIN error\n", 32);
+		      }
+		  *err = EDOM;
+		}
+		break;
+	    case 25:
+		/* sinh(finite) overflow */
+		exc.type = OVERFLOW;
+		exc.name = "sinh";
+		if (_LIB_VERSION == _SVID_)
+		  exc.retval = ( (x>zero) ? HUGE : -HUGE);
+		else
+		  exc.retval = ( (x>zero) ? HUGE_VAL : -HUGE_VAL);
+		if (_LIB_VERSION == _POSIX_)
+		  *err = ERANGE;
+		else if (!fd_matherr(&exc)) {
+			*err = ERANGE;
+		}
+		break;
+	    case 26:
+		/* sqrt(x<0) */
+		exc.type = DOMAIN;
+		exc.name = "sqrt";
+		if (_LIB_VERSION == _SVID_)
+		  exc.retval = zero;
+		else
+		  exc.retval = zero/zero;
+		if (_LIB_VERSION == _POSIX_)
+		  *err = EDOM;
+		else if (!fd_matherr(&exc)) {
+		  if (_LIB_VERSION == _SVID_) {
+			(void) WRITE2("sqrt: DOMAIN error\n", 19);
+		      }
+		  *err = EDOM;
+		}
+		break;
+            case 27:
+                /* fmod(x,0) */
+                exc.type = DOMAIN;
+                exc.name = "fmod";
+                if (_LIB_VERSION == _SVID_)
+                    exc.retval = x;
+		else
+		    exc.retval = zero/zero;
+                if (_LIB_VERSION == _POSIX_)
+                  *err = EDOM;
+                else if (!fd_matherr(&exc)) {
+                  if (_LIB_VERSION == _SVID_) {
+                    (void) WRITE2("fmod:  DOMAIN error\n", 20);
+                  }
+                  *err = EDOM;
+                }
+                break;
+            case 28:
+                /* remainder(x,0) */
+                exc.type = DOMAIN;
+                exc.name = "remainder";
+                exc.retval = zero/zero;
+                if (_LIB_VERSION == _POSIX_)
+                  *err = EDOM;
+                else if (!fd_matherr(&exc)) {
+                  if (_LIB_VERSION == _SVID_) {
+                    (void) WRITE2("remainder: DOMAIN error\n", 24);
+                  }
+                  *err = EDOM;
+                }
+                break;
+            case 29:
+                /* acosh(x<1) */
+                exc.type = DOMAIN;
+                exc.name = "acosh";
+                exc.retval = zero/zero;
+                if (_LIB_VERSION == _POSIX_)
+                  *err = EDOM;
+                else if (!fd_matherr(&exc)) {
+                  if (_LIB_VERSION == _SVID_) {
+                    (void) WRITE2("acosh: DOMAIN error\n", 20);
+                  }
+                  *err = EDOM;
+                }
+                break;
+            case 30:
+                /* atanh(|x|>1) */
+                exc.type = DOMAIN;
+                exc.name = "atanh";
+                exc.retval = zero/zero;
+                if (_LIB_VERSION == _POSIX_)
+                  *err = EDOM;
+                else if (!fd_matherr(&exc)) {
+                  if (_LIB_VERSION == _SVID_) {
+                    (void) WRITE2("atanh: DOMAIN error\n", 20);
+                  }
+                  *err = EDOM;
+                }
+                break;
+            case 31:
+                /* atanh(|x|=1) */
+                exc.type = SING;
+                exc.name = "atanh";
+		exc.retval = x/zero;	/* sign(x)*inf */
+                if (_LIB_VERSION == _POSIX_)
+                  *err = EDOM;
+                else if (!fd_matherr(&exc)) {
+                  if (_LIB_VERSION == _SVID_) {
+                    (void) WRITE2("atanh: SING error\n", 18);
+                  }
+                  *err = EDOM;
+                }
+                break;
+	    case 32:
+		/* scalb overflow; SVID also returns +-HUGE_VAL */
+		exc.type = OVERFLOW;
+		exc.name = "scalb";
+		exc.retval = x > zero ? HUGE_VAL : -HUGE_VAL;
+		if (_LIB_VERSION == _POSIX_)
+		  *err = ERANGE;
+		else if (!fd_matherr(&exc)) {
+			*err = ERANGE;
+		}
+		break;
+	    case 33:
+		/* scalb underflow */
+		exc.type = UNDERFLOW;
+		exc.name = "scalb";
+		exc.retval = fd_copysign(zero,x);
+		if (_LIB_VERSION == _POSIX_)
+		  *err = ERANGE;
+		else if (!fd_matherr(&exc)) {
+			*err = ERANGE;
+		}
+		break;
+	    case 34:
+		/* j0(|x|>X_TLOSS) */
+                exc.type = TLOSS;
+                exc.name = "j0";
+                exc.retval = zero;
+                if (_LIB_VERSION == _POSIX_)
+                        *err = ERANGE;
+                else if (!fd_matherr(&exc)) {
+                        if (_LIB_VERSION == _SVID_) {
+                                (void) WRITE2(exc.name, 2);
+                                (void) WRITE2(": TLOSS error\n", 14);
+                        }
+                        *err = ERANGE;
+                }        
+		break;
+	    case 35:
+		/* y0(x>X_TLOSS) */
+                exc.type = TLOSS;
+                exc.name = "y0";
+                exc.retval = zero;
+                if (_LIB_VERSION == _POSIX_)
+                        *err = ERANGE;
+                else if (!fd_matherr(&exc)) {
+                        if (_LIB_VERSION == _SVID_) {
+                                (void) WRITE2(exc.name, 2);
+                                (void) WRITE2(": TLOSS error\n", 14);
+                        }
+                        *err = ERANGE;
+                }        
+		break;
+	    case 36:
+		/* j1(|x|>X_TLOSS) */
+                exc.type = TLOSS;
+                exc.name = "j1";
+                exc.retval = zero;
+                if (_LIB_VERSION == _POSIX_)
+                        *err = ERANGE;
+                else if (!fd_matherr(&exc)) {
+                        if (_LIB_VERSION == _SVID_) {
+                                (void) WRITE2(exc.name, 2);
+                                (void) WRITE2(": TLOSS error\n", 14);
+                        }
+                        *err = ERANGE;
+                }        
+		break;
+	    case 37:
+		/* y1(x>X_TLOSS) */
+                exc.type = TLOSS;
+                exc.name = "y1";
+                exc.retval = zero;
+                if (_LIB_VERSION == _POSIX_)
+                        *err = ERANGE;
+                else if (!fd_matherr(&exc)) {
+                        if (_LIB_VERSION == _SVID_) {
+                                (void) WRITE2(exc.name, 2);
+                                (void) WRITE2(": TLOSS error\n", 14);
+                        }
+                        *err = ERANGE;
+                }        
+		break;
+	    case 38:
+		/* jn(|x|>X_TLOSS) */
+                exc.type = TLOSS;
+                exc.name = "jn";
+                exc.retval = zero;
+                if (_LIB_VERSION == _POSIX_)
+                        *err = ERANGE;
+                else if (!fd_matherr(&exc)) {
+                        if (_LIB_VERSION == _SVID_) {
+                                (void) WRITE2(exc.name, 2);
+                                (void) WRITE2(": TLOSS error\n", 14);
+                        }
+                        *err = ERANGE;
+                }        
+		break;
+	    case 39:
+		/* yn(x>X_TLOSS) */
+                exc.type = TLOSS;
+                exc.name = "yn";
+                exc.retval = zero;
+                if (_LIB_VERSION == _POSIX_)
+                        *err = ERANGE;
+                else if (!fd_matherr(&exc)) {
+                        if (_LIB_VERSION == _SVID_) {
+                                (void) WRITE2(exc.name, 2);
+                                (void) WRITE2(": TLOSS error\n", 14);
+                        }
+                        *err = ERANGE;
+                }        
+		break;
+	    case 40:
+		/* gamma(finite) overflow */
+		exc.type = OVERFLOW;
+		exc.name = "gamma";
+                if (_LIB_VERSION == _SVID_)
+                  exc.retval = HUGE;
+                else
+                  exc.retval = HUGE_VAL;
+                if (_LIB_VERSION == _POSIX_)
+		  *err = ERANGE;
+                else if (!fd_matherr(&exc)) {
+                  *err = ERANGE;
+                }
+		break;
+	    case 41:
+		/* gamma(-integer) or gamma(0) */
+		exc.type = SING;
+		exc.name = "gamma";
+                if (_LIB_VERSION == _SVID_)
+                  exc.retval = HUGE;
+                else
+                  exc.retval = HUGE_VAL;
+		if (_LIB_VERSION == _POSIX_)
+		  *err = EDOM;
+		else if (!fd_matherr(&exc)) {
+		  if (_LIB_VERSION == _SVID_) {
+			(void) WRITE2("gamma: SING error\n", 18);
+		      }
+		  *err = EDOM;
+		}
+		break;
+	    case 42:
+		/* pow(NaN,0.0) */
+		/* error only if _LIB_VERSION == _SVID_ & _XOPEN_ */
+		exc.type = DOMAIN;
+		exc.name = "pow";
+		exc.retval = x;
+		if (_LIB_VERSION == _IEEE_ ||
+		    _LIB_VERSION == _POSIX_) exc.retval = 1.0;
+		else if (!fd_matherr(&exc)) {
+			*err = EDOM;
+		}
+		break;
+	}
+	return exc.retval; 
+}

mozilla/js/src/fdlibm/k_tan.c

@@ -0,0 +1,170 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * ***** BEGIN LICENSE BLOCK *****
+ * Version: MPL 1.1/GPL 2.0/LGPL 2.1
+ *
+ * The contents of this file are subject to the Mozilla Public License Version
+ * 1.1 (the "License"); you may not use this file except in compliance with
+ * the License. You may obtain a copy of the License at
+ * http://www.mozilla.org/MPL/
+ *
+ * Software distributed under the License is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+ * for the specific language governing rights and limitations under the
+ * License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is
+ * Sun Microsystems, Inc.
+ * Portions created by the Initial Developer are Copyright (C) 1998
+ * the Initial Developer. All Rights Reserved.
+ *
+ * Contributor(s):
+ *
+ * Alternatively, the contents of this file may be used under the terms of
+ * either of the GNU General Public License Version 2 or later (the "GPL"),
+ * or the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+ * in which case the provisions of the GPL or the LGPL are applicable instead
+ * of those above. If you wish to allow use of your version of this file only
+ * under the terms of either the GPL or the LGPL, and not to allow others to
+ * use your version of this file under the terms of the MPL, indicate your
+ * decision by deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL or the LGPL. If you do not delete
+ * the provisions above, a recipient may use your version of this file under
+ * the terms of any one of the MPL, the GPL or the LGPL.
+ *
+ * ***** END LICENSE BLOCK ***** */
+
+/* @(#)k_tan.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* __kernel_tan( x, y, k )
+ * kernel tan function on [-pi/4, pi/4], pi/4 ~ 0.7854
+ * Input x is assumed to be bounded by ~pi/4 in magnitude.
+ * Input y is the tail of x.
+ * Input k indicates whether tan (if k=1) or 
+ * -1/tan (if k= -1) is returned.
+ *
+ * Algorithm
+ *	1. Since tan(-x) = -tan(x), we need only to consider positive x. 
+ *	2. if x < 2^-28 (hx<0x3e300000 0), return x with inexact if x!=0.
+ *	3. tan(x) is approximated by a odd polynomial of degree 27 on
+ *	   [0,0.67434]
+ *		  	         3             27
+ *	   	tan(x) ~ x + T1*x + ... + T13*x
+ *	   where
+ *	
+ * 	        |tan(x)         2     4            26   |     -59.2
+ * 	        |----- - (1+T1*x +T2*x +.... +T13*x    )| <= 2
+ * 	        |  x 					| 
+ * 
+ *	   Note: tan(x+y) = tan(x) + tan'(x)*y
+ *		          ~ tan(x) + (1+x*x)*y
+ *	   Therefore, for better accuracy in computing tan(x+y), let 
+ *		     3      2      2       2       2
+ *		r = x *(T2+x *(T3+x *(...+x *(T12+x *T13))))
+ *	   then
+ *		 		    3    2
+ *		tan(x+y) = x + (T1*x + (x *(r+y)+y))
+ *
+ *      4. For x in [0.67434,pi/4],  let y = pi/4 - x, then
+ *		tan(x) = tan(pi/4-y) = (1-tan(y))/(1+tan(y))
+ *		       = 1 - 2*(tan(y) - (tan(y)^2)/(1+tan(y)))
+ */
+
+#include "fdlibm.h"
+#ifdef __STDC__
+static const double 
+#else
+static double 
+#endif
+one   =  1.00000000000000000000e+00, /* 0x3FF00000, 0x00000000 */
+pio4  =  7.85398163397448278999e-01, /* 0x3FE921FB, 0x54442D18 */
+pio4lo=  3.06161699786838301793e-17, /* 0x3C81A626, 0x33145C07 */
+T[] =  {
+  3.33333333333334091986e-01, /* 0x3FD55555, 0x55555563 */
+  1.33333333333201242699e-01, /* 0x3FC11111, 0x1110FE7A */
+  5.39682539762260521377e-02, /* 0x3FABA1BA, 0x1BB341FE */
+  2.18694882948595424599e-02, /* 0x3F9664F4, 0x8406D637 */
+  8.86323982359930005737e-03, /* 0x3F8226E3, 0xE96E8493 */
+  3.59207910759131235356e-03, /* 0x3F6D6D22, 0xC9560328 */
+  1.45620945432529025516e-03, /* 0x3F57DBC8, 0xFEE08315 */
+  5.88041240820264096874e-04, /* 0x3F4344D8, 0xF2F26501 */
+  2.46463134818469906812e-04, /* 0x3F3026F7, 0x1A8D1068 */
+  7.81794442939557092300e-05, /* 0x3F147E88, 0xA03792A6 */
+  7.14072491382608190305e-05, /* 0x3F12B80F, 0x32F0A7E9 */
+ -1.85586374855275456654e-05, /* 0xBEF375CB, 0xDB605373 */
+  2.59073051863633712884e-05, /* 0x3EFB2A70, 0x74BF7AD4 */
+};
+
+#ifdef __STDC__
+	double __kernel_tan(double x, double y, int iy)
+#else
+	double __kernel_tan(x, y, iy)
+	double x,y; int iy;
+#endif
+{
+        fd_twoints u;
+	double z,r,v,w,s;
+	int ix,hx;
+        u.d = x;
+	hx = __HI(u);	/* high word of x */
+	ix = hx&0x7fffffff;	/* high word of |x| */
+	if(ix<0x3e300000)			/* x < 2**-28 */
+	    {if((int)x==0) {			/* generate inexact */
+                u.d =x;
+		if(((ix|__LO(u))|(iy+1))==0) return one/fd_fabs(x);
+		else return (iy==1)? x: -one/x;
+	    }
+	    }
+	if(ix>=0x3FE59428) { 			/* |x|>=0.6744 */
+	    if(hx<0) {x = -x; y = -y;}
+	    z = pio4-x;
+	    w = pio4lo-y;
+	    x = z+w; y = 0.0;
+	}
+	z	=  x*x;
+	w 	=  z*z;
+    /* Break x^5*(T[1]+x^2*T[2]+...) into
+     *	  x^5(T[1]+x^4*T[3]+...+x^20*T[11]) +
+     *	  x^5(x^2*(T[2]+x^4*T[4]+...+x^22*[T12]))
+     */
+	r = T[1]+w*(T[3]+w*(T[5]+w*(T[7]+w*(T[9]+w*T[11]))));
+	v = z*(T[2]+w*(T[4]+w*(T[6]+w*(T[8]+w*(T[10]+w*T[12])))));
+	s = z*x;
+	r = y + z*(s*(r+v)+y);
+	r += T[0]*s;
+	w = x+r;
+	if(ix>=0x3FE59428) {
+	    v = (double)iy;
+	    return (double)(1-((hx>>30)&2))*(v-2.0*(x-(w*w/(w+v)-r)));
+	}
+	if(iy==1) return w;
+	else {		/* if allow error up to 2 ulp, 
+			   simply return -1.0/(x+r) here */
+     /*  compute -1.0/(x+r) accurately */
+	    double a,t;
+	    z  = w;
+            u.d = z;
+	    __LO(u) = 0;
+            z = u.d;
+	    v  = r-(z - x); 	/* z+v = r+x */
+	    t = a  = -1.0/w;	/* a = -1.0/w */
+            u.d = t;
+	    __LO(u) = 0;
+            t = u.d;
+	    s  = 1.0+t*z;
+	    return t+a*(s+t*v);
+	}
+}

mozilla/js/src/fdlibm/s_asinh.c

@@ -0,0 +1,101 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * ***** BEGIN LICENSE BLOCK *****
+ * Version: MPL 1.1/GPL 2.0/LGPL 2.1
+ *
+ * The contents of this file are subject to the Mozilla Public License Version
+ * 1.1 (the "License"); you may not use this file except in compliance with
+ * the License. You may obtain a copy of the License at
+ * http://www.mozilla.org/MPL/
+ *
+ * Software distributed under the License is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+ * for the specific language governing rights and limitations under the
+ * License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is
+ * Sun Microsystems, Inc.
+ * Portions created by the Initial Developer are Copyright (C) 1998
+ * the Initial Developer. All Rights Reserved.
+ *
+ * Contributor(s):
+ *
+ * Alternatively, the contents of this file may be used under the terms of
+ * either of the GNU General Public License Version 2 or later (the "GPL"),
+ * or the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+ * in which case the provisions of the GPL or the LGPL are applicable instead
+ * of those above. If you wish to allow use of your version of this file only
+ * under the terms of either the GPL or the LGPL, and not to allow others to
+ * use your version of this file under the terms of the MPL, indicate your
+ * decision by deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL or the LGPL. If you do not delete
+ * the provisions above, a recipient may use your version of this file under
+ * the terms of any one of the MPL, the GPL or the LGPL.
+ *
+ * ***** END LICENSE BLOCK ***** */
+
+/* @(#)s_asinh.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* asinh(x)
+ * Method :
+ *	Based on 
+ *		asinh(x) = sign(x) * log [ |x| + sqrt(x*x+1) ]
+ *	we have
+ *	asinh(x) := x  if  1+x*x=1,
+ *		 := sign(x)*(log(x)+ln2)) for large |x|, else
+ *		 := sign(x)*log(2|x|+1/(|x|+sqrt(x*x+1))) if|x|>2, else
+ *		 := sign(x)*log1p(|x| + x^2/(1 + sqrt(1+x^2)))  
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double 
+#else
+static double 
+#endif
+one =  1.00000000000000000000e+00, /* 0x3FF00000, 0x00000000 */
+ln2 =  6.93147180559945286227e-01, /* 0x3FE62E42, 0xFEFA39EF */
+really_big=  1.00000000000000000000e+300; 
+
+#ifdef __STDC__
+	double fd_asinh(double x)
+#else
+	double fd_asinh(x)
+	double x;
+#endif
+{	
+        fd_twoints u;
+	double t,w;
+	int hx,ix;
+        u.d = x;
+	hx = __HI(u);
+	ix = hx&0x7fffffff;
+	if(ix>=0x7ff00000) return x+x;	/* x is inf or NaN */
+	if(ix< 0x3e300000) {	/* |x|<2**-28 */
+	    if(really_big+x>one) return x;	/* return x inexact except 0 */
+	} 
+	if(ix>0x41b00000) {	/* |x| > 2**28 */
+	    w = __ieee754_log(fd_fabs(x))+ln2;
+	} else if (ix>0x40000000) {	/* 2**28 > |x| > 2.0 */
+	    t = fd_fabs(x);
+	    w = __ieee754_log(2.0*t+one/(fd_sqrt(x*x+one)+t));
+	} else {		/* 2.0 > |x| > 2**-28 */
+	    t = x*x;
+	    w =fd_log1p(fd_fabs(x)+t/(one+fd_sqrt(one+t)));
+	}
+	if(hx>0) return w; else return -w;
+}

mozilla/js/src/fdlibm/s_atan.c

@@ -0,0 +1,175 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * ***** BEGIN LICENSE BLOCK *****
+ * Version: MPL 1.1/GPL 2.0/LGPL 2.1
+ *
+ * The contents of this file are subject to the Mozilla Public License Version
+ * 1.1 (the "License"); you may not use this file except in compliance with
+ * the License. You may obtain a copy of the License at
+ * http://www.mozilla.org/MPL/
+ *
+ * Software distributed under the License is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+ * for the specific language governing rights and limitations under the
+ * License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is
+ * Sun Microsystems, Inc.
+ * Portions created by the Initial Developer are Copyright (C) 1998
+ * the Initial Developer. All Rights Reserved.
+ *
+ * Contributor(s):
+ *
+ * Alternatively, the contents of this file may be used under the terms of
+ * either of the GNU General Public License Version 2 or later (the "GPL"),
+ * or the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+ * in which case the provisions of the GPL or the LGPL are applicable instead
+ * of those above. If you wish to allow use of your version of this file only
+ * under the terms of either the GPL or the LGPL, and not to allow others to
+ * use your version of this file under the terms of the MPL, indicate your
+ * decision by deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL or the LGPL. If you do not delete
+ * the provisions above, a recipient may use your version of this file under
+ * the terms of any one of the MPL, the GPL or the LGPL.
+ *
+ * ***** END LICENSE BLOCK ***** */
+
+/* @(#)s_atan.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ *
+ */
+
+/* atan(x)
+ * Method
+ *   1. Reduce x to positive by atan(x) = -atan(-x).
+ *   2. According to the integer k=4t+0.25 chopped, t=x, the argument
+ *      is further reduced to one of the following intervals and the
+ *      arctangent of t is evaluated by the corresponding formula:
+ *
+ *      [0,7/16]      atan(x) = t-t^3*(a1+t^2*(a2+...(a10+t^2*a11)...)
+ *      [7/16,11/16]  atan(x) = atan(1/2) + atan( (t-0.5)/(1+t/2) )
+ *      [11/16.19/16] atan(x) = atan( 1 ) + atan( (t-1)/(1+t) )
+ *      [19/16,39/16] atan(x) = atan(3/2) + atan( (t-1.5)/(1+1.5t) )
+ *      [39/16,INF]   atan(x) = atan(INF) + atan( -1/t )
+ *
+ * Constants:
+ * The hexadecimal values are the intended ones for the following 
+ * constants. The decimal values may be used, provided that the 
+ * compiler will convert from decimal to binary accurately enough 
+ * to produce the hexadecimal values shown.
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double atanhi[] = {
+#else
+static double atanhi[] = {
+#endif
+  4.63647609000806093515e-01, /* atan(0.5)hi 0x3FDDAC67, 0x0561BB4F */
+  7.85398163397448278999e-01, /* atan(1.0)hi 0x3FE921FB, 0x54442D18 */
+  9.82793723247329054082e-01, /* atan(1.5)hi 0x3FEF730B, 0xD281F69B */
+  1.57079632679489655800e+00, /* atan(inf)hi 0x3FF921FB, 0x54442D18 */
+};
+
+#ifdef __STDC__
+static const double atanlo[] = {
+#else
+static double atanlo[] = {
+#endif
+  2.26987774529616870924e-17, /* atan(0.5)lo 0x3C7A2B7F, 0x222F65E2 */
+  3.06161699786838301793e-17, /* atan(1.0)lo 0x3C81A626, 0x33145C07 */
+  1.39033110312309984516e-17, /* atan(1.5)lo 0x3C700788, 0x7AF0CBBD */
+  6.12323399573676603587e-17, /* atan(inf)lo 0x3C91A626, 0x33145C07 */
+};
+
+#ifdef __STDC__
+static const double aT[] = {
+#else
+static double aT[] = {
+#endif
+  3.33333333333329318027e-01, /* 0x3FD55555, 0x5555550D */
+ -1.99999999998764832476e-01, /* 0xBFC99999, 0x9998EBC4 */
+  1.42857142725034663711e-01, /* 0x3FC24924, 0x920083FF */
+ -1.11111104054623557880e-01, /* 0xBFBC71C6, 0xFE231671 */
+  9.09088713343650656196e-02, /* 0x3FB745CD, 0xC54C206E */
+ -7.69187620504482999495e-02, /* 0xBFB3B0F2, 0xAF749A6D */
+  6.66107313738753120669e-02, /* 0x3FB10D66, 0xA0D03D51 */
+ -5.83357013379057348645e-02, /* 0xBFADDE2D, 0x52DEFD9A */
+  4.97687799461593236017e-02, /* 0x3FA97B4B, 0x24760DEB */
+ -3.65315727442169155270e-02, /* 0xBFA2B444, 0x2C6A6C2F */
+  1.62858201153657823623e-02, /* 0x3F90AD3A, 0xE322DA11 */
+};
+
+#ifdef __STDC__
+	static const double 
+#else
+	static double 
+#endif
+one   = 1.0,
+really_big   = 1.0e300;
+
+#ifdef __STDC__
+	double fd_atan(double x)
+#else
+	double fd_atan(x)
+	double x;
+#endif
+{
+        fd_twoints u;
+	double w,s1,s2,z;
+	int ix,hx,id;
+
+        u.d = x;
+	hx = __HI(u);
+	ix = hx&0x7fffffff;
+	if(ix>=0x44100000) {	/* if |x| >= 2^66 */
+            u.d = x;
+	    if(ix>0x7ff00000||
+		(ix==0x7ff00000&&(__LO(u)!=0)))
+		return x+x;		/* NaN */
+	    if(hx>0) return  atanhi[3]+atanlo[3];
+	    else     return -atanhi[3]-atanlo[3];
+	} if (ix < 0x3fdc0000) {	/* |x| < 0.4375 */
+	    if (ix < 0x3e200000) {	/* |x| < 2^-29 */
+		if(really_big+x>one) return x;	/* raise inexact */
+	    }
+	    id = -1;
+	} else {
+	x = fd_fabs(x);
+	if (ix < 0x3ff30000) {		/* |x| < 1.1875 */
+	    if (ix < 0x3fe60000) {	/* 7/16 <=|x|<11/16 */
+		id = 0; x = (2.0*x-one)/(2.0+x); 
+	    } else {			/* 11/16<=|x|< 19/16 */
+		id = 1; x  = (x-one)/(x+one); 
+	    }
+	} else {
+	    if (ix < 0x40038000) {	/* |x| < 2.4375 */
+		id = 2; x  = (x-1.5)/(one+1.5*x);
+	    } else {			/* 2.4375 <= |x| < 2^66 */
+		id = 3; x  = -1.0/x;
+	    }
+	}}
+    /* end of argument reduction */
+	z = x*x;
+	w = z*z;
+    /* break sum from i=0 to 10 aT[i]z**(i+1) into odd and even poly */
+	s1 = z*(aT[0]+w*(aT[2]+w*(aT[4]+w*(aT[6]+w*(aT[8]+w*aT[10])))));
+	s2 = w*(aT[1]+w*(aT[3]+w*(aT[5]+w*(aT[7]+w*aT[9]))));
+	if (id<0) return x - x*(s1+s2);
+	else {
+	    z = atanhi[id] - ((x*(s1+s2) - atanlo[id]) - x);
+	    return (hx<0)? -z:z;
+	}
+}

mozilla/js/src/fdlibm/s_cbrt.c

@@ -0,0 +1,133 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * ***** BEGIN LICENSE BLOCK *****
+ * Version: MPL 1.1/GPL 2.0/LGPL 2.1
+ *
+ * The contents of this file are subject to the Mozilla Public License Version
+ * 1.1 (the "License"); you may not use this file except in compliance with
+ * the License. You may obtain a copy of the License at
+ * http://www.mozilla.org/MPL/
+ *
+ * Software distributed under the License is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+ * for the specific language governing rights and limitations under the
+ * License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is
+ * Sun Microsystems, Inc.
+ * Portions created by the Initial Developer are Copyright (C) 1998
+ * the Initial Developer. All Rights Reserved.
+ *
+ * Contributor(s):
+ *
+ * Alternatively, the contents of this file may be used under the terms of
+ * either of the GNU General Public License Version 2 or later (the "GPL"),
+ * or the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+ * in which case the provisions of the GPL or the LGPL are applicable instead
+ * of those above. If you wish to allow use of your version of this file only
+ * under the terms of either the GPL or the LGPL, and not to allow others to
+ * use your version of this file under the terms of the MPL, indicate your
+ * decision by deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL or the LGPL. If you do not delete
+ * the provisions above, a recipient may use your version of this file under
+ * the terms of any one of the MPL, the GPL or the LGPL.
+ *
+ * ***** END LICENSE BLOCK ***** */
+
+/* @(#)s_cbrt.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ *
+ */
+
+#include "fdlibm.h"
+
+/* cbrt(x)
+ * Return cube root of x
+ */
+#ifdef __STDC__
+static const unsigned 
+#else
+static unsigned 
+#endif
+	B1 = 715094163, /* B1 = (682-0.03306235651)*2**20 */
+	B2 = 696219795; /* B2 = (664-0.03306235651)*2**20 */
+
+#ifdef __STDC__
+static const double
+#else
+static double
+#endif
+C =  5.42857142857142815906e-01, /* 19/35     = 0x3FE15F15, 0xF15F15F1 */
+D = -7.05306122448979611050e-01, /* -864/1225 = 0xBFE691DE, 0x2532C834 */
+E =  1.41428571428571436819e+00, /* 99/70     = 0x3FF6A0EA, 0x0EA0EA0F */
+F =  1.60714285714285720630e+00, /* 45/28     = 0x3FF9B6DB, 0x6DB6DB6E */
+G =  3.57142857142857150787e-01; /* 5/14      = 0x3FD6DB6D, 0xB6DB6DB7 */
+
+#ifdef __STDC__
+	double fd_cbrt(double x) 
+#else
+	double fd_cbrt(x) 
+	double x;
+#endif
+{
+        fd_twoints u;
+	int	hx;
+	double r,s,t=0.0,w;
+	unsigned sign;
+
+        u.d = x;
+	hx = __HI(u);		/* high word of x */
+	sign=hx&0x80000000; 		/* sign= sign(x) */
+	hx  ^=sign;
+	if(hx>=0x7ff00000) return(x+x); /* cbrt(NaN,INF) is itself */
+	if((hx|__LO(u))==0) {
+            x = u.d;
+	    return(x);		/* cbrt(0) is itself */
+        }
+        u.d = x;
+	__HI(u) = hx;	/* x <- |x| */
+        x = u.d;
+    /* rough cbrt to 5 bits */
+	if(hx<0x00100000) 		/* subnormal number */
+	  {u.d = t; __HI(u)=0x43500000; t=u.d;		/* set t= 2**54 */
+	   t*=x; __HI(u)=__HI(u)/3+B2;
+	  }
+	else {
+	  u.d = t; __HI(u)=hx/3+B1; t = u.d;
+        }
+
+
+    /* new cbrt to 23 bits, may be implemented in single precision */
+	r=t*t/x;
+	s=C+r*t;
+	t*=G+F/(s+E+D/s);	
+
+    /* chopped to 20 bits and make it larger than cbrt(x) */ 
+        u.d = t;
+	__LO(u)=0; __HI(u)+=0x00000001;
+        t = u.d;
+
+    /* one step newton iteration to 53 bits with error less than 0.667 ulps */
+	s=t*t;		/* t*t is exact */
+	r=x/s;
+	w=t+t;
+	r=(r-t)/(w+r);	/* r-s is exact */
+	t=t+t*r;
+
+    /* retore the sign bit */
+        u.d = t;
+	__HI(u) |= sign;
+        t = u.d;
+	return(t);
+}

mozilla/js/src/fdlibm/s_ceil.c

@@ -0,0 +1,120 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * ***** BEGIN LICENSE BLOCK *****
+ * Version: MPL 1.1/GPL 2.0/LGPL 2.1
+ *
+ * The contents of this file are subject to the Mozilla Public License Version
+ * 1.1 (the "License"); you may not use this file except in compliance with
+ * the License. You may obtain a copy of the License at
+ * http://www.mozilla.org/MPL/
+ *
+ * Software distributed under the License is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+ * for the specific language governing rights and limitations under the
+ * License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is
+ * Sun Microsystems, Inc.
+ * Portions created by the Initial Developer are Copyright (C) 1998
+ * the Initial Developer. All Rights Reserved.
+ *
+ * Contributor(s):
+ *
+ * Alternatively, the contents of this file may be used under the terms of
+ * either of the GNU General Public License Version 2 or later (the "GPL"),
+ * or the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+ * in which case the provisions of the GPL or the LGPL are applicable instead
+ * of those above. If you wish to allow use of your version of this file only
+ * under the terms of either the GPL or the LGPL, and not to allow others to
+ * use your version of this file under the terms of the MPL, indicate your
+ * decision by deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL or the LGPL. If you do not delete
+ * the provisions above, a recipient may use your version of this file under
+ * the terms of any one of the MPL, the GPL or the LGPL.
+ *
+ * ***** END LICENSE BLOCK ***** */
+
+/* @(#)s_ceil.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/*
+ * ceil(x)
+ * Return x rounded toward -inf to integral value
+ * Method:
+ *	Bit twiddling.
+ * Exception:
+ *	Inexact flag raised if x not equal to ceil(x).
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double really_big = 1.0e300;
+#else
+static double really_big = 1.0e300;
+#endif
+
+#ifdef __STDC__
+	double fd_ceil(double x)
+#else
+	double fd_ceil(x)
+	double x;
+#endif
+{
+        fd_twoints u;
+	int i0,i1,j0;
+	unsigned i,j;
+        u.d = x;
+	i0 =  __HI(u);
+	i1 =  __LO(u);
+	j0 = ((i0>>20)&0x7ff)-0x3ff;
+	if(j0<20) {
+	    if(j0<0) { 	/* raise inexact if x != 0 */
+		if(really_big+x>0.0) {/* return 0*sign(x) if |x|<1 */
+		    if(i0<0) {i0=0x80000000;i1=0;} 
+		    else if((i0|i1)!=0) { i0=0x3ff00000;i1=0;}
+		}
+	    } else {
+		i = (0x000fffff)>>j0;
+		if(((i0&i)|i1)==0) return x; /* x is integral */
+		if(really_big+x>0.0) {	/* raise inexact flag */
+		    if(i0>0) i0 += (0x00100000)>>j0;
+		    i0 &= (~i); i1=0;
+		}
+	    }
+	} else if (j0>51) {
+	    if(j0==0x400) return x+x;	/* inf or NaN */
+	    else return x;		/* x is integral */
+	} else {
+	    i = ((unsigned)(0xffffffff))>>(j0-20);
+	    if((i1&i)==0) return x;	/* x is integral */
+	    if(really_big+x>0.0) { 		/* raise inexact flag */
+		if(i0>0) {
+		    if(j0==20) i0+=1; 
+		    else {
+			j = i1 + (1<<(52-j0));
+			if((int)j<i1) i0+=1;	/* got a carry */
+			i1 = j;
+		    }
+		}
+		i1 &= (~i);
+	    }
+	}
+        u.d = x;
+	__HI(u) = i0;
+	__LO(u) = i1;
+        x = u.d;
+	return x;
+}

mozilla/js/src/fdlibm/s_copysign.c

@@ -0,0 +1,72 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * ***** BEGIN LICENSE BLOCK *****
+ * Version: MPL 1.1/GPL 2.0/LGPL 2.1
+ *
+ * The contents of this file are subject to the Mozilla Public License Version
+ * 1.1 (the "License"); you may not use this file except in compliance with
+ * the License. You may obtain a copy of the License at
+ * http://www.mozilla.org/MPL/
+ *
+ * Software distributed under the License is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+ * for the specific language governing rights and limitations under the
+ * License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is
+ * Sun Microsystems, Inc.
+ * Portions created by the Initial Developer are Copyright (C) 1998
+ * the Initial Developer. All Rights Reserved.
+ *
+ * Contributor(s):
+ *
+ * Alternatively, the contents of this file may be used under the terms of
+ * either of the GNU General Public License Version 2 or later (the "GPL"),
+ * or the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+ * in which case the provisions of the GPL or the LGPL are applicable instead
+ * of those above. If you wish to allow use of your version of this file only
+ * under the terms of either the GPL or the LGPL, and not to allow others to
+ * use your version of this file under the terms of the MPL, indicate your
+ * decision by deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL or the LGPL. If you do not delete
+ * the provisions above, a recipient may use your version of this file under
+ * the terms of any one of the MPL, the GPL or the LGPL.
+ *
+ * ***** END LICENSE BLOCK ***** */
+
+/* @(#)s_copysign.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/*
+ * copysign(double x, double y)
+ * copysign(x,y) returns a value with the magnitude of x and
+ * with the sign bit of y.
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+	double fd_copysign(double x, double y)
+#else
+	double fd_copysign(x,y)
+	double x,y;
+#endif
+{
+        fd_twoints ux, uy;
+        ux.d = x; uy.d = y;
+	__HI(ux) = (__HI(ux)&0x7fffffff)|(__HI(uy)&0x80000000);
+        x = ux.d;
+        return x;
+}

mozilla/js/src/fdlibm/s_cos.c

@@ -0,0 +1,118 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * ***** BEGIN LICENSE BLOCK *****
+ * Version: MPL 1.1/GPL 2.0/LGPL 2.1
+ *
+ * The contents of this file are subject to the Mozilla Public License Version
+ * 1.1 (the "License"); you may not use this file except in compliance with
+ * the License. You may obtain a copy of the License at
+ * http://www.mozilla.org/MPL/
+ *
+ * Software distributed under the License is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+ * for the specific language governing rights and limitations under the
+ * License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is
+ * Sun Microsystems, Inc.
+ * Portions created by the Initial Developer are Copyright (C) 1998
+ * the Initial Developer. All Rights Reserved.
+ *
+ * Contributor(s):
+ *
+ * Alternatively, the contents of this file may be used under the terms of
+ * either of the GNU General Public License Version 2 or later (the "GPL"),
+ * or the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+ * in which case the provisions of the GPL or the LGPL are applicable instead
+ * of those above. If you wish to allow use of your version of this file only
+ * under the terms of either the GPL or the LGPL, and not to allow others to
+ * use your version of this file under the terms of the MPL, indicate your
+ * decision by deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL or the LGPL. If you do not delete
+ * the provisions above, a recipient may use your version of this file under
+ * the terms of any one of the MPL, the GPL or the LGPL.
+ *
+ * ***** END LICENSE BLOCK ***** */
+
+/* @(#)s_cos.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* cos(x)
+ * Return cosine function of x.
+ *
+ * kernel function:
+ *	__kernel_sin		... sine function on [-pi/4,pi/4]
+ *	__kernel_cos		... cosine function on [-pi/4,pi/4]
+ *	__ieee754_rem_pio2	... argument reduction routine
+ *
+ * Method.
+ *      Let S,C and T denote the sin, cos and tan respectively on 
+ *	[-PI/4, +PI/4]. Reduce the argument x to y1+y2 = x-k*pi/2 
+ *	in [-pi/4 , +pi/4], and let n = k mod 4.
+ *	We have
+ *
+ *          n        sin(x)      cos(x)        tan(x)
+ *     ----------------------------------------------------------
+ *	    0	       S	   C		 T
+ *	    1	       C	  -S		-1/T
+ *	    2	      -S	  -C		 T
+ *	    3	      -C	   S		-1/T
+ *     ----------------------------------------------------------
+ *
+ * Special cases:
+ *      Let trig be any of sin, cos, or tan.
+ *      trig(+-INF)  is NaN, with signals;
+ *      trig(NaN)    is that NaN;
+ *
+ * Accuracy:
+ *	TRIG(x) returns trig(x) nearly rounded 
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+	double fd_cos(double x)
+#else
+	double fd_cos(x)
+	double x;
+#endif
+{
+        fd_twoints u;
+	double y[2],z=0.0;
+	int n, ix;
+
+    /* High word of x. */
+        u.d = x;
+	ix = __HI(u);
+
+    /* |x| ~< pi/4 */
+	ix &= 0x7fffffff;
+	if(ix <= 0x3fe921fb) return __kernel_cos(x,z);
+
+    /* cos(Inf or NaN) is NaN */
+	else if (ix>=0x7ff00000) return x-x;
+
+    /* argument reduction needed */
+	else {
+	    n = __ieee754_rem_pio2(x,y);
+	    switch(n&3) {
+		case 0: return  __kernel_cos(y[0],y[1]);
+		case 1: return -__kernel_sin(y[0],y[1],1);
+		case 2: return -__kernel_cos(y[0],y[1]);
+		default:
+		        return  __kernel_sin(y[0],y[1],1);
+	    }
+	}
+}

mozilla/js/src/fdlibm/s_erf.c

@@ -0,0 +1,356 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * ***** BEGIN LICENSE BLOCK *****
+ * Version: MPL 1.1/GPL 2.0/LGPL 2.1
+ *
+ * The contents of this file are subject to the Mozilla Public License Version
+ * 1.1 (the "License"); you may not use this file except in compliance with
+ * the License. You may obtain a copy of the License at
+ * http://www.mozilla.org/MPL/
+ *
+ * Software distributed under the License is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+ * for the specific language governing rights and limitations under the
+ * License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is
+ * Sun Microsystems, Inc.
+ * Portions created by the Initial Developer are Copyright (C) 1998
+ * the Initial Developer. All Rights Reserved.
+ *
+ * Contributor(s):
+ *
+ * Alternatively, the contents of this file may be used under the terms of
+ * either of the GNU General Public License Version 2 or later (the "GPL"),
+ * or the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+ * in which case the provisions of the GPL or the LGPL are applicable instead
+ * of those above. If you wish to allow use of your version of this file only
+ * under the terms of either the GPL or the LGPL, and not to allow others to
+ * use your version of this file under the terms of the MPL, indicate your
+ * decision by deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL or the LGPL. If you do not delete
+ * the provisions above, a recipient may use your version of this file under
+ * the terms of any one of the MPL, the GPL or the LGPL.
+ *
+ * ***** END LICENSE BLOCK ***** */
+
+/* @(#)s_erf.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* double erf(double x)
+ * double erfc(double x)
+ *			     x
+ *		      2      |\
+ *     erf(x)  =  ---------  | exp(-t*t)dt
+ *	 	   sqrt(pi) \| 
+ *			     0
+ *
+ *     erfc(x) =  1-erf(x)
+ *  Note that 
+ *		erf(-x) = -erf(x)
+ *		erfc(-x) = 2 - erfc(x)
+ *
+ * Method:
+ *	1. For |x| in [0, 0.84375]
+ *	    erf(x)  = x + x*R(x^2)
+ *          erfc(x) = 1 - erf(x)           if x in [-.84375,0.25]
+ *                  = 0.5 + ((0.5-x)-x*R)  if x in [0.25,0.84375]
+ *	   where R = P/Q where P is an odd poly of degree 8 and
+ *	   Q is an odd poly of degree 10.
+ *						 -57.90
+ *			| R - (erf(x)-x)/x | <= 2
+ *	
+ *
+ *	   Remark. The formula is derived by noting
+ *          erf(x) = (2/sqrt(pi))*(x - x^3/3 + x^5/10 - x^7/42 + ....)
+ *	   and that
+ *          2/sqrt(pi) = 1.128379167095512573896158903121545171688
+ *	   is close to one. The interval is chosen because the fix
+ *	   point of erf(x) is near 0.6174 (i.e., erf(x)=x when x is
+ *	   near 0.6174), and by some experiment, 0.84375 is chosen to
+ * 	   guarantee the error is less than one ulp for erf.
+ *
+ *      2. For |x| in [0.84375,1.25], let s = |x| - 1, and
+ *         c = 0.84506291151 rounded to single (24 bits)
+ *         	erf(x)  = sign(x) * (c  + P1(s)/Q1(s))
+ *         	erfc(x) = (1-c)  - P1(s)/Q1(s) if x > 0
+ *			  1+(c+P1(s)/Q1(s))    if x < 0
+ *         	|P1/Q1 - (erf(|x|)-c)| <= 2**-59.06
+ *	   Remark: here we use the taylor series expansion at x=1.
+ *		erf(1+s) = erf(1) + s*Poly(s)
+ *			 = 0.845.. + P1(s)/Q1(s)
+ *	   That is, we use rational approximation to approximate
+ *			erf(1+s) - (c = (single)0.84506291151)
+ *	   Note that |P1/Q1|< 0.078 for x in [0.84375,1.25]
+ *	   where 
+ *		P1(s) = degree 6 poly in s
+ *		Q1(s) = degree 6 poly in s
+ *
+ *      3. For x in [1.25,1/0.35(~2.857143)], 
+ *         	erfc(x) = (1/x)*exp(-x*x-0.5625+R1/S1)
+ *         	erf(x)  = 1 - erfc(x)
+ *	   where 
+ *		R1(z) = degree 7 poly in z, (z=1/x^2)
+ *		S1(z) = degree 8 poly in z
+ *
+ *      4. For x in [1/0.35,28]
+ *         	erfc(x) = (1/x)*exp(-x*x-0.5625+R2/S2) if x > 0
+ *			= 2.0 - (1/x)*exp(-x*x-0.5625+R2/S2) if -6<x<0
+ *			= 2.0 - tiny		(if x <= -6)
+ *         	erf(x)  = sign(x)*(1.0 - erfc(x)) if x < 6, else
+ *         	erf(x)  = sign(x)*(1.0 - tiny)
+ *	   where
+ *		R2(z) = degree 6 poly in z, (z=1/x^2)
+ *		S2(z) = degree 7 poly in z
+ *
+ *      Note1:
+ *	   To compute exp(-x*x-0.5625+R/S), let s be a single
+ *	   precision number and s := x; then
+ *		-x*x = -s*s + (s-x)*(s+x)
+ *	        exp(-x*x-0.5626+R/S) = 
+ *			exp(-s*s-0.5625)*exp((s-x)*(s+x)+R/S);
+ *      Note2:
+ *	   Here 4 and 5 make use of the asymptotic series
+ *			  exp(-x*x)
+ *		erfc(x) ~ ---------- * ( 1 + Poly(1/x^2) )
+ *			  x*sqrt(pi)
+ *	   We use rational approximation to approximate
+ *      	g(s)=f(1/x^2) = log(erfc(x)*x) - x*x + 0.5625
+ *	   Here is the error bound for R1/S1 and R2/S2
+ *      	|R1/S1 - f(x)|  < 2**(-62.57)
+ *      	|R2/S2 - f(x)|  < 2**(-61.52)
+ *
+ *      5. For inf > x >= 28
+ *         	erf(x)  = sign(x) *(1 - tiny)  (raise inexact)
+ *         	erfc(x) = tiny*tiny (raise underflow) if x > 0
+ *			= 2 - tiny if x<0
+ *
+ *      7. Special case:
+ *         	erf(0)  = 0, erf(inf)  = 1, erf(-inf) = -1,
+ *         	erfc(0) = 1, erfc(inf) = 0, erfc(-inf) = 2, 
+ *	   	erfc/erf(NaN) is NaN
+ */
+
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double
+#else
+static double
+#endif
+tiny	    = 1e-300,
+half=  5.00000000000000000000e-01, /* 0x3FE00000, 0x00000000 */
+one =  1.00000000000000000000e+00, /* 0x3FF00000, 0x00000000 */
+two =  2.00000000000000000000e+00, /* 0x40000000, 0x00000000 */
+	/* c = (float)0.84506291151 */
+erx =  8.45062911510467529297e-01, /* 0x3FEB0AC1, 0x60000000 */
+/*
+ * Coefficients for approximation to  erf on [0,0.84375]
+ */
+efx =  1.28379167095512586316e-01, /* 0x3FC06EBA, 0x8214DB69 */
+efx8=  1.02703333676410069053e+00, /* 0x3FF06EBA, 0x8214DB69 */
+pp0  =  1.28379167095512558561e-01, /* 0x3FC06EBA, 0x8214DB68 */
+pp1  = -3.25042107247001499370e-01, /* 0xBFD4CD7D, 0x691CB913 */
+pp2  = -2.84817495755985104766e-02, /* 0xBF9D2A51, 0xDBD7194F */
+pp3  = -5.77027029648944159157e-03, /* 0xBF77A291, 0x236668E4 */
+pp4  = -2.37630166566501626084e-05, /* 0xBEF8EAD6, 0x120016AC */
+qq1  =  3.97917223959155352819e-01, /* 0x3FD97779, 0xCDDADC09 */
+qq2  =  6.50222499887672944485e-02, /* 0x3FB0A54C, 0x5536CEBA */
+qq3  =  5.08130628187576562776e-03, /* 0x3F74D022, 0xC4D36B0F */
+qq4  =  1.32494738004321644526e-04, /* 0x3F215DC9, 0x221C1A10 */
+qq5  = -3.96022827877536812320e-06, /* 0xBED09C43, 0x42A26120 */
+/*
+ * Coefficients for approximation to  erf  in [0.84375,1.25] 
+ */
+pa0  = -2.36211856075265944077e-03, /* 0xBF6359B8, 0xBEF77538 */
+pa1  =  4.14856118683748331666e-01, /* 0x3FDA8D00, 0xAD92B34D */
+pa2  = -3.72207876035701323847e-01, /* 0xBFD7D240, 0xFBB8C3F1 */
+pa3  =  3.18346619901161753674e-01, /* 0x3FD45FCA, 0x805120E4 */
+pa4  = -1.10894694282396677476e-01, /* 0xBFBC6398, 0x3D3E28EC */
+pa5  =  3.54783043256182359371e-02, /* 0x3FA22A36, 0x599795EB */
+pa6  = -2.16637559486879084300e-03, /* 0xBF61BF38, 0x0A96073F */
+qa1  =  1.06420880400844228286e-01, /* 0x3FBB3E66, 0x18EEE323 */
+qa2  =  5.40397917702171048937e-01, /* 0x3FE14AF0, 0x92EB6F33 */
+qa3  =  7.18286544141962662868e-02, /* 0x3FB2635C, 0xD99FE9A7 */
+qa4  =  1.26171219808761642112e-01, /* 0x3FC02660, 0xE763351F */
+qa5  =  1.36370839120290507362e-02, /* 0x3F8BEDC2, 0x6B51DD1C */
+qa6  =  1.19844998467991074170e-02, /* 0x3F888B54, 0x5735151D */
+/*
+ * Coefficients for approximation to  erfc in [1.25,1/0.35]
+ */
+ra0  = -9.86494403484714822705e-03, /* 0xBF843412, 0x600D6435 */
+ra1  = -6.93858572707181764372e-01, /* 0xBFE63416, 0xE4BA7360 */
+ra2  = -1.05586262253232909814e+01, /* 0xC0251E04, 0x41B0E726 */
+ra3  = -6.23753324503260060396e+01, /* 0xC04F300A, 0xE4CBA38D */
+ra4  = -1.62396669462573470355e+02, /* 0xC0644CB1, 0x84282266 */
+ra5  = -1.84605092906711035994e+02, /* 0xC067135C, 0xEBCCABB2 */
+ra6  = -8.12874355063065934246e+01, /* 0xC0545265, 0x57E4D2F2 */
+ra7  = -9.81432934416914548592e+00, /* 0xC023A0EF, 0xC69AC25C */
+sa1  =  1.96512716674392571292e+01, /* 0x4033A6B9, 0xBD707687 */
+sa2  =  1.37657754143519042600e+02, /* 0x4061350C, 0x526AE721 */
+sa3  =  4.34565877475229228821e+02, /* 0x407B290D, 0xD58A1A71 */
+sa4  =  6.45387271733267880336e+02, /* 0x40842B19, 0x21EC2868 */
+sa5  =  4.29008140027567833386e+02, /* 0x407AD021, 0x57700314 */
+sa6  =  1.08635005541779435134e+02, /* 0x405B28A3, 0xEE48AE2C */
+sa7  =  6.57024977031928170135e+00, /* 0x401A47EF, 0x8E484A93 */
+sa8  = -6.04244152148580987438e-02, /* 0xBFAEEFF2, 0xEE749A62 */
+/*
+ * Coefficients for approximation to  erfc in [1/.35,28]
+ */
+rb0  = -9.86494292470009928597e-03, /* 0xBF843412, 0x39E86F4A */
+rb1  = -7.99283237680523006574e-01, /* 0xBFE993BA, 0x70C285DE */
+rb2  = -1.77579549177547519889e+01, /* 0xC031C209, 0x555F995A */
+rb3  = -1.60636384855821916062e+02, /* 0xC064145D, 0x43C5ED98 */
+rb4  = -6.37566443368389627722e+02, /* 0xC083EC88, 0x1375F228 */
+rb5  = -1.02509513161107724954e+03, /* 0xC0900461, 0x6A2E5992 */
+rb6  = -4.83519191608651397019e+02, /* 0xC07E384E, 0x9BDC383F */
+sb1  =  3.03380607434824582924e+01, /* 0x403E568B, 0x261D5190 */
+sb2  =  3.25792512996573918826e+02, /* 0x40745CAE, 0x221B9F0A */
+sb3  =  1.53672958608443695994e+03, /* 0x409802EB, 0x189D5118 */
+sb4  =  3.19985821950859553908e+03, /* 0x40A8FFB7, 0x688C246A */
+sb5  =  2.55305040643316442583e+03, /* 0x40A3F219, 0xCEDF3BE6 */
+sb6  =  4.74528541206955367215e+02, /* 0x407DA874, 0xE79FE763 */
+sb7  = -2.24409524465858183362e+01; /* 0xC03670E2, 0x42712D62 */
+
+#ifdef __STDC__
+	double fd_erf(double x) 
+#else
+	double fd_erf(x) 
+	double x;
+#endif
+{
+        fd_twoints u;
+	int hx,ix,i;
+	double R,S,P,Q,s,y,z,r;
+        u.d = x;
+	hx = __HI(u);
+	ix = hx&0x7fffffff;
+	if(ix>=0x7ff00000) {		/* erf(nan)=nan */
+	    i = ((unsigned)hx>>31)<<1;
+	    return (double)(1-i)+one/x;	/* erf(+-inf)=+-1 */
+	}
+
+	if(ix < 0x3feb0000) {		/* |x|<0.84375 */
+	    if(ix < 0x3e300000) { 	/* |x|<2**-28 */
+	        if (ix < 0x00800000) 
+		    return 0.125*(8.0*x+efx8*x);  /*avoid underflow */
+		return x + efx*x;
+	    }
+	    z = x*x;
+	    r = pp0+z*(pp1+z*(pp2+z*(pp3+z*pp4)));
+	    s = one+z*(qq1+z*(qq2+z*(qq3+z*(qq4+z*qq5))));
+	    y = r/s;
+	    return x + x*y;
+	}
+	if(ix < 0x3ff40000) {		/* 0.84375 <= |x| < 1.25 */
+	    s = fd_fabs(x)-one;
+	    P = pa0+s*(pa1+s*(pa2+s*(pa3+s*(pa4+s*(pa5+s*pa6)))));
+	    Q = one+s*(qa1+s*(qa2+s*(qa3+s*(qa4+s*(qa5+s*qa6)))));
+	    if(hx>=0) return erx + P/Q; else return -erx - P/Q;
+	}
+	if (ix >= 0x40180000) {		/* inf>|x|>=6 */
+	    if(hx>=0) return one-tiny; else return tiny-one;
+	}
+	x = fd_fabs(x);
+ 	s = one/(x*x);
+	if(ix< 0x4006DB6E) {	/* |x| < 1/0.35 */
+	    R=ra0+s*(ra1+s*(ra2+s*(ra3+s*(ra4+s*(
+				ra5+s*(ra6+s*ra7))))));
+	    S=one+s*(sa1+s*(sa2+s*(sa3+s*(sa4+s*(
+				sa5+s*(sa6+s*(sa7+s*sa8)))))));
+	} else {	/* |x| >= 1/0.35 */
+	    R=rb0+s*(rb1+s*(rb2+s*(rb3+s*(rb4+s*(
+				rb5+s*rb6)))));
+	    S=one+s*(sb1+s*(sb2+s*(sb3+s*(sb4+s*(
+				sb5+s*(sb6+s*sb7))))));
+	}
+	z  = x;  
+        u.d = z;
+	__LO(u) = 0;
+        z = u.d;
+	r  =  __ieee754_exp(-z*z-0.5625)*__ieee754_exp((z-x)*(z+x)+R/S);
+	if(hx>=0) return one-r/x; else return  r/x-one;
+}
+
+#ifdef __STDC__
+	double erfc(double x) 
+#else
+	double erfc(x) 
+	double x;
+#endif
+{
+        fd_twoints u;
+	int hx,ix;
+	double R,S,P,Q,s,y,z,r;
+        u.d = x;
+	hx = __HI(u);
+	ix = hx&0x7fffffff;
+	if(ix>=0x7ff00000) {			/* erfc(nan)=nan */
+						/* erfc(+-inf)=0,2 */
+	    return (double)(((unsigned)hx>>31)<<1)+one/x;
+	}
+
+	if(ix < 0x3feb0000) {		/* |x|<0.84375 */
+	    if(ix < 0x3c700000)  	/* |x|<2**-56 */
+		return one-x;
+	    z = x*x;
+	    r = pp0+z*(pp1+z*(pp2+z*(pp3+z*pp4)));
+	    s = one+z*(qq1+z*(qq2+z*(qq3+z*(qq4+z*qq5))));
+	    y = r/s;
+	    if(hx < 0x3fd00000) {  	/* x<1/4 */
+		return one-(x+x*y);
+	    } else {
+		r = x*y;
+		r += (x-half);
+	        return half - r ;
+	    }
+	}
+	if(ix < 0x3ff40000) {		/* 0.84375 <= |x| < 1.25 */
+	    s = fd_fabs(x)-one;
+	    P = pa0+s*(pa1+s*(pa2+s*(pa3+s*(pa4+s*(pa5+s*pa6)))));
+	    Q = one+s*(qa1+s*(qa2+s*(qa3+s*(qa4+s*(qa5+s*qa6)))));
+	    if(hx>=0) {
+	        z  = one-erx; return z - P/Q; 
+	    } else {
+		z = erx+P/Q; return one+z;
+	    }
+	}
+	if (ix < 0x403c0000) {		/* |x|<28 */
+	    x = fd_fabs(x);
+ 	    s = one/(x*x);
+	    if(ix< 0x4006DB6D) {	/* |x| < 1/.35 ~ 2.857143*/
+	        R=ra0+s*(ra1+s*(ra2+s*(ra3+s*(ra4+s*(
+				ra5+s*(ra6+s*ra7))))));
+	        S=one+s*(sa1+s*(sa2+s*(sa3+s*(sa4+s*(
+				sa5+s*(sa6+s*(sa7+s*sa8)))))));
+	    } else {			/* |x| >= 1/.35 ~ 2.857143 */
+		if(hx<0&&ix>=0x40180000) return two-tiny;/* x < -6 */
+	        R=rb0+s*(rb1+s*(rb2+s*(rb3+s*(rb4+s*(
+				rb5+s*rb6)))));
+	        S=one+s*(sb1+s*(sb2+s*(sb3+s*(sb4+s*(
+				sb5+s*(sb6+s*sb7))))));
+	    }
+	    z  = x;
+            u.d = z;
+	    __LO(u)  = 0;
+            z = u.d;
+	    r  =  __ieee754_exp(-z*z-0.5625)*
+			__ieee754_exp((z-x)*(z+x)+R/S);
+	    if(hx>0) return r/x; else return two-r/x;
+	} else {
+	    if(hx>0) return tiny*tiny; else return two-tiny;
+	}
+}

mozilla/js/src/fdlibm/s_expm1.c

@@ -0,0 +1,267 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * ***** BEGIN LICENSE BLOCK *****
+ * Version: MPL 1.1/GPL 2.0/LGPL 2.1
+ *
+ * The contents of this file are subject to the Mozilla Public License Version
+ * 1.1 (the "License"); you may not use this file except in compliance with
+ * the License. You may obtain a copy of the License at
+ * http://www.mozilla.org/MPL/
+ *
+ * Software distributed under the License is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+ * for the specific language governing rights and limitations under the
+ * License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is
+ * Sun Microsystems, Inc.
+ * Portions created by the Initial Developer are Copyright (C) 1998
+ * the Initial Developer. All Rights Reserved.
+ *
+ * Contributor(s):
+ *
+ * Alternatively, the contents of this file may be used under the terms of
+ * either of the GNU General Public License Version 2 or later (the "GPL"),
+ * or the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+ * in which case the provisions of the GPL or the LGPL are applicable instead
+ * of those above. If you wish to allow use of your version of this file only
+ * under the terms of either the GPL or the LGPL, and not to allow others to
+ * use your version of this file under the terms of the MPL, indicate your
+ * decision by deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL or the LGPL. If you do not delete
+ * the provisions above, a recipient may use your version of this file under
+ * the terms of any one of the MPL, the GPL or the LGPL.
+ *
+ * ***** END LICENSE BLOCK ***** */
+
+/* @(#)s_expm1.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* expm1(x)
+ * Returns exp(x)-1, the exponential of x minus 1.
+ *
+ * Method
+ *   1. Argument reduction:
+ *	Given x, find r and integer k such that
+ *
+ *               x = k*ln2 + r,  |r| <= 0.5*ln2 ~ 0.34658  
+ *
+ *      Here a correction term c will be computed to compensate 
+ *	the error in r when rounded to a floating-point number.
+ *
+ *   2. Approximating expm1(r) by a special rational function on
+ *	the interval [0,0.34658]:
+ *	Since
+ *	    r*(exp(r)+1)/(exp(r)-1) = 2+ r^2/6 - r^4/360 + ...
+ *	we define R1(r*r) by
+ *	    r*(exp(r)+1)/(exp(r)-1) = 2+ r^2/6 * R1(r*r)
+ *	That is,
+ *	    R1(r**2) = 6/r *((exp(r)+1)/(exp(r)-1) - 2/r)
+ *		     = 6/r * ( 1 + 2.0*(1/(exp(r)-1) - 1/r))
+ *		     = 1 - r^2/60 + r^4/2520 - r^6/100800 + ...
+ *      We use a special Reme algorithm on [0,0.347] to generate 
+ * 	a polynomial of degree 5 in r*r to approximate R1. The 
+ *	maximum error of this polynomial approximation is bounded 
+ *	by 2**-61. In other words,
+ *	    R1(z) ~ 1.0 + Q1*z + Q2*z**2 + Q3*z**3 + Q4*z**4 + Q5*z**5
+ *	where 	Q1  =  -1.6666666666666567384E-2,
+ * 		Q2  =   3.9682539681370365873E-4,
+ * 		Q3  =  -9.9206344733435987357E-6,
+ * 		Q4  =   2.5051361420808517002E-7,
+ * 		Q5  =  -6.2843505682382617102E-9;
+ *  	(where z=r*r, and the values of Q1 to Q5 are listed below)
+ *	with error bounded by
+ *	    |                  5           |     -61
+ *	    | 1.0+Q1*z+...+Q5*z   -  R1(z) | <= 2 
+ *	    |                              |
+ *	
+ *	expm1(r) = exp(r)-1 is then computed by the following 
+ * 	specific way which minimize the accumulation rounding error: 
+ *			       2     3
+ *			      r     r    [ 3 - (R1 + R1*r/2)  ]
+ *	      expm1(r) = r + --- + --- * [--------------------]
+ *		              2     2    [ 6 - r*(3 - R1*r/2) ]
+ *	
+ *	To compensate the error in the argument reduction, we use
+ *		expm1(r+c) = expm1(r) + c + expm1(r)*c 
+ *			   ~ expm1(r) + c + r*c 
+ *	Thus c+r*c will be added in as the correction terms for
+ *	expm1(r+c). Now rearrange the term to avoid optimization 
+ * 	screw up:
+ *		        (      2                                    2 )
+ *		        ({  ( r    [ R1 -  (3 - R1*r/2) ]  )  }    r  )
+ *	 expm1(r+c)~r - ({r*(--- * [--------------------]-c)-c} - --- )
+ *	                ({  ( 2    [ 6 - r*(3 - R1*r/2) ]  )  }    2  )
+ *                      (                                             )
+ *    	
+ *		   = r - E
+ *   3. Scale back to obtain expm1(x):
+ *	From step 1, we have
+ *	   expm1(x) = either 2^k*[expm1(r)+1] - 1
+ *		    = or     2^k*[expm1(r) + (1-2^-k)]
+ *   4. Implementation notes:
+ *	(A). To save one multiplication, we scale the coefficient Qi
+ *	     to Qi*2^i, and replace z by (x^2)/2.
+ *	(B). To achieve maximum accuracy, we compute expm1(x) by
+ *	  (i)   if x < -56*ln2, return -1.0, (raise inexact if x!=inf)
+ *	  (ii)  if k=0, return r-E
+ *	  (iii) if k=-1, return 0.5*(r-E)-0.5
+ *        (iv)	if k=1 if r < -0.25, return 2*((r+0.5)- E)
+ *	       	       else	     return  1.0+2.0*(r-E);
+ *	  (v)   if (k<-2||k>56) return 2^k(1-(E-r)) - 1 (or exp(x)-1)
+ *	  (vi)  if k <= 20, return 2^k((1-2^-k)-(E-r)), else
+ *	  (vii) return 2^k(1-((E+2^-k)-r)) 
+ *
+ * Special cases:
+ *	expm1(INF) is INF, expm1(NaN) is NaN;
+ *	expm1(-INF) is -1, and
+ *	for finite argument, only expm1(0)=0 is exact.
+ *
+ * Accuracy:
+ *	according to an error analysis, the error is always less than
+ *	1 ulp (unit in the last place).
+ *
+ * Misc. info.
+ *	For IEEE double 
+ *	    if x >  7.09782712893383973096e+02 then expm1(x) overflow
+ *
+ * Constants:
+ * The hexadecimal values are the intended ones for the following 
+ * constants. The decimal values may be used, provided that the 
+ * compiler will convert from decimal to binary accurately enough
+ * to produce the hexadecimal values shown.
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double
+#else
+static double
+#endif
+one		= 1.0,
+really_big		= 1.0e+300,
+tiny		= 1.0e-300,
+o_threshold	= 7.09782712893383973096e+02,/* 0x40862E42, 0xFEFA39EF */
+ln2_hi		= 6.93147180369123816490e-01,/* 0x3fe62e42, 0xfee00000 */
+ln2_lo		= 1.90821492927058770002e-10,/* 0x3dea39ef, 0x35793c76 */
+invln2		= 1.44269504088896338700e+00,/* 0x3ff71547, 0x652b82fe */
+	/* scaled coefficients related to expm1 */
+Q1  =  -3.33333333333331316428e-02, /* BFA11111 111110F4 */
+Q2  =   1.58730158725481460165e-03, /* 3F5A01A0 19FE5585 */
+Q3  =  -7.93650757867487942473e-05, /* BF14CE19 9EAADBB7 */
+Q4  =   4.00821782732936239552e-06, /* 3ED0CFCA 86E65239 */
+Q5  =  -2.01099218183624371326e-07; /* BE8AFDB7 6E09C32D */
+
+#ifdef __STDC__
+	double fd_expm1(double x)
+#else
+	double fd_expm1(x)
+	double x;
+#endif
+{
+        fd_twoints u;
+	double y,hi,lo,c,t,e,hxs,hfx,r1;
+	int k,xsb;
+	unsigned hx;
+
+        u.d = x;
+	hx  = __HI(u);	/* high word of x */
+	xsb = hx&0x80000000;		/* sign bit of x */
+	if(xsb==0) y=x; else y= -x;	/* y = |x| */
+	hx &= 0x7fffffff;		/* high word of |x| */
+
+    /* filter out huge and non-finite argument */
+	if(hx >= 0x4043687A) {			/* if |x|>=56*ln2 */
+	    if(hx >= 0x40862E42) {		/* if |x|>=709.78... */
+                if(hx>=0x7ff00000) {
+                    u.d = x;
+		    if(((hx&0xfffff)|__LO(u))!=0) 
+		         return x+x; 	 /* NaN */
+		    else return (xsb==0)? x:-1.0;/* exp(+-inf)={inf,-1} */
+	        }
+	        if(x > o_threshold) return really_big*really_big; /* overflow */
+	    }
+	    if(xsb!=0) { /* x < -56*ln2, return -1.0 with inexact */
+		if(x+tiny<0.0)		/* raise inexact */
+		return tiny-one;	/* return -1 */
+	    }
+	}
+
+    /* argument reduction */
+	if(hx > 0x3fd62e42) {		/* if  |x| > 0.5 ln2 */ 
+	    if(hx < 0x3FF0A2B2) {	/* and |x| < 1.5 ln2 */
+		if(xsb==0)
+		    {hi = x - ln2_hi; lo =  ln2_lo;  k =  1;}
+		else
+		    {hi = x + ln2_hi; lo = -ln2_lo;  k = -1;}
+	    } else {
+		k  = (int)(invln2*x+((xsb==0)?0.5:-0.5));
+		t  = k;
+		hi = x - t*ln2_hi;	/* t*ln2_hi is exact here */
+		lo = t*ln2_lo;
+	    }
+	    x  = hi - lo;
+	    c  = (hi-x)-lo;
+	} 
+	else if(hx < 0x3c900000) {  	/* when |x|<2**-54, return x */
+	    t = really_big+x;	/* return x with inexact flags when x!=0 */
+	    return x - (t-(really_big+x));	
+	}
+	else k = 0;
+
+    /* x is now in primary range */
+	hfx = 0.5*x;
+	hxs = x*hfx;
+	r1 = one+hxs*(Q1+hxs*(Q2+hxs*(Q3+hxs*(Q4+hxs*Q5))));
+	t  = 3.0-r1*hfx;
+	e  = hxs*((r1-t)/(6.0 - x*t));
+	if(k==0) return x - (x*e-hxs);		/* c is 0 */
+	else {
+	    e  = (x*(e-c)-c);
+	    e -= hxs;
+	    if(k== -1) return 0.5*(x-e)-0.5;
+	    if(k==1) 
+	       	if(x < -0.25) return -2.0*(e-(x+0.5));
+	       	else 	      return  one+2.0*(x-e);
+	    if (k <= -2 || k>56) {   /* suffice to return exp(x)-1 */
+	        y = one-(e-x);
+                u.d = y;
+	        __HI(u) += (k<<20);	/* add k to y's exponent */
+                y = u.d;
+	        return y-one;
+	    }
+	    t = one;
+	    if(k<20) {
+                u.d = t;
+	       	__HI(u) = 0x3ff00000 - (0x200000>>k);  /* t=1-2^-k */
+                t = u.d;
+	       	y = t-(e-x);
+                u.d = y;
+	       	__HI(u) += (k<<20);	/* add k to y's exponent */
+                y = u.d;
+	   } else {
+               u.d = t;
+	       	__HI(u)  = ((0x3ff-k)<<20);	/* 2^-k */
+                t = u.d;
+	       	y = x-(e+t);
+	       	y += one;
+                u.d = y;
+	       	__HI(u) += (k<<20);	/* add k to y's exponent */
+                y = u.d;
+	    }
+	}
+	return y;
+}

mozilla/js/src/fdlibm/s_fabs.c

@@ -0,0 +1,70 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * ***** BEGIN LICENSE BLOCK *****
+ * Version: MPL 1.1/GPL 2.0/LGPL 2.1
+ *
+ * The contents of this file are subject to the Mozilla Public License Version
+ * 1.1 (the "License"); you may not use this file except in compliance with
+ * the License. You may obtain a copy of the License at
+ * http://www.mozilla.org/MPL/
+ *
+ * Software distributed under the License is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+ * for the specific language governing rights and limitations under the
+ * License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is
+ * Sun Microsystems, Inc.
+ * Portions created by the Initial Developer are Copyright (C) 1998
+ * the Initial Developer. All Rights Reserved.
+ *
+ * Contributor(s):
+ *
+ * Alternatively, the contents of this file may be used under the terms of
+ * either of the GNU General Public License Version 2 or later (the "GPL"),
+ * or the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+ * in which case the provisions of the GPL or the LGPL are applicable instead
+ * of those above. If you wish to allow use of your version of this file only
+ * under the terms of either the GPL or the LGPL, and not to allow others to
+ * use your version of this file under the terms of the MPL, indicate your
+ * decision by deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL or the LGPL. If you do not delete
+ * the provisions above, a recipient may use your version of this file under
+ * the terms of any one of the MPL, the GPL or the LGPL.
+ *
+ * ***** END LICENSE BLOCK ***** */
+
+/* @(#)s_fabs.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/*
+ * fabs(x) returns the absolute value of x.
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+	double fd_fabs(double x)
+#else
+	double fd_fabs(x)
+	double x;
+#endif
+{
+        fd_twoints u;
+        u.d = x;
+	__HI(u) &= 0x7fffffff;
+        x = u.d;
+        return x;
+}

mozilla/js/src/fdlibm/s_finite.c

@@ -0,0 +1,71 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * ***** BEGIN LICENSE BLOCK *****
+ * Version: MPL 1.1/GPL 2.0/LGPL 2.1
+ *
+ * The contents of this file are subject to the Mozilla Public License Version
+ * 1.1 (the "License"); you may not use this file except in compliance with
+ * the License. You may obtain a copy of the License at
+ * http://www.mozilla.org/MPL/
+ *
+ * Software distributed under the License is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+ * for the specific language governing rights and limitations under the
+ * License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is
+ * Sun Microsystems, Inc.
+ * Portions created by the Initial Developer are Copyright (C) 1998
+ * the Initial Developer. All Rights Reserved.
+ *
+ * Contributor(s):
+ *
+ * Alternatively, the contents of this file may be used under the terms of
+ * either of the GNU General Public License Version 2 or later (the "GPL"),
+ * or the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+ * in which case the provisions of the GPL or the LGPL are applicable instead
+ * of those above. If you wish to allow use of your version of this file only
+ * under the terms of either the GPL or the LGPL, and not to allow others to
+ * use your version of this file under the terms of the MPL, indicate your
+ * decision by deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL or the LGPL. If you do not delete
+ * the provisions above, a recipient may use your version of this file under
+ * the terms of any one of the MPL, the GPL or the LGPL.
+ *
+ * ***** END LICENSE BLOCK ***** */
+
+/* @(#)s_finite.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/*
+ * finite(x) returns 1 is x is finite, else 0;
+ * no branching!
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+	int fd_finite(double x)
+#else
+	int fd_finite(x)
+	double x;
+#endif
+{
+        fd_twoints u;
+	int hx; 
+        u.d = x;
+	hx = __HI(u);
+	return  (unsigned)((hx&0x7fffffff)-0x7ff00000)>>31;
+}

mozilla/js/src/fdlibm/s_floor.c

@@ -0,0 +1,121 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * ***** BEGIN LICENSE BLOCK *****
+ * Version: MPL 1.1/GPL 2.0/LGPL 2.1
+ *
+ * The contents of this file are subject to the Mozilla Public License Version
+ * 1.1 (the "License"); you may not use this file except in compliance with
+ * the License. You may obtain a copy of the License at
+ * http://www.mozilla.org/MPL/
+ *
+ * Software distributed under the License is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+ * for the specific language governing rights and limitations under the
+ * License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is
+ * Sun Microsystems, Inc.
+ * Portions created by the Initial Developer are Copyright (C) 1998
+ * the Initial Developer. All Rights Reserved.
+ *
+ * Contributor(s):
+ *
+ * Alternatively, the contents of this file may be used under the terms of
+ * either of the GNU General Public License Version 2 or later (the "GPL"),
+ * or the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+ * in which case the provisions of the GPL or the LGPL are applicable instead
+ * of those above. If you wish to allow use of your version of this file only
+ * under the terms of either the GPL or the LGPL, and not to allow others to
+ * use your version of this file under the terms of the MPL, indicate your
+ * decision by deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL or the LGPL. If you do not delete
+ * the provisions above, a recipient may use your version of this file under
+ * the terms of any one of the MPL, the GPL or the LGPL.
+ *
+ * ***** END LICENSE BLOCK ***** */
+
+/* @(#)s_floor.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/*
+ * floor(x)
+ * Return x rounded toward -inf to integral value
+ * Method:
+ *	Bit twiddling.
+ * Exception:
+ *	Inexact flag raised if x not equal to floor(x).
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double really_big = 1.0e300;
+#else
+static double really_big = 1.0e300;
+#endif
+
+#ifdef __STDC__
+	double fd_floor(double x)
+#else
+	double fd_floor(x)
+	double x;
+#endif
+{
+        fd_twoints u;
+	int i0,i1,j0;
+	unsigned i,j;
+        u.d = x;
+	i0 =  __HI(u);
+	i1 =  __LO(u);
+	j0 = ((i0>>20)&0x7ff)-0x3ff;
+	if(j0<20) {
+	    if(j0<0) { 	/* raise inexact if x != 0 */
+		if(really_big+x>0.0) {/* return 0*sign(x) if |x|<1 */
+		    if(i0>=0) {i0=i1=0;} 
+		    else if(((i0&0x7fffffff)|i1)!=0)
+			{ i0=0xbff00000;i1=0;}
+		}
+	    } else {
+		i = (0x000fffff)>>j0;
+		if(((i0&i)|i1)==0) return x; /* x is integral */
+		if(really_big+x>0.0) {	/* raise inexact flag */
+		    if(i0<0) i0 += (0x00100000)>>j0;
+		    i0 &= (~i); i1=0;
+		}
+	    }
+	} else if (j0>51) {
+	    if(j0==0x400) return x+x;	/* inf or NaN */
+	    else return x;		/* x is integral */
+	} else {
+	    i = ((unsigned)(0xffffffff))>>(j0-20);
+	    if((i1&i)==0) return x;	/* x is integral */
+	    if(really_big+x>0.0) { 		/* raise inexact flag */
+		if(i0<0) {
+		    if(j0==20) i0+=1; 
+		    else {
+			j = i1+(1<<(52-j0));
+			if((int)j<i1) i0 +=1 ; 	/* got a carry */
+			i1=j;
+		    }
+		}
+		i1 &= (~i);
+	    }
+	}
+        u.d = x;
+	__HI(u) = i0;
+	__LO(u) = i1;
+        x = u.d;
+	return x;
+}

mozilla/js/src/fdlibm/s_frexp.c

@@ -0,0 +1,99 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * ***** BEGIN LICENSE BLOCK *****
+ * Version: MPL 1.1/GPL 2.0/LGPL 2.1
+ *
+ * The contents of this file are subject to the Mozilla Public License Version
+ * 1.1 (the "License"); you may not use this file except in compliance with
+ * the License. You may obtain a copy of the License at
+ * http://www.mozilla.org/MPL/
+ *
+ * Software distributed under the License is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+ * for the specific language governing rights and limitations under the
+ * License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is
+ * Sun Microsystems, Inc.
+ * Portions created by the Initial Developer are Copyright (C) 1998
+ * the Initial Developer. All Rights Reserved.
+ *
+ * Contributor(s):
+ *
+ * Alternatively, the contents of this file may be used under the terms of
+ * either of the GNU General Public License Version 2 or later (the "GPL"),
+ * or the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+ * in which case the provisions of the GPL or the LGPL are applicable instead
+ * of those above. If you wish to allow use of your version of this file only
+ * under the terms of either the GPL or the LGPL, and not to allow others to
+ * use your version of this file under the terms of the MPL, indicate your
+ * decision by deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL or the LGPL. If you do not delete
+ * the provisions above, a recipient may use your version of this file under
+ * the terms of any one of the MPL, the GPL or the LGPL.
+ *
+ * ***** END LICENSE BLOCK ***** */
+
+/* @(#)s_frexp.c 1.4 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/*
+ * for non-zero x 
+ *	x = frexp(arg,&exp);
+ * return a double fp quantity x such that 0.5 <= |x| <1.0
+ * and the corresponding binary exponent "exp". That is
+ *	arg = x*2^exp.
+ * If arg is inf, 0.0, or NaN, then frexp(arg,&exp) returns arg 
+ * with *exp=0. 
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double
+#else
+static double
+#endif
+two54 =  1.80143985094819840000e+16; /* 0x43500000, 0x00000000 */
+
+#ifdef __STDC__
+	double fd_frexp(double x, int *eptr)
+#else
+	double fd_frexp(x, eptr)
+	double x; int *eptr;
+#endif
+{
+	int  hx, ix, lx;
+        fd_twoints u;
+        u.d = x;
+	hx = __HI(u);
+	ix = 0x7fffffff&hx;
+	lx = __LO(u);
+	*eptr = 0;
+	if(ix>=0x7ff00000||((ix|lx)==0)) return x;	/* 0,inf,nan */
+	if (ix<0x00100000) {		/* subnormal */
+	    x *= two54;
+            u.d = x;
+	    hx = __HI(u);
+	    ix = hx&0x7fffffff;
+	    *eptr = -54;
+	}
+	*eptr += (ix>>20)-1022;
+	hx = (hx&0x800fffff)|0x3fe00000;
+        u.d = x;
+	__HI(u) = hx;
+        x = u.d;
+	return x;
+}

mozilla/js/src/fdlibm/s_ilogb.c

@@ -0,0 +1,85 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * ***** BEGIN LICENSE BLOCK *****
+ * Version: MPL 1.1/GPL 2.0/LGPL 2.1
+ *
+ * The contents of this file are subject to the Mozilla Public License Version
+ * 1.1 (the "License"); you may not use this file except in compliance with
+ * the License. You may obtain a copy of the License at
+ * http://www.mozilla.org/MPL/
+ *
+ * Software distributed under the License is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+ * for the specific language governing rights and limitations under the
+ * License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is
+ * Sun Microsystems, Inc.
+ * Portions created by the Initial Developer are Copyright (C) 1998
+ * the Initial Developer. All Rights Reserved.
+ *
+ * Contributor(s):
+ *
+ * Alternatively, the contents of this file may be used under the terms of
+ * either of the GNU General Public License Version 2 or later (the "GPL"),
+ * or the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+ * in which case the provisions of the GPL or the LGPL are applicable instead
+ * of those above. If you wish to allow use of your version of this file only
+ * under the terms of either the GPL or the LGPL, and not to allow others to
+ * use your version of this file under the terms of the MPL, indicate your
+ * decision by deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL or the LGPL. If you do not delete
+ * the provisions above, a recipient may use your version of this file under
+ * the terms of any one of the MPL, the GPL or the LGPL.
+ *
+ * ***** END LICENSE BLOCK ***** */
+
+/* @(#)s_ilogb.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* ilogb(double x)
+ * return the binary exponent of non-zero x
+ * ilogb(0) = 0x80000001
+ * ilogb(inf/NaN) = 0x7fffffff (no signal is raised)
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+	int fd_ilogb(double x)
+#else
+	int fd_ilogb(x)
+	double x;
+#endif
+{
+	int hx,lx,ix;
+        fd_twoints u;
+        u.d = x;
+	hx  = (__HI(u))&0x7fffffff;	/* high word of x */
+	if(hx<0x00100000) {
+	    lx = __LO(u);
+	    if((hx|lx)==0) 
+		return 0x80000001;	/* ilogb(0) = 0x80000001 */
+	    else			/* subnormal x */
+		if(hx==0) {
+		    for (ix = -1043; lx>0; lx<<=1) ix -=1;
+		} else {
+		    for (ix = -1022,hx<<=11; hx>0; hx<<=1) ix -=1;
+		}
+	    return ix;
+	}
+	else if (hx<0x7ff00000) return (hx>>20)-1023;
+	else return 0x7fffffff;
+}

mozilla/js/src/fdlibm/s_isnan.c

@@ -0,0 +1,74 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * ***** BEGIN LICENSE BLOCK *****
+ * Version: MPL 1.1/GPL 2.0/LGPL 2.1
+ *
+ * The contents of this file are subject to the Mozilla Public License Version
+ * 1.1 (the "License"); you may not use this file except in compliance with
+ * the License. You may obtain a copy of the License at
+ * http://www.mozilla.org/MPL/
+ *
+ * Software distributed under the License is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+ * for the specific language governing rights and limitations under the
+ * License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is
+ * Sun Microsystems, Inc.
+ * Portions created by the Initial Developer are Copyright (C) 1998
+ * the Initial Developer. All Rights Reserved.
+ *
+ * Contributor(s):
+ *
+ * Alternatively, the contents of this file may be used under the terms of
+ * either of the GNU General Public License Version 2 or later (the "GPL"),
+ * or the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+ * in which case the provisions of the GPL or the LGPL are applicable instead
+ * of those above. If you wish to allow use of your version of this file only
+ * under the terms of either the GPL or the LGPL, and not to allow others to
+ * use your version of this file under the terms of the MPL, indicate your
+ * decision by deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL or the LGPL. If you do not delete
+ * the provisions above, a recipient may use your version of this file under
+ * the terms of any one of the MPL, the GPL or the LGPL.
+ *
+ * ***** END LICENSE BLOCK ***** */
+
+/* @(#)s_isnan.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/*
+ * isnan(x) returns 1 is x is nan, else 0;
+ * no branching!
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+	int fd_isnan(double x)
+#else
+	int fd_isnan(x)
+	double x;
+#endif
+{
+        fd_twoints u;
+	int hx,lx;
+        u.d = x;
+	hx = (__HI(u)&0x7fffffff);
+	lx = __LO(u);
+	hx |= (unsigned)(lx|(-lx))>>31;	
+	hx = 0x7ff00000 - hx;
+	return ((unsigned)(hx))>>31;
+}

mozilla/js/src/fdlibm/s_ldexp.c

@@ -0,0 +1,66 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * ***** BEGIN LICENSE BLOCK *****
+ * Version: MPL 1.1/GPL 2.0/LGPL 2.1
+ *
+ * The contents of this file are subject to the Mozilla Public License Version
+ * 1.1 (the "License"); you may not use this file except in compliance with
+ * the License. You may obtain a copy of the License at
+ * http://www.mozilla.org/MPL/
+ *
+ * Software distributed under the License is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+ * for the specific language governing rights and limitations under the
+ * License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is
+ * Sun Microsystems, Inc.
+ * Portions created by the Initial Developer are Copyright (C) 1998
+ * the Initial Developer. All Rights Reserved.
+ *
+ * Contributor(s):
+ *
+ * Alternatively, the contents of this file may be used under the terms of
+ * either of the GNU General Public License Version 2 or later (the "GPL"),
+ * or the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+ * in which case the provisions of the GPL or the LGPL are applicable instead
+ * of those above. If you wish to allow use of your version of this file only
+ * under the terms of either the GPL or the LGPL, and not to allow others to
+ * use your version of this file under the terms of the MPL, indicate your
+ * decision by deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL or the LGPL. If you do not delete
+ * the provisions above, a recipient may use your version of this file under
+ * the terms of any one of the MPL, the GPL or the LGPL.
+ *
+ * ***** END LICENSE BLOCK ***** */
+
+/* @(#)s_ldexp.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+#include "fdlibm.h"
+#include <errno.h>
+
+#ifdef __STDC__
+	double fd_ldexp(double value, int exp)
+#else
+	double fd_ldexp(value, exp)
+	double value; int exp;
+#endif
+{
+	if(!fd_finite(value)||value==0.0) return value;
+	value = fd_scalbn(value,exp);
+	if(!fd_finite(value)||value==0.0) errno = ERANGE;
+	return value;
+}

mozilla/js/src/fdlibm/s_lib_version.c

@@ -0,0 +1,73 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * ***** BEGIN LICENSE BLOCK *****
+ * Version: MPL 1.1/GPL 2.0/LGPL 2.1
+ *
+ * The contents of this file are subject to the Mozilla Public License Version
+ * 1.1 (the "License"); you may not use this file except in compliance with
+ * the License. You may obtain a copy of the License at
+ * http://www.mozilla.org/MPL/
+ *
+ * Software distributed under the License is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+ * for the specific language governing rights and limitations under the
+ * License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is
+ * Sun Microsystems, Inc.
+ * Portions created by the Initial Developer are Copyright (C) 1998
+ * the Initial Developer. All Rights Reserved.
+ *
+ * Contributor(s):
+ *
+ * Alternatively, the contents of this file may be used under the terms of
+ * either of the GNU General Public License Version 2 or later (the "GPL"),
+ * or the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+ * in which case the provisions of the GPL or the LGPL are applicable instead
+ * of those above. If you wish to allow use of your version of this file only
+ * under the terms of either the GPL or the LGPL, and not to allow others to
+ * use your version of this file under the terms of the MPL, indicate your
+ * decision by deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL or the LGPL. If you do not delete
+ * the provisions above, a recipient may use your version of this file under
+ * the terms of any one of the MPL, the GPL or the LGPL.
+ *
+ * ***** END LICENSE BLOCK ***** */
+
+/* @(#)s_lib_version.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/*
+ * MACRO for standards
+ */
+
+#include "fdlibm.h"
+
+/*
+ * define and initialize _LIB_VERSION
+ */
+#ifdef _POSIX_MODE
+_LIB_VERSION_TYPE _LIB_VERSION = _POSIX_;
+#else
+#ifdef _XOPEN_MODE
+_LIB_VERSION_TYPE _LIB_VERSION = _XOPEN_;
+#else
+#ifdef _SVID3_MODE
+_LIB_VERSION_TYPE _LIB_VERSION = _SVID_;
+#else					/* default _IEEE_MODE */
+_LIB_VERSION_TYPE _LIB_VERSION = _IEEE_;
+#endif
+#endif
+#endif

mozilla/js/src/fdlibm/s_log1p.c

@@ -0,0 +1,211 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * ***** BEGIN LICENSE BLOCK *****
+ * Version: MPL 1.1/GPL 2.0/LGPL 2.1
+ *
+ * The contents of this file are subject to the Mozilla Public License Version
+ * 1.1 (the "License"); you may not use this file except in compliance with
+ * the License. You may obtain a copy of the License at
+ * http://www.mozilla.org/MPL/
+ *
+ * Software distributed under the License is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+ * for the specific language governing rights and limitations under the
+ * License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is
+ * Sun Microsystems, Inc.
+ * Portions created by the Initial Developer are Copyright (C) 1998
+ * the Initial Developer. All Rights Reserved.
+ *
+ * Contributor(s):
+ *
+ * Alternatively, the contents of this file may be used under the terms of
+ * either of the GNU General Public License Version 2 or later (the "GPL"),
+ * or the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+ * in which case the provisions of the GPL or the LGPL are applicable instead
+ * of those above. If you wish to allow use of your version of this file only
+ * under the terms of either the GPL or the LGPL, and not to allow others to
+ * use your version of this file under the terms of the MPL, indicate your
+ * decision by deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL or the LGPL. If you do not delete
+ * the provisions above, a recipient may use your version of this file under
+ * the terms of any one of the MPL, the GPL or the LGPL.
+ *
+ * ***** END LICENSE BLOCK ***** */
+
+/* @(#)s_log1p.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/* double log1p(double x)
+ *
+ * Method :                  
+ *   1. Argument Reduction: find k and f such that 
+ *			1+x = 2^k * (1+f), 
+ *	   where  sqrt(2)/2 < 1+f < sqrt(2) .
+ *
+ *      Note. If k=0, then f=x is exact. However, if k!=0, then f
+ *	may not be representable exactly. In that case, a correction
+ *	term is need. Let u=1+x rounded. Let c = (1+x)-u, then
+ *	log(1+x) - log(u) ~ c/u. Thus, we proceed to compute log(u),
+ *	and add back the correction term c/u.
+ *	(Note: when x > 2**53, one can simply return log(x))
+ *
+ *   2. Approximation of log1p(f).
+ *	Let s = f/(2+f) ; based on log(1+f) = log(1+s) - log(1-s)
+ *		 = 2s + 2/3 s**3 + 2/5 s**5 + .....,
+ *	     	 = 2s + s*R
+ *      We use a special Reme algorithm on [0,0.1716] to generate 
+ * 	a polynomial of degree 14 to approximate R The maximum error 
+ *	of this polynomial approximation is bounded by 2**-58.45. In
+ *	other words,
+ *		        2      4      6      8      10      12      14
+ *	    R(z) ~ Lp1*s +Lp2*s +Lp3*s +Lp4*s +Lp5*s  +Lp6*s  +Lp7*s
+ *  	(the values of Lp1 to Lp7 are listed in the program)
+ *	and
+ *	    |      2          14          |     -58.45
+ *	    | Lp1*s +...+Lp7*s    -  R(z) | <= 2 
+ *	    |                             |
+ *	Note that 2s = f - s*f = f - hfsq + s*hfsq, where hfsq = f*f/2.
+ *	In order to guarantee error in log below 1ulp, we compute log
+ *	by
+ *		log1p(f) = f - (hfsq - s*(hfsq+R)).
+ *	
+ *	3. Finally, log1p(x) = k*ln2 + log1p(f).  
+ *		 	     = k*ln2_hi+(f-(hfsq-(s*(hfsq+R)+k*ln2_lo)))
+ *	   Here ln2 is split into two floating point number: 
+ *			ln2_hi + ln2_lo,
+ *	   where n*ln2_hi is always exact for |n| < 2000.
+ *
+ * Special cases:
+ *	log1p(x) is NaN with signal if x < -1 (including -INF) ; 
+ *	log1p(+INF) is +INF; log1p(-1) is -INF with signal;
+ *	log1p(NaN) is that NaN with no signal.
+ *
+ * Accuracy:
+ *	according to an error analysis, the error is always less than
+ *	1 ulp (unit in the last place).
+ *
+ * Constants:
+ * The hexadecimal values are the intended ones for the following 
+ * constants. The decimal values may be used, provided that the 
+ * compiler will convert from decimal to binary accurately enough 
+ * to produce the hexadecimal values shown.
+ *
+ * Note: Assuming log() return accurate answer, the following
+ * 	 algorithm can be used to compute log1p(x) to within a few ULP:
+ *	
+ *		u = 1+x;
+ *		if(u==1.0) return x ; else
+ *			   return log(u)*(x/(u-1.0));
+ *
+ *	 See HP-15C Advanced Functions Handbook, p.193.
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+static const double
+#else
+static double
+#endif
+ln2_hi  =  6.93147180369123816490e-01,	/* 3fe62e42 fee00000 */
+ln2_lo  =  1.90821492927058770002e-10,	/* 3dea39ef 35793c76 */
+two54   =  1.80143985094819840000e+16,  /* 43500000 00000000 */
+Lp1 = 6.666666666666735130e-01,  /* 3FE55555 55555593 */
+Lp2 = 3.999999999940941908e-01,  /* 3FD99999 9997FA04 */
+Lp3 = 2.857142874366239149e-01,  /* 3FD24924 94229359 */
+Lp4 = 2.222219843214978396e-01,  /* 3FCC71C5 1D8E78AF */
+Lp5 = 1.818357216161805012e-01,  /* 3FC74664 96CB03DE */
+Lp6 = 1.531383769920937332e-01,  /* 3FC39A09 D078C69F */
+Lp7 = 1.479819860511658591e-01;  /* 3FC2F112 DF3E5244 */
+
+static double zero = 0.0;
+
+#ifdef __STDC__
+	double fd_log1p(double x)
+#else
+	double fd_log1p(x)
+	double x;
+#endif
+{
+	double hfsq,f,c,s,z,R,u;
+	int k,hx,hu,ax;
+        fd_twoints un;
+
+        un.d = x;
+	hx = __HI(un);		/* high word of x */
+	ax = hx&0x7fffffff;
+
+	k = 1;
+	if (hx < 0x3FDA827A) {			/* x < 0.41422  */
+	    if(ax>=0x3ff00000) {		/* x <= -1.0 */
+		if(x==-1.0) return -two54/zero; /* log1p(-1)=+inf */
+		else return (x-x)/(x-x);	/* log1p(x<-1)=NaN */
+	    }
+	    if(ax<0x3e200000) {			/* |x| < 2**-29 */
+		if(two54+x>zero			/* raise inexact */
+	            &&ax<0x3c900000) 		/* |x| < 2**-54 */
+		    return x;
+		else
+		    return x - x*x*0.5;
+	    }
+	    if(hx>0||hx<=((int)0xbfd2bec3)) {
+		k=0;f=x;hu=1;}	/* -0.2929<x<0.41422 */
+	} 
+	if (hx >= 0x7ff00000) return x+x;
+	if(k!=0) {
+	    if(hx<0x43400000) {
+		u  = 1.0+x; 
+                un.d = u;
+	        hu = __HI(un);		/* high word of u */
+	        k  = (hu>>20)-1023;
+	        c  = (k>0)? 1.0-(u-x):x-(u-1.0);/* correction term */
+		c /= u;
+	    } else {
+		u  = x;
+                un.d = u;
+	        hu = __HI(un);		/* high word of u */
+	        k  = (hu>>20)-1023;
+		c  = 0;
+	    }
+	    hu &= 0x000fffff;
+	    if(hu<0x6a09e) {
+                un.d = u;
+	        __HI(un) = hu|0x3ff00000;	/* normalize u */
+                u = un.d;
+	    } else {
+	        k += 1; 
+                un.d = u;
+	        __HI(un) = hu|0x3fe00000;	/* normalize u/2 */
+                u = un.d;
+	        hu = (0x00100000-hu)>>2;
+	    }
+	    f = u-1.0;
+	}
+	hfsq=0.5*f*f;
+	if(hu==0) {	/* |f| < 2**-20 */
+	    if(f==zero) if(k==0) return zero;  
+			else {c += k*ln2_lo; return k*ln2_hi+c;}
+	    R = hfsq*(1.0-0.66666666666666666*f);
+	    if(k==0) return f-R; else
+	    	     return k*ln2_hi-((R-(k*ln2_lo+c))-f);
+	}
+ 	s = f/(2.0+f); 
+	z = s*s;
+	R = z*(Lp1+z*(Lp2+z*(Lp3+z*(Lp4+z*(Lp5+z*(Lp6+z*Lp7))))));
+	if(k==0) return f-(hfsq-s*(hfsq+R)); else
+		 return k*ln2_hi-((hfsq-(s*(hfsq+R)+(k*ln2_lo+c)))-f);
+}

mozilla/js/src/fdlibm/s_logb.c

@@ -0,0 +1,79 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * ***** BEGIN LICENSE BLOCK *****
+ * Version: MPL 1.1/GPL 2.0/LGPL 2.1
+ *
+ * The contents of this file are subject to the Mozilla Public License Version
+ * 1.1 (the "License"); you may not use this file except in compliance with
+ * the License. You may obtain a copy of the License at
+ * http://www.mozilla.org/MPL/
+ *
+ * Software distributed under the License is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+ * for the specific language governing rights and limitations under the
+ * License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is
+ * Sun Microsystems, Inc.
+ * Portions created by the Initial Developer are Copyright (C) 1998
+ * the Initial Developer. All Rights Reserved.
+ *
+ * Contributor(s):
+ *
+ * Alternatively, the contents of this file may be used under the terms of
+ * either of the GNU General Public License Version 2 or later (the "GPL"),
+ * or the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+ * in which case the provisions of the GPL or the LGPL are applicable instead
+ * of those above. If you wish to allow use of your version of this file only
+ * under the terms of either the GPL or the LGPL, and not to allow others to
+ * use your version of this file under the terms of the MPL, indicate your
+ * decision by deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL or the LGPL. If you do not delete
+ * the provisions above, a recipient may use your version of this file under
+ * the terms of any one of the MPL, the GPL or the LGPL.
+ *
+ * ***** END LICENSE BLOCK ***** */
+
+/* @(#)s_logb.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+/*
+ * double logb(x)
+ * IEEE 754 logb. Included to pass IEEE test suite. Not recommend.
+ * Use ilogb instead.
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+	double fd_logb(double x)
+#else
+	double fd_logb(x)
+	double x;
+#endif
+{
+	int lx,ix;
+        fd_twoints u;
+
+        u.d = x;
+	ix = (__HI(u))&0x7fffffff;	/* high |x| */
+	lx = __LO(u);			/* low x */
+	if((ix|lx)==0) return -1.0/fd_fabs(x);
+	if(ix>=0x7ff00000) return x*x;
+	if((ix>>=20)==0) 			/* IEEE 754 logb */
+		return -1022.0; 
+	else
+		return (double) (ix-1023); 
+}

mozilla/js/src/fdlibm/s_matherr.c

@@ -0,0 +1,64 @@
+/* -*- Mode: C; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*-
+ *
+ * ***** BEGIN LICENSE BLOCK *****
+ * Version: MPL 1.1/GPL 2.0/LGPL 2.1
+ *
+ * The contents of this file are subject to the Mozilla Public License Version
+ * 1.1 (the "License"); you may not use this file except in compliance with
+ * the License. You may obtain a copy of the License at
+ * http://www.mozilla.org/MPL/
+ *
+ * Software distributed under the License is distributed on an "AS IS" basis,
+ * WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License
+ * for the specific language governing rights and limitations under the
+ * License.
+ *
+ * The Original Code is Mozilla Communicator client code, released
+ * March 31, 1998.
+ *
+ * The Initial Developer of the Original Code is
+ * Sun Microsystems, Inc.
+ * Portions created by the Initial Developer are Copyright (C) 1998
+ * the Initial Developer. All Rights Reserved.
+ *
+ * Contributor(s):
+ *
+ * Alternatively, the contents of this file may be used under the terms of
+ * either of the GNU General Public License Version 2 or later (the "GPL"),
+ * or the GNU Lesser General Public License Version 2.1 or later (the "LGPL"),
+ * in which case the provisions of the GPL or the LGPL are applicable instead
+ * of those above. If you wish to allow use of your version of this file only
+ * under the terms of either the GPL or the LGPL, and not to allow others to
+ * use your version of this file under the terms of the MPL, indicate your
+ * decision by deleting the provisions above and replace them with the notice
+ * and other provisions required by the GPL or the LGPL. If you do not delete
+ * the provisions above, a recipient may use your version of this file under
+ * the terms of any one of the MPL, the GPL or the LGPL.
+ *
+ * ***** END LICENSE BLOCK ***** */
+
+/* @(#)s_matherr.c 1.3 95/01/18 */
+/*
+ * ====================================================
+ * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved.
+ *
+ * Developed at SunSoft, a Sun Microsystems, Inc. business.
+ * Permission to use, copy, modify, and distribute this
+ * software is freely granted, provided that this notice 
+ * is preserved.
+ * ====================================================
+ */
+
+#include "fdlibm.h"
+
+#ifdef __STDC__
+	int fd_matherr(struct exception *x)
+#else
+	int fd_matherr(x)
+	struct exception *x;
+#endif
+{
+	int n=0;
+	if(x->arg1!=x->arg1) return 0;
+	return n;
+}